organic compounds
r-2,c-6-Bis(4-chlorophenyl)-c-3,t-3-dimethylpiperidin-4-one
aDepartment of Chemistry, Government Arts College (Autonomous), Coimbatore 641 018, Tamilnadu, India, bPG Research Department of Physics, Rajah Serfoji Government College (Autonomous), Thanjavur 613 005, Tamilnadu, India, and cDepartment of Chemistry, Howard University, 525 College Street NW, Washington, DC 20059, USA
*Correspondence e-mail: [email protected]
In the title molecule, C19H19Cl2NO, the piperidine ring adopts a chair conformation and the dihedral angle between the two benzene rings is 77.23 (7)°. In the crystal structure, molecules are linked by N—H⋯O and C—H⋯O hydrogen bonds, and a weak C—H⋯π interaction is also observed.
Related literature
For a related see: Gayathri et al. (2008
). For background on the biological activities of piperidones, see: Dimmock et al. (2001
); Perumal et al. (2001
). For the synthesis and stereodynamics of piperidin-4-ones and their derivatives, see: Ponnuswamy et al. (2002
). For the synthesis, see: Noller & Baliah (1948
).
Experimental
Crystal data
|
|
Data collection: CrysAlis CCD (Oxford Diffraction, 2008
); cell refinement: CrysAlis RED (Oxford Diffraction, 2008
); data reduction: CrysAlis RED; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: ORTEP-3 (Farrugia, 1997
); software used to prepare material for publication: PLATON (Spek, 2003
).
Supporting information
contains datablocks global, I. DOI: 10.1107/S1600536808036325/hb2832sup1.cif
Structure factors: contains datablock I. DOI: 10.1107/S1600536808036325/hb2832Isup2.hkl
The procedure adopted for the preparation of the title heterocyclic compound is similar to that of Noller & Baliah (1948). Ammonium acetate (7.7 g, 0.1 mol), 4-chlorobenzaldehyde (28.1 g, 0.2 mol) and 3-methyl-2-butanone (10.7 ml, 0.1 mol) were dissolved in 70 ml of rectified spirit. The resulting solution was heated to boiling and set aside for a day. The oily base obtained was converted into its hydrochloride by the addition of concentrated hydrochloric acid and the separated solid was filtered. Then the hydrochloride was neutralized with liquid ammonia. The resulting solid was filtered and purified by recrystallization from ethanol to yield colourless plates of (I). The yield of the product obtained was 28.65 g (82%).
Atom H1 attached to N1 was located in a difference fourier map and refined isotropically. The remaining H atoms were positioned geometrically and allowed to ride on their parent atoms, with C—H = 0.95, 0.98, 0.99 and 1.00 Å for Csp2, methyl, methylene and methine C, respectively; Uiso(H) = kUeq(C), where k = 1.5 for methyl and 1.2 for all other H atoms.
Data collection: CrysAlis CCD (Oxford Diffraction, 2008); cell CrysAlis RED (Oxford Diffraction, 2008); data reduction: CrysAlis RED (Oxford Diffraction, 2008); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: ORTEP-3 (Farrugia, 1997); software used to prepare material for publication: PLATON (Spek, 2003).
| C19H19Cl2NO | Dx = 1.330 Mg m−3 |
| Mr = 348.25 | Melting point: 402(1) K |
| Orthorhombic, Pna21 | Mo Kα radiation, λ = 0.71073 Å |
| Hall symbol: P 2c -2n | Cell parameters from 4389 reflections |
| a = 13.1627 (5) Å | θ = 4.5–32.5° |
| b = 22.4739 (7) Å | µ = 0.38 mm−1 |
| c = 5.8794 (2) Å | T = 200 K |
| V = 1739.23 (10) Å3 | Rectangular-plate, colourless |
| Z = 4 | 0.44 × 0.31 × 0.22 mm |
| F(000) = 728 |
| Oxford Diffraction R Gemini diffractometer | 5694 independent reflections |
| Radiation source: fine-focus sealed tube | 2460 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.052 |
| Detector resolution: 10.5081 pixels mm-1 | θmax = 32.5°, θmin = 4.7° |
| ϕ and ω scans | h = −18→19 |
| Absorption correction: multi-scan (CrysAlis RED; Oxford Diffraction, 2008) | k = −33→33 |
| Tmin = 0.950, Tmax = 1.000 | l = −8→8 |
| 19147 measured reflections |
| Refinement on F2 | Secondary atom site location: difference Fourier map |
| Least-squares matrix: full | Hydrogen site location: difmap and geom |
| R[F2 > 2σ(F2)] = 0.039 | H atoms treated by a mixture of independent and constrained refinement |
| wR(F2) = 0.083 | w = 1/[σ2(Fo2) + (0.0371P)2] where P = (Fo2 + 2Fc2)/3 |
| S = 0.82 | (Δ/σ)max = 0.001 |
| 5694 reflections | Δρmax = 0.34 e Å−3 |
| 212 parameters | Δρmin = −0.31 e Å−3 |
| 1 restraint | Absolute structure: Flack (1983), 2278 Friedel pairs |
| Primary atom site location: structure-invariant direct methods | Absolute structure parameter: −0.03 (5) |
| C19H19Cl2NO | V = 1739.23 (10) Å3 |
| Mr = 348.25 | Z = 4 |
| Orthorhombic, Pna21 | Mo Kα radiation |
| a = 13.1627 (5) Å | µ = 0.38 mm−1 |
| b = 22.4739 (7) Å | T = 200 K |
| c = 5.8794 (2) Å | 0.44 × 0.31 × 0.22 mm |
| Oxford Diffraction R Gemini diffractometer | 5694 independent reflections |
| Absorption correction: multi-scan (CrysAlis RED; Oxford Diffraction, 2008) | 2460 reflections with I > 2σ(I) |
| Tmin = 0.950, Tmax = 1.000 | Rint = 0.052 |
| 19147 measured reflections |
| R[F2 > 2σ(F2)] = 0.039 | H atoms treated by a mixture of independent and constrained refinement |
| wR(F2) = 0.083 | Δρmax = 0.34 e Å−3 |
| S = 0.82 | Δρmin = −0.31 e Å−3 |
| 5694 reflections | Absolute structure: Flack (1983), 2278 Friedel pairs |
| 212 parameters | Absolute structure parameter: −0.03 (5) |
| 1 restraint |
Geometry. Bond distances, angles etc. have been calculated using the rounded fractional coordinates. All su's are estimated from the variances of the (full) variance-covariance matrix. The cell e.s.d.'s are taken into account in the estimation of distances, angles and torsion angles |
Refinement. Refinement of F2 against ALL reflections. The weighted R-factor wR and goodness of fit S are based on F2, conventional R-factors R are based on F, with F set to zero for negative F2. The threshold expression of F2 > 2σ(F2) is used only for calculating R-factors(gt) etc. and is not relevant to the choice of reflections for refinement. R-factors based on F2 are statistically about twice as large as those based on F, and R- factors based on ALL data will be even larger. |
| x | y | z | Uiso*/Ueq | ||
| Cl1 | 0.03898 (4) | 0.45263 (2) | 0.55799 (11) | 0.0585 (2) | |
| Cl2 | 0.10182 (5) | −0.04812 (2) | 1.04537 (12) | 0.0655 (2) | |
| O4 | 0.57022 (11) | 0.24936 (6) | 1.2121 (2) | 0.0424 (5) | |
| N1 | 0.28387 (13) | 0.22418 (6) | 1.0183 (3) | 0.0312 (5) | |
| C2 | 0.32122 (13) | 0.28540 (7) | 1.0528 (3) | 0.0277 (5) | |
| C3 | 0.43587 (14) | 0.28927 (8) | 0.9833 (3) | 0.0307 (6) | |
| C4 | 0.49124 (15) | 0.23934 (9) | 1.1093 (3) | 0.0341 (6) | |
| C5 | 0.44531 (14) | 0.17905 (9) | 1.1022 (4) | 0.0411 (7) | |
| C6 | 0.33289 (15) | 0.18081 (8) | 1.1659 (3) | 0.0321 (6) | |
| C21 | 0.25298 (15) | 0.32842 (8) | 0.9275 (3) | 0.0312 (6) | |
| C22 | 0.21068 (13) | 0.31249 (8) | 0.7180 (3) | 0.0314 (6) | |
| C23 | 0.14602 (14) | 0.35069 (8) | 0.6055 (3) | 0.0345 (6) | |
| C24 | 0.12245 (15) | 0.40493 (8) | 0.7019 (3) | 0.0352 (6) | |
| C25 | 0.16202 (16) | 0.42206 (8) | 0.9082 (3) | 0.0377 (7) | |
| C26 | 0.22727 (14) | 0.38327 (8) | 1.0207 (3) | 0.0347 (6) | |
| C31 | 0.47926 (14) | 0.34992 (8) | 1.0480 (4) | 0.0439 (7) | |
| C32 | 0.45062 (15) | 0.27850 (10) | 0.7274 (3) | 0.0426 (7) | |
| C61 | 0.27905 (14) | 0.12205 (8) | 1.1398 (3) | 0.0305 (6) | |
| C62 | 0.28440 (17) | 0.08976 (9) | 0.9400 (3) | 0.0439 (7) | |
| C63 | 0.23098 (19) | 0.03820 (9) | 0.9104 (4) | 0.0504 (8) | |
| C64 | 0.17155 (15) | 0.01751 (8) | 1.0837 (4) | 0.0424 (7) | |
| C65 | 0.16451 (18) | 0.04755 (10) | 1.2868 (4) | 0.0461 (8) | |
| C66 | 0.21822 (16) | 0.09989 (10) | 1.3129 (3) | 0.0432 (8) | |
| H1 | 0.2194 (13) | 0.2237 (7) | 1.032 (3) | 0.023 (5)* | |
| H2 | 0.31631 | 0.29460 | 1.21887 | 0.0333* | |
| H5A | 0.48191 | 0.15262 | 1.20910 | 0.0493* | |
| H5B | 0.45276 | 0.16236 | 0.94724 | 0.0493* | |
| H6 | 0.32639 | 0.19436 | 1.32722 | 0.0385* | |
| H22 | 0.22667 | 0.27498 | 0.65262 | 0.0376* | |
| H23 | 0.11790 | 0.33976 | 0.46270 | 0.0414* | |
| H25 | 0.14517 | 0.45957 | 0.97251 | 0.0452* | |
| H26 | 0.25477 | 0.39444 | 1.16384 | 0.0416* | |
| H31A | 0.44241 | 0.38120 | 0.96623 | 0.0659* | |
| H31B | 0.55139 | 0.35148 | 1.00700 | 0.0659* | |
| H31C | 0.47187 | 0.35603 | 1.21217 | 0.0659* | |
| H32A | 0.41564 | 0.30973 | 0.64133 | 0.0639* | |
| H32B | 0.42235 | 0.23962 | 0.68637 | 0.0639* | |
| H32C | 0.52328 | 0.27930 | 0.69113 | 0.0639* | |
| H62 | 0.32636 | 0.10380 | 0.81998 | 0.0527* | |
| H63 | 0.23513 | 0.01699 | 0.77096 | 0.0605* | |
| H65 | 0.12350 | 0.03259 | 1.40682 | 0.0553* | |
| H66 | 0.21343 | 0.12114 | 1.45215 | 0.0519* |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Cl1 | 0.0547 (3) | 0.0505 (3) | 0.0703 (4) | 0.0179 (3) | −0.0132 (4) | 0.0120 (3) |
| Cl2 | 0.0681 (4) | 0.0421 (3) | 0.0864 (4) | −0.0195 (3) | −0.0183 (4) | 0.0074 (3) |
| O4 | 0.0273 (8) | 0.0530 (9) | 0.0468 (8) | −0.0024 (7) | −0.0046 (8) | 0.0054 (7) |
| N1 | 0.0184 (9) | 0.0324 (8) | 0.0427 (10) | 0.0015 (7) | −0.0010 (8) | 0.0036 (7) |
| C2 | 0.0273 (10) | 0.0267 (9) | 0.0292 (9) | 0.0009 (8) | 0.0047 (10) | 0.0017 (10) |
| C3 | 0.0262 (11) | 0.0338 (10) | 0.0321 (10) | −0.0012 (9) | 0.0015 (9) | 0.0010 (8) |
| C4 | 0.0225 (10) | 0.0414 (12) | 0.0385 (11) | 0.0026 (9) | 0.0030 (10) | −0.0003 (9) |
| C5 | 0.0293 (11) | 0.0359 (11) | 0.0581 (14) | 0.0052 (9) | −0.0109 (11) | 0.0094 (11) |
| C6 | 0.0329 (11) | 0.0306 (10) | 0.0328 (9) | 0.0049 (9) | −0.0053 (9) | 0.0087 (8) |
| C21 | 0.0223 (10) | 0.0374 (12) | 0.0339 (10) | −0.0015 (9) | 0.0035 (9) | −0.0045 (9) |
| C22 | 0.0337 (11) | 0.0273 (10) | 0.0331 (10) | −0.0018 (9) | −0.0029 (10) | −0.0017 (8) |
| C23 | 0.0307 (11) | 0.0362 (10) | 0.0366 (11) | 0.0023 (9) | −0.0043 (9) | 0.0008 (9) |
| C24 | 0.0306 (11) | 0.0327 (11) | 0.0424 (11) | 0.0012 (9) | −0.0018 (10) | 0.0117 (10) |
| C25 | 0.0354 (12) | 0.0304 (11) | 0.0472 (11) | 0.0037 (10) | 0.0028 (11) | −0.0011 (10) |
| C26 | 0.0282 (10) | 0.0364 (10) | 0.0394 (10) | 0.0017 (9) | −0.0005 (10) | −0.0045 (9) |
| C31 | 0.0355 (11) | 0.0386 (11) | 0.0577 (12) | −0.0024 (9) | −0.0058 (13) | −0.0094 (11) |
| C32 | 0.0360 (13) | 0.0550 (14) | 0.0368 (11) | −0.0003 (10) | 0.0049 (11) | 0.0074 (11) |
| C61 | 0.0304 (11) | 0.0246 (9) | 0.0364 (10) | 0.0045 (9) | −0.0026 (9) | 0.0077 (8) |
| C62 | 0.0537 (15) | 0.0387 (12) | 0.0393 (11) | −0.0057 (11) | 0.0080 (11) | 0.0021 (10) |
| C63 | 0.0657 (17) | 0.0362 (13) | 0.0493 (12) | −0.0036 (12) | −0.0009 (14) | −0.0095 (11) |
| C64 | 0.0390 (12) | 0.0308 (10) | 0.0573 (14) | −0.0048 (9) | −0.0099 (13) | 0.0126 (12) |
| C65 | 0.0384 (14) | 0.0485 (14) | 0.0514 (13) | −0.0074 (11) | −0.0026 (11) | 0.0076 (11) |
| C66 | 0.0445 (14) | 0.0455 (14) | 0.0397 (11) | −0.0003 (12) | −0.0064 (11) | 0.0015 (10) |
| Cl1—C24 | 1.7528 (19) | C62—C63 | 1.367 (3) |
| Cl2—C64 | 1.7518 (19) | C63—C64 | 1.366 (3) |
| O4—C4 | 1.223 (2) | C64—C65 | 1.375 (3) |
| N1—C2 | 1.475 (2) | C65—C66 | 1.381 (3) |
| N1—C6 | 1.456 (2) | C2—H2 | 1.0000 |
| N1—H1 | 0.853 (17) | C5—H5A | 0.9900 |
| C2—C3 | 1.566 (3) | C5—H5B | 0.9900 |
| C2—C21 | 1.511 (2) | C6—H6 | 1.0000 |
| C3—C31 | 1.526 (3) | C22—H22 | 0.9500 |
| C3—C32 | 1.536 (3) | C23—H23 | 0.9500 |
| C3—C4 | 1.529 (3) | C25—H25 | 0.9500 |
| C4—C5 | 1.484 (3) | C26—H26 | 0.9500 |
| C5—C6 | 1.527 (3) | C31—H31A | 0.9800 |
| C6—C61 | 1.507 (3) | C31—H31B | 0.9800 |
| C21—C22 | 1.398 (3) | C31—H31C | 0.9800 |
| C21—C26 | 1.391 (3) | C32—H32A | 0.9800 |
| C22—C23 | 1.378 (3) | C32—H32B | 0.9800 |
| C23—C24 | 1.380 (3) | C32—H32C | 0.9800 |
| C24—C25 | 1.375 (3) | C62—H62 | 0.9500 |
| C25—C26 | 1.391 (3) | C63—H63 | 0.9500 |
| C61—C66 | 1.387 (3) | C65—H65 | 0.9500 |
| C61—C62 | 1.383 (3) | C66—H66 | 0.9500 |
| C2—N1—C6 | 113.25 (15) | N1—C2—H2 | 108.00 |
| C6—N1—H1 | 112.1 (11) | C3—C2—H2 | 108.00 |
| C2—N1—H1 | 109.3 (11) | C21—C2—H2 | 108.00 |
| N1—C2—C21 | 109.36 (14) | C4—C5—H5A | 109.00 |
| N1—C2—C3 | 109.70 (14) | C4—C5—H5B | 109.00 |
| C3—C2—C21 | 114.21 (14) | C6—C5—H5A | 109.00 |
| C2—C3—C31 | 110.20 (14) | C6—C5—H5B | 109.00 |
| C2—C3—C4 | 106.98 (14) | H5A—C5—H5B | 108.00 |
| C4—C3—C32 | 107.37 (15) | N1—C6—H6 | 109.00 |
| C31—C3—C32 | 109.73 (16) | C5—C6—H6 | 109.00 |
| C4—C3—C31 | 110.87 (15) | C61—C6—H6 | 109.00 |
| C2—C3—C32 | 111.63 (15) | C21—C22—H22 | 120.00 |
| O4—C4—C5 | 121.87 (18) | C23—C22—H22 | 120.00 |
| O4—C4—C3 | 120.61 (17) | C22—C23—H23 | 120.00 |
| C3—C4—C5 | 117.52 (16) | C24—C23—H23 | 120.00 |
| C4—C5—C6 | 111.36 (16) | C24—C25—H25 | 121.00 |
| N1—C6—C5 | 107.50 (15) | C26—C25—H25 | 121.00 |
| C5—C6—C61 | 114.09 (16) | C21—C26—H26 | 119.00 |
| N1—C6—C61 | 108.52 (15) | C25—C26—H26 | 119.00 |
| C2—C21—C26 | 121.30 (16) | C3—C31—H31A | 109.00 |
| C2—C21—C22 | 120.15 (16) | C3—C31—H31B | 109.00 |
| C22—C21—C26 | 118.50 (17) | C3—C31—H31C | 109.00 |
| C21—C22—C23 | 120.61 (17) | H31A—C31—H31B | 109.00 |
| C22—C23—C24 | 119.48 (17) | H31A—C31—H31C | 109.00 |
| C23—C24—C25 | 121.64 (17) | H31B—C31—H31C | 109.00 |
| Cl1—C24—C25 | 119.47 (14) | C3—C32—H32A | 109.00 |
| Cl1—C24—C23 | 118.88 (14) | C3—C32—H32B | 109.00 |
| C24—C25—C26 | 118.54 (17) | C3—C32—H32C | 109.00 |
| C21—C26—C25 | 121.22 (17) | H32A—C32—H32B | 109.00 |
| C62—C61—C66 | 117.66 (18) | H32A—C32—H32C | 109.00 |
| C6—C61—C62 | 121.51 (17) | H32B—C32—H32C | 109.00 |
| C6—C61—C66 | 120.76 (16) | C61—C62—H62 | 119.00 |
| C61—C62—C63 | 121.81 (19) | C63—C62—H62 | 119.00 |
| C62—C63—C64 | 119.2 (2) | C62—C63—H63 | 120.00 |
| Cl2—C64—C65 | 119.33 (17) | C64—C63—H63 | 120.00 |
| Cl2—C64—C63 | 119.38 (17) | C64—C65—H65 | 121.00 |
| C63—C64—C65 | 121.28 (19) | C66—C65—H65 | 121.00 |
| C64—C65—C66 | 118.7 (2) | C61—C66—H66 | 119.00 |
| C61—C66—C65 | 121.31 (18) | C65—C66—H66 | 119.00 |
| C6—N1—C2—C3 | 64.86 (19) | N1—C6—C61—C62 | 68.3 (2) |
| C6—N1—C2—C21 | −169.16 (15) | N1—C6—C61—C66 | −108.6 (2) |
| C2—N1—C6—C5 | −64.02 (19) | C5—C6—C61—C62 | −51.5 (2) |
| C2—N1—C6—C61 | 172.13 (15) | C5—C6—C61—C66 | 131.6 (2) |
| N1—C2—C3—C4 | −51.75 (18) | C2—C21—C22—C23 | 178.11 (17) |
| N1—C2—C3—C31 | −172.37 (15) | C26—C21—C22—C23 | 0.8 (3) |
| N1—C2—C3—C32 | 65.44 (19) | C2—C21—C26—C25 | −178.05 (17) |
| C21—C2—C3—C4 | −174.92 (14) | C22—C21—C26—C25 | −0.8 (3) |
| C21—C2—C3—C31 | 64.5 (2) | C21—C22—C23—C24 | −0.5 (3) |
| C21—C2—C3—C32 | −57.7 (2) | C22—C23—C24—Cl1 | −179.30 (14) |
| N1—C2—C21—C22 | −36.1 (2) | C22—C23—C24—C25 | 0.1 (3) |
| N1—C2—C21—C26 | 141.12 (18) | Cl1—C24—C25—C26 | 179.33 (15) |
| C3—C2—C21—C22 | 87.3 (2) | C23—C24—C25—C26 | −0.1 (3) |
| C3—C2—C21—C26 | −95.5 (2) | C24—C25—C26—C21 | 0.4 (3) |
| C2—C3—C4—O4 | −132.07 (17) | C6—C61—C62—C63 | −176.1 (2) |
| C2—C3—C4—C5 | 47.7 (2) | C66—C61—C62—C63 | 0.9 (3) |
| C31—C3—C4—O4 | −11.9 (2) | C6—C61—C66—C65 | 176.77 (19) |
| C31—C3—C4—C5 | 167.88 (17) | C62—C61—C66—C65 | −0.2 (3) |
| C32—C3—C4—O4 | 107.97 (19) | C61—C62—C63—C64 | −0.8 (3) |
| C32—C3—C4—C5 | −72.3 (2) | C62—C63—C64—Cl2 | 179.29 (17) |
| O4—C4—C5—C6 | 129.70 (19) | C62—C63—C64—C65 | 0.0 (3) |
| C3—C4—C5—C6 | −50.1 (2) | Cl2—C64—C65—C66 | −178.65 (17) |
| C4—C5—C6—N1 | 53.9 (2) | C63—C64—C65—C66 | 0.6 (3) |
| C4—C5—C6—C61 | 174.28 (16) | C64—C65—C66—C61 | −0.5 (3) |
| D—H···A | D—H | H···A | D···A | D—H···A |
| N1—H1···O4i | 0.853 (17) | 2.312 (17) | 3.092 (2) | 152.3 (15) |
| C23—H23···O4ii | 0.95 | 2.56 | 3.377 (2) | 144 |
| C31—H31B···Cg1iii | 0.98 | 2.96 | 3.7265 (15) | 136 |
| Symmetry codes: (i) x−1/2, −y+1/2, z; (ii) x−1/2, −y+1/2, z−1; (iii) x+1/2, −y+1/2, z. |
Experimental details
| Crystal data | |
| Chemical formula | C19H19Cl2NO |
| Mr | 348.25 |
| Crystal system, space group | Orthorhombic, Pna21 |
| Temperature (K) | 200 |
| a, b, c (Å) | 13.1627 (5), 22.4739 (7), 5.8794 (2) |
| V (Å3) | 1739.23 (10) |
| Z | 4 |
| Radiation type | Mo Kα |
| µ (mm−1) | 0.38 |
| Crystal size (mm) | 0.44 × 0.31 × 0.22 |
| Data collection | |
| Diffractometer | Oxford Diffraction R Gemini diffractometer |
| Absorption correction | Multi-scan (CrysAlis RED; Oxford Diffraction, 2008) |
| Tmin, Tmax | 0.950, 1.000 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 19147, 5694, 2460 |
| Rint | 0.052 |
| (sin θ/λ)max (Å−1) | 0.757 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.039, 0.083, 0.82 |
| No. of reflections | 5694 |
| No. of parameters | 212 |
| No. of restraints | 1 |
| H-atom treatment | H atoms treated by a mixture of independent and constrained refinement |
| Δρmax, Δρmin (e Å−3) | 0.34, −0.31 |
| Absolute structure | Flack (1983), 2278 Friedel pairs |
| Absolute structure parameter | −0.03 (5) |
Computer programs: CrysAlis CCD (Oxford Diffraction, 2008), CrysAlis RED (Oxford Diffraction, 2008), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), ORTEP-3 (Farrugia, 1997), PLATON (Spek, 2003).
| D—H···A | D—H | H···A | D···A | D—H···A |
| N1—H1···O4i | 0.853 (17) | 2.312 (17) | 3.092 (2) | 152.3 (15) |
| C23—H23···O4ii | 0.95 | 2.56 | 3.377 (2) | 144 |
| C31—H31B···Cg1iii | 0.98 | 2.96 | 3.7265 (15) | 136 |
| Symmetry codes: (i) x−1/2, −y+1/2, z; (ii) x−1/2, −y+1/2, z−1; (iii) x+1/2, −y+1/2, z. |
Acknowledgements
AT thanks the UGC, India, for the award of a Minor Research Project [File No. MRP-2355/06(UGC-SERO), Link No. 2355, 10/01/2007]. RJB acknowledges the NSF–MRI program for funding the purchase of the X-ray CCD diffractometer.
References
Dimmock, J. R., Padmanilayam, M. P., Puthucode, R. N., Nazarali, A. J., Motaganahalli, N. L., Zello, G. A., Quail, J. W., Oloo, E. O., Kraatz, H. B., Prisciak, J. S., Allen, T. M., Santos, C. L., Balsarini, J., Clercq, E. D. & Manavathu, E. K. (2001). J. Med. Chem. 44, 586–593. Web of Science CSD CrossRef PubMed CAS Google Scholar
Farrugia, L. J. (1997). J. Appl. Cryst. 30, 565. CrossRef IUCr Journals Google Scholar
Flack, H. D. (1983). Acta Cryst. A39, 876–881. CrossRef CAS Web of Science IUCr Journals Google Scholar
Gayathri, P., Thiruvalluvar, A., Manimekalai, A., Sivakumar, S. & Butcher, R. J. (2008). Acta Cryst. E64, o1973. Web of Science CSD CrossRef IUCr Journals Google Scholar
Noller, C. & Baliah, V. (1948). J. Am. Chem. Soc. 70, 3853–3855. CrossRef PubMed CAS Web of Science Google Scholar
Oxford Diffraction (2008). CrysAlis CCD and CrysAlis RED. Oxford Diffraction Ltd, Abingdon, Oxfordshire, England. Google Scholar
Perumal, R. V., Agiraj, M. & Shanmugapandiyan, P. (2001). Indian Drugs, 38, 156–159. Google Scholar
Ponnuswamy, S., Venkatraj, M., Jeyaraman, R., Suresh Kumar, M., Kumaran, D. & Ponnuswamy, M. N. (2002). Indian J. Chem. Sect B, 41, 614–627. Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Spek, A. L. (2003). J. Appl. Cryst. 36, 7–13. Web of Science CrossRef CAS IUCr Journals Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
; (ii)
; (iii)
. ![[Figure 1]](./hb2832fig1thm.gif)
![[Figure 2]](./hb2832fig2thm.gif)




Piperidones are an important group of heterocyclic compounds in the field of medicinal chemistry due to their biological activities, including cytotoxic and anticancer properties (Dimmock et al., 2001). Piperidones were also reported to possess analgesic, anti-inflammatory, central nervous system (CNS), local anaesthetic, anticancer and antimicrobial activity (Perumal et al., 2001). The design and synthesis of conformationally anchored molecules is an important approach towards improving potency and selectivity. One such class of compounds constitutes piperidin-4-ones and their derivatives, whose synthesis and stereodynamics are well investigated (Ponnuswamy et al., 2002). The crystal structure of r-2,c-6-Bis(4-chlorophenyl)-t-3-isopropyl-1-nitrosopiperidin-4-one has been reported, wherein the piperidine ring adopts a chair conformation (Gayathri et al., 2008).
In the title molecule, C19H19Cl2NO (Fig. 1), the piperidine ring adopts a chair conformation. The phenyl rings at position 2,6 and one of the methyl groups attached to the piperidine ring in 3, have equatorial orientations. The dihedral angle between the two phenyl rings is 77.23 (7)°. In the crystal, the molecules are linked by N1—H1···O4 (x - 1/2, 1/2 - y, z) and C23—H23···O4(x - 1/2, -y + 1/2, z - 1) hydrogen bonds (Table 1). Further, a C31—H31B···π interaction involving the phenyl ring (C61—C66) at position 6 also present in the crystal structure.