metal-organic compounds
(Acetylacetonato-κ2O,O′)aqua[2-(2-nitrophenoxy)-N′-(2-oxidobenzylidene-κO)acetohydrazidato-κ2O,N′]manganese(III)
aCollege of Materials Science & Engineering, Huaqiao University, Quanzhou 362021, People's Republic of China
*Correspondence e-mail: [email protected]
In the title complex, [Mn(C15H11N3O5)(C5H7O2)(H2O)], the MnIII ion has a distorted octahedral coordination geometry. It is coordinated by a phenoxy O atom, a hydrazine N atom and a carbonyl O atom of the 2-(2-nitrophenoxy)-N′-(2-oxidobenzylidene-κO)acetohydrazidate dianion, by two O atoms of the acetylacetonate anion and by the O atom of a coordinated water molecule. In the crystal structure, complex molecules are linked into centrosymmetric dimeric units through four intermolecular O—H⋯O hydrogen bonds involving both H atoms of the coordinated water molecule.
Related literature
For the biological activity and chemical versatility of hydrazone complexes, see: Liu & Gao (1998
); Iskander et al. (2001
); Cariati et al. (2002
); Sreekanth et al. (2004
); Bai et al. (2006
); Mondal et al. (2008
). For phenoxyacetylhydrazone complexes, see: Chen & Liu (2004
); Sun et al. (2005
); Chen & Liu (2006
).
Experimental
Crystal data
|
Refinement
|
| ||||||||||||||||||||||
Data collection: TEXRAY (Molecular Structure Corporation, 1999
); cell refinement: TEXRAY; data reduction: TEXSAN (Molecular Structure Corporation, 1999
); program(s) used to solve structure: SHELXS98 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL98 (Sheldrick, 2008
); molecular graphics: ORTEX (McArdle, 1995
); software used to prepare material for publication: SHELXL97.
Supporting information
contains datablocks I, global. DOI: 10.1107/S1600536809028177/fj2221sup1.cif
Structure factors: contains datablock I. DOI: 10.1107/S1600536809028177/fj2221Isup2.hkl
The N-salicylaldehyde-N'- (o-nitrophenoxyacyl) hydrazone ligand, (H2L) was prepared according the reference (Sun et al., 2005). H2L (0.05 mmol) and Mn(acac)3 (0.05 mmol) were dissolved in a mixed solution of 10 ml 95% EtOH and 1 ml DMF. The mixture was stirred for 3 h. After one week, Dark-brown crystals of (I) were obtained.
The water H atoms (H01 and H02) were located from the difference Fourier map and refined isotropically, with O—H distance restraints of 0.88 Å. The other H atoms were positioned geometrically, with C—H = 0.93, 0.97 and 0.96 Å for aromatic, methylene and methyl H, respectively, and constrained to ride on their parent atoms, with Uiso(H) = xUeq(C), where x = 1.5 for methyl H and x = 1.2 for all other H atoms.
Data collection: TEXRAY (Molecular Structure Corporation, 1999); cell TEXRAY (Molecular Structure Corporation, 1999); data reduction: TEXSAN (Molecular Structure Corporation, 1999); program(s) used to solve structure: SHELXS98 (Sheldrick, 2008); program(s) used to refine structure: SHELXL98 (Sheldrick, 2008); molecular graphics: ORTEX (McArdle, 1995); software used to prepare material for publication: SHELXL97 (Sheldrick, 2008).
| Fig. 1. The molecular structure of (I), showing 20% probability displacement ellipsoids and the atom numbering scheme. |
| Fig. 2. Extended centrosymmetrical dimer structure of (I). |
| [Mn(C15H11N3O5)(C5H7O2)(H2O)] | F(000) = 1000 |
| Mr = 485.33 | Dx = 1.542 Mg m−3 |
| Monoclinic, P21/c | Mo Kα radiation, λ = 0.71073 Å |
| Hall symbol: -P 2ybc | Cell parameters from 4921 reflections |
| a = 8.5217 (6) Å | θ = 2.3–27.5° |
| b = 13.9263 (10) Å | µ = 0.69 mm−1 |
| c = 17.6311 (10) Å | T = 293 K |
| β = 92.725 (3)° | Prism, red-black |
| V = 2090.0 (2) Å3 | 0.58 × 0.32 × 0.27 mm |
| Z = 4 |
| Rigaku R-AXIS RAPID Imaging Plate diffractometer | 4735 independent reflections |
| Radiation source: fine-focus sealed tube | 3155 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.046 |
| ω scans | θmax = 27.5°, θmin = 2.3° |
| Absorption correction: multi-scan (TEXRAY; Molecular Structure Corporation, 1999) | h = 0→11 |
| Tmin = 0.766, Tmax = 0.832 | k = 0→18 |
| 4735 measured reflections | l = −22→22 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.038 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.086 | H-atom parameters constrained |
| S = 0.88 | w = 1/[σ2(Fo2) + (0.042P)2] where P = (Fo2 + 2Fc2)/3 |
| 4735 reflections | (Δ/σ)max < 0.001 |
| 293 parameters | Δρmax = 0.41 e Å−3 |
| 2 restraints | Δρmin = −0.26 e Å−3 |
| [Mn(C15H11N3O5)(C5H7O2)(H2O)] | V = 2090.0 (2) Å3 |
| Mr = 485.33 | Z = 4 |
| Monoclinic, P21/c | Mo Kα radiation |
| a = 8.5217 (6) Å | µ = 0.69 mm−1 |
| b = 13.9263 (10) Å | T = 293 K |
| c = 17.6311 (10) Å | 0.58 × 0.32 × 0.27 mm |
| β = 92.725 (3)° |
| Rigaku R-AXIS RAPID Imaging Plate diffractometer | 4735 independent reflections |
| Absorption correction: multi-scan (TEXRAY; Molecular Structure Corporation, 1999) | 3155 reflections with I > 2σ(I) |
| Tmin = 0.766, Tmax = 0.832 | Rint = 0.046 |
| 4735 measured reflections |
| R[F2 > 2σ(F2)] = 0.038 | 2 restraints |
| wR(F2) = 0.086 | H-atom parameters constrained |
| S = 0.88 | Δρmax = 0.41 e Å−3 |
| 4735 reflections | Δρmin = −0.26 e Å−3 |
| 293 parameters |
Geometry. All e.s.d.'s (except the e.s.d. in the dihedral angle between two l.s. planes) are estimated using the full covariance matrix. The cell e.s.d.'s are taken into account individually in the estimation of e.s.d.'s in distances, angles and torsion angles; correlations between e.s.d.'s in cell parameters are only used when they are defined by crystal symmetry. An approximate (isotropic) treatment of cell e.s.d.'s is used for estimating e.s.d.'s involving l.s. planes. |
Refinement. Refinement of F2 against ALL reflections. The weighted R-factor wR and goodness of fit S are based on F2, conventional R-factors R are based on F, with F set to zero for negative F2. The threshold expression of F2 > σ(F2) is used only for calculating R-factors(gt) etc. and is not relevant to the choice of reflections for refinement. R-factors based on F2 are statistically about twice as large as those based on F, and R- factors based on ALL data will be even larger. |
| x | y | z | Uiso*/Ueq | ||
| Mn1 | 0.42210 (3) | 0.18422 (2) | 0.481380 (18) | 0.03308 (10) | |
| N1 | 0.57698 (19) | 0.27034 (12) | 0.53316 (9) | 0.0331 (4) | |
| N2 | 0.73611 (19) | 0.24037 (13) | 0.53073 (10) | 0.0375 (4) | |
| N3 | 0.8041 (2) | 0.02849 (16) | 0.26015 (12) | 0.0533 (5) | |
| O1 | 0.25674 (16) | 0.25554 (11) | 0.52037 (9) | 0.0418 (4) | |
| O2 | 0.61556 (15) | 0.11671 (10) | 0.46352 (8) | 0.0378 (3) | |
| O3 | 0.90604 (16) | 0.07570 (10) | 0.41027 (8) | 0.0388 (3) | |
| O4 | 0.8243 (2) | −0.04084 (13) | 0.30114 (10) | 0.0592 (5) | |
| O5 | 0.7271 (3) | 0.02349 (18) | 0.20070 (14) | 0.1154 (10) | |
| O6 | 0.44030 (18) | 0.26593 (11) | 0.38003 (9) | 0.0456 (4) | |
| O7 | 0.29877 (16) | 0.09269 (10) | 0.42284 (8) | 0.0378 (3) | |
| O1W | 0.39896 (18) | 0.07903 (11) | 0.57926 (8) | 0.0445 (4) | |
| H01 | 0.3227 | 0.0898 | 0.6102 | 0.084 (10)* | |
| H02 | 0.3985 | 0.0165 | 0.5720 | 0.059 (8)* | |
| C1 | 0.2598 (2) | 0.34515 (15) | 0.54655 (12) | 0.0363 (5) | |
| C2 | 0.3993 (2) | 0.39648 (15) | 0.56558 (11) | 0.0356 (5) | |
| C3 | 0.3901 (3) | 0.49157 (16) | 0.59191 (12) | 0.0447 (6) | |
| H3A | 0.4822 | 0.5254 | 0.6036 | 0.054* | |
| C4 | 0.2482 (3) | 0.53520 (17) | 0.60058 (14) | 0.0545 (6) | |
| H4A | 0.2434 | 0.5984 | 0.6173 | 0.065* | |
| C5 | 0.1116 (3) | 0.48358 (19) | 0.58401 (14) | 0.0547 (7) | |
| H5A | 0.0149 | 0.5125 | 0.5907 | 0.066* | |
| C6 | 0.1161 (3) | 0.39072 (17) | 0.55798 (13) | 0.0474 (6) | |
| H6A | 0.0226 | 0.3576 | 0.5478 | 0.057* | |
| C7 | 0.5521 (2) | 0.35502 (15) | 0.55894 (11) | 0.0364 (5) | |
| H7A | 0.6389 | 0.3919 | 0.5743 | 0.044* | |
| C8 | 0.7392 (2) | 0.16010 (15) | 0.49417 (12) | 0.0342 (5) | |
| C9 | 0.8935 (2) | 0.10965 (16) | 0.48634 (12) | 0.0398 (5) | |
| H9A | 0.9791 | 0.1536 | 0.4990 | 0.048* | |
| H9B | 0.9013 | 0.0559 | 0.5213 | 0.048* | |
| C10 | 0.9278 (2) | 0.14196 (15) | 0.35479 (12) | 0.0361 (5) | |
| C11 | 0.8798 (2) | 0.11932 (16) | 0.27964 (13) | 0.0406 (5) | |
| C12 | 0.9049 (3) | 0.18249 (19) | 0.22091 (14) | 0.0531 (6) | |
| H12A | 0.8707 | 0.1669 | 0.1716 | 0.064* | |
| C13 | 0.9798 (3) | 0.26774 (18) | 0.23514 (16) | 0.0570 (7) | |
| H13A | 0.9990 | 0.3095 | 0.1955 | 0.068* | |
| C14 | 1.0266 (3) | 0.29151 (18) | 0.30817 (16) | 0.0552 (7) | |
| H14A | 1.0773 | 0.3497 | 0.3177 | 0.066* | |
| C15 | 0.9996 (3) | 0.23052 (17) | 0.36756 (13) | 0.0457 (6) | |
| H15A | 1.0297 | 0.2488 | 0.4169 | 0.055* | |
| C16 | 0.4860 (4) | 0.28832 (19) | 0.25042 (16) | 0.0682 (8) | |
| H16A | 0.4550 | 0.3539 | 0.2572 | 0.102* | |
| H16B | 0.4391 | 0.2643 | 0.2036 | 0.102* | |
| H16C | 0.5983 | 0.2848 | 0.2489 | 0.102* | |
| C17 | 0.4325 (3) | 0.22903 (17) | 0.31512 (13) | 0.0446 (5) | |
| C18 | 0.3747 (3) | 0.13544 (18) | 0.29967 (13) | 0.0479 (6) | |
| H18A | 0.3812 | 0.1129 | 0.2503 | 0.057* | |
| C19 | 0.3099 (2) | 0.07523 (16) | 0.35096 (12) | 0.0378 (5) | |
| C20 | 0.2423 (3) | −0.01982 (16) | 0.32597 (13) | 0.0471 (6) | |
| H20A | 0.1363 | −0.0249 | 0.3417 | 0.071* | |
| H20B | 0.3044 | −0.0707 | 0.3486 | 0.071* | |
| H20C | 0.2430 | −0.0246 | 0.2717 | 0.071* |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Mn1 | 0.03206 (16) | 0.03084 (17) | 0.03640 (18) | 0.00197 (14) | 0.00244 (12) | −0.00560 (15) |
| N1 | 0.0330 (9) | 0.0332 (10) | 0.0331 (9) | 0.0030 (7) | 0.0021 (8) | −0.0026 (8) |
| N2 | 0.0315 (9) | 0.0399 (11) | 0.0413 (10) | 0.0049 (8) | 0.0021 (8) | −0.0051 (8) |
| N3 | 0.0568 (12) | 0.0530 (14) | 0.0498 (13) | −0.0075 (11) | −0.0001 (11) | −0.0056 (11) |
| O1 | 0.0340 (8) | 0.0387 (8) | 0.0533 (9) | 0.0027 (6) | 0.0078 (7) | −0.0123 (7) |
| O2 | 0.0343 (7) | 0.0318 (8) | 0.0475 (9) | 0.0009 (6) | 0.0037 (7) | −0.0063 (7) |
| O3 | 0.0420 (8) | 0.0379 (8) | 0.0371 (8) | 0.0071 (7) | 0.0087 (7) | −0.0008 (7) |
| O4 | 0.0740 (12) | 0.0437 (10) | 0.0604 (11) | −0.0057 (9) | 0.0091 (9) | −0.0050 (9) |
| O5 | 0.158 (2) | 0.0944 (18) | 0.0865 (16) | −0.0486 (17) | −0.0697 (17) | 0.0141 (13) |
| O6 | 0.0578 (10) | 0.0365 (9) | 0.0425 (9) | −0.0007 (7) | 0.0016 (8) | 0.0018 (7) |
| O7 | 0.0405 (8) | 0.0375 (8) | 0.0353 (8) | −0.0033 (6) | 0.0028 (7) | −0.0057 (6) |
| O1W | 0.0534 (9) | 0.0368 (9) | 0.0437 (9) | 0.0019 (7) | 0.0092 (8) | −0.0013 (7) |
| C1 | 0.0419 (11) | 0.0358 (12) | 0.0314 (11) | 0.0069 (9) | 0.0029 (9) | −0.0015 (9) |
| C2 | 0.0431 (12) | 0.0333 (11) | 0.0308 (11) | 0.0058 (9) | 0.0046 (9) | −0.0037 (9) |
| C3 | 0.0544 (14) | 0.0377 (13) | 0.0417 (13) | 0.0053 (11) | 0.0009 (11) | −0.0045 (10) |
| C4 | 0.0717 (17) | 0.0369 (13) | 0.0547 (15) | 0.0181 (13) | 0.0010 (13) | −0.0090 (11) |
| C5 | 0.0528 (15) | 0.0583 (16) | 0.0531 (15) | 0.0241 (13) | 0.0040 (12) | −0.0089 (13) |
| C6 | 0.0435 (12) | 0.0493 (14) | 0.0496 (14) | 0.0105 (11) | 0.0046 (11) | −0.0072 (12) |
| C7 | 0.0390 (11) | 0.0357 (12) | 0.0345 (12) | −0.0007 (9) | 0.0009 (9) | −0.0056 (10) |
| C8 | 0.0368 (11) | 0.0346 (12) | 0.0317 (11) | 0.0044 (9) | 0.0055 (9) | 0.0018 (9) |
| C9 | 0.0390 (11) | 0.0450 (13) | 0.0356 (11) | 0.0108 (10) | 0.0033 (10) | 0.0003 (10) |
| C10 | 0.0312 (10) | 0.0357 (12) | 0.0418 (12) | 0.0075 (9) | 0.0060 (9) | 0.0010 (10) |
| C11 | 0.0383 (11) | 0.0377 (12) | 0.0458 (13) | 0.0023 (10) | 0.0029 (10) | 0.0002 (11) |
| C12 | 0.0585 (15) | 0.0573 (16) | 0.0432 (13) | 0.0045 (13) | 0.0004 (12) | 0.0036 (12) |
| C13 | 0.0642 (16) | 0.0482 (16) | 0.0591 (17) | 0.0034 (13) | 0.0090 (14) | 0.0146 (13) |
| C14 | 0.0601 (15) | 0.0359 (13) | 0.0701 (18) | −0.0029 (11) | 0.0095 (14) | −0.0009 (12) |
| C15 | 0.0488 (13) | 0.0409 (14) | 0.0476 (14) | 0.0043 (11) | 0.0052 (11) | −0.0057 (11) |
| C16 | 0.096 (2) | 0.0565 (17) | 0.0538 (16) | 0.0007 (16) | 0.0162 (15) | 0.0136 (14) |
| C17 | 0.0465 (13) | 0.0467 (14) | 0.0407 (13) | 0.0076 (11) | 0.0050 (11) | 0.0033 (11) |
| C18 | 0.0598 (15) | 0.0477 (14) | 0.0368 (12) | 0.0032 (12) | 0.0082 (11) | −0.0041 (11) |
| C19 | 0.0361 (11) | 0.0377 (12) | 0.0394 (12) | 0.0066 (9) | −0.0007 (10) | −0.0084 (10) |
| C20 | 0.0523 (14) | 0.0431 (14) | 0.0456 (13) | 0.0005 (11) | 0.0000 (11) | −0.0126 (11) |
| Mn1—O1 | 1.8806 (14) | C5—C6 | 1.373 (3) |
| Mn1—O7 | 1.9214 (14) | C5—H5A | 0.9300 |
| Mn1—O2 | 1.9366 (13) | C6—H6A | 0.9300 |
| Mn1—N1 | 1.9746 (16) | C7—H7A | 0.9300 |
| Mn1—O6 | 2.1303 (15) | C8—C9 | 1.503 (3) |
| Mn1—O1W | 2.2793 (15) | C9—H9A | 0.9700 |
| N1—C7 | 1.285 (3) | C9—H9B | 0.9700 |
| N1—N2 | 1.421 (2) | C10—C15 | 1.390 (3) |
| N2—C8 | 1.291 (3) | C10—C11 | 1.404 (3) |
| N3—O5 | 1.212 (3) | C11—C12 | 1.383 (3) |
| N3—O4 | 1.213 (2) | C12—C13 | 1.366 (4) |
| N3—C11 | 1.454 (3) | C12—H12A | 0.9300 |
| O1—C1 | 1.330 (2) | C13—C14 | 1.370 (4) |
| O2—C8 | 1.309 (2) | C13—H13A | 0.9300 |
| O3—C10 | 1.364 (2) | C14—C15 | 1.376 (3) |
| O3—C9 | 1.431 (2) | C14—H14A | 0.9300 |
| O6—C17 | 1.253 (3) | C15—H15A | 0.9300 |
| O7—C19 | 1.298 (2) | C16—C17 | 1.497 (3) |
| O1W—H01 | 0.8802 | C16—H16A | 0.9600 |
| O1W—H02 | 0.8799 | C16—H16B | 0.9600 |
| C1—C6 | 1.402 (3) | C16—H16C | 0.9600 |
| C1—C2 | 1.414 (3) | C17—C18 | 1.415 (3) |
| C2—C3 | 1.407 (3) | C18—C19 | 1.368 (3) |
| C2—C7 | 1.435 (3) | C18—H18A | 0.9300 |
| C3—C4 | 1.368 (3) | C19—C20 | 1.501 (3) |
| C3—H3A | 0.9300 | C20—H20A | 0.9600 |
| C4—C5 | 1.387 (4) | C20—H20B | 0.9600 |
| C4—H4A | 0.9300 | C20—H20C | 0.9600 |
| O1—Mn1—O7 | 98.43 (6) | C2—C7—H7A | 117.8 |
| O1—Mn1—O2 | 166.98 (7) | N2—C8—O2 | 124.81 (18) |
| O7—Mn1—O2 | 92.22 (6) | N2—C8—C9 | 119.28 (19) |
| O1—Mn1—N1 | 90.36 (7) | O2—C8—C9 | 115.90 (18) |
| O7—Mn1—N1 | 171.05 (6) | O3—C9—C8 | 110.20 (16) |
| O2—Mn1—N1 | 79.31 (6) | O3—C9—H9A | 109.6 |
| O1—Mn1—O6 | 96.33 (7) | C8—C9—H9A | 109.6 |
| O7—Mn1—O6 | 87.91 (6) | O3—C9—H9B | 109.6 |
| O2—Mn1—O6 | 91.51 (6) | C8—C9—H9B | 109.6 |
| N1—Mn1—O6 | 89.40 (6) | H9A—C9—H9B | 108.1 |
| O1—Mn1—O1W | 88.25 (6) | O3—C10—C15 | 123.9 (2) |
| O7—Mn1—O1W | 85.15 (6) | O3—C10—C11 | 118.78 (19) |
| O2—Mn1—O1W | 85.19 (6) | C15—C10—C11 | 117.3 (2) |
| N1—Mn1—O1W | 96.91 (6) | C12—C11—C10 | 121.0 (2) |
| O6—Mn1—O1W | 172.19 (6) | C12—C11—N3 | 117.3 (2) |
| C7—N1—N2 | 116.98 (17) | C10—C11—N3 | 121.6 (2) |
| C7—N1—Mn1 | 127.08 (14) | C13—C12—C11 | 120.2 (2) |
| N2—N1—Mn1 | 115.18 (12) | C13—C12—H12A | 119.9 |
| C8—N2—N1 | 108.13 (16) | C11—C12—H12A | 119.9 |
| O5—N3—O4 | 121.7 (2) | C12—C13—C14 | 119.7 (2) |
| O5—N3—C11 | 118.1 (2) | C12—C13—H13A | 120.2 |
| O4—N3—C11 | 120.2 (2) | C14—C13—H13A | 120.2 |
| C1—O1—Mn1 | 128.29 (13) | C13—C14—C15 | 120.9 (2) |
| C8—O2—Mn1 | 112.55 (12) | C13—C14—H14A | 119.5 |
| C10—O3—C9 | 117.88 (17) | C15—C14—H14A | 119.5 |
| C17—O6—Mn1 | 122.95 (15) | C14—C15—C10 | 120.8 (2) |
| C19—O7—Mn1 | 125.80 (13) | C14—C15—H15A | 119.6 |
| Mn1—O1W—H01 | 116.9 | C10—C15—H15A | 119.6 |
| Mn1—O1W—H02 | 121.7 | C17—C16—H16A | 109.5 |
| H01—O1W—H02 | 105.0 | C17—C16—H16B | 109.5 |
| O1—C1—C6 | 118.1 (2) | H16A—C16—H16B | 109.5 |
| O1—C1—C2 | 123.98 (18) | C17—C16—H16C | 109.5 |
| C6—C1—C2 | 117.85 (19) | H16A—C16—H16C | 109.5 |
| C3—C2—C1 | 119.68 (19) | H16B—C16—H16C | 109.5 |
| C3—C2—C7 | 118.1 (2) | O6—C17—C18 | 123.8 (2) |
| C1—C2—C7 | 122.25 (18) | O6—C17—C16 | 117.7 (2) |
| C4—C3—C2 | 121.2 (2) | C18—C17—C16 | 118.5 (2) |
| C4—C3—H3A | 119.4 | C19—C18—C17 | 125.8 (2) |
| C2—C3—H3A | 119.4 | C19—C18—H18A | 117.1 |
| C3—C4—C5 | 118.9 (2) | C17—C18—H18A | 117.1 |
| C3—C4—H4A | 120.5 | O7—C19—C18 | 125.5 (2) |
| C5—C4—H4A | 120.5 | O7—C19—C20 | 113.99 (19) |
| C6—C5—C4 | 121.5 (2) | C18—C19—C20 | 120.5 (2) |
| C6—C5—H5A | 119.3 | C19—C20—H20A | 109.5 |
| C4—C5—H5A | 119.3 | C19—C20—H20B | 109.5 |
| C5—C6—C1 | 120.8 (2) | H20A—C20—H20B | 109.5 |
| C5—C6—H6A | 119.6 | C19—C20—H20C | 109.5 |
| C1—C6—H6A | 119.6 | H20A—C20—H20C | 109.5 |
| N1—C7—C2 | 124.32 (19) | H20B—C20—H20C | 109.5 |
| N1—C7—H7A | 117.8 | ||
| O1—Mn1—N1—C7 | −18.44 (18) | O1—C1—C6—C5 | −179.2 (2) |
| O2—Mn1—N1—C7 | 169.54 (18) | C2—C1—C6—C5 | 2.5 (3) |
| O6—Mn1—N1—C7 | 77.89 (17) | N2—N1—C7—C2 | −179.77 (19) |
| O1W—Mn1—N1—C7 | −106.72 (17) | Mn1—N1—C7—C2 | 10.7 (3) |
| O1—Mn1—N1—N2 | 171.88 (14) | C3—C2—C7—N1 | −177.42 (19) |
| O2—Mn1—N1—N2 | −0.15 (13) | C1—C2—C7—N1 | 2.5 (3) |
| O6—Mn1—N1—N2 | −91.80 (14) | N1—N2—C8—O2 | 1.6 (3) |
| O1W—Mn1—N1—N2 | 83.60 (13) | N1—N2—C8—C9 | −177.13 (17) |
| C7—N1—N2—C8 | −171.41 (17) | Mn1—O2—C8—N2 | −1.8 (3) |
| Mn1—N1—N2—C8 | −0.6 (2) | Mn1—O2—C8—C9 | 176.98 (14) |
| O7—Mn1—O1—C1 | −157.85 (17) | C10—O3—C9—C8 | 71.6 (2) |
| O2—Mn1—O1—C1 | 57.6 (4) | N2—C8—C9—O3 | −136.04 (19) |
| N1—Mn1—O1—C1 | 20.41 (17) | O2—C8—C9—O3 | 45.1 (2) |
| O6—Mn1—O1—C1 | −69.03 (17) | C9—O3—C10—C15 | 27.0 (3) |
| O1W—Mn1—O1—C1 | 117.32 (17) | C9—O3—C10—C11 | −155.01 (18) |
| O1—Mn1—O2—C8 | −37.1 (3) | O3—C10—C11—C12 | −177.42 (19) |
| O7—Mn1—O2—C8 | 177.99 (13) | C15—C10—C11—C12 | 0.7 (3) |
| N1—Mn1—O2—C8 | 0.91 (13) | O3—C10—C11—N3 | 1.6 (3) |
| O6—Mn1—O2—C8 | 90.02 (14) | C15—C10—C11—N3 | 179.81 (19) |
| O1W—Mn1—O2—C8 | −97.07 (13) | O5—N3—C11—C12 | −21.3 (4) |
| O1—Mn1—O6—C17 | −125.31 (18) | O4—N3—C11—C12 | 155.4 (2) |
| O7—Mn1—O6—C17 | −27.06 (18) | O5—N3—C11—C10 | 159.6 (2) |
| O2—Mn1—O6—C17 | 65.11 (18) | O4—N3—C11—C10 | −23.7 (3) |
| N1—Mn1—O6—C17 | 144.40 (18) | C10—C11—C12—C13 | 1.1 (4) |
| O1—Mn1—O7—C19 | 125.06 (16) | N3—C11—C12—C13 | −178.0 (2) |
| O2—Mn1—O7—C19 | −62.46 (16) | C11—C12—C13—C14 | −1.6 (4) |
| O6—Mn1—O7—C19 | 28.97 (16) | C12—C13—C14—C15 | 0.2 (4) |
| O1W—Mn1—O7—C19 | −147.44 (16) | C13—C14—C15—C10 | 1.7 (4) |
| Mn1—O1—C1—C6 | 166.84 (16) | O3—C10—C15—C14 | 175.9 (2) |
| Mn1—O1—C1—C2 | −15.0 (3) | C11—C10—C15—C14 | −2.2 (3) |
| O1—C1—C2—C3 | 179.15 (19) | Mn1—O6—C17—C18 | 15.6 (3) |
| C6—C1—C2—C3 | −2.6 (3) | Mn1—O6—C17—C16 | −165.12 (17) |
| O1—C1—C2—C7 | −0.8 (3) | O6—C17—C18—C19 | 4.8 (4) |
| C6—C1—C2—C7 | 177.4 (2) | C16—C17—C18—C19 | −174.5 (2) |
| C1—C2—C3—C4 | 1.0 (3) | Mn1—O7—C19—C18 | −20.4 (3) |
| C7—C2—C3—C4 | −179.1 (2) | Mn1—O7—C19—C20 | 160.21 (14) |
| C2—C3—C4—C5 | 1.0 (4) | C17—C18—C19—O7 | −3.8 (4) |
| C3—C4—C5—C6 | −1.1 (4) | C17—C18—C19—C20 | 175.6 (2) |
| C4—C5—C6—C1 | −0.6 (4) |
| D—H···A | D—H | H···A | D···A | D—H···A |
| O1W—H01···O4i | 0.88 | 2.16 | 2.955 (2) | 150 |
| O1W—H02···O2i | 0.88 | 1.96 | 2.829 (2) | 169 |
| Symmetry code: (i) −x+1, −y, −z+1. |
Experimental details
| Crystal data | |
| Chemical formula | [Mn(C15H11N3O5)(C5H7O2)(H2O)] |
| Mr | 485.33 |
| Crystal system, space group | Monoclinic, P21/c |
| Temperature (K) | 293 |
| a, b, c (Å) | 8.5217 (6), 13.9263 (10), 17.6311 (10) |
| β (°) | 92.725 (3) |
| V (Å3) | 2090.0 (2) |
| Z | 4 |
| Radiation type | Mo Kα |
| µ (mm−1) | 0.69 |
| Crystal size (mm) | 0.58 × 0.32 × 0.27 |
| Data collection | |
| Diffractometer | Rigaku R-AXIS RAPID Imaging Plate diffractometer |
| Absorption correction | Multi-scan (TEXRAY; Molecular Structure Corporation, 1999) |
| Tmin, Tmax | 0.766, 0.832 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 4735, 4735, 3155 |
| Rint | 0.046 |
| (sin θ/λ)max (Å−1) | 0.649 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.038, 0.086, 0.88 |
| No. of reflections | 4735 |
| No. of parameters | 293 |
| No. of restraints | 2 |
| H-atom treatment | H-atom parameters constrained |
| Δρmax, Δρmin (e Å−3) | 0.41, −0.26 |
Computer programs: TEXRAY (Molecular Structure Corporation, 1999), TEXSAN (Molecular Structure Corporation, 1999), SHELXS98 (Sheldrick, 2008), SHELXL98 (Sheldrick, 2008), ORTEX (McArdle, 1995), SHELXL97 (Sheldrick, 2008).
| D—H···A | D—H | H···A | D···A | D—H···A |
| O1W—H01···O4i | 0.88 | 2.16 | 2.955 (2) | 150 |
| O1W—H02···O2i | 0.88 | 1.96 | 2.829 (2) | 169 |
| Symmetry code: (i) −x+1, −y, −z+1. |
Acknowledgements
We are grateful for financial support from the Natural Science Foundation of Fujian Province of China (No. E0640006).
References
Bai, Y., Dang, D.-B., Cao, X., Duan, C.-Y. & Meng, Q.-J. (2006). Inorg. Chem. Commun. 9, 86–89. Web of Science CSD CrossRef CAS Google Scholar
Cariati, F., Caruso, U., Centore, R., Marcolli, W., De Maria, A., Panunzi, B., Roviello, A. & Tuzi, A. (2002). Inorg. Chem. 41, 6597–6603. Web of Science CSD CrossRef PubMed CAS Google Scholar
Chen, X.-H. & Liu, S.-X. (2004). Chin. J. Struct. Chem. 23, 33–37. CAS Google Scholar
Chen, X.-H. & Liu, S.-X. (2006). Acta Cryst. E62, m2869–m2871. Web of Science CSD CrossRef CAS IUCr Journals Google Scholar
Iskander, M. F., Khalil, T. E., Haase, W., Werner, R., Svoboda, I. & Fuess, H. (2001). Polyhedron, 20, 2787–2798. Web of Science CSD CrossRef CAS Google Scholar
Liu, S.-X. & Gao, S. (1998). Polyhedron, 17, 81–84. CSD CrossRef Web of Science Google Scholar
McArdle, P. (1995). J. Appl. Cryst. 28, 65. CrossRef IUCr Journals Google Scholar
Molecular Structure Corporation (1999). TEXRAY and TEXSAN. MSC, The Woodlands, Texas, USA. Google Scholar
Mondal, B., Drew, M. G. B., Banerjee, R. & Ghosh, T. (2008). Polyhedron, 27, 3197–3206. Web of Science CSD CrossRef CAS Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Sreekanth, A., Kala, U. L., Nayar, C. R. & Kurup, M. R. P. (2004). Polyhedron, 23, 41–47. Web of Science CSD CrossRef CAS Google Scholar
Sun, M.-M., Li, W.-P. & Liu, S.-X. (2005). Acta Cryst. E61, m1818–m1820. Web of Science CSD CrossRef CAS IUCr Journals Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
![[Figure 1]](./fj2221fig1thm.gif)
![[Figure 2]](./fj2221fig2thm.gif)




The design and construction of hydrazone complexes are of great interest due to their various structures and their biological activities and chemical versatility (Liu & Gao, 1998; Iskander et al., 2001; Cariati et al., 2002; Sreekanth et al., 2004; Bai et al., 2006; Mondal et al., 2008). Relatively speaking, only a few crystal structures of phenoxyacetylhydrazone complexes have been studied (Chen & Liu, 2004; Sun et al., 2005; Chen & Liu, 2006).
As shown in Fig. 1, the MnIII ion in (I) is octahedrally coordinated by phenol atom O1, hydrazine atom N1 and carbonyl atom O2 from the phenoxyacetylhydrazone ligand L2-, two oxygen atoms (O6 and O7) from an acac- ligand, and O1W atom from coordinated water molecule. Atoms O1, N1, O2 and O7 form the equatorial plane, while the atoms O6 and O1W occupy the two axial positions. The bond distance of Mn1—O6(acac-) (2.130 (2) Å) is much longer than the one of Mn1—O7(acac-) (1.921 (1) Å) due to the Jahn-Teller effect of Mn(III) ion.
In most of phenoxyacetylhydrazone complexes, the phenoxy oxygen atom is not coordinated to metal atom. This structural phenomenon is found in the title complex (I) and was also found in several known complexes (Chen & Liu, 2004; Sun et al., 2005; Chen & Liu, 2006).
The complex Co(C2H3O2)(C4H9NO)2(C15H11N3O5) (II) (Sun et al., 2005) and the title complex Mn(C15H11N3O5)(C5H7O2)(H2O) (I) have the same N-salicylaldehyde-N'– (o-nitrophenoxyacyl) hydrazone ligand. The dihedral angles between the two benzene rings of the phenoxyacyl hydrazone ligand in complex (I) is 89.48 (8)°, while the corresponding one in (II) is 44.1 (1)°. This big difference of the two dihedral angles may come from the different sizes of the second ligands in the two complexes.
As shown in Fig. 2, two neighboring complex molecules are linked by four hydrogen bonds O—H(coordinated water molecule)···O(carbonyl O or oxygen in o-nitrate group) to form a centrosymmetrical dimer.