metal-organic compounds
Decaaqua-1κ5O,4κ5O-bis(μ-nitrilotriacetato)-1:2κ5O:N,O′,O′′,O′′′;3:4κ5N,O,O′,O′′:O′′′-μ-oxido-2:3κ2O:O-diperoxido-2κ2O,O′;3κ2O,O′-1,4-dicopper(II)-2,3-dititanium(IV) heptahydrate
aCollege of Chinese Language and Culture, Jinan University, Guangzhou 510610, People's Republic of China, bOffice of Rongcheng Vocational College, Rongcheng Vocational College, Rongcheng 476600, People's Republic of China, and cDepartment of Chemistry, University of Malaya, 50603 Kuala Lumpur, Malaysia
*Correspondence e-mail: [email protected]
The tetranuclear title compound, [Cu2Ti2(C6H6NO6)2O(O2)2(H2O)10]·7H2O, lies about a twofold rotation axis that passes through the bridging oxide atom. The titanium atom is N,O,O′,O′′-chelated by the nitrilotriacetate and O,O′-chelated by the peroidxo group and is coordinated to the bridging O atom in an overall pentagonal-bipyramidal geometry. The O atom of one of the carboxylate –CO2 groups binds to the water-coordinated Cu atom, whose is an elongated octahedron. Adjacent tetranuclear molecules are linked through the coordinated and uncoordinated water molecules by O—H⋯O hydrogen bonds into a three-dimensional network.
Related literature
For the hydrated sodium and ammonium salts of oxobis(nitrilotriacetatoperoxotitanates), see: Schwarzenbach & Girgis (1975
); Zhou et al. (2004
).
Experimental
Crystal data
|
Refinement
|
|
Data collection: RAPID-AUTO (Rigaku, 2002
); cell refinement: RAPID-AUTO; data reduction: CrystalClear (Rigaku/MSC, 2002
); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: X-SEED (Barbour, 2001
); software used to prepare material for publication: publCIF (Westrip, 2010
).
Supporting information
contains datablocks global, I. DOI: 10.1107/S1600536810004198/bt5183sup1.cif
Structure factors: contains datablock I. DOI: 10.1107/S1600536810004198/bt5183Isup2.hkl
To a suspension of nitrilotriacetic acid (1.91 g, 10 mol) in water (30 ml) was added titanium tetrabutoxide (3.40 ml). After 12 hours, the mixture was allowed to cool to 273 K; 30% hydrogen peroxide (5 ml) was added. The mixture was filtered. The pH of the filtrate was raised to 4.0. Copper chloride dihydrate (1.70 g, 10 mol) was added. The solution was kept at 279 K for a week. Green crystals were collected and washed with water; the yield was 90%. CH&N elemental analysis. Found (Calc. for C12H46O34N2Cu2Ti2): C 14.59 (14.63), H 4.75 (4.71), N 2.82% (2.84%). The crystals do not dissolve in organic solvents.
Carbon-bound H-atoms were allowed to ride on their parent atoms (C–H 0.97 Å) with U(H) set to 1.2Ueq(C). The water H-atoms were located in a difference Fourier map, and were initially refined with distance restraints of O–H 0.84 and H···H 1.37 Å; with U(H) set to 1.5Ueq(O). Once found, their positions were fixed.
Data collection: RAPID-AUTO (Rigaku, 2002); cell RAPID-AUTO (Rigaku, 2002); data reduction: CrystalClear (Rigaku/MSC, 2002); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: X-SEED (Barbour, 2001); software used to prepare material for publication: publCIF (Westrip, 2010).
| Fig. 1. Anisotropic displacement ellipsoid plot (Barbour, 2001) of Cu2Ti2(O)(O2)2(H2O)10(C6H6NO6)2.7H2O at the 70% probability level; hydrogen atoms are drawn as spheres of arbitrary radius. |
| [Cu2Ti2(C6H6NO6)2O(O2)2(H2O)10]·7H2O | F(000) = 2024 |
| Mr = 985.39 | Dx = 1.925 Mg m−3 |
| Monoclinic, C2/c | Mo Kα radiation, λ = 0.71073 Å |
| Hall symbol: -C 2yc | Cell parameters from 13230 reflections |
| a = 14.9312 (10) Å | θ = 3.1–27.5° |
| b = 13.2892 (9) Å | µ = 1.81 mm−1 |
| c = 17.4449 (10) Å | T = 293 K |
| β = 100.825 (2)° | Block, green |
| V = 3399.9 (4) Å3 | 0.30 × 0.20 × 0.20 mm |
| Z = 4 |
| Rigaku R-AXIS Spider IP diffractometer | 3894 independent reflections |
| Radiation source: fine-focus sealed tube | 3408 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.033 |
| ω scan | θmax = 27.5°, θmin = 3.1° |
| Absorption correction: multi-scan (ABSCOR; Higashi, 1995) | h = −19→19 |
| Tmin = 0.694, Tmax = 1.000 | k = −17→17 |
| 16221 measured reflections | l = −22→22 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.026 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.075 | H-atom parameters constrained |
| S = 1.08 | w = 1/[σ2(Fo2) + (0.0339P)2 + 4.0704P] where P = (Fo2 + 2Fc2)/3 |
| 3894 reflections | (Δ/σ)max = 0.001 |
| 236 parameters | Δρmax = 0.44 e Å−3 |
| 0 restraints | Δρmin = −0.31 e Å−3 |
| [Cu2Ti2(C6H6NO6)2O(O2)2(H2O)10]·7H2O | V = 3399.9 (4) Å3 |
| Mr = 985.39 | Z = 4 |
| Monoclinic, C2/c | Mo Kα radiation |
| a = 14.9312 (10) Å | µ = 1.81 mm−1 |
| b = 13.2892 (9) Å | T = 293 K |
| c = 17.4449 (10) Å | 0.30 × 0.20 × 0.20 mm |
| β = 100.825 (2)° |
| Rigaku R-AXIS Spider IP diffractometer | 3894 independent reflections |
| Absorption correction: multi-scan (ABSCOR; Higashi, 1995) | 3408 reflections with I > 2σ(I) |
| Tmin = 0.694, Tmax = 1.000 | Rint = 0.033 |
| 16221 measured reflections |
| R[F2 > 2σ(F2)] = 0.026 | 0 restraints |
| wR(F2) = 0.075 | H-atom parameters constrained |
| S = 1.08 | Δρmax = 0.44 e Å−3 |
| 3894 reflections | Δρmin = −0.31 e Å−3 |
| 236 parameters |
| x | y | z | Uiso*/Ueq | ||
| Cu1 | 0.133265 (16) | 0.615605 (19) | 0.469933 (13) | 0.02095 (8) | |
| Ti1 | 0.42419 (2) | 0.63347 (3) | 0.319688 (18) | 0.01718 (9) | |
| O1 | 0.39888 (10) | 0.78937 (11) | 0.30661 (8) | 0.0241 (3) | |
| O2 | 0.36186 (12) | 0.91179 (12) | 0.21923 (9) | 0.0331 (4) | |
| O3 | 0.38194 (10) | 0.48763 (11) | 0.28694 (8) | 0.0254 (3) | |
| O4 | 0.31766 (13) | 0.38625 (12) | 0.19110 (10) | 0.0355 (4) | |
| O5 | 0.31248 (10) | 0.63343 (12) | 0.37559 (8) | 0.0263 (3) | |
| O6 | 0.16254 (10) | 0.64622 (12) | 0.36729 (8) | 0.0254 (3) | |
| O7 | 0.5000 | 0.63818 (16) | 0.2500 | 0.0239 (4) | |
| O8 | 0.50228 (10) | 0.67667 (12) | 0.41151 (8) | 0.0280 (3) | |
| O9 | 0.49544 (10) | 0.56625 (12) | 0.40498 (8) | 0.0296 (3) | |
| O1w | 0.00795 (10) | 0.58467 (12) | 0.40849 (8) | 0.0254 (3) | |
| H11 | −0.0307 | 0.6261 | 0.4188 | 0.038* | |
| H12 | 0.0096 | 0.5890 | 0.3607 | 0.038* | |
| O2w | 0.08783 (12) | 0.58514 (13) | 0.56735 (9) | 0.0358 (4) | |
| H21 | 0.0557 | 0.5363 | 0.5765 | 0.054* | |
| H22 | 0.0908 | 0.6269 | 0.6039 | 0.054* | |
| O3w | 0.25339 (11) | 0.62901 (14) | 0.53336 (9) | 0.0360 (4) | |
| H31 | 0.2639 | 0.6289 | 0.5824 | 0.054* | |
| H32 | 0.2965 | 0.6587 | 0.5181 | 0.054* | |
| O4w | 0.09054 (10) | 0.77903 (12) | 0.47459 (8) | 0.0274 (3) | |
| H4w1 | 0.0638 | 0.7931 | 0.5115 | 0.041* | |
| H4w2 | 0.0566 | 0.7959 | 0.4325 | 0.041* | |
| O5w | 0.17335 (12) | 0.44158 (13) | 0.44550 (9) | 0.0355 (4) | |
| H51 | 0.1595 | 0.4244 | 0.3984 | 0.053* | |
| H52 | 0.2304 | 0.4418 | 0.4585 | 0.053* | |
| O6w | 0.12472 (12) | 0.30720 (14) | 0.55409 (10) | 0.0394 (4) | |
| H61 | 0.1311 | 0.3329 | 0.5114 | 0.059* | |
| H62 | 0.1168 | 0.2450 | 0.5476 | 0.059* | |
| O7w | 0.36239 (13) | 0.41472 (15) | 0.45757 (11) | 0.0466 (5) | |
| H71 | 0.3780 | 0.4405 | 0.4181 | 0.070* | |
| H72 | 0.4018 | 0.4295 | 0.4970 | 0.070* | |
| O8w | −0.01007 (15) | 0.80955 (16) | 0.33263 (11) | 0.0542 (5) | |
| H81 | −0.0423 | 0.8616 | 0.3237 | 0.081* | |
| H82 | 0.0404 | 0.8207 | 0.3196 | 0.081* | |
| O9w | 0.5000 | 1.04750 (17) | 0.2500 | 0.0319 (5) | |
| H9 | 0.4536 | 1.0105 | 0.2432 | 0.048* | |
| N1 | 0.30344 (11) | 0.65163 (12) | 0.21958 (9) | 0.0170 (3) | |
| C1 | 0.36250 (14) | 0.82322 (15) | 0.23904 (11) | 0.0221 (4) | |
| C2 | 0.32017 (14) | 0.74543 (15) | 0.17992 (11) | 0.0224 (4) | |
| H2A | 0.2631 | 0.7709 | 0.1504 | 0.027* | |
| H2B | 0.3607 | 0.7322 | 0.1437 | 0.027* | |
| C3 | 0.30488 (14) | 0.56253 (15) | 0.16936 (11) | 0.0227 (4) | |
| H3A | 0.3465 | 0.5742 | 0.1337 | 0.027* | |
| H3B | 0.2445 | 0.5513 | 0.1387 | 0.027* | |
| C4 | 0.33482 (14) | 0.47085 (16) | 0.21844 (11) | 0.0227 (4) | |
| C5 | 0.21789 (13) | 0.65676 (17) | 0.25076 (11) | 0.0224 (4) | |
| H5A | 0.1768 | 0.6045 | 0.2264 | 0.027* | |
| H5B | 0.1888 | 0.7211 | 0.2368 | 0.027* | |
| C6 | 0.23267 (13) | 0.64436 (15) | 0.33827 (11) | 0.0191 (4) |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Cu1 | 0.01981 (13) | 0.02595 (14) | 0.01754 (13) | −0.00436 (9) | 0.00469 (9) | −0.00037 (9) |
| Ti1 | 0.01574 (17) | 0.02177 (18) | 0.01442 (16) | 0.00001 (13) | 0.00386 (12) | 0.00014 (12) |
| O1 | 0.0284 (8) | 0.0214 (7) | 0.0208 (7) | 0.0008 (6) | 0.0002 (6) | −0.0029 (5) |
| O2 | 0.0396 (9) | 0.0210 (8) | 0.0352 (8) | −0.0057 (7) | −0.0017 (7) | 0.0041 (6) |
| O3 | 0.0290 (8) | 0.0202 (7) | 0.0249 (7) | −0.0009 (6) | −0.0005 (6) | 0.0013 (6) |
| O4 | 0.0464 (10) | 0.0203 (8) | 0.0360 (9) | 0.0004 (7) | −0.0019 (7) | −0.0053 (6) |
| O5 | 0.0173 (7) | 0.0438 (9) | 0.0180 (6) | 0.0002 (6) | 0.0042 (5) | 0.0011 (6) |
| O6 | 0.0192 (7) | 0.0363 (8) | 0.0220 (7) | −0.0003 (6) | 0.0070 (5) | 0.0019 (6) |
| O7 | 0.0205 (10) | 0.0325 (11) | 0.0195 (9) | 0.000 | 0.0062 (8) | 0.000 |
| O8 | 0.0249 (8) | 0.0365 (9) | 0.0213 (7) | −0.0015 (7) | 0.0006 (6) | −0.0035 (6) |
| O9 | 0.0281 (8) | 0.0350 (9) | 0.0243 (7) | 0.0051 (7) | 0.0013 (6) | 0.0063 (6) |
| O1w | 0.0247 (8) | 0.0285 (8) | 0.0241 (7) | −0.0044 (6) | 0.0076 (6) | −0.0029 (6) |
| O2w | 0.0535 (11) | 0.0327 (9) | 0.0258 (7) | −0.0203 (8) | 0.0190 (7) | −0.0081 (7) |
| O3w | 0.0266 (8) | 0.0562 (11) | 0.0233 (7) | −0.0132 (8) | 0.0001 (6) | 0.0062 (7) |
| O4w | 0.0268 (8) | 0.0330 (8) | 0.0224 (7) | −0.0010 (6) | 0.0049 (6) | −0.0035 (6) |
| O5w | 0.0370 (9) | 0.0380 (9) | 0.0310 (8) | 0.0004 (7) | 0.0052 (7) | −0.0032 (7) |
| O6w | 0.0345 (9) | 0.0426 (10) | 0.0420 (9) | −0.0011 (8) | 0.0098 (7) | −0.0002 (8) |
| O7w | 0.0379 (10) | 0.0545 (12) | 0.0443 (10) | −0.0041 (9) | −0.0006 (8) | 0.0179 (9) |
| O8w | 0.0553 (13) | 0.0572 (13) | 0.0454 (11) | 0.0194 (10) | −0.0024 (9) | 0.0064 (9) |
| O9w | 0.0229 (11) | 0.0308 (12) | 0.0402 (12) | 0.000 | 0.0008 (9) | 0.000 |
| N1 | 0.0187 (8) | 0.0169 (8) | 0.0159 (7) | −0.0022 (6) | 0.0044 (6) | −0.0008 (6) |
| C1 | 0.0199 (10) | 0.0219 (10) | 0.0247 (9) | −0.0014 (8) | 0.0047 (7) | 0.0007 (8) |
| C2 | 0.0262 (10) | 0.0216 (10) | 0.0186 (9) | −0.0034 (8) | 0.0020 (7) | 0.0043 (8) |
| C3 | 0.0285 (11) | 0.0207 (10) | 0.0183 (9) | 0.0008 (8) | 0.0028 (7) | −0.0030 (7) |
| C4 | 0.0211 (9) | 0.0244 (10) | 0.0233 (9) | 0.0014 (8) | 0.0060 (7) | −0.0022 (8) |
| C5 | 0.0161 (9) | 0.0312 (11) | 0.0198 (9) | 0.0008 (8) | 0.0033 (7) | 0.0006 (8) |
| C6 | 0.0199 (9) | 0.0183 (9) | 0.0200 (9) | −0.0017 (7) | 0.0060 (7) | −0.0010 (7) |
| Cu1—O3w | 1.9308 (16) | O3w—H31 | 0.8399 |
| Cu1—O6 | 1.9639 (14) | O3w—H32 | 0.8400 |
| Cu1—O2w | 1.9862 (15) | O4w—H4w1 | 0.8400 |
| Cu1—O1w | 2.0163 (15) | O4w—H4w2 | 0.8399 |
| Cu1—O4w | 2.2693 (16) | O5w—H51 | 0.8401 |
| Cu1—O5w | 2.4462 (17) | O5w—H52 | 0.8400 |
| Ti1—O7 | 1.8110 (3) | O6w—H61 | 0.8400 |
| Ti1—O9 | 1.8838 (14) | O6w—H62 | 0.8400 |
| Ti1—O8 | 1.8850 (14) | O7w—H71 | 0.8400 |
| Ti1—O5 | 2.0843 (14) | O7w—H72 | 0.8401 |
| Ti1—O3 | 2.0845 (15) | O8w—H81 | 0.8400 |
| Ti1—O1 | 2.1106 (15) | O8w—H82 | 0.8400 |
| Ti1—N1 | 2.2751 (16) | O9w—H9 | 0.8401 |
| O1—C1 | 1.283 (2) | N1—C2 | 1.470 (2) |
| O2—C1 | 1.226 (3) | N1—C3 | 1.475 (2) |
| O3—C4 | 1.287 (2) | N1—C5 | 1.481 (2) |
| O4—C4 | 1.229 (3) | C1—C2 | 1.512 (3) |
| O5—C6 | 1.254 (2) | C2—H2A | 0.9700 |
| O6—C6 | 1.246 (2) | C2—H2B | 0.9700 |
| O7—Ti1i | 1.8110 (3) | C3—C4 | 1.508 (3) |
| O8—O9 | 1.474 (2) | C3—H3A | 0.9700 |
| O1w—H11 | 0.8400 | C3—H3B | 0.9700 |
| O1w—H12 | 0.8401 | C5—C6 | 1.510 (3) |
| O2w—H21 | 0.8400 | C5—H5A | 0.9700 |
| O2w—H22 | 0.8400 | C5—H5B | 0.9700 |
| O3w—Cu1—O6 | 99.30 (6) | Cu1—O2w—H22 | 122.5 |
| O3w—Cu1—O2w | 87.61 (7) | H21—O2w—H22 | 108.5 |
| O6—Cu1—O2w | 173.02 (7) | Cu1—O3w—H31 | 124.0 |
| O3w—Cu1—O1w | 173.18 (7) | Cu1—O3w—H32 | 123.1 |
| O6—Cu1—O1w | 84.30 (6) | H31—O3w—H32 | 108.4 |
| O2w—Cu1—O1w | 88.93 (6) | Cu1—O4w—H4w1 | 114.7 |
| O3w—Cu1—O4w | 97.37 (7) | Cu1—O4w—H4w2 | 110.6 |
| O6—Cu1—O4w | 86.94 (6) | H4w1—O4w—H4w2 | 108.4 |
| O2w—Cu1—O4w | 91.20 (6) | Cu1—O5w—H51 | 113.8 |
| O1w—Cu1—O4w | 88.57 (6) | Cu1—O5w—H52 | 102.6 |
| O3w—Cu1—O5w | 87.46 (7) | H51—O5w—H52 | 108.4 |
| O6—Cu1—O5w | 86.18 (6) | H61—O6w—H62 | 108.4 |
| O2w—Cu1—O5w | 95.19 (6) | H71—O7w—H72 | 108.4 |
| O1w—Cu1—O5w | 87.00 (6) | H81—O8w—H82 | 108.5 |
| O4w—Cu1—O5w | 172.15 (5) | C2—N1—C3 | 112.23 (14) |
| O7—Ti1—O9 | 102.42 (6) | C2—N1—C5 | 111.62 (16) |
| O7—Ti1—O8 | 101.25 (5) | C3—N1—C5 | 111.40 (15) |
| O9—Ti1—O8 | 46.04 (7) | C2—N1—Ti1 | 105.73 (11) |
| O7—Ti1—O5 | 165.95 (4) | C3—N1—Ti1 | 105.83 (11) |
| O9—Ti1—O5 | 90.75 (6) | C5—N1—Ti1 | 109.69 (11) |
| O8—Ti1—O5 | 91.38 (6) | O2—C1—O1 | 125.10 (19) |
| O7—Ti1—O3 | 92.48 (8) | O2—C1—C2 | 118.93 (18) |
| O9—Ti1—O3 | 82.68 (6) | O1—C1—C2 | 115.94 (17) |
| O8—Ti1—O3 | 128.55 (6) | N1—C2—C1 | 110.17 (15) |
| O5—Ti1—O3 | 84.28 (6) | N1—C2—H2A | 109.6 |
| O7—Ti1—O1 | 90.88 (8) | C1—C2—H2A | 109.6 |
| O9—Ti1—O1 | 127.87 (6) | N1—C2—H2B | 109.6 |
| O8—Ti1—O1 | 82.10 (6) | C1—C2—H2B | 109.6 |
| O5—Ti1—O1 | 84.72 (6) | H2A—C2—H2B | 108.1 |
| O3—Ti1—O1 | 147.58 (6) | N1—C3—C4 | 110.31 (15) |
| O7—Ti1—N1 | 89.21 (4) | N1—C3—H3A | 109.6 |
| O9—Ti1—N1 | 154.83 (7) | C4—C3—H3A | 109.6 |
| O8—Ti1—N1 | 153.44 (7) | N1—C3—H3B | 109.6 |
| O5—Ti1—N1 | 76.74 (6) | C4—C3—H3B | 109.6 |
| O3—Ti1—N1 | 74.50 (6) | H3A—C3—H3B | 108.1 |
| O1—Ti1—N1 | 73.32 (6) | O4—C4—O3 | 123.8 (2) |
| C1—O1—Ti1 | 118.67 (13) | O4—C4—C3 | 120.05 (18) |
| C4—O3—Ti1 | 120.00 (13) | O3—C4—C3 | 116.06 (18) |
| C6—O5—Ti1 | 121.52 (12) | N1—C5—C6 | 113.20 (16) |
| C6—O6—Cu1 | 135.58 (13) | N1—C5—H5A | 108.9 |
| Ti1—O7—Ti1i | 176.04 (14) | C6—C5—H5A | 108.9 |
| O9—O8—Ti1 | 66.94 (8) | N1—C5—H5B | 108.9 |
| O8—O9—Ti1 | 67.02 (8) | C6—C5—H5B | 108.9 |
| Cu1—O1w—H11 | 111.0 | H5A—C5—H5B | 107.8 |
| Cu1—O1w—H12 | 108.4 | O6—C6—O5 | 125.48 (17) |
| H11—O1w—H12 | 108.4 | O6—C6—C5 | 115.73 (17) |
| Cu1—O2w—H21 | 128.2 | O5—C6—C5 | 118.79 (17) |
| O7—Ti1—O1—C1 | 60.95 (14) | O1—Ti1—N1—C2 | 34.18 (11) |
| O9—Ti1—O1—C1 | 167.48 (14) | O7—Ti1—N1—C3 | 62.26 (13) |
| O8—Ti1—O1—C1 | 162.18 (15) | O9—Ti1—N1—C3 | −56.2 (2) |
| O5—Ti1—O1—C1 | −105.68 (15) | O8—Ti1—N1—C3 | 176.38 (14) |
| O3—Ti1—O1—C1 | −35.1 (2) | O5—Ti1—N1—C3 | −118.19 (12) |
| N1—Ti1—O1—C1 | −27.96 (14) | O3—Ti1—N1—C3 | −30.53 (11) |
| O7—Ti1—O3—C4 | −67.06 (15) | O1—Ti1—N1—C3 | 153.42 (13) |
| O9—Ti1—O3—C4 | −169.27 (15) | O7—Ti1—N1—C5 | −177.46 (14) |
| O8—Ti1—O3—C4 | −173.57 (14) | O9—Ti1—N1—C5 | 64.1 (2) |
| O5—Ti1—O3—C4 | 99.23 (15) | O8—Ti1—N1—C5 | −63.3 (2) |
| O1—Ti1—O3—C4 | 28.5 (2) | O5—Ti1—N1—C5 | 2.08 (12) |
| N1—Ti1—O3—C4 | 21.43 (14) | O3—Ti1—N1—C5 | 89.74 (13) |
| O7—Ti1—O5—C6 | 0.3 (4) | O1—Ti1—N1—C5 | −86.31 (13) |
| O9—Ti1—O5—C6 | −159.50 (16) | Ti1—O1—C1—O2 | −163.57 (17) |
| O8—Ti1—O5—C6 | 154.45 (16) | Ti1—O1—C1—C2 | 14.5 (2) |
| O3—Ti1—O5—C6 | −76.94 (16) | C3—N1—C2—C1 | −152.71 (16) |
| O1—Ti1—O5—C6 | 72.52 (16) | C5—N1—C2—C1 | 81.41 (19) |
| N1—Ti1—O5—C6 | −1.55 (15) | Ti1—N1—C2—C1 | −37.80 (18) |
| O3w—Cu1—O6—C6 | 21.7 (2) | O2—C1—C2—N1 | −163.33 (19) |
| O1w—Cu1—O6—C6 | −152.5 (2) | O1—C1—C2—N1 | 18.4 (2) |
| O4w—Cu1—O6—C6 | 118.6 (2) | C2—N1—C3—C4 | 151.50 (17) |
| O5w—Cu1—O6—C6 | −65.1 (2) | C5—N1—C3—C4 | −82.5 (2) |
| O7—Ti1—O8—O9 | −96.49 (10) | Ti1—N1—C3—C4 | 36.65 (18) |
| O5—Ti1—O8—O9 | 89.71 (9) | Ti1—O3—C4—O4 | 170.04 (17) |
| O3—Ti1—O8—O9 | 5.92 (11) | Ti1—O3—C4—C3 | −6.4 (2) |
| O1—Ti1—O8—O9 | 174.19 (9) | N1—C3—C4—O4 | 160.50 (19) |
| N1—Ti1—O8—O9 | 152.02 (13) | N1—C3—C4—O3 | −22.9 (2) |
| O7—Ti1—O9—O8 | 93.73 (10) | C2—N1—C5—C6 | −119.28 (18) |
| O5—Ti1—O9—O8 | −91.20 (9) | C3—N1—C5—C6 | 114.39 (18) |
| O3—Ti1—O9—O8 | −175.33 (9) | Ti1—N1—C5—C6 | −2.4 (2) |
| O1—Ti1—O9—O8 | −7.30 (11) | Cu1—O6—C6—O5 | −11.1 (3) |
| N1—Ti1—O9—O8 | −150.44 (14) | Cu1—O6—C6—C5 | 169.07 (15) |
| O7—Ti1—N1—C2 | −56.98 (13) | Ti1—O5—C6—O6 | −179.24 (16) |
| O9—Ti1—N1—C2 | −175.44 (15) | Ti1—O5—C6—C5 | 0.6 (3) |
| O8—Ti1—N1—C2 | 57.15 (19) | N1—C5—C6—O6 | −178.72 (17) |
| O5—Ti1—N1—C2 | 122.57 (13) | N1—C5—C6—O5 | 1.4 (3) |
| O3—Ti1—N1—C2 | −149.77 (13) |
| Symmetry code: (i) −x+1, y, −z+1/2. |
| D—H···A | D—H | H···A | D···A | D—H···A |
| O1w—H11···O6wii | 0.84 | 1.80 | 2.627 (2) | 169 |
| O1w—H12···O9wiii | 0.84 | 1.99 | 2.789 (1) | 159 |
| O2w—H21···O1wii | 0.84 | 1.91 | 2.746 (2) | 173 |
| O2w—H22···O1iv | 0.84 | 1.90 | 2.737 (2) | 174 |
| O3w—H31···O4v | 0.84 | 1.93 | 2.746 (2) | 165 |
| O3w—H32···O4wiv | 0.84 | 1.86 | 2.658 (2) | 158 |
| O4w—H4w1···O8iv | 0.84 | 1.85 | 2.693 (2) | 176 |
| O4w—H4w2···O8w | 0.84 | 1.85 | 2.675 (2) | 169 |
| O5w—H51···O2vi | 0.84 | 2.02 | 2.850 (2) | 168 |
| O5w—H52···O7w | 0.84 | 2.01 | 2.813 (3) | 161 |
| O6w—H61···O5w | 0.84 | 2.02 | 2.797 (2) | 153 |
| O6w—H62···O7wvii | 0.84 | 2.15 | 2.965 (3) | 164 |
| O7w—H71···O3 | 0.84 | 2.38 | 3.195 (2) | 163 |
| O7w—H72···O9viii | 0.84 | 2.07 | 2.900 (2) | 168 |
| O8w—H81···O3ix | 0.84 | 2.06 | 2.890 (2) | 172 |
| O8w—H82···O4x | 0.84 | 2.33 | 3.148 (3) | 164 |
| O9w—H9···O2 | 0.84 | 1.89 | 2.716 (2) | 170 |
| Symmetry codes: (ii) −x, −y+1, −z+1; (iii) x−1/2, y−1/2, z; (iv) −x+1/2, −y+3/2, −z+1; (v) x, −y+1, z+1/2; (vi) −x+1/2, y−1/2, −z+1/2; (vii) −x+1/2, −y+1/2, −z+1; (viii) −x+1, −y+1, −z+1; (ix) x−1/2, y+1/2, z; (x) −x+1/2, y+1/2, −z+1/2. |
Experimental details
| Crystal data | |
| Chemical formula | [Cu2Ti2(C6H6NO6)2O(O2)2(H2O)10]·7H2O |
| Mr | 985.39 |
| Crystal system, space group | Monoclinic, C2/c |
| Temperature (K) | 293 |
| a, b, c (Å) | 14.9312 (10), 13.2892 (9), 17.4449 (10) |
| β (°) | 100.825 (2) |
| V (Å3) | 3399.9 (4) |
| Z | 4 |
| Radiation type | Mo Kα |
| µ (mm−1) | 1.81 |
| Crystal size (mm) | 0.30 × 0.20 × 0.20 |
| Data collection | |
| Diffractometer | Rigaku R-AXIS Spider IP diffractometer |
| Absorption correction | Multi-scan (ABSCOR; Higashi, 1995) |
| Tmin, Tmax | 0.694, 1.000 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 16221, 3894, 3408 |
| Rint | 0.033 |
| (sin θ/λ)max (Å−1) | 0.649 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.026, 0.075, 1.08 |
| No. of reflections | 3894 |
| No. of parameters | 236 |
| H-atom treatment | H-atom parameters constrained |
| Δρmax, Δρmin (e Å−3) | 0.44, −0.31 |
Computer programs: RAPID-AUTO (Rigaku, 2002), CrystalClear (Rigaku/MSC, 2002), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), X-SEED (Barbour, 2001), publCIF (Westrip, 2010).
| D—H···A | D—H | H···A | D···A | D—H···A |
| O1w—H11···O6wi | 0.84 | 1.80 | 2.627 (2) | 169 |
| O1w—H12···O9wii | 0.84 | 1.99 | 2.789 (1) | 159 |
| O2w—H21···O1wi | 0.84 | 1.91 | 2.746 (2) | 173 |
| O2w—H22···O1iii | 0.84 | 1.90 | 2.737 (2) | 174 |
| O3w—H31···O4iv | 0.84 | 1.93 | 2.746 (2) | 165 |
| O3w—H32···O4wiii | 0.84 | 1.86 | 2.658 (2) | 158 |
| O4w—H4w1···O8iii | 0.84 | 1.85 | 2.693 (2) | 176 |
| O4w—H4w2···O8w | 0.84 | 1.85 | 2.675 (2) | 169 |
| O5w—H51···O2v | 0.84 | 2.02 | 2.850 (2) | 168 |
| O5w—H52···O7w | 0.84 | 2.01 | 2.813 (3) | 161 |
| O6w—H61···O5w | 0.84 | 2.02 | 2.797 (2) | 153 |
| O6w—H62···O7wvi | 0.84 | 2.15 | 2.965 (3) | 164 |
| O7w—H71···O3 | 0.84 | 2.38 | 3.195 (2) | 163 |
| O7w—H72···O9vii | 0.84 | 2.07 | 2.900 (2) | 168 |
| O8w—H81···O3viii | 0.84 | 2.06 | 2.890 (2) | 172 |
| O8w—H82···O4ix | 0.84 | 2.33 | 3.148 (3) | 164 |
| O9w—H9···O2 | 0.84 | 1.89 | 2.716 (2) | 170 |
| Symmetry codes: (i) −x, −y+1, −z+1; (ii) x−1/2, y−1/2, z; (iii) −x+1/2, −y+3/2, −z+1; (iv) x, −y+1, z+1/2; (v) −x+1/2, y−1/2, −z+1/2; (vi) −x+1/2, −y+1/2, −z+1; (vii) −x+1, −y+1, −z+1; (viii) x−1/2, y+1/2, z; (ix) −x+1/2, y+1/2, −z+1/2. |
Acknowledgements
We thank the the National Science Foundation of China (No. 20971045-B0103303) and the University of Malaya for supporting this study.
References
Barbour, L. J. (2001). J. Supramol. Chem. 1, 189–191. CrossRef CAS Google Scholar
Higashi, T. (1995). ABSCOR. Rigaku Corporation, Tokyo, Japan. Google Scholar
Rigaku (2002). RAPID-AUTO. Rigaku Corporation, Tokyo, Japan. Google Scholar
Rigaku/MSC (2002). CrystalClear. Rigaku/MSC Inc., The Woodlands, Texas, USA. Google Scholar
Schwarzenbach, D. & Girgis, K. (1975). Helv. Chim. Acta, 58, 2391–2398. CSD CrossRef CAS Web of Science Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Westrip, S. P. (2010). publCIF. In preparation. Google Scholar
Zhou, Z.-H., Hong, Q.-M. & Deng, Y.-F. (2004). Huaxue Xuebao, 62, 2379–2385. CAS Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
; (iii)
; (iv)
; (v)
; (vi)
; (vii)
; (ix)
. ![[Figure 1]](./bt5183fig1thm.gif)



