metal-organic compounds
{1,8-Bis[2-(2-oxidobenzylideneamino)phenoxy]-3,6-dioxaoctane}nitratopraseodymium(III) trichloromethane solvate
aDepartment of Chemistry, State Key Laboratory of Applied Organic Chemistry, College of Chemical Engineering, Lanzhou University, Lanzhou 730000, People's Republic of China, bState Key Laboratory of Coordination Chemistry, Nanjing University, Nanjing 210093, People's Republic of China, and cDepartment of Chemistry, Liaocheng University, Liaocheng 252000, People's Republic of China
*Correspondence e-mail: [email protected]
In the title compound, [Pr(C32H30N2O6)(NO3)]·CHCl3, the PrIII ion is ten-coordinated by eight O atoms and two N atoms from the acyclic crown-type Schiff base ligand and the bidentate nitrate group. The around PrIII is a distorted bicapped square antiprism. The chloroform solvent molecule is not involved either in coordination to the PrIII center or in hydrogen bonding to the complex. The Pr—O(phenolate) bonds are significantly shorter than the Pr—O(ether) and Pr—O(nitrate) bonds, which suggests that the Pr—O(phenolate) bond is stronger than these other bonds. In the the acyclic crown-type Schiff base ligand wraps around the PrIII centre, forming a pseudo-ring.
Related literature
For general backgound, see: Wen et al. (2001
); Liu et al. (2004
). For related structures, see: Yu et al. (2006
); Ding et al. (2007
). For related literature, see: Si et al. (1994
).
Experimental
Crystal data
|
Refinement
|
| |||||||||||||||||||||||||||||||||||||||||||||||||||
Data collection: SMART (Bruker, 1997
); cell refinement: SAINT (Bruker, 1997
); data reduction: SAINT; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: SHELXTL (Sheldrick, 2008
); software used to prepare material for publication: publCIF (Westrip, 2008
).
Supporting information
contains datablocks I, global. DOI: 10.1107/S1600536808021259/wn2255sup1.cif
Structure factors: contains datablock I. DOI: 10.1107/S1600536808021259/wn2255Isup2.hkl
H2L was synthesized using a literature method (Si et al.,1994). The title compound Pr(NO3)(C32H30O6N2)(CHCl3) was synthesized as follows: NaOH (8.0 mg, 0.2 mmol) was added to 10 ml of ethyl acetate solution containing H2L (54.0 mg, 0.1 mmol). The mixture was stirred for 10 min at room temperature to obtain a yellow solution. 5 ml of ethyl acetate solution containing Pr(NO3)3.6H2O (43.4 mg, 0.1 mmol) was then added to the mixture and a yellow precipitate formed. The precipitate was collected and washed three times with ethyl acetate. Further drying in a vacuum afforded a yellow powder. Yellow single crystals of the title compound were grown from a mixed methanol/chloroform solution (v:v 1:2) by slow evaporation at room temperature.
All H atoms were placed in geometrically idealized positions and constrained to ride on their parent atoms, with C—H = 0.93–0.98 Å, and with Uiso(H)= 1.2Ueq(C). The highest residual electron density peak is located 1.32 Å from O6.
Data collection: SMART (Bruker, 1997); cell SAINT (Bruker, 1997); data reduction: SAINT (Bruker, 1997); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: SHELXTL (Sheldrick, 2008); software used to prepare material for publication: publCIF (Westrip, 2008).
| [Pr(C32H30N2O6)(NO3)]·CHCl3 | F(000) = 1728 |
| Mr = 860.87 | Dx = 1.645 Mg m−3 |
| Monoclinic, P21/c | Mo Kα radiation, λ = 0.71073 Å |
| a = 11.3454 (14) Å | Cell parameters from 5219 reflections |
| b = 20.150 (2) Å | θ = 2.3–25.5° |
| c = 15.4676 (17) Å | µ = 1.69 mm−1 |
| β = 100.585 (2)° | T = 298 K |
| V = 3475.9 (7) Å3 | Block, yellow |
| Z = 4 | 0.48 × 0.43 × 0.21 mm |
| Bruker SMART 1000 CCD diffractometer | 6118 independent reflections |
| Radiation source: fine-focus sealed tube | 4284 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.043 |
| ϕ and ω scans | θmax = 25.0°, θmin = 1.7° |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | h = −13→13 |
| Tmin = 0.498, Tmax = 0.718 | k = −23→20 |
| 17233 measured reflections | l = −16→18 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.035 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.083 | H-atom parameters constrained |
| S = 1.03 | w = 1/[σ2(Fo2) + (0.0368P)2] where P = (Fo2 + 2Fc2)/3 |
| 6118 reflections | (Δ/σ)max = 0.001 |
| 442 parameters | Δρmax = 1.44 e Å−3 |
| 0 restraints | Δρmin = −0.55 e Å−3 |
| [Pr(C32H30N2O6)(NO3)]·CHCl3 | V = 3475.9 (7) Å3 |
| Mr = 860.87 | Z = 4 |
| Monoclinic, P21/c | Mo Kα radiation |
| a = 11.3454 (14) Å | µ = 1.69 mm−1 |
| b = 20.150 (2) Å | T = 298 K |
| c = 15.4676 (17) Å | 0.48 × 0.43 × 0.21 mm |
| β = 100.585 (2)° |
| Bruker SMART 1000 CCD diffractometer | 6118 independent reflections |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | 4284 reflections with I > 2σ(I) |
| Tmin = 0.498, Tmax = 0.718 | Rint = 0.043 |
| 17233 measured reflections |
| R[F2 > 2σ(F2)] = 0.035 | 0 restraints |
| wR(F2) = 0.083 | H-atom parameters constrained |
| S = 1.03 | Δρmax = 1.44 e Å−3 |
| 6118 reflections | Δρmin = −0.55 e Å−3 |
| 442 parameters |
Geometry. All e.s.d.'s (except the e.s.d. in the dihedral angle between two l.s. planes) are estimated using the full covariance matrix. The cell e.s.d.'s are taken into account individually in the estimation of e.s.d.'s in distances, angles and torsion angles; correlations between e.s.d.'s in cell parameters are only used when they are defined by crystal symmetry. An approximate (isotropic) treatment of cell e.s.d.'s is used for estimating e.s.d.'s involving l.s. planes. |
Refinement. Refinement of F2 against ALL reflections. The weighted R-factor wR and goodness of fit S are based on F2, conventional R-factors R are based on F, with F set to zero for negative F2. The threshold expression of F2 > σ(F2) is used only for calculating R-factors(gt) etc. and is not relevant to the choice of reflections for refinement. R-factors based on F2 are statistically about twice as large as those based on F, and R- factors based on ALL data will be even larger. |
| x | y | z | Uiso*/Ueq | ||
| Pr1 | 0.84007 (2) | 0.784583 (11) | 0.158214 (16) | 0.03001 (9) | |
| Cl1 | 0.16296 (15) | 0.61952 (9) | 0.19132 (14) | 0.0999 (6) | |
| Cl2 | 0.23419 (17) | 0.65708 (9) | 0.03000 (13) | 0.0984 (6) | |
| Cl3 | 0.41044 (14) | 0.64221 (10) | 0.18791 (15) | 0.1164 (7) | |
| N1 | 0.6762 (3) | 0.71096 (16) | 0.0580 (2) | 0.0339 (8) | |
| N2 | 0.6852 (3) | 0.76463 (17) | 0.2664 (2) | 0.0348 (9) | |
| N3 | 1.1034 (3) | 0.79143 (19) | 0.2513 (3) | 0.0436 (10) | |
| C9 | 0.6446 (4) | 0.5878 (2) | 0.0482 (3) | 0.0503 (13) | |
| H9 | 0.5646 | 0.5918 | 0.0534 | 0.060* | |
| O1 | 0.9051 (2) | 0.69333 (14) | 0.04725 (19) | 0.0372 (7) | |
| O2 | 0.9149 (3) | 0.82509 (15) | 0.01016 (19) | 0.0409 (8) | |
| O3 | 0.9091 (3) | 0.91629 (14) | 0.1443 (2) | 0.0389 (7) | |
| O4 | 0.8019 (2) | 0.87638 (13) | 0.2862 (2) | 0.0376 (7) | |
| O5 | 0.6794 (2) | 0.84723 (13) | 0.09646 (19) | 0.0381 (7) | |
| O6 | 0.8714 (2) | 0.68515 (14) | 0.2275 (2) | 0.0394 (7) | |
| O7 | 1.0201 (3) | 0.80827 (17) | 0.2899 (2) | 0.0514 (9) | |
| O8 | 1.0758 (3) | 0.78130 (15) | 0.1693 (2) | 0.0462 (8) | |
| O9 | 1.2050 (3) | 0.7844 (2) | 0.2900 (3) | 0.0823 (13) | |
| C1 | 0.9179 (4) | 0.7150 (2) | −0.0398 (3) | 0.0458 (12) | |
| H1A | 0.8394 | 0.7200 | −0.0767 | 0.055* | |
| H1B | 0.9623 | 0.6821 | −0.0666 | 0.055* | |
| C2 | 0.9823 (4) | 0.7793 (2) | −0.0330 (3) | 0.0453 (12) | |
| H2A | 1.0627 | 0.7741 | 0.0008 | 0.054* | |
| H2B | 0.9882 | 0.7956 | −0.0911 | 0.054* | |
| C3 | 0.9633 (5) | 0.8900 (2) | 0.0084 (3) | 0.0529 (14) | |
| H3A | 0.9595 | 0.9042 | −0.0520 | 0.064* | |
| H3B | 1.0467 | 0.8902 | 0.0375 | 0.064* | |
| C4 | 0.8932 (5) | 0.9359 (2) | 0.0539 (3) | 0.0541 (14) | |
| H4A | 0.9210 | 0.9811 | 0.0495 | 0.065* | |
| H4B | 0.8090 | 0.9339 | 0.0270 | 0.065* | |
| C5 | 0.8566 (4) | 0.9631 (2) | 0.1947 (3) | 0.0454 (12) | |
| H5A | 0.7723 | 0.9690 | 0.1700 | 0.055* | |
| H5B | 0.8964 | 1.0057 | 0.1950 | 0.055* | |
| C6 | 0.8715 (4) | 0.9359 (2) | 0.2860 (3) | 0.0438 (12) | |
| H6A | 0.9554 | 0.9263 | 0.3080 | 0.053* | |
| H6B | 0.8454 | 0.9686 | 0.3245 | 0.053* | |
| C7 | 0.8358 (4) | 0.6361 (2) | 0.0440 (3) | 0.0375 (11) | |
| C8 | 0.7160 (4) | 0.6445 (2) | 0.0490 (3) | 0.0371 (11) | |
| C10 | 0.6931 (5) | 0.5260 (2) | 0.0397 (4) | 0.0599 (15) | |
| H10 | 0.6453 | 0.4884 | 0.0384 | 0.072* | |
| C11 | 0.8117 (5) | 0.5196 (2) | 0.0331 (4) | 0.0609 (15) | |
| H11 | 0.8438 | 0.4778 | 0.0270 | 0.073* | |
| C12 | 0.8823 (5) | 0.5746 (2) | 0.0354 (3) | 0.0495 (13) | |
| H12 | 0.9626 | 0.5701 | 0.0311 | 0.059* | |
| C13 | 0.5709 (4) | 0.7263 (2) | 0.0152 (3) | 0.0386 (11) | |
| H13 | 0.5275 | 0.6923 | −0.0164 | 0.046* | |
| C14 | 0.5133 (4) | 0.7900 (2) | 0.0109 (3) | 0.0358 (10) | |
| C15 | 0.5697 (4) | 0.8475 (2) | 0.0520 (3) | 0.0351 (10) | |
| C16 | 0.5031 (4) | 0.9069 (2) | 0.0427 (3) | 0.0523 (13) | |
| H16 | 0.5364 | 0.9450 | 0.0712 | 0.063* | |
| C17 | 0.3912 (5) | 0.9097 (3) | −0.0070 (4) | 0.0635 (16) | |
| H17 | 0.3502 | 0.9499 | −0.0129 | 0.076* | |
| C18 | 0.3374 (5) | 0.8544 (3) | −0.0488 (4) | 0.0695 (17) | |
| H18 | 0.2606 | 0.8568 | −0.0824 | 0.083* | |
| C19 | 0.3990 (4) | 0.7954 (3) | −0.0402 (3) | 0.0525 (14) | |
| H19 | 0.3635 | 0.7580 | −0.0692 | 0.063* | |
| C20 | 0.6820 (4) | 0.8820 (2) | 0.2903 (3) | 0.0364 (11) | |
| C21 | 0.6188 (4) | 0.8227 (2) | 0.2810 (3) | 0.0376 (11) | |
| C22 | 0.4985 (4) | 0.8233 (3) | 0.2833 (3) | 0.0486 (13) | |
| H22 | 0.4554 | 0.7838 | 0.2758 | 0.058* | |
| C23 | 0.4404 (4) | 0.8817 (3) | 0.2966 (4) | 0.0577 (15) | |
| H23 | 0.3590 | 0.8817 | 0.2987 | 0.069* | |
| C24 | 0.5048 (5) | 0.9396 (3) | 0.3066 (4) | 0.0576 (15) | |
| H24 | 0.4665 | 0.9790 | 0.3163 | 0.069* | |
| C25 | 0.6248 (5) | 0.9408 (2) | 0.3027 (3) | 0.0507 (13) | |
| H25 | 0.6670 | 0.9806 | 0.3082 | 0.061* | |
| C26 | 0.6611 (4) | 0.7105 (2) | 0.3046 (3) | 0.0372 (11) | |
| H26 | 0.6015 | 0.7130 | 0.3385 | 0.045* | |
| C27 | 0.7169 (4) | 0.6467 (2) | 0.3000 (3) | 0.0357 (11) | |
| C28 | 0.8194 (4) | 0.6370 (2) | 0.2618 (3) | 0.0348 (11) | |
| C29 | 0.8640 (4) | 0.5720 (2) | 0.2616 (3) | 0.0462 (12) | |
| H29 | 0.9306 | 0.5641 | 0.2358 | 0.055* | |
| C30 | 0.8129 (5) | 0.5196 (2) | 0.2980 (3) | 0.0554 (14) | |
| H30 | 0.8447 | 0.4772 | 0.2963 | 0.066* | |
| C31 | 0.7142 (5) | 0.5299 (3) | 0.3372 (3) | 0.0550 (14) | |
| H31 | 0.6801 | 0.4947 | 0.3625 | 0.066* | |
| C32 | 0.6671 (4) | 0.5927 (2) | 0.3383 (3) | 0.0487 (13) | |
| H32 | 0.6009 | 0.5996 | 0.3649 | 0.058* | |
| C33 | 0.2640 (4) | 0.6656 (3) | 0.1447 (4) | 0.0643 (16) | |
| H33 | 0.2544 | 0.7125 | 0.1589 | 0.077* |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Pr1 | 0.02794 (14) | 0.03197 (14) | 0.02875 (14) | −0.00197 (11) | 0.00155 (9) | 0.00156 (12) |
| Cl1 | 0.0752 (12) | 0.0960 (13) | 0.1290 (17) | −0.0180 (10) | 0.0202 (11) | 0.0328 (12) |
| Cl2 | 0.1104 (14) | 0.0852 (12) | 0.1010 (15) | −0.0041 (10) | 0.0232 (11) | −0.0036 (11) |
| Cl3 | 0.0498 (10) | 0.1420 (17) | 0.150 (2) | 0.0073 (10) | −0.0020 (11) | −0.0466 (15) |
| N1 | 0.030 (2) | 0.033 (2) | 0.040 (2) | −0.0011 (17) | 0.0089 (17) | −0.0020 (18) |
| N2 | 0.033 (2) | 0.039 (2) | 0.031 (2) | −0.0044 (17) | 0.0038 (16) | 0.0001 (17) |
| N3 | 0.026 (2) | 0.053 (3) | 0.048 (3) | 0.0021 (19) | −0.0038 (19) | 0.002 (2) |
| C9 | 0.050 (3) | 0.048 (3) | 0.052 (3) | −0.010 (3) | 0.009 (3) | −0.010 (3) |
| O1 | 0.0364 (18) | 0.0414 (18) | 0.0343 (18) | −0.0057 (14) | 0.0081 (14) | 0.0002 (14) |
| O2 | 0.050 (2) | 0.0399 (19) | 0.0327 (19) | −0.0042 (15) | 0.0083 (15) | 0.0018 (15) |
| O3 | 0.0424 (19) | 0.0337 (17) | 0.041 (2) | −0.0066 (14) | 0.0079 (15) | 0.0002 (15) |
| O4 | 0.0342 (18) | 0.0356 (18) | 0.044 (2) | −0.0018 (14) | 0.0087 (14) | 0.0000 (15) |
| O5 | 0.0312 (17) | 0.0356 (17) | 0.0435 (19) | 0.0013 (14) | −0.0037 (14) | −0.0021 (15) |
| O6 | 0.0354 (18) | 0.0364 (17) | 0.047 (2) | 0.0035 (14) | 0.0083 (15) | 0.0129 (16) |
| O7 | 0.039 (2) | 0.069 (2) | 0.045 (2) | 0.0021 (17) | 0.0033 (16) | −0.0087 (18) |
| O8 | 0.0381 (18) | 0.065 (2) | 0.0342 (19) | 0.0018 (16) | 0.0036 (15) | −0.0025 (17) |
| O9 | 0.037 (2) | 0.128 (4) | 0.072 (3) | 0.006 (2) | −0.015 (2) | −0.009 (3) |
| C1 | 0.061 (3) | 0.052 (3) | 0.025 (3) | 0.000 (3) | 0.010 (2) | −0.005 (2) |
| C2 | 0.060 (3) | 0.043 (3) | 0.036 (3) | −0.006 (2) | 0.018 (2) | 0.004 (2) |
| C3 | 0.079 (4) | 0.042 (3) | 0.040 (3) | −0.012 (3) | 0.017 (3) | 0.004 (2) |
| C4 | 0.087 (4) | 0.032 (3) | 0.046 (3) | −0.006 (3) | 0.021 (3) | 0.009 (2) |
| C5 | 0.053 (3) | 0.028 (3) | 0.054 (3) | −0.010 (2) | 0.007 (3) | −0.007 (2) |
| C6 | 0.048 (3) | 0.038 (3) | 0.046 (3) | −0.008 (2) | 0.009 (2) | −0.007 (2) |
| C7 | 0.043 (3) | 0.036 (3) | 0.035 (3) | −0.007 (2) | 0.010 (2) | −0.002 (2) |
| C8 | 0.037 (3) | 0.035 (3) | 0.038 (3) | −0.004 (2) | 0.002 (2) | −0.008 (2) |
| C10 | 0.077 (4) | 0.039 (3) | 0.066 (4) | −0.018 (3) | 0.020 (3) | −0.010 (3) |
| C11 | 0.078 (4) | 0.031 (3) | 0.076 (4) | 0.005 (3) | 0.018 (3) | −0.008 (3) |
| C12 | 0.055 (3) | 0.036 (3) | 0.058 (4) | 0.008 (2) | 0.015 (3) | −0.008 (3) |
| C13 | 0.035 (3) | 0.041 (3) | 0.039 (3) | −0.011 (2) | 0.005 (2) | −0.007 (2) |
| C14 | 0.031 (2) | 0.043 (3) | 0.033 (3) | −0.001 (2) | 0.005 (2) | 0.002 (2) |
| C15 | 0.032 (3) | 0.045 (3) | 0.030 (3) | 0.003 (2) | 0.008 (2) | 0.003 (2) |
| C16 | 0.055 (3) | 0.049 (3) | 0.051 (3) | 0.012 (3) | 0.004 (3) | 0.002 (3) |
| C17 | 0.049 (3) | 0.071 (4) | 0.065 (4) | 0.026 (3) | −0.005 (3) | −0.003 (3) |
| C18 | 0.034 (3) | 0.093 (5) | 0.074 (4) | 0.017 (3) | −0.008 (3) | 0.004 (4) |
| C19 | 0.037 (3) | 0.066 (4) | 0.050 (3) | −0.003 (3) | −0.004 (2) | −0.002 (3) |
| C20 | 0.039 (3) | 0.039 (3) | 0.031 (3) | 0.007 (2) | 0.007 (2) | 0.001 (2) |
| C21 | 0.038 (3) | 0.041 (3) | 0.033 (3) | 0.003 (2) | 0.006 (2) | −0.002 (2) |
| C22 | 0.035 (3) | 0.054 (3) | 0.056 (3) | −0.003 (2) | 0.007 (2) | −0.002 (3) |
| C23 | 0.036 (3) | 0.072 (4) | 0.068 (4) | 0.007 (3) | 0.016 (3) | 0.004 (3) |
| C24 | 0.056 (4) | 0.056 (4) | 0.062 (4) | 0.019 (3) | 0.014 (3) | −0.003 (3) |
| C25 | 0.055 (3) | 0.046 (3) | 0.052 (3) | 0.000 (3) | 0.011 (3) | 0.000 (3) |
| C26 | 0.029 (2) | 0.054 (3) | 0.030 (2) | −0.010 (2) | 0.0087 (19) | −0.009 (2) |
| C27 | 0.041 (3) | 0.033 (3) | 0.031 (3) | −0.008 (2) | 0.002 (2) | −0.001 (2) |
| C28 | 0.033 (3) | 0.036 (3) | 0.032 (3) | −0.003 (2) | −0.002 (2) | 0.005 (2) |
| C29 | 0.050 (3) | 0.046 (3) | 0.043 (3) | 0.006 (2) | 0.009 (2) | 0.005 (2) |
| C30 | 0.068 (4) | 0.042 (3) | 0.052 (4) | 0.000 (3) | −0.001 (3) | 0.005 (3) |
| C31 | 0.073 (4) | 0.044 (3) | 0.045 (3) | −0.020 (3) | 0.004 (3) | 0.008 (3) |
| C32 | 0.050 (3) | 0.051 (3) | 0.044 (3) | −0.013 (3) | 0.007 (2) | 0.003 (3) |
| C33 | 0.046 (3) | 0.048 (3) | 0.100 (5) | −0.001 (3) | 0.016 (3) | −0.010 (3) |
| Pr1—O6 | 2.269 (3) | C5—H5B | 0.9700 |
| Pr1—O5 | 2.278 (3) | C6—H6A | 0.9700 |
| Pr1—N1 | 2.646 (3) | C6—H6B | 0.9700 |
| Pr1—O8 | 2.649 (3) | C7—C12 | 1.363 (6) |
| Pr1—O7 | 2.649 (3) | C7—C8 | 1.386 (6) |
| Pr1—N2 | 2.670 (4) | C10—C11 | 1.374 (7) |
| Pr1—O1 | 2.708 (3) | C10—H10 | 0.9300 |
| Pr1—O2 | 2.710 (3) | C11—C12 | 1.364 (6) |
| Pr1—O3 | 2.787 (3) | C11—H11 | 0.9300 |
| Pr1—O4 | 2.801 (3) | C12—H12 | 0.9300 |
| Cl1—C33 | 1.733 (5) | C13—C14 | 1.436 (6) |
| Cl2—C33 | 1.752 (6) | C13—H13 | 0.9300 |
| Cl3—C33 | 1.738 (5) | C14—C19 | 1.393 (6) |
| N1—C13 | 1.293 (5) | C14—C15 | 1.415 (6) |
| N1—C8 | 1.429 (5) | C15—C16 | 1.408 (6) |
| N2—C26 | 1.293 (5) | C16—C17 | 1.360 (7) |
| N2—C21 | 1.432 (5) | C16—H16 | 0.9300 |
| N3—O9 | 1.206 (5) | C17—C18 | 1.374 (7) |
| N3—O7 | 1.255 (4) | C17—H17 | 0.9300 |
| N3—O8 | 1.266 (5) | C18—C19 | 1.372 (7) |
| C9—C10 | 1.378 (6) | C18—H18 | 0.9300 |
| C9—C8 | 1.399 (6) | C19—H19 | 0.9300 |
| C9—H9 | 0.9300 | C20—C25 | 1.379 (6) |
| O1—C7 | 1.391 (5) | C20—C21 | 1.388 (6) |
| O1—C1 | 1.448 (5) | C21—C22 | 1.372 (6) |
| O2—C3 | 1.421 (5) | C22—C23 | 1.382 (6) |
| O2—C2 | 1.438 (5) | C22—H22 | 0.9300 |
| O3—C5 | 1.422 (5) | C23—C24 | 1.371 (7) |
| O3—C4 | 1.432 (5) | C23—H23 | 0.9300 |
| O4—C20 | 1.378 (5) | C24—C25 | 1.374 (6) |
| O4—C6 | 1.437 (5) | C24—H24 | 0.9300 |
| O5—C15 | 1.306 (5) | C25—H25 | 0.9300 |
| O6—C28 | 1.298 (5) | C26—C27 | 1.440 (6) |
| C1—C2 | 1.482 (6) | C26—H26 | 0.9300 |
| C1—H1A | 0.9700 | C27—C32 | 1.407 (6) |
| C1—H1B | 0.9700 | C27—C28 | 1.411 (6) |
| C2—H2A | 0.9700 | C28—C29 | 1.405 (6) |
| C2—H2B | 0.9700 | C29—C30 | 1.373 (6) |
| C3—C4 | 1.480 (6) | C29—H29 | 0.9300 |
| C3—H3A | 0.9700 | C30—C31 | 1.383 (7) |
| C3—H3B | 0.9700 | C30—H30 | 0.9300 |
| C4—H4A | 0.9700 | C31—C32 | 1.375 (7) |
| C4—H4B | 0.9700 | C31—H31 | 0.9300 |
| C5—C6 | 1.495 (6) | C32—H32 | 0.9300 |
| C5—H5A | 0.9700 | C33—H33 | 0.9800 |
| O6—Pr1—O5 | 136.97 (10) | C3—C4—H4B | 110.1 |
| O6—Pr1—N1 | 79.26 (11) | H4A—C4—H4B | 108.4 |
| O5—Pr1—N1 | 69.09 (10) | O3—C5—C6 | 106.8 (4) |
| O6—Pr1—O8 | 83.05 (10) | O3—C5—H5A | 110.4 |
| O5—Pr1—O8 | 139.60 (10) | C6—C5—H5A | 110.4 |
| N1—Pr1—O8 | 128.04 (10) | O3—C5—H5B | 110.4 |
| O6—Pr1—O7 | 76.36 (11) | C6—C5—H5B | 110.4 |
| O5—Pr1—O7 | 131.84 (10) | H5A—C5—H5B | 108.6 |
| N1—Pr1—O7 | 155.61 (11) | O4—C6—C5 | 109.9 (4) |
| O8—Pr1—O7 | 47.81 (10) | O4—C6—H6A | 109.7 |
| O6—Pr1—N2 | 68.58 (10) | C5—C6—H6A | 109.7 |
| O5—Pr1—N2 | 77.19 (11) | O4—C6—H6B | 109.7 |
| N1—Pr1—N2 | 79.07 (10) | C5—C6—H6B | 109.7 |
| O8—Pr1—N2 | 136.75 (10) | H6A—C6—H6B | 108.2 |
| O7—Pr1—N2 | 92.76 (10) | C12—C7—C8 | 121.2 (4) |
| O6—Pr1—O1 | 70.29 (10) | C12—C7—O1 | 122.1 (4) |
| O5—Pr1—O1 | 113.61 (10) | C8—C7—O1 | 116.8 (4) |
| N1—Pr1—O1 | 59.47 (9) | C7—C8—C9 | 118.2 (4) |
| O8—Pr1—O1 | 68.58 (9) | C7—C8—N1 | 116.8 (4) |
| O7—Pr1—O1 | 110.38 (9) | C9—C8—N1 | 125.0 (4) |
| N2—Pr1—O1 | 125.60 (9) | C11—C10—C9 | 120.3 (5) |
| O6—Pr1—O2 | 128.24 (10) | C11—C10—H10 | 119.8 |
| O5—Pr1—O2 | 80.19 (10) | C9—C10—H10 | 119.8 |
| N1—Pr1—O2 | 88.25 (10) | C12—C11—C10 | 120.1 (5) |
| O8—Pr1—O2 | 65.98 (9) | C12—C11—H11 | 119.9 |
| O7—Pr1—O2 | 106.17 (10) | C10—C11—H11 | 119.9 |
| N2—Pr1—O2 | 156.82 (10) | C7—C12—C11 | 120.3 (5) |
| O1—Pr1—O2 | 60.33 (8) | C7—C12—H12 | 119.9 |
| O6—Pr1—O3 | 148.83 (10) | C11—C12—H12 | 119.9 |
| O5—Pr1—O3 | 69.79 (9) | N1—C13—C14 | 127.4 (4) |
| N1—Pr1—O3 | 131.76 (10) | N1—C13—H13 | 116.3 |
| O8—Pr1—O3 | 74.57 (9) | C14—C13—H13 | 116.3 |
| O7—Pr1—O3 | 72.54 (10) | C19—C14—C15 | 119.2 (4) |
| N2—Pr1—O3 | 114.75 (10) | C19—C14—C13 | 117.6 (4) |
| O1—Pr1—O3 | 118.97 (8) | C15—C14—C13 | 123.1 (4) |
| O2—Pr1—O3 | 60.76 (9) | O5—C15—C16 | 119.9 (4) |
| O6—Pr1—O4 | 106.28 (10) | O5—C15—C14 | 122.8 (4) |
| O5—Pr1—O4 | 73.42 (9) | C16—C15—C14 | 117.4 (4) |
| N1—Pr1—O4 | 126.95 (9) | C17—C16—C15 | 121.4 (5) |
| O8—Pr1—O4 | 104.85 (9) | C17—C16—H16 | 119.3 |
| O7—Pr1—O4 | 62.29 (9) | C15—C16—H16 | 119.3 |
| N2—Pr1—O4 | 56.72 (9) | C16—C17—C18 | 121.4 (5) |
| O1—Pr1—O4 | 172.66 (8) | C16—C17—H17 | 119.3 |
| O2—Pr1—O4 | 120.76 (8) | C18—C17—H17 | 119.3 |
| O3—Pr1—O4 | 60.53 (8) | C19—C18—C17 | 118.8 (5) |
| C13—N1—C8 | 117.0 (4) | C19—C18—H18 | 120.6 |
| C13—N1—Pr1 | 130.5 (3) | C17—C18—H18 | 120.6 |
| C8—N1—Pr1 | 112.5 (2) | C18—C19—C14 | 121.8 (5) |
| C26—N2—C21 | 117.1 (4) | C18—C19—H19 | 119.1 |
| C26—N2—Pr1 | 129.2 (3) | C14—C19—H19 | 119.1 |
| C21—N2—Pr1 | 113.7 (3) | O4—C20—C25 | 124.8 (4) |
| O9—N3—O7 | 122.1 (4) | O4—C20—C21 | 114.8 (4) |
| O9—N3—O8 | 121.1 (4) | C25—C20—C21 | 120.4 (4) |
| O7—N3—O8 | 116.8 (4) | C22—C21—C20 | 119.1 (4) |
| C10—C9—C8 | 119.9 (5) | C22—C21—N2 | 124.5 (4) |
| C10—C9—H9 | 120.1 | C20—C21—N2 | 116.3 (4) |
| C8—C9—H9 | 120.1 | C21—C22—C23 | 121.0 (5) |
| C7—O1—C1 | 111.6 (3) | C21—C22—H22 | 119.5 |
| C7—O1—Pr1 | 111.6 (2) | C23—C22—H22 | 119.5 |
| C1—O1—Pr1 | 118.0 (2) | C24—C23—C22 | 118.9 (5) |
| C3—O2—C2 | 109.9 (3) | C24—C23—H23 | 120.6 |
| C3—O2—Pr1 | 118.4 (3) | C22—C23—H23 | 120.6 |
| C2—O2—Pr1 | 118.3 (2) | C23—C24—C25 | 121.4 (5) |
| C5—O3—C4 | 111.2 (3) | C23—C24—H24 | 119.3 |
| C5—O3—Pr1 | 115.9 (2) | C25—C24—H24 | 119.3 |
| C4—O3—Pr1 | 110.6 (2) | C24—C25—C20 | 119.1 (5) |
| C20—O4—C6 | 118.6 (3) | C24—C25—H25 | 120.4 |
| C20—O4—Pr1 | 111.7 (2) | C20—C25—H25 | 120.4 |
| C6—O4—Pr1 | 113.2 (2) | N2—C26—C27 | 126.7 (4) |
| C15—O5—Pr1 | 146.5 (3) | N2—C26—H26 | 116.6 |
| C28—O6—Pr1 | 144.1 (3) | C27—C26—H26 | 116.6 |
| N3—O7—Pr1 | 97.3 (3) | C32—C27—C28 | 119.7 (4) |
| N3—O8—Pr1 | 97.0 (2) | C32—C27—C26 | 117.1 (4) |
| O1—C1—C2 | 109.2 (4) | C28—C27—C26 | 123.2 (4) |
| O1—C1—H1A | 109.8 | O6—C28—C29 | 120.4 (4) |
| C2—C1—H1A | 109.8 | O6—C28—C27 | 122.6 (4) |
| O1—C1—H1B | 109.8 | C29—C28—C27 | 117.1 (4) |
| C2—C1—H1B | 109.8 | C30—C29—C28 | 122.4 (5) |
| H1A—C1—H1B | 108.3 | C30—C29—H29 | 118.8 |
| O2—C2—C1 | 107.2 (4) | C28—C29—H29 | 118.8 |
| O2—C2—H2A | 110.3 | C29—C30—C31 | 120.1 (5) |
| C1—C2—H2A | 110.3 | C29—C30—H30 | 120.0 |
| O2—C2—H2B | 110.3 | C31—C30—H30 | 120.0 |
| C1—C2—H2B | 110.3 | C32—C31—C30 | 119.4 (5) |
| H2A—C2—H2B | 108.5 | C32—C31—H31 | 120.3 |
| O2—C3—C4 | 108.8 (4) | C30—C31—H31 | 120.3 |
| O2—C3—H3A | 109.9 | C31—C32—C27 | 121.3 (5) |
| C4—C3—H3A | 109.9 | C31—C32—H32 | 119.4 |
| O2—C3—H3B | 109.9 | C27—C32—H32 | 119.4 |
| C4—C3—H3B | 109.9 | Cl1—C33—Cl3 | 110.7 (3) |
| H3A—C3—H3B | 108.3 | Cl1—C33—Cl2 | 110.4 (3) |
| O3—C4—C3 | 108.0 (4) | Cl3—C33—Cl2 | 110.9 (3) |
| O3—C4—H4A | 110.1 | Cl1—C33—H33 | 108.2 |
| C3—C4—H4A | 110.1 | Cl3—C33—H33 | 108.2 |
| O3—C4—H4B | 110.1 | Cl2—C33—H33 | 108.2 |
Experimental details
| Crystal data | |
| Chemical formula | [Pr(C32H30N2O6)(NO3)]·CHCl3 |
| Mr | 860.87 |
| Crystal system, space group | Monoclinic, P21/c |
| Temperature (K) | 298 |
| a, b, c (Å) | 11.3454 (14), 20.150 (2), 15.4676 (17) |
| β (°) | 100.585 (2) |
| V (Å3) | 3475.9 (7) |
| Z | 4 |
| Radiation type | Mo Kα |
| µ (mm−1) | 1.69 |
| Crystal size (mm) | 0.48 × 0.43 × 0.21 |
| Data collection | |
| Diffractometer | Bruker SMART 1000 CCD diffractometer |
| Absorption correction | Multi-scan (SADABS; Sheldrick, 1996) |
| Tmin, Tmax | 0.498, 0.718 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 17233, 6118, 4284 |
| Rint | 0.043 |
| (sin θ/λ)max (Å−1) | 0.595 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.035, 0.083, 1.03 |
| No. of reflections | 6118 |
| No. of parameters | 442 |
| H-atom treatment | H-atom parameters constrained |
| Δρmax, Δρmin (e Å−3) | 1.44, −0.55 |
Computer programs: SMART (Bruker, 1997), SAINT (Bruker, 1997), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), SHELXTL (Sheldrick, 2008), publCIF (Westrip, 2008).
| Pr1—O6 | 2.269 (3) | Pr1—N2 | 2.670 (4) |
| Pr1—O5 | 2.278 (3) | Pr1—O1 | 2.708 (3) |
| Pr1—N1 | 2.646 (3) | Pr1—O2 | 2.710 (3) |
| Pr1—O8 | 2.649 (3) | Pr1—O3 | 2.787 (3) |
| Pr1—O7 | 2.649 (3) | Pr1—O4 | 2.801 (3) |
| O6—Pr1—N1 | 79.26 (11) | N1—Pr1—O1 | 59.47 (9) |
| O6—Pr1—O7 | 76.36 (11) | O1—Pr1—O2 | 60.33 (8) |
| O8—Pr1—O7 | 47.81 (10) | O2—Pr1—O3 | 60.76 (9) |
| O5—Pr1—N2 | 77.19 (11) | O5—Pr1—O4 | 73.42 (9) |
| N1—Pr1—N2 | 79.07 (10) | N2—Pr1—O4 | 56.72 (9) |
| O7—Pr1—N2 | 92.76 (10) | O3—Pr1—O4 | 60.53 (8) |
Acknowledgements
The authors acknowledge the National Natural Science Foundation of China (grant Nos. 20771048, 20431010, 20621091 and J0630962) for financial support.
References
Bruker (1997). SMART and SAINT. Bruker AXS Inc., Madison, Winconsin, USA. Google Scholar
Ding, X.-S., Yu, T.-Z. & Liu, X. (2007). Hua Xue Tong Bao, 6, 463–466. Google Scholar
Liu, W.-S., Li, X.-F., Wen, Y.-H. & Tan, M.-Y. (2004). Dalton Trans. pp. 640–644. Web of Science CSD CrossRef Google Scholar
Sheldrick, G. M. (1996). SADABS. University of Göttingen, Germany. Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Si, J.-M., Wu, Y.-J., Cai, L., Liu, Y.-Z. & Du, B.-S. (1994). J. Inclusion Phenom. Mol. Recognit. Chem. 17, 249–258. CrossRef CAS Web of Science Google Scholar
Wen, Y.-H., Qin, Z. & Liu, W.-S. (2001). J. Radioanal. Nucl. Chem. 250, 285–289. Web of Science CrossRef CAS Google Scholar
Westrip, S. P. (2008). publCIF. In preparation. Google Scholar
Yu, T.-Z., Su, W.-M., Li, W.-L. & Hong, Z.-R. (2006). Inorg. Chim. Acta, 359, 2246–2251. CrossRef CAS Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
![[Figure 1]](./wn2255fig1thm.gif)
![[Figure 2]](./wn2255fig2thm.gif)




Open chain polyethers offer many advantages over traditional crown ethers (Liu et al.,2004). They are excellent reagents for activating ion-selective electrodes and extracts of rare earth ions (Wen et al., 2001). In recent years the structures and properties of complexes with the zinc(II) ion, rare earth ions, and non-cyclic crown-type Schiff bases have been reported (Ding et al., 2007; Yu et al., 2006). To further understand the ability of these compounds to complex rare earth ions, we have prepared a non-cyclic crown-type Schiff base,1,8-bis[2-(2-hydroxyphenylideneimino)phenoxy]-3,6-dioxaoctane (H2L), as a ligand and investigated the reaction of H2L with Pr(NO3)3.6H2O. As part of a series of studies, we report here the crystal structure of the title compound. The structure of the complex is illustrated in Fig.1. Selected bond lengths and angles are given in Table 1. The PrIII ion is coordinated by ten donor atoms, eight of which belong to the non-cyclic crown-type Schiff base ligand and the remaining two to the bidentate nitrate group. The coordination polyhedron around PrIII is a distorted bicapped square antiprism (Fig. 2). The chloroform solvent molecule is not involved either in coordination to the PrIII center or in hydrogen bonding to the complex. The Pr—O (phenolate) bonds are stronger than the other Pr—O bonds. In the crystal structure, the non-cyclic crown-type Schiff base ligand wraps around the PrIII centre, forming a pseudo-ring.