metal-organic compounds
trans,trans,trans-Diaquabis(nicotinamide-κN)bis(2-nitrobenzoato-κO)cadmium(II) dihydrate
aCollege of Chemistry and Chemical Engineering, Yangzhou University, Yangzhou 225002, People's Republic of China, and bDepartment of Chemistry, University of Malaya, 50603, Kuala Lumpur, Malaysia
*Correspondence e-mail: [email protected]
The cadmium atom in the title compound, [Cd(C7H4NO4)2(C6H6N2O)2(H2O)2]·2H2O, lies on a center of inversion in an all-trans octahedral environment. In the crystal, the complex interacts with the uncoordinated water molecules through O—H⋯O and N—H⋯O hydrogen bonds, forming a layered network.
Related literature
There are several examples of diaquadi(arylcarboxylato)di(nicotinamide)metal(II) compounds. For recent examples, see: Hökelek & Necefoğlu (2007a
,b
); Hökelek et al. (2007
); Koksharova et al. (2006
); Şahin et al. (2007a
,b
); Stachova et al. (2006
); Çaylak et al. (2007
).
Experimental
Crystal data
|
Refinement
|
|
Data collection: SMART (Bruker, 2000
); cell refinement: SAINT (Bruker, 2000
); data reduction: SAINT; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: X-SEED (Barbour, 2001
); software used to prepare material for publication: publCIF (Westrip, 2009
).
Supporting information
contains datablocks global, I. DOI: 10.1107/S1600536809005479/pv2136sup1.cif
Structure factors: contains datablock I. DOI: 10.1107/S1600536809005479/pv2136Isup2.hkl
A water/methanol (1:1 v/v) solution (3 ml) of cadmium nitrate trihydrate (0.082 g, 0.3 mmol) was added to a water/methanol (1:1 v/v) solution (3 ml) of 2-nitrobenzoic acid (0.100 g, 0.6 mmol), sodium hydroxide (0.024 g, 0.6 mmol) and nicotinamide (0.073 g, 0.6 mmol). A white powder was obtained after several days; this was recrystallized from DMF/methanol (3:1 v/v) to give colorless crystals in 50% yield. CH&N elemental analysis. Calculated for C26H28CdN6O14: C 41.04 H 3.68 N 11.04%; found: C 40.08, H 3.87, N 10.93%.
Carbon-bound H atoms were placed in calculated positions and were allowed to ride on the parent atoms. N and O-bound H atoms were located in a difference Fourier map, and were refined with distance restraints N–H = O–H = 0.85±0.01 Å; for the water molecules, an additional H···H 1.39±0.01 Å restraint was used. Their temperature factors were freely refined.
The measurements are 100% at the 2θ limit of 50 °.
Data collection: SMART (Bruker, 2000); cell SAINT (Bruker, 2000); data reduction: SAINT (Bruker, 2000); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: X-SEED (Barbour, 2001); software used to prepare material for publication: publCIF (Westrip, 2009).
| Fig. 1. Thermal ellipsoid plot of Cd(H2O)2(C7H4NO4)2(C6H6N2O)2.2H2O; displacement ellipsoids are drawn at the 50% probabability level, and H atoms as spheres of arbitrary radii. |
| [Cd(C7H4NO4)2(C6H6N2O)2(H2O)2]·2H2O | F(000) = 772 |
| Mr = 760.94 | Dx = 1.660 Mg m−3 |
| Monoclinic, P21/n | Mo Kα radiation, λ = 0.71073 Å |
| Hall symbol: -P 2yn | Cell parameters from 3417 reflections |
| a = 7.9365 (8) Å | θ = 2.1–25.1° |
| b = 19.589 (2) Å | µ = 0.80 mm−1 |
| c = 10.059 (1) Å | T = 293 K |
| β = 103.178 (2)° | Rod, colorless |
| V = 1522.6 (3) Å3 | 0.50 × 0.18 × 0.18 mm |
| Z = 2 |
| Bruker SMART area-detector diffractometer | 2651 independent reflections |
| Radiation source: medium-focus sealed tube | 2396 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.016 |
| ϕ and ω scans | θmax = 25.1°, θmin = 2.1° |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | h = −9→3 |
| Tmin = 0.619, Tmax = 0.866 | k = −20→23 |
| 4427 measured reflections | l = −11→11 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.034 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.093 | H atoms treated by a mixture of independent and constrained refinement |
| S = 1.13 | w = 1/[σ2(Fo2) + (0.0433P)2 + 2.3534P] where P = (Fo2 + 2Fc2)/3 |
| 2651 reflections | (Δ/σ)max = 0.001 |
| 246 parameters | Δρmax = 0.42 e Å−3 |
| 9 restraints | Δρmin = −1.04 e Å−3 |
| [Cd(C7H4NO4)2(C6H6N2O)2(H2O)2]·2H2O | V = 1522.6 (3) Å3 |
| Mr = 760.94 | Z = 2 |
| Monoclinic, P21/n | Mo Kα radiation |
| a = 7.9365 (8) Å | µ = 0.80 mm−1 |
| b = 19.589 (2) Å | T = 293 K |
| c = 10.059 (1) Å | 0.50 × 0.18 × 0.18 mm |
| β = 103.178 (2)° |
| Bruker SMART area-detector diffractometer | 2651 independent reflections |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | 2396 reflections with I > 2σ(I) |
| Tmin = 0.619, Tmax = 0.866 | Rint = 0.016 |
| 4427 measured reflections |
| R[F2 > 2σ(F2)] = 0.034 | 9 restraints |
| wR(F2) = 0.093 | H atoms treated by a mixture of independent and constrained refinement |
| S = 1.13 | Δρmax = 0.42 e Å−3 |
| 2651 reflections | Δρmin = −1.04 e Å−3 |
| 246 parameters |
| x | y | z | Uiso*/Ueq | ||
| Cd1 | 0.5000 | 0.5000 | 0.5000 | 0.02349 (13) | |
| O1 | 0.6570 (3) | 0.40982 (12) | 0.4385 (2) | 0.0312 (5) | |
| O2 | 0.4256 (3) | 0.36571 (14) | 0.2970 (3) | 0.0428 (7) | |
| O3 | 0.3595 (4) | 0.23243 (19) | 0.1217 (4) | 0.0693 (10) | |
| O4 | 0.4552 (5) | 0.2124 (2) | 0.3355 (4) | 0.0835 (12) | |
| O5 | 0.0789 (4) | 0.48477 (17) | 0.8538 (3) | 0.0505 (8) | |
| O1W | 0.7685 (3) | 0.55083 (13) | 0.5819 (3) | 0.0362 (6) | |
| H11 | 0.842 (5) | 0.561 (2) | 0.536 (4) | 0.055 (14)* | |
| H12 | 0.737 (6) | 0.5868 (14) | 0.616 (5) | 0.082 (19)* | |
| O2W | 0.9923 (3) | 0.57871 (14) | 0.4149 (3) | 0.0375 (6) | |
| H21 | 0.987 (5) | 0.556 (2) | 0.342 (3) | 0.079 (18)* | |
| H22 | 1.097 (2) | 0.581 (2) | 0.460 (3) | 0.050 (13)* | |
| N1 | 0.4713 (4) | 0.23414 (16) | 0.2260 (4) | 0.0438 (8) | |
| N2 | 0.5129 (3) | 0.44979 (15) | 0.7119 (3) | 0.0291 (6) | |
| N3 | 0.1940 (4) | 0.44256 (19) | 1.0627 (3) | 0.0405 (8) | |
| H31 | 0.274 (4) | 0.424 (2) | 1.122 (3) | 0.055 (13)* | |
| H32 | 0.114 (4) | 0.457 (2) | 1.098 (3) | 0.049 (12)* | |
| C1 | 0.6994 (4) | 0.32348 (16) | 0.2832 (3) | 0.0237 (6) | |
| C2 | 0.6421 (4) | 0.26190 (17) | 0.2198 (3) | 0.0282 (7) | |
| C3 | 0.7386 (5) | 0.22316 (19) | 0.1503 (4) | 0.0386 (9) | |
| H3 | 0.6942 | 0.1829 | 0.1070 | 0.047 (12)* | |
| C4 | 0.9033 (5) | 0.2454 (2) | 0.1459 (4) | 0.0407 (9) | |
| H4 | 0.9714 | 0.2196 | 0.1008 | 0.047 (12)* | |
| C5 | 0.9655 (5) | 0.3057 (2) | 0.2087 (4) | 0.0430 (9) | |
| H5 | 1.0761 | 0.3205 | 0.2063 | 0.057 (13)* | |
| C6 | 0.8643 (4) | 0.34455 (19) | 0.2755 (4) | 0.0337 (8) | |
| H6 | 0.9075 | 0.3855 | 0.3161 | 0.046 (12)* | |
| C7 | 0.5842 (4) | 0.36885 (16) | 0.3458 (3) | 0.0262 (7) | |
| C8 | 0.3792 (4) | 0.46351 (17) | 0.7674 (3) | 0.0256 (7) | |
| H8 | 0.2975 | 0.4951 | 0.7238 | 0.044 (12)* | |
| C9 | 0.3553 (4) | 0.43356 (17) | 0.8857 (3) | 0.0273 (7) | |
| C10 | 0.4767 (5) | 0.3864 (2) | 0.9499 (4) | 0.0399 (9) | |
| H10 | 0.4645 | 0.3648 | 1.0295 | 0.044 (11)* | |
| C11 | 0.6165 (5) | 0.3721 (2) | 0.8941 (4) | 0.0461 (10) | |
| H11A | 0.7004 | 0.3410 | 0.9362 | 0.055 (13)* | |
| C12 | 0.6301 (5) | 0.40434 (19) | 0.7751 (4) | 0.0352 (8) | |
| H12A | 0.7239 | 0.3942 | 0.7375 | 0.052 (12)* | |
| C13 | 0.1972 (4) | 0.45472 (18) | 0.9337 (3) | 0.0312 (7) |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Cd1 | 0.02157 (19) | 0.0277 (2) | 0.0224 (2) | −0.00033 (12) | 0.00743 (13) | 0.00046 (12) |
| O1 | 0.0292 (12) | 0.0324 (13) | 0.0303 (12) | 0.0020 (10) | 0.0034 (10) | −0.0075 (10) |
| O2 | 0.0268 (13) | 0.0550 (17) | 0.0443 (15) | 0.0049 (12) | 0.0033 (11) | −0.0207 (13) |
| O3 | 0.0398 (17) | 0.078 (2) | 0.085 (3) | −0.0141 (16) | 0.0042 (17) | −0.027 (2) |
| O4 | 0.087 (3) | 0.098 (3) | 0.078 (3) | −0.041 (2) | 0.044 (2) | 0.003 (2) |
| O5 | 0.0388 (16) | 0.084 (2) | 0.0318 (15) | 0.0297 (15) | 0.0135 (12) | 0.0122 (14) |
| O1W | 0.0273 (13) | 0.0406 (14) | 0.0416 (15) | −0.0066 (11) | 0.0094 (11) | −0.0085 (12) |
| O2W | 0.0276 (13) | 0.0452 (15) | 0.0390 (15) | 0.0019 (11) | 0.0061 (11) | −0.0039 (12) |
| N1 | 0.0417 (19) | 0.0363 (18) | 0.057 (2) | −0.0114 (14) | 0.0190 (17) | −0.0155 (16) |
| N2 | 0.0251 (14) | 0.0348 (15) | 0.0274 (15) | 0.0037 (12) | 0.0059 (11) | 0.0027 (12) |
| N3 | 0.0366 (17) | 0.066 (2) | 0.0223 (15) | 0.0158 (16) | 0.0128 (13) | 0.0093 (15) |
| C1 | 0.0281 (16) | 0.0240 (16) | 0.0173 (14) | 0.0011 (13) | 0.0015 (12) | −0.0017 (12) |
| C2 | 0.0282 (17) | 0.0258 (17) | 0.0313 (17) | −0.0024 (13) | 0.0083 (14) | −0.0016 (14) |
| C3 | 0.051 (2) | 0.0263 (18) | 0.041 (2) | −0.0017 (16) | 0.0154 (17) | −0.0088 (16) |
| C4 | 0.042 (2) | 0.040 (2) | 0.045 (2) | 0.0102 (17) | 0.0185 (17) | −0.0024 (17) |
| C5 | 0.0305 (19) | 0.047 (2) | 0.056 (3) | −0.0013 (17) | 0.0203 (18) | −0.0033 (19) |
| C6 | 0.0303 (18) | 0.0349 (19) | 0.0359 (19) | −0.0044 (15) | 0.0075 (15) | −0.0083 (15) |
| C7 | 0.0254 (16) | 0.0243 (16) | 0.0297 (17) | 0.0019 (13) | 0.0078 (13) | 0.0013 (13) |
| C8 | 0.0246 (16) | 0.0309 (18) | 0.0201 (15) | 0.0033 (13) | 0.0025 (12) | 0.0029 (13) |
| C9 | 0.0282 (17) | 0.0336 (18) | 0.0199 (15) | 0.0028 (14) | 0.0051 (13) | −0.0012 (13) |
| C10 | 0.042 (2) | 0.053 (2) | 0.0267 (18) | 0.0173 (18) | 0.0117 (15) | 0.0150 (17) |
| C11 | 0.041 (2) | 0.062 (3) | 0.035 (2) | 0.027 (2) | 0.0095 (17) | 0.0190 (19) |
| C12 | 0.0303 (18) | 0.046 (2) | 0.0317 (19) | 0.0088 (16) | 0.0117 (15) | 0.0022 (16) |
| C13 | 0.0304 (18) | 0.0375 (19) | 0.0274 (17) | 0.0051 (15) | 0.0098 (14) | 0.0027 (14) |
| Cd1—O1i | 2.325 (2) | C1—C2 | 1.391 (4) |
| Cd1—O1 | 2.325 (2) | C1—C6 | 1.391 (5) |
| Cd1—O1Wi | 2.326 (2) | C1—C7 | 1.512 (4) |
| Cd1—O1W | 2.326 (2) | C2—C3 | 1.377 (5) |
| Cd1—N2 | 2.329 (3) | C3—C4 | 1.388 (5) |
| Cd1—N2i | 2.329 (3) | C3—H3 | 0.9300 |
| O1—C7 | 1.266 (4) | C4—C5 | 1.378 (6) |
| O2—C7 | 1.244 (4) | C4—H4 | 0.9300 |
| O3—N1 | 1.211 (5) | C5—C6 | 1.386 (5) |
| O4—N1 | 1.214 (5) | C5—H5 | 0.9300 |
| O5—C13 | 1.237 (4) | C6—H6 | 0.9300 |
| O1W—H11 | 0.85 (4) | C8—C9 | 1.378 (5) |
| O1W—H12 | 0.85 (4) | C8—H8 | 0.9300 |
| O2W—H21 | 0.85 (3) | C9—C10 | 1.383 (5) |
| O2W—H22 | 0.85 (3) | C9—C13 | 1.502 (5) |
| N1—C2 | 1.476 (4) | C10—C11 | 1.382 (5) |
| N2—C8 | 1.334 (4) | C10—H10 | 0.9300 |
| N2—C12 | 1.339 (4) | C11—C12 | 1.379 (5) |
| N3—C13 | 1.325 (4) | C11—H11A | 0.9300 |
| N3—H31 | 0.84 (3) | C12—H12A | 0.9300 |
| N3—H32 | 0.85 (3) | ||
| O1i—Cd1—O1 | 180.000 (1) | C1—C2—N1 | 120.5 (3) |
| O1i—Cd1—O1Wi | 85.20 (9) | C2—C3—C4 | 118.7 (3) |
| O1—Cd1—O1Wi | 94.80 (9) | C2—C3—H3 | 120.7 |
| O1i—Cd1—O1W | 94.80 (9) | C4—C3—H3 | 120.7 |
| O1—Cd1—O1W | 85.20 (9) | C5—C4—C3 | 119.8 (3) |
| O1Wi—Cd1—O1W | 180.00 (12) | C5—C4—H4 | 120.1 |
| O1i—Cd1—N2 | 89.52 (9) | C3—C4—H4 | 120.1 |
| O1—Cd1—N2 | 90.48 (9) | C4—C5—C6 | 120.4 (3) |
| O1Wi—Cd1—N2 | 89.36 (10) | C4—C5—H5 | 119.8 |
| O1W—Cd1—N2 | 90.64 (10) | C6—C5—H5 | 119.8 |
| O1i—Cd1—N2i | 90.48 (9) | C5—C6—C1 | 121.4 (3) |
| O1—Cd1—N2i | 89.52 (9) | C5—C6—H6 | 119.3 |
| O1Wi—Cd1—N2i | 90.64 (10) | C1—C6—H6 | 119.3 |
| O1W—Cd1—N2i | 89.36 (10) | O2—C7—O1 | 125.0 (3) |
| N2—Cd1—N2i | 180.0 | O2—C7—C1 | 117.4 (3) |
| C7—O1—Cd1 | 119.7 (2) | O1—C7—C1 | 117.5 (3) |
| Cd1—O1W—H11 | 126 (3) | N2—C8—C9 | 123.7 (3) |
| Cd1—O1W—H12 | 100 (3) | N2—C8—H8 | 118.2 |
| H11—O1W—H12 | 109 (4) | C9—C8—H8 | 118.2 |
| H21—O2W—H22 | 109.4 (17) | C8—C9—C10 | 118.0 (3) |
| O3—N1—O4 | 124.7 (4) | C8—C9—C13 | 116.7 (3) |
| O3—N1—C2 | 118.2 (4) | C10—C9—C13 | 125.3 (3) |
| O4—N1—C2 | 117.1 (4) | C11—C10—C9 | 118.9 (3) |
| C8—N2—C12 | 117.9 (3) | C11—C10—H10 | 120.5 |
| C8—N2—Cd1 | 115.1 (2) | C9—C10—H10 | 120.5 |
| C12—N2—Cd1 | 126.6 (2) | C12—C11—C10 | 119.3 (3) |
| C13—N3—H31 | 126 (3) | C12—C11—H11A | 120.4 |
| C13—N3—H32 | 122 (2) | C10—C11—H11A | 120.4 |
| H31—N3—H32 | 111.4 (18) | N2—C12—C11 | 122.2 (3) |
| C2—C1—C6 | 116.4 (3) | N2—C12—H12A | 118.9 |
| C2—C1—C7 | 122.4 (3) | C11—C12—H12A | 118.9 |
| C6—C1—C7 | 121.0 (3) | O5—C13—N3 | 122.8 (3) |
| C3—C2—C1 | 123.3 (3) | O5—C13—C9 | 119.2 (3) |
| C3—C2—N1 | 116.2 (3) | N3—C13—C9 | 118.0 (3) |
| O1Wi—Cd1—O1—C7 | 22.2 (2) | C4—C5—C6—C1 | 1.0 (6) |
| O1W—Cd1—O1—C7 | −157.8 (2) | C2—C1—C6—C5 | −0.3 (5) |
| N2—Cd1—O1—C7 | 111.6 (2) | C7—C1—C6—C5 | −174.8 (3) |
| N2i—Cd1—O1—C7 | −68.4 (2) | Cd1—O1—C7—O2 | −11.8 (5) |
| O1i—Cd1—N2—C8 | 29.7 (2) | Cd1—O1—C7—C1 | 163.9 (2) |
| O1—Cd1—N2—C8 | −150.3 (2) | C2—C1—C7—O2 | −27.5 (5) |
| O1Wi—Cd1—N2—C8 | −55.5 (2) | C6—C1—C7—O2 | 146.7 (3) |
| O1W—Cd1—N2—C8 | 124.5 (2) | C2—C1—C7—O1 | 156.4 (3) |
| O1i—Cd1—N2—C12 | −157.2 (3) | C6—C1—C7—O1 | −29.4 (4) |
| O1—Cd1—N2—C12 | 22.8 (3) | C12—N2—C8—C9 | 0.0 (5) |
| O1Wi—Cd1—N2—C12 | 117.6 (3) | Cd1—N2—C8—C9 | 173.7 (3) |
| O1W—Cd1—N2—C12 | −62.4 (3) | N2—C8—C9—C10 | −0.3 (5) |
| C6—C1—C2—C3 | −1.2 (5) | N2—C8—C9—C13 | −179.8 (3) |
| C7—C1—C2—C3 | 173.2 (3) | C8—C9—C10—C11 | 0.7 (6) |
| C6—C1—C2—N1 | 178.0 (3) | C13—C9—C10—C11 | −179.9 (4) |
| C7—C1—C2—N1 | −7.5 (5) | C9—C10—C11—C12 | −0.8 (7) |
| O3—N1—C2—C3 | −69.1 (5) | C8—N2—C12—C11 | −0.1 (6) |
| O4—N1—C2—C3 | 108.4 (4) | Cd1—N2—C12—C11 | −173.0 (3) |
| O3—N1—C2—C1 | 111.6 (4) | C10—C11—C12—N2 | 0.6 (7) |
| O4—N1—C2—C1 | −70.9 (5) | C8—C9—C13—O5 | 15.8 (5) |
| C1—C2—C3—C4 | 1.9 (6) | C10—C9—C13—O5 | −163.7 (4) |
| N1—C2—C3—C4 | −177.4 (3) | C8—C9—C13—N3 | −161.5 (3) |
| C2—C3—C4—C5 | −1.1 (6) | C10—C9—C13—N3 | 19.0 (6) |
| C3—C4—C5—C6 | −0.3 (6) |
| Symmetry code: (i) −x+1, −y+1, −z+1. |
| D—H···A | D—H | H···A | D···A | D—H···A |
| O1w—H11···O2w | 0.85 (4) | 1.92 (4) | 2.764 (4) | 174 (4) |
| O1w—H12···O2i | 0.85 (4) | 1.95 (5) | 2.718 (4) | 150 (4) |
| O2w—H21···O5i | 0.85 (3) | 2.08 (3) | 2.910 (4) | 166 (4) |
| O2w—H22···O1ii | 0.85 (3) | 2.00 (1) | 2.846 (3) | 177 (5) |
| N3—H31···O2iii | 0.85 (3) | 2.22 (2) | 3.038 (4) | 165 (4) |
| N3—H32···O5iv | 0.85 (3) | 2.05 (3) | 2.873 (4) | 164 (4) |
| Symmetry codes: (i) −x+1, −y+1, −z+1; (ii) −x+2, −y+1, −z+1; (iii) x, y, z+1; (iv) −x, −y+1, −z+2. |
Experimental details
| Crystal data | |
| Chemical formula | [Cd(C7H4NO4)2(C6H6N2O)2(H2O)2]·2H2O |
| Mr | 760.94 |
| Crystal system, space group | Monoclinic, P21/n |
| Temperature (K) | 293 |
| a, b, c (Å) | 7.9365 (8), 19.589 (2), 10.059 (1) |
| β (°) | 103.178 (2) |
| V (Å3) | 1522.6 (3) |
| Z | 2 |
| Radiation type | Mo Kα |
| µ (mm−1) | 0.80 |
| Crystal size (mm) | 0.50 × 0.18 × 0.18 |
| Data collection | |
| Diffractometer | Bruker SMART area-detector diffractometer |
| Absorption correction | Multi-scan (SADABS; Sheldrick, 1996) |
| Tmin, Tmax | 0.619, 0.866 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 4427, 2651, 2396 |
| Rint | 0.016 |
| (sin θ/λ)max (Å−1) | 0.597 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.034, 0.093, 1.13 |
| No. of reflections | 2651 |
| No. of parameters | 246 |
| No. of restraints | 9 |
| H-atom treatment | H atoms treated by a mixture of independent and constrained refinement |
| Δρmax, Δρmin (e Å−3) | 0.42, −1.04 |
Computer programs: SMART (Bruker, 2000), SAINT (Bruker, 2000), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), X-SEED (Barbour, 2001), publCIF (Westrip, 2009).
| D—H···A | D—H | H···A | D···A | D—H···A |
| O1w—H11···O2w | 0.85 (4) | 1.92 (4) | 2.764 (4) | 174 (4) |
| O1w—H12···O2i | 0.85 (4) | 1.95 (5) | 2.718 (4) | 150 (4) |
| O2w—H21···O5i | 0.85 (3) | 2.08 (3) | 2.910 (4) | 166 (4) |
| O2w—H22···O1ii | 0.85 (3) | 2.00 (1) | 2.846 (3) | 177 (5) |
| N3—H31···O2iii | 0.85 (3) | 2.22 (2) | 3.038 (4) | 165 (4) |
| N3—H32···O5iv | 0.85 (3) | 2.05 (3) | 2.873 (4) | 164 (4) |
| Symmetry codes: (i) −x+1, −y+1, −z+1; (ii) −x+2, −y+1, −z+1; (iii) x, y, z+1; (iv) −x, −y+1, −z+2. |
Acknowledgements
We thank the Foundation of Jiangsu Provincial Key Program of Physical Chemistry in Yangzhou University and the University of Malaya for supporting this study.
References
Barbour, L. J. (2001). J. Supramol. Chem., 1, 189–191. CrossRef CAS Google Scholar
Bruker (2000). SAINT and SAINT. Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
Çaylak, N., Hökelek, T. & Necefoğlu, H. (2007). Acta Cryst. E63, m1341–m1343. Web of Science CSD CrossRef IUCr Journals Google Scholar
Hökelek, T., Çaylak, N. & Necefoğlu, H. (2007). Acta Cryst. E63, m1873–m1874. Web of Science CSD CrossRef IUCr Journals Google Scholar
Hökelek, T. & Necefoğlu, H. (2007a). Acta Cryst. E63, m1078–m1080. Web of Science CSD CrossRef IUCr Journals Google Scholar
Hökelek, T. & Necefoğlu, H. (2007b). Acta Cryst. E63, m1279–m1281. Web of Science CSD CrossRef IUCr Journals Google Scholar
Koksharova, T. V., Sadikov, G. G., Antsyshkina, A. S., Gritsenko, I. S., Sergienko, V. S. & Egorova, O. A. (2006). Russ. J. Inorg. Chem. 51, 895–900. Web of Science CrossRef Google Scholar
Şahin, O., Büyükgüngör, O., Köse, D. A. & Necefoglu, H. (2007a). Acta Cryst. C63, m510–m512. Web of Science CSD CrossRef IUCr Journals Google Scholar
Şahin, O., Büyükgüngör, O., Köse, D. A., Ozturkkan, E. F. & Necefoglu, H. (2007b). Acta Cryst. C63, m243–m245. Web of Science CSD CrossRef IUCr Journals Google Scholar
Sheldrick, G. M. (1996). SADABS. University of Göttingen, Germany. Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Stachova, P., Melnik, M., Korobik, M., Mrozinski, M., Koman, M., Glowiak, T. & Valigura, D. (2006). Inorg. Chim. Acta, 360, 1517–1522. Web of Science CSD CrossRef Google Scholar
Westrip, S. P. (2009). publCIF. In preparation. Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
![[Figure 1]](./pv2136fig1thm.gif)



