metal-organic compounds
(2,2′-Bipyridine-κ2N,N′)bis(N-ethyl-N-phenyldithiocarbamato-κ2S,S′)cadmium(II) chloroform solvate
aSchool of Chemical Sciences, Universiti Kebangsaan Malaysia, 43600 Bangi, Selangor Darul Ehsan, Malaysia, and bDepartment of Chemistry, University of Malaya, 50603 Kuala Lumpur, Malaysia
*Correspondence e-mail: [email protected]
In the title compound, [Cd(C9H10NS2)2(C10H8N2)]·CHCl3, the CdII atom exists in an all-cis distorted octahedral geometry. is isobidentate for one dithiocarbamate ligand and anisobidentate for the other. The chloroform solvent molecule is disordered over two positions of equal occupancy.
Related literature
For the crystal structures of other cadmium dithiocarbamate–2,2′-bipyridine adducts, see: Airoldi et al. (1990
); Deng et al. (2007
); Ivanchenko et al. (2000
).
Experimental
Crystal data
|
Data collection: SMART (Bruker, 2000
); cell refinement: SAINT (Bruker, 2000
); data reduction: SAINT; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: X-SEED (Barbour, 2001
); software used to prepare material for publication: publCIF (Westrip, 2009
).
Supporting information
contains datablocks global, I. DOI: https://doi.org/10.1107/S1600536809041294/xu2633sup1.cif
Structure factors: contains datablock I. DOI: https://doi.org/10.1107/S1600536809041294/xu2633Isup2.hkl
Ethylphenylamine (20 mmol) and carbon disulfide (20 mmol) were dissolved in ethanol (50 ml) at 277 K. Calcium chloride (10 mmol) and 2,2'-bipyridine (10 mmol) dissolved in ethanol (50 mmol) was then added. The white solid that precipitated was collected and recrystallized from an ethanol-chloroform mixture.
As there is some disorder in the ethyl chains of both dithiocarbamate ligands, the C–N distances were tightly restrained to 1.450±0.005 Å and the C–C distances to 1.500±0.005 Å. The chloforom molecule is disordered over two positions; the occupancies were fixed as 0.5 for both components. The six C–Cl distances were restrained to within 0.01 Å of each other as were the Cl···Cl distances. The anisotropic temperature factors of the disordered atoms were restrained to be nearly isotropic.
The phenyl rings were refined as rigid hexagons of 1.39 ° sides.
Carbon-bound H-atoms were placed in calculated positions (C—H 0.93 to 0.97 Å) and were included in the in the riding model approximation, with U(H) set to 1.2 to 1.5U(C).
For the crystal structures of other cadmium dithiocarbamate–2,2'-bipyridine adducts, see: Airoldi et al. (1990); Deng et al. (2007); Ivanchenko et al. (2000).
Data collection: SMART (Bruker, 2000); cell SAINT (Bruker, 2000); data reduction: SAINT (Bruker, 2000); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: X-SEED (Barbour, 2001); software used to prepare material for publication: publCIF (Westrip, 2009).
| Fig. 1. Thermal ellipsoid plot (Barbour, 2001) of Cd(C10H8N2)(C9H10NS2)2.CHCl3 at the 50% probability level. Hydrogen atoms are drawn as spheres of arbitrary radius. The disorder is not shown. |
| [Cd(C9H10NS2)2(C10H8N2)]·CHCl3 | F(000) = 1576 |
| Mr = 780.55 | Dx = 1.533 Mg m−3 |
| Monoclinic, P21/c | Mo Kα radiation, λ = 0.71073 Å |
| Hall symbol: -P 2ybc | Cell parameters from 2492 reflections |
| a = 7.1911 (6) Å | θ = 2.5–20.1° |
| b = 27.752 (3) Å | µ = 1.16 mm−1 |
| c = 17.1907 (16) Å | T = 293 K |
| β = 99.620 (5)° | Plate, yellow |
| V = 3382.5 (6) Å3 | 0.23 × 0.06 × 0.01 mm |
| Z = 4 |
| Bruker SMART APEX diffractometer | 5964 independent reflections |
| Radiation source: fine-focus sealed tube | 4307 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.056 |
| Detector resolution: 8.33 pixels mm-1 | θmax = 25.0°, θmin = 1.4° |
| φ and ω scans | h = −8→8 |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | k = −27→33 |
| Tmin = 0.777, Tmax = 0.989 | l = −20→20 |
| 18956 measured reflections |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.070 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.170 | H-atom parameters constrained |
| S = 1.31 | w = 1/[σ2(Fo2) + (0.05P)2 + 5.0P] where P = (Fo2 + 2Fc2)/3 |
| 5964 reflections | (Δ/σ)max = 0.001 |
| 358 parameters | Δρmax = 0.85 e Å−3 |
| 76 restraints | Δρmin = −0.72 e Å−3 |
| [Cd(C9H10NS2)2(C10H8N2)]·CHCl3 | V = 3382.5 (6) Å3 |
| Mr = 780.55 | Z = 4 |
| Monoclinic, P21/c | Mo Kα radiation |
| a = 7.1911 (6) Å | µ = 1.16 mm−1 |
| b = 27.752 (3) Å | T = 293 K |
| c = 17.1907 (16) Å | 0.23 × 0.06 × 0.01 mm |
| β = 99.620 (5)° |
| Bruker SMART APEX diffractometer | 5964 independent reflections |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | 4307 reflections with I > 2σ(I) |
| Tmin = 0.777, Tmax = 0.989 | Rint = 0.056 |
| 18956 measured reflections |
| R[F2 > 2σ(F2)] = 0.070 | 76 restraints |
| wR(F2) = 0.170 | H-atom parameters constrained |
| S = 1.31 | Δρmax = 0.85 e Å−3 |
| 5964 reflections | Δρmin = −0.72 e Å−3 |
| 358 parameters |
| x | y | z | Uiso*/Ueq | Occ. (<1) | |
| Cd1 | 0.64381 (8) | 0.753688 (19) | 0.52186 (3) | 0.0473 (2) | |
| Cl1 | 0.484 (3) | 0.6172 (12) | 0.3411 (19) | 0.163 (3) | 0.50 |
| Cl2 | 0.3864 (15) | 0.5394 (4) | 0.4309 (8) | 0.201 (4) | 0.50 |
| Cl3 | 0.7627 (15) | 0.5707 (5) | 0.4502 (9) | 0.219 (4) | 0.50 |
| Cl1' | 0.479 (3) | 0.6169 (12) | 0.3297 (19) | 0.163 (3) | 0.50 |
| Cl2' | 0.2584 (15) | 0.5496 (5) | 0.3957 (8) | 0.201 (4) | 0.50 |
| Cl3' | 0.6405 (16) | 0.5623 (5) | 0.4624 (9) | 0.219 (4) | 0.50 |
| S1 | 0.6020 (3) | 0.84105 (7) | 0.57280 (13) | 0.0553 (5) | |
| S2 | 0.9794 (3) | 0.80367 (8) | 0.55465 (14) | 0.0620 (6) | |
| S3 | 0.3644 (3) | 0.69545 (9) | 0.55197 (13) | 0.0648 (6) | |
| S4 | 0.7601 (3) | 0.68697 (8) | 0.63055 (13) | 0.0603 (6) | |
| N1 | 0.9189 (8) | 0.8918 (2) | 0.6032 (5) | 0.069 (2) | |
| N2 | 0.4809 (7) | 0.6337 (2) | 0.6669 (4) | 0.0562 (17) | |
| N3 | 0.7617 (8) | 0.7162 (2) | 0.4173 (3) | 0.0520 (16) | |
| N4 | 0.4490 (8) | 0.7698 (2) | 0.3965 (3) | 0.0485 (15) | |
| C1 | 0.8430 (10) | 0.8488 (3) | 0.5790 (4) | 0.0511 (19) | |
| C2 | 1.1238 (10) | 0.8984 (4) | 0.6258 (9) | 0.142 (6) | |
| H2A | 1.1532 | 0.9172 | 0.6738 | 0.170* | |
| H2B | 1.1876 | 0.8675 | 0.6337 | 0.170* | |
| C3 | 1.179 (2) | 0.9245 (6) | 0.5578 (9) | 0.190 (8) | |
| H3A | 1.3126 | 0.9306 | 0.5680 | 0.285* | |
| H3B | 1.1126 | 0.9546 | 0.5505 | 0.285* | |
| H3C | 1.1486 | 0.9053 | 0.5110 | 0.285* | |
| C4 | 0.8064 (7) | 0.93085 (18) | 0.6236 (4) | 0.066 (2) | |
| C5 | 0.7457 (9) | 0.9666 (2) | 0.5687 (3) | 0.082 (3) | |
| H5 | 0.7698 | 0.9639 | 0.5173 | 0.098* | |
| C6 | 0.6491 (8) | 1.0065 (2) | 0.5904 (5) | 0.089 (3) | |
| H6 | 0.6085 | 1.0304 | 0.5536 | 0.107* | |
| C7 | 0.6131 (8) | 1.0105 (2) | 0.6671 (5) | 0.096 (4) | |
| H7 | 0.5484 | 1.0372 | 0.6816 | 0.115* | |
| C8 | 0.6738 (10) | 0.9748 (3) | 0.7220 (4) | 0.106 (4) | |
| H8 | 0.6497 | 0.9775 | 0.7734 | 0.127* | |
| C9 | 0.7704 (9) | 0.9349 (2) | 0.7003 (4) | 0.092 (3) | |
| H9 | 0.8110 | 0.9110 | 0.7371 | 0.110* | |
| C10 | 0.5316 (9) | 0.6685 (3) | 0.6205 (4) | 0.0444 (17) | |
| C11 | 0.2868 (9) | 0.6185 (3) | 0.6667 (5) | 0.074 (3) | |
| H11A | 0.2024 | 0.6449 | 0.6486 | 0.089* | |
| H11B | 0.2707 | 0.6105 | 0.7201 | 0.089* | |
| C12 | 0.2348 (17) | 0.5758 (3) | 0.6147 (7) | 0.109 (4) | |
| H12A | 0.1066 | 0.5668 | 0.6163 | 0.164* | |
| H12B | 0.3168 | 0.5493 | 0.6328 | 0.164* | |
| H12C | 0.2477 | 0.5837 | 0.5615 | 0.164* | |
| C13 | 0.6215 (7) | 0.61172 (18) | 0.7254 (3) | 0.0520 (19) | |
| C14 | 0.6465 (8) | 0.62834 (18) | 0.8028 (3) | 0.065 (2) | |
| H14 | 0.5752 | 0.6541 | 0.8160 | 0.078* | |
| C15 | 0.7781 (9) | 0.6064 (2) | 0.8604 (3) | 0.084 (3) | |
| H15 | 0.7948 | 0.6175 | 0.9121 | 0.101* | |
| C16 | 0.8846 (8) | 0.5679 (2) | 0.8406 (4) | 0.093 (3) | |
| H16 | 0.9726 | 0.5532 | 0.8792 | 0.112* | |
| C17 | 0.8596 (8) | 0.5513 (2) | 0.7633 (4) | 0.090 (3) | |
| H17 | 0.9309 | 0.5255 | 0.7501 | 0.108* | |
| C18 | 0.7281 (9) | 0.5732 (2) | 0.7057 (3) | 0.076 (3) | |
| H18 | 0.7114 | 0.5621 | 0.6540 | 0.092* | |
| C19 | 0.9258 (11) | 0.6929 (3) | 0.4302 (5) | 0.071 (3) | |
| H19 | 0.9829 | 0.6873 | 0.4821 | 0.085* | |
| C20 | 1.0139 (13) | 0.6769 (4) | 0.3707 (6) | 0.082 (3) | |
| H20 | 1.1280 | 0.6605 | 0.3822 | 0.098* | |
| C21 | 0.9331 (13) | 0.6851 (3) | 0.2945 (6) | 0.073 (3) | |
| H21 | 0.9920 | 0.6752 | 0.2530 | 0.088* | |
| C22 | 0.7648 (13) | 0.7082 (3) | 0.2806 (5) | 0.067 (2) | |
| H22 | 0.7058 | 0.7136 | 0.2290 | 0.080* | |
| C23 | 0.6803 (10) | 0.7236 (3) | 0.3425 (4) | 0.0488 (18) | |
| C24 | 0.4952 (10) | 0.7492 (3) | 0.3318 (4) | 0.0512 (18) | |
| C25 | 0.3768 (12) | 0.7501 (3) | 0.2588 (5) | 0.064 (2) | |
| H25 | 0.4117 | 0.7350 | 0.2151 | 0.077* | |
| C26 | 0.2083 (14) | 0.7738 (4) | 0.2528 (6) | 0.080 (3) | |
| H26 | 0.1269 | 0.7751 | 0.2048 | 0.096* | |
| C27 | 0.1606 (12) | 0.7954 (4) | 0.3178 (7) | 0.081 (3) | |
| H27 | 0.0460 | 0.8114 | 0.3149 | 0.098* | |
| C28 | 0.2842 (11) | 0.7932 (3) | 0.3876 (5) | 0.063 (2) | |
| H28 | 0.2518 | 0.8089 | 0.4312 | 0.076* | |
| C29 | 0.5297 (17) | 0.5900 (6) | 0.4329 (14) | 0.117 (6) | 0.50 |
| H29 | 0.5059 | 0.6125 | 0.4741 | 0.141* | 0.50 |
| C29' | 0.4379 (19) | 0.5918 (6) | 0.4173 (13) | 0.117 (6) | 0.50 |
| H29' | 0.4021 | 0.6168 | 0.4522 | 0.141* | 0.50 |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Cd1 | 0.0559 (3) | 0.0480 (3) | 0.0360 (3) | −0.0026 (3) | 0.0020 (2) | −0.0005 (3) |
| Cl1 | 0.184 (4) | 0.141 (3) | 0.178 (6) | −0.006 (3) | 0.071 (3) | −0.005 (4) |
| Cl2 | 0.221 (7) | 0.174 (5) | 0.217 (7) | −0.039 (6) | 0.063 (6) | 0.007 (5) |
| Cl3 | 0.225 (7) | 0.212 (6) | 0.208 (6) | 0.018 (6) | 0.000 (6) | −0.007 (5) |
| Cl1' | 0.184 (4) | 0.141 (3) | 0.178 (6) | −0.006 (3) | 0.071 (3) | −0.005 (4) |
| Cl2' | 0.221 (7) | 0.174 (5) | 0.217 (7) | −0.039 (6) | 0.063 (6) | 0.007 (5) |
| Cl3' | 0.225 (7) | 0.212 (6) | 0.208 (6) | 0.018 (6) | 0.000 (6) | −0.007 (5) |
| S1 | 0.0463 (10) | 0.0549 (12) | 0.0626 (13) | −0.0009 (9) | 0.0029 (9) | −0.0126 (10) |
| S2 | 0.0562 (12) | 0.0569 (12) | 0.0749 (15) | 0.0013 (10) | 0.0168 (11) | −0.0120 (11) |
| S3 | 0.0468 (11) | 0.0820 (15) | 0.0588 (13) | −0.0022 (11) | −0.0107 (10) | 0.0217 (11) |
| S4 | 0.0455 (10) | 0.0728 (14) | 0.0572 (13) | −0.0096 (10) | −0.0072 (9) | 0.0204 (11) |
| N1 | 0.041 (4) | 0.056 (4) | 0.113 (6) | −0.005 (3) | 0.017 (4) | −0.025 (4) |
| N2 | 0.044 (3) | 0.064 (4) | 0.056 (4) | −0.005 (3) | −0.002 (3) | 0.013 (3) |
| N3 | 0.050 (4) | 0.065 (4) | 0.037 (4) | 0.001 (3) | −0.003 (3) | −0.010 (3) |
| N4 | 0.049 (3) | 0.055 (4) | 0.039 (4) | 0.002 (3) | 0.001 (3) | 0.004 (3) |
| C1 | 0.055 (4) | 0.054 (5) | 0.044 (4) | −0.004 (4) | 0.006 (4) | −0.008 (4) |
| C2 | 0.138 (12) | 0.066 (7) | 0.254 (19) | −0.006 (7) | 0.127 (13) | −0.033 (9) |
| C3 | 0.109 (11) | 0.182 (18) | 0.27 (2) | 0.035 (12) | 0.010 (14) | −0.054 (17) |
| C4 | 0.051 (5) | 0.059 (5) | 0.086 (7) | −0.016 (4) | 0.004 (5) | −0.019 (5) |
| C5 | 0.066 (6) | 0.079 (7) | 0.095 (8) | 0.006 (5) | −0.005 (5) | −0.028 (6) |
| C6 | 0.061 (6) | 0.075 (7) | 0.120 (10) | 0.003 (5) | −0.017 (6) | −0.030 (6) |
| C7 | 0.073 (6) | 0.061 (6) | 0.154 (12) | −0.008 (5) | 0.018 (7) | −0.039 (7) |
| C8 | 0.114 (9) | 0.077 (8) | 0.136 (11) | −0.005 (7) | 0.050 (8) | −0.044 (8) |
| C9 | 0.101 (8) | 0.059 (6) | 0.123 (10) | −0.005 (6) | 0.039 (7) | −0.008 (6) |
| C10 | 0.044 (4) | 0.054 (4) | 0.032 (4) | 0.000 (3) | −0.002 (3) | 0.000 (3) |
| C11 | 0.064 (5) | 0.080 (6) | 0.076 (7) | −0.003 (5) | 0.006 (5) | 0.014 (5) |
| C12 | 0.114 (9) | 0.097 (8) | 0.114 (10) | −0.028 (7) | 0.012 (8) | −0.003 (7) |
| C13 | 0.055 (4) | 0.046 (4) | 0.057 (5) | −0.001 (4) | 0.013 (4) | 0.012 (4) |
| C14 | 0.082 (6) | 0.052 (5) | 0.058 (5) | 0.003 (4) | −0.001 (5) | 0.003 (4) |
| C15 | 0.098 (7) | 0.085 (7) | 0.060 (6) | −0.011 (6) | −0.013 (5) | 0.012 (5) |
| C16 | 0.079 (7) | 0.103 (8) | 0.092 (8) | 0.018 (6) | −0.004 (6) | 0.038 (7) |
| C17 | 0.073 (6) | 0.096 (8) | 0.102 (8) | 0.038 (6) | 0.017 (6) | 0.032 (7) |
| C18 | 0.088 (6) | 0.087 (7) | 0.058 (6) | 0.022 (6) | 0.023 (5) | 0.010 (5) |
| C19 | 0.056 (5) | 0.099 (7) | 0.054 (5) | 0.018 (5) | −0.005 (4) | −0.009 (5) |
| C20 | 0.058 (5) | 0.094 (7) | 0.091 (8) | 0.021 (5) | 0.005 (5) | −0.021 (6) |
| C21 | 0.070 (6) | 0.085 (7) | 0.066 (6) | −0.008 (5) | 0.017 (5) | −0.026 (5) |
| C22 | 0.085 (6) | 0.075 (6) | 0.040 (5) | −0.006 (5) | 0.008 (4) | −0.005 (4) |
| C23 | 0.053 (4) | 0.052 (4) | 0.039 (4) | −0.013 (4) | −0.001 (4) | −0.004 (3) |
| C24 | 0.057 (4) | 0.048 (4) | 0.047 (4) | −0.013 (4) | 0.006 (4) | 0.009 (4) |
| C25 | 0.067 (5) | 0.068 (5) | 0.050 (5) | −0.005 (5) | −0.013 (4) | 0.007 (4) |
| C26 | 0.069 (6) | 0.094 (7) | 0.068 (7) | −0.010 (6) | −0.018 (5) | 0.013 (6) |
| C27 | 0.046 (5) | 0.084 (7) | 0.108 (9) | 0.008 (5) | −0.005 (5) | 0.017 (6) |
| C28 | 0.051 (5) | 0.061 (5) | 0.077 (6) | 0.005 (4) | 0.010 (4) | 0.012 (4) |
| C29 | 0.126 (11) | 0.105 (8) | 0.121 (9) | 0.009 (8) | 0.022 (9) | 0.010 (7) |
| C29' | 0.126 (11) | 0.105 (8) | 0.121 (9) | 0.009 (8) | 0.022 (9) | 0.010 (7) |
| Cd1—N3 | 2.355 (6) | C8—C9 | 1.3900 |
| Cd1—N4 | 2.408 (6) | C8—H8 | 0.9300 |
| Cd1—S1 | 2.612 (2) | C9—H9 | 0.9300 |
| Cd1—S4 | 2.664 (2) | C11—C12 | 1.493 (5) |
| Cd1—S3 | 2.696 (2) | C11—H11A | 0.9700 |
| Cd1—S2 | 2.759 (2) | C11—H11B | 0.9700 |
| Cl1—C29 | 1.731 (9) | C12—H12A | 0.9600 |
| Cl2—C29 | 1.740 (9) | C12—H12B | 0.9600 |
| Cl3—C29 | 1.737 (9) | C12—H12C | 0.9600 |
| Cl1'—C29' | 1.730 (9) | C13—C14 | 1.3900 |
| Cl2'—C29' | 1.736 (9) | C13—C18 | 1.3900 |
| Cl3'—C29' | 1.736 (9) | C14—C15 | 1.3900 |
| S1—C1 | 1.731 (8) | C14—H14 | 0.9300 |
| S2—C1 | 1.686 (8) | C15—C16 | 1.3900 |
| S3—C10 | 1.709 (7) | C15—H15 | 0.9300 |
| S4—C10 | 1.703 (7) | C16—C17 | 1.3900 |
| N1—C1 | 1.350 (9) | C16—H16 | 0.9300 |
| N1—C4 | 1.430 (7) | C17—C18 | 1.3900 |
| N1—C2 | 1.471 (5) | C17—H17 | 0.9300 |
| N2—C10 | 1.341 (9) | C18—H18 | 0.9300 |
| N2—C13 | 1.438 (7) | C19—C20 | 1.363 (12) |
| N2—C11 | 1.458 (5) | C19—H19 | 0.9300 |
| N3—C19 | 1.332 (10) | C20—C21 | 1.362 (13) |
| N3—C23 | 1.335 (9) | C20—H20 | 0.9300 |
| N4—C28 | 1.338 (9) | C21—C22 | 1.354 (12) |
| N4—C24 | 1.341 (10) | C21—H21 | 0.9300 |
| C2—C3 | 1.486 (5) | C22—C23 | 1.379 (11) |
| C2—H2A | 0.9700 | C22—H22 | 0.9300 |
| C2—H2B | 0.9700 | C23—C24 | 1.493 (11) |
| C3—H3A | 0.9600 | C24—C25 | 1.394 (11) |
| C3—H3B | 0.9600 | C25—C26 | 1.367 (13) |
| C3—H3C | 0.9600 | C25—H25 | 0.9300 |
| C4—C5 | 1.3900 | C26—C27 | 1.362 (14) |
| C4—C9 | 1.3900 | C26—H26 | 0.9300 |
| C5—C6 | 1.3900 | C27—C28 | 1.370 (12) |
| C5—H5 | 0.9300 | C27—H27 | 0.9300 |
| C6—C7 | 1.3900 | C28—H28 | 0.9300 |
| C6—H6 | 0.9300 | C29—H29 | 0.9800 |
| C7—C8 | 1.3900 | C29'—H29' | 0.9800 |
| C7—H7 | 0.9300 | ||
| N3—Cd1—N4 | 68.2 (2) | N2—C11—H11B | 109.2 |
| N3—Cd1—S1 | 137.94 (17) | C12—C11—H11B | 109.2 |
| N4—Cd1—S1 | 92.60 (15) | H11A—C11—H11B | 107.9 |
| N3—Cd1—S4 | 96.75 (16) | C11—C12—H12A | 109.5 |
| N4—Cd1—S4 | 145.52 (15) | C11—C12—H12B | 109.5 |
| S1—Cd1—S4 | 116.75 (7) | H12A—C12—H12B | 109.5 |
| N3—Cd1—S3 | 104.88 (16) | C11—C12—H12C | 109.5 |
| N4—Cd1—S3 | 86.69 (15) | H12A—C12—H12C | 109.5 |
| S1—Cd1—S3 | 111.16 (7) | H12B—C12—H12C | 109.5 |
| S4—Cd1—S3 | 66.76 (6) | C14—C13—C18 | 120.0 |
| N3—Cd1—S2 | 87.94 (15) | C14—C13—N2 | 119.5 (5) |
| N4—Cd1—S2 | 116.60 (15) | C18—C13—N2 | 120.5 (5) |
| S1—Cd1—S2 | 67.08 (6) | C13—C14—C15 | 120.0 |
| S4—Cd1—S2 | 92.56 (7) | C13—C14—H14 | 120.0 |
| S3—Cd1—S2 | 156.49 (7) | C15—C14—H14 | 120.0 |
| C1—S1—Cd1 | 88.0 (3) | C14—C15—C16 | 120.0 |
| C1—S2—Cd1 | 84.2 (3) | C14—C15—H15 | 120.0 |
| C10—S3—Cd1 | 86.2 (3) | C16—C15—H15 | 120.0 |
| C10—S4—Cd1 | 87.3 (2) | C17—C16—C15 | 120.0 |
| C1—N1—C4 | 122.0 (6) | C17—C16—H16 | 120.0 |
| C1—N1—C2 | 121.8 (7) | C15—C16—H16 | 120.0 |
| C4—N1—C2 | 115.1 (7) | C16—C17—C18 | 120.0 |
| C10—N2—C13 | 119.5 (5) | C16—C17—H17 | 120.0 |
| C10—N2—C11 | 124.2 (6) | C18—C17—H17 | 120.0 |
| C13—N2—C11 | 116.1 (6) | C17—C18—C13 | 120.0 |
| C19—N3—C23 | 118.0 (7) | C17—C18—H18 | 120.0 |
| C19—N3—Cd1 | 120.6 (5) | C13—C18—H18 | 120.0 |
| C23—N3—Cd1 | 120.7 (5) | N3—C19—C20 | 122.8 (8) |
| C28—N4—C24 | 116.8 (7) | N3—C19—H19 | 118.6 |
| C28—N4—Cd1 | 124.3 (5) | C20—C19—H19 | 118.6 |
| C24—N4—Cd1 | 118.4 (5) | C19—C20—C21 | 119.4 (8) |
| N1—C1—S2 | 120.8 (6) | C19—C20—H20 | 120.3 |
| N1—C1—S1 | 118.5 (6) | C21—C20—H20 | 120.3 |
| S2—C1—S1 | 120.7 (4) | C22—C21—C20 | 118.2 (9) |
| C3—C2—N1 | 104.0 (11) | C22—C21—H21 | 120.9 |
| C3—C2—H2A | 111.0 | C20—C21—H21 | 120.9 |
| N1—C2—H2A | 111.0 | C21—C22—C23 | 120.5 (8) |
| C3—C2—H2B | 111.0 | C21—C22—H22 | 119.8 |
| N1—C2—H2B | 111.0 | C23—C22—H22 | 119.8 |
| H2A—C2—H2B | 109.0 | N3—C23—C22 | 121.1 (7) |
| C2—C3—H3A | 109.5 | N3—C23—C24 | 115.5 (7) |
| C2—C3—H3B | 109.5 | C22—C23—C24 | 123.4 (7) |
| H3A—C3—H3B | 109.5 | N4—C24—C25 | 122.7 (8) |
| C2—C3—H3C | 109.5 | N4—C24—C23 | 116.1 (6) |
| H3A—C3—H3C | 109.5 | C25—C24—C23 | 121.2 (7) |
| H3B—C3—H3C | 109.5 | C26—C25—C24 | 118.5 (9) |
| C5—C4—C9 | 120.0 | C26—C25—H25 | 120.8 |
| C5—C4—N1 | 120.0 (6) | C24—C25—H25 | 120.8 |
| C9—C4—N1 | 119.8 (6) | C27—C26—C25 | 119.4 (9) |
| C6—C5—C4 | 120.0 | C27—C26—H26 | 120.3 |
| C6—C5—H5 | 120.0 | C25—C26—H26 | 120.3 |
| C4—C5—H5 | 120.0 | C26—C27—C28 | 118.9 (9) |
| C5—C6—C7 | 120.0 | C26—C27—H27 | 120.5 |
| C5—C6—H6 | 120.0 | C28—C27—H27 | 120.5 |
| C7—C6—H6 | 120.0 | N4—C28—C27 | 123.7 (9) |
| C8—C7—C6 | 120.0 | N4—C28—H28 | 118.2 |
| C8—C7—H7 | 120.0 | C27—C28—H28 | 118.2 |
| C6—C7—H7 | 120.0 | Cl1—C29—Cl3 | 108.6 (8) |
| C9—C8—C7 | 120.0 | Cl1—C29—Cl2 | 108.2 (7) |
| C9—C8—H8 | 120.0 | Cl3—C29—Cl2 | 107.8 (7) |
| C7—C8—H8 | 120.0 | Cl1—C29—H29 | 110.7 |
| C8—C9—C4 | 120.0 | Cl3—C29—H29 | 110.7 |
| C8—C9—H9 | 120.0 | Cl2—C29—H29 | 110.7 |
| C4—C9—H9 | 120.0 | Cl1'—C29'—Cl2' | 108.3 (7) |
| N2—C10—S4 | 120.7 (5) | Cl1'—C29'—Cl3' | 109.0 (8) |
| N2—C10—S3 | 119.7 (5) | Cl2'—C29'—Cl3' | 108.5 (7) |
| S4—C10—S3 | 119.6 (4) | Cl1'—C29'—H29' | 110.3 |
| N2—C11—C12 | 112.0 (7) | Cl2'—C29'—H29' | 110.3 |
| N2—C11—H11A | 109.2 | Cl3'—C29'—H29' | 110.3 |
| C12—C11—H11A | 109.2 | ||
| N3—Cd1—S1—C1 | −57.8 (3) | N1—C4—C5—C6 | −175.0 (5) |
| N4—Cd1—S1—C1 | −117.5 (3) | C4—C5—C6—C7 | 0.0 |
| S4—Cd1—S1—C1 | 81.3 (3) | C5—C6—C7—C8 | 0.0 |
| S3—Cd1—S1—C1 | 155.1 (3) | C6—C7—C8—C9 | 0.0 |
| S2—Cd1—S1—C1 | 0.4 (3) | C7—C8—C9—C4 | 0.0 |
| N3—Cd1—S2—C1 | 144.9 (3) | C5—C4—C9—C8 | 0.0 |
| N4—Cd1—S2—C1 | 80.6 (3) | N1—C4—C9—C8 | 175.0 (5) |
| S1—Cd1—S2—C1 | −0.4 (3) | C13—N2—C10—S4 | −0.1 (10) |
| S4—Cd1—S2—C1 | −118.5 (3) | C11—N2—C10—S4 | 174.8 (6) |
| S3—Cd1—S2—C1 | −91.0 (3) | C13—N2—C10—S3 | −178.9 (5) |
| N3—Cd1—S3—C10 | 92.9 (3) | C11—N2—C10—S3 | −4.0 (10) |
| N4—Cd1—S3—C10 | 159.3 (3) | Cd1—S4—C10—N2 | −175.7 (6) |
| S1—Cd1—S3—C10 | −109.2 (3) | Cd1—S4—C10—S3 | 3.1 (4) |
| S4—Cd1—S3—C10 | 1.9 (3) | Cd1—S3—C10—N2 | 175.7 (6) |
| S2—Cd1—S3—C10 | −28.2 (3) | Cd1—S3—C10—S4 | −3.1 (4) |
| N3—Cd1—S4—C10 | −105.2 (3) | C10—N2—C11—C12 | 95.3 (10) |
| N4—Cd1—S4—C10 | −44.4 (4) | C13—N2—C11—C12 | −89.6 (9) |
| S1—Cd1—S4—C10 | 101.0 (3) | C10—N2—C13—C14 | 96.2 (7) |
| S3—Cd1—S4—C10 | −1.9 (3) | C11—N2—C13—C14 | −79.1 (7) |
| S2—Cd1—S4—C10 | 166.6 (3) | C10—N2—C13—C18 | −85.7 (7) |
| N4—Cd1—N3—C19 | 174.9 (7) | C11—N2—C13—C18 | 98.9 (7) |
| S1—Cd1—N3—C19 | 106.6 (6) | C18—C13—C14—C15 | 0.0 |
| S4—Cd1—N3—C19 | −37.2 (6) | N2—C13—C14—C15 | 178.1 (5) |
| S3—Cd1—N3—C19 | −104.9 (6) | C13—C14—C15—C16 | 0.0 |
| S2—Cd1—N3—C19 | 55.1 (6) | C14—C15—C16—C17 | 0.0 |
| N4—Cd1—N3—C23 | 4.6 (5) | C15—C16—C17—C18 | 0.0 |
| S1—Cd1—N3—C23 | −63.6 (6) | C16—C17—C18—C13 | 0.0 |
| S4—Cd1—N3—C23 | 152.5 (5) | C14—C13—C18—C17 | 0.0 |
| S3—Cd1—N3—C23 | 84.8 (5) | N2—C13—C18—C17 | −178.0 (5) |
| S2—Cd1—N3—C23 | −115.2 (5) | C23—N3—C19—C20 | 0.7 (13) |
| N3—Cd1—N4—C28 | 174.0 (6) | Cd1—N3—C19—C20 | −169.8 (7) |
| S1—Cd1—N4—C28 | −44.5 (6) | N3—C19—C20—C21 | 0.5 (15) |
| S4—Cd1—N4—C28 | 105.0 (6) | C19—C20—C21—C22 | −1.4 (15) |
| S3—Cd1—N4—C28 | 66.5 (6) | C20—C21—C22—C23 | 1.2 (14) |
| S2—Cd1—N4—C28 | −110.1 (6) | C19—N3—C23—C22 | −0.9 (11) |
| N3—Cd1—N4—C24 | 2.5 (5) | Cd1—N3—C23—C22 | 169.6 (6) |
| S1—Cd1—N4—C24 | 144.0 (5) | C19—N3—C23—C24 | 179.0 (7) |
| S4—Cd1—N4—C24 | −66.4 (6) | Cd1—N3—C23—C24 | −10.4 (8) |
| S3—Cd1—N4—C24 | −104.9 (5) | C21—C22—C23—N3 | 0.0 (13) |
| S2—Cd1—N4—C24 | 78.4 (5) | C21—C22—C23—C24 | 180.0 (7) |
| C4—N1—C1—S2 | 179.5 (6) | C28—N4—C24—C25 | −2.2 (11) |
| C2—N1—C1—S2 | −13.4 (13) | Cd1—N4—C24—C25 | 169.9 (6) |
| C4—N1—C1—S1 | 0.0 (11) | C28—N4—C24—C23 | 179.4 (6) |
| C2—N1—C1—S1 | 167.1 (8) | Cd1—N4—C24—C23 | −8.5 (8) |
| Cd1—S2—C1—N1 | −178.8 (7) | N3—C23—C24—N4 | 12.3 (9) |
| Cd1—S2—C1—S1 | 0.7 (4) | C22—C23—C24—N4 | −167.7 (7) |
| Cd1—S1—C1—N1 | 178.8 (7) | N3—C23—C24—C25 | −166.1 (7) |
| Cd1—S1—C1—S2 | −0.7 (5) | C22—C23—C24—C25 | 13.8 (11) |
| C1—N1—C2—C3 | 104.8 (12) | N4—C24—C25—C26 | 1.1 (12) |
| C4—N1—C2—C3 | −87.3 (12) | C23—C24—C25—C26 | 179.4 (8) |
| C1—N1—C4—C5 | −97.3 (8) | C24—C25—C26—C27 | −0.3 (14) |
| C2—N1—C4—C5 | 94.8 (9) | C25—C26—C27—C28 | 0.6 (15) |
| C1—N1—C4—C9 | 87.7 (8) | C24—N4—C28—C27 | 2.5 (12) |
| C2—N1—C4—C9 | −80.2 (9) | Cd1—N4—C28—C27 | −169.0 (7) |
| C9—C4—C5—C6 | 0.0 | C26—C27—C28—N4 | −1.8 (14) |
Experimental details
| Crystal data | |
| Chemical formula | [Cd(C9H10NS2)2(C10H8N2)]·CHCl3 |
| Mr | 780.55 |
| Crystal system, space group | Monoclinic, P21/c |
| Temperature (K) | 293 |
| a, b, c (Å) | 7.1911 (6), 27.752 (3), 17.1907 (16) |
| β (°) | 99.620 (5) |
| V (Å3) | 3382.5 (6) |
| Z | 4 |
| Radiation type | Mo Kα |
| µ (mm−1) | 1.16 |
| Crystal size (mm) | 0.23 × 0.06 × 0.01 |
| Data collection | |
| Diffractometer | Bruker SMART APEX |
| Absorption correction | Multi-scan (SADABS; Sheldrick, 1996) |
| Tmin, Tmax | 0.777, 0.989 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 18956, 5964, 4307 |
| Rint | 0.056 |
| (sin θ/λ)max (Å−1) | 0.595 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.070, 0.170, 1.31 |
| No. of reflections | 5964 |
| No. of parameters | 358 |
| No. of restraints | 76 |
| H-atom treatment | H-atom parameters constrained |
| Δρmax, Δρmin (e Å−3) | 0.85, −0.72 |
Computer programs: SMART (Bruker, 2000), SAINT (Bruker, 2000), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), X-SEED (Barbour, 2001), publCIF (Westrip, 2009).
Acknowledgements
We thank Universiti Kebangsaan Malaysia (UKM-GUP-NBT-08–27-111 and 06–01-02-SF0539) and the University of Malaya for supporting this study.
References
Airoldi, C., De Oliveira, S. F., Ruggiero, S. G. & Lechat, J. R. (1990). Inorg. Chim. Acta, 174, 103–108. CSD CrossRef CAS Web of Science Google Scholar
Barbour, L. J. (2001). J. Supramol. Chem. 1, 189–191. CrossRef CAS Google Scholar
Bruker (2000). SAINT and SMART. Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
Deng, Y.-H., Liu, J., Yang, Y.-L. & Ma, H.-W. (2007). Huaxue Xuebao, 65, 2868–2874. CAS Google Scholar
Ivanchenko, A. V., Gromilov, S. A., Zemskova, S. M. & Baidina, I. A. (2000). Zh. Strukt. Khim. 41, 106–115. Google Scholar
Sheldrick, G. M. (1996). SADABS. University of Göttingen, Germany. Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Westrip, S. P. (2009). publCIF. In preparation. Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
![[Figure 1]](./xu2633fig1thm.gif)



