metal-organic compounds
Tris(ethane-1,2-diamine)copper(II) bis(trifluoroacetate)
aInorganic Chemistry Division, Chemistry Department, Moscow State University, 119991 Leninskie Gory 1-3, Moscow, Russian Federation, and bGeneral Chemistry Division, Chemistry Department, Moscow State University, 119991 Leninskie Gory 1-3, Moscow, Russian Federation
*Correspondence e-mail: [email protected]
In the title complex, [Cu(H2NCH2CH2NH2)3](CF3COO)2, the environment of the Cu atom is distorted octahedral, formed by six N atoms from three chelating ethane-1,2-diamine ligands. The Cu—N distances range from 2.050 (2) to 2.300 (2) Å. This complex cation and the two trifluoroacetate anions are connected by weak N—H⋯O and N—H⋯F hydrogen bonds, forming a three-dimensional framework. In both anions, the F atoms are disordered over two positions; in one the site-occupancy factors are 0.55 and 0.45, in the other the values are 0.69 and 0.31.
Related literature
For other carboxylate complexes, see: Karpova et al. (1998
); Karpova et al. (2001
); Gutnikov et al. (2006
); Karpova et al. (2007
).
Experimental
Crystal data
|
Data collection
|
Refinement
|
|
Data collection: SMART (Bruker, 2000
); cell refinement: SAINT (Bruker, 2000
); data reduction: SAINT; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97; molecular graphics: ORTEP-3 (Farrugia, 1997
); software used to prepare material for publication: WinGX (Farrugia, 1999
).
Supporting information
contains datablocks global, I, publication_text. DOI: 10.1107/S1600536808001438/wn2235sup1.cif
Structure factors: contains datablock I. DOI: 10.1107/S1600536808001438/wn2235Isup2.hkl
An ethanol solution of [Cu(CF3COO)2(CH3CN)]2(CH3CN)2 was mixed with ethylenediamine in a 1:4 molar ratio. After several days blue prism-shaped crystals were formed in a desiccator over P4O10.
All H atoms were positioned geometrically and refined using a riding model (including about C—C or C—N bonds) with C—H = 0.97 Å, N—H = 0.90 Å and with Uiso(H) = 1.2Ueq(C,N). The DELU option in SHELXL97 was used with parameters 0.0001, 0.0001 for all bonds Cu1—N; for all C—O and C—F bonds. The MERG option with parameter 2 was used before The F atoms are disordered over two positions, with site occupancy ratios 0.55 (3)/0.45 (3) and 0.69 (2)/0.31 (2).
Data collection: SMART (Bruker, 2000); cell SAINT (Bruker, 2000); data reduction: SAINT (Bruker, 2000); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: ORTEP-3 (Farrugia, 1997); software used to prepare material for publication: WinGX (Farrugia, 1999).
| [Cu(C2H8N2)3](C2F3O2)2 | Z = 2 |
| Mr = 469.90 | F(000) = 482 |
| Triclinic, P1 | Dx = 1.679 Mg m−3 |
| Hall symbol: -P 1 | Mo Kα radiation, λ = 0.71073 Å |
| a = 8.582 (6) Å | Cell parameters from 250 reflections |
| b = 9.316 (6) Å | θ = 18–24° |
| c = 12.859 (7) Å | µ = 1.26 mm−1 |
| α = 74.73 (3)° | T = 293 K |
| β = 84.69 (4)° | Prism, blue |
| γ = 69.56 (3)° | 0.15 × 0.1 × 0.08 mm |
| V = 929.3 (10) Å3 |
| Bruker SMART CCD area-detector diffractometer | 4277 reflections with I > 2σ(I) |
| Radiation source: fine–focus sealed tube | θmax = 30.0°, θmin = 1.6° |
| Graphite monochromator | h = −11→12 |
| Detector resolution: 0.1 pixels mm-1 | k = 0→13 |
| ϕ and ω scans | l = −17→18 |
| 5406 independent reflections |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.039 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.092 | H-atom parameters constrained |
| S = 0.94 | w = 1/[σ2(Fo2) + (0.0567P)2] where P = (Fo2 + 2Fc2)/3 |
| 5406 reflections | (Δ/σ)max = 0.001 |
| 300 parameters | Δρmax = 0.24 e Å−3 |
| 45 restraints | Δρmin = −0.25 e Å−3 |
| [Cu(C2H8N2)3](C2F3O2)2 | γ = 69.56 (3)° |
| Mr = 469.90 | V = 929.3 (10) Å3 |
| Triclinic, P1 | Z = 2 |
| a = 8.582 (6) Å | Mo Kα radiation |
| b = 9.316 (6) Å | µ = 1.26 mm−1 |
| c = 12.859 (7) Å | T = 293 K |
| α = 74.73 (3)° | 0.15 × 0.1 × 0.08 mm |
| β = 84.69 (4)° |
| Bruker SMART CCD area-detector diffractometer | 4277 reflections with I > 2σ(I) |
| 5406 independent reflections |
| R[F2 > 2σ(F2)] = 0.039 | 45 restraints |
| wR(F2) = 0.092 | H-atom parameters constrained |
| S = 0.94 | Δρmax = 0.24 e Å−3 |
| 5406 reflections | Δρmin = −0.25 e Å−3 |
| 300 parameters |
Experimental. The original HKL file was deleted and the present study was conducted using the merged data set. |
Geometry. All s.u.'s (except the s.u.'s in the dihedral angle between two l.s. planes) are estimated using the full covariance matrix. The cell s.u.'s are taken into account individually in the estimation of s.u.'s in distances, angles and torsion angles; correlations between s.u.'s in cell parameters are only used when they are defined by crystal symmetry. An approximate (isotropic) treatment of cell s.u.'s is used for estimating s.u.'s involving l.s. planes. |
Refinement. Refinement of F2 against ALL reflections. The weighted R–factor wR and goodness of fit S are based on F2, conventional R–factors R are based on F, with F set to zero for negative F2. The threshold expression of F2 > 2σ(F2) is used only for calculating R–factors(gt) etc. and is not relevant to the choice of reflections for refinement. R–factors based on F2 are statistically about twice as large as those based on F, and R–factors based on ALL data will be even larger. |
| x | y | z | Uiso*/Ueq | Occ. (<1) | |
| Cu1 | 0.94303 (3) | 0.85236 (3) | 0.778785 (18) | 0.03254 (8) | |
| N1 | 0.8821 (2) | 0.8734 (2) | 0.93404 (13) | 0.0444 (3) | |
| H1A | 0.9694 | 0.8131 | 0.9777 | 0.053* | |
| H1B | 0.8587 | 0.9745 | 0.9362 | 0.053* | |
| C1 | 0.7376 (3) | 0.8237 (3) | 0.97256 (17) | 0.0486 (5) | |
| H1C | 0.6921 | 0.8610 | 1.0363 | 0.058* | |
| H1D | 0.7726 | 0.7092 | 0.9923 | 0.058* | |
| C2 | 0.6060 (3) | 0.8885 (3) | 0.88718 (19) | 0.0503 (5) | |
| H2C | 0.5139 | 0.8505 | 0.9121 | 0.060* | |
| H2D | 0.5641 | 1.0031 | 0.8708 | 0.060* | |
| N2 | 0.6812 (2) | 0.8352 (2) | 0.79038 (16) | 0.0495 (4) | |
| H2A | 0.6212 | 0.8977 | 0.7314 | 0.059* | |
| H2B | 0.6866 | 0.7350 | 0.7968 | 0.059* | |
| N3 | 0.8604 (2) | 1.1007 (2) | 0.71134 (15) | 0.0471 (4) | |
| H3A | 0.8004 | 1.1244 | 0.6515 | 0.057* | |
| H3B | 0.7948 | 1.1505 | 0.7589 | 0.057* | |
| C3 | 1.0036 (3) | 1.1543 (3) | 0.68450 (19) | 0.0539 (5) | |
| H3C | 0.9672 | 1.2681 | 0.6739 | 0.065* | |
| H3D | 1.0531 | 1.1292 | 0.6177 | 0.065* | |
| C4 | 1.1308 (3) | 1.0764 (3) | 0.77268 (19) | 0.0510 (5) | |
| H4C | 1.2266 | 1.1102 | 0.7523 | 0.061* | |
| H4D | 1.0843 | 1.1079 | 0.8382 | 0.061* | |
| N4 | 1.1826 (2) | 0.9040 (2) | 0.79228 (15) | 0.0457 (4) | |
| H4A | 1.2277 | 0.8564 | 0.8583 | 0.055* | |
| H4B | 1.2577 | 0.8695 | 0.7428 | 0.055* | |
| N5 | 0.9835 (2) | 0.8096 (2) | 0.62842 (13) | 0.0453 (4) | |
| H5A | 0.8923 | 0.8658 | 0.5873 | 0.054* | |
| H5B | 1.0688 | 0.8396 | 0.5965 | 0.054* | |
| C5 | 1.0217 (3) | 0.6405 (3) | 0.6384 (2) | 0.0540 (5) | |
| H5C | 1.0712 | 0.6134 | 0.5721 | 0.065* | |
| H5D | 0.9208 | 0.6139 | 0.6522 | 0.065* | |
| C6 | 1.1414 (3) | 0.5510 (3) | 0.7304 (2) | 0.0541 (5) | |
| H6C | 1.1649 | 0.4382 | 0.7420 | 0.065* | |
| H6D | 1.2451 | 0.5721 | 0.7144 | 0.065* | |
| N6 | 1.0652 (2) | 0.6024 (2) | 0.82682 (15) | 0.0482 (4) | |
| H6A | 1.1435 | 0.5783 | 0.8766 | 0.058* | |
| H6B | 0.9914 | 0.5539 | 0.8555 | 0.058* | |
| C7 | 0.7420 (3) | 0.3504 (3) | 0.91576 (18) | 0.0494 (4) | |
| C8 | 0.5826 (4) | 0.4304 (4) | 0.8472 (3) | 0.0722 (6) | |
| C9 | 0.5876 (3) | 0.1740 (3) | 0.4611 (2) | 0.0526 (5) | |
| C10 | 0.4415 (4) | 0.2533 (4) | 0.5269 (3) | 0.0749 (6) | |
| O1 | 0.8137 (3) | 0.4407 (2) | 0.92515 (17) | 0.0722 (5) | |
| O2 | 0.7776 (3) | 0.2083 (2) | 0.95315 (17) | 0.0721 (5) | |
| O3 | 0.7270 (2) | 0.1248 (2) | 0.50104 (16) | 0.0693 (5) | |
| O4 | 0.5502 (3) | 0.1706 (3) | 0.37227 (17) | 0.0780 (6) | |
| F1A | 0.495 (2) | 0.5750 (14) | 0.8639 (12) | 0.087 (2) | 0.55 (3) |
| F2A | 0.4769 (16) | 0.3531 (13) | 0.8668 (13) | 0.089 (3) | 0.55 (3) |
| F3A | 0.6064 (18) | 0.4591 (14) | 0.7404 (6) | 0.093 (3) | 0.55 (3) |
| F1B | 0.471 (2) | 0.537 (2) | 0.8865 (14) | 0.083 (2) | 0.45 (3) |
| F2B | 0.5182 (17) | 0.3267 (11) | 0.8290 (14) | 0.088 (2) | 0.45 (3) |
| F3B | 0.6454 (13) | 0.4960 (16) | 0.7584 (10) | 0.084 (3) | 0.45 (3) |
| F4A | 0.4601 (19) | 0.166 (3) | 0.6294 (12) | 0.095 (4) | 0.31 (2) |
| F5A | 0.2886 (15) | 0.281 (3) | 0.4998 (12) | 0.090 (4) | 0.31 (2) |
| F6A | 0.460 (3) | 0.3837 (19) | 0.529 (2) | 0.110 (5) | 0.31 (2) |
| F4B | 0.4729 (10) | 0.2254 (9) | 0.6304 (5) | 0.0850 (12) | 0.69 (2) |
| F5B | 0.3116 (8) | 0.2068 (10) | 0.5228 (6) | 0.0872 (13) | 0.69 (2) |
| F6B | 0.3834 (11) | 0.4109 (4) | 0.4916 (4) | 0.0858 (16) | 0.69 (2) |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Cu1 | 0.03390 (11) | 0.03383 (12) | 0.03075 (11) | −0.01198 (8) | −0.00040 (7) | −0.00858 (8) |
| N1 | 0.0453 (9) | 0.0514 (10) | 0.0380 (6) | −0.0172 (8) | 0.0030 (6) | −0.0134 (6) |
| C1 | 0.0495 (12) | 0.0522 (12) | 0.0418 (11) | −0.0159 (10) | 0.0017 (9) | −0.0102 (9) |
| C2 | 0.0459 (11) | 0.0535 (12) | 0.0534 (12) | −0.0178 (10) | −0.0004 (9) | −0.0151 (10) |
| N2 | 0.0431 (7) | 0.0582 (10) | 0.0527 (10) | −0.0214 (8) | 0.0005 (7) | −0.0173 (9) |
| N3 | 0.0516 (9) | 0.0419 (7) | 0.0458 (9) | −0.0141 (6) | −0.0022 (7) | −0.0090 (6) |
| C3 | 0.0558 (13) | 0.0551 (13) | 0.0501 (12) | −0.0207 (11) | −0.0030 (10) | −0.0082 (10) |
| C4 | 0.0567 (13) | 0.0513 (12) | 0.0484 (12) | −0.0217 (10) | −0.0007 (10) | −0.0126 (10) |
| N4 | 0.0435 (7) | 0.0539 (10) | 0.0436 (9) | −0.0214 (7) | 0.0008 (6) | −0.0122 (8) |
| N5 | 0.0497 (9) | 0.0504 (9) | 0.0371 (7) | −0.0169 (8) | −0.0005 (6) | −0.0130 (7) |
| C5 | 0.0562 (13) | 0.0536 (13) | 0.0544 (13) | −0.0187 (10) | −0.0003 (10) | −0.0168 (11) |
| C6 | 0.0556 (13) | 0.0511 (12) | 0.0564 (13) | −0.0160 (10) | 0.0011 (10) | −0.0178 (11) |
| N6 | 0.0492 (10) | 0.0468 (10) | 0.0468 (10) | −0.0151 (8) | −0.0046 (8) | −0.0085 (8) |
| C7 | 0.0437 (11) | 0.0599 (10) | 0.0441 (11) | −0.0142 (9) | 0.0010 (8) | −0.0166 (9) |
| C8 | 0.0540 (14) | 0.0761 (15) | 0.0748 (13) | −0.0134 (9) | −0.0125 (11) | −0.0069 (13) |
| C9 | 0.0515 (10) | 0.0506 (12) | 0.0544 (11) | −0.0160 (10) | 0.0046 (9) | −0.0141 (10) |
| C10 | 0.0646 (14) | 0.0808 (12) | 0.0766 (12) | −0.0185 (13) | 0.0130 (13) | −0.0279 (14) |
| O1 | 0.0695 (12) | 0.0765 (11) | 0.0789 (13) | −0.0323 (10) | −0.0057 (10) | −0.0208 (10) |
| O2 | 0.0746 (12) | 0.0622 (9) | 0.0781 (13) | −0.0197 (9) | −0.0112 (10) | −0.0157 (9) |
| O3 | 0.0593 (10) | 0.0788 (13) | 0.0688 (11) | −0.0210 (9) | −0.0023 (8) | −0.0191 (10) |
| O4 | 0.0763 (13) | 0.0897 (15) | 0.0685 (11) | −0.0219 (11) | −0.0079 (9) | −0.0262 (11) |
| F1A | 0.094 (5) | 0.078 (3) | 0.086 (5) | −0.026 (2) | −0.003 (3) | −0.018 (4) |
| F2A | 0.085 (4) | 0.089 (3) | 0.097 (5) | −0.036 (3) | −0.012 (3) | −0.018 (3) |
| F3A | 0.099 (5) | 0.099 (4) | 0.0789 (16) | −0.032 (3) | −0.003 (2) | −0.0216 (19) |
| F1B | 0.077 (4) | 0.089 (6) | 0.085 (6) | −0.026 (4) | 0.004 (3) | −0.025 (5) |
| F2B | 0.086 (5) | 0.093 (3) | 0.089 (6) | −0.033 (3) | 0.006 (4) | −0.029 (3) |
| F3B | 0.078 (4) | 0.102 (5) | 0.075 (3) | −0.033 (3) | 0.001 (2) | −0.022 (3) |
| F4A | 0.070 (4) | 0.113 (10) | 0.093 (4) | −0.038 (6) | 0.005 (3) | 0.000 (6) |
| F5A | 0.078 (3) | 0.116 (11) | 0.083 (5) | −0.038 (6) | 0.005 (3) | −0.029 (6) |
| F6A | 0.097 (9) | 0.098 (5) | 0.144 (12) | −0.056 (6) | 0.016 (8) | −0.020 (7) |
| F4B | 0.085 (3) | 0.091 (3) | 0.0800 (15) | −0.033 (2) | 0.0010 (16) | −0.0179 (17) |
| F5B | 0.080 (2) | 0.091 (3) | 0.090 (3) | −0.030 (3) | −0.0023 (18) | −0.020 (3) |
| F6B | 0.082 (4) | 0.0829 (12) | 0.090 (2) | −0.0239 (16) | −0.0062 (19) | −0.0192 (13) |
| Cu1—N5 | 2.050 (2) | N5—H5A | 0.9000 |
| Cu1—N1 | 2.059 (2) | N5—H5B | 0.9000 |
| Cu1—N3 | 2.126 (2) | C5—C6 | 1.503 (3) |
| Cu1—N6 | 2.136 (2) | C5—H5C | 0.9700 |
| Cu1—N2 | 2.297 (2) | C5—H5D | 0.9700 |
| Cu1—N4 | 2.300 (2) | C6—N6 | 1.462 (3) |
| N1—C1 | 1.471 (3) | C6—H6C | 0.9700 |
| N1—H1A | 0.9000 | C6—H6D | 0.9700 |
| N1—H1B | 0.9000 | N6—H6A | 0.9000 |
| C1—C2 | 1.500 (3) | N6—H6B | 0.9000 |
| C1—H1C | 0.9700 | C7—O2 | 1.219 (3) |
| C1—H1D | 0.9700 | C7—O1 | 1.237 (3) |
| C2—N2 | 1.471 (3) | C7—C8 | 1.539 (4) |
| C2—H2C | 0.9700 | C8—F1B | 1.291 (11) |
| C2—H2D | 0.9700 | C8—F3B | 1.311 (7) |
| N2—H2A | 0.9000 | C8—F2A | 1.312 (7) |
| N2—H2B | 0.9000 | C8—F3A | 1.338 (7) |
| N3—C3 | 1.462 (3) | C8—F2B | 1.345 (9) |
| N3—H3A | 0.9000 | C8—F1A | 1.357 (9) |
| N3—H3B | 0.9000 | C9—O4 | 1.225 (3) |
| C3—C4 | 1.499 (3) | C9—O3 | 1.230 (3) |
| C3—H3C | 0.9700 | C9—C10 | 1.524 (4) |
| C3—H3D | 0.9700 | C10—F6A | 1.286 (10) |
| C4—N4 | 1.466 (3) | C10—F5A | 1.308 (11) |
| C4—H4C | 0.9700 | C10—F4B | 1.322 (6) |
| C4—H4D | 0.9700 | C10—F5B | 1.338 (5) |
| N4—H4A | 0.9000 | C10—F6B | 1.338 (5) |
| N4—H4B | 0.9000 | C10—F4A | 1.343 (11) |
| N5—C5 | 1.464 (3) | ||
| N5—Cu1—N1 | 171.52 (7) | H5A—N5—H5B | 108.3 |
| N5—Cu1—N3 | 91.32 (8) | N5—C5—C6 | 107.7 (2) |
| N1—Cu1—N3 | 93.88 (8) | N5—C5—H5C | 110.2 |
| N5—Cu1—N6 | 81.82 (8) | C6—C5—H5C | 110.2 |
| N1—Cu1—N6 | 93.95 (8) | N5—C5—H5D | 110.2 |
| N3—Cu1—N6 | 169.22 (7) | C6—C5—H5D | 110.2 |
| N5—Cu1—N2 | 92.91 (8) | H5C—C5—H5D | 108.5 |
| N1—Cu1—N2 | 80.03 (8) | N6—C6—C5 | 108.1 (2) |
| N3—Cu1—N2 | 94.49 (8) | N6—C6—H6C | 110.1 |
| N6—Cu1—N2 | 94.15 (9) | C5—C6—H6C | 110.1 |
| N5—Cu1—N4 | 98.13 (8) | N6—C6—H6D | 110.1 |
| N1—Cu1—N4 | 89.38 (8) | C5—C6—H6D | 110.1 |
| N3—Cu1—N4 | 79.81 (8) | H6C—C6—H6D | 108.4 |
| N6—Cu1—N4 | 92.88 (8) | C6—N6—Cu1 | 107.29 (14) |
| N2—Cu1—N4 | 167.65 (7) | C6—N6—H6A | 110.3 |
| C1—N1—Cu1 | 110.81 (14) | Cu1—N6—H6A | 110.3 |
| C1—N1—H1A | 109.5 | C6—N6—H6B | 110.3 |
| Cu1—N1—H1A | 109.5 | Cu1—N6—H6B | 110.3 |
| C1—N1—H1B | 109.5 | H6A—N6—H6B | 108.5 |
| Cu1—N1—H1B | 109.5 | O2—C7—O1 | 129.9 (2) |
| H1A—N1—H1B | 108.1 | O2—C7—C8 | 115.2 (2) |
| N1—C1—C2 | 110.86 (18) | O1—C7—C8 | 114.9 (2) |
| N1—C1—H1C | 109.5 | F1B—C8—F3B | 110.6 (7) |
| C2—C1—H1C | 109.5 | F1B—C8—F2A | 86.2 (6) |
| N1—C1—H1D | 109.5 | F3B—C8—F2A | 133.3 (5) |
| C2—C1—H1D | 109.5 | F1B—C8—F3A | 118.9 (10) |
| H1C—C1—H1D | 108.1 | F3B—C8—F3A | 28.3 (3) |
| N2—C2—C1 | 107.94 (19) | F2A—C8—F3A | 105.2 (5) |
| N2—C2—H2C | 110.1 | F1B—C8—F2B | 110.6 (7) |
| C1—C2—H2C | 110.1 | F3B—C8—F2B | 110.6 (5) |
| N2—C2—H2D | 110.1 | F2A—C8—F2B | 27.2 (3) |
| C1—C2—H2D | 110.1 | F3A—C8—F2B | 82.7 (5) |
| H2C—C2—H2D | 108.4 | F1B—C8—F1A | 21.0 (6) |
| C2—N2—Cu1 | 105.49 (14) | F3B—C8—F1A | 90.5 (6) |
| C2—N2—H2A | 110.6 | F2A—C8—F1A | 104.9 (5) |
| Cu1—N2—H2A | 110.6 | F3A—C8—F1A | 103.9 (6) |
| C2—N2—H2B | 110.6 | F2B—C8—F1A | 126.1 (7) |
| Cu1—N2—H2B | 110.6 | F1B—C8—C7 | 112.6 (9) |
| H2A—N2—H2B | 108.8 | F3B—C8—C7 | 98.8 (7) |
| C3—N3—Cu1 | 109.77 (15) | F2A—C8—C7 | 114.9 (4) |
| C3—N3—H3A | 109.7 | F3A—C8—C7 | 115.3 (7) |
| Cu1—N3—H3A | 109.7 | F2B—C8—C7 | 113.1 (5) |
| C3—N3—H3B | 109.7 | F1A—C8—C7 | 111.6 (7) |
| Cu1—N3—H3B | 109.7 | O4—C9—O3 | 128.0 (3) |
| H3A—N3—H3B | 108.2 | O4—C9—C10 | 114.6 (3) |
| N3—C3—C4 | 110.8 (2) | O3—C9—C10 | 117.4 (3) |
| N3—C3—H3C | 109.5 | F6A—C10—F5A | 109.5 (6) |
| C4—C3—H3C | 109.5 | F6A—C10—F4B | 79.6 (10) |
| N3—C3—H3D | 109.5 | F5A—C10—F4B | 117.5 (7) |
| C4—C3—H3D | 109.5 | F6A—C10—F5B | 135.3 (9) |
| H3C—C3—H3D | 108.1 | F5A—C10—F5B | 28.1 (8) |
| N4—C4—C3 | 110.08 (19) | F4B—C10—F5B | 105.9 (4) |
| N4—C4—H4C | 109.6 | F6A—C10—F6B | 34.5 (11) |
| C3—C4—H4C | 109.6 | F5A—C10—F6B | 77.3 (8) |
| N4—C4—H4D | 109.6 | F4B—C10—F6B | 105.2 (4) |
| C3—C4—H4D | 109.6 | F5B—C10—F6B | 105.2 (3) |
| H4C—C4—H4D | 108.2 | F6A—C10—F4A | 105.5 (7) |
| C4—N4—Cu1 | 105.13 (14) | F5A—C10—F4A | 106.4 (8) |
| C4—N4—H4A | 110.7 | F4B—C10—F4A | 26.0 (9) |
| Cu1—N4—H4A | 110.7 | F5B—C10—F4A | 86.2 (7) |
| C4—N4—H4B | 110.7 | F6B—C10—F4A | 128.0 (12) |
| Cu1—N4—H4B | 110.7 | F6A—C10—C9 | 105.3 (6) |
| H4A—N4—H4B | 108.8 | F5A—C10—C9 | 120.7 (7) |
| C5—N5—Cu1 | 109.29 (14) | F4B—C10—C9 | 114.9 (4) |
| C5—N5—H5A | 109.8 | F5B—C10—C9 | 111.5 (4) |
| Cu1—N5—H5A | 109.8 | F6B—C10—C9 | 113.3 (3) |
| C5—N5—H5B | 109.8 | F4A—C10—C9 | 108.5 (9) |
| Cu1—N5—H5B | 109.8 |
| D—H···A | D—H | H···A | D···A | D—H···A |
| N2—H2B···F1A | 0.90 | 2.54 | 3.248 (17) | 136 |
| N2—H2B···F3B | 0.90 | 2.55 | 3.41 (2) | 161 |
| N6—H6B···O1 | 0.90 | 2.15 | 3.048 (3) | 179 |
| N1—H1A···O2i | 0.90 | 2.35 | 3.141 (3) | 147 |
| N1—H1A···O1i | 0.90 | 2.53 | 3.377 (4) | 156 |
| N4—H4A···O2i | 0.90 | 2.34 | 3.175 (3) | 154 |
| N6—H6A···O1i | 0.90 | 2.56 | 3.326 (3) | 143 |
| N1—H1B···O2ii | 0.90 | 2.11 | 3.002 (3) | 173 |
| N2—H2A···F4Aii | 0.90 | 2.47 | 3.267 (15) | 148 |
| N3—H3A···O3ii | 0.90 | 2.09 | 2.958 (3) | 162 |
| N5—H5A···O3ii | 0.90 | 2.36 | 3.126 (3) | 143 |
| N2—H2A···O4iii | 0.90 | 2.41 | 3.037 (3) | 127 |
| N4—H4B···O4iv | 0.90 | 2.11 | 2.997 (3) | 168 |
| N5—H5B···O3iv | 0.90 | 2.13 | 3.013 (3) | 167 |
| Symmetry codes: (i) −x+2, −y+1, −z+2; (ii) x, y+1, z; (iii) −x+1, −y+1, −z+1; (iv) −x+2, −y+1, −z+1. |
Experimental details
| Crystal data | |
| Chemical formula | [Cu(C2H8N2)3](C2F3O2)2 |
| Mr | 469.90 |
| Crystal system, space group | Triclinic, P1 |
| Temperature (K) | 293 |
| a, b, c (Å) | 8.582 (6), 9.316 (6), 12.859 (7) |
| α, β, γ (°) | 74.73 (3), 84.69 (4), 69.56 (3) |
| V (Å3) | 929.3 (10) |
| Z | 2 |
| Radiation type | Mo Kα |
| µ (mm−1) | 1.26 |
| Crystal size (mm) | 0.15 × 0.1 × 0.08 |
| Data collection | |
| Diffractometer | Bruker SMART CCD area-detector diffractometer |
| Absorption correction | – |
| No. of measured, independent and observed [I > 2σ(I)] reflections | ?, 5406, 4277 |
| Rint | ? |
| (sin θ/λ)max (Å−1) | 0.703 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.039, 0.092, 0.94 |
| No. of reflections | 5406 |
| No. of parameters | 300 |
| No. of restraints | 45 |
| H-atom treatment | H-atom parameters constrained |
| Δρmax, Δρmin (e Å−3) | 0.24, −0.25 |
Computer programs: SMART (Bruker, 2000), SAINT (Bruker, 2000), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), ORTEP-3 (Farrugia, 1997), WinGX (Farrugia, 1999).
| D—H···A | D—H | H···A | D···A | D—H···A |
| N2—H2B···F1A | 0.90 | 2.54 | 3.248 (17) | 136.0 |
| N2—H2B···F3B | 0.90 | 2.55 | 3.41 (2) | 161.0 |
| N6—H6B···O1 | 0.90 | 2.15 | 3.048 (3) | 179.2 |
| N1—H1A···O2i | 0.90 | 2.35 | 3.141 (3) | 147.2 |
| N1—H1A···O1i | 0.90 | 2.53 | 3.377 (4) | 156.4 |
| N4—H4A···O2i | 0.90 | 2.34 | 3.175 (3) | 154.4 |
| N6—H6A···O1i | 0.90 | 2.56 | 3.326 (3) | 143.3 |
| N1—H1B···O2ii | 0.90 | 2.11 | 3.002 (3) | 172.8 |
| N2—H2A···F4Aii | 0.90 | 2.47 | 3.267 (15) | 148.3 |
| N3—H3A···O3ii | 0.90 | 2.09 | 2.958 (3) | 162.1 |
| N5—H5A···O3ii | 0.90 | 2.36 | 3.126 (3) | 143.3 |
| N2—H2A···O4iii | 0.90 | 2.41 | 3.037 (3) | 127.0 |
| N4—H4B···O4iv | 0.90 | 2.11 | 2.997 (3) | 167.8 |
| N5—H5B···O3iv | 0.90 | 2.13 | 3.013 (3) | 167.0 |
| Symmetry codes: (i) −x+2, −y+1, −z+2; (ii) x, y+1, z; (iii) −x+1, −y+1, −z+1; (iv) −x+2, −y+1, −z+1. |
Acknowledgements
The authors gratefully acknowledge Zoja A. Starikova for the X-ray data collection. This investigation was supported by the Russian Fund of Basic Research (project No. 05–03–33038-a).
References
Bruker (2000). SMART and SAINT. Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
Farrugia, L. J. (1997). J. Appl. Cryst. 30, 565. CrossRef IUCr Journals Google Scholar
Farrugia, L. J. (1999). J. Appl. Cryst. 32, 837–838. CrossRef CAS IUCr Journals Google Scholar
Gutnikov, S. I., Karpova, E. V., Zakharov, M. A. & Boltalin, A. I. (2006). Russ. J. Inorg. Chem. 51, 541–548. Web of Science CrossRef Google Scholar
Karpova, E. V., Boltalin, A. I., Korenev, Yu. M., Zakharov, M. A. & Troyanov, S. I. (2001). Russ. J. Coord. Chem. 27, 286–291. Web of Science CrossRef CAS Google Scholar
Karpova, E. V., Boltalin, A. I., Zakharov, M. A., Sorokina, N. I., Korenev, Yu. M. & Troyanov, S. I. (1998). Z. Anorg. Allg. Chem. B624, 741–744. CrossRef Google Scholar
Karpova, E. V., Zakharov, M. A., Gutnikov, S. I. & Boltalin, A. I. (2007). Acta Cryst. E63, m658–m659. Web of Science CSD CrossRef IUCr Journals Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
![[P \overline 1] Mathematical equation](teximages/wn2235fi1.gif)
![[Figure 1]](./wn2235fig1thm.gif)




The present investigation is a continuation of experimental work to study the structure and properties of different carboxylate complexes (Karpova et al., 1998; Karpova et al., 2001; Gutnikov et al., 2006; Karpova et al., 2007). In the title compound, Cu(H2NCH2CH2NH2)3.(CF3COO)2, the asymmetric unit consists of a complex cation and two crystallographically independent anions. The environment of the Cu atom is distorted octahedral, formed by six N atoms from three chelate ethylenediamine groups. The two trifluoroacetate anions form N—H···O and N—H···F hydrogen bonds with NH2 groups of the cation, forming a three-dimensional framework.