Acta Cryst. (2009). E65, o365 [ doi:10.1107/S1600536809002086 ]
In the title compound, C14H16N42+·2C7H5O6S-·2H2O, the 3,3'-(p-phenylenedimethylene)diimidazol-1-ium dication lies on a crystallographic inversion center. In the crystal structure, dications, anions and solvent water molecules are linked via O-H
O, N-H
O and C-H
O hydrogen bonds, and C-H
interactions, forming a three-dimensional network containing R22(4), R24(12), R44(22), R810(32) and R1214(66) ring motifs.
1,4-Bis(imidazol-1-ylmethyl)benzene) (bix) was prepared according to a literature method (Hoskins et al., 1997). 1:2 molar amounts of bix (47.6 mg, 0.2 mmol) and 5-sulfosalicylic acid dihydrate (101.6 mg, 0.4 mmol) were dissolved in 95% methanol (20 ml). The mixture was stirred for 30 min at ambient temperature and then filtered. The resulting colourless solution was kept in air for one week. Block colourless crystals of (I) suitable for single-crystal X-ray diffraction analysis were grown at the bottom of the vessel by slow evaporation of the solution (yield 86.4 mg, 60.8%, based on a 1:2 salt).
H atoms bonded to C atoms were positioned geometrically with C–H = 0.93Å (aromatic) and 0.97Å (methylene) and refined in a riding-model approximation Uiso(H) = 1.2Ueq(C). H atoms bonded to O and N atoms were found in difference Fourier maps and the N—H and O—H distances were refined freely [the refined distances are given in Table 1; Uiso(H) = 1.2Ueq(N) and 1.5Ueq(O)].
Data collection: SMART (Bruker, 2001); cell refinement: SAINT-Plus (Bruker, 2001); data reduction: SAINT-Plus (Bruker, 2001); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: PLATON (Spek, 2003); software used to prepare material for publication: PLATON (Spek, 2003).
| C14H16N42+·2C7H5O6S−·2H2O | Z = 1 |
| Mr = 710.68 | F(000) = 370 |
| Triclinic, P1 | Dx = 1.514 Mg m−3 |
| Hall symbol: -P 1 | Mo Kα radiation, λ = 0.71073 Å |
| a = 7.9975 (6) Å | Cell parameters from 2637 reflections |
| b = 8.8060 (7) Å | θ = 2.3–28.0° |
| c = 11.2419 (8) Å | µ = 0.25 mm−1 |
| α = 90.784 (1)° | T = 292 K |
| β = 96.656 (1)° | Block, colorless |
| γ = 97.342 (1)° | 0.20 × 0.10 × 0.10 mm |
| V = 779.61 (10) Å3 |
| Bruker SMART APEX CCD area-detector diffractometer | 3168 independent reflections |
| Radiation source: fine focus sealed Siemens Mo tube | 2524 reflections with I > 2σ(I) |
| graphite | Rint = 0.024 |
| 0.3° wide ω exposures scans | θmax = 26.5°, θmin = 1.8° |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1997) | h = −9→10 |
| Tmin = 0.942, Tmax = 0.976 | k = −11→11 |
| 8434 measured reflections | l = −12→14 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.050 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.142 | H atoms treated by a mixture of independent and constrained refinement |
| S = 1.12 | w = 1/[σ2(Fo2) + (0.0671P)2 + 0.3146P] where P = (Fo2 + 2Fc2)/3 |
| 3168 reflections | (Δ/σ)max < 0.001 |
| 232 parameters | Δρmax = 0.34 e Å−3 |
| 0 restraints | Δρmin = −0.24 e Å−3 |
| C14H16N42+·2C7H5O6S−·2H2O | γ = 97.342 (1)° |
| Mr = 710.68 | V = 779.61 (10) Å3 |
| Triclinic, P1 | Z = 1 |
| a = 7.9975 (6) Å | Mo Kα radiation |
| b = 8.8060 (7) Å | µ = 0.25 mm−1 |
| c = 11.2419 (8) Å | T = 292 K |
| α = 90.784 (1)° | 0.20 × 0.10 × 0.10 mm |
| β = 96.656 (1)° |
| Bruker SMART APEX CCD area-detector diffractometer | 3168 independent reflections |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1997) | 2524 reflections with I > 2σ(I) |
| Tmin = 0.942, Tmax = 0.976 | Rint = 0.024 |
| 8434 measured reflections | θmax = 26.5° |
| R[F2 > 2σ(F2)] = 0.050 | H atoms treated by a mixture of independent and constrained refinement |
| wR(F2) = 0.142 | Δρmax = 0.34 e Å−3 |
| S = 1.12 | Δρmin = −0.24 e Å−3 |
| 3168 reflections | Absolute structure: ? |
| 232 parameters | Flack parameter: ? |
| 0 restraints | Rogers parameter: ? |
Geometry. All e.s.d.'s (except the e.s.d. in the dihedral angle between two l.s. planes) are estimated using the full covariance matrix. The cell e.s.d.'s are taken into account individually in the estimation of e.s.d.'s in distances, angles and torsion angles; correlations between e.s.d.'s in cell parameters are only used when they are defined by crystal symmetry. An approximate (isotropic) treatment of cell e.s.d.'s is used for estimating e.s.d.'s involving l.s. planes. |
Refinement. Refinement of F2 against ALL reflections. The weighted R-factor wR and goodness of fit S are based on F2, conventional R-factors R are based on F, with F set to zero for negative F2. The threshold expression of F2 > σ(F2) is used only for calculating R-factors(gt) etc. and is not relevant to the choice of reflections for refinement. R-factors based on F2 are statistically about twice as large as those based on F, and R- factors based on ALL data will be even larger. |
| x | y | z | Uiso*/Ueq | ||
| C1 | 0.6276 (3) | 0.1488 (3) | 0.0830 (2) | 0.0345 (5) | |
| C2 | 0.7379 (3) | 0.0442 (3) | 0.1231 (2) | 0.0411 (6) | |
| C3 | 0.7390 (4) | −0.0098 (3) | 0.2385 (3) | 0.0498 (7) | |
| H3 | 0.8114 | −0.0803 | 0.2645 | 0.060* | |
| C4 | 0.6339 (4) | 0.0403 (3) | 0.3140 (2) | 0.0460 (6) | |
| H4 | 0.6351 | 0.0032 | 0.3911 | 0.055* | |
| C5 | 0.5250 (3) | 0.1465 (3) | 0.2763 (2) | 0.0341 (5) | |
| C6 | 0.5211 (3) | 0.1995 (3) | 0.1617 (2) | 0.0333 (5) | |
| H6 | 0.4474 | 0.2693 | 0.1362 | 0.040* | |
| C7 | 0.6258 (3) | 0.2045 (3) | −0.0404 (2) | 0.0367 (6) | |
| C8 | −0.0498 (4) | −0.5225 (3) | 0.1136 (2) | 0.0445 (6) | |
| C9 | 0.0677 (4) | −0.6056 (3) | 0.0730 (2) | 0.0501 (7) | |
| H9 | 0.1143 | −0.6774 | 0.1221 | 0.060* | |
| C10 | −0.1170 (4) | −0.4163 (3) | 0.0397 (3) | 0.0517 (7) | |
| H10 | −0.1963 | −0.3591 | 0.0661 | 0.062* | |
| C11 | −0.1021 (5) | −0.5466 (4) | 0.2371 (3) | 0.0625 (9) | |
| H11A | −0.2250 | −0.5643 | 0.2315 | 0.075* | |
| H11B | −0.0586 | −0.6370 | 0.2699 | 0.075* | |
| C12 | 0.0904 (4) | −0.3092 (3) | 0.3061 (2) | 0.0489 (7) | |
| H12 | 0.1579 | −0.3061 | 0.2439 | 0.059* | |
| C13 | −0.1055 (4) | −0.3780 (3) | 0.4208 (2) | 0.0474 (7) | |
| H13 | −0.1979 | −0.4325 | 0.4511 | 0.057* | |
| C14 | −0.0133 (4) | −0.2505 (3) | 0.4685 (3) | 0.0513 (7) | |
| H14 | −0.0291 | −0.1992 | 0.5384 | 0.062* | |
| N1 | 0.1078 (3) | −0.2097 (3) | 0.3962 (2) | 0.0523 (6) | |
| H1A | 0.175 (4) | −0.135 (4) | 0.406 (3) | 0.063* | |
| N2 | −0.0387 (3) | −0.4140 (2) | 0.31870 (18) | 0.0419 (5) | |
| O1 | 0.5166 (2) | 0.3008 (2) | −0.07003 (16) | 0.0477 (5) | |
| H1 | 0.520 (4) | 0.323 (4) | −0.150 (3) | 0.072* | |
| O2 | 0.7193 (2) | 0.1627 (2) | −0.10967 (16) | 0.0504 (5) | |
| O3 | 0.8439 (3) | −0.0099 (3) | 0.05360 (19) | 0.0635 (6) | |
| H3A | 0.858 (4) | 0.013 (4) | −0.0196 (15) | 0.095* | |
| O4 | 0.3120 (3) | 0.3311 (2) | 0.32481 (17) | 0.0513 (5) | |
| O5 | 0.5091 (3) | 0.2577 (3) | 0.48529 (18) | 0.0677 (6) | |
| O6 | 0.2758 (3) | 0.0777 (2) | 0.4006 (2) | 0.0664 (6) | |
| O7 | 0.5030 (3) | 0.3928 (2) | 0.71130 (18) | 0.0563 (6) | |
| H7A | 0.506 (5) | 0.342 (4) | 0.644 (4) | 0.084* | |
| H7B | 0.565 (5) | 0.471 (5) | 0.700 (3) | 0.084* | |
| S1 | 0.39522 (9) | 0.20854 (7) | 0.37902 (5) | 0.0380 (2) |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| C1 | 0.0372 (13) | 0.0356 (11) | 0.0304 (13) | −0.0014 (10) | 0.0101 (10) | 0.0005 (9) |
| C2 | 0.0420 (15) | 0.0447 (13) | 0.0394 (14) | 0.0077 (11) | 0.0145 (12) | 0.0024 (11) |
| C3 | 0.0516 (17) | 0.0541 (15) | 0.0497 (17) | 0.0238 (13) | 0.0114 (13) | 0.0118 (13) |
| C4 | 0.0571 (17) | 0.0473 (14) | 0.0346 (14) | 0.0080 (12) | 0.0068 (12) | 0.0105 (11) |
| C5 | 0.0408 (14) | 0.0367 (12) | 0.0239 (11) | −0.0020 (10) | 0.0084 (10) | −0.0001 (9) |
| C6 | 0.0362 (13) | 0.0355 (11) | 0.0282 (12) | 0.0018 (10) | 0.0074 (10) | 0.0017 (9) |
| C7 | 0.0391 (14) | 0.0405 (12) | 0.0302 (12) | −0.0023 (11) | 0.0115 (11) | 0.0009 (10) |
| C8 | 0.0486 (16) | 0.0490 (14) | 0.0329 (14) | −0.0049 (12) | 0.0056 (12) | −0.0065 (11) |
| C9 | 0.0567 (18) | 0.0533 (16) | 0.0403 (15) | 0.0168 (13) | −0.0047 (13) | 0.0036 (12) |
| C10 | 0.0493 (17) | 0.0607 (17) | 0.0476 (17) | 0.0155 (14) | 0.0082 (13) | −0.0092 (13) |
| C11 | 0.083 (2) | 0.0612 (18) | 0.0376 (16) | −0.0217 (16) | 0.0181 (15) | −0.0101 (13) |
| C12 | 0.0461 (16) | 0.0579 (16) | 0.0411 (15) | −0.0069 (13) | 0.0142 (13) | −0.0036 (12) |
| C13 | 0.0448 (15) | 0.0683 (18) | 0.0301 (13) | 0.0035 (13) | 0.0134 (12) | 0.0044 (12) |
| C14 | 0.0567 (18) | 0.0588 (17) | 0.0397 (15) | 0.0109 (14) | 0.0087 (13) | −0.0068 (13) |
| N1 | 0.0543 (16) | 0.0512 (14) | 0.0470 (14) | −0.0095 (11) | 0.0055 (12) | −0.0062 (11) |
| N2 | 0.0443 (13) | 0.0500 (12) | 0.0300 (11) | −0.0033 (10) | 0.0100 (9) | −0.0018 (9) |
| O1 | 0.0577 (12) | 0.0605 (11) | 0.0293 (10) | 0.0153 (9) | 0.0142 (9) | 0.0116 (8) |
| O2 | 0.0561 (12) | 0.0623 (11) | 0.0374 (10) | 0.0087 (9) | 0.0237 (9) | 0.0049 (9) |
| O3 | 0.0681 (14) | 0.0761 (14) | 0.0585 (14) | 0.0311 (12) | 0.0333 (12) | 0.0130 (11) |
| O4 | 0.0595 (12) | 0.0561 (11) | 0.0436 (11) | 0.0171 (9) | 0.0170 (9) | 0.0094 (9) |
| O5 | 0.0763 (15) | 0.0925 (16) | 0.0349 (11) | 0.0276 (13) | −0.0058 (10) | −0.0228 (11) |
| O6 | 0.0833 (15) | 0.0500 (11) | 0.0726 (15) | −0.0035 (10) | 0.0506 (13) | 0.0020 (10) |
| O7 | 0.0863 (17) | 0.0511 (12) | 0.0309 (10) | 0.0033 (11) | 0.0104 (10) | 0.0057 (9) |
| S1 | 0.0512 (4) | 0.0382 (3) | 0.0258 (3) | 0.0028 (3) | 0.0128 (3) | 0.0011 (2) |
| C1—C2 | 1.399 (4) | C10—H10 | 0.9300 |
| C1—C6 | 1.403 (3) | C11—N2 | 1.474 (3) |
| C1—C7 | 1.476 (3) | C11—H11A | 0.9700 |
| C2—O3 | 1.343 (3) | C11—H11B | 0.9700 |
| C2—C3 | 1.386 (4) | C12—N1 | 1.313 (4) |
| C3—C4 | 1.368 (4) | C12—N2 | 1.316 (3) |
| C3—H3 | 0.9300 | C12—H12 | 0.9300 |
| C4—C5 | 1.396 (4) | C13—C14 | 1.331 (4) |
| C4—H4 | 0.9300 | C13—N2 | 1.371 (3) |
| C5—C6 | 1.374 (3) | C13—H13 | 0.9300 |
| C5—S1 | 1.765 (2) | C14—N1 | 1.353 (4) |
| C6—H6 | 0.9300 | C14—H14 | 0.9300 |
| C7—O2 | 1.224 (3) | N1—H1A | 0.79 (3) |
| C7—O1 | 1.313 (3) | O1—H1 | 0.93 (4) |
| C8—C9 | 1.376 (4) | O3—H3A | 0.87 (2) |
| C8—C10 | 1.378 (4) | O4—S1 | 1.4444 (19) |
| C8—C11 | 1.505 (4) | O5—S1 | 1.441 (2) |
| C9—C10i | 1.379 (4) | O6—S1 | 1.442 (2) |
| C9—H9 | 0.9300 | O7—H7A | 0.88 (4) |
| C10—C9i | 1.379 (4) | O7—H7B | 0.81 (4) |
| C2—C1—C6 | 119.0 (2) | N2—C11—C8 | 112.1 (2) |
| C2—C1—C7 | 119.7 (2) | N2—C11—H11A | 109.2 |
| C6—C1—C7 | 121.3 (2) | C8—C11—H11A | 109.2 |
| O3—C2—C3 | 117.2 (2) | N2—C11—H11B | 109.2 |
| O3—C2—C1 | 122.7 (2) | C8—C11—H11B | 109.2 |
| C3—C2—C1 | 120.1 (2) | H11A—C11—H11B | 107.9 |
| C4—C3—C2 | 120.3 (2) | N1—C12—N2 | 108.4 (2) |
| C4—C3—H3 | 119.9 | N1—C12—H12 | 125.8 |
| C2—C3—H3 | 119.9 | N2—C12—H12 | 125.8 |
| C3—C4—C5 | 120.5 (2) | C14—C13—N2 | 107.2 (2) |
| C3—C4—H4 | 119.8 | C14—C13—H13 | 126.4 |
| C5—C4—H4 | 119.8 | N2—C13—H13 | 126.4 |
| C6—C5—C4 | 119.8 (2) | C13—C14—N1 | 107.1 (2) |
| C6—C5—S1 | 121.96 (19) | C13—C14—H14 | 126.5 |
| C4—C5—S1 | 118.19 (18) | N1—C14—H14 | 126.5 |
| C5—C6—C1 | 120.3 (2) | C12—N1—C14 | 109.2 (2) |
| C5—C6—H6 | 119.8 | C12—N1—H1A | 126 (3) |
| C1—C6—H6 | 119.8 | C14—N1—H1A | 124 (3) |
| O2—C7—O1 | 122.8 (2) | C12—N2—C13 | 108.1 (2) |
| O2—C7—C1 | 122.1 (2) | C12—N2—C11 | 126.2 (2) |
| O1—C7—C1 | 115.1 (2) | C13—N2—C11 | 125.7 (2) |
| C9—C8—C10 | 118.8 (2) | C7—O1—H1 | 108 (2) |
| C9—C8—C11 | 120.3 (3) | C2—O3—H3A | 128.1 (11) |
| C10—C8—C11 | 120.9 (3) | H7A—O7—H7B | 100 (4) |
| C8—C9—C10i | 120.7 (3) | O5—S1—O6 | 111.68 (15) |
| C8—C9—H9 | 119.6 | O5—S1—O4 | 112.97 (13) |
| C10i—C9—H9 | 119.6 | O6—S1—O4 | 112.13 (13) |
| C8—C10—C9i | 120.5 (3) | O5—S1—C5 | 105.30 (12) |
| C8—C10—H10 | 119.8 | O6—S1—C5 | 106.67 (11) |
| C9i—C10—H10 | 119.8 | O4—S1—C5 | 107.55 (11) |
| C6—C1—C2—O3 | −180.0 (2) | C9—C8—C10—C9i | 0.2 (5) |
| C7—C1—C2—O3 | −0.3 (4) | C11—C8—C10—C9i | 179.6 (3) |
| C6—C1—C2—C3 | 1.0 (4) | C9—C8—C11—N2 | 110.3 (3) |
| C7—C1—C2—C3 | −179.3 (2) | C10—C8—C11—N2 | −69.2 (4) |
| O3—C2—C3—C4 | −179.8 (3) | N2—C13—C14—N1 | 0.0 (3) |
| C1—C2—C3—C4 | −0.8 (4) | N2—C12—N1—C14 | −0.3 (4) |
| C2—C3—C4—C5 | −0.3 (4) | C13—C14—N1—C12 | 0.2 (4) |
| C3—C4—C5—C6 | 1.1 (4) | N1—C12—N2—C13 | 0.3 (3) |
| C3—C4—C5—S1 | −179.0 (2) | N1—C12—N2—C11 | 179.9 (3) |
| C4—C5—C6—C1 | −0.8 (4) | C14—C13—N2—C12 | −0.2 (3) |
| S1—C5—C6—C1 | 179.28 (17) | C14—C13—N2—C11 | −179.8 (3) |
| C2—C1—C6—C5 | −0.2 (4) | C8—C11—N2—C12 | −21.6 (5) |
| C7—C1—C6—C5 | −179.8 (2) | C8—C11—N2—C13 | 157.9 (3) |
| C2—C1—C7—O2 | −0.5 (4) | C6—C5—S1—O5 | −128.2 (2) |
| C6—C1—C7—O2 | 179.2 (2) | C4—C5—S1—O5 | 52.0 (2) |
| C2—C1—C7—O1 | 179.2 (2) | C6—C5—S1—O6 | 113.1 (2) |
| C6—C1—C7—O1 | −1.2 (3) | C4—C5—S1—O6 | −66.8 (2) |
| C10—C8—C9—C10i | −0.2 (5) | C6—C5—S1—O4 | −7.4 (2) |
| C11—C8—C9—C10i | −179.6 (3) | C4—C5—S1—O4 | 172.70 (19) |
| Symmetry codes: (i) −x, −y−1, −z. |
| D—H···A | D—H | H···A | D···A | D—H···A |
| O1—H1···O7ii | 0.93 (4) | 1.68 (4) | 2.593 (3) | 168 (3) |
| O3—H3A···O2 | 0.87 (2) | 2.04 (2) | 2.591 (3) | 121 (3) |
| O3—H3A···O3iii | 0.87 (2) | 2.46 (2) | 2.883 (4) | 111 (2) |
| O7—H7B···O4iv | 0.81 (4) | 1.93 (4) | 2.741 (3) | 173 (4) |
| O7—H7A···O5 | 0.88 (4) | 1.93 (4) | 2.799 (3) | 172 (4) |
| N1—H1A···O6 | 0.79 (3) | 1.95 (3) | 2.707 (3) | 160 (3) |
| C4—H4···O6v | 0.93 | 2.51 | 3.411 (4) | 164 |
| C12—H12···O2vi | 0.93 | 2.22 | 3.035 (3) | 146 |
| C14—H14···O6vii | 0.93 | 2.52 | 3.219 (4) | 132 |
| C3—H3···Cg1viii | 0.93 | 2.97 (1) | 3.889 (3) | 170 |
| Symmetry codes: (ii) x, y, z−1; (iii) −x+2, −y, −z; (iv) −x+1, −y+1, −z+1; (v) −x+1, −y, −z+1; (vi) −x+1, −y, −z; (vii) −x, −y, −z+1; (viii) x+1, y, z. |
| D—H···A | D—H | H···A | D···A | D—H···A |
| O1—H1···O7i | 0.93 (4) | 1.68 (4) | 2.593 (3) | 168 (3) |
| O3—H3A···O2 | 0.87 (2) | 2.04 (2) | 2.591 (3) | 121 (3) |
| O3—H3A···O3ii | 0.87 (2) | 2.46 (2) | 2.883 (4) | 111 (2) |
| O7—H7B···O4iii | 0.81 (4) | 1.93 (4) | 2.741 (3) | 173 (4) |
| O7—H7A···O5 | 0.88 (4) | 1.93 (4) | 2.799 (3) | 172 (4) |
| N1—H1A···O6 | 0.79 (3) | 1.95 (3) | 2.707 (3) | 160 (3) |
| C4—H4···O6iv | 0.93 | 2.51 | 3.411 (4) | 164 |
| C12—H12···O2v | 0.93 | 2.22 | 3.035 (3) | 146 |
| C14—H14···O6vi | 0.93 | 2.52 | 3.219 (4) | 132 |
| C3—H3···Cg1vii | 0.93 | 2.97 (1) | 3.889 (3) | 170 |
| Symmetry codes: (i) x, y, z−1; (ii) −x+2, −y, −z; (iii) −x+1, −y+1, −z+1; (iv) −x+1, −y, −z+1; (v) −x+1, −y, −z; (vi) −x, −y, −z+1; (vii) x+1, y, z. |
Bernstein, J., Davis, R. E., Shimoni, L. & Chang, N.-L. (1995). Angew. Chem. Int. Ed. Engl. 34, 1555–1573.
Bruker (2001). SMART and SAINT-Plus. Bruker AXS Inc., Madison, Wisconsin, USA.
Hoskins, B. F., Robson, R. & Slizys, D. A. (1997). J. Am. Chem. Soc. 119, 2952–2953.
Meng, X.-G., Xiao, Y.-L., Wang, Z.-L. & Liu, C.-L. (2008). Acta Cryst. C64, o53–o57.
Meng, X.-G., Zhou, C.-S., Wang, L. & Liu, C.-L. (2007). Acta Cryst. C63, o667–o670.
Muthiah, P. T., Hemamalini, M., Bocelli, G. & Cantoni, A. (2003). Acta Cryst. E59, o2015–o2017.
Sheldrick, G. M. (1997). SADABS. Bruker AXS Inc., Madison, Wisconsin, USA.
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122.
Smith, G., Wermuth, U. D. & Healy, P. C. (2005a). Acta Cryst. C61, o555–o558.
Smith, G., Wermuth, U. D. & White, J. M. (2004). Acta Cryst. C60, o575–o581.
Smith, G., Wermuth, U. D. & White, J. M. (2005b). Acta Cryst. C61, o105–o109.
Smith, G., Wermuth, U. D. & White, J. M. (2005c). Acta Cryst. E61, o313–o316.
Spek, A. L. (2003). J. Appl. Cryst. 36, 7–13.
5-Sulfosaliyclic acid (5-H2SSA), a strong organic acid (pKa1=2.6), can easily release its sulfonic hydrogen atom to a nitrogen-containing Lewis bases (Muthiah et al., 2003; Smith et al., 2004, 2005a, 2005b, 2005c; Meng et al., 2007; Meng et al., 2008), forming organic salts in most cases. In this paper, we report the crystal structure of the title compound, C14H16N4.2(C7H5O6S).2(H2O) (I) , which was obtained by crystallization of the 95% methanol solution of 5-H2SSA and 1,4-Bis(imidazol-1-ylmethyl)benzene) (bix) (molar ratio 2:1) at room temperature.
In (I), the asymmetric unit consists of one half bix2+ dication, one complete 5-HSSA- anion and one water molecule (see Fig. 1 for symmetry complete formula unit). Similar to some analogs (Meng et al., 2007, 2008), the hydrogen atom was transferred from the sulfonic group to the imidazole nitrogen atom, forming an 1:2 organic salt (cation to anion). The hydroxyl O3 atom forms an intramolecular S(6) and an intermolecular R22(4) ring, resulting in a 5-HSSA- dimer (Bernstein, et al., 1995). The carboxyl O1 atom is only hydrogen-bonded to a water molecule at (x, y, z - 1). The plane defined by sulfonic O4/O5/O6 atoms makes a dihedral angle of 88.7 (1)° with the C1—C6 plane, with the distances of each oxygen atom away from the benzene-plane being 0.211 (1), 1.126 (1) and 1.237 (1) Å, respectively, which is slightly different from those recently reported by Meng, et al., 2007, 2008. In the bix2+ dication, there is an crystallogrphic inversion centre at the centre of gravity of the benzene ring.
In the crystal structure of (I), the ionic components are linked by a cooperative action of N—H···O, O—H···O and C—H···O hydrogen bonds into a continuous three-dimensional network which is further consolidated by a C—H···π interaction (Table 1). In more detail, the supramolecular structure in (I) can be analyzed in terms of three substructures. First, by utilizing three intermolecular O1—H1···O7i [symmetry code: (i) x, y, z - 1], O7—H7A···O5 and O7—H7B···O4ii [symmetry code: (ii) 1 - x, 1 - y, 1 - z] hydrogen bonds, the 5-HSSA- anions and water molecules are linked into a one-dimensional tape structure running parallel to the [001] direction (Fig.2) in which alternating R24(12) and R44(20) (Bernstein, et al., 1995) hydrogen-bonded rings are formed. Secondly, these adjacent one-dimensional tapes are further joined together by the hydroxylic R22(4) hydrogen-bonded ring, resulting in a two-dimensional wrinkled sheet running parallel to the (110) plane. In addition to, the intramolecular S(6) and intermolecular R22(4) hydrogen-bonded rings, another R810(32) hydrogen-bond motif is formed in the sheet (Fig.2). These sheets are joined by means of the N1—H1A···O6 hydrogen bond, forming a three-dimensional network (Fig.3) in which larger R1214(66) hydrogen-bonded rings are observed. Further analysis (using the program PLATON [Spek, 2003]) shows that these three-dimensional networks are strengthened by C—H···O hydrogen bonds and weak C—H···π interactions (Table 1).