polyoxometalates
accessIron(II) and copper(II) paratungstates B: a single-crystal X-ray diffraction study
aUniversität Wien, Fakultät für Chemie, Institut für Biophysikalische Chemie, Althanstrasse 14, Wien 1090, Austria, and bUniversität Wien, Fakultät für Chemie, Zentrum für Röntgenstrukturanalyse, Währinger Strasse 42, Wien 1090, Austria
*Correspondence e-mail: [email protected]
Paratungstate B is a common isopolytungstate (IPOT) built of the [W12O40(OH)2]10− anion and exhibits a cluster-like construction of 12 W-centred distorted octahedra. Due to a high the paratungstate anion acts as a multidentate ligand forming high-dimensional extended structures, which exhibit unique catalytic and magnetic properties. Two new paradodecatungstate B compounds decorated by iron(II) or copper(II), namely Na5Fe2.5[W12O40(OH)2]·36H2O (Na5Fe2.5paraB) and Na4Cu3[W12O40(OH)2]·28H2O (Na4Cu3paraB), have been synthesized by a convenient aqueous solution method, and structurally characterized by single-crystal and powder X-ray diffraction, IR spectroscopy, elemental analysis and thermogravimetric analysis. Both compounds crystallize in the triclinic P
In both compounds, the [W12O40(OH)2]10− polyanion acts as a multidentate ligand that links transition-metal and sodium cations, forming a three-dimensional framework.
1. Introduction
The structural diversity of polyoxometalates (Pope, 1983
) and their proven applications in catalysis (Wang & Yang, 2015
), nanotechnology (Yamase & Pope, 2002
), electrochemistry (Sadakane & Steckhan, 1998
), materials science (Proust et al., 2008
), molecular magnetism (Clemente-Juan et al., 2012
), macromolecular crystallography (Bijelic & Rompel, 2015
, 2017
; Molitor et al., 2017
) and medicine (Fu et al., 2015
; Bijelic et al., 2018a
,b
) have encouraged the synthesis of novel polyanions with promising properties. One of the most common isopolytungstates (IPOTs) is paratungstate B, built of the [W12O40(OH)2]10− anion that is stable in aqueous acidic solution and exhibits a cluster-like construction of 12 W-centred distorted octahedra (Evans & Rollins, 1976
; Pope, 1983
). Due to a high surface charge density, the paratungstate anion acts as a multidentate ligand, which can coordinate alkaline (Peresypkina et al., 2014
) and transition-metal cations (Radio et al., 2010
, 2011
; Gumerova et al., 2015
), and also act as a precursor (Sokolov et al., 2012
). By coordinating transition-metal cations, paratungstates can form high-dimensional extended structures, which exhibit unique catalytic (He et al., 2008
; Chen et al., 2017
) and magnetic properties (Li et al., 2008
, 2009
). So far, three paratungstates B with FeII and nine with CuII as counter-cations have been successfully synthesized and characterized by X-ray diffraction (Table 1
). We present herein two novel paratungstates B, one with FeII and one with CuII, namely the double sodium–iron(II) paratungstate Na5Fe2.5[W12O40(OH)2]·36H2O (denoted Na5Fe2.5paraB) and the double sodium–copper(II) paratungstate Na4Cu3[W12O40(OH)2]·28H2O (denoted Na4Cu3paraB), which were synthesized by a convenient aqueous solution method.
|
2. Experimental
2.1. Synthesis and crystallization
The reagents were used as purchased from Sigma–Aldrich without further purification.
2.1.1. Synthesis of Na5Fe2.5paraB
Iron powder (0.112 g, 2 mmol) was added to a solution (15 ml) of Na2WO4·2H2O (3.96 g, 12 mmol), which was acidified to pH = 2.5 with HCl (1 M). The mixture was stirred in an ultrasonic bath, giving a deep-blue solution, which was left to stand closed at room temperature. The pale-red–brown crystals which grew on the beaker walls were collected after three weeks (yield ∼2 g, ∼53%, based on W). Elemental analysis found (calculated) for Fe2.5H74Na5O78W12 (%): Na 3.13 (3.03), Fe 3.71 (3.69), W 56.8 (58.32).
2.1.2. Synthesis of Na4Cu3paraB
Sodium orthotungstate Na2WO4·2H2O (5.5 g, 16.7 mmol) was dissolved in water (25 ml) and the pH was adjusted to 8 by adding dilute HNO3 (1 M). An aqueous solution (10 ml) of Cu(NO3)2·3H2O (0.5 g, 2.1 mmol) was then added dropwise, while the pH was maintained between 3.0 and 4.5 with HNO3 (1 M). The final mixture was filtered (pH = 4.2) and allowed to stand closed at room temperature. Light-blue crystals formed within two months (yield ∼3.5 g, 69% based on W). Elemental analysis found (calculated) for Cu3H58Na4O70W12 (%): Na 2.62 (2.51), Cu 5.13 (5.20), W 59.1 (60.16).
2.2. IR spectroscopy
The title compounds were identified by IR measurements on a Bruker Vertex70 IR Spectrometer equipped with a single-reflection diamond-ATR unit (ATR is attenuated total reflectance) in the range 4000–400 cm−1.
2.3. TGA measurements
Thermogravimetric analysis (TGA) was performed on a Mettler SDTA851e Thermogravimetric Analyzer under a nitrogen flow with a heating rate of 5 K min−1 in the region from 298 to 973 K.
2.4. Elemental analysis
Elemental analysis was conducted using inductive-coupled plasma–mass spectrometry (PerkinElmer Elan 6000 ICP MS) and atomic absorption spectroscopy (PerkinElmer 1100 Flame AAS) in aqueous solutions containing 2% HNO3. Standards were prepared from single-element standard solutions of concentration 1000 mg l−1 (from Merck, Ultra Scientific and Analytika Prague).
2.5. Powder X-ray diffraction
Powder X-ray diffraction (PXRD) was performed on a Bruker D8 Advance diffractometer, with Cu Kα radiation (λ = 1.54056 Å), a Lynxeye silicon strip detector, a SolX and a variable slit aperture of 12 mm. The 2θ range was 8–50°.
2.6. Refinement
In Table 2
, the crystallographic characteristics of the two new paratungstates B and the experimental conditions of the data collection and refinement are reported. The positions of the independent H atoms were obtained by difference Fourier techniques and were refined with free isotropic displacement parameters.
|
Fixed isotropic displacement parameters for all H atoms with a value equal to 1.5Ueq of the corresponding O—H group atom were assigned. Restrained distances for D—H bonds were applied to avoid short D—H⋯H—D interactions. To force correct bonds, specified bonds were added to or removed from the connectivity list.
The disordered water molecules in the coordination spheres of atom Na1 in Na4Cu3paraB and of atoms Na4 and Na5 in Na5Fe2.5paraB were refined with two positions with fixed occupancy factors of 0.5.
In Na4Cu3paraB, part of the disordered water molecules were not modelled and the disordered density was considered using the OLEX2 (Dolomanov et al., 2009
) implementation of BYPASS (a.k.a. SQUEEZE; Spek, 2015
). The modelled electron density is consistent with approximately four water molecules per unit cell.
The structures have been deposited with the Inorganic Crystal Structure Database (ICSD) (https://www2.fiz-karlsruhe.de/icsd_home.html) under collection numbers 434558 and 434559.
3. Results and discussion
The syntheses of Na5Fe2.5paraB and Na4Cu3paraB were carried out with WVI-to-MII ratios of W:Fe = 12:2 and W:Cu = 12:1.5, and a pH of 2.5 for Na5Fe2.5paraB and 4.2 for Na4Cu3paraB, which are different from previously reported conditions (Table 1
) and made it possible to obtain compounds with new Fe–Na and Cu–Na compositions. The presence of NaI as counter-cation in paratungstates B, together with CuII or FeII, have been observed previously both in excess and in deficiency of the transition-metal ion in the reaction mixture, which had a pH in the range 3.5–6.5 (Table 1
). This allows one to conclude that crystallization of paratungstates B as double-alkali–transition-metal salts is more preferable than crystallization of pure transition-metal paratungstates B, regardless of the starting molar ratios of the components and the pH of the reaction system.
The main structural elements of Na5Fe2.5paraB and Na4Cu3paraB are shown in Fig. 1
. Both compounds consist of paradodecatungstate B [W12O40(OH)2]10− polyanions (Evans & Rollins, 1976
; Pope, 1983
), sodium and transition-metal cations, and additional water molecules (Fig. 1
). The paratungstate B units observed in Na5Fe2.5paraB and Na4Cu3paraB are structurally identical to previously reported units (Table 1
).
| Figure 1 Structural elements in Na5Fe2.5paraB and Na4Cu3paraB. (a) The [W12O40(OH)2]10− anion in Na5Fe2.5paraB connected to four Na+ and six Fe2+ ions via terminal O atoms. (b) A fragment of the infinite 1D chain in Na5Fe2.5paraB consisting of Na and Fe polyhedra. (c) The [W12O40(OH)2]10− anion in Na4Cu3paraB connected to six Na+ and six Cu2+ ions via terminal O atoms. (d) A fragment of the infinite 1D chain in Na4Cu3paraB consisting of Na and Cu polyhedra. Colour code: {WO6} are light-blue or violet octahedra, {W3O14} are blue octahedra and {W3O13} are violet octahedra, and Na atoms are green, Fe orange, Cu blue and O red. |
In Na4Cu3paraB, there is one-half unit of the POM, which lies on an inversion centre, in the asymmetric unit. For Na5Fe2.5paraB, there are two independent half-POM units in the asymmetric unit.
The centrosymmetric [W12O40(OH)2]10− anion consists of four corner-sharing groups: two {W3O13} (violet octahedra in Figs. 1
a and 1c) and two {W3O14} (blue octahedra in Figs. 1
a and 1c) units. Each {W3O13} fragment is formed by three edge-sharing {WO6} octahedra with a common O atom, while in the {W3O14} triads, the three edge-sharing {WO6} octahedra are linearly connected with no common O atom to the three W atoms. In the {W3O13} groups, each octahedron has one terminal O atom, while in the {W3O14} units, each octahedron has two unshared O atoms (Figs. 1
a and 1c). The O atoms connected to the W centres can be classified into three groups. The first group is comprised of terminal O atoms (Ot), each bonded to one W atom. The second group consists of bridging O atoms (Odb), each connected to two W atoms. There are two types of Odb, one bridges two W atoms within the same {W3O13} or {W3O14} fragment (Odb1), while the other bridges two W atoms between the different {W3O13} and {W3O14} units (Odb2). The third group contains triply bridging O atoms, linked by three W atoms. The triply bridging O atoms exclusively from {W3O13} are labelled Otb1, whereas the O atoms bridging three W atoms between {W3O13} and {W3O14} units are labelled as Otb2.
The exact positions of the two protons in [W12O40(OH)2]10− were located previously on triply bridging O atoms of {W3O13} by neutron diffraction (Evans & Prince, 1983
). Selected bond lengths and angles are presented in Table 3
. All the W atoms in [W12O40(OH)2]10− exhibit the +VI when applying the bond valence sum (BVS) calculations of Brown & Altermatt (1985
). For Na5Fe2.5paraB and Na4Cu3paraB, we got average values of 6.01 and 6.09, respectively. BVS calculations for Fe and Cu sites show that both ions exhibit the +II oxidation state, with a value of 2.12 for Fe and 2.08 for Cu.
| |||||||||||||||||||||||||||||||||||||||||
In the of Na5Fe2.5paraB, the paratungstate anions act as decadentate ligands, which are linked via terminal O atoms to six Fe2+ and four Na+ cations. There are two crystallographically unique iron centres with different coordination modes (Figs. 1
a and 1b). The coordination sphere of one type of Fe2+ atom (Fe2) is formed by two Ot from the belt unit {W3O14} of one [W12O40(OH)2]10−, one Ot from the capping {W3O13} group of a neighbouring polyanion and completed by three H2O molecules. The octahedrally coordinated second Fe2+ atom (Fe1) is linked by two Ot from the {W3O13} units of two neighbouring polyanions, two Na+ bridging O atoms and two lattice H2O molecules. The Fe1 octahedron and three Na(H2O)6 units from the infinite one-dimensional (1D) chain share a corner, thereby forming a two-dimensional sheet (2D) in the ab plane (Fig. 1
b). Neighbouring sheets are connected to each other by Fe2 cations, giving rise to a complicated three-dimensional structure (Figs. 2
and 3
). It should be noted that the double sodium–iron(II) paratungstate B Na5Fe2.5[W12O40(OH)2]·36H2O reported in this work has the same cationic composition as reported in Na5[{Fe(H2O)3}2{Fe(H2O)4}0.5(H2W12O42)]·30H2O (Yang et al., 2003
) (Table 1
). However, the minor difference with respect to the water content in these two structures leads to a significant change in the unit-cell parameters (Tables 1
and 2
) and the motif of crystal packing (Figs. 2
and 3
).
| Figure 2 The crystal packing of Na5Fe2.5paraB, viewed along the b axis. Colour code: {WO6} are light-blue octahedra and Na atoms are green, Fe yellow and O red. |
| Figure 3 The crystal packing of Na5Fe2.5paraB, viewed along the a axis. Colour code: {WO6} are light-blue octahedra and Na atoms are green, Fe yellow and O red. |
In the of Na4Cu3paraB, each paratungstate B anion is coordinated to six Cu2+ and six Na+ via Ot and therefore acts as a dodecadentate ligand (Figs. 1
c and 1d). There are three crystallographically unique copper centres with different coordination modes. Two (Cu1 and Cu2) out of three Cu2+ cations take part in the formation of infinite chains with alternating Na and Cu polyhedra connected by a common edge (Figs. 1
d and 4) and have different coordination environments. The Cu2 atoms are linked by four Ot atoms of the belt-fragment {W3O14} from two neighbouring [W12O40(OH)2]10− anions and two Na+ bridging H2O molecules. The coordination sphere of Cu3 consists of two Ot of the capping {W3O13} group of a neighbouring polyanion and is completed by four bridging H2O molecules. The third Cu1 atom coordinates to four Ot atoms of the belt units {W3O14} from two neighbouring [W12O40(OH)2]10− anions and two H2O molecules. The Cu2+ ions exhibit a distorted square–bipyramidal coordination geometry with elongated axial distances [2.365 (7)–2.520 (8) Å]. The three-dimensional (3D) structure of Na4Cu3-paraB consists of 2D sheets formed by two chains, namely {[(Na(H2O)2)2W12O40(OH)2]8−}n and {[Na(H2O)2–Cu(H2O)2–Na(H2O)2–Cu(H2O)4]6+}n parallel to the ab plane (Fig. 4
). The 2D sheets are connected along the c axis by [Cu(H2O)4]2+ cations (Fig. 5
). The two [Na(H2O)5]+ cations, which are connected to Ot of one polyanion and do not participate in the formation of sodium–copper chains, are located in 1D tunnels in the structure of Na4Cu3-paraB.
| Figure 4 The crystal packing of Na4Cu3paraB, viewed along the c axis. Colour code: {WO6} are light-blue octahedra and Na atoms are green, Cu blue and O red. |
| Figure 5 The crystal packing of Na4Cu3paraB, viewed along the a axis. Colour code: {WO6} are light-blue octahedra and Na atoms are green, Cu blue and O red. |
The results of the powder XRD patterns of Na5Fe2.5paraB and Na4Cu3paraB have been investigated in the solid state at room temperature (Fig. 6
). The simulated powder diffraction pattern was based on the single-crystal structural data. The simulated peak positions are in good agreement with those observed. A comparison of the experimental and simulated powder diffraction patterns confirms that the POTs structures had been solved accurately and that both products consist of a single phase.
| Figure 6 Experimental (blue) and simulated (black) X-ray diffraction patterns of (a) Na4Cu3paraB and (b) Na5Fe2.5paraB. |
In the IR spectra of Na5Fe2.5paraB and Na4Cu3paraB, the characteristic peaks at 975, 950, 932, 867, 676 and 488 cm−1, and at 972, 937, 926, 872, 675 and 493 cm−1, respectively, are attributed to the W=Ot and W—O—W vibrations in the paratungstate anion, which are in agreement with previously reported data (Table 1
; Qu et al., 2012
). The slight peak displacements are due to the effects of different coordination modes of paratungstate B. The peaks at ∼1600 and 3400 cm−1 are attributed to the vibration of water molecules.
The disordered water molecules in Na4Cu3paraB were treated with SQUEEZE (Spek, 2015
) and the exact number of water molecules was determined by TGA. The TG curve shows a three-step weight-loss process (Fig. 7
). The first weight loss of 7.48% in the temperature range 25–125 °C corresponds to all lattice H2O and water molecules from coordinating Na+ and Cu2+. The second (2.72%) and third (3.61%) steps in the range 125–500 °C correspond to 13 H2O molecules coordinating Na+ and Cu2+. The total weight loss is 13.83%, which results in the formula Na4Cu3[W12O40(OH)2]·28H2O.
| Figure 7 Thermogravimetric curve of Na4Cu3paraB. |
The success in synthesizing Na5Fe2.5paraB and Na4Cu3paraB shows that paratungstate B is a versatile building block, which can be modified by metal sites into high-dimensional architectures and the different connection principle of the transition metals has a big impact on the dimensionalities of the frameworks.
Supporting information
contains datablocks ando209_p-1, mo_ando241_p-1, global. DOI: https://doi.org/10.1107/S2053229618010021/jr3015sup1.cif
Structure factors: contains datablock ando209_p-1. DOI: https://doi.org/10.1107/S2053229618010021/jr3015ando209_p-1sup2.hkl
Structure factors: contains datablock mo_ando241_p-1. DOI: https://doi.org/10.1107/S2053229618010021/jr3015mo_ando241_p-1sup3.hkl
For both structures, data collection: APEX3; cell SAINT (Bruker, 2015); data reduction: SAINT (Bruker, 2015). Program(s) used to solve structure: SHELXS97 (Sheldrick, 2008) and shelXle (Hübschle et al., 2011) for ando209_p-1; SHELXS97 (Sheldrick, 2008) for mo_ando241_p-1. Program(s) used to refine structure: SHELXL2014 (Sheldrick, 2015) for ando209_p-1; SHELXL2016 (Sheldrick, 2015) for mo_ando241_p-1. Molecular graphics: OLEX2 (Dolomanov et al., 2009) and DIAMOND (Brandenburg, 2006) for ando209_p-1; OLEX2 (Dolomanov et al., 2009) for mo_ando241_p-1. For both structures, software used to prepare material for publication: OLEX2 (Dolomanov et al., 2009).
| Na4Cu3[W12O40(OH)2]·28H2O | Z = 1 |
| Mr = 3621.13 | F(000) = 1607 |
| Triclinic, P1 | Dx = 4.080 Mg m−3 |
| a = 10.6516 (5) Å | Mo Kα radiation, λ = 0.71073 Å |
| b = 12.7532 (6) Å | Cell parameters from 6027 reflections |
| c = 13.0730 (5) Å | θ = 3.0–30.0° |
| α = 113.771 (1)° | µ = 24.53 mm−1 |
| β = 90.443 (1)° | T = 100 K |
| γ = 112.502 (1)° | Plate, blue |
| V = 1473.65 (11) Å3 | 0.13 × 0.07 × 0.02 mm |
| Bruker APEX-II CCD diffractometer | 4720 reflections with I > 2σ(I) |
| Radiation source: sealed xray tube, Incoatec IuS | Rint = 0.048 |
| φ and ω scans | θmax = 25.4°, θmin = 2.1° |
| Absorption correction: multi-scan (SADABS; Bruker, 2016) | h = −12→12 |
| Tmin = 0.004, Tmax = 0.023 | k = −15→14 |
| 11292 measured reflections | l = −11→15 |
| 5321 independent reflections |
| Refinement on F2 | Hydrogen site location: difference Fourier map |
| Least-squares matrix: full | H atoms treated by a mixture of independent and constrained refinement |
| R[F2 > 2σ(F2)] = 0.035 | w = 1/[σ2(Fo2) + (0.0463P)2 + 6.2838P] where P = (Fo2 + 2Fc2)/3 |
| wR(F2) = 0.098 | (Δ/σ)max < 0.001 |
| S = 1.05 | Δρmax = 2.15 e Å−3 |
| 5321 reflections | Δρmin = −1.63 e Å−3 |
| 463 parameters | Extinction correction: SHELXL2014 (Sheldrick, 2015), Fc*=kFc[1+0.001xFc2λ3/sin(2θ)]-1/4 |
| 100 restraints | Extinction coefficient: 0.00022 (6) |
Geometry. All esds (except the esd in the dihedral angle between two l.s. planes) are estimated using the full covariance matrix. The cell esds are taken into account individually in the estimation of esds in distances, angles and torsion angles; correlations between esds in cell parameters are only used when they are defined by crystal symmetry. An approximate (isotropic) treatment of cell esds is used for estimating esds involving l.s. planes. |
Refinement. _olex2_refinement_description 1. Fixed Uiso At 1.5 times of: All O(H,H) groups 2. Restrained distances Na2-H31A 2.8 with sigma of 0.05 H34B-H25A 2.2 with sigma of 0.02 H34A-H25A 2.2 with sigma of 0.03 H34B_$2-H31B 2.2 with sigma of 0.02 H34A_$4-H31B_$3 2.2 with sigma of 0.02 Cu3-H25A 2.7 with sigma of 0.05 Cu3-H25B 2.3 with sigma of 0.02 H35A-O24 1.8 with sigma of 0.06 H35B-O19 2 with sigma of 0.06 Na1-H27B 2.8 with sigma of 0.05 Na1-H27C = Na1-H27A = Na1-H27D 2.8 with sigma of 0.05 H33B-Na1 2.8 with sigma of 0.02 H33B-O27 2.4 with sigma of 0.05 Na1-H28A 2.7 with sigma of 0.04 H33B-H28A 2.4 with sigma of 0.04 H32A_$3-O26 1.8 with sigma of 0.04 Na2-H31B = Na2-H32B 2.8 with sigma of 0.075 O32-H27B_$5 2.3 with sigma of 0.04 H29A_$1-H22A 2.2 with sigma of 0.02 O31-H31A = O31-H31B = O26-H26B = O26-H26A = O29-H29B = O29-H29A = O30-H30A = O30-H30B = O32-H32A = O32-H32B = O27-H27A = O27-H27B = O22-H22A = O22-H22B = O25-H25A = O25-H25B = O28-H28A = O28-H28B = O33-H33A = O33-H33B 0.87 with sigma of 0.015 Na1_$5-H29A_$5 2.7 with sigma of 0.04 H31A-H31B ~ H32B-H32A ~ H29A-H29B ~ H30A-H30B ~ H26B-H26A ~ H27A-H27B ~ H22A- H22B ~ H25A-H25B ~ H28A-H28B ~ H33A-H33B with sigma of 0.01 3. Uiso/Uaniso restraints and constraints Uanis(O3) ~ Ueq: with sigma of 0.01 and sigma for terminal atoms of 0.02 Uanis(O35) ~ Ueq: with sigma of 0.01 and sigma for terminal atoms of 0.02 Uanis(O27) = Uanis(O27B) = Uanis(O33) 4. Others Fixed Sof: O27(0.5) H27A(0.5) H27B(0.5) O27B(0.5) H27C(0.5) H27D(0.5) O33(0.2) H33A(0.2) H33B(0.2) O34(0.8) H34A(0.8) H34B(0.8) 5.a Free rotating group: O27B(H27C,H27D), O35(H35A,H35B), O34(H34A,H34B) 5.b Rotating group: O26(H26A,H26B), O30(H30A,H30B) _smtbx_masks_special_details ? loop_ _smtbx_masks_void_nr _smtbx_masks_void_average_x _smtbx_masks_void_average_y _smtbx_masks_void_average_z _smtbx_masks_void_volume _smtbx_masks_void_count_electrons _smtbx_masks_void_content 1 0.500 0.000 0.000 42.5 50.5 ? |
| x | y | z | Uiso*/Ueq | Occ. (<1) | |
| W1 | 0.40078 (5) | 0.59904 (4) | 0.70077 (4) | 0.02587 (13) | |
| W2 | 0.29232 (5) | 0.29326 (4) | 0.70980 (4) | 0.02647 (13) | |
| W3 | 0.11342 (5) | 0.30259 (4) | 0.50852 (4) | 0.02644 (13) | |
| W4 | 0.36784 (5) | 0.55467 (4) | 0.25109 (4) | 0.02598 (13) | |
| W5 | 0.25460 (5) | 0.24015 (4) | 0.24532 (4) | 0.02651 (13) | |
| W6 | 0.44888 (5) | 0.25037 (4) | 0.45361 (4) | 0.02571 (13) | |
| Cu1 | 0.5000 | 0.5000 | 0.0000 | 0.0295 (4) | |
| Cu2 | 0.5000 | 0.0000 | 0.5000 | 0.0318 (4) | |
| Cu3 | 0.0000 | 0.0000 | 0.5000 | 0.0292 (4) | |
| Na1 | 0.1011 (5) | 0.6455 (5) | 0.8881 (4) | 0.0388 (11) | |
| Na2 | 0.2217 (6) | −0.0459 (5) | 0.6480 (4) | 0.0453 (12) | |
| O1 | 0.4360 (8) | 0.7354 (7) | 0.6568 (6) | 0.0307 (17) | |
| O2 | 0.2961 (8) | 0.6304 (7) | 0.7964 (6) | 0.0321 (18) | |
| O3 | 0.2806 (8) | 0.4797 (7) | 0.5682 (6) | 0.0274 (16) | |
| O4 | 0.4464 (8) | 0.4809 (7) | 0.7296 (6) | 0.0287 (17) | |
| O5 | 0.2953 (7) | 0.3510 (7) | 0.8548 (6) | 0.0278 (16) | |
| O6 | 0.1920 (8) | 0.1290 (7) | 0.6530 (7) | 0.0311 (17) | |
| O7 | 0.4689 (7) | 0.2862 (7) | 0.7099 (6) | 0.0265 (16) | |
| O8 | 0.1595 (8) | 0.3407 (7) | 0.6693 (6) | 0.0280 (17) | |
| O9 | 0.3000 (7) | 0.2617 (7) | 0.5253 (6) | 0.0256 (16) | |
| O10 | 0.0060 (8) | 0.1394 (7) | 0.4742 (6) | 0.0283 (17) | |
| O11 | 0.1443 (7) | 0.2788 (7) | 0.3603 (6) | 0.0273 (16) | |
| O12 | −0.0075 (8) | 0.3650 (7) | 0.5232 (6) | 0.0303 (17) | |
| O13 | 0.3723 (8) | 0.5048 (7) | 0.1034 (6) | 0.0303 (17) | |
| O14 | 0.2479 (8) | 0.6201 (7) | 0.2670 (6) | 0.0292 (17) | |
| O15 | 0.2601 (8) | 0.3979 (7) | 0.2454 (6) | 0.0285 (17) | |
| O16 | 0.4167 (8) | 0.2715 (7) | 0.1837 (6) | 0.0277 (17) | |
| O17 | 0.1273 (8) | 0.1263 (7) | 0.1285 (6) | 0.0321 (18) | |
| O18 | 0.4261 (8) | 0.3860 (7) | 0.3991 (6) | 0.0270 (16) | |
| O19 | 0.2939 (8) | 0.1433 (7) | 0.3058 (6) | 0.0278 (16) | |
| O20 | 0.4522 (8) | 0.1175 (7) | 0.4616 (6) | 0.0308 (17) | |
| O21 | 0.5820 (8) | 0.3799 (7) | 0.5722 (6) | 0.0278 (17) | |
| O22 | 0.5004 (8) | 0.6562 (7) | −0.0030 (7) | 0.0322 (18) | |
| H22A | 0.484 (6) | 0.641 (10) | −0.074 (3) | 0.048* | |
| H22B | 0.572 (9) | 0.722 (8) | 0.045 (6) | 0.048* | |
| O23 | 0.2659 (9) | −0.1426 (8) | 0.4500 (7) | 0.039 (2) | |
| O24 | 0.5333 (8) | −0.0689 (7) | 0.3444 (7) | 0.0329 (18) | |
| O25 | 0.1090 (9) | −0.0398 (7) | 0.3744 (7) | 0.039 (2) | |
| H25A | 0.110 (4) | −0.105 (2) | 0.3192 (19) | 0.059* | |
| H25B | 0.166 (10) | 0.037 (2) | 0.392 (8) | 0.059* | |
| O26 | 0.0069 (9) | 0.5944 (8) | 0.7000 (7) | 0.0376 (19) | |
| H26A | −0.0758 | 0.6059 | 0.6943 | 0.056* | |
| H26B | −0.0175 | 0.5090 | 0.6477 | 0.056* | |
| O28 | −0.0711 (10) | 0.6370 (10) | 1.0034 (8) | 0.053 (3) | |
| H28A | −0.148 (3) | 0.585 (9) | 0.954 (3) | 0.080* | |
| H28B | −0.056 (11) | 0.635 (12) | 1.068 (7) | 0.080* | |
| O29 | 0.2535 (9) | 0.6809 (10) | 1.0510 (8) | 0.047 (2) | |
| H29A | 0.310 (7) | 0.654 (10) | 1.013 (4) | 0.070* | |
| H29B | 0.282 (10) | 0.757 (6) | 1.107 (9) | 0.070* | |
| O30 | 0.0122 (9) | 0.4225 (8) | 0.8273 (7) | 0.039 (2) | |
| H30A | 0.0498 | 0.3733 | 0.7612 | 0.058* | |
| H30B | −0.0916 | 0.3696 | 0.7900 | 0.058* | |
| O31 | 0.2749 (14) | 0.1008 (11) | 0.8572 (10) | 0.072 (3) | |
| H31A | 0.306 (13) | 0.060 (8) | 0.883 (4) | 0.107* | |
| H31B | 0.196 (6) | 0.105 (11) | 0.867 (7) | 0.107* | |
| O32 | 0.2210 (10) | −0.1857 (9) | 0.7127 (9) | 0.051 (2) | |
| H32A | 0.150 (6) | −0.252 (9) | 0.712 (13) | 0.077* | |
| H32B | 0.305 (4) | −0.174 (11) | 0.736 (14) | 0.077* | |
| O27 | 0.158 (3) | 0.860 (3) | 0.922 (2) | 0.057 (5) | 0.5 |
| H27A | 0.246 (5) | 0.904 (6) | 0.946 (10) | 0.086* | 0.5 |
| H27B | 0.113 (6) | 0.858 (6) | 0.865 (4) | 0.086* | 0.5 |
| O27B | 0.119 (3) | 0.853 (3) | 0.960 (2) | 0.057 (5) | 0.5 |
| H27C | 0.0694 | 0.8626 | 0.9158 | 0.086* | 0.5 |
| H27D | 0.2008 | 0.9067 | 0.9675 | 0.086* | 0.5 |
| O35 | 0.3779 (17) | −0.0594 (14) | 0.1911 (10) | 0.097 (5) | |
| H35A | 0.4125 | −0.0615 | 0.2488 | 0.145* | |
| H35B | 0.3375 | −0.0105 | 0.2126 | 0.145* | |
| O33 | 0.004 (6) | 0.884 (4) | 1.035 (4) | 0.057 (5) | 0.2 |
| H33A | 0.07 (5) | 0.951 (12) | 1.09 (4) | 0.086* | 0.2 |
| H33B | −0.012 (17) | 0.808 (8) | 1.027 (16) | 0.086* | 0.2 |
| O34 | −0.0162 (12) | −0.1184 (11) | 0.1541 (9) | 0.050 (3) | 0.8 |
| H34A | 0.0167 | −0.0472 | 0.2126 | 0.075* | 0.8 |
| H34B | −0.0554 | −0.1769 | 0.1746 | 0.075* | 0.8 |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| W1 | 0.0266 (2) | 0.0247 (2) | 0.0263 (2) | 0.01145 (19) | 0.00481 (18) | 0.01057 (19) |
| W2 | 0.0264 (2) | 0.0259 (2) | 0.0273 (2) | 0.01121 (19) | 0.00467 (18) | 0.01163 (19) |
| W3 | 0.0264 (2) | 0.0253 (2) | 0.0273 (2) | 0.01089 (19) | 0.00448 (18) | 0.01138 (19) |
| W4 | 0.0262 (2) | 0.0257 (2) | 0.0260 (2) | 0.01136 (19) | 0.00429 (18) | 0.01098 (19) |
| W5 | 0.0270 (2) | 0.0250 (2) | 0.0265 (2) | 0.01085 (19) | 0.00361 (18) | 0.01049 (19) |
| W6 | 0.0266 (2) | 0.0245 (2) | 0.0259 (2) | 0.01144 (19) | 0.00433 (18) | 0.01039 (19) |
| Cu1 | 0.0326 (10) | 0.0310 (10) | 0.0286 (10) | 0.0162 (9) | 0.0076 (8) | 0.0138 (8) |
| Cu2 | 0.0351 (11) | 0.0298 (10) | 0.0326 (10) | 0.0152 (9) | 0.0068 (8) | 0.0142 (9) |
| Cu3 | 0.0302 (10) | 0.0274 (10) | 0.0319 (10) | 0.0130 (8) | 0.0059 (8) | 0.0140 (8) |
| Na1 | 0.037 (3) | 0.042 (3) | 0.039 (3) | 0.019 (2) | 0.008 (2) | 0.017 (2) |
| Na2 | 0.045 (3) | 0.037 (3) | 0.052 (3) | 0.015 (2) | 0.004 (2) | 0.021 (2) |
| O1 | 0.027 (4) | 0.029 (4) | 0.031 (4) | 0.009 (3) | 0.002 (3) | 0.011 (3) |
| O2 | 0.032 (4) | 0.038 (4) | 0.032 (4) | 0.017 (4) | 0.004 (3) | 0.019 (4) |
| O3 | 0.028 (4) | 0.028 (4) | 0.028 (4) | 0.009 (3) | 0.009 (3) | 0.016 (3) |
| O4 | 0.031 (4) | 0.025 (4) | 0.035 (4) | 0.015 (3) | 0.009 (3) | 0.014 (3) |
| O5 | 0.023 (4) | 0.030 (4) | 0.030 (4) | 0.010 (3) | 0.004 (3) | 0.014 (3) |
| O6 | 0.031 (4) | 0.029 (4) | 0.036 (4) | 0.015 (3) | 0.005 (3) | 0.015 (4) |
| O7 | 0.024 (4) | 0.028 (4) | 0.029 (4) | 0.012 (3) | 0.002 (3) | 0.012 (3) |
| O8 | 0.026 (4) | 0.033 (4) | 0.026 (4) | 0.011 (3) | 0.005 (3) | 0.015 (3) |
| O9 | 0.026 (4) | 0.028 (4) | 0.021 (4) | 0.009 (3) | 0.004 (3) | 0.012 (3) |
| O10 | 0.028 (4) | 0.023 (4) | 0.030 (4) | 0.007 (3) | 0.002 (3) | 0.011 (3) |
| O11 | 0.023 (4) | 0.031 (4) | 0.031 (4) | 0.013 (3) | 0.004 (3) | 0.016 (3) |
| O12 | 0.032 (4) | 0.037 (4) | 0.029 (4) | 0.017 (4) | 0.011 (3) | 0.018 (4) |
| O13 | 0.028 (4) | 0.035 (4) | 0.029 (4) | 0.013 (3) | 0.007 (3) | 0.014 (3) |
| O14 | 0.031 (4) | 0.026 (4) | 0.030 (4) | 0.011 (3) | 0.007 (3) | 0.013 (3) |
| O15 | 0.029 (4) | 0.025 (4) | 0.030 (4) | 0.009 (3) | 0.006 (3) | 0.013 (3) |
| O16 | 0.034 (4) | 0.030 (4) | 0.020 (4) | 0.015 (3) | 0.006 (3) | 0.010 (3) |
| O17 | 0.039 (5) | 0.032 (4) | 0.028 (4) | 0.017 (4) | 0.006 (3) | 0.014 (3) |
| O18 | 0.028 (4) | 0.021 (4) | 0.029 (4) | 0.008 (3) | 0.002 (3) | 0.010 (3) |
| O19 | 0.025 (4) | 0.028 (4) | 0.032 (4) | 0.012 (3) | 0.007 (3) | 0.013 (3) |
| O20 | 0.033 (4) | 0.033 (4) | 0.030 (4) | 0.016 (4) | 0.010 (3) | 0.015 (4) |
| O21 | 0.024 (4) | 0.030 (4) | 0.025 (4) | 0.008 (3) | 0.006 (3) | 0.011 (3) |
| O22 | 0.033 (5) | 0.032 (4) | 0.029 (4) | 0.017 (4) | 0.002 (3) | 0.008 (4) |
| O23 | 0.037 (5) | 0.034 (4) | 0.040 (5) | 0.016 (4) | 0.002 (4) | 0.009 (4) |
| O24 | 0.032 (4) | 0.029 (4) | 0.034 (4) | 0.013 (4) | 0.003 (3) | 0.010 (3) |
| O25 | 0.043 (5) | 0.024 (4) | 0.042 (5) | 0.010 (4) | 0.012 (4) | 0.011 (4) |
| O26 | 0.036 (5) | 0.042 (5) | 0.038 (5) | 0.020 (4) | 0.007 (4) | 0.017 (4) |
| O28 | 0.043 (6) | 0.082 (7) | 0.036 (5) | 0.032 (5) | 0.011 (4) | 0.023 (5) |
| O29 | 0.044 (5) | 0.062 (6) | 0.045 (5) | 0.031 (5) | 0.016 (4) | 0.026 (5) |
| O30 | 0.036 (5) | 0.051 (5) | 0.029 (4) | 0.021 (4) | 0.009 (4) | 0.014 (4) |
| O31 | 0.102 (10) | 0.065 (7) | 0.054 (6) | 0.043 (7) | 0.005 (6) | 0.025 (6) |
| O32 | 0.039 (5) | 0.052 (6) | 0.070 (7) | 0.021 (5) | 0.012 (5) | 0.033 (5) |
| O27 | 0.070 (15) | 0.047 (7) | 0.062 (16) | 0.028 (10) | 0.021 (9) | 0.027 (10) |
| O27B | 0.070 (15) | 0.047 (7) | 0.062 (16) | 0.028 (10) | 0.021 (9) | 0.027 (10) |
| O35 | 0.126 (11) | 0.088 (9) | 0.065 (7) | 0.078 (8) | −0.027 (7) | −0.007 (6) |
| O33 | 0.070 (15) | 0.047 (7) | 0.062 (16) | 0.028 (10) | 0.021 (9) | 0.027 (10) |
| O34 | 0.047 (7) | 0.041 (6) | 0.030 (6) | −0.005 (5) | 0.010 (5) | 0.008 (5) |
| W1—O1 | 1.951 (7) | Cu1—O22 | 2.007 (8) |
| W1—O2 | 1.710 (8) | Cu1—O22iv | 2.007 (8) |
| W1—O3 | 1.818 (7) | Cu2—Na2 | 3.542 (6) |
| W1—O4 | 1.914 (7) | Cu2—Na2v | 3.542 (6) |
| W1—O16i | 2.067 (8) | Cu2—O20 | 1.985 (8) |
| W1—O18i | 2.260 (8) | Cu2—O20v | 1.985 (8) |
| W2—O4 | 2.230 (7) | Cu2—O23 | 2.345 (8) |
| W2—O5 | 1.730 (7) | Cu2—O23v | 2.345 (8) |
| W2—O6 | 1.762 (8) | Cu2—O24 | 1.961 (8) |
| W2—O7 | 1.917 (7) | Cu2—O24v | 1.961 (8) |
| W2—O8 | 1.884 (8) | Cu3—Na2 | 3.400 (5) |
| W2—O9 | 2.287 (7) | Cu3—Na2ii | 3.400 (5) |
| W3—Na2ii | 3.632 (5) | Cu3—O6 | 2.366 (8) |
| W3—O3 | 2.088 (7) | Cu3—O6ii | 2.366 (8) |
| W3—O8 | 1.968 (7) | Cu3—O10 | 1.918 (7) |
| W3—O9 | 2.268 (8) | Cu3—O10ii | 1.918 (7) |
| W3—O10 | 1.805 (7) | Cu3—O25ii | 2.027 (8) |
| W3—O11 | 1.888 (7) | Cu3—O25 | 2.027 (8) |
| W3—O12 | 1.730 (8) | Na1—O2 | 2.439 (9) |
| W4—O4i | 2.226 (8) | Na1—O26 | 2.376 (9) |
| W4—O7i | 1.963 (7) | Na1—O28 | 2.380 (10) |
| W4—O13 | 1.780 (7) | Na1—O29 | 2.446 (11) |
| W4—O14 | 1.747 (8) | Na1—O30 | 2.392 (10) |
| W4—O15 | 1.855 (7) | Na1—O27 | 2.41 (3) |
| W4—O21i | 2.098 (7) | Na1—O27B | 2.35 (3) |
| W5—O11 | 1.938 (7) | Na2—W3ii | 3.632 (5) |
| W5—O15 | 1.990 (7) | Na2—O6 | 2.345 (9) |
| W5—O16 | 1.882 (8) | Na2—O10ii | 2.459 (9) |
| W5—O17 | 1.718 (8) | Na2—O23 | 2.516 (10) |
| W5—O18 | 2.273 (7) | Na2—O24v | 2.432 (10) |
| W5—O19 | 1.872 (7) | Na2—O31 | 2.519 (13) |
| W6—O1i | 1.920 (8) | Na2—O32 | 2.260 (10) |
| W6—O9 | 1.872 (7) | O1—W6i | 1.920 (8) |
| W6—O18 | 2.207 (7) | O4—W4i | 2.226 (8) |
| W6—O19 | 2.103 (7) | O5—Cu1vi | 2.413 (7) |
| W6—O20 | 1.753 (8) | O7—W4i | 1.963 (7) |
| W6—O21 | 1.803 (7) | O10—Na2ii | 2.459 (9) |
| Cu1—O5iii | 2.413 (7) | O16—W1i | 2.067 (7) |
| Cu1—O5i | 2.413 (7) | O18—W1i | 2.260 (8) |
| Cu1—O13 | 1.926 (8) | O21—W4i | 2.098 (7) |
| Cu1—O13iv | 1.926 (8) | O24—Na2v | 2.432 (10) |
| O1—W1—O16i | 82.4 (3) | O24—Cu2—Na2v | 41.1 (2) |
| O1—W1—O18i | 70.2 (3) | O24v—Cu2—Na2v | 138.9 (2) |
| O2—W1—O1 | 99.5 (3) | O24v—Cu2—Na2 | 41.1 (2) |
| O2—W1—O3 | 104.1 (4) | O24—Cu2—O20 | 87.1 (3) |
| O2—W1—O4 | 102.2 (3) | O24—Cu2—O20v | 92.9 (3) |
| O2—W1—O16i | 94.8 (3) | O24v—Cu2—O20v | 87.1 (3) |
| O2—W1—O18i | 164.6 (3) | O24v—Cu2—O20 | 92.9 (3) |
| O3—W1—O1 | 93.2 (3) | O24—Cu2—O23 | 93.9 (3) |
| O3—W1—O4 | 94.1 (3) | O24v—Cu2—O23v | 93.9 (3) |
| O3—W1—O16i | 161.1 (3) | O24—Cu2—O23v | 86.1 (3) |
| O3—W1—O18i | 88.3 (3) | O24v—Cu2—O23 | 86.1 (3) |
| O4—W1—O1 | 154.6 (3) | O24v—Cu2—O24 | 180.0 |
| O4—W1—O16i | 82.8 (3) | Na2—Cu3—Na2ii | 180.0 |
| O4—W1—O18i | 85.7 (3) | O6ii—Cu3—Na2ii | 43.6 (2) |
| O16i—W1—O18i | 72.9 (3) | O6—Cu3—Na2 | 43.6 (2) |
| O4—W2—O9 | 77.3 (3) | O6—Cu3—Na2ii | 136.4 (2) |
| O5—W2—O4 | 91.7 (3) | O6ii—Cu3—Na2 | 136.4 (2) |
| O5—W2—O6 | 105.6 (3) | O6—Cu3—O6ii | 180.0 (3) |
| O5—W2—O7 | 98.5 (3) | O10—Cu3—Na2 | 134.8 (2) |
| O5—W2—O8 | 98.8 (3) | O10—Cu3—Na2ii | 45.2 (2) |
| O5—W2—O9 | 167.4 (3) | O10ii—Cu3—Na2ii | 134.8 (2) |
| O6—W2—O4 | 161.2 (3) | O10ii—Cu3—Na2 | 45.2 (2) |
| O6—W2—O7 | 96.2 (3) | O10ii—Cu3—O6 | 86.7 (3) |
| O6—W2—O8 | 99.2 (3) | O10ii—Cu3—O6ii | 93.3 (3) |
| O6—W2—O9 | 86.2 (3) | O10—Cu3—O6 | 93.3 (3) |
| O7—W2—O4 | 73.6 (3) | O10—Cu3—O6ii | 86.7 (3) |
| O7—W2—O9 | 84.4 (3) | O10—Cu3—O10ii | 180.0 |
| O8—W2—O4 | 85.1 (3) | O10—Cu3—O25 | 89.1 (3) |
| O8—W2—O7 | 152.8 (3) | O10—Cu3—O25ii | 90.9 (3) |
| O8—W2—O9 | 74.4 (3) | O10ii—Cu3—O25 | 90.9 (3) |
| O3—W3—Na2ii | 159.2 (2) | O10ii—Cu3—O25ii | 89.1 (3) |
| O3—W3—O9 | 76.3 (3) | O25—Cu3—Na2 | 85.0 (3) |
| O8—W3—Na2ii | 115.9 (2) | O25ii—Cu3—Na2ii | 85.0 (3) |
| O8—W3—O3 | 79.4 (3) | O25—Cu3—Na2ii | 95.0 (3) |
| O8—W3—O9 | 73.4 (3) | O25ii—Cu3—Na2 | 95.0 (3) |
| O9—W3—Na2ii | 120.3 (2) | O25ii—Cu3—O6ii | 96.9 (3) |
| O10—W3—Na2ii | 37.5 (3) | O25ii—Cu3—O6 | 83.1 (3) |
| O10—W3—O3 | 163.0 (3) | O25—Cu3—O6 | 96.9 (3) |
| O10—W3—O8 | 90.7 (3) | O25—Cu3—O6ii | 83.1 (3) |
| O10—W3—O9 | 87.7 (3) | O25—Cu3—O25ii | 180.0 (4) |
| O10—W3—O11 | 97.4 (3) | O2—Na1—O29 | 81.7 (3) |
| O11—W3—Na2ii | 82.2 (2) | O26—Na1—O2 | 80.5 (3) |
| O11—W3—O3 | 87.2 (3) | O26—Na1—O28 | 111.0 (4) |
| O11—W3—O8 | 157.1 (3) | O26—Na1—O29 | 161.9 (4) |
| O11—W3—O9 | 85.5 (3) | O26—Na1—O30 | 86.2 (3) |
| O12—W3—Na2ii | 71.8 (3) | O26—Na1—O27 | 84.4 (8) |
| O12—W3—O3 | 93.1 (3) | O28—Na1—O2 | 165.5 (4) |
| O12—W3—O8 | 97.5 (3) | O28—Na1—O29 | 86.1 (3) |
| O12—W3—O9 | 167.0 (3) | O28—Na1—O30 | 84.9 (4) |
| O12—W3—O10 | 101.9 (4) | O28—Na1—O27 | 94.3 (6) |
| O12—W3—O11 | 101.7 (3) | O30—Na1—O2 | 87.1 (3) |
| O7i—W4—O4i | 72.8 (3) | O30—Na1—O29 | 89.7 (4) |
| O7i—W4—O21i | 79.7 (3) | O30—Na1—O27 | 169.6 (9) |
| O13—W4—O4i | 88.2 (3) | O27—Na1—O2 | 95.8 (7) |
| O13—W4—O7i | 91.2 (3) | O27—Na1—O29 | 100.6 (9) |
| O13—W4—O15 | 98.3 (3) | O27B—Na1—O2 | 110.2 (7) |
| O13—W4—O21i | 164.6 (3) | O27B—Na1—O26 | 92.8 (8) |
| O14—W4—O4i | 164.9 (3) | O27B—Na1—O28 | 78.9 (6) |
| O14—W4—O7i | 95.4 (3) | O27B—Na1—O29 | 96.3 (9) |
| O14—W4—O13 | 101.8 (3) | O27B—Na1—O30 | 162.2 (8) |
| O14—W4—O15 | 101.3 (3) | Cu2—Na2—W3ii | 118.32 (15) |
| O14—W4—O21i | 91.5 (3) | Cu3—Na2—W3ii | 60.12 (9) |
| O15—W4—O4i | 88.2 (3) | Cu3—Na2—Cu2 | 100.18 (13) |
| O15—W4—O7i | 158.6 (3) | O6—Na2—W3ii | 101.7 (3) |
| O15—W4—O21i | 86.6 (3) | O6—Na2—Cu2 | 93.5 (2) |
| O21i—W4—O4i | 77.3 (3) | O6—Na2—Cu3 | 44.0 (2) |
| O11—W5—O15 | 81.1 (3) | O6—Na2—O10ii | 76.0 (3) |
| O11—W5—O18 | 80.1 (3) | O6—Na2—O23 | 102.4 (3) |
| O15—W5—O18 | 80.2 (3) | O6—Na2—O24v | 87.4 (3) |
| O16—W5—O11 | 154.7 (3) | O6—Na2—O31 | 76.2 (4) |
| O16—W5—O15 | 86.7 (3) | O10ii—Na2—W3ii | 26.54 (17) |
| O16—W5—O18 | 76.0 (3) | O10ii—Na2—Cu2 | 113.4 (2) |
| O17—W5—O11 | 100.9 (3) | O10ii—Na2—Cu3 | 33.59 (18) |
| O17—W5—O15 | 101.6 (3) | O10ii—Na2—O23 | 76.4 (3) |
| O17—W5—O16 | 103.2 (3) | O10ii—Na2—O31 | 123.3 (4) |
| O17—W5—O18 | 178.1 (3) | O23—Na2—W3ii | 77.0 (2) |
| O17—W5—O19 | 102.1 (3) | O23—Na2—Cu2 | 41.4 (2) |
| O19—W5—O11 | 89.2 (3) | O23—Na2—Cu3 | 79.5 (2) |
| O19—W5—O15 | 155.7 (3) | O23—Na2—O31 | 158.1 (4) |
| O19—W5—O16 | 93.1 (3) | O24v—Na2—W3ii | 150.1 (3) |
| O19—W5—O18 | 76.2 (3) | O24v—Na2—Cu2 | 32.0 (2) |
| O1i—W6—O18 | 72.0 (3) | O24v—Na2—Cu3 | 115.8 (2) |
| O1i—W6—O19 | 81.2 (3) | O24v—Na2—O10ii | 141.2 (3) |
| O9—W6—O1i | 154.3 (3) | O24v—Na2—O23 | 73.3 (3) |
| O9—W6—O18 | 84.3 (3) | O24v—Na2—O31 | 84.8 (4) |
| O9—W6—O19 | 82.9 (3) | O31—Na2—W3ii | 125.0 (4) |
| O19—W6—O18 | 73.4 (3) | O31—Na2—Cu2 | 116.7 (4) |
| O20—W6—O1i | 100.5 (3) | O31—Na2—Cu3 | 111.2 (3) |
| O20—W6—O9 | 100.5 (3) | O32—Na2—W3ii | 80.5 (3) |
| O20—W6—O18 | 166.0 (3) | O32—Na2—Cu2 | 106.6 (3) |
| O20—W6—O19 | 94.0 (3) | O32—Na2—Cu3 | 139.6 (3) |
| O20—W6—O21 | 102.8 (4) | O32—Na2—O6 | 156.0 (4) |
| O21—W6—O1i | 93.7 (3) | O32—Na2—O10ii | 106.6 (4) |
| O21—W6—O9 | 95.7 (3) | O32—Na2—O23 | 101.3 (4) |
| O21—W6—O18 | 89.6 (3) | O32—Na2—O24v | 102.6 (4) |
| O21—W6—O19 | 163.0 (3) | O32—Na2—O31 | 83.0 (4) |
| O5i—Cu1—O5iii | 180.0 (4) | W6i—O1—W1 | 119.2 (4) |
| O13iv—Cu1—O5iii | 95.3 (3) | W1—O2—Na1 | 165.1 (4) |
| O13—Cu1—O5iii | 84.7 (3) | W1—O3—W3 | 138.3 (4) |
| O13—Cu1—O5i | 95.3 (3) | W1—O4—W2 | 124.5 (4) |
| O13iv—Cu1—O5i | 84.7 (3) | W1—O4—W4i | 138.3 (4) |
| O13—Cu1—O13iv | 180.0 | W4i—O4—W2 | 95.7 (3) |
| O13iv—Cu1—O22iv | 89.8 (3) | W2—O5—Cu1vi | 124.8 (4) |
| O13—Cu1—O22iv | 90.2 (3) | W2—O6—Cu3 | 128.5 (4) |
| O13iv—Cu1—O22 | 90.2 (3) | W2—O6—Na2 | 136.6 (4) |
| O13—Cu1—O22 | 89.8 (3) | Na2—O6—Cu3 | 92.4 (3) |
| O22—Cu1—O5iii | 96.7 (3) | W2—O7—W4i | 116.8 (4) |
| O22iv—Cu1—O5i | 96.7 (3) | W2—O8—W3 | 118.1 (4) |
| O22—Cu1—O5i | 83.3 (3) | W3—O9—W2 | 93.0 (3) |
| O22iv—Cu1—O5iii | 83.3 (3) | W6—O9—W2 | 124.6 (4) |
| O22—Cu1—O22iv | 180.0 | W6—O9—W3 | 140.5 (4) |
| Na2v—Cu2—Na2 | 180.0 | W3—O10—Cu3 | 142.8 (4) |
| O20—Cu2—Na2v | 89.6 (2) | W3—O10—Na2ii | 116.0 (4) |
| O20—Cu2—Na2 | 90.4 (2) | Cu3—O10—Na2ii | 101.2 (3) |
| O20v—Cu2—Na2v | 90.4 (2) | W3—O11—W5 | 147.9 (4) |
| O20v—Cu2—Na2 | 89.6 (2) | W4—O13—Cu1 | 141.2 (5) |
| O20—Cu2—O20v | 180.00 (15) | W4—O15—W5 | 147.1 (4) |
| O20—Cu2—O23 | 90.5 (3) | W5—O16—W1i | 115.9 (3) |
| O20—Cu2—O23v | 89.5 (3) | W1i—O18—W5 | 95.2 (3) |
| O20v—Cu2—O23 | 89.5 (3) | W6—O18—W1i | 96.7 (3) |
| O20v—Cu2—O23v | 90.5 (3) | W6—O18—W5 | 96.3 (3) |
| O23v—Cu2—Na2v | 45.2 (2) | W5—O19—W6 | 114.1 (4) |
| O23v—Cu2—Na2 | 134.8 (2) | W6—O20—Cu2 | 165.2 (5) |
| O23—Cu2—Na2 | 45.2 (2) | W6—O21—W4i | 138.5 (4) |
| O23—Cu2—Na2v | 134.8 (2) | Cu2—O23—Na2 | 93.5 (3) |
| O23v—Cu2—O23 | 180.0 | Cu2—O24—Na2v | 107.0 (4) |
| O24—Cu2—Na2 | 138.9 (2) |
| Symmetry codes: (i) −x+1, −y+1, −z+1; (ii) −x, −y, −z+1; (iii) x, y, z−1; (iv) −x+1, −y+1, −z; (v) −x+1, −y, −z+1; (vi) x, y, z+1. |
| Na5Fe2.5[W12O40(OH)2]·36H2O | Z = 2 |
| Mr = 3771.27 | F(000) = 3388 |
| Triclinic, P1 | Dx = 3.708 Mg m−3 |
| a = 12.3758 (6) Å | Mo Kα radiation, λ = 0.71073 Å |
| b = 14.7752 (7) Å | Cell parameters from 9822 reflections |
| c = 18.8919 (8) Å | θ = 2.2–25.5° |
| α = 92.9341 (14)° | µ = 21.02 mm−1 |
| β = 100.6938 (14)° | T = 100 K |
| γ = 94.1698 (15)° | Needle, clear light orange |
| V = 3378.1 (3) Å3 | 0.37 × 0.07 × 0.04 mm |
| Bruker D8 Venture diffractometer | 10876 reflections with I > 2σ(I) |
| Radiation source: sealed xray tube, Incoatec IuS | Rint = 0.032 |
| φ and ω scans | θmax = 25.4°, θmin = 2.3° |
| Absorption correction: multi-scan (SADABS; Bruker, 2016) | h = −14→14 |
| Tmin = 0.012, Tmax = 0.044 | k = −17→17 |
| 38068 measured reflections | l = −22→22 |
| 12318 independent reflections |
| Refinement on F2 | Hydrogen site location: difference Fourier map |
| Least-squares matrix: full | H atoms treated by a mixture of independent and constrained refinement |
| R[F2 > 2σ(F2)] = 0.022 | w = 1/[σ2(Fo2) + (0.0176P)2 + 7.2977P] where P = (Fo2 + 2Fc2)/3 |
| wR(F2) = 0.058 | (Δ/σ)max = 0.005 |
| S = 1.09 | Δρmax = 1.57 e Å−3 |
| 12318 reflections | Δρmin = −1.25 e Å−3 |
| 980 parameters | Extinction correction: SHELXL2016 (Sheldrick, 2016), Fc*=kFc[1+0.001xFc2λ3/sin(2θ)]-1/4 |
| 405 restraints | Extinction coefficient: 0.000312 (12) |
Geometry. All esds (except the esd in the dihedral angle between two l.s. planes) are estimated using the full covariance matrix. The cell esds are taken into account individually in the estimation of esds in distances, angles and torsion angles; correlations between esds in cell parameters are only used when they are defined by crystal symmetry. An approximate (isotropic) treatment of cell esds is used for estimating esds involving l.s. planes. |
Refinement. _olex2_refinement_description 1. Fixed Uiso At 1.5 times of: All O(H,H) groups 2. Restrained distances H64A-H61B_$1 2.2 with sigma of 0.02 H59B-H63B 2.2 with sigma of 0.02 H63B_$2-H71A 2.2 with sigma of 0.02 H71A-H63B_$2 2.2 with sigma of 0.05 H49B-Na1 2.7 with sigma of 0.01 H51B-O35_$4 2.3 with sigma of 0.04 H51A-H51B 1.41 with sigma of 0.01 O51-H51A = O51-H51B 0.87 with sigma of 0.01 H52A-Na3 2.7 with sigma of 0.01 O52-H52B = O52-H52A 0.87 with sigma of 0.01 H52A-H52B 1.41 with sigma of 0.01 H53A-O36 2 with sigma of 0.04 H53A-H53B 1.41 with sigma of 0.01 O53-H53A = O53-H53B 0.87 with sigma of 0.01 H77B-H28A 2.2 with sigma of 0.02 H77A-H28A 2.2 with sigma of 0.02 O77-H77A = O77-H77B = O28-H28B = O28-H28A 0.87 with sigma of 0.01 H77A-H77B = H28B-H28A 1.41 with sigma of 0.01 H49B-Na2 2.7 with sigma of 0.01 Na2-H49A 2.7 with sigma of 0.02 O50-H50A ~ O50-H50B ~ O51-H51A ~ O51-H51B ~ O48-H48A ~ O48-H48B ~ O47-H47B O47-H47A ~ O65-H65B ~ O65-H65A ~ O64-H64A ~ O64-H64B ~ O74-H74A ~ O74-H74B O63-H63A ~ O63-H63B ~ O60-H60B ~ O60-H60A ~ O167-H16B ~ O167-H16A ~ O67-H67B O67-H67A ~ O27-H27B ~ O27-H27A ~ O28-H28A ~ O28-H28B ~ O77-H77A ~ O77-H77B with sigma of 0.02 3. Others Fixed Sof: O66(0.5) O67(0.5) H67A(0.5) H67B(0.5) O166(0.5) O167(0.5) H16A(0.5) H16B(0.5) 4.a Free rotating group: O49(H49A,H49B), O62(H62A,H62B), O57(H57A,H57B), O68(H68A,H68B), O69(H69A, H69B), O70(H70A,H70B), O71(H71A,H71B), O72(H72A,H72B), O73(H73A,H73B) 4.b Rotating group: O22(H22A,H22B), O23(H23A,H23B), O24(H24A,H24B), O27(H27A,H27B), O29(H29A, H29B), O47(H47A,H47B), O48(H48A,H48B), O50(H50A,H50B), O54(H54A,H54B), O55(H55A,H55B), O56(H56A,H56B), O58(H58A,H58B), O59(H59A,H59B), O60(H60A,H60B), O61(H61A,H61B), O63(H63A,H63B), O64(H64A,H64B), O65(H65A,H65B), O74(H74A, H74B), O67(H67A,H67B), O167(H16A,H16B) |
| x | y | z | Uiso*/Ueq | Occ. (<1) | |
| W1 | 0.43982 (2) | 0.96245 (2) | 1.17681 (2) | 0.01193 (6) | |
| W2 | 0.25947 (2) | 0.81700 (2) | 1.03223 (2) | 0.01230 (6) | |
| W3 | 0.39839 (2) | 0.69804 (2) | 0.93379 (2) | 0.01231 (6) | |
| W4 | 0.61176 (2) | 0.80885 (2) | 0.88516 (2) | 0.01207 (6) | |
| W5 | 0.34632 (2) | 0.93167 (2) | 0.87838 (2) | 0.01145 (5) | |
| W6 | 0.41877 (2) | 1.15417 (2) | 0.92471 (2) | 0.01161 (6) | |
| W7 | 0.09965 (2) | 0.79501 (2) | 0.57766 (2) | 0.01183 (6) | |
| W8 | 0.24036 (2) | 0.68517 (2) | 0.47575 (2) | 0.01201 (6) | |
| W9 | 0.15423 (2) | 0.56265 (2) | 0.62612 (2) | 0.01127 (5) | |
| W10 | 0.08150 (2) | 0.34469 (2) | 0.56793 (2) | 0.01140 (6) | |
| W11 | −0.06153 (2) | 0.45282 (2) | 0.67587 (2) | 0.01177 (6) | |
| W12 | −0.11444 (2) | 0.68342 (2) | 0.62245 (2) | 0.01181 (6) | |
| Fe1 | 0.000000 | 1.000000 | 0.500000 | 0.0146 (2) | |
| Fe2 | 0.07450 (6) | 0.82233 (5) | 0.76386 (4) | 0.01358 (16) | |
| Fe3 | 0.42245 (6) | 0.66855 (5) | 0.74623 (4) | 0.01375 (16) | |
| Na1 | 0.500000 | 0.000000 | 0.500000 | 0.0205 (7) | |
| Na2 | 0.28394 (19) | 0.13921 (14) | 0.60840 (11) | 0.0213 (5) | |
| Na3 | 0.50905 (19) | 0.63218 (14) | 0.41748 (11) | 0.0193 (5) | |
| Na4 | −0.00109 (19) | 1.11946 (14) | 0.90833 (12) | 0.0205 (5) | |
| Na5 | 0.19312 (19) | 1.34276 (14) | 0.89244 (12) | 0.0216 (5) | |
| Na6 | 0.000000 | 1.500000 | 1.000000 | 0.0270 (7) | |
| O75 | 0.1001 (3) | 0.8950 (2) | 0.53226 (19) | 0.0156 (8) | |
| O77 | 0.0108 (3) | 1.0403 (3) | 0.6088 (2) | 0.0216 (9) | |
| H77A | −0.022 (3) | 1.079 (2) | 0.634 (2) | 0.032* | |
| H77B | 0.0826 (10) | 1.056 (3) | 0.6221 (19) | 0.032* | |
| O1 | 0.3979 (3) | 0.9495 (2) | 1.25833 (19) | 0.0168 (8) | |
| O78 | −0.2529 (3) | 0.7055 (2) | 0.60234 (19) | 0.0157 (8) | |
| O2 | 0.5723 (3) | 1.0360 (2) | 1.20459 (19) | 0.0141 (8) | |
| O76 | 0.1546 (3) | 1.0778 (2) | 0.49860 (19) | 0.0167 (8) | |
| O3 | 0.5139 (3) | 0.8592 (2) | 1.16577 (18) | 0.0141 (8) | |
| O4 | 0.3706 (3) | 1.0748 (2) | 1.14768 (19) | 0.0149 (8) | |
| O5 | 0.5025 (3) | 0.9800 (2) | 1.07220 (18) | 0.0127 (7) | |
| O6 | 0.3153 (3) | 0.9044 (2) | 1.10875 (19) | 0.0137 (8) | |
| O7 | 0.2386 (3) | 0.7250 (2) | 1.08414 (19) | 0.0177 (8) | |
| O8 | 0.4370 (3) | 0.7922 (2) | 1.03049 (18) | 0.0138 (8) | |
| O9 | 0.3135 (3) | 0.9243 (2) | 0.96673 (19) | 0.0144 (8) | |
| O10 | 0.1258 (3) | 0.8510 (2) | 1.00611 (19) | 0.0162 (8) | |
| O11 | 0.2618 (3) | 0.7439 (2) | 0.94416 (18) | 0.0140 (8) | |
| O12 | 0.3941 (3) | 0.6005 (2) | 0.98167 (19) | 0.0165 (8) | |
| O13 | 0.5521 (3) | 0.7084 (2) | 0.93601 (19) | 0.0145 (8) | |
| O14 | 0.3535 (3) | 0.6564 (2) | 0.84180 (18) | 0.0142 (8) | |
| O15 | 0.7498 (3) | 0.7843 (2) | 0.90512 (19) | 0.0163 (8) | |
| O16 | 0.5632 (3) | 0.7473 (2) | 0.80024 (19) | 0.0154 (8) | |
| O17 | 0.4373 (3) | 0.8345 (2) | 0.88711 (19) | 0.0148 (8) | |
| O18 | 0.3123 (3) | 1.0590 (2) | 0.87348 (18) | 0.0135 (7) | |
| O19 | 0.2265 (3) | 0.8848 (2) | 0.82087 (19) | 0.0157 (8) | |
| O20 | 0.3779 (3) | 1.1284 (2) | 1.00996 (18) | 0.0135 (8) | |
| O21 | 0.3490 (3) | 1.2486 (2) | 0.90007 (19) | 0.0162 (8) | |
| O22 | 0.4906 (3) | 0.5437 (2) | 0.7766 (2) | 0.0176 (8) | |
| H22A | 0.471921 | 0.525896 | 0.818159 | 0.026* | |
| H22B | 0.565119 | 0.549590 | 0.783409 | 0.026* | |
| O23 | 0.4817 (3) | 0.6504 (2) | 0.6488 (2) | 0.0189 (8) | |
| H23A | 0.534097 | 0.610923 | 0.653309 | 0.028* | |
| H23B | 0.511449 | 0.703254 | 0.636478 | 0.028* | |
| O24 | 0.3712 (3) | 0.7970 (2) | 0.71232 (19) | 0.0170 (8) | |
| H24A | 0.400970 | 0.812752 | 0.674860 | 0.026* | |
| H24B | 0.392232 | 0.840087 | 0.747703 | 0.026* | |
| O25 | 0.2710 (3) | 0.6072 (2) | 0.68784 (19) | 0.0145 (8) | |
| O26 | 0.1417 (3) | 0.8342 (2) | 0.67012 (19) | 0.0163 (8) | |
| O27 | 0.0118 (3) | 0.8350 (2) | 0.85913 (19) | 0.0175 (8) | |
| H27A | −0.019350 | 0.780861 | 0.870617 | 0.026* | |
| H27B | −0.041858 | 0.874914 | 0.855558 | 0.026* | |
| O28 | 0.0044 (3) | 0.9491 (2) | 0.73617 (19) | 0.0171 (8) | |
| H28A | 0.025 (4) | 0.961 (3) | 0.6950 (14) | 0.026* | |
| H28B | 0.025 (5) | 0.999 (2) | 0.7650 (19) | 0.026* | |
| O29 | 0.1294 (3) | 0.6937 (2) | 0.7944 (2) | 0.0171 (8) | |
| H29A | 0.120845 | 0.654521 | 0.755798 | 0.026* | |
| H29B | 0.090838 | 0.670087 | 0.825449 | 0.026* | |
| O30 | −0.0686 (3) | 0.7429 (2) | 0.70806 (19) | 0.0173 (8) | |
| O31 | −0.0565 (3) | 0.7844 (2) | 0.57317 (19) | 0.0130 (7) | |
| O32 | 0.0612 (3) | 0.6594 (2) | 0.62006 (19) | 0.0152 (8) | |
| O33 | 0.0626 (3) | 0.7070 (2) | 0.47893 (19) | 0.0138 (8) | |
| O34 | 0.1905 (3) | 0.5774 (2) | 0.53939 (19) | 0.0158 (8) | |
| O35 | 0.2371 (3) | 0.7542 (2) | 0.56669 (18) | 0.0149 (8) | |
| O36 | 0.2569 (3) | 0.7839 (2) | 0.42933 (19) | 0.0150 (8) | |
| O37 | 0.3757 (3) | 0.6545 (2) | 0.49892 (19) | 0.0163 (8) | |
| O38 | −0.1295 (3) | 0.5646 (2) | 0.65250 (19) | 0.0146 (8) | |
| O39 | −0.1851 (3) | 0.3951 (2) | 0.60394 (19) | 0.0137 (7) | |
| O40 | −0.1030 (3) | 0.4288 (2) | 0.7553 (2) | 0.0177 (8) | |
| O41 | 0.0140 (3) | 0.3492 (2) | 0.65924 (18) | 0.0134 (7) | |
| O42 | 0.0032 (3) | 0.4785 (2) | 0.57249 (18) | 0.0134 (8) | |
| O43 | 0.0721 (3) | 0.5233 (2) | 0.70755 (19) | 0.0143 (8) | |
| O44 | −0.1231 (3) | 0.6218 (2) | 0.51595 (18) | 0.0128 (7) | |
| O45 | 0.1879 (3) | 0.4362 (2) | 0.62501 (18) | 0.0134 (7) | |
| O46 | 0.1513 (3) | 0.2498 (2) | 0.58872 (19) | 0.0157 (8) | |
| O47 | 0.3478 (3) | 0.2254 (2) | 0.7211 (2) | 0.0203 (9) | |
| H47A | 0.376148 | 0.281108 | 0.714149 | 0.030* | |
| H47B | 0.400373 | 0.197678 | 0.748989 | 0.030* | |
| O48 | 0.2635 (4) | 0.0174 (3) | 0.6787 (2) | 0.0340 (11) | |
| H48A | 0.329102 | 0.003969 | 0.702825 | 0.051* | |
| H48B | 0.232193 | −0.032050 | 0.651118 | 0.051* | |
| O49 | 0.4680 (4) | 0.0895 (3) | 0.6048 (2) | 0.0229 (9) | |
| H49A | 0.505130 | 0.135577 | 0.631042 | 0.034* | |
| H49B | 0.466632 | 0.046477 | 0.634452 | 0.034* | |
| O50 | 0.7003 (3) | 0.0214 (2) | 0.5578 (2) | 0.0216 (9) | |
| H50A | 0.709887 | 0.009412 | 0.604986 | 0.032* | |
| H50B | 0.727030 | 0.080448 | 0.559699 | 0.032* | |
| O51 | 0.5203 (4) | 0.1320 (3) | 0.4330 (2) | 0.0265 (9) | |
| H51A | 0.478 (4) | 0.139 (4) | 0.3902 (16) | 0.040* | |
| H51B | 0.5888 (17) | 0.150 (4) | 0.427 (3) | 0.040* | |
| O52 | 0.6197 (4) | 0.7649 (2) | 0.4778 (2) | 0.0215 (9) | |
| H52A | 0.663 (3) | 0.7394 (10) | 0.5110 (18) | 0.032* | |
| H52B | 0.577 (4) | 0.797 (4) | 0.499 (2) | 0.032* | |
| O53 | 0.4156 (3) | 0.7413 (3) | 0.3450 (2) | 0.0232 (9) | |
| H53A | 0.355 (2) | 0.745 (4) | 0.362 (2) | 0.035* | |
| H53B | 0.397 (4) | 0.728 (4) | 0.2988 (8) | 0.035* | |
| O54 | 0.6019 (3) | 0.6050 (2) | 0.32011 (19) | 0.0185 (8) | |
| H54A | 0.569316 | 0.556728 | 0.292040 | 0.028* | |
| H54B | 0.671969 | 0.594865 | 0.336455 | 0.028* | |
| O55 | 0.6443 (3) | 0.5476 (2) | 0.4892 (2) | 0.0193 (8) | |
| H55A | 0.713115 | 0.572858 | 0.490711 | 0.029* | |
| H55B | 0.640827 | 0.489651 | 0.470739 | 0.029* | |
| O56 | 0.4026 (3) | 0.4899 (2) | 0.3769 (2) | 0.0205 (8) | |
| H56A | 0.351594 | 0.497092 | 0.338263 | 0.031* | |
| H56B | 0.369101 | 0.469394 | 0.411358 | 0.031* | |
| O58 | 0.1426 (3) | 1.0451 (2) | 0.9812 (2) | 0.0220 (9) | |
| H58A | 0.208095 | 1.069437 | 0.976634 | 0.033* | |
| H58B | 0.137172 | 0.986597 | 0.967312 | 0.033* | |
| O59 | 0.1030 (3) | 1.0982 (2) | 0.8154 (2) | 0.0196 (8) | |
| H59A | 0.172924 | 1.082290 | 0.833307 | 0.029* | |
| H59B | 0.111317 | 1.150360 | 0.791637 | 0.029* | |
| O60 | −0.1092 (3) | 0.9738 (2) | 0.8820 (2) | 0.0231 (9) | |
| H60A | −0.166090 | 0.977993 | 0.846658 | 0.035* | |
| H60B | −0.134022 | 0.956833 | 0.920654 | 0.035* | |
| O61 | 0.3140 (3) | 1.4191 (2) | 0.9940 (2) | 0.0229 (9) | |
| H61A | 0.369086 | 1.458527 | 0.980717 | 0.034* | |
| H61B | 0.352070 | 1.378925 | 1.025227 | 0.034* | |
| O62 | 0.1017 (4) | 1.2528 (3) | 0.9709 (2) | 0.0218 (9) | |
| H62A | 0.145760 | 1.229523 | 1.005333 | 0.033* | |
| H62B | 0.060640 | 1.285112 | 0.993112 | 0.033* | |
| O63 | 0.1595 (3) | 1.2692 (2) | 0.7723 (2) | 0.0204 (8) | |
| H63A | 0.214911 | 1.286341 | 0.744070 | 0.031* | |
| H63B | 0.090044 | 1.282058 | 0.742511 | 0.031* | |
| O64 | −0.1812 (4) | 1.4738 (3) | 0.9349 (2) | 0.0286 (10) | |
| H64A | −0.234836 | 1.515714 | 0.949155 | 0.043* | |
| H64B | −0.218263 | 1.412264 | 0.938246 | 0.043* | |
| O65 | −0.0222 (4) | 1.3617 (3) | 1.0594 (2) | 0.0269 (9) | |
| H65A | −0.092383 | 1.350512 | 1.064955 | 0.040* | |
| H65B | 0.021278 | 1.365054 | 1.103450 | 0.040* | |
| O74 | 0.2373 (4) | 1.4742 (3) | 0.8282 (2) | 0.0339 (11) | |
| H74A | 0.277054 | 1.459042 | 0.795994 | 0.051* | |
| H74B | 0.275256 | 1.516954 | 0.859008 | 0.051* | |
| O66 | 0.0455 (9) | 1.4372 (6) | 0.8932 (6) | 0.025 (2) | 0.5 |
| O67 | −0.0980 (10) | 1.2057 (8) | 0.8245 (6) | 0.040 (3) | 0.5 |
| H67A | −0.172297 | 1.223060 | 0.834440 | 0.061* | 0.5 |
| H67B | −0.118922 | 1.176966 | 0.772875 | 0.061* | 0.5 |
| O166 | 0.0109 (11) | 1.3927 (8) | 0.8881 (6) | 0.036 (3) | 0.5 |
| O167 | −0.1337 (10) | 1.1537 (9) | 0.8069 (7) | 0.047 (3) | 0.5 |
| H16A | −0.120091 | 1.218036 | 0.783218 | 0.070* | 0.5 |
| H16B | −0.219353 | 1.157915 | 0.813213 | 0.070* | 0.5 |
| O57 | 0.3650 (4) | 0.6621 (3) | 0.2063 (2) | 0.0269 (9) | |
| H57A | 0.426675 | 0.650088 | 0.193605 | 0.040* | |
| H57B | 0.322656 | 0.684798 | 0.170648 | 0.040* | |
| O68 | 0.8504 (4) | 0.6607 (2) | 0.8242 (2) | 0.0222 (9) | |
| H68A | 0.874753 | 0.686576 | 0.789231 | 0.033* | |
| H68B | 0.811052 | 0.697443 | 0.843819 | 0.033* | |
| O69 | 0.6958 (3) | 0.5233 (3) | 0.7662 (2) | 0.0230 (9) | |
| H69A | 0.706601 | 0.467755 | 0.777240 | 0.034* | |
| H69B | 0.749060 | 0.560225 | 0.790897 | 0.034* | |
| O70 | 0.4874 (4) | 0.4128 (3) | 0.8762 (2) | 0.0258 (9) | |
| H70A | 0.526630 | 0.411288 | 0.919288 | 0.039* | |
| H70B | 0.422232 | 0.385367 | 0.874613 | 0.039* | |
| O71 | 0.9183 (3) | 0.1787 (2) | 0.6740 (2) | 0.0227 (9) | |
| H71A | 0.945097 | 0.231566 | 0.664001 | 0.034* | |
| H71B | 0.851249 | 0.167453 | 0.649725 | 0.034* | |
| O72 | 0.7852 (4) | 0.9728 (3) | 0.7021 (2) | 0.0282 (10) | |
| H72A | 0.741468 | 0.923175 | 0.697101 | 0.042* | |
| H72B | 0.751210 | 1.018193 | 0.715589 | 0.042* | |
| O73 | 0.6434 (4) | 0.8229 (2) | 0.6820 (2) | 0.0211 (9) | |
| H73A | 0.614540 | 0.802804 | 0.717447 | 0.032* | |
| H73B | 0.681198 | 0.781510 | 0.666241 | 0.032* |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| W1 | 0.01172 (12) | 0.01254 (10) | 0.01175 (11) | 0.00075 (8) | 0.00268 (8) | 0.00154 (8) |
| W2 | 0.01205 (12) | 0.01225 (10) | 0.01259 (11) | 0.00030 (8) | 0.00248 (8) | 0.00132 (8) |
| W3 | 0.01267 (12) | 0.01148 (10) | 0.01268 (11) | 0.00047 (8) | 0.00234 (8) | 0.00094 (8) |
| W4 | 0.01198 (12) | 0.01195 (10) | 0.01232 (11) | 0.00099 (8) | 0.00236 (8) | 0.00104 (8) |
| W5 | 0.01123 (12) | 0.01134 (10) | 0.01177 (10) | 0.00078 (8) | 0.00211 (8) | 0.00128 (8) |
| W6 | 0.01164 (12) | 0.01129 (10) | 0.01178 (10) | 0.00095 (8) | 0.00183 (8) | 0.00125 (8) |
| W7 | 0.01197 (12) | 0.01111 (10) | 0.01233 (10) | 0.00082 (8) | 0.00213 (8) | 0.00099 (8) |
| W8 | 0.01164 (12) | 0.01182 (10) | 0.01258 (11) | 0.00048 (8) | 0.00245 (8) | 0.00124 (8) |
| W9 | 0.01105 (12) | 0.01091 (10) | 0.01184 (10) | 0.00080 (8) | 0.00205 (8) | 0.00127 (8) |
| W10 | 0.01133 (12) | 0.01107 (10) | 0.01177 (10) | 0.00089 (8) | 0.00202 (8) | 0.00114 (8) |
| W11 | 0.01170 (12) | 0.01198 (10) | 0.01187 (11) | 0.00078 (8) | 0.00277 (8) | 0.00146 (8) |
| W12 | 0.01179 (12) | 0.01161 (10) | 0.01209 (11) | 0.00098 (8) | 0.00230 (8) | 0.00121 (8) |
| Fe1 | 0.0158 (6) | 0.0140 (5) | 0.0141 (5) | 0.0019 (4) | 0.0030 (4) | 0.0021 (4) |
| Fe2 | 0.0130 (4) | 0.0142 (3) | 0.0132 (4) | 0.0001 (3) | 0.0022 (3) | 0.0005 (3) |
| Fe3 | 0.0133 (4) | 0.0137 (3) | 0.0140 (4) | −0.0001 (3) | 0.0023 (3) | 0.0005 (3) |
| Na1 | 0.0215 (18) | 0.0183 (15) | 0.0213 (16) | 0.0016 (13) | 0.0035 (13) | 0.0010 (12) |
| Na2 | 0.0235 (13) | 0.0208 (10) | 0.0191 (11) | 0.0053 (10) | 0.0010 (9) | 0.0018 (9) |
| Na3 | 0.0198 (13) | 0.0191 (10) | 0.0198 (11) | 0.0021 (9) | 0.0057 (9) | 0.0023 (9) |
| Na4 | 0.0204 (13) | 0.0220 (11) | 0.0208 (11) | 0.0027 (9) | 0.0074 (9) | 0.0044 (9) |
| Na5 | 0.0222 (13) | 0.0223 (11) | 0.0206 (11) | 0.0046 (10) | 0.0032 (9) | 0.0024 (9) |
| Na6 | 0.0214 (19) | 0.0287 (17) | 0.0322 (19) | 0.0043 (15) | 0.0050 (15) | 0.0118 (14) |
| O75 | 0.014 (2) | 0.0130 (17) | 0.0200 (19) | 0.0037 (15) | 0.0038 (15) | 0.0025 (14) |
| O77 | 0.019 (2) | 0.025 (2) | 0.020 (2) | 0.0053 (17) | 0.0017 (17) | −0.0017 (16) |
| O1 | 0.017 (2) | 0.0177 (18) | 0.0156 (19) | −0.0001 (16) | 0.0028 (15) | −0.0009 (15) |
| O78 | 0.014 (2) | 0.0158 (17) | 0.0178 (19) | 0.0008 (15) | 0.0033 (15) | 0.0003 (14) |
| O2 | 0.013 (2) | 0.0142 (17) | 0.0142 (18) | −0.0001 (15) | 0.0011 (15) | 0.0016 (14) |
| O76 | 0.017 (2) | 0.0150 (17) | 0.0184 (19) | 0.0002 (15) | 0.0045 (16) | 0.0013 (15) |
| O3 | 0.016 (2) | 0.0140 (17) | 0.0128 (18) | 0.0000 (15) | 0.0045 (15) | 0.0042 (14) |
| O4 | 0.015 (2) | 0.0136 (17) | 0.0171 (19) | 0.0022 (15) | 0.0052 (15) | 0.0009 (14) |
| O5 | 0.013 (2) | 0.0111 (16) | 0.0135 (18) | −0.0014 (15) | 0.0024 (15) | −0.0003 (14) |
| O6 | 0.012 (2) | 0.0143 (17) | 0.0159 (18) | 0.0033 (15) | 0.0039 (15) | 0.0011 (14) |
| O7 | 0.021 (2) | 0.0144 (17) | 0.0174 (19) | −0.0015 (16) | 0.0046 (16) | 0.0022 (15) |
| O8 | 0.014 (2) | 0.0127 (17) | 0.0147 (18) | 0.0021 (15) | 0.0019 (15) | 0.0028 (14) |
| O9 | 0.016 (2) | 0.0135 (17) | 0.0138 (18) | 0.0016 (15) | 0.0025 (15) | 0.0016 (14) |
| O10 | 0.015 (2) | 0.0137 (17) | 0.0184 (19) | −0.0022 (15) | 0.0012 (15) | −0.0007 (14) |
| O11 | 0.011 (2) | 0.0149 (17) | 0.0148 (18) | −0.0024 (15) | 0.0003 (15) | −0.0010 (14) |
| O12 | 0.018 (2) | 0.0147 (17) | 0.0169 (19) | 0.0038 (16) | 0.0033 (16) | 0.0023 (14) |
| O13 | 0.012 (2) | 0.0163 (17) | 0.0146 (18) | 0.0023 (15) | 0.0002 (15) | 0.0003 (14) |
| O14 | 0.015 (2) | 0.0183 (18) | 0.0095 (17) | 0.0022 (15) | 0.0027 (14) | 0.0003 (14) |
| O15 | 0.014 (2) | 0.0161 (18) | 0.0182 (19) | 0.0009 (15) | 0.0013 (15) | 0.0007 (15) |
| O16 | 0.016 (2) | 0.0160 (17) | 0.0133 (18) | −0.0009 (15) | 0.0020 (15) | −0.0003 (14) |
| O17 | 0.014 (2) | 0.0129 (17) | 0.0180 (19) | 0.0029 (15) | 0.0039 (15) | 0.0044 (14) |
| O18 | 0.013 (2) | 0.0138 (17) | 0.0147 (18) | 0.0038 (15) | 0.0028 (15) | 0.0027 (14) |
| O19 | 0.018 (2) | 0.0138 (17) | 0.0160 (19) | 0.0027 (15) | 0.0029 (15) | 0.0021 (14) |
| O20 | 0.014 (2) | 0.0128 (17) | 0.0136 (18) | −0.0009 (15) | 0.0037 (15) | −0.0009 (14) |
| O21 | 0.016 (2) | 0.0149 (17) | 0.0171 (19) | 0.0007 (15) | 0.0018 (15) | 0.0016 (15) |
| O22 | 0.013 (2) | 0.0175 (18) | 0.021 (2) | 0.0005 (16) | 0.0000 (16) | 0.0004 (15) |
| O23 | 0.017 (2) | 0.0179 (18) | 0.023 (2) | 0.0025 (16) | 0.0065 (16) | 0.0014 (15) |
| O24 | 0.022 (2) | 0.0154 (18) | 0.0125 (18) | 0.0026 (16) | 0.0007 (16) | 0.0007 (14) |
| O25 | 0.016 (2) | 0.0141 (17) | 0.0139 (18) | 0.0022 (15) | 0.0029 (15) | 0.0005 (14) |
| O26 | 0.014 (2) | 0.0159 (17) | 0.0192 (19) | 0.0007 (15) | 0.0035 (15) | 0.0003 (15) |
| O27 | 0.017 (2) | 0.0180 (18) | 0.0181 (19) | 0.0028 (16) | 0.0035 (16) | 0.0023 (15) |
| O28 | 0.020 (2) | 0.0147 (17) | 0.0152 (19) | −0.0001 (16) | 0.0015 (16) | −0.0009 (15) |
| O29 | 0.020 (2) | 0.0152 (18) | 0.0157 (19) | 0.0030 (16) | 0.0017 (16) | −0.0011 (14) |
| O30 | 0.018 (2) | 0.0194 (18) | 0.0145 (19) | 0.0013 (16) | 0.0019 (15) | 0.0023 (15) |
| O31 | 0.0106 (19) | 0.0127 (16) | 0.0159 (18) | 0.0025 (15) | 0.0019 (14) | 0.0028 (14) |
| O32 | 0.017 (2) | 0.0133 (17) | 0.0163 (19) | 0.0012 (15) | 0.0047 (15) | 0.0034 (14) |
| O33 | 0.014 (2) | 0.0131 (17) | 0.0152 (18) | 0.0025 (15) | 0.0036 (15) | 0.0031 (14) |
| O34 | 0.018 (2) | 0.0128 (17) | 0.0180 (19) | 0.0031 (15) | 0.0075 (16) | 0.0005 (14) |
| O35 | 0.012 (2) | 0.0174 (18) | 0.0143 (18) | −0.0024 (15) | 0.0029 (15) | −0.0012 (14) |
| O36 | 0.018 (2) | 0.0109 (17) | 0.0161 (18) | −0.0002 (15) | 0.0039 (15) | 0.0011 (14) |
| O37 | 0.014 (2) | 0.0140 (17) | 0.0188 (19) | −0.0014 (15) | −0.0003 (15) | −0.0019 (14) |
| O38 | 0.011 (2) | 0.0153 (17) | 0.0182 (19) | 0.0011 (15) | 0.0034 (15) | 0.0029 (14) |
| O39 | 0.013 (2) | 0.0149 (17) | 0.0137 (18) | 0.0044 (15) | 0.0017 (15) | 0.0020 (14) |
| O40 | 0.016 (2) | 0.0197 (18) | 0.0183 (19) | 0.0029 (16) | 0.0049 (16) | 0.0037 (15) |
| O41 | 0.014 (2) | 0.0143 (17) | 0.0115 (17) | 0.0004 (15) | 0.0025 (15) | 0.0025 (14) |
| O42 | 0.016 (2) | 0.0116 (16) | 0.0119 (17) | −0.0014 (15) | 0.0004 (15) | 0.0010 (14) |
| O43 | 0.013 (2) | 0.0158 (17) | 0.0140 (18) | 0.0013 (15) | 0.0023 (15) | −0.0011 (14) |
| O44 | 0.0098 (19) | 0.0121 (16) | 0.0155 (18) | −0.0009 (14) | 0.0016 (14) | −0.0020 (14) |
| O45 | 0.012 (2) | 0.0141 (17) | 0.0145 (18) | 0.0036 (15) | 0.0038 (15) | 0.0017 (14) |
| O46 | 0.015 (2) | 0.0143 (17) | 0.0172 (19) | 0.0001 (15) | 0.0023 (15) | 0.0014 (14) |
| O47 | 0.023 (2) | 0.0176 (18) | 0.020 (2) | 0.0025 (17) | 0.0021 (17) | 0.0033 (15) |
| O48 | 0.032 (3) | 0.027 (2) | 0.035 (3) | −0.010 (2) | −0.013 (2) | 0.0112 (19) |
| O49 | 0.029 (3) | 0.0205 (19) | 0.019 (2) | 0.0028 (18) | 0.0034 (17) | 0.0034 (16) |
| O50 | 0.023 (2) | 0.0148 (18) | 0.026 (2) | 0.0003 (17) | 0.0049 (18) | −0.0003 (16) |
| O51 | 0.026 (2) | 0.027 (2) | 0.027 (2) | −0.0014 (19) | 0.0041 (18) | 0.0060 (18) |
| O52 | 0.023 (2) | 0.0185 (19) | 0.021 (2) | 0.0062 (17) | −0.0009 (17) | 0.0043 (16) |
| O53 | 0.021 (2) | 0.030 (2) | 0.021 (2) | 0.0054 (18) | 0.0070 (17) | 0.0020 (18) |
| O54 | 0.019 (2) | 0.0185 (18) | 0.0167 (19) | 0.0018 (16) | 0.0011 (16) | 0.0002 (15) |
| O55 | 0.019 (2) | 0.0170 (18) | 0.022 (2) | 0.0009 (16) | 0.0042 (17) | 0.0041 (16) |
| O56 | 0.020 (2) | 0.0204 (19) | 0.021 (2) | −0.0001 (17) | 0.0053 (17) | 0.0002 (16) |
| O58 | 0.022 (2) | 0.0171 (19) | 0.030 (2) | 0.0059 (17) | 0.0077 (18) | 0.0077 (16) |
| O59 | 0.020 (2) | 0.0163 (18) | 0.022 (2) | 0.0026 (16) | 0.0018 (17) | 0.0020 (15) |
| O60 | 0.021 (2) | 0.023 (2) | 0.024 (2) | 0.0038 (17) | 0.0026 (17) | 0.0005 (17) |
| O61 | 0.027 (2) | 0.0155 (18) | 0.026 (2) | 0.0017 (17) | 0.0041 (18) | 0.0049 (16) |
| O62 | 0.021 (2) | 0.021 (2) | 0.023 (2) | 0.0034 (17) | 0.0019 (17) | 0.0039 (16) |
| O63 | 0.019 (2) | 0.0216 (19) | 0.020 (2) | 0.0010 (17) | 0.0016 (16) | 0.0040 (16) |
| O64 | 0.027 (3) | 0.018 (2) | 0.042 (3) | 0.0026 (18) | 0.009 (2) | 0.0024 (18) |
| O65 | 0.026 (2) | 0.030 (2) | 0.025 (2) | 0.0000 (19) | 0.0054 (18) | 0.0091 (18) |
| O74 | 0.044 (3) | 0.026 (2) | 0.026 (2) | −0.008 (2) | −0.003 (2) | 0.0047 (18) |
| O66 | 0.024 (6) | 0.024 (5) | 0.025 (5) | 0.003 (4) | 0.001 (4) | 0.002 (5) |
| O67 | 0.030 (7) | 0.075 (9) | 0.028 (6) | 0.033 (6) | 0.017 (5) | 0.027 (6) |
| O166 | 0.050 (8) | 0.043 (7) | 0.021 (5) | 0.025 (6) | 0.011 (5) | 0.011 (5) |
| O167 | 0.029 (7) | 0.079 (9) | 0.042 (7) | 0.013 (6) | 0.021 (6) | 0.033 (7) |
| O57 | 0.034 (3) | 0.027 (2) | 0.019 (2) | 0.008 (2) | 0.0013 (18) | 0.0053 (17) |
| O68 | 0.025 (2) | 0.0220 (19) | 0.022 (2) | −0.0006 (18) | 0.0110 (17) | 0.0005 (16) |
| O69 | 0.017 (2) | 0.0207 (19) | 0.029 (2) | −0.0010 (17) | 0.0008 (17) | 0.0005 (17) |
| O70 | 0.025 (3) | 0.031 (2) | 0.020 (2) | −0.0015 (19) | −0.0007 (17) | 0.0079 (18) |
| O71 | 0.023 (2) | 0.0154 (18) | 0.028 (2) | −0.0029 (17) | 0.0007 (18) | 0.0046 (16) |
| O72 | 0.024 (3) | 0.021 (2) | 0.041 (3) | 0.0019 (18) | 0.011 (2) | −0.0005 (19) |
| O73 | 0.026 (2) | 0.0209 (19) | 0.019 (2) | 0.0026 (18) | 0.0106 (17) | 0.0032 (16) |
| W1—O1 | 1.729 (4) | Fe1—O77iii | 2.087 (4) |
| W1—O2 | 1.873 (4) | Fe1—O77 | 2.087 (4) |
| W1—O3 | 1.859 (3) | Fe1—O76iii | 2.165 (4) |
| W1—O4 | 1.979 (3) | Fe1—O76 | 2.165 (4) |
| W1—O5 | 2.273 (3) | Fe2—O19 | 2.108 (4) |
| W1—O6 | 1.930 (4) | Fe2—O26 | 2.101 (4) |
| W2—O6 | 1.882 (3) | Fe2—O27 | 2.093 (4) |
| W2—O7 | 1.748 (3) | Fe2—O28 | 2.169 (4) |
| W2—O8 | 2.259 (4) | Fe2—O29 | 2.136 (4) |
| W2—O9 | 2.201 (3) | Fe2—O30 | 2.122 (4) |
| W2—O10 | 1.754 (4) | Fe3—O14 | 2.145 (3) |
| W2—O11 | 1.943 (3) | Fe3—O16 | 2.087 (4) |
| W3—O8 | 2.195 (3) | Fe3—O22 | 2.145 (4) |
| W3—O11 | 1.905 (4) | Fe3—O23 | 2.116 (4) |
| W3—O12 | 1.743 (3) | Fe3—O24 | 2.136 (3) |
| W3—O13 | 1.890 (4) | Fe3—O25 | 2.106 (4) |
| W3—O14 | 1.786 (3) | Na1—O49 | 2.434 (4) |
| W3—O17 | 2.297 (3) | Na1—O49iv | 2.434 (4) |
| W4—O4i | 1.869 (3) | Na1—O50 | 2.507 (4) |
| W4—O13 | 1.980 (3) | Na1—O50iv | 2.507 (4) |
| W4—O15 | 1.748 (4) | Na1—O51iv | 2.402 (4) |
| W4—O16 | 1.782 (3) | Na1—O51 | 2.402 (4) |
| W4—O17 | 2.226 (4) | Na2—Na3v | 4.194 (3) |
| W4—O20i | 2.122 (3) | Na2—O76vi | 2.460 (4) |
| W5—O2i | 2.071 (4) | Na2—O46 | 2.394 (4) |
| W5—O5i | 2.224 (4) | Na2—O47 | 2.395 (4) |
| W5—O9 | 1.796 (3) | Na2—O48 | 2.317 (4) |
| W5—O17 | 1.883 (3) | Na2—O49 | 2.456 (5) |
| W5—O18 | 1.960 (3) | Na2—O52v | 2.606 (4) |
| W5—O19 | 1.743 (4) | Na3—Na2v | 4.194 (3) |
| W6—O3i | 2.043 (3) | Na3—O37 | 2.484 (4) |
| W6—O5i | 2.271 (3) | Na3—O52 | 2.412 (4) |
| W6—O8i | 1.923 (4) | Na3—O53 | 2.392 (5) |
| W6—O18 | 1.942 (4) | Na3—O54 | 2.375 (4) |
| W6—O20 | 1.826 (3) | Na3—O55 | 2.416 (4) |
| W6—O21 | 1.732 (4) | Na3—O56 | 2.408 (4) |
| W7—O75 | 1.746 (3) | Na4—Na5 | 3.996 (3) |
| W7—O26 | 1.781 (4) | Na4—O10vii | 2.477 (4) |
| W7—O31 | 1.913 (4) | Na4—O58 | 2.407 (5) |
| W7—O32 | 2.247 (3) | Na4—O59 | 2.383 (4) |
| W7—O33 | 2.174 (3) | Na4—O60 | 2.427 (4) |
| W7—O35 | 1.888 (4) | Na4—O62 | 2.395 (4) |
| W8—O33 | 2.258 (4) | Na4—O67 | 2.302 (11) |
| W8—O34 | 2.166 (3) | Na4—O167 | 2.382 (13) |
| W8—O35 | 1.961 (3) | Na5—Na6 | 4.167 (2) |
| W8—O36 | 1.759 (3) | Na5—O21 | 2.447 (4) |
| W8—O37 | 1.750 (4) | Na5—O61 | 2.380 (4) |
| W8—O39ii | 1.860 (3) | Na5—O62 | 2.418 (4) |
| W9—O25 | 1.743 (4) | Na5—O63 | 2.416 (4) |
| W9—O32 | 1.895 (4) | Na5—O74 | 2.424 (4) |
| W9—O34 | 1.797 (4) | Na5—O66 | 2.379 (11) |
| W9—O42 | 2.213 (4) | Na5—O166 | 2.412 (12) |
| W9—O43 | 2.079 (4) | Na6—Na5viii | 4.167 (2) |
| W9—O45 | 1.943 (3) | Na6—O64viii | 2.344 (4) |
| W10—O33ii | 1.922 (4) | Na6—O64 | 2.344 (4) |
| W10—O41 | 2.052 (3) | Na6—O65 | 2.404 (4) |
| W10—O42 | 2.268 (3) | Na6—O65viii | 2.404 (4) |
| W10—O44ii | 1.835 (3) | Na6—O66 | 2.358 (11) |
| W10—O45 | 1.947 (4) | Na6—O66viii | 2.358 (11) |
| W10—O46 | 1.724 (4) | Na6—O166viii | 2.606 (11) |
| W11—O38 | 1.942 (3) | Na6—O166 | 2.606 (11) |
| W11—O39 | 1.958 (4) | O2—W5i | 2.071 (3) |
| W11—O40 | 1.719 (4) | O76—Na2ix | 2.460 (4) |
| W11—O41 | 1.892 (3) | O3—W6i | 2.043 (3) |
| W11—O42 | 2.283 (3) | O4—W4i | 1.869 (3) |
| W11—O43 | 1.870 (4) | O5—W5i | 2.224 (3) |
| W12—O78 | 1.743 (4) | O5—W6i | 2.271 (3) |
| W12—O30 | 1.775 (4) | O8—W6i | 1.923 (4) |
| W12—O31 | 1.960 (3) | O10—Na4vii | 2.477 (4) |
| W12—O32 | 2.237 (4) | O20—W4i | 2.122 (3) |
| W12—O38 | 1.879 (3) | O33—W10ii | 1.922 (4) |
| W12—O44 | 2.146 (3) | O39—W8ii | 1.860 (3) |
| Fe1—O75iii | 2.100 (3) | O44—W10ii | 1.835 (3) |
| Fe1—O75 | 2.100 (3) | O52—Na2v | 2.606 (4) |
| O67a—Na4—Na5 | 72.3 (3) | O38—W12—O44 | 86.63 (14) |
| O167b—Na4—Na5 | 91.8 (3) | O44—W12—O32 | 76.83 (13) |
| O67a—Na4—O10vii | 91.4 (3) | O75iii—Fe1—O75 | 180.00 (17) |
| O1—W1—O2 | 102.23 (16) | O75—Fe1—O76 | 84.52 (14) |
| O1—W1—O3 | 102.82 (16) | O75iii—Fe1—O76iii | 84.51 (14) |
| O1—W1—O4 | 100.36 (16) | O75—Fe1—O76iii | 95.48 (14) |
| O1—W1—O5 | 177.56 (16) | O75iii—Fe1—O76 | 95.49 (14) |
| O1—W1—O6 | 102.08 (16) | O77—Fe1—O75 | 88.54 (15) |
| O167b—Na4—O10vii | 92.8 (3) | O77iii—Fe1—O75iii | 88.54 (15) |
| O167b—Na4—O58 | 160.3 (3) | O77iii—Fe1—O75 | 91.46 (15) |
| O67a—Na4—O58 | 164.0 (3) | O77—Fe1—O75iii | 91.46 (15) |
| O167b—Na4—O59 | 80.4 (3) | O77iii—Fe1—O77 | 180.0 (2) |
| O67a—Na4—O59 | 82.0 (3) | O77—Fe1—O76iii | 89.27 (15) |
| O67a—Na4—O60 | 100.9 (3) | O77iii—Fe1—O76iii | 90.73 (15) |
| O167b—Na4—O60 | 79.8 (3) | O77iii—Fe1—O76 | 89.27 (15) |
| O67a—Na4—O62 | 91.2 (3) | O77—Fe1—O76 | 90.73 (15) |
| O167b—Na4—O62 | 112.6 (3) | O76iii—Fe1—O76 | 180.0 |
| O66a—Na5—Na4 | 91.9 (2) | O19—Fe2—O28 | 94.86 (14) |
| O2—W1—O4 | 86.64 (15) | O19—Fe2—O29 | 88.73 (14) |
| O2—W1—O5 | 75.66 (14) | O19—Fe2—O30 | 172.37 (14) |
| O2—W1—O6 | 154.94 (15) | O26—Fe2—O19 | 86.58 (14) |
| O166b—Na5—Na4 | 74.3 (3) | O26—Fe2—O28 | 84.95 (14) |
| O66a—Na5—Na6 | 28.3 (3) | O26—Fe2—O29 | 99.31 (14) |
| O166b—Na5—Na6 | 35.4 (3) | O26—Fe2—O30 | 93.00 (14) |
| O166b—Na5—O21 | 163.0 (3) | O27—Fe2—O19 | 88.57 (15) |
| O3—W1—O2 | 92.10 (16) | O27—Fe2—O26 | 170.10 (14) |
| O3—W1—O4 | 156.51 (14) | O27—Fe2—O28 | 86.87 (14) |
| O3—W1—O5 | 76.16 (13) | O27—Fe2—O29 | 89.20 (14) |
| O3—W1—O6 | 88.40 (15) | O27—Fe2—O30 | 92.94 (15) |
| O4—W1—O5 | 80.82 (13) | O29—Fe2—O28 | 174.61 (15) |
| O6—W1—O4 | 83.09 (15) | O30—Fe2—O28 | 92.69 (14) |
| O6—W1—O5 | 80.15 (14) | O30—Fe2—O29 | 83.82 (14) |
| O6—W2—O8 | 86.58 (14) | O16—Fe3—O14 | 93.57 (14) |
| O6—W2—O9 | 82.77 (14) | O16—Fe3—O22 | 92.74 (14) |
| O6—W2—O11 | 155.70 (15) | O16—Fe3—O23 | 94.67 (15) |
| O7—W2—O6 | 97.75 (16) | O16—Fe3—O24 | 83.16 (14) |
| O7—W2—O8 | 93.99 (16) | O16—Fe3—O25 | 171.65 (14) |
| O7—W2—O9 | 170.19 (16) | O22—Fe3—O14 | 83.38 (14) |
| O7—W2—O10 | 102.74 (17) | O23—Fe3—O14 | 167.85 (14) |
| O7—W2—O11 | 95.65 (15) | O23—Fe3—O22 | 87.31 (14) |
| O66a—Na5—O21 | 176.3 (3) | O23—Fe3—O24 | 88.30 (14) |
| O66a—Na5—O61 | 96.4 (3) | O24—Fe3—O14 | 101.55 (14) |
| O166b—Na5—O62 | 71.7 (3) | O24—Fe3—O22 | 173.74 (15) |
| O66a—Na5—O62 | 84.3 (3) | O25—Fe3—O14 | 87.26 (14) |
| O66a—Na5—O63 | 105.1 (3) | O25—Fe3—O22 | 95.61 (14) |
| O166b—Na5—O63 | 97.0 (3) | O25—Fe3—O23 | 85.89 (14) |
| O166b—Na5—O74 | 88.6 (3) | O25—Fe3—O24 | 88.53 (14) |
| O66a—Na5—O74 | 74.2 (3) | O49—Na1—O49iv | 180.0 |
| O66aviii—Na6—Na5viii | 28.5 (3) | O49—Na1—O50iv | 94.06 (13) |
| O166b—Na6—Na5viii | 147.6 (3) | O49iv—Na1—O50iv | 85.94 (13) |
| O66a—Na6—Na5viii | 151.5 (3) | O49iv—Na1—O50 | 94.06 (13) |
| O166bviii—Na6—Na5 | 147.6 (3) | O49—Na1—O50 | 85.94 (13) |
| O66aviii—Na6—Na5 | 151.5 (3) | O50iv—Na1—O50 | 180.0 |
| O166bviii—Na6—Na5viii | 32.4 (3) | O51—Na1—O49iv | 87.15 (13) |
| O166b—Na6—Na5 | 32.4 (3) | O51—Na1—O49 | 92.85 (13) |
| O9—W2—O8 | 76.25 (13) | O51iv—Na1—O49 | 87.15 (13) |
| O10—W2—O6 | 100.05 (16) | O51iv—Na1—O49iv | 92.85 (13) |
| O10—W2—O8 | 160.90 (15) | O51iv—Na1—O50iv | 90.54 (14) |
| O10—W2—O9 | 86.76 (15) | O51—Na1—O50iv | 89.46 (14) |
| O10—W2—O11 | 96.62 (16) | O51iv—Na1—O50 | 89.46 (14) |
| O11—W2—O8 | 72.31 (14) | O51—Na1—O50 | 90.54 (14) |
| O11—W2—O9 | 80.65 (13) | O51—Na1—O51iv | 180.0 |
| O8—W3—O17 | 77.47 (13) | O76vi—Na2—Na3v | 115.31 (11) |
| O11—W3—O8 | 74.48 (14) | O76vi—Na2—O52v | 85.72 (14) |
| O11—W3—O17 | 85.82 (14) | O46—Na2—Na3v | 80.08 (10) |
| O12—W3—O8 | 94.71 (15) | O46—Na2—O76vi | 76.13 (14) |
| O12—W3—O11 | 100.68 (16) | O46—Na2—O47 | 83.98 (14) |
| O12—W3—O13 | 97.09 (16) | O46—Na2—O49 | 151.08 (16) |
| O12—W3—O14 | 103.75 (16) | O46—Na2—O52v | 83.19 (14) |
| O12—W3—O17 | 168.24 (16) | O47—Na2—Na3v | 69.12 (11) |
| O13—W3—O8 | 85.38 (14) | O47—Na2—O76vi | 158.13 (17) |
| O13—W3—O11 | 154.04 (14) | O47—Na2—O49 | 92.49 (15) |
| O13—W3—O17 | 73.75 (14) | O47—Na2—O52v | 101.02 (15) |
| O14—W3—O8 | 160.44 (14) | O48—Na2—Na3v | 144.46 (14) |
| O14—W3—O11 | 95.49 (16) | O48—Na2—O76vi | 97.84 (16) |
| O14—W3—O13 | 98.50 (16) | O48—Na2—O46 | 122.29 (18) |
| O14—W3—O17 | 85.19 (14) | O48—Na2—O47 | 85.06 (16) |
| O4i—W4—O13 | 158.70 (15) | O48—Na2—O49 | 85.78 (16) |
| O4i—W4—O17 | 87.50 (14) | O48—Na2—O52v | 154.45 (18) |
| O4i—W4—O20i | 87.80 (14) | O49—Na2—Na3v | 71.91 (11) |
| O13—W4—O17 | 73.81 (14) | O49—Na2—O76vi | 109.31 (15) |
| O13—W4—O20i | 78.33 (13) | O49—Na2—O52v | 69.29 (14) |
| O15—W4—O4i | 99.78 (16) | O52v—Na2—Na3v | 31.89 (9) |
| O15—W4—O13 | 96.69 (16) | O37—Na3—Na2v | 116.60 (11) |
| O15—W4—O16 | 102.35 (17) | O52—Na3—Na2v | 34.80 (10) |
| O15—W4—O17 | 166.45 (15) | O52—Na3—O37 | 88.80 (14) |
| O15—W4—O20i | 91.54 (16) | O52—Na3—O55 | 85.00 (15) |
| O16—W4—O4i | 98.64 (16) | O53—Na3—Na2v | 66.75 (11) |
| O16—W4—O13 | 90.86 (15) | O53—Na3—O37 | 86.52 (14) |
| O16—W4—O17 | 87.68 (16) | O53—Na3—O52 | 83.44 (15) |
| O16—W4—O20i | 163.37 (16) | O53—Na3—O55 | 165.38 (17) |
| O20i—W4—O17 | 77.24 (14) | O53—Na3—O56 | 104.30 (16) |
| O2i—W5—O5i | 73.17 (13) | O54—Na3—Na2v | 69.01 (10) |
| O9—W5—O2i | 161.79 (16) | O54—Na3—O37 | 167.68 (17) |
| O9—W5—O5i | 88.63 (15) | O54—Na3—O52 | 100.05 (16) |
| O9—W5—O17 | 94.60 (16) | O54—Na3—O53 | 86.01 (15) |
| O9—W5—O18 | 92.85 (15) | O54—Na3—O55 | 87.22 (15) |
| O17—W5—O2i | 83.63 (14) | O54—Na3—O56 | 86.22 (14) |
| O17—W5—O5i | 86.14 (15) | O55—Na3—Na2v | 98.71 (11) |
| O66a—Na6—Na5 | 28.5 (3) | O55—Na3—O37 | 102.18 (14) |
| O66a—Na6—O65viii | 81.5 (3) | O56—Na3—Na2v | 153.79 (12) |
| O66aviii—Na6—O65viii | 98.5 (3) | O56—Na3—O37 | 86.15 (14) |
| O66aviii—Na6—O65 | 81.5 (3) | O56—Na3—O52 | 170.45 (16) |
| O66a—Na6—O65 | 98.5 (3) | O56—Na3—O55 | 88.15 (15) |
| O66a—Na6—O66viii | 180.0 | O10vii—Na4—Na5 | 110.91 (11) |
| O166b—Na6—O166viii | 180.0 | O58—Na4—Na5 | 94.56 (12) |
| Na5—O166b—Na6 | 112.2 (5) | O58—Na4—O10vii | 102.18 (15) |
| Na6—O66a—Na5 | 123.2 (5) | O58—Na4—O60 | 89.00 (15) |
| O17—W5—O18 | 156.21 (16) | O59—Na4—Na5 | 68.57 (10) |
| O18—W5—O2i | 82.29 (14) | O59—Na4—O10vii | 173.18 (17) |
| O18—W5—O5i | 71.47 (14) | O59—Na4—O58 | 84.62 (15) |
| O19—W5—O2i | 94.39 (15) | O59—Na4—O60 | 95.17 (15) |
| O19—W5—O5i | 163.66 (14) | O59—Na4—O62 | 98.88 (15) |
| O19—W5—O9 | 103.63 (17) | O60—Na4—Na5 | 162.87 (13) |
| O19—W5—O17 | 103.30 (16) | O60—Na4—O10vii | 84.57 (14) |
| O19—W5—O18 | 96.82 (16) | O62—Na4—Na5 | 34.07 (10) |
| O3i—W6—O5i | 72.91 (13) | O62—Na4—O10vii | 82.69 (14) |
| O8i—W6—O3i | 84.52 (15) | O62—Na4—O58 | 82.18 (15) |
| O8i—W6—O5i | 85.68 (14) | O62—Na4—O60 | 162.60 (16) |
| O8i—W6—O18 | 155.62 (15) | Na4—Na5—Na6 | 90.45 (5) |
| O18—W6—O3i | 82.76 (14) | O21—Na5—Na4 | 88.71 (11) |
| O18—W6—O5i | 70.73 (14) | O21—Na5—Na6 | 148.08 (11) |
| O20—W6—O3i | 160.28 (14) | O61—Na5—Na4 | 122.47 (12) |
| O20—W6—O5i | 87.38 (14) | O61—Na5—Na6 | 73.42 (11) |
| O20—W6—O8i | 94.35 (16) | O61—Na5—O21 | 80.23 (14) |
| O20—W6—O18 | 90.72 (15) | O61—Na5—O62 | 90.73 (15) |
| O21—W6—O3i | 96.16 (15) | O61—Na5—O63 | 151.18 (18) |
| O21—W6—O5i | 165.95 (15) | O61—Na5—O74 | 85.58 (15) |
| O21—W6—O8i | 102.36 (16) | O61—Na5—O166 | 108.6 (3) |
| O21—W6—O18 | 99.63 (16) | O62—Na5—Na4 | 33.69 (10) |
| O21—W6—O20 | 103.29 (16) | O62—Na5—Na6 | 68.87 (11) |
| O75—W7—O26 | 103.42 (16) | O62—Na5—O21 | 94.18 (15) |
| O75—W7—O31 | 94.64 (16) | O62—Na5—O74 | 157.62 (18) |
| O75—W7—O32 | 167.01 (16) | O63—Na5—Na4 | 76.45 (11) |
| O75—W7—O33 | 93.94 (15) | O63—Na5—Na6 | 131.93 (13) |
| O75—W7—O35 | 100.95 (16) | O63—Na5—O21 | 78.65 (14) |
| O26—W7—O31 | 98.53 (16) | O63—Na5—O62 | 110.12 (15) |
| O26—W7—O32 | 85.41 (14) | O63—Na5—O74 | 82.05 (15) |
| O26—W7—O33 | 161.89 (14) | O74—Na5—Na4 | 150.39 (14) |
| O26—W7—O35 | 95.91 (16) | O74—Na5—Na6 | 88.95 (13) |
| O31—W7—O32 | 74.41 (14) | O74—Na5—O21 | 106.88 (17) |
| O31—W7—O33 | 84.98 (14) | Na5viii—Na6—Na5 | 180.0 |
| O33—W7—O32 | 78.40 (13) | O64—Na6—Na5 | 106.43 (10) |
| O35—W7—O31 | 155.66 (14) | O64viii—Na6—Na5viii | 106.43 (11) |
| O35—W7—O32 | 87.39 (14) | O64—Na6—Na5viii | 73.57 (10) |
| O35—W7—O33 | 75.47 (14) | O64viii—Na6—Na5 | 73.57 (11) |
| O34—W8—O33 | 76.31 (13) | O64—Na6—O64viii | 180.0 |
| O35—W8—O33 | 72.16 (14) | O64—Na6—O65viii | 89.83 (14) |
| O35—W8—O34 | 79.27 (14) | O64—Na6—O65 | 90.17 (15) |
| O36—W8—O33 | 92.20 (15) | O64viii—Na6—O65 | 89.83 (14) |
| O36—W8—O34 | 167.70 (15) | O64viii—Na6—O65viii | 90.17 (15) |
| O36—W8—O35 | 93.19 (15) | O64viii—Na6—O66 | 96.6 (3) |
| O36—W8—O39ii | 97.99 (15) | O64—Na6—O66 | 83.4 (3) |
| O37—W8—O33 | 162.25 (15) | O64—Na6—O66viii | 96.6 (3) |
| O37—W8—O34 | 88.05 (15) | O64viii—Na6—O66viii | 83.4 (3) |
| O37—W8—O35 | 97.00 (16) | O64—Na6—O166viii | 105.8 (3) |
| O37—W8—O36 | 102.61 (17) | O64—Na6—O166 | 74.2 (3) |
| O37—W8—O39ii | 101.14 (16) | O64viii—Na6—O166viii | 74.2 (3) |
| O39ii—W8—O33 | 86.20 (15) | O64viii—Na6—O166 | 105.8 (3) |
| O39ii—W8—O34 | 85.75 (14) | O65—Na6—Na5 | 81.74 (11) |
| O39ii—W8—O35 | 156.00 (15) | O65viii—Na6—Na5viii | 81.74 (11) |
| O25—W9—O32 | 103.17 (16) | O65—Na6—Na5viii | 98.26 (11) |
| O25—W9—O34 | 104.38 (17) | O65viii—Na6—Na5 | 98.26 (11) |
| O25—W9—O42 | 163.37 (14) | O65—Na6—O65viii | 180.0 |
| O25—W9—O43 | 92.49 (15) | O65—Na6—O166viii | 95.1 (3) |
| O25—W9—O45 | 97.59 (16) | O65viii—Na6—O166viii | 84.9 (3) |
| O32—W9—O42 | 84.68 (14) | O65viii—Na6—O166 | 95.1 (3) |
| O32—W9—O43 | 84.03 (14) | O65—Na6—O166 | 84.9 (3) |
| O32—W9—O45 | 155.61 (16) | W7—O75—Fe1 | 141.2 (2) |
| O34—W9—O32 | 94.46 (15) | W1—O2—W5i | 115.40 (17) |
| O34—W9—O42 | 89.37 (15) | Fe1—O76—Na2ix | 123.52 (16) |
| O34—W9—O43 | 162.93 (16) | W1—O3—W6i | 116.84 (17) |
| O34—W9—O45 | 92.62 (15) | W4i—O4—W1 | 147.3 (2) |
| O43—W9—O42 | 73.56 (13) | W5i—O5—W1 | 95.76 (13) |
| O45—W9—O42 | 72.07 (14) | W5i—O5—W6i | 97.18 (14) |
| O45—W9—O43 | 82.42 (14) | W6i—O5—W1 | 94.06 (12) |
| O33ii—W10—O41 | 84.49 (14) | W2—O6—W1 | 149.1 (2) |
| O33ii—W10—O42 | 85.99 (14) | W3—O8—W2 | 95.05 (14) |
| O33ii—W10—O45 | 155.71 (15) | W6i—O8—W2 | 137.59 (17) |
| O41—W10—O42 | 72.95 (13) | W6i—O8—W3 | 125.95 (18) |
| O44ii—W10—O33ii | 94.56 (15) | W5—O9—W2 | 137.20 (18) |
| O44ii—W10—O41 | 160.62 (14) | W2—O10—Na4vii | 123.67 (18) |
| O44ii—W10—O42 | 87.67 (14) | W3—O11—W2 | 117.26 (18) |
| O44ii—W10—O45 | 91.49 (15) | W3—O13—W4 | 117.31 (18) |
| O45—W10—O41 | 82.10 (14) | W3—O14—Fe3 | 133.7 (2) |
| O45—W10—O42 | 70.76 (13) | W4—O16—Fe3 | 138.8 (2) |
| O46—W10—O33ii | 102.68 (16) | W4—O17—W3 | 93.90 (13) |
| O46—W10—O41 | 95.21 (15) | W5—O17—W3 | 125.71 (18) |
| O46—W10—O42 | 164.79 (15) | W5—O17—W4 | 139.11 (18) |
| O46—W10—O44ii | 103.85 (16) | W6—O18—W5 | 119.54 (18) |
| O46—W10—O45 | 98.64 (16) | W5—O19—Fe2 | 172.3 (2) |
| O38—W11—O39 | 84.45 (15) | W6—O20—W4i | 138.94 (18) |
| O38—W11—O42 | 81.24 (14) | W6—O21—Na5 | 154.0 (2) |
| O39—W11—O42 | 79.88 (14) | W9—O25—Fe3 | 169.9 (2) |
| O40—W11—O38 | 102.46 (16) | W7—O26—Fe2 | 135.4 (2) |
| O40—W11—O39 | 101.77 (16) | W12—O30—Fe2 | 137.9 (2) |
| O40—W11—O41 | 100.97 (16) | W7—O31—W12 | 116.06 (17) |
| O40—W11—O42 | 176.04 (16) | W9—O32—W7 | 124.93 (18) |
| O40—W11—O43 | 102.78 (17) | W9—O32—W12 | 139.49 (18) |
| O41—W11—O38 | 156.18 (15) | W12—O32—W7 | 94.25 (13) |
| O41—W11—O39 | 86.64 (15) | W7—O33—W8 | 95.16 (14) |
| O41—W11—O42 | 75.46 (13) | W10ii—O33—W7 | 125.80 (18) |
| O43—W11—O38 | 87.92 (15) | W10ii—O33—W8 | 137.86 (18) |
| O43—W11—O39 | 155.33 (15) | W9—O34—W8 | 139.68 (18) |
| O43—W11—O41 | 91.09 (15) | W7—O35—W8 | 116.42 (18) |
| O43—W11—O42 | 75.78 (14) | W8—O37—Na3 | 127.58 (19) |
| O78—W12—O30 | 102.32 (17) | W12—O38—W11 | 147.9 (2) |
| O78—W12—O31 | 97.07 (15) | W8ii—O39—W11 | 150.9 (2) |
| O78—W12—O32 | 166.24 (15) | W11—O41—W10 | 116.54 (16) |
| O78—W12—O38 | 99.83 (16) | W9—O42—W10 | 96.86 (14) |
| O78—W12—O44 | 91.39 (15) | W9—O42—W11 | 95.65 (13) |
| O30—W12—O31 | 91.54 (15) | W10—O42—W11 | 95.01 (12) |
| O30—W12—O32 | 88.42 (16) | W11—O43—W9 | 114.98 (17) |
| O30—W12—O38 | 99.13 (16) | W10ii—O44—W12 | 136.52 (18) |
| O30—W12—O44 | 163.89 (16) | W9—O45—W10 | 119.05 (18) |
| O31—W12—O32 | 73.79 (13) | W10—O46—Na2 | 166.1 (2) |
| O31—W12—O44 | 78.25 (13) | Na1—O49—Na2 | 120.25 (17) |
| O38—W12—O31 | 157.54 (15) | Na3—O52—Na2v | 113.31 (16) |
| O38—W12—O32 | 86.74 (14) | Na4—O62—Na5 | 112.24 (17) |
| Symmetry codes: (i) −x+1, −y+2, −z+2; (ii) −x, −y+1, −z+1; (iii) −x, −y+2, −z+1; (iv) −x+1, −y, −z+1; (v) −x+1, −y+1, −z+1; (vi) x, y−1, z; (vii) −x, −y+2, −z+2; (viii) −x, −y+3, −z+2; (ix) x, y+1, z. |
| Compounds | Unit-cell parameters a, b and c (Å) and α, β and γ (°) | Volume (Å3), Z and space group | Synthesis details (source of W; W:MII ratio; M= Fe, Cu; pH) | Reference |
| FeII | ||||
| K6[{Fe(H2O)4}2(H2W12O42)]·15H2O | 14.9967 (5), 10.3872 (3), 18.8237 (6); 90, 93.407 (1), 90 | 2927.1 (2), 2, P21/n | K2WO4; 12:1.4; ? | Yang et al. (2003) |
| (H3O)2[{Fe(H2O)4Fe(H2O)3}2(H2W12O42)]·20H2O | 12.1794 (4), 22.4938 (4), 11.6941 (3); 90, 105.731 (2), 90 | 3083.7 (1), 2, P21/c | Li2WO4; 12:1.4; ? | Yang et al. (2003) |
| Na5[{Fe(H2O)3}2{Fe(H2O)4}0.5(H2W12O42)]·30H2O | 12.121 (2), 12.426 (3), 13.247 (3); 68.33 (3), 71.33 (3), 71.44 (3) | 1710.7 (6), 1, P1 | Na2WO4; 12:1.4; – | Yang et al. (2003) |
| CuII | ||||
| Na8[Cu(H2O)2(H2W12O42)].30H2O | 13.081 (4), 13.160 (6), 20.127 (6); 78.294 (12), 78.524 (11), 72.593 (11) | 3201.7 (17), 2, P1 | Na2WO4; 12:2.4; 4.8 | Li et al. (2008) |
| KNa3[Cu(H2O)2{Cu(H2O)3}2(H2W12O42)]·16H2O | 10.799 (2), 11.914 (2), 13.377 (3); 70.18 (3), 68.07 (3), 64.80 (3) | 1410.9 (5), 1, P1 | Na2[W12O40(OH)2]; 12:2; 3.5 | Li et al. (2009) |
| \ [{Na2(µ-H2O)2(H2O)6}{Cu(H2O)2}{Cu(H2O)4}2\ {Cu2(µ-OH)2(H2O)6}(H2W12O42)]·10H2O | 10.697 (5), 12.921 (5), 13.653 (5); 73.608 (5), 75.671 (5), 67.748 (5) | 1654.4 (12), 1, P1 | (NH4)6[W12O40]; 12:0.4; 6.2 | Kong et al. (2010) |
| \ [{Na(H2O)4}2{Cu0.5(H2O)}4{Cu0.5(H2O)1.5}2\ (H4W12O42)]?3H2O | 10.7060 (11), 12.7124 (14), 13.1664 (14); 113.7600 (10), 90.8230 (10), 111.8290 (10) | 1493.8 (3), 1, P1 | Na2WO4; 12:3; 6.5 | Gao et al. (2011) |
| [Na2(H2O)10][Cu4(H2O)12(H2W12O42)]·15H2O | 10.1535 (2), 13.2118 (3), 13.7049 (5); 112.692 (3), 94.771 (3), 102.969 (2) | 1623.15 (8), 1, P1 | Na2WO4; 12:36; 4 | Qu et al. (2012) |
| Cu3(H2O)8[H6W12O42] | 10.6753 (5), 12.7814 (5), 13.0976 (5); 113.737 (4), 90.433 (3), 112.560 (4) | 1482.73 (12), 2, P1 | (NH4)6[W12O40]; 12:36; – | Chen et al. (2017) |
| (NH4)8[Cu(H2O)2H2W12O42]·10H2O | 14.278 (5), 15.435 (5), 24.881 (5); 90, 90, 90 | 5483 (3), 2, Pbcn | (NH4)6[W12O40]; 12:2.5; 4.8 | Zhang (2012) |
| Na2Cu3(CuOH)2[W12O40(OH)2].32H2O | 10.6836 (4), 12.9066 (6), 13.6475 (5); 73.561 (4), 67.666 (4) | 1648.68 (12), 1, P1 | Na2WO4; 12:7.5; – | Radio et al. (2014) |
| Na2Cu5(H2O)24(OH)2[H2W12O42]·10H2O | 10.7140 (8), 12.9476 (9), 13.6696 (10); 73.56, 75.73, 67.69 | 1661.8 (2), 1, P1 | Na2WO4; 12:20; 3.8 | Qu et al., 2015 |
| Na5Fe2.5paraB | Na3Cu4paraB | |
| W═Ot | 1.719 (4)-1.797 (4) | 1.710 (8)–1.780 (7) |
| W—Odb1 | 1.888 (4)–2.050 (2) | 1.872 (7)–2.103 (7) |
| W—Odb2 | 1.826 (3)–2.166 (3) | 1.805 (7)–2.098 (7) |
| W—Otb1 | 2.201 (3)–2.297 (3) | 2.207 (7)–2.273 (7) |
| W—Otb2 | 1.895 (4)–2.259 (4) | 1.882 (8)–2.287 (7) |
| W···W (between corner-sharing WO6) | 3.649 (4)–3.878 (5) | 3.377 (4)–3.688 (2) |
| W···W (between edge-sharing WO6) | 3.273 (4)–3.352 (4) | 3.306 (2)–3.377 (3) |
| MII—O (M = Fe or Cu) | 2.087 (4)–2.169 (4) | 1.918 (7)–2.366 (8) |
| NaI—O | 2.302 (11)–2.606 (11) | 2.345 (9)–2.519 (13) |
| O—W—O | 70.73 (14)–104.38 (17) | 154.94 (15)–177.56 (16) |
| 70.2 (3)–105.6 (3) | 152.8 (3)–178.1 (3) |
Acknowledgements
The authors are grateful to Assistant Professor Dr P. Unfried for support with the TGA and to Associate Professor K. Richter and M. Andraghetti for help with PXRD measurements at the Department of Inorganic Chemistry, University of Vienna. We thank RNDr Marek Bujdoš, PhD, for support with the ICP–MS and AAS analysis at the Institute of Laboratory Research on Geomaterials, Comenius Univiversity in Bratislava. We wish to thank E. Al-Sayed, MSc, and Dr J. Breibeck for valuable discussions regarding this work.
Funding information
Funding for this research was provided by: Austrian Science Fund (award No. M2203 to N. Gumerova; award No. P27534 to A. Rompel).
References
Bijelic, A., Aureliano, M. & Rompel, A. (2018a). Angew. Chem. Int. Ed. In the press. doi:10.1002/anie.201803868 and doi:10.1002/ange.201803868. Google Scholar
Bijelic, A., Aureliano, M. & Rompel, A. (2018b). Chem. Commun. 54, 1153–1169. Web of Science CrossRef Google Scholar
Bijelic, A. & Rompel, A. (2015). Coord. Chem. Rev. 299, 22–38. Web of Science CrossRef CAS PubMed Google Scholar
Bijelic, A. & Rompel, A. (2017). Acc. Chem. Res. 50, 1441–1448. Web of Science CrossRef CAS PubMed Google Scholar
Brandenburg, K. (2006). DIAMOND. Crystal Impact GbR, Bonn, Germany. Google Scholar
Brown, I. D. & Altermatt, D. (1985). Acta Cryst. B41, 244–247. CrossRef CAS Web of Science IUCr Journals Google Scholar
Bruker (2015). SAINT. Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
Bruker (2016). SADABS. Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
Chen, Y., Zhang, C., Zhang, J., Ye, Z., Zheng, K., Fang, Q. & Li, G. (2017). Inorg. Chem. Front. 4, 1917–1922. Web of Science CrossRef Google Scholar
Clemente-Juan, J. M., Coronado, E. & Gaita-Ariño, A. (2012). Chem. Soc. Rev. 41, 7464–7478. Web of Science CAS PubMed Google Scholar
Dolomanov, O. V., Bourhis, L. J., Gildea, R. J., Howard, J. A. K. & Puschmann, H. (2009). J. Appl. Cryst. 42, 339–341. Web of Science CrossRef CAS IUCr Journals Google Scholar
Evans, H. T. & Prince, E. (1983). J. Am. Chem. Soc. 105, 4838–4839. CrossRef Web of Science Google Scholar
Evans, H. T. & Rollins, O. W. (1976). Acta Cryst. B32, 1565–1567. CrossRef CAS IUCr Journals Web of Science Google Scholar
Fu, L., Gao, H., Yan, M., Li, S., Li, X., Dai, Z. & Liu, S. (2015). Small, 11, 2938–2945. Web of Science CrossRef CAS PubMed Google Scholar
Gao, S., Zhao, J., Zhou, B., Yu, K., Su, Z., Wang, L., Yin, Y., Zhao, Z., Yu, Y. & Chen, Y. (2011). Inorg. Chim. Acta, 379, 151–157. Web of Science CrossRef Google Scholar
Groom, C. R., Bruno, I. J., Lightfoot, M. P. & Ward, S. C. (2016). Acta Cryst. B72, 171–179. Web of Science CrossRef IUCr Journals Google Scholar
Gumerova, N. I., Kasyanova, K. V., Rozantsev, G. M., Baumer, V. N. & Radio, S. V. (2015). J. Cluster Sci. 26, 1171–1186. Web of Science CrossRef Google Scholar
He, L.-W., Lin, B.-Z., Liu, X.-Z., Huang, X.-F. & Feng, Y.-L. (2008). Solid State Sci. 10, 237–243. Web of Science CrossRef Google Scholar
Hübschle, C. B., Sheldrick, G. M. & Dittrich, B. (2011). J. Appl. Cryst. 44, 1281–1284. Web of Science CrossRef IUCr Journals Google Scholar
Kong, Q.-J., Zhang, C.-J. & Chen, Y.-G. (2010). J. Mol. Struct. 964, 82–87. Web of Science CrossRef Google Scholar
Li, B., Bi, B., Li, W. & Wu, L. (2008). J. Solid State Chem. 181, 3337–3343. Web of Science CrossRef Google Scholar
Li, Y.-W., Wang, Y.-H., Li, Y.-G., Wang, E.-B., Chen, W.-L., Wu, Q. & Shi, Q. (2009). Inorg. Chim. Acta, 362, 1078–1082. Web of Science CrossRef Google Scholar
Molitor, C., Bijelic, A. & Rompel, A. (2017). IUCrJ, 4, 734–740. Web of Science CrossRef CAS PubMed IUCr Journals Google Scholar
Peresypkina, E. V., Virovets, A. V., Adonin, S. A., Abramov, P. A., Rogachev, A. V., Sinkevich, P. L., Korenev, V. S. & Sokolov, M. N. (2014). J. Struct. Chem. 55, 295–298. Web of Science CrossRef Google Scholar
Pope, M. (1983). In Heteropoly and Isopoly Oxometalates. Berlin: Springer. Google Scholar
Proust, A., Thouvenot, R. & Gouzerh, P. (2008). Chem. Commun. pp. 1837–1852. Web of Science CrossRef Google Scholar
Qu, X., Yang, Y., Yu, X., Lv, Z., Ji, M. & Feng, S. (2015). Inorg. Chem. Commun. 60, 126–130. Web of Science CrossRef Google Scholar
Qu, X., Yang, Y., Zhang, F. & Yu, X. (2012). Struct. Chem. 23, 1867–1872. Web of Science CrossRef Google Scholar
Radio, S. V., Kryuchkov, M. A., Zavialova, E. G., Baumer, V. N., Shishkin, O. V. & Rozantsev, G. M. (2010). J. Coord. Chem. 63, 1678–1689. Web of Science CrossRef Google Scholar
Radio, S. V., Melnik, N. A., Ivantsova, E. S. & Baumer, V. N. (2014). J. Struct. Chem. 55, 879–886. Web of Science CrossRef Google Scholar
Radio, S. V., Rozantsev, G. M., Baumer, V. N. & Shishkin, O. V. (2011). J. Struct. Chem. 52, 111–117. CrossRef Google Scholar
Sadakane, M. & Steckhan, E. (1998). Chem. Rev. 98, 219–238. Web of Science CrossRef PubMed CAS Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Sheldrick, G. M. (2015). Acta Cryst. C71, 3–8. Web of Science CrossRef IUCr Journals Google Scholar
Spek, A. L. (2015). Acta Cryst. C71, 9–18. Web of Science CrossRef IUCr Journals Google Scholar
Sokolov, M. N., Adonin, S. A., Abramov, P. A., Mainichev, D. A., Zakharchuk, N. F. & Fedin, V. P. (2012). Chem. Commun. 48, 6666–6668. Web of Science CrossRef Google Scholar
Wang, S.-S. & Yang, G.-Y. (2015). Chem. Rev. 115, 4893–4962. Web of Science CrossRef CAS PubMed Google Scholar
Yamase, T. & Pope, M. (2002). Editors. Polyoxometalate Chemistry for Nano-Composite Design. Springer Science & Business Media. Google Scholar
Yang, W.-B., Lu, C.-Z., Lin, X. & Zhuang, H.-H. (2003). Z. Anorg. Allg. Chem. 629, 2046–2052. Web of Science CrossRef Google Scholar
Zhang, Z. (2012). J. Chem. Crystallogr. 42, 333–337. Web of Science CrossRef Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.
access

journal menu



