organic compounds
3,3-Dimethyl-cis-2,6-di-p-tolylpiperidin-4-one
aPG Research Department of Physics, Rajah Serfoji Government College (Autonomous), Thanjavur 613 005, Tamilnadu, India, bDepartment of Chemistry, Government Arts College (Autonomous), Coimbatore 641 018, Tamilnadu, India, and cDepartment of Chemistry, Howard University, 525 College Street NW, Washington, DC 20059, USA
*Correspondence e-mail: [email protected]
In the title molecule, C21H25NO, the piperidine ring adopts a chair conformation. The benzene rings and one of the methyl groups attached to the piperidine ring have equatorial orientations. The dihedral angle between the two benzene rings is 72.53 (9)°. In the crystal, molecules are linked by N—H⋯O hydrogen bonds. Weak C—H⋯π interactions involving the benzene rings are also present in the crystal structure.
Related literature
For related crystal structures, see: Gayathri et al. (2008
); Ilango et al. (2008
). For biological activities of piperidones, see: Aridoss et al. (2008
). For the synthesis, see: Noller and Baliah (1948
). For the stereochemistry and ring conformation of piperidin-4-ones and their derivatives, see: Ponnuswamy et al. (2002
).
Experimental
Crystal data
|
Refinement
|
|
Data collection: CrysAlis Pro (Oxford Diffraction, 2009
); cell refinement: CrysAlis Pro; data reduction: CrysAlis Pro; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: ORTEP-3 (Farrugia, 1997
); software used to prepare material for publication: PLATON (Spek, 2009
).
Supporting information
contains datablocks global, I. DOI: 10.1107/S160053680903579X/sj2644sup1.cif
Structure factors: contains datablock I. DOI: 10.1107/S160053680903579X/sj2644Isup2.hkl
The procedure adopted by Noller & Baliah (1948) was followed for the preparation of the title compound. To the solution of ammonium acetate (3.85 g, 0.05 mol) in dry ethanol, p-tolualdehyde (12.0 g, 0.1 mol) and isopropyl methyl ketone (5.35 ml, 0.05 mol) were added and allowed to reflux on a water bath for 1 h. The resulting solution was kept at room temperature for overnight and the precipitated solid was filtered. The solid was crystallized using benzene - petroleum ether mixture. The yield of the product obtained was 7.36 g (48%).
In the absence of any anamalous scatterers in the molecule, the Friedel pairs were merged. The in the present model has been chosen arbitrarily. Atom H1 on N1 was located in a difference Fourier map and refined isotropically. Remaining H atoms were positioned geometrically and allowed to ride on their parent atoms, with C—H = 0.95, 0.98, 0.99 and 1.00 Å for Csp2, methyl, methylene and methine C, respectively; Uiso(H) = kUeq(C), where k = 1.5 for methyl and 1.2 for all other H atoms.
Data collection: CrysAlis PRO (Oxford Diffraction, 2009); cell CrysAlis PRO (Oxford Diffraction, 2009); data reduction: CrysAlis PRO (Oxford Diffraction, 2009); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: ORTEP-3 (Farrugia, 1997); software used to prepare material for publication: PLATON (Spek, 2009).
| C21H25NO | Dx = 1.169 Mg m−3 |
| Mr = 307.42 | Melting point: 389(1) K |
| Orthorhombic, Pna21 | Cu Kα radiation, λ = 1.54184 Å |
| Hall symbol: P 2c -2n | Cell parameters from 3875 reflections |
| a = 12.9576 (3) Å | θ = 5.2–74.0° |
| b = 22.6153 (5) Å | µ = 0.55 mm−1 |
| c = 5.9600 (1) Å | T = 110 K |
| V = 1746.52 (6) Å3 | Rectangular-plate, colourless |
| Z = 4 | 0.51 × 0.34 × 0.12 mm |
| F(000) = 664 |
| Oxford Diffraction Xcalibur diffractometer with a Ruby Gemini detector | 1914 independent reflections |
| Radiation source: fine-focus sealed tube | 1859 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.018 |
| Detector resolution: 10.5081 pixels mm-1 | θmax = 74.1°, θmin = 5.2° |
| ω scans | h = −16→8 |
| Absorption correction: multi-scan (CrysAlis PRO; Oxford Diffraction, 2009) | k = −27→16 |
| Tmin = 0.665, Tmax = 1.000 | l = −6→7 |
| 4198 measured reflections |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.039 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.106 | H atoms treated by a mixture of independent and constrained refinement |
| S = 1.04 | w = 1/[σ2(Fo2) + (0.0807P)2 + 0.2385P] where P = (Fo2 + 2Fc2)/3 |
| 1914 reflections | (Δ/σ)max = 0.001 |
| 216 parameters | Δρmax = 0.26 e Å−3 |
| 1 restraint | Δρmin = −0.24 e Å−3 |
| C21H25NO | V = 1746.52 (6) Å3 |
| Mr = 307.42 | Z = 4 |
| Orthorhombic, Pna21 | Cu Kα radiation |
| a = 12.9576 (3) Å | µ = 0.55 mm−1 |
| b = 22.6153 (5) Å | T = 110 K |
| c = 5.9600 (1) Å | 0.51 × 0.34 × 0.12 mm |
| Oxford Diffraction Xcalibur diffractometer with a Ruby Gemini detector | 1914 independent reflections |
| Absorption correction: multi-scan (CrysAlis PRO; Oxford Diffraction, 2009) | 1859 reflections with I > 2σ(I) |
| Tmin = 0.665, Tmax = 1.000 | Rint = 0.018 |
| 4198 measured reflections |
| R[F2 > 2σ(F2)] = 0.039 | 1 restraint |
| wR(F2) = 0.106 | H atoms treated by a mixture of independent and constrained refinement |
| S = 1.04 | Δρmax = 0.26 e Å−3 |
| 1914 reflections | Δρmin = −0.24 e Å−3 |
| 216 parameters |
Geometry. Bond distances, angles etc. have been calculated using the rounded fractional coordinates. All su's are estimated from the variances of the (full) variance-covariance matrix. The cell e.s.d.'s are taken into account in the estimation of distances, angles and torsion angles |
Refinement. Refinement of F2 against ALL reflections. The weighted R-factor wR and goodness of fit S are based on F2, conventional R-factors R are based on F, with F set to zero for negative F2. The threshold expression of F2 > 2σ(F2) is used only for calculating R-factors(gt) etc. and is not relevant to the choice of reflections for refinement. R-factors based on F2 are statistically about twice as large as those based on F, and R- factors based on ALL data will be even larger. |
| x | y | z | Uiso*/Ueq | ||
| O4 | 0.56853 (10) | 0.24999 (6) | −0.0992 (3) | 0.0283 (4) | |
| N1 | 0.27975 (12) | 0.27483 (7) | 0.1089 (3) | 0.0224 (4) | |
| C2 | 0.31792 (13) | 0.21482 (8) | 0.0700 (3) | 0.0211 (5) | |
| C3 | 0.43464 (13) | 0.21033 (8) | 0.1375 (3) | 0.0231 (5) | |
| C4 | 0.49127 (14) | 0.25941 (8) | 0.0097 (4) | 0.0239 (5) | |
| C5 | 0.44461 (14) | 0.32042 (8) | 0.0236 (4) | 0.0281 (5) | |
| C6 | 0.32911 (14) | 0.31839 (8) | −0.0373 (3) | 0.0236 (5) | |
| C12 | 0.04818 (17) | 0.04740 (9) | 0.5387 (4) | 0.0352 (6) | |
| C16 | 0.11057 (17) | 0.54217 (9) | 0.0765 (4) | 0.0342 (6) | |
| C21 | 0.24918 (13) | 0.17115 (8) | 0.1927 (3) | 0.0213 (5) | |
| C22 | 0.22517 (14) | 0.11643 (8) | 0.0988 (4) | 0.0242 (5) | |
| C23 | 0.16130 (14) | 0.07669 (8) | 0.2094 (4) | 0.0259 (5) | |
| C24 | 0.11876 (14) | 0.09021 (8) | 0.4177 (4) | 0.0259 (5) | |
| C25 | 0.14229 (15) | 0.14503 (8) | 0.5111 (4) | 0.0259 (5) | |
| C26 | 0.20649 (14) | 0.18499 (8) | 0.4018 (4) | 0.0230 (5) | |
| C31 | 0.45077 (15) | 0.22090 (9) | 0.3902 (4) | 0.0286 (5) | |
| C32 | 0.47915 (15) | 0.15041 (8) | 0.0708 (4) | 0.0295 (6) | |
| C61 | 0.27612 (14) | 0.37750 (8) | −0.0106 (3) | 0.0234 (5) | |
| C62 | 0.27803 (15) | 0.40730 (9) | 0.1934 (4) | 0.0281 (5) | |
| C63 | 0.22477 (17) | 0.46020 (9) | 0.2216 (4) | 0.0301 (6) | |
| C64 | 0.16765 (15) | 0.48444 (8) | 0.0463 (4) | 0.0278 (5) | |
| C65 | 0.16612 (16) | 0.45467 (9) | −0.1565 (4) | 0.0285 (5) | |
| C66 | 0.21927 (15) | 0.40169 (9) | −0.1854 (4) | 0.0275 (5) | |
| H1 | 0.216 (2) | 0.2763 (10) | 0.077 (5) | 0.023 (6)* | |
| H2 | 0.31246 | 0.20644 | −0.09429 | 0.0253* | |
| H5A | 0.48115 | 0.34728 | −0.08076 | 0.0338* | |
| H5B | 0.45294 | 0.33610 | 0.17764 | 0.0338* | |
| H6 | 0.32193 | 0.30512 | −0.19655 | 0.0283* | |
| H12A | −0.02240 | 0.05189 | 0.48213 | 0.0528* | |
| H12B | 0.04947 | 0.05577 | 0.70001 | 0.0528* | |
| H12C | 0.07180 | 0.00682 | 0.51226 | 0.0528* | |
| H16A | 0.05083 | 0.54316 | −0.02433 | 0.0513* | |
| H16B | 0.15679 | 0.57518 | 0.04106 | 0.0513* | |
| H16C | 0.08706 | 0.54561 | 0.23220 | 0.0513* | |
| H22 | 0.25301 | 0.10614 | −0.04335 | 0.0290* | |
| H23 | 0.14636 | 0.03963 | 0.14173 | 0.0311* | |
| H25 | 0.11384 | 0.15536 | 0.65267 | 0.0311* | |
| H26 | 0.22149 | 0.22201 | 0.46970 | 0.0276* | |
| H31A | 0.52472 | 0.22461 | 0.42168 | 0.0428* | |
| H31B | 0.42247 | 0.18747 | 0.47486 | 0.0428* | |
| H31C | 0.41538 | 0.25733 | 0.43496 | 0.0428* | |
| H32A | 0.55189 | 0.14846 | 0.11519 | 0.0441* | |
| H32B | 0.47353 | 0.14536 | −0.09201 | 0.0441* | |
| H32C | 0.44060 | 0.11891 | 0.14654 | 0.0441* | |
| H62 | 0.31622 | 0.39132 | 0.31523 | 0.0337* | |
| H63 | 0.22739 | 0.48002 | 0.36202 | 0.0361* | |
| H65 | 0.12808 | 0.47069 | −0.27848 | 0.0342* | |
| H66 | 0.21659 | 0.38193 | −0.32591 | 0.0330* |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| O4 | 0.0233 (6) | 0.0338 (7) | 0.0279 (7) | 0.0004 (5) | 0.0018 (6) | 0.0032 (6) |
| N1 | 0.0197 (7) | 0.0216 (8) | 0.0258 (8) | −0.0004 (5) | 0.0003 (7) | 0.0018 (7) |
| C2 | 0.0223 (8) | 0.0218 (8) | 0.0192 (9) | −0.0003 (6) | −0.0006 (7) | −0.0001 (7) |
| C3 | 0.0201 (8) | 0.0253 (9) | 0.0238 (10) | 0.0003 (7) | −0.0005 (7) | 0.0015 (8) |
| C4 | 0.0215 (8) | 0.0270 (8) | 0.0233 (9) | −0.0013 (7) | −0.0022 (8) | −0.0006 (8) |
| C5 | 0.0240 (8) | 0.0234 (9) | 0.0370 (11) | −0.0022 (7) | 0.0040 (8) | 0.0027 (8) |
| C6 | 0.0256 (9) | 0.0220 (8) | 0.0231 (9) | 0.0003 (7) | 0.0014 (7) | 0.0001 (7) |
| C12 | 0.0374 (10) | 0.0292 (9) | 0.0390 (12) | −0.0069 (8) | 0.0044 (10) | 0.0088 (10) |
| C16 | 0.0349 (10) | 0.0258 (9) | 0.0419 (13) | 0.0039 (7) | 0.0066 (10) | 0.0033 (9) |
| C21 | 0.0199 (8) | 0.0218 (8) | 0.0222 (9) | 0.0011 (6) | −0.0017 (7) | 0.0022 (8) |
| C22 | 0.0247 (8) | 0.0249 (9) | 0.0229 (9) | 0.0009 (6) | −0.0008 (8) | −0.0023 (8) |
| C23 | 0.0285 (8) | 0.0196 (8) | 0.0297 (10) | −0.0008 (7) | −0.0045 (8) | −0.0002 (8) |
| C24 | 0.0234 (8) | 0.0242 (8) | 0.0302 (10) | −0.0009 (7) | −0.0015 (8) | 0.0065 (8) |
| C25 | 0.0260 (9) | 0.0284 (9) | 0.0232 (9) | 0.0017 (7) | 0.0017 (8) | 0.0012 (8) |
| C26 | 0.0238 (8) | 0.0207 (8) | 0.0245 (9) | 0.0006 (6) | −0.0002 (8) | −0.0011 (8) |
| C31 | 0.0261 (9) | 0.0365 (10) | 0.0232 (9) | −0.0027 (8) | −0.0045 (8) | 0.0023 (9) |
| C32 | 0.0263 (9) | 0.0251 (9) | 0.0370 (11) | 0.0023 (7) | 0.0033 (8) | 0.0027 (9) |
| C61 | 0.0242 (8) | 0.0218 (8) | 0.0242 (10) | −0.0022 (7) | 0.0047 (8) | 0.0032 (8) |
| C62 | 0.0330 (9) | 0.0271 (9) | 0.0243 (10) | 0.0007 (7) | −0.0023 (9) | 0.0037 (9) |
| C63 | 0.0388 (10) | 0.0257 (9) | 0.0257 (10) | −0.0011 (8) | 0.0019 (9) | −0.0023 (8) |
| C64 | 0.0260 (8) | 0.0229 (9) | 0.0344 (11) | −0.0018 (7) | 0.0069 (8) | 0.0037 (9) |
| C65 | 0.0301 (9) | 0.0284 (9) | 0.0270 (10) | 0.0000 (7) | 0.0009 (8) | 0.0085 (8) |
| C66 | 0.0315 (10) | 0.0284 (9) | 0.0226 (9) | −0.0016 (8) | 0.0013 (8) | 0.0008 (8) |
| O4—C4 | 1.212 (2) | C65—C66 | 1.393 (3) |
| N1—C2 | 1.463 (2) | C2—H2 | 1.0000 |
| N1—C6 | 1.463 (2) | C5—H5A | 0.9900 |
| N1—H1 | 0.85 (3) | C5—H5B | 0.9900 |
| C2—C21 | 1.518 (2) | C6—H6 | 1.0000 |
| C2—C3 | 1.568 (2) | C12—H12A | 0.9800 |
| C3—C4 | 1.533 (3) | C12—H12B | 0.9800 |
| C3—C31 | 1.539 (3) | C12—H12C | 0.9800 |
| C3—C32 | 1.525 (3) | C16—H16A | 0.9800 |
| C4—C5 | 1.509 (3) | C16—H16B | 0.9800 |
| C5—C6 | 1.541 (3) | C16—H16C | 0.9800 |
| C6—C61 | 1.511 (3) | C22—H22 | 0.9500 |
| C12—C24 | 1.515 (3) | C23—H23 | 0.9500 |
| C16—C64 | 1.511 (3) | C25—H25 | 0.9500 |
| C21—C22 | 1.393 (3) | C26—H26 | 0.9500 |
| C21—C26 | 1.399 (3) | C31—H31A | 0.9800 |
| C22—C23 | 1.388 (3) | C31—H31B | 0.9800 |
| C23—C24 | 1.392 (3) | C31—H31C | 0.9800 |
| C24—C25 | 1.393 (3) | C32—H32A | 0.9800 |
| C25—C26 | 1.390 (3) | C32—H32B | 0.9800 |
| C61—C66 | 1.388 (3) | C32—H32C | 0.9800 |
| C61—C62 | 1.390 (3) | C62—H62 | 0.9500 |
| C62—C63 | 1.391 (3) | C63—H63 | 0.9500 |
| C63—C64 | 1.393 (3) | C65—H65 | 0.9500 |
| C64—C65 | 1.384 (3) | C66—H66 | 0.9500 |
| O4···C21i | 3.419 (2) | H5B···C24i | 3.0700 |
| O4···N1i | 3.057 (2) | H6···H2 | 2.3200 |
| O4···H32B | 2.6700 | H6···H66 | 2.3400 |
| O4···H32A | 2.6400 | H12B···H25 | 2.4200 |
| O4···H1i | 2.26 (3) | H12C···H23 | 2.5200 |
| O4···H25ii | 2.6700 | H16A···H65 | 2.4500 |
| N1···O4iii | 3.057 (2) | H16B···C23vii | 3.0800 |
| N1···H31C | 2.6500 | H16B···C24vii | 3.0200 |
| N1···H62 | 2.9500 | H16B···C25vii | 3.0500 |
| N1···H26 | 2.5700 | H16C···H63 | 2.4700 |
| C21···O4iii | 3.419 (2) | H22···H2 | 2.4100 |
| C22···C32 | 3.384 (3) | H23···H12C | 2.5200 |
| C26···C31 | 3.269 (3) | H25···H12B | 2.4200 |
| C31···C26 | 3.269 (3) | H25···O4viii | 2.6700 |
| C32···C22 | 3.384 (3) | H25···H5Aviii | 2.3400 |
| C4···H1i | 3.05 (3) | H26···N1 | 2.5700 |
| C5···H62 | 2.8900 | H26···C31 | 3.0100 |
| C5···H31C | 2.8600 | H31A···H32A | 2.5400 |
| C21···H32C | 2.7600 | H31B···C21 | 2.8300 |
| C21···H31B | 2.8300 | H31B···C26 | 2.8300 |
| C22···H32C | 2.8100 | H31B···H32C | 2.5100 |
| C23···H16Biv | 3.0800 | H31C···N1 | 2.6500 |
| C24···H5Biii | 3.0700 | H31C···C5 | 2.8600 |
| C24···H16Biv | 3.0200 | H31C···H5B | 2.4000 |
| C25···H16Biv | 3.0500 | H32A···O4 | 2.6400 |
| C26···H1 | 2.83 (3) | H32A···H31A | 2.5400 |
| C26···H31B | 2.8300 | H32A···C61i | 3.0600 |
| C31···H5B | 2.9000 | H32A···C66i | 3.0300 |
| C31···H26 | 3.0100 | H32B···O4 | 2.6700 |
| C61···H32Aiii | 3.0600 | H32B···H2 | 2.5000 |
| C62···H5B | 2.7800 | H32C···C21 | 2.7600 |
| C62···H66v | 3.0300 | H32C···C22 | 2.8100 |
| C65···H63vi | 3.0300 | H32C···H31B | 2.5100 |
| C66···H32Aiii | 3.0300 | H62···N1 | 2.9500 |
| H1···C26 | 2.83 (3) | H62···C5 | 2.8900 |
| H1···O4iii | 2.26 (3) | H62···H5B | 2.3200 |
| H1···C4iii | 3.05 (3) | H62···H66v | 2.5100 |
| H2···H6 | 2.3200 | H63···C65v | 3.0300 |
| H2···H22 | 2.4100 | H63···H16C | 2.4700 |
| H2···H32B | 2.5000 | H63···H65v | 2.5100 |
| H5A···H25ii | 2.3400 | H65···H16A | 2.4500 |
| H5B···C31 | 2.9000 | H65···H63vi | 2.5100 |
| H5B···C62 | 2.7800 | H66···C62vi | 3.0300 |
| H5B···H31C | 2.4000 | H66···H6 | 2.3400 |
| H5B···H62 | 2.3200 | H66···H62vi | 2.5100 |
| C2—N1—C6 | 112.50 (15) | C6—C5—H5B | 110.00 |
| C6—N1—H1 | 105.4 (18) | H5A—C5—H5B | 108.00 |
| C2—N1—H1 | 109.3 (16) | N1—C6—H6 | 109.00 |
| N1—C2—C21 | 109.20 (14) | C5—C6—H6 | 109.00 |
| N1—C2—C3 | 110.21 (14) | C61—C6—H6 | 109.00 |
| C3—C2—C21 | 113.59 (14) | C24—C12—H12A | 109.00 |
| C2—C3—C31 | 111.83 (14) | C24—C12—H12B | 109.00 |
| C2—C3—C4 | 106.69 (14) | C24—C12—H12C | 109.00 |
| C4—C3—C32 | 109.43 (15) | H12A—C12—H12B | 109.00 |
| C31—C3—C32 | 109.98 (16) | H12A—C12—H12C | 109.00 |
| C4—C3—C31 | 107.98 (16) | H12B—C12—H12C | 109.00 |
| C2—C3—C32 | 110.81 (15) | C64—C16—H16A | 109.00 |
| O4—C4—C5 | 121.41 (18) | C64—C16—H16B | 109.00 |
| O4—C4—C3 | 122.29 (16) | C64—C16—H16C | 109.00 |
| C3—C4—C5 | 116.30 (16) | H16A—C16—H16B | 109.00 |
| C4—C5—C6 | 110.43 (15) | H16A—C16—H16C | 109.00 |
| N1—C6—C5 | 107.73 (15) | H16B—C16—H16C | 109.00 |
| C5—C6—C61 | 112.97 (15) | C21—C22—H22 | 119.00 |
| N1—C6—C61 | 109.54 (15) | C23—C22—H22 | 119.00 |
| C2—C21—C26 | 121.04 (16) | C22—C23—H23 | 119.00 |
| C2—C21—C22 | 121.03 (17) | C24—C23—H23 | 119.00 |
| C22—C21—C26 | 117.92 (17) | C24—C25—H25 | 119.00 |
| C21—C22—C23 | 121.2 (2) | C26—C25—H25 | 119.00 |
| C22—C23—C24 | 121.15 (18) | C21—C26—H26 | 120.00 |
| C23—C24—C25 | 117.72 (18) | C25—C26—H26 | 120.00 |
| C12—C24—C25 | 120.7 (2) | C3—C31—H31A | 109.00 |
| C12—C24—C23 | 121.55 (17) | C3—C31—H31B | 109.00 |
| C24—C25—C26 | 121.5 (2) | C3—C31—H31C | 109.00 |
| C21—C26—C25 | 120.57 (18) | H31A—C31—H31B | 109.00 |
| C62—C61—C66 | 118.34 (18) | H31A—C31—H31C | 109.00 |
| C6—C61—C62 | 120.85 (16) | H31B—C31—H31C | 109.00 |
| C6—C61—C66 | 120.71 (17) | C3—C32—H32A | 109.00 |
| C61—C62—C63 | 120.9 (2) | C3—C32—H32B | 109.00 |
| C62—C63—C64 | 120.8 (2) | C3—C32—H32C | 109.00 |
| C16—C64—C65 | 121.2 (2) | H32A—C32—H32B | 109.00 |
| C16—C64—C63 | 120.7 (2) | H32A—C32—H32C | 109.00 |
| C63—C64—C65 | 118.12 (18) | H32B—C32—H32C | 109.00 |
| C64—C65—C66 | 121.3 (2) | C61—C62—H62 | 120.00 |
| C61—C66—C65 | 120.6 (2) | C63—C62—H62 | 120.00 |
| N1—C2—H2 | 108.00 | C62—C63—H63 | 120.00 |
| C3—C2—H2 | 108.00 | C64—C63—H63 | 120.00 |
| C21—C2—H2 | 108.00 | C64—C65—H65 | 119.00 |
| C4—C5—H5A | 110.00 | C66—C65—H65 | 119.00 |
| C4—C5—H5B | 110.00 | C61—C66—H66 | 120.00 |
| C6—C5—H5A | 110.00 | C65—C66—H66 | 120.00 |
| C6—N1—C2—C3 | 65.65 (19) | N1—C6—C61—C62 | 63.7 (2) |
| C6—N1—C2—C21 | −168.91 (14) | N1—C6—C61—C66 | −112.47 (19) |
| C2—N1—C6—C5 | −64.42 (19) | C5—C6—C61—C62 | −56.4 (2) |
| C2—N1—C6—C61 | 172.34 (14) | C5—C6—C61—C66 | 127.44 (19) |
| N1—C2—C3—C4 | −53.85 (19) | C2—C21—C22—C23 | −179.21 (17) |
| N1—C2—C3—C31 | 64.01 (19) | C26—C21—C22—C23 | −0.3 (3) |
| N1—C2—C3—C32 | −172.90 (16) | C2—C21—C26—C25 | 178.97 (17) |
| C21—C2—C3—C4 | −176.75 (15) | C22—C21—C26—C25 | 0.1 (3) |
| C21—C2—C3—C31 | −58.9 (2) | C21—C22—C23—C24 | 0.2 (3) |
| C21—C2—C3—C32 | 64.2 (2) | C22—C23—C24—C12 | 179.41 (19) |
| N1—C2—C21—C22 | 142.56 (17) | C22—C23—C24—C25 | 0.1 (3) |
| N1—C2—C21—C26 | −36.3 (2) | C12—C24—C25—C26 | −179.65 (19) |
| C3—C2—C21—C22 | −94.0 (2) | C23—C24—C25—C26 | −0.4 (3) |
| C3—C2—C21—C26 | 87.2 (2) | C24—C25—C26—C21 | 0.3 (3) |
| C2—C3—C4—O4 | −129.7 (2) | C6—C61—C62—C63 | −176.61 (18) |
| C2—C3—C4—C5 | 49.4 (2) | C66—C61—C62—C63 | −0.3 (3) |
| C31—C3—C4—O4 | 109.9 (2) | C6—C61—C66—C65 | 176.65 (18) |
| C31—C3—C4—C5 | −71.0 (2) | C62—C61—C66—C65 | 0.4 (3) |
| C32—C3—C4—O4 | −9.8 (3) | C61—C62—C63—C64 | 0.4 (3) |
| C32—C3—C4—C5 | 169.34 (18) | C62—C63—C64—C16 | −179.47 (19) |
| O4—C4—C5—C6 | 127.7 (2) | C62—C63—C64—C65 | −0.5 (3) |
| C3—C4—C5—C6 | −51.4 (2) | C16—C64—C65—C66 | 179.51 (19) |
| C4—C5—C6—N1 | 54.8 (2) | C63—C64—C65—C66 | 0.5 (3) |
| C4—C5—C6—C61 | 175.93 (17) | C64—C65—C66—C61 | −0.5 (3) |
| Symmetry codes: (i) x+1/2, −y+1/2, z; (ii) x+1/2, −y+1/2, z−1; (iii) x−1/2, −y+1/2, z; (iv) −x+1/2, y−1/2, z+1/2; (v) x, y, z+1; (vi) x, y, z−1; (vii) −x+1/2, y+1/2, z−1/2; (viii) x−1/2, −y+1/2, z+1. |
| D—H···A | D—H | H···A | D···A | D—H···A |
| N1—H1···O4iii | 0.85 (3) | 2.26 (3) | 3.057 (2) | 157 (2) |
| C16—H16B···Cg1vii | 0.98 | 2.80 | 3.704 (2) | 154 |
| C32—H32A···Cg2i | 0.98 | 2.90 | 3.659 (2) | 135 |
| Symmetry codes: (i) x+1/2, −y+1/2, z; (iii) x−1/2, −y+1/2, z; (vii) −x+1/2, y+1/2, z−1/2. |
Experimental details
| Crystal data | |
| Chemical formula | C21H25NO |
| Mr | 307.42 |
| Crystal system, space group | Orthorhombic, Pna21 |
| Temperature (K) | 110 |
| a, b, c (Å) | 12.9576 (3), 22.6153 (5), 5.9600 (1) |
| V (Å3) | 1746.52 (6) |
| Z | 4 |
| Radiation type | Cu Kα |
| µ (mm−1) | 0.55 |
| Crystal size (mm) | 0.51 × 0.34 × 0.12 |
| Data collection | |
| Diffractometer | Oxford Diffraction Xcalibur diffractometer with a Ruby Gemini detector |
| Absorption correction | Multi-scan (CrysAlis PRO; Oxford Diffraction, 2009) |
| Tmin, Tmax | 0.665, 1.000 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 4198, 1914, 1859 |
| Rint | 0.018 |
| (sin θ/λ)max (Å−1) | 0.624 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.039, 0.106, 1.04 |
| No. of reflections | 1914 |
| No. of parameters | 216 |
| No. of restraints | 1 |
| H-atom treatment | H atoms treated by a mixture of independent and constrained refinement |
| Δρmax, Δρmin (e Å−3) | 0.26, −0.24 |
Computer programs: CrysAlis PRO (Oxford Diffraction, 2009), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), ORTEP-3 (Farrugia, 1997), PLATON (Spek, 2009).
| D—H···A | D—H | H···A | D···A | D—H···A |
| N1—H1···O4i | 0.85 (3) | 2.26 (3) | 3.057 (2) | 157 (2) |
| C16—H16B···Cg1ii | 0.98 | 2.80 | 3.704 (2) | 154 |
| C32—H32A···Cg2iii | 0.98 | 2.90 | 3.659 (2) | 135 |
| Symmetry codes: (i) x−1/2, −y+1/2, z; (ii) −x+1/2, y+1/2, z−1/2; (iii) x+1/2, −y+1/2, z. |
Acknowledgements
RJB acknowledges the NSF MRI program (grant No. CHE-0619278) for funds to purchase an X-ray diffractometer.
References
Aridoss, G., Amirthaganesan, S., Ashok Kumar, N., Kim, J. T., Lim, K. T., Kabilan, S. & Jeong, Y. T. (2008). Bioorg. Med. Chem. Lett. 18, 6542–6548. Web of Science CSD CrossRef PubMed CAS Google Scholar
Farrugia, L. J. (1997). J. Appl. Cryst. 30, 565. CrossRef IUCr Journals Google Scholar
Gayathri, P., Thiruvalluvar, A., Manimekalai, A., Sivakumar, S. & Butcher, R. J. (2008). Acta Cryst. E64, o1973. Web of Science CSD CrossRef IUCr Journals Google Scholar
Ilango, S. S., Ponnuswamy, S., Gayathri, P., Thiruvalluvar, A. & Butcher, R. J. (2008). Acta Cryst. E64, o2312. Web of Science CSD CrossRef IUCr Journals Google Scholar
Noller, C. & Baliah, V. (1948). J. Am. Chem. Soc. 70, 3853–3855. CrossRef PubMed CAS Web of Science Google Scholar
Oxford Diffraction (2009). CrysAlis Pro. Oxford Diffraction Ltd, Yarnton, Oxfordshire, England. Google Scholar
Ponnuswamy, S., Venkatraj, M., Jeyaraman, R., Suresh Kumar, M., Kumaran, D. & Ponnuswamy, M. N. (2002). Indian J. Chem. Sect. B, 41, 614–627. Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Spek, A. L. (2009). Acta Cryst. D65, 148–155. Web of Science CrossRef CAS IUCr Journals Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
; (ii)
; (iii)
. ![[Figure 1]](./sj2644fig1thm.gif)
![[Figure 2]](./sj2644fig2thm.gif)




Piperidin-4-ones and their derivatives show a broad spectrum of biological activity which includes antimicrobial, antiviral, anti tuberculosis and anticancer activities (Aridoss et al., 2008). Recent research effort has been devoted to the discovery of potential 2,6-diarylpiperidin-4-one based chemical entities and establishing their stereochemistry, (Ponnuswamy et al., 2002) because, the pharmacological effects of potential drugs depends sensitively on the stereochemistry and ring conformations.
Crystal structures of r-2,c-6-Bis(4-chlorophenyl)-t-3-isopropyl-1-nitrosopiperidin-4-one (Gayathri et al., 2008) and r-2,c-6-Bis(4-chlorophenyl)-c-3,t-3- dimethylpiperidin-4-one(Ilango et al., 2008) have been reported, wherein the piperidine rings adopt chair conformations.
In the title molecule, C21H25NO, Fig.1, the piperidine ring adopts a chair conformation. The benzene rings at position 2,6 and one of the methyl groups attached to the piperidine ring in 3, have equatorial orientations. The dihedral angle between the two benzene rings is 72.53 (9)°. Molecules are linked by intermolecular N1—H1···O4 (-1/2 + x, 1/2 - y, z)hydrogen bonds, forming an infinite one-dimensional chain with base vector [1 0 0]. Further, C16—H16B···π (1/2 - x, 1/2 + y, -1/2 + z) and C32—H32A···π (1/2 + x, 1/2 - y, z) interactions involving the benzene rings at position 2 (C21—C26) and 6 (C61—C66) are also present in the crystal structure.