metal-organic compounds
trans,trans,trans-Diaquabis(nicotinamide-κN)bis(2-nitrobenzoato-κO)copper(II)
aCollege of Chemistry and Chemical Engineering, Yangzhou University, Yangzhou 225002, People's Republic of China, and bDepartment of Chemistry, University of Malaya, 50603, Kuala Lumpur, Malaysia
*Correspondence e-mail: [email protected]
The water-coordinated metal atom in the title compound, [Cu(C7H4NO4)2(C6H6N2O)2(H2O)2], lies on a center of inversion in an all-trans octahedral environment with slight distortions. The molecule interacts with adjacent molecules through O—H⋯O and N—H⋯O hydrogen bonds, forming a layered network parallel to (010).
Related literature
There are recent examples of diaquadi(arylcarboxylato)di(nicotinamide)metal(II) compounds, see: Hökelek & Necefoğlu (2007a
,b
); Hökelek et al. (2007
); Koksharova et al. (2006
); Şahin et al. (2007a
, 2007b
); Stachova et al. (2006
); Çaylak et al. (2007
); Zhang et al. (2009
).
Experimental
Crystal data
|
Refinement
|
| ||||||||||
|
Data collection: SMART (Bruker, 2000
); cell refinement: SAINT (Bruker, 2000
); data reduction: SAINT; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: X-SEED (Barbour, 2001
); software used to prepare material for publication: publCIF (Westrip, 2009
).
Supporting information
contains datablocks global, I. DOI: 10.1107/S1600536809007995/bt2894sup1.cif
Structure factors: contains datablock I. DOI: 10.1107/S1600536809007995/bt2894Isup2.hkl
A water/methanol (1:1 v/v) solution (3 ml) of copper nitrate trihydrate (0.174 g, 0.6 mmol) was added to a water/methanol (1:1 v/v) solution (3 ml) of 2-nitrobenzoic acid (0.100 g, 0.6 mmol), sodium hydroxide (0.024 g 0.6 mmol) and nicotinamide (0.073 g, 0.6 mmol). Blue block were obtained after several days (yield: 40%). CH&N elemental analysis: calc. for C26H24CuN6O12: C 46.19, H 3.59,N 12.43%; found: C 46.37, H 3.41, N 12.60%.
Carbon-bound H atoms were placed in calculated positions and were allowed to ride on the parent atoms. The oxygen-bound ones were located in a difference Fourier map, and were refined with distance restraints N–H, O–H = 0.85±0.01 Å; an additional H···H 1.39 + 0.01 Å restraint was used. Their displacement parameters were freely refined.
Data collection: SMART (Bruker, 2000); cell SAINT (Bruker, 2000); data reduction: SAINT (Bruker, 2000); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: X-SEED (Barbour, 2001); software used to prepare material for publication: publCIF (Westrip, 2009).
| Fig. 1. Thermal ellipsoid plot of Cu(H2O)2(C7H4NO4)2(C6H6N2O)2; displacement ellipsoids are drawn at the 50% probabability level, and H atoms as spheres of arbitrary radii. |
| [Cu(C7H4NO4)2(C6H6N2O)2(H2O)2] | F(000) = 694 |
| Mr = 676.05 | Dx = 1.577 Mg m−3 |
| Monoclinic, P21/n | Mo Kα radiation, λ = 0.71073 Å |
| Hall symbol: -P 2yn | Cell parameters from 3858 reflections |
| a = 7.9582 (3) Å | θ = 2.2–25.0° |
| b = 18.7044 (6) Å | µ = 0.84 mm−1 |
| c = 9.8573 (2) Å | T = 295 K |
| β = 104.012 (2)° | Block, blue |
| V = 1423.63 (8) Å3 | 0.45 × 0.20 × 0.16 mm |
| Z = 2 |
| Bruker SMART area-detector diffractometer | 2507 independent reflections |
| Radiation source: medium-focus sealed tube | 2069 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.036 |
| ϕ and ω scans | θmax = 25.0°, θmin = 2.2° |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | h = −9→9 |
| Tmin = 0.557, Tmax = 0.877 | k = −14→22 |
| 7295 measured reflections | l = −11→11 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.048 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.111 | H atoms treated by a mixture of independent and constrained refinement |
| S = 1.12 | w = 1/[σ2(Fo2) + (0.0395P)2 + 1.8061P] where P = (Fo2 + 2Fc2)/3 |
| 2507 reflections | (Δ/σ)max = 0.001 |
| 229 parameters | Δρmax = 0.31 e Å−3 |
| 4 restraints | Δρmin = −0.46 e Å−3 |
| [Cu(C7H4NO4)2(C6H6N2O)2(H2O)2] | V = 1423.63 (8) Å3 |
| Mr = 676.05 | Z = 2 |
| Monoclinic, P21/n | Mo Kα radiation |
| a = 7.9582 (3) Å | µ = 0.84 mm−1 |
| b = 18.7044 (6) Å | T = 295 K |
| c = 9.8573 (2) Å | 0.45 × 0.20 × 0.16 mm |
| β = 104.012 (2)° |
| Bruker SMART area-detector diffractometer | 2507 independent reflections |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | 2069 reflections with I > 2σ(I) |
| Tmin = 0.557, Tmax = 0.877 | Rint = 0.036 |
| 7295 measured reflections |
| R[F2 > 2σ(F2)] = 0.048 | 4 restraints |
| wR(F2) = 0.111 | H atoms treated by a mixture of independent and constrained refinement |
| S = 1.12 | Δρmax = 0.31 e Å−3 |
| 2507 reflections | Δρmin = −0.46 e Å−3 |
| 229 parameters |
| x | y | z | Uiso*/Ueq | ||
| Cu1 | 0.5000 | 0.5000 | 0.5000 | 0.02960 (19) | |
| O1 | 0.6141 (3) | 0.41263 (12) | 0.4483 (2) | 0.0329 (5) | |
| O2 | 0.3896 (3) | 0.37179 (15) | 0.2856 (3) | 0.0531 (7) | |
| O3 | 0.3215 (5) | 0.2416 (3) | 0.0916 (5) | 0.1123 (16) | |
| O4 | 0.3942 (5) | 0.2153 (2) | 0.3108 (5) | 0.1137 (16) | |
| O5 | 0.0632 (4) | 0.49124 (18) | 0.8331 (3) | 0.0642 (9) | |
| O1W | 0.8082 (4) | 0.54476 (16) | 0.5876 (3) | 0.0493 (7) | |
| H11 | 0.772 (6) | 0.5753 (19) | 0.637 (4) | 0.067 (15)* | |
| H12 | 0.883 (5) | 0.522 (2) | 0.647 (4) | 0.073 (16)* | |
| N1 | 0.4256 (5) | 0.2375 (2) | 0.2043 (5) | 0.0624 (10) | |
| N2 | 0.4917 (3) | 0.45491 (14) | 0.6829 (3) | 0.0290 (6) | |
| N3 | 0.1614 (5) | 0.4274 (2) | 1.0283 (3) | 0.0539 (9) | |
| H31 | 0.081 (4) | 0.442 (2) | 1.065 (4) | 0.069 (14)* | |
| H32 | 0.241 (4) | 0.403 (2) | 1.082 (4) | 0.075 (16)* | |
| C1 | 0.6639 (4) | 0.32322 (17) | 0.2924 (3) | 0.0297 (7) | |
| C2 | 0.6033 (5) | 0.26281 (19) | 0.2137 (4) | 0.0372 (8) | |
| C3 | 0.7038 (6) | 0.2231 (2) | 0.1461 (4) | 0.0496 (10) | |
| H3 | 0.6578 | 0.1835 | 0.0929 | 0.057 (12)* | |
| C4 | 0.8740 (6) | 0.2428 (2) | 0.1585 (4) | 0.0552 (11) | |
| H4 | 0.9433 | 0.2170 | 0.1125 | 0.065 (13)* | |
| C5 | 0.9406 (5) | 0.3009 (2) | 0.2392 (4) | 0.0503 (10) | |
| H5 | 1.0561 | 0.3135 | 0.2495 | 0.067 (14)* | |
| C6 | 0.8366 (4) | 0.3409 (2) | 0.3053 (4) | 0.0395 (8) | |
| H6 | 0.8834 | 0.3801 | 0.3591 | 0.038 (10)* | |
| C7 | 0.5449 (4) | 0.37176 (17) | 0.3480 (3) | 0.0289 (7) | |
| C8 | 0.3508 (4) | 0.46333 (17) | 0.7327 (3) | 0.0306 (7) | |
| H8 | 0.2571 | 0.4882 | 0.6785 | 0.029 (9)* | |
| C9 | 0.3378 (4) | 0.43678 (18) | 0.8613 (3) | 0.0304 (7) | |
| C10 | 0.4781 (5) | 0.3999 (2) | 0.9403 (4) | 0.0434 (9) | |
| H10 | 0.4747 | 0.3819 | 1.0276 | 0.048 (11)* | |
| C11 | 0.6240 (5) | 0.3899 (2) | 0.8889 (4) | 0.0461 (10) | |
| H11A | 0.7186 | 0.3644 | 0.9402 | 0.062 (13)* | |
| C12 | 0.6259 (4) | 0.41833 (19) | 0.7608 (4) | 0.0364 (8) | |
| H12A | 0.7241 | 0.4120 | 0.7268 | 0.032 (9)* | |
| C13 | 0.1760 (5) | 0.4530 (2) | 0.9067 (4) | 0.0419 (9) |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Cu1 | 0.0375 (3) | 0.0296 (3) | 0.0256 (3) | 0.0041 (3) | 0.0153 (2) | 0.0014 (2) |
| O1 | 0.0378 (13) | 0.0332 (12) | 0.0292 (12) | 0.0057 (10) | 0.0110 (10) | −0.0034 (10) |
| O2 | 0.0318 (14) | 0.0677 (19) | 0.0557 (17) | 0.0093 (13) | 0.0028 (12) | −0.0203 (14) |
| O3 | 0.061 (2) | 0.178 (5) | 0.091 (3) | −0.027 (3) | 0.006 (2) | −0.071 (3) |
| O4 | 0.094 (3) | 0.118 (4) | 0.140 (4) | −0.030 (3) | 0.049 (3) | 0.048 (3) |
| O5 | 0.0489 (16) | 0.107 (3) | 0.0436 (15) | 0.0375 (17) | 0.0254 (13) | 0.0285 (16) |
| O1W | 0.0454 (16) | 0.0586 (19) | 0.0407 (16) | 0.0032 (14) | 0.0045 (13) | −0.0056 (14) |
| N1 | 0.060 (2) | 0.051 (2) | 0.079 (3) | −0.0141 (19) | 0.023 (2) | −0.022 (2) |
| N2 | 0.0302 (14) | 0.0338 (15) | 0.0250 (14) | 0.0037 (12) | 0.0104 (11) | −0.0004 (12) |
| N3 | 0.046 (2) | 0.084 (3) | 0.039 (2) | 0.020 (2) | 0.0237 (17) | 0.0225 (18) |
| C1 | 0.0332 (18) | 0.0310 (17) | 0.0259 (17) | 0.0033 (14) | 0.0089 (14) | 0.0021 (14) |
| C2 | 0.040 (2) | 0.0354 (19) | 0.037 (2) | 0.0021 (16) | 0.0110 (16) | 0.0003 (16) |
| C3 | 0.066 (3) | 0.037 (2) | 0.046 (2) | 0.007 (2) | 0.014 (2) | −0.0094 (18) |
| C4 | 0.069 (3) | 0.054 (3) | 0.050 (3) | 0.025 (2) | 0.027 (2) | 0.003 (2) |
| C5 | 0.041 (2) | 0.052 (2) | 0.062 (3) | 0.0077 (19) | 0.0224 (19) | 0.005 (2) |
| C6 | 0.036 (2) | 0.037 (2) | 0.045 (2) | 0.0019 (16) | 0.0094 (16) | −0.0030 (17) |
| C7 | 0.0341 (18) | 0.0287 (17) | 0.0254 (17) | 0.0025 (14) | 0.0104 (14) | 0.0028 (14) |
| C8 | 0.0326 (18) | 0.0327 (18) | 0.0270 (17) | 0.0055 (15) | 0.0082 (14) | 0.0006 (14) |
| C9 | 0.0335 (18) | 0.0333 (18) | 0.0269 (17) | 0.0033 (14) | 0.0123 (14) | 0.0022 (14) |
| C10 | 0.050 (2) | 0.054 (2) | 0.0303 (18) | 0.0127 (19) | 0.0168 (17) | 0.0124 (17) |
| C11 | 0.043 (2) | 0.056 (2) | 0.042 (2) | 0.0189 (19) | 0.0159 (18) | 0.0153 (18) |
| C12 | 0.0342 (19) | 0.041 (2) | 0.038 (2) | 0.0087 (16) | 0.0168 (16) | 0.0057 (16) |
| C13 | 0.042 (2) | 0.053 (2) | 0.0347 (19) | 0.0079 (18) | 0.0167 (17) | 0.0081 (17) |
| Cu1—O1i | 1.995 (2) | C1—C6 | 1.389 (5) |
| Cu1—O1 | 1.995 (2) | C1—C7 | 1.507 (4) |
| Cu1—N2i | 2.006 (3) | C2—C3 | 1.377 (5) |
| Cu1—N2 | 2.006 (3) | C3—C4 | 1.380 (6) |
| Cu1—O1w | 2.537 (3) | C3—H3 | 0.9300 |
| O1—C7 | 1.266 (4) | C4—C5 | 1.375 (6) |
| O2—C7 | 1.240 (4) | C4—H4 | 0.9300 |
| O3—N1 | 1.216 (5) | C5—C6 | 1.389 (5) |
| O4—N1 | 1.210 (5) | C5—H5 | 0.9300 |
| O5—C13 | 1.237 (4) | C6—H6 | 0.9300 |
| O1W—H11 | 0.85 (4) | C8—C9 | 1.389 (4) |
| O1W—H12 | 0.85 (4) | C8—H8 | 0.9300 |
| N1—C2 | 1.472 (5) | C9—C10 | 1.381 (5) |
| N2—C8 | 1.337 (4) | C9—C13 | 1.493 (5) |
| N2—C12 | 1.342 (4) | C10—C11 | 1.387 (5) |
| N3—C13 | 1.322 (5) | C10—H10 | 0.9300 |
| N3—H31 | 0.85 (4) | C11—C12 | 1.374 (5) |
| N3—H32 | 0.85 (4) | C11—H11A | 0.9300 |
| C1—C2 | 1.389 (5) | C12—H12A | 0.9300 |
| O1i—Cu1—O1 | 180.000 (1) | C4—C3—H3 | 120.5 |
| O1i—Cu1—N2i | 90.07 (10) | C5—C4—C3 | 119.7 (4) |
| O1—Cu1—N2i | 89.93 (10) | C5—C4—H4 | 120.1 |
| O1i—Cu1—N2 | 89.93 (10) | C3—C4—H4 | 120.1 |
| O1—Cu1—N2 | 90.07 (10) | C4—C5—C6 | 120.4 (4) |
| N2i—Cu1—N2 | 180.00 (14) | C4—C5—H5 | 119.8 |
| O1i—Cu1—O1W | 96.04 (9) | C6—C5—H5 | 119.8 |
| O1—Cu1—O1W | 83.96 (9) | C5—C6—C1 | 121.2 (4) |
| N2i—Cu1—O1W | 85.84 (10) | C5—C6—H6 | 119.4 |
| N2—Cu1—O1W | 94.16 (10) | C1—C6—H6 | 119.4 |
| C7—O1—Cu1 | 123.7 (2) | O2—C7—O1 | 125.5 (3) |
| Cu1—O1W—H11 | 89 (3) | O2—C7—C1 | 117.3 (3) |
| Cu1—O1W—H12 | 122 (3) | O1—C7—C1 | 117.1 (3) |
| H11—O1W—H12 | 103 (4) | N2—C8—C9 | 123.2 (3) |
| O4—N1—O3 | 125.1 (4) | N2—C8—H8 | 118.4 |
| O4—N1—C2 | 116.9 (4) | C9—C8—H8 | 118.4 |
| O3—N1—C2 | 117.9 (4) | C10—C9—C8 | 117.7 (3) |
| C8—N2—C12 | 118.1 (3) | C10—C9—C13 | 124.8 (3) |
| C8—N2—Cu1 | 119.6 (2) | C8—C9—C13 | 117.5 (3) |
| C12—N2—Cu1 | 122.3 (2) | C9—C10—C11 | 119.7 (3) |
| C13—N3—H31 | 120 (3) | C9—C10—H10 | 120.2 |
| C13—N3—H32 | 123 (3) | C11—C10—H10 | 120.2 |
| H31—N3—H32 | 115 (4) | C12—C11—C10 | 118.7 (3) |
| C2—C1—C6 | 116.5 (3) | C12—C11—H11A | 120.7 |
| C2—C1—C7 | 122.0 (3) | C10—C11—H11A | 120.7 |
| C6—C1—C7 | 121.2 (3) | N2—C12—C11 | 122.6 (3) |
| C3—C2—C1 | 123.1 (3) | N2—C12—H12A | 118.7 |
| C3—C2—N1 | 117.2 (3) | C11—C12—H12A | 118.7 |
| C1—C2—N1 | 119.7 (3) | O5—C13—N3 | 122.1 (3) |
| C2—C3—C4 | 119.0 (4) | O5—C13—C9 | 119.9 (3) |
| C2—C3—H3 | 120.5 | N3—C13—C9 | 118.0 (3) |
| N2i—Cu1—O1—C7 | −65.5 (2) | C2—C1—C6—C5 | 1.7 (5) |
| N2—Cu1—O1—C7 | 114.5 (2) | C7—C1—C6—C5 | −171.9 (3) |
| O1W—Cu1—O1—C7 | −151.3 (2) | Cu1—O1—C7—O2 | −14.1 (5) |
| O1i—Cu1—N2—C8 | 40.3 (2) | Cu1—O1—C7—C1 | 160.6 (2) |
| O1—Cu1—N2—C8 | −139.7 (2) | C2—C1—C7—O2 | −24.1 (5) |
| O1W—Cu1—N2—C8 | 136.3 (2) | C6—C1—C7—O2 | 149.2 (3) |
| O1i—Cu1—N2—C12 | −137.2 (3) | C2—C1—C7—O1 | 160.7 (3) |
| O1—Cu1—N2—C12 | 42.8 (3) | C6—C1—C7—O1 | −26.0 (4) |
| O1W—Cu1—N2—C12 | −41.1 (3) | C12—N2—C8—C9 | 0.7 (5) |
| C6—C1—C2—C3 | −2.6 (5) | Cu1—N2—C8—C9 | −176.9 (2) |
| C7—C1—C2—C3 | 171.0 (3) | N2—C8—C9—C10 | −0.1 (5) |
| C6—C1—C2—N1 | 175.3 (3) | N2—C8—C9—C13 | 177.3 (3) |
| C7—C1—C2—N1 | −11.1 (5) | C8—C9—C10—C11 | −0.8 (6) |
| O4—N1—C2—C3 | 111.8 (5) | C13—C9—C10—C11 | −178.0 (4) |
| O3—N1—C2—C3 | −69.5 (5) | C9—C10—C11—C12 | 1.2 (6) |
| O4—N1—C2—C1 | −66.2 (5) | C8—N2—C12—C11 | −0.4 (5) |
| O3—N1—C2—C1 | 112.5 (4) | Cu1—N2—C12—C11 | 177.2 (3) |
| C1—C2—C3—C4 | 1.3 (6) | C10—C11—C12—N2 | −0.6 (6) |
| N1—C2—C3—C4 | −176.6 (4) | C10—C9—C13—O5 | 174.3 (4) |
| C2—C3—C4—C5 | 0.9 (6) | C8—C9—C13—O5 | −2.9 (5) |
| C3—C4—C5—C6 | −1.6 (6) | C10—C9—C13—N3 | −3.5 (6) |
| C4—C5—C6—C1 | 0.3 (6) | C8—C9—C13—N3 | 179.3 (4) |
| Symmetry code: (i) −x+1, −y+1, −z+1. |
| D—H···A | D—H | H···A | D···A | D—H···A |
| O1w—H11···O2i | 0.85 (4) | 1.92 (2) | 2.726 (4) | 159 (4) |
| O1w—H12···O5ii | 0.85 (4) | 2.11 (2) | 2.934 (2) | 165 (3) |
| N3—H32···O2iii | 0.85 (4) | 2.15 (2) | 2.929 (4) | 152 (4) |
| N3—H31···O5iv | 0.85 (4) | 2.11 (2) | 2.926 (4) | 161 (4) |
| Symmetry codes: (i) −x+1, −y+1, −z+1; (ii) x+1, y, z; (iii) x, y, z+1; (iv) −x, −y+1, −z+2. |
Experimental details
| Crystal data | |
| Chemical formula | [Cu(C7H4NO4)2(C6H6N2O)2(H2O)2] |
| Mr | 676.05 |
| Crystal system, space group | Monoclinic, P21/n |
| Temperature (K) | 295 |
| a, b, c (Å) | 7.9582 (3), 18.7044 (6), 9.8573 (2) |
| β (°) | 104.012 (2) |
| V (Å3) | 1423.63 (8) |
| Z | 2 |
| Radiation type | Mo Kα |
| µ (mm−1) | 0.84 |
| Crystal size (mm) | 0.45 × 0.20 × 0.16 |
| Data collection | |
| Diffractometer | Bruker SMART area-detector diffractometer |
| Absorption correction | Multi-scan (SADABS; Sheldrick, 1996) |
| Tmin, Tmax | 0.557, 0.877 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 7295, 2507, 2069 |
| Rint | 0.036 |
| (sin θ/λ)max (Å−1) | 0.595 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.048, 0.111, 1.12 |
| No. of reflections | 2507 |
| No. of parameters | 229 |
| No. of restraints | 4 |
| H-atom treatment | H atoms treated by a mixture of independent and constrained refinement |
| Δρmax, Δρmin (e Å−3) | 0.31, −0.46 |
Computer programs: SMART (Bruker, 2000), SAINT (Bruker, 2000), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), X-SEED (Barbour, 2001), publCIF (Westrip, 2009).
| D—H···A | D—H | H···A | D···A | D—H···A |
| O1w—H11···O2i | 0.85 (4) | 1.92 (2) | 2.726 (4) | 159 (4) |
| O1w—H12···O5ii | 0.85 (4) | 2.11 (2) | 2.934 (2) | 165 (3) |
| N3—H32···O2iii | 0.85 (4) | 2.15 (2) | 2.929 (4) | 152 (4) |
| N3—H31···O5iv | 0.85 (4) | 2.11 (2) | 2.926 (4) | 161 (4) |
| Symmetry codes: (i) −x+1, −y+1, −z+1; (ii) x+1, y, z; (iii) x, y, z+1; (iv) −x, −y+1, −z+2. |
Acknowledgements
We thank the Foundation of Jiangsu Provincial Key Program of Physical Chemistry in Yangzhou University and the University of Malaya for supporting this study.
References
Barbour, L. J. (2001). J. Supramol. Chem. 1, 189–191. CrossRef CAS Google Scholar
Bruker (2000). SMART and SAINT. Bruker AXS Inc., Madison, Winconsin, USA. Google Scholar
Çaylak, N., Hökelek, T. & Necefoğlu, H. (2007). Acta Cryst. E63, m1341–m1343. Web of Science CSD CrossRef IUCr Journals Google Scholar
Hökelek, T., Çaylak, N. & Necefoğlu, H. (2007). Acta Cryst. E63, m1873–m1874. Web of Science CSD CrossRef IUCr Journals Google Scholar
Hökelek, T. & Necefoğlu, H. (2007a). Acta Cryst. E63, m1078–m1080. Web of Science CSD CrossRef IUCr Journals Google Scholar
Hökelek, T. & Necefoğlu, H. (2007b). Acta Cryst. E63, m1279–m1281. Web of Science CSD CrossRef IUCr Journals Google Scholar
Koksharova, T. V., Sadikov, G. G., Antsyshkina, A. S., Gritsenko, I. S., Sergienko, V. S. & Egorova, O. A. (2006). Russ. J. Inorg. Chem. 51, 895–900. Web of Science CrossRef Google Scholar
Şahin, O., Büyükgüngör, O., Köse, D. A. & Necefoğlu, H. (2007a). Acta Cryst. C63, m510–m512. Web of Science CSD CrossRef IUCr Journals Google Scholar
Şahin, O., Büyükgüngör, O., Köse, D. A., Ozturkkan, E. F. & Necefoğlu, H. (2007b). Acta Cryst. C63, m243–m245. Web of Science CSD CrossRef IUCr Journals Google Scholar
Sheldrick, G. M. (1996). SADABS. University of Göttingen, Germany. Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Stachova, P., Melnik, M., Korobik, M., Mrozinski, M., Koman, M., Glowiak, T. & Valigura, D. (2006). Inorg. Chim. Acta, 360, 1517–1522. Web of Science CSD CrossRef Google Scholar
Westrip, S. P. (2009). publCIF. In preparation. Google Scholar
Zhang, K.-L., Yang, B., Lin, J.-G. & Ng, S. W. (2009). Acta Cryst. E65, m292. Web of Science CSD CrossRef IUCr Journals Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
![[Figure 1]](./bt2894fig1thm.gif)



