metal-organic compounds
Octabenzyldichlorodi-μ2-hydroxo-di-μ3-oxo-tetratin toluene disolvate
aDepartment of Chemistry, Bharathidasan University, Tiruchirappalli, Tamil Nadu 620 024, India, bDepartment of Chemistry, University of Aberdeen, Meston Walk, Old Aberdeen AB24 3UE, Scotland, and cSchool of Chemistry, University of St Andrews, Fife KY16 9ST, Scotland
*Correspondence e-mail: [email protected]
The title tin complex crystallizes as a stoichiometric toluene-solvated dimer of 1,1,3,3-tetrabenzyl-1-chloro-3-hydroxydistannoxane, [Sn4(C7H7)8Cl2O2(OH)2]·2C7H8. The tetranuclear molecule lies across a centre of inversion in space group P21/n; the Sn4O4 framework, in which the two independent Sn centres both have distorted trigonal bipyramidal coordination, is essentially planar.
Comment
The organotin component of the title compound, (I
), was obtained as an adventitious product of the partial hydrolysis of dibenzyldichlorotin(IV) during the attempted preparation of adducts of this tin precursor complex with amines. It crystallizes from toluene as the stoichiometric disolvate 1,1,3,3-tetrabenzyl-1-chloro-3-hydroxydistannoxane–toluene (1/2).![[link]](../../../../../../logos/arrows/e_arr.gif)
The tetranuclear molecule is a dimeric form of the simple distannoxane ClSn(CH2Ph)2OSn(CH2Ph)2OH. The dimer lies across a centre of inversion and the Sn4O4 framework, which is essentially planar, takes the form of three edge-fused Sn2O2 rings (Fig. 1
and Table 1
). Each of the two independent Sn atoms is five-coordinate, adopting approximate trigonal bipyramidal coordination, as demonstrated by the bond angles (Table 1
): the benzyl groups occupy equatorial sites and the unique Cl bonded to Sn2 occupies an axial site.
This type of molecular architecture appears to be rather characteristic of functionalized distannoxanes XSnR2OSnR2Y, where X and Y are electron-rich substituents, such as OH, Cl, I or NCS, all of which are capable of coordinating to a second Sn atom (Chow, 1971
; Puff et al., 1981
; Graziani et al., 1983
; Blair et al., 1997
; Dakternieks et al., 1997
; Lu et al., 2001
). The present example is unusual only inasmuch as the two electron-rich substituents X and Y are different, here Cl and OH; in most previously reported examples, these two substituents are the same, although an example with X = I and Y = OEt has been reported by Blair et al. (1997
).
The Sn—O distances for the equatorial sites are slightly shorter than those for the axial sites (Table 1
) and the Sn—C distances lie in the rather narrow range 2.144 (3)–2.156 (4) Å. There are no direction-specific interactions between the dimeric tin units. In particular, the hydroxyl group acts neither as a donor nor as an acceptor of hydrogen bonds: there are no O or C atoms within 3.6 Å of atom O2 other than those in the same dimer unit, and none of these is appropriately positioned to act as a hydrogen-bond donor or acceptor. It is likely that the hydroxyl group at (x, y, z) is effectively shielded by the adjacent benzyl substituents, especially by the phenyl rings C11–C16 and C21–C26 at (x, y, z) and C41–C46 at (1 − x, 1 − y, 1 − z) (Figs. 1 and 2).
| Figure 1 The asymmetric unit of (I ), showing the atom-labelling scheme. Displacement ellipsoids are drawn at the 30% probability level. For the sake of clarity, the toluene solvent molecule has been omitted. |
| Figure 2 The centrosymmetric distannoxane dimer and the unique toluene solvent molecule. Displacement ellipsoids are drawn at the 30% probability level. For the sake of clarity, the phenyl ring atoms Cn2–Cn6 (n = 1–4) and the associated H atoms have been omitted. The atoms with the suffix a are at the symmetry position (1 − x, 1 − y, 1 − z). |
Experimental
The title distannoxane was obtained as an adventitious product from the attempted reaction of dibenzyldichlorotin(IV) with either 2-(dimethylamino)pyridine or N,N,N′,N′-tetramethylethylenediamine. Crystallization from toluene solution gave the stoichiometric disolvate (I
) in each case. Crystals of both were examined, and they proved to have identical cell dimensions; data sets were collected for both and they gave essentially identical refinements.
Crystal data
|
Data collection
Refinement
|
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
All H atoms were located from difference maps and then treated as riding atoms. H atoms bonded to C atoms were assigned C—H distances of 0.95 (aromatic) or 0.99 Å (CH2), with Uiso(H) = 1.2Ueq(C); the H atom bonded to O2 was assigned an O—H distance of 0.84 Å and a Uiso(H) value of 1.2Ueq(O). The anisotropic displacement parameter values gave some indication of libration about Sn—C bonds in several of the benzyl groups: however, it did not prove possible to account for this using a static disorder model. The highest maximum is the diference map is adjacemt to the C45—C46 bond, 1.15 Å from C45 and 1.00 Å from C46; the deepest hole is 0.85 Å from Sn2.
Data collection: KappaCCD Server Software (Nonius, 1997
); cell refinement: DENZO–SMN (Otwinowski & Minor, 1997
); data reduction: DENZO–SMN; program(s) used to solve structure: OSCAIL (McArdle, 2003
) and SHELXS97 (Sheldrick, 1997
); program(s) used to refine structure: OSCAIL and SHELXL97 (Sheldrick, 1997
); molecular graphics: PLATON (Spek, 2003
); software used to prepare material for publication: SHELXL97 and PRPKAPPA (Ferguson, 1999
).
Supporting information
contains datablocks global, I. DOI: https://doi.org/10.1107/S160053680400697X/lh6189sup1.cif
Structure factors: contains datablock I. DOI: https://doi.org/10.1107/S160053680400697X/lh6189Isup2.hkl
Data collection: KappaCCD Server Software (Nonius, 1997); cell DENZO-SMN (Otwinowski & Minor, 1997); data reduction: DENZO-SMN; program(s) used to solve structure: OSCAIL (McArdle, 2003) and SHELXS97 (Sheldrick, 1997); program(s) used to refine structure: OSCAIL and SHELXL97 (Sheldrick, 1997); molecular graphics: PLATON (Spek, 2003); software used to prepare material for publication: SHELXL97 and PRPKAPPA (Ferguson, 1999).
| [Sn4(C7H7)Cl2O2(OH)2]·2C7H8 | F(000) = 1520 |
| Mr = 1525.03 | Dx = 1.594 Mg m−3 |
| Monoclinic, P21/n | Mo Kα radiation, λ = 0.71073 Å |
| Hall symbol: -P 2yn | Cell parameters from 7235 reflections |
| a = 10.0738 (2) Å | θ = 3.3–27.5° |
| b = 15.5680 (3) Å | µ = 1.69 mm−1 |
| c = 20.3943 (3) Å | T = 120 K |
| β = 96.673 (1)° | Block, colourless |
| V = 3176.75 (10) Å3 | 0.40 × 0.20 × 0.10 mm |
| Z = 2 |
| Nonius KappaCCD diffractometer | 7235 independent reflections |
| Radiation source: rotating anode | 5628 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.074 |
| φ scans, and ω scans with κ offsets | θmax = 27.5°, θmin = 3.3° |
| Absorption correction: multi-scan (SORTAV; Blessing, 1995, 1997) | h = −13→13 |
| Tmin = 0.552, Tmax = 0.850 | k = −20→20 |
| 38321 measured reflections | l = −26→26 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.039 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.088 | H-atom parameters constrained |
| S = 1.04 | w = 1/[σ2(Fo2) + (0.0369P)2 + 3.0069P] where P = (Fo2 + 2Fc2)/3 |
| 7235 reflections | (Δ/σ)max = 0.002 |
| 361 parameters | Δρmax = 1.03 e Å−3 |
| 0 restraints | Δρmin = −1.08 e Å−3 |
| x | y | z | Uiso*/Ueq | Occ. (<1) | |
| Sn1 | 0.47186 (2) | 0.400543 (15) | 0.526877 (11) | 0.02463 (8) | |
| Sn2 | 0.38725 (2) | 0.613123 (16) | 0.615749 (12) | 0.02976 (8) | |
| Cl1 | 0.31601 (10) | 0.48300 (6) | 0.67267 (5) | 0.0391 (2) | |
| O1 | 0.4503 (2) | 0.53387 (15) | 0.54706 (11) | 0.0257 (5) | |
| O2 | 0.5363 (2) | 0.30670 (17) | 0.46019 (12) | 0.0338 (6) | |
| C11 | 0.5656 (3) | 0.2717 (2) | 0.63170 (16) | 0.0280 (8) | |
| C12 | 0.4452 (4) | 0.2526 (2) | 0.65557 (18) | 0.0330 (8) | |
| C13 | 0.4112 (4) | 0.1698 (2) | 0.67068 (18) | 0.0358 (9) | |
| C14 | 0.4984 (4) | 0.1025 (2) | 0.66102 (19) | 0.0359 (9) | |
| C15 | 0.6181 (4) | 0.1201 (2) | 0.6384 (2) | 0.0386 (9) | |
| C16 | 0.6522 (4) | 0.2042 (3) | 0.62379 (18) | 0.0356 (9) | |
| C17 | 0.5992 (4) | 0.3619 (2) | 0.61338 (18) | 0.0338 (8) | |
| C21 | 0.1925 (3) | 0.4032 (2) | 0.45308 (18) | 0.0284 (8) | |
| C22 | 0.1784 (4) | 0.3588 (3) | 0.3935 (2) | 0.0465 (11) | |
| C23 | 0.1146 (5) | 0.3957 (6) | 0.3372 (3) | 0.084 (2) | |
| C24 | 0.0619 (6) | 0.4748 (6) | 0.3382 (4) | 0.111 (3) | |
| C25 | 0.0737 (6) | 0.5207 (4) | 0.3969 (5) | 0.105 (3) | |
| C26 | 0.1393 (4) | 0.4847 (3) | 0.4539 (3) | 0.0618 (14) | |
| C27 | 0.2647 (3) | 0.3649 (3) | 0.51373 (18) | 0.0327 (8) | |
| C31 | 0.5053 (3) | 0.6673 (2) | 0.75837 (18) | 0.0322 (8) | |
| C32 | 0.4554 (4) | 0.7470 (2) | 0.77449 (19) | 0.0350 (9) | |
| C33 | 0.4260 (4) | 0.7653 (3) | 0.8375 (2) | 0.0409 (10) | |
| C34 | 0.4463 (4) | 0.7043 (3) | 0.8862 (2) | 0.0430 (10) | |
| C35 | 0.4933 (4) | 0.6240 (3) | 0.8716 (2) | 0.0415 (10) | |
| C36 | 0.5223 (4) | 0.6056 (3) | 0.8078 (2) | 0.0367 (9) | |
| C37 | 0.5432 (4) | 0.6508 (3) | 0.69090 (19) | 0.0396 (9) | |
| C41 | 0.1906 (3) | 0.7620 (2) | 0.60061 (19) | 0.0336 (9) | |
| C42 | 0.1958 (4) | 0.8100 (3) | 0.5442 (2) | 0.0479 (11) | |
| C43 | 0.2033 (5) | 0.8968 (3) | 0.5428 (3) | 0.0645 (14) | |
| C44 | 0.2060 (5) | 0.9399 (4) | 0.5986 (3) | 0.0645 (14) | |
| C45 | 0.1993 (5) | 0.9013 (4) | 0.6576 (3) | 0.0660 (17) | |
| C46 | 0.1896 (4) | 0.8070 (4) | 0.6590 (2) | 0.0608 (14) | |
| C47 | 0.1893 (4) | 0.6669 (3) | 0.5971 (3) | 0.0643 (15) | |
| C51 | 0.7260 (5) | 0.8822 (3) | 0.6469 (2) | 0.0468 (11) | |
| C52 | 0.5969 (5) | 0.8867 (3) | 0.6167 (3) | 0.0600 (15) | |
| C53 | 0.5732 (6) | 0.8918 (3) | 0.5481 (4) | 0.078 (2) | |
| C54 | 0.6756 (9) | 0.8928 (3) | 0.5118 (3) | 0.084 (2) | |
| C55 | 0.8000 (7) | 0.8893 (3) | 0.5407 (3) | 0.0664 (15) | |
| C56 | 0.8286 (5) | 0.8841 (3) | 0.6077 (3) | 0.0544 (12) | |
| C57 | 0.7563 (9) | 0.8762 (5) | 0.7207 (3) | 0.122 (3) | |
| H2 | 0.5182 | 0.2541 | 0.4618 | 0.041* | |
| H12 | 0.3847 | 0.2979 | 0.6616 | 0.040* | |
| H13 | 0.3290 | 0.1586 | 0.6876 | 0.043* | |
| H14 | 0.4748 | 0.0450 | 0.6701 | 0.043* | |
| H15 | 0.6786 | 0.0746 | 0.6325 | 0.046* | |
| H16 | 0.7359 | 0.2154 | 0.6082 | 0.043* | |
| H17A | 0.6938 | 0.3650 | 0.6048 | 0.041* | |
| H17B | 0.5869 | 0.4013 | 0.6503 | 0.041* | |
| H22 | 0.2132 | 0.3023 | 0.3917 | 0.056* | |
| H23 | 0.1079 | 0.3647 | 0.2968 | 0.101* | |
| H24 | 0.0168 | 0.4991 | 0.2991 | 0.133* | |
| H25 | 0.0369 | 0.5768 | 0.3981 | 0.127* | |
| H26 | 0.1476 | 0.5165 | 0.4939 | 0.074* | |
| H27A | 0.2575 | 0.3015 | 0.5111 | 0.039* | |
| H27B | 0.2220 | 0.3840 | 0.5526 | 0.039* | |
| H32 | 0.4413 | 0.7899 | 0.7413 | 0.042* | |
| H33 | 0.3917 | 0.8202 | 0.8471 | 0.049* | |
| H34 | 0.4280 | 0.7172 | 0.9297 | 0.052* | |
| H35 | 0.5060 | 0.5813 | 0.9050 | 0.050* | |
| H36 | 0.5540 | 0.5501 | 0.7980 | 0.044* | |
| H37A | 0.6124 | 0.6053 | 0.6945 | 0.048* | |
| H37B | 0.5851 | 0.7037 | 0.6758 | 0.048* | |
| H42 | 0.1938 | 0.7801 | 0.5035 | 0.057* | |
| H43 | 0.2067 | 0.9262 | 0.5022 | 0.077* | |
| H44 | 0.2130 | 1.0007 | 0.5973 | 0.077* | |
| H45 | 0.2009 | 0.9341 | 0.6970 | 0.079* | |
| H46 | 0.1827 | 0.7776 | 0.6992 | 0.073* | |
| H47A | 0.1484 | 0.6488 | 0.5528 | 0.077* | |
| H47B | 0.1334 | 0.6441 | 0.6300 | 0.077* | |
| H52 | 0.5241 | 0.8863 | 0.6424 | 0.072* | |
| H53 | 0.4841 | 0.8945 | 0.5270 | 0.094* | |
| H54 | 0.6589 | 0.8961 | 0.4651 | 0.101* | |
| H55 | 0.8714 | 0.8904 | 0.5141 | 0.080* | |
| H56 | 0.9189 | 0.8817 | 0.6272 | 0.065* | |
| H57A | 0.8468 | 0.8535 | 0.7320 | 0.183* | 0.50 |
| H57B | 0.6917 | 0.8377 | 0.7381 | 0.183* | 0.50 |
| H57C | 0.7502 | 0.9334 | 0.7402 | 0.183* | 0.50 |
| H57D | 0.6790 | 0.8963 | 0.7415 | 0.183* | 0.50 |
| H57E | 0.8341 | 0.9120 | 0.7354 | 0.183* | 0.50 |
| H57F | 0.7756 | 0.8164 | 0.7334 | 0.183* | 0.50 |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Sn1 | 0.02328 (13) | 0.02541 (13) | 0.02479 (13) | 0.00154 (9) | 0.00109 (9) | 0.00599 (10) |
| Sn2 | 0.02910 (14) | 0.02791 (15) | 0.03366 (15) | 0.00235 (10) | 0.00955 (11) | 0.00097 (10) |
| Cl1 | 0.0486 (6) | 0.0358 (5) | 0.0352 (5) | −0.0013 (4) | 0.0148 (4) | 0.0039 (4) |
| O1 | 0.0289 (13) | 0.0233 (13) | 0.0253 (12) | 0.0027 (9) | 0.0044 (10) | 0.0051 (10) |
| O2 | 0.0361 (14) | 0.0292 (14) | 0.0371 (14) | 0.0033 (11) | 0.0081 (12) | 0.0004 (11) |
| C11 | 0.0285 (19) | 0.033 (2) | 0.0205 (17) | 0.0049 (15) | −0.0045 (14) | 0.0040 (15) |
| C12 | 0.033 (2) | 0.033 (2) | 0.033 (2) | 0.0057 (16) | 0.0023 (16) | 0.0053 (16) |
| C13 | 0.034 (2) | 0.040 (2) | 0.033 (2) | −0.0006 (17) | 0.0016 (16) | 0.0058 (17) |
| C14 | 0.044 (2) | 0.027 (2) | 0.034 (2) | −0.0016 (17) | −0.0068 (17) | 0.0031 (16) |
| C15 | 0.041 (2) | 0.032 (2) | 0.042 (2) | 0.0094 (17) | −0.0018 (18) | 0.0014 (17) |
| C16 | 0.031 (2) | 0.042 (2) | 0.033 (2) | 0.0062 (17) | −0.0005 (16) | 0.0078 (17) |
| C17 | 0.032 (2) | 0.037 (2) | 0.0306 (19) | 0.0026 (16) | −0.0055 (16) | 0.0099 (17) |
| C21 | 0.0207 (17) | 0.031 (2) | 0.0326 (19) | −0.0069 (14) | −0.0015 (14) | 0.0056 (15) |
| C22 | 0.024 (2) | 0.078 (3) | 0.038 (2) | 0.000 (2) | 0.0022 (17) | −0.008 (2) |
| C23 | 0.029 (3) | 0.190 (8) | 0.033 (3) | −0.013 (4) | 0.000 (2) | 0.014 (4) |
| C24 | 0.037 (3) | 0.183 (9) | 0.102 (5) | −0.041 (4) | −0.033 (3) | 0.101 (6) |
| C25 | 0.052 (3) | 0.059 (4) | 0.189 (8) | −0.015 (3) | −0.058 (4) | 0.062 (5) |
| C26 | 0.042 (3) | 0.035 (3) | 0.100 (4) | 0.001 (2) | −0.028 (3) | −0.003 (2) |
| C27 | 0.0278 (19) | 0.039 (2) | 0.032 (2) | −0.0045 (16) | 0.0036 (16) | 0.0058 (17) |
| C31 | 0.0242 (18) | 0.039 (2) | 0.034 (2) | −0.0081 (16) | 0.0074 (15) | −0.0056 (17) |
| C32 | 0.031 (2) | 0.035 (2) | 0.040 (2) | −0.0055 (16) | 0.0082 (17) | 0.0010 (17) |
| C33 | 0.031 (2) | 0.040 (2) | 0.053 (3) | −0.0071 (17) | 0.0098 (18) | −0.011 (2) |
| C34 | 0.038 (2) | 0.059 (3) | 0.033 (2) | −0.014 (2) | 0.0116 (18) | −0.010 (2) |
| C35 | 0.039 (2) | 0.047 (3) | 0.038 (2) | −0.0115 (19) | 0.0019 (18) | 0.0078 (19) |
| C36 | 0.031 (2) | 0.036 (2) | 0.043 (2) | −0.0024 (16) | 0.0039 (17) | −0.0016 (18) |
| C37 | 0.032 (2) | 0.047 (3) | 0.040 (2) | −0.0056 (18) | 0.0085 (17) | −0.0023 (19) |
| C41 | 0.0215 (18) | 0.038 (2) | 0.041 (2) | 0.0083 (15) | 0.0025 (16) | −0.0013 (18) |
| C42 | 0.047 (3) | 0.048 (3) | 0.049 (3) | 0.013 (2) | 0.006 (2) | 0.002 (2) |
| C43 | 0.060 (3) | 0.055 (3) | 0.080 (4) | 0.014 (2) | 0.014 (3) | 0.014 (3) |
| C44 | 0.050 (3) | 0.055 (3) | 0.086 (4) | 0.002 (2) | 0.000 (3) | −0.003 (3) |
| C45 | 0.042 (3) | 0.085 (4) | 0.068 (4) | 0.019 (2) | −0.008 (2) | −0.053 (3) |
| C46 | 0.044 (3) | 0.100 (4) | 0.037 (2) | 0.034 (3) | 0.001 (2) | −0.005 (3) |
| C47 | 0.028 (2) | 0.035 (3) | 0.132 (5) | 0.0054 (18) | 0.018 (3) | 0.011 (3) |
| C51 | 0.069 (3) | 0.034 (2) | 0.036 (2) | −0.016 (2) | 0.000 (2) | −0.0021 (18) |
| C52 | 0.048 (3) | 0.027 (2) | 0.112 (5) | −0.0037 (19) | 0.040 (3) | −0.009 (3) |
| C53 | 0.063 (4) | 0.039 (3) | 0.119 (6) | −0.013 (2) | −0.050 (4) | 0.024 (3) |
| C54 | 0.148 (7) | 0.054 (4) | 0.044 (3) | −0.039 (4) | −0.021 (4) | 0.007 (2) |
| C55 | 0.093 (4) | 0.051 (3) | 0.062 (4) | 0.003 (3) | 0.037 (3) | −0.002 (3) |
| C56 | 0.037 (2) | 0.050 (3) | 0.075 (4) | 0.001 (2) | 0.001 (2) | 0.017 (2) |
| C57 | 0.213 (9) | 0.109 (6) | 0.041 (3) | −0.086 (6) | −0.003 (4) | 0.007 (3) |
| Sn1—O1 | 2.132 (2) | C31—C32 | 1.392 (5) |
| Sn1—O2 | 2.147 (2) | C32—C33 | 1.382 (6) |
| Sn1—C17 | 2.143 (3) | C32—H32 | 0.95 |
| Sn1—C27 | 2.146 (3) | C33—C34 | 1.372 (6) |
| Sn1—O1i | 2.051 (2) | C33—H33 | 0.95 |
| Sn2—O1 | 2.024 (2) | C34—C35 | 1.381 (6) |
| Sn2—Cl1 | 2.4819 (10) | C34—H34 | 0.95 |
| Sn2—C37 | 2.145 (4) | C35—C36 | 1.396 (6) |
| Sn2—C47 | 2.156 (4) | C35—H35 | 0.95 |
| Sn2—O2i | 2.197 (3) | C36—H36 | 0.95 |
| O2—H2 | 0.84 | C47—C41 | 1.482 (6) |
| C17—C11 | 1.502 (5) | C47—H47A | 0.99 |
| C17—H17A | 0.99 | C47—H47B | 0.99 |
| C17—H17B | 0.99 | C41—C42 | 1.377 (6) |
| C11—C16 | 1.387 (5) | C41—C46 | 1.382 (6) |
| C11—C12 | 1.391 (5) | C42—C43 | 1.354 (6) |
| C12—C13 | 1.378 (5) | C42—H42 | 0.95 |
| C12—H12 | 0.95 | C43—C44 | 1.318 (7) |
| C13—C14 | 1.395 (5) | C43—H43 | 0.95 |
| C13—H13 | 0.95 | C44—C45 | 1.354 (8) |
| C14—C15 | 1.369 (6) | C44—H44 | 0.95 |
| C14—H14 | 0.95 | C45—C46 | 1.472 (8) |
| C15—C16 | 1.394 (5) | C45—H45 | 0.95 |
| C15—H15 | 0.95 | C46—H46 | 0.95 |
| C16—H16 | 0.95 | C51—C52 | 1.374 (7) |
| C27—C21 | 1.486 (5) | C51—C56 | 1.380 (7) |
| C27—H27A | 0.99 | C51—C57 | 1.503 (7) |
| C27—H27B | 0.99 | C52—C53 | 1.394 (9) |
| C21—C26 | 1.377 (5) | C52—H52 | 0.95 |
| C21—C22 | 1.391 (5) | C53—C54 | 1.338 (10) |
| C22—C23 | 1.376 (7) | C53—H53 | 0.95 |
| C22—H22 | 0.95 | C54—C55 | 1.322 (9) |
| C23—C24 | 1.341 (10) | C54—H54 | 0.95 |
| C23—H23 | 0.95 | C55—C56 | 1.366 (7) |
| C24—C25 | 1.387 (11) | C55—H55 | 0.95 |
| C24—H24 | 0.95 | C56—H56 | 0.95 |
| C25—C26 | 1.387 (8) | C57—H57A | 0.98 |
| C25—H25 | 0.95 | C57—H57B | 0.98 |
| C26—H26 | 0.95 | C57—H57C | 0.98 |
| C37—C31 | 1.492 (5) | C57—H57D | 0.98 |
| C37—H37A | 0.99 | C57—H57E | 0.98 |
| C37—H37B | 0.99 | C57—H57F | 0.98 |
| C31—C36 | 1.388 (5) | ||
| O1—Sn1—O2 | 146.07 (9) | C36—C31—C37 | 121.8 (4) |
| O1—Sn1—O1i | 73.34 (10) | C32—C31—C37 | 120.6 (4) |
| O1—Sn1—C17 | 100.30 (12) | C33—C32—C31 | 121.7 (4) |
| O1—Sn1—C27 | 99.02 (12) | C33—C32—H32 | 119.1 |
| O2—Sn1—C17 | 97.73 (13) | C31—C32—H32 | 119.1 |
| O2—Sn1—C27 | 96.07 (13) | C34—C33—C32 | 119.9 (4) |
| O2—Sn1—O1i | 72.76 (10) | C34—C33—H33 | 120.0 |
| O1i—Sn1—C17 | 120.11 (12) | C32—C33—H33 | 120.0 |
| O1i—Sn1—C27 | 119.09 (11) | C33—C34—C35 | 119.8 (4) |
| C17—Sn1—C27 | 120.70 (14) | C33—C34—H34 | 120.1 |
| Sn1—O1—Sn2 | 140.75 (11) | C35—C34—H34 | 120.1 |
| Sn1i—O1—Sn1 | 106.66 (10) | C34—C35—C36 | 120.0 (4) |
| Cl1—Sn2—O2i | 159.64 (7) | C34—C35—H35 | 120.0 |
| Cl1—Sn2—O1 | 87.55 (7) | C36—C35—H35 | 120.0 |
| Cl1—Sn2—C37 | 96.70 (12) | C31—C36—C35 | 120.9 (4) |
| Cl1—Sn2—C47 | 95.02 (13) | C31—C36—H36 | 119.5 |
| O2i—Sn2—O1 | 72.21 (10) | C35—C36—H36 | 119.5 |
| O2i—Sn2—C37 | 93.47 (13) | C41—C47—Sn2 | 112.1 (3) |
| O2i—Sn2—C47 | 92.76 (15) | C41—C47—H47A | 109.2 |
| O1—Sn2—C37 | 113.48 (13) | Sn2—C47—H47A | 109.2 |
| O1—Sn2—C47 | 118.24 (18) | C41—C47—H47B | 109.2 |
| C37—Sn2—C47 | 127.27 (19) | Sn2—C47—H47B | 109.2 |
| Sn1i—O1—Sn2 | 112.52 (11) | H47A—C47—H47B | 107.9 |
| Sn1—O2—Sn2i | 102.50 (11) | C42—C41—C46 | 116.7 (4) |
| Sn1—O2—H2 | 123.7 | C42—C41—C47 | 120.2 (4) |
| Sn2i—O2—H2 | 132.7 | C46—C41—C47 | 123.1 (4) |
| C11—C17—Sn1 | 109.7 (2) | C43—C42—C41 | 124.5 (5) |
| C11—C17—H17A | 109.7 | C43—C42—H42 | 117.8 |
| Sn1—C17—H17A | 109.7 | C41—C42—H42 | 117.8 |
| C11—C17—H17B | 109.7 | C44—C43—C42 | 119.1 (5) |
| Sn1—C17—H17B | 109.7 | C44—C43—H43 | 120.5 |
| H17A—C17—H17B | 108.2 | C42—C43—H43 | 120.5 |
| C16—C11—C12 | 117.7 (3) | C43—C44—C45 | 122.9 (5) |
| C16—C11—C17 | 121.1 (3) | C43—C44—H44 | 118.6 |
| C12—C11—C17 | 121.2 (3) | C45—C44—H44 | 118.6 |
| C13—C12—C11 | 121.9 (3) | C44—C45—C46 | 118.0 (4) |
| C13—C12—H12 | 119.1 | C44—C45—H45 | 121.0 |
| C11—C12—H12 | 119.1 | C46—C45—H45 | 121.0 |
| C12—C13—C14 | 119.6 (4) | C41—C46—C45 | 118.8 (5) |
| C12—C13—H13 | 120.2 | C41—C46—H46 | 120.6 |
| C14—C13—H13 | 120.2 | C45—C46—H46 | 120.6 |
| C15—C14—C13 | 119.4 (4) | C52—C51—C56 | 118.1 (4) |
| C15—C14—H14 | 120.3 | C52—C51—C57 | 121.6 (6) |
| C13—C14—H14 | 120.3 | C56—C51—C57 | 120.2 (5) |
| C14—C15—C16 | 120.6 (4) | C51—C52—C53 | 119.7 (5) |
| C14—C15—H15 | 119.7 | C51—C52—H52 | 120.1 |
| C16—C15—H15 | 119.7 | C53—C52—H52 | 120.1 |
| C11—C16—C15 | 120.8 (4) | C54—C53—C52 | 120.2 (5) |
| C11—C16—H16 | 119.6 | C54—C53—H53 | 119.9 |
| C15—C16—H16 | 119.6 | C52—C53—H53 | 119.9 |
| C21—C27—Sn1 | 112.0 (2) | C55—C54—C53 | 120.3 (5) |
| C21—C27—H27A | 109.2 | C55—C54—H54 | 119.8 |
| Sn1—C27—H27A | 109.2 | C53—C54—H54 | 119.8 |
| C21—C27—H27B | 109.2 | C54—C55—C56 | 121.8 (5) |
| Sn1—C27—H27B | 109.2 | C54—C55—H55 | 119.1 |
| H27A—C27—H27B | 107.9 | C56—C55—H55 | 119.1 |
| C26—C21—C22 | 117.9 (4) | C55—C56—C51 | 119.8 (5) |
| C26—C21—C27 | 120.9 (4) | C55—C56—H56 | 120.1 |
| C22—C21—C27 | 121.2 (4) | C51—C56—H56 | 120.1 |
| C23—C22—C21 | 120.8 (5) | C51—C57—H57A | 109.5 |
| C23—C22—H22 | 119.6 | C51—C57—H57B | 109.5 |
| C21—C22—H22 | 119.6 | H57A—C57—H57B | 109.5 |
| C24—C23—C22 | 121.1 (6) | C51—C57—H57C | 109.5 |
| C24—C23—H23 | 119.4 | H57A—C57—H57C | 109.5 |
| C22—C23—H23 | 119.4 | H57B—C57—H57C | 109.5 |
| C23—C24—C25 | 119.5 (5) | C51—C57—H57D | 109.5 |
| C23—C24—H24 | 120.3 | H57A—C57—H57D | 141.1 |
| C25—C24—H24 | 120.3 | H57B—C57—H57D | 56.3 |
| C26—C25—C24 | 120.0 (6) | H57C—C57—H57D | 56.3 |
| C26—C25—H25 | 120.0 | C51—C57—H57E | 109.5 |
| C24—C25—H25 | 120.0 | H57A—C57—H57E | 56.3 |
| C21—C26—C25 | 120.7 (6) | H57B—C57—H57E | 141.1 |
| C21—C26—H26 | 119.7 | H57C—C57—H57E | 56.3 |
| C25—C26—H26 | 119.7 | H57D—C57—H57E | 109.5 |
| C31—C37—Sn2 | 117.5 (2) | C51—C57—H57F | 109.5 |
| C31—C37—H37A | 107.9 | H57A—C57—H57F | 56.3 |
| Sn2—C37—H37A | 107.9 | H57B—C57—H57F | 56.3 |
| C31—C37—H37B | 107.9 | H57C—C57—H57F | 141.1 |
| Sn2—C37—H37B | 107.9 | H57D—C57—H57F | 109.5 |
| H37A—C37—H37B | 107.2 | H57E—C57—H57F | 109.5 |
| C36—C31—C32 | 117.6 (3) | ||
| C37—Sn2—O1—Sn1i | −84.97 (16) | C22—C23—C24—C25 | 1.1 (9) |
| C47—Sn2—O1—Sn1i | 84.40 (17) | C23—C24—C25—C26 | −0.2 (9) |
| O2i—Sn2—O1—Sn1i | 1.01 (10) | C22—C21—C26—C25 | 0.1 (7) |
| Cl1—Sn2—O1—Sn1i | 178.79 (10) | C27—C21—C26—C25 | 179.0 (4) |
| C37—Sn2—O1—Sn1 | 91.3 (2) | C24—C25—C26—C21 | −0.4 (9) |
| C47—Sn2—O1—Sn1 | −99.3 (2) | O1—Sn2—C37—C31 | −148.5 (3) |
| O2i—Sn2—O1—Sn1 | 177.3 (2) | C47—Sn2—C37—C31 | 43.3 (4) |
| Cl1—Sn2—O1—Sn1 | −4.95 (17) | O2i—Sn2—C37—C31 | 139.4 (3) |
| O1i—Sn1—O1—Sn2 | −176.4 (2) | Cl1—Sn2—C37—C31 | −58.3 (3) |
| C17—Sn1—O1—Sn2 | −57.9 (2) | Sn2—C37—C31—C36 | 98.0 (4) |
| C27—Sn1—O1—Sn2 | 65.8 (2) | Sn2—C37—C31—C32 | −84.2 (4) |
| O2—Sn1—O1—Sn2 | −178.86 (14) | C36—C31—C32—C33 | 1.2 (5) |
| C17—Sn1—O1—Sn1i | 118.54 (13) | C37—C31—C32—C33 | −176.7 (3) |
| C27—Sn1—O1—Sn1i | −117.80 (12) | C31—C32—C33—C34 | 0.2 (6) |
| O2—Sn1—O1—Sn1i | −2.5 (2) | C32—C33—C34—C35 | −1.4 (6) |
| O1i—Sn1—O2—Sn2i | −0.90 (8) | C33—C34—C35—C36 | 1.1 (6) |
| O1—Sn1—O2—Sn2i | 1.6 (2) | C32—C31—C36—C35 | −1.6 (5) |
| C17—Sn1—O2—Sn2i | −120.10 (13) | C37—C31—C36—C35 | 176.3 (3) |
| C27—Sn1—O2—Sn2i | 117.72 (12) | C34—C35—C36—C31 | 0.4 (6) |
| O1i—Sn1—C17—C11 | −137.0 (2) | O1—Sn2—C47—C41 | −124.5 (3) |
| O1—Sn1—C17—C11 | 146.4 (2) | C37—Sn2—C47—C41 | 43.2 (5) |
| C27—Sn1—C17—C11 | 39.3 (3) | O2i—Sn2—C47—C41 | −53.3 (4) |
| O2—Sn1—C17—C11 | −62.5 (3) | Cl1—Sn2—C47—C41 | 145.6 (4) |
| Sn1—C17—C11—C16 | 109.4 (3) | Sn2—C47—C41—C42 | 93.2 (4) |
| Sn1—C17—C11—C12 | −69.0 (4) | Sn2—C47—C41—C46 | −85.5 (4) |
| C16—C11—C12—C13 | −0.4 (5) | C46—C41—C42—C43 | 1.8 (6) |
| C17—C11—C12—C13 | 178.0 (3) | C47—C41—C42—C43 | −176.9 (4) |
| C11—C12—C13—C14 | −1.0 (6) | C41—C42—C43—C44 | −0.1 (8) |
| C12—C13—C14—C15 | 1.8 (6) | C42—C43—C44—C45 | −1.1 (8) |
| C13—C14—C15—C16 | −1.2 (6) | C43—C44—C45—C46 | 0.4 (8) |
| C12—C11—C16—C15 | 1.0 (5) | C42—C41—C46—C45 | −2.4 (6) |
| C17—C11—C16—C15 | −177.4 (3) | C47—C41—C46—C45 | 176.3 (4) |
| C14—C15—C16—C11 | −0.2 (6) | C44—C45—C46—C41 | 1.4 (6) |
| O1i—Sn1—C27—C21 | −7.7 (3) | C56—C51—C52—C53 | 0.9 (6) |
| O1—Sn1—C27—C21 | 68.2 (3) | C57—C51—C52—C53 | −179.7 (5) |
| C17—Sn1—C27—C21 | 175.9 (2) | C51—C52—C53—C54 | −0.4 (7) |
| O2—Sn1—C27—C21 | −81.4 (3) | C52—C53—C54—C55 | −0.2 (8) |
| Sn1—C27—C21—C26 | −85.8 (4) | C53—C54—C55—C56 | 0.4 (8) |
| Sn1—C27—C21—C22 | 93.1 (4) | C54—C55—C56—C51 | 0.1 (8) |
| C26—C21—C22—C23 | 0.8 (6) | C52—C51—C56—C55 | −0.7 (7) |
| C27—C21—C22—C23 | −178.2 (4) | C57—C51—C56—C55 | 179.8 (5) |
| C21—C22—C23—C24 | −1.4 (7) |
| Symmetry code: (i) −x+1, −y+1, −z+1. |
Footnotes
‡Postal address: Department of Electrical Engineering and Physics, University of Dundee, Dundee DD1 4HN, Scotland
Acknowledgements
X-ray data were collected at the EPSRC X-ray Crystallographic Service, University of Southampton, England; the authors thank the staff for all their help and advice. JNL thanks NCR Self-Service, Dundee, for grants which have provided computing facilities for this work.
References
Blair, J. A., Howie, R. A., Wardell, J. L. & Cox, P. J. (1997). Polyhedron, 16, 881–888. CSD CrossRef CAS Web of Science Google Scholar
Blessing, R. H. (1995). Acta Cryst. A51, 33–37. CrossRef CAS Web of Science IUCr Journals Google Scholar
Blessing, R. H. (1997). J. Appl. Cryst. 30, 421–426. CrossRef CAS Web of Science IUCr Journals Google Scholar
Chow, Y. M. (1971). Inorg. Chem. 10, 673–677. CSD CrossRef CAS Web of Science Google Scholar
Dakternieks, D., Jurkschat, K., Dreumel, S. & Tiekink, E. R. T. (1997). Inorg. Chem. 36, 2023–2029. CSD CrossRef PubMed CAS Web of Science Google Scholar
Ferguson, G. (1999). PRPKAPPA. University of Guelph, Canada. Google Scholar
Graziani, R., Casellato, U. & Plazzogna, G. (1983). Acta Cryst. C39, 1188–1190. CSD CrossRef CAS Web of Science IUCr Journals Google Scholar
Lu, Y., Leng, X., Wang, H., Xie, Q. & Li, J. (2001). Acta Cryst. C57, 1391–1392. Web of Science CSD CrossRef CAS IUCr Journals Google Scholar
McArdle, P. (2003). OSCAIL for Windows. Version 10. Crystallography Centre, Chemistry Department, NUI Galway, Ireland. Google Scholar
Nonius (1997). KappaCCD Server Software. Windows 3.11 Version, Nonius BV, Delft, The Netherlands. Google Scholar
Otwinowski, Z. & Minor, W. (1997). Methods in Enzymology, Vol. 276, Macromolecular Crystallography, Part A, edited by C. W. Carter Jr and R. M. Sweet, pp. 307–326. New York: Academic Press. Google Scholar
Puff, H., Freidrichs, E. & Visel, F. (1981). Z. Anorg. Allg. Chem. 477, 50–58. CSD CrossRef CAS Web of Science Google Scholar
Sheldrick, G. M. (1997). SHELXS97 and SHELXL97. University of Göttingen, Germany. Google Scholar
Spek, A. L. (2003). J. Appl. Cryst. 36, 7–13. Web of Science CrossRef CAS IUCr Journals Google Scholar
© International Union of Crystallography. Prior permission is not required to reproduce short quotations, tables and figures from this article, provided the original authors and source are cited. For more information, click here.


journal menu



