metal-organic compounds
Chloridotris[μ2-2-(dimethylamino)ethanolato]-μ3-hydroxido-tri-μ2-trifluoroacetato-tetracopper(II) tetrahydrofuran solvate
aNational Center for Physics, Quaid-i-Azam University, Islamabad 45320, Pakistan, bDepartment of Chemistry, Faculty of Science, University of Malaya, Lembah Pantai, 50603-Kuala Lumpur, Malaysia, and cSTaRBURSTT Cyber Instrumentation Consortium, Youngstown State Unversity, Department of Chemistry, One University Plaza, Youngstown, Ohio 44555-3663, USA
*Correspondence e-mail: [email protected], [email protected]
The title compound, [Cu4(C2F3O2)3(C4H10NO)3Cl(OH)]·C4H8O or [Cu4(TFA)3(dmae)3Cl(OH)]·THF (dmae is dimethylaminoethanolate, TFA is trifluoroacetate and THF is tetrahydrofuran), has an approximate molecular threefold symmetry with three equivalent {Cu(dmae)(TFA)} units bridging between a Cu—Cl and a hydroxide unit, with the latter two lying on the molecular threefold axis. However, in the solid state, the tetranuclear complex has Ci symmetry. The Cu atom bonded to the Cl atom has a distorted tetrahedral geometry. The other three Cu atoms have distorted square-pyramidal geometries with an NO4 coordination environment. The bonds within the CuNO3 base of the pyramid range from 1.953 (2) to 2.033 (3) Å, while the apical Cu—O bonds are significantly longer, ranging from 2.286 (2) to 2.377 (2) Å. The square-pyramidal geometries are augmented by weak interactions towards a sixth O atom, forming a highly distorted octahedral coordination environment [long Cu—O distances = 2.712 (2)–2.824 (2) Å]. The hydroxide group is hydrogen bonded to the tetrahydrofuran solvent molecule. One of the –CF3 groups shows minor disorder over two positions, with a refined occupancy ratio of 0.894 (4):0.106 (5).
Related literature
For the synthesis of [Cu(dmae)Cl]4, used as starting material for title compound, see: Anwander et al. (1997
). For general background to copper(II) complexes, see: Coastamagna et al. (1992
). For related structures, see: Tahir et al. (2008
); Shahid et al. (2009
).
Experimental
Crystal data
|
Refinement
|
| |||||||||||||||||
Data collection: APEX2 (Bruker, 2008
); cell refinement: SAINT (Bruker, 2008
); data reduction: SAINT; program(s) used to solve structure: SHELXTL (Sheldrick, 2008
); program(s) used to refine structure: SHELXTL; molecular graphics: Mercury (Macrae et al., 2008
); software used to prepare material for publication: SHELXTL and publCIF (Westrip, 2010
).
Supporting information
contains datablocks I, global. DOI: 10.1107/S1600536810022877/fj2302sup1.cif
Structure factors: contains datablock I. DOI: 10.1107/S1600536810022877/fj2302Isup2.hkl
Tetrameric N,N-dimethylaminoethanolato copper(II) chloride, [Cu(dmae)Cl]4 was prepared according to a literature method (Anwander et al., 1997). The title compound was prepared as follows: 1.25 g (1.67 mmole) of [Cu(dmae)Cl]4 in 20 ml THF were combined with 1.77 g (6.66 mmole) of Cu(F3CCOO)2 in 10 ml THF followed by the addition of 0.297 g (3.33 mmole) N,N-dimethylaminoethanol. The reaction mixture was stirred for 3 h and filtered through a cannula to remove any undissolved species. The filtrate was evaporated to dryness under vacuum, the solid was re-dissolved in 5 ml THF and placed in a vial with rubber seal at room temperature for one week to give blue crystals suitable for single-crystal X-ray Yield: 86% m.p. 393–394 K. Elemental Analysis for Cu4((CH3)2NCH2CH2O)3(F3CCOO)3(OH)Cl % calc: C, 21.99 H, 3.97 N, 4.27, % found: C, 22.10 H, 3.90 N, 4.53.
The fluorine atoms bonded to C14 were refined as disordered over two mutually exclusive positions with a refined occupancy ratio of 0.894 (4) to 0.106 (5). C—F bond distances within this CF3 group were restrained to be the same within a standard uncertaincy of 0.02 Å and ADPs of the minor F atoms were constrained to be identical to those of the major moiety F atom opposite their position.
All hydrogen atoms were added in calculated positions with a C—H bond distances of 0.97 (methylene), 0.96 (methyl) and 1.00 Å (OH). They were refined with isotropic displacement parameteres Uiso of 1.5 (methyl, OH) or 1.2 times Ueq (methylene) of the adjacent carbon or oxygen atom.
Data collection: APEX2 (Bruker, 2008); cell SAINT (Bruker, 2008); data reduction: SAINT (Bruker, 2008); program(s) used to solve structure: SHELXTL (Sheldrick, 2008); program(s) used to refine structure: SHELXTL (Sheldrick, 2008); molecular graphics: Mercury (Macrae et al., 2008); software used to prepare material for publication: SHELXTL (Sheldrick, 2008) and publCIF (Westrip, 2010).
| [Cu4(C2F3O2)3(C4H10NO)3Cl(OH)]·C4H8O | F(000) = 3952 |
| Mr = 982.21 | Dx = 1.838 Mg m−3 |
| Monoclinic, C2/c | Mo Kα radiation, λ = 0.71073 Å |
| Hall symbol: -C 2yc | Cell parameters from 1722 reflections |
| a = 16.4353 (14) Å | θ = 2.4–30.1° |
| b = 12.1893 (12) Å | µ = 2.54 mm−1 |
| c = 35.547 (3) Å | T = 100 K |
| β = 94.678 (2)° | Block, blue |
| V = 7097.7 (11) Å3 | 0.41 × 0.38 × 0.28 mm |
| Z = 8 |
| Bruker SMART APEX CCD diffractometer | 10267 independent reflections |
| Radiation source: fine-focus sealed tube | 7515 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.035 |
| ω scans | θmax = 31.6°, θmin = 1.2° |
| Absorption correction: multi-scan (SADABS; Bruker, 2008) | h = −12→22 |
| Tmin = 0.673, Tmax = 0.746 | k = −15→17 |
| 20465 measured reflections | l = −37→50 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.043 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.103 | H-atom parameters constrained |
| S = 1.01 | w = 1/[σ2(Fo2) + (0.0396P)2 + 12.2423P] where P = (Fo2 + 2Fc2)/3 |
| 10267 reflections | (Δ/σ)max = 0.001 |
| 467 parameters | Δρmax = 0.92 e Å−3 |
| 15 restraints | Δρmin = −0.69 e Å−3 |
| [Cu4(C2F3O2)3(C4H10NO)3Cl(OH)]·C4H8O | V = 7097.7 (11) Å3 |
| Mr = 982.21 | Z = 8 |
| Monoclinic, C2/c | Mo Kα radiation |
| a = 16.4353 (14) Å | µ = 2.54 mm−1 |
| b = 12.1893 (12) Å | T = 100 K |
| c = 35.547 (3) Å | 0.41 × 0.38 × 0.28 mm |
| β = 94.678 (2)° |
| Bruker SMART APEX CCD diffractometer | 10267 independent reflections |
| Absorption correction: multi-scan (SADABS; Bruker, 2008) | 7515 reflections with I > 2σ(I) |
| Tmin = 0.673, Tmax = 0.746 | Rint = 0.035 |
| 20465 measured reflections |
| R[F2 > 2σ(F2)] = 0.043 | 15 restraints |
| wR(F2) = 0.103 | H-atom parameters constrained |
| S = 1.01 | w = 1/[σ2(Fo2) + (0.0396P)2 + 12.2423P] where P = (Fo2 + 2Fc2)/3 |
| 10267 reflections | Δρmax = 0.92 e Å−3 |
| 467 parameters | Δρmin = −0.69 e Å−3 |
Experimental. The fluorine atoms bonded to C14 were refined as disordered over two mutually exclusive positions with a refined occupancy ratio of 0.894 (4) to 0.106 (5). C-f bond distances within this CF3 group were restrained to be the same within a standard uncertaincy of 0.02 Angstrom and ADPs of the minor F atoms were constrained to be identical to those of the major moiety F atom opposite their position. |
Geometry. All e.s.d.'s (except the e.s.d. in the dihedral angle between two l.s. planes) are estimated using the full covariance matrix. The cell e.s.d.'s are taken into account individually in the estimation of e.s.d.'s in distances, angles and torsion angles; correlations between e.s.d.'s in cell parameters are only used when they are defined by crystal symmetry. An approximate (isotropic) treatment of cell e.s.d.'s is used for estimating e.s.d.'s involving l.s. planes. |
Refinement. Refinement of F2 against ALL reflections. The weighted R-factor wR and goodness of fit S are based on F2, conventional R-factors R are based on F, with F set to zero for negative F2. The threshold expression of F2 > σ(F2) is used only for calculating R-factors(gt) etc. and is not relevant to the choice of reflections for refinement. R-factors based on F2 are statistically about twice as large as those based on F, and R- factors based on ALL data will be even larger. |
| x | y | z | Uiso*/Ueq | Occ. (<1) | |
| C1 | 0.3487 (2) | 0.6333 (3) | 0.27202 (8) | 0.0213 (7) | |
| H1A | 0.2955 | 0.6699 | 0.2659 | 0.026* | |
| H1B | 0.3614 | 0.5884 | 0.2500 | 0.026* | |
| C2 | 0.41488 (18) | 0.7186 (3) | 0.28039 (9) | 0.0188 (7) | |
| H2A | 0.4693 | 0.6841 | 0.2796 | 0.023* | |
| H2B | 0.4097 | 0.7771 | 0.2610 | 0.023* | |
| C3 | 0.3331 (2) | 0.8365 (3) | 0.31874 (10) | 0.0253 (8) | |
| H3A | 0.3358 | 0.8958 | 0.3003 | 0.038* | |
| H3B | 0.3303 | 0.8679 | 0.3440 | 0.038* | |
| H3C | 0.2843 | 0.7919 | 0.3123 | 0.038* | |
| C4 | 0.4799 (2) | 0.8341 (3) | 0.32982 (10) | 0.0240 (7) | |
| H4A | 0.4845 | 0.8938 | 0.3117 | 0.036* | |
| H4B | 0.5289 | 0.7881 | 0.3305 | 0.036* | |
| H4C | 0.4745 | 0.8649 | 0.3550 | 0.036* | |
| C5 | 0.16045 (19) | 0.6242 (3) | 0.37865 (9) | 0.0203 (7) | |
| H5A | 0.1270 | 0.6612 | 0.3580 | 0.024* | |
| H5B | 0.1718 | 0.6772 | 0.3995 | 0.024* | |
| C6 | 0.11552 (19) | 0.5262 (3) | 0.39231 (10) | 0.0234 (7) | |
| H6A | 0.0666 | 0.5508 | 0.4045 | 0.028* | |
| H6B | 0.0974 | 0.4787 | 0.3706 | 0.028* | |
| C7 | 0.1697 (2) | 0.5093 (3) | 0.45818 (10) | 0.0283 (8) | |
| H7A | 0.1147 | 0.5027 | 0.4668 | 0.042* | |
| H7B | 0.1853 | 0.5868 | 0.4578 | 0.042* | |
| H7C | 0.2085 | 0.4690 | 0.4754 | 0.042* | |
| C8 | 0.1435 (2) | 0.3471 (3) | 0.42013 (11) | 0.0274 (8) | |
| H8A | 0.0861 | 0.3437 | 0.4256 | 0.041* | |
| H8B | 0.1769 | 0.3067 | 0.4396 | 0.041* | |
| H8C | 0.1498 | 0.3141 | 0.3954 | 0.041* | |
| C9 | 0.24516 (18) | 0.2700 (3) | 0.31588 (9) | 0.0180 (6) | |
| H9A | 0.2240 | 0.2915 | 0.2901 | 0.022* | |
| H9B | 0.2000 | 0.2358 | 0.3285 | 0.022* | |
| C10 | 0.31478 (18) | 0.1882 (3) | 0.31392 (9) | 0.0175 (6) | |
| H10A | 0.3235 | 0.1482 | 0.3381 | 0.021* | |
| H10B | 0.3008 | 0.1341 | 0.2937 | 0.021* | |
| C11 | 0.3849 (2) | 0.2949 (3) | 0.26740 (9) | 0.0238 (7) | |
| H11A | 0.3777 | 0.2355 | 0.2489 | 0.036* | |
| H11B | 0.4350 | 0.3355 | 0.2634 | 0.036* | |
| H11C | 0.3380 | 0.3448 | 0.2644 | 0.036* | |
| C12 | 0.46108 (19) | 0.1720 (3) | 0.31080 (10) | 0.0237 (7) | |
| H12A | 0.4524 | 0.1108 | 0.2930 | 0.036* | |
| H12B | 0.4661 | 0.1437 | 0.3367 | 0.036* | |
| H12C | 0.5112 | 0.2110 | 0.3058 | 0.036* | |
| C13 | 0.37061 (18) | 0.7122 (3) | 0.42640 (9) | 0.0166 (6) | |
| C14 | 0.3775 (2) | 0.8151 (3) | 0.45127 (10) | 0.0294 (8) | |
| C15 | 0.36846 (19) | 0.2779 (3) | 0.42436 (9) | 0.0194 (6) | |
| C16 | 0.3779 (2) | 0.1874 (3) | 0.45482 (10) | 0.0252 (7) | |
| C17 | 0.55106 (18) | 0.4851 (3) | 0.34328 (8) | 0.0157 (6) | |
| C18 | 0.6447 (2) | 0.4702 (3) | 0.34677 (10) | 0.0244 (7) | |
| C19 | 0.5583 (2) | 0.3809 (3) | 0.44361 (11) | 0.0290 (8) | |
| H19A | 0.5641 | 0.3255 | 0.4236 | 0.035* | |
| H19B | 0.5265 | 0.3485 | 0.4633 | 0.035* | |
| C20 | 0.6412 (2) | 0.4186 (4) | 0.46031 (11) | 0.0331 (9) | |
| H20A | 0.6634 | 0.3684 | 0.4805 | 0.040* | |
| H20B | 0.6805 | 0.4245 | 0.4407 | 0.040* | |
| C21 | 0.6219 (2) | 0.5295 (4) | 0.47598 (13) | 0.0426 (11) | |
| H21A | 0.6701 | 0.5785 | 0.4767 | 0.051* | |
| H21B | 0.6036 | 0.5231 | 0.5017 | 0.051* | |
| C22 | 0.5532 (2) | 0.5721 (3) | 0.44827 (11) | 0.0330 (9) | |
| H22A | 0.5109 | 0.6091 | 0.4620 | 0.040* | |
| H22B | 0.5747 | 0.6252 | 0.4305 | 0.040* | |
| Cl1 | 0.13236 (5) | 0.50928 (7) | 0.27516 (2) | 0.02051 (16) | |
| Cu1 | 0.23798 (2) | 0.50916 (3) | 0.317137 (10) | 0.01044 (8) | |
| Cu2 | 0.39464 (2) | 0.63387 (3) | 0.350823 (10) | 0.01304 (8) | |
| Cu3 | 0.28392 (2) | 0.48008 (3) | 0.401847 (10) | 0.01366 (9) | |
| Cu4 | 0.39472 (2) | 0.37149 (3) | 0.343178 (10) | 0.01343 (8) | |
| F1 | 0.38789 (19) | 0.2286 (2) | 0.48959 (7) | 0.0616 (8) | |
| F2 | 0.44062 (16) | 0.1223 (2) | 0.45106 (7) | 0.0499 (7) | |
| F3 | 0.31145 (16) | 0.1262 (2) | 0.45306 (9) | 0.0618 (8) | |
| F4 | 0.45195 (17) | 0.8352 (4) | 0.46438 (13) | 0.0738 (15) | 0.894 (5) |
| F5 | 0.3505 (3) | 0.9028 (2) | 0.43088 (9) | 0.0678 (12) | 0.894 (5) |
| F6 | 0.3305 (2) | 0.8121 (3) | 0.47923 (9) | 0.0526 (10) | 0.894 (5) |
| F4B | 0.418 (2) | 0.8966 (17) | 0.4377 (8) | 0.0526 (10) | 0.106 (5) |
| F5B | 0.3162 (13) | 0.855 (3) | 0.4664 (11) | 0.0738 (15) | 0.106 (5) |
| F6B | 0.420 (2) | 0.788 (2) | 0.4834 (6) | 0.0678 (12) | 0.106 (5) |
| F7 | 0.68329 (13) | 0.5493 (2) | 0.36747 (8) | 0.0452 (7) | |
| F8 | 0.67280 (13) | 0.4751 (2) | 0.31263 (7) | 0.0474 (7) | |
| F9 | 0.66948 (11) | 0.37600 (18) | 0.36251 (6) | 0.0329 (5) | |
| N1 | 0.40701 (15) | 0.7666 (2) | 0.31829 (7) | 0.0158 (5) | |
| N2 | 0.17040 (16) | 0.4632 (2) | 0.41990 (7) | 0.0195 (6) | |
| N3 | 0.39102 (15) | 0.2481 (2) | 0.30606 (7) | 0.0163 (5) | |
| O1 | 0.34445 (12) | 0.56503 (18) | 0.30425 (6) | 0.0159 (4) | |
| O2 | 0.23492 (12) | 0.58621 (18) | 0.36547 (6) | 0.0155 (4) | |
| O3 | 0.27429 (12) | 0.36447 (17) | 0.33646 (6) | 0.0141 (4) | |
| O4 | 0.40721 (13) | 0.72338 (18) | 0.39660 (6) | 0.0187 (5) | |
| O5 | 0.33254 (13) | 0.6340 (2) | 0.43810 (6) | 0.0211 (5) | |
| O6 | 0.32578 (13) | 0.35798 (19) | 0.43373 (6) | 0.0192 (5) | |
| O7 | 0.40130 (13) | 0.25998 (19) | 0.39509 (6) | 0.0189 (5) | |
| O8 | 0.51284 (12) | 0.39551 (19) | 0.34027 (6) | 0.0196 (5) | |
| O9 | 0.52741 (13) | 0.58004 (19) | 0.34305 (7) | 0.0213 (5) | |
| O10 | 0.38614 (12) | 0.49500 (16) | 0.37767 (6) | 0.0122 (4) | |
| H10 | 0.4325 | 0.4905 | 0.3976 | 0.018* | |
| O11 | 0.51928 (15) | 0.4780 (2) | 0.42819 (8) | 0.0318 (6) |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| C1 | 0.0238 (17) | 0.0301 (18) | 0.0103 (14) | −0.0031 (14) | 0.0035 (12) | 0.0015 (13) |
| C2 | 0.0169 (15) | 0.0227 (17) | 0.0180 (15) | 0.0011 (12) | 0.0087 (12) | 0.0044 (13) |
| C3 | 0.0224 (17) | 0.0220 (18) | 0.0321 (19) | 0.0076 (14) | 0.0060 (14) | 0.0069 (15) |
| C4 | 0.0229 (17) | 0.0194 (17) | 0.0296 (18) | −0.0061 (13) | 0.0021 (14) | 0.0040 (14) |
| C5 | 0.0201 (16) | 0.0214 (17) | 0.0199 (15) | 0.0065 (13) | 0.0046 (12) | 0.0013 (13) |
| C6 | 0.0168 (15) | 0.0282 (19) | 0.0250 (17) | 0.0009 (13) | 0.0007 (13) | −0.0003 (14) |
| C7 | 0.0271 (17) | 0.040 (2) | 0.0189 (17) | −0.0023 (16) | 0.0088 (14) | −0.0038 (15) |
| C8 | 0.0244 (18) | 0.028 (2) | 0.0312 (19) | −0.0064 (14) | 0.0074 (15) | 0.0034 (15) |
| C9 | 0.0167 (15) | 0.0161 (15) | 0.0212 (16) | −0.0021 (12) | 0.0008 (12) | −0.0019 (13) |
| C10 | 0.0178 (15) | 0.0175 (16) | 0.0171 (15) | −0.0017 (12) | 0.0009 (12) | −0.0018 (12) |
| C11 | 0.0274 (18) | 0.0251 (18) | 0.0197 (16) | −0.0027 (14) | 0.0075 (14) | −0.0045 (14) |
| C12 | 0.0168 (16) | 0.0243 (18) | 0.0297 (18) | 0.0062 (13) | 0.0010 (13) | −0.0089 (15) |
| C13 | 0.0161 (15) | 0.0173 (15) | 0.0156 (15) | 0.0034 (12) | −0.0033 (12) | −0.0047 (12) |
| C14 | 0.036 (2) | 0.0260 (19) | 0.0273 (19) | −0.0043 (16) | 0.0099 (16) | −0.0086 (16) |
| C15 | 0.0195 (16) | 0.0184 (16) | 0.0197 (16) | −0.0030 (13) | −0.0031 (12) | 0.0024 (13) |
| C16 | 0.035 (2) | 0.0217 (18) | 0.0199 (17) | 0.0028 (15) | 0.0053 (14) | 0.0050 (14) |
| C17 | 0.0125 (13) | 0.0211 (16) | 0.0139 (14) | 0.0018 (12) | 0.0036 (11) | 0.0025 (12) |
| C18 | 0.0166 (15) | 0.0246 (18) | 0.0324 (19) | 0.0038 (13) | 0.0054 (14) | 0.0113 (15) |
| C19 | 0.0284 (19) | 0.029 (2) | 0.0283 (19) | 0.0025 (15) | −0.0032 (15) | 0.0047 (16) |
| C20 | 0.0233 (18) | 0.048 (3) | 0.0270 (19) | 0.0037 (17) | −0.0060 (15) | 0.0058 (18) |
| C21 | 0.032 (2) | 0.049 (3) | 0.044 (3) | −0.0038 (19) | −0.0155 (19) | −0.007 (2) |
| C22 | 0.029 (2) | 0.030 (2) | 0.037 (2) | 0.0000 (16) | −0.0118 (16) | −0.0089 (17) |
| Cl1 | 0.0180 (3) | 0.0238 (4) | 0.0185 (4) | 0.0001 (3) | −0.0054 (3) | 0.0021 (3) |
| Cu1 | 0.01002 (16) | 0.01276 (18) | 0.00839 (16) | −0.00009 (13) | −0.00024 (12) | 0.00033 (13) |
| Cu2 | 0.01405 (18) | 0.01354 (18) | 0.01150 (17) | −0.00088 (14) | 0.00094 (13) | 0.00082 (14) |
| Cu3 | 0.01306 (17) | 0.01724 (19) | 0.01080 (17) | 0.00010 (14) | 0.00167 (13) | 0.00157 (14) |
| Cu4 | 0.01185 (18) | 0.01471 (18) | 0.01367 (17) | 0.00029 (14) | 0.00071 (13) | −0.00261 (14) |
| F1 | 0.115 (2) | 0.0484 (17) | 0.0214 (13) | 0.0182 (16) | 0.0036 (13) | 0.0092 (12) |
| F2 | 0.0589 (17) | 0.0486 (16) | 0.0429 (15) | 0.0237 (13) | 0.0085 (12) | 0.0191 (13) |
| F3 | 0.0555 (17) | 0.0442 (17) | 0.086 (2) | −0.0120 (13) | 0.0071 (15) | 0.0327 (16) |
| F4 | 0.0287 (16) | 0.099 (3) | 0.093 (3) | −0.0140 (17) | 0.0005 (16) | −0.075 (3) |
| F5 | 0.121 (4) | 0.0276 (16) | 0.056 (2) | 0.0143 (18) | 0.012 (2) | −0.0113 (15) |
| F6 | 0.061 (2) | 0.056 (2) | 0.0442 (19) | −0.0053 (16) | 0.0264 (16) | −0.0278 (16) |
| F4B | 0.061 (2) | 0.056 (2) | 0.0442 (19) | −0.0053 (16) | 0.0264 (16) | −0.0278 (16) |
| F5B | 0.0287 (16) | 0.099 (3) | 0.093 (3) | −0.0140 (17) | 0.0005 (16) | −0.075 (3) |
| F6B | 0.121 (4) | 0.0276 (16) | 0.056 (2) | 0.0143 (18) | 0.012 (2) | −0.0113 (15) |
| F7 | 0.0210 (11) | 0.0334 (13) | 0.0787 (19) | −0.0063 (10) | −0.0113 (11) | 0.0017 (13) |
| F8 | 0.0272 (12) | 0.075 (2) | 0.0427 (15) | 0.0169 (12) | 0.0203 (10) | 0.0258 (13) |
| F9 | 0.0180 (10) | 0.0303 (12) | 0.0505 (14) | 0.0051 (8) | 0.0039 (9) | 0.0172 (11) |
| N1 | 0.0137 (12) | 0.0168 (13) | 0.0173 (13) | 0.0012 (10) | 0.0034 (10) | 0.0015 (10) |
| N2 | 0.0181 (13) | 0.0260 (15) | 0.0148 (13) | −0.0005 (11) | 0.0039 (10) | 0.0009 (11) |
| N3 | 0.0154 (12) | 0.0155 (13) | 0.0180 (13) | 0.0011 (10) | 0.0011 (10) | −0.0029 (11) |
| O1 | 0.0160 (11) | 0.0204 (11) | 0.0114 (10) | −0.0034 (9) | 0.0026 (8) | 0.0016 (9) |
| O2 | 0.0151 (10) | 0.0186 (11) | 0.0128 (10) | 0.0018 (9) | 0.0018 (8) | 0.0002 (9) |
| O3 | 0.0128 (10) | 0.0139 (10) | 0.0153 (10) | 0.0000 (8) | −0.0006 (8) | −0.0019 (8) |
| O4 | 0.0204 (11) | 0.0191 (12) | 0.0168 (11) | −0.0024 (9) | 0.0022 (9) | −0.0016 (9) |
| O5 | 0.0227 (12) | 0.0260 (13) | 0.0147 (11) | −0.0046 (10) | 0.0018 (9) | −0.0039 (10) |
| O6 | 0.0211 (12) | 0.0200 (12) | 0.0165 (11) | 0.0013 (9) | 0.0021 (9) | 0.0037 (9) |
| O7 | 0.0222 (11) | 0.0179 (11) | 0.0167 (11) | 0.0023 (9) | 0.0020 (9) | 0.0009 (9) |
| O8 | 0.0138 (11) | 0.0213 (12) | 0.0242 (12) | 0.0000 (9) | 0.0048 (9) | −0.0032 (10) |
| O9 | 0.0155 (11) | 0.0201 (12) | 0.0285 (13) | 0.0027 (9) | 0.0030 (9) | 0.0045 (10) |
| O10 | 0.0122 (9) | 0.0135 (10) | 0.0109 (9) | −0.0005 (8) | 0.0002 (7) | −0.0007 (8) |
| O11 | 0.0296 (14) | 0.0249 (14) | 0.0373 (15) | 0.0007 (11) | −0.0193 (11) | −0.0005 (12) |
| C1—O1 | 1.422 (4) | C14—F6 | 1.308 (4) |
| C1—C2 | 1.516 (5) | C14—F4B | 1.310 (14) |
| C1—H1A | 0.9900 | C14—F6B | 1.333 (15) |
| C1—H1B | 0.9900 | C14—F5 | 1.346 (5) |
| C2—N1 | 1.484 (4) | C15—O7 | 1.230 (4) |
| C2—H2A | 0.9900 | C15—O6 | 1.263 (4) |
| C2—H2B | 0.9900 | C15—C16 | 1.545 (5) |
| C3—N1 | 1.485 (4) | C16—F2 | 1.316 (4) |
| C3—H3A | 0.9800 | C16—F3 | 1.319 (4) |
| C3—H3B | 0.9800 | C16—F1 | 1.332 (4) |
| C3—H3C | 0.9800 | C17—O9 | 1.221 (4) |
| C4—N1 | 1.484 (4) | C17—O8 | 1.260 (4) |
| C4—H4A | 0.9800 | C17—C18 | 1.545 (4) |
| C4—H4B | 0.9800 | C18—F9 | 1.326 (4) |
| C4—H4C | 0.9800 | C18—F8 | 1.334 (4) |
| C5—O2 | 1.423 (3) | C18—F7 | 1.340 (4) |
| C5—C6 | 1.505 (5) | C19—O11 | 1.434 (4) |
| C5—H5A | 0.9900 | C19—C20 | 1.512 (5) |
| C5—H5B | 0.9900 | C19—H19A | 0.9900 |
| C6—N2 | 1.490 (4) | C19—H19B | 0.9900 |
| C6—H6A | 0.9900 | C20—C21 | 1.506 (6) |
| C6—H6B | 0.9900 | C20—H20A | 0.9900 |
| C7—N2 | 1.473 (4) | C20—H20B | 0.9900 |
| C7—H7A | 0.9800 | C21—C22 | 1.528 (5) |
| C7—H7B | 0.9800 | C21—H21A | 0.9900 |
| C7—H7C | 0.9800 | C21—H21B | 0.9900 |
| C8—N2 | 1.483 (4) | C22—O11 | 1.439 (4) |
| C8—H8A | 0.9800 | C22—H22A | 0.9900 |
| C8—H8B | 0.9800 | C22—H22B | 0.9900 |
| C8—H8C | 0.9800 | Cl1—Cu1 | 2.1948 (8) |
| C9—O3 | 1.426 (4) | Cu1—O2 | 1.962 (2) |
| C9—C10 | 1.523 (4) | Cu1—O1 | 1.966 (2) |
| C9—H9A | 0.9900 | Cu1—O3 | 1.968 (2) |
| C9—H9B | 0.9900 | Cu2—O10 | 1.954 (2) |
| C10—N3 | 1.496 (4) | Cu2—O4 | 1.956 (2) |
| C10—H10A | 0.9900 | Cu2—O1 | 1.975 (2) |
| C10—H10B | 0.9900 | Cu2—N1 | 2.009 (3) |
| C11—N3 | 1.484 (4) | Cu2—O9 | 2.317 (2) |
| C11—H11A | 0.9800 | Cu3—O2 | 1.956 (2) |
| C11—H11B | 0.9800 | Cu3—O10 | 1.957 (2) |
| C11—H11C | 0.9800 | Cu3—O6 | 1.961 (2) |
| C12—N3 | 1.478 (4) | Cu3—N2 | 2.032 (3) |
| C12—H12A | 0.9800 | Cu3—O5 | 2.377 (2) |
| C12—H12B | 0.9800 | Cu4—O10 | 1.954 (2) |
| C12—H12C | 0.9800 | Cu4—O8 | 1.974 (2) |
| C13—O5 | 1.231 (4) | Cu4—O3 | 1.976 (2) |
| C13—O4 | 1.267 (4) | Cu4—N3 | 1.998 (3) |
| C13—C14 | 1.533 (5) | Cu4—O7 | 2.287 (2) |
| C14—F5B | 1.278 (15) | O10—H10 | 0.9990 |
| C14—F4 | 1.296 (4) | ||
| O1—C1—C2 | 109.0 (2) | F8—C18—C17 | 109.7 (3) |
| O1—C1—H1A | 109.9 | F7—C18—C17 | 112.5 (3) |
| C2—C1—H1A | 109.9 | O11—C19—C20 | 105.1 (3) |
| O1—C1—H1B | 109.9 | O11—C19—H19A | 110.7 |
| C2—C1—H1B | 109.9 | C20—C19—H19A | 110.7 |
| H1A—C1—H1B | 108.3 | O11—C19—H19B | 110.7 |
| N1—C2—C1 | 109.5 (2) | C20—C19—H19B | 110.7 |
| N1—C2—H2A | 109.8 | H19A—C19—H19B | 108.8 |
| C1—C2—H2A | 109.8 | C21—C20—C19 | 102.0 (3) |
| N1—C2—H2B | 109.8 | C21—C20—H20A | 111.4 |
| C1—C2—H2B | 109.8 | C19—C20—H20A | 111.4 |
| H2A—C2—H2B | 108.2 | C21—C20—H20B | 111.4 |
| N1—C3—H3A | 109.5 | C19—C20—H20B | 111.4 |
| N1—C3—H3B | 109.5 | H20A—C20—H20B | 109.2 |
| H3A—C3—H3B | 109.5 | C20—C21—C22 | 103.5 (3) |
| N1—C3—H3C | 109.5 | C20—C21—H21A | 111.1 |
| H3A—C3—H3C | 109.5 | C22—C21—H21A | 111.1 |
| H3B—C3—H3C | 109.5 | C20—C21—H21B | 111.1 |
| N1—C4—H4A | 109.5 | C22—C21—H21B | 111.1 |
| N1—C4—H4B | 109.5 | H21A—C21—H21B | 109.0 |
| H4A—C4—H4B | 109.5 | O11—C22—C21 | 106.5 (3) |
| N1—C4—H4C | 109.5 | O11—C22—H22A | 110.4 |
| H4A—C4—H4C | 109.5 | C21—C22—H22A | 110.4 |
| H4B—C4—H4C | 109.5 | O11—C22—H22B | 110.4 |
| O2—C5—C6 | 107.8 (3) | C21—C22—H22B | 110.4 |
| O2—C5—H5A | 110.1 | H22A—C22—H22B | 108.6 |
| C6—C5—H5A | 110.1 | O2—Cu1—O1 | 97.18 (9) |
| O2—C5—H5B | 110.1 | O2—Cu1—O3 | 98.75 (9) |
| C6—C5—H5B | 110.1 | O1—Cu1—O3 | 98.13 (9) |
| H5A—C5—H5B | 108.5 | O2—Cu1—Cl1 | 121.31 (6) |
| N2—C6—C5 | 109.6 (3) | O1—Cu1—Cl1 | 120.73 (7) |
| N2—C6—H6A | 109.8 | O3—Cu1—Cl1 | 116.00 (6) |
| C5—C6—H6A | 109.8 | O10—Cu2—O4 | 94.81 (9) |
| N2—C6—H6B | 109.8 | O10—Cu2—O1 | 89.98 (9) |
| C5—C6—H6B | 109.8 | O4—Cu2—O1 | 160.49 (9) |
| H6A—C6—H6B | 108.2 | O10—Cu2—N1 | 173.56 (9) |
| N2—C7—H7A | 109.5 | O4—Cu2—N1 | 91.20 (10) |
| N2—C7—H7B | 109.5 | O1—Cu2—N1 | 85.10 (10) |
| H7A—C7—H7B | 109.5 | O10—Cu2—O9 | 85.32 (8) |
| N2—C7—H7C | 109.5 | O4—Cu2—O9 | 102.75 (9) |
| H7A—C7—H7C | 109.5 | O1—Cu2—O9 | 96.48 (8) |
| H7B—C7—H7C | 109.5 | N1—Cu2—O9 | 91.08 (9) |
| N2—C8—H8A | 109.5 | O2—Cu3—O10 | 88.29 (8) |
| N2—C8—H8B | 109.5 | O2—Cu3—O6 | 172.03 (9) |
| H8A—C8—H8B | 109.5 | O10—Cu3—O6 | 92.93 (9) |
| N2—C8—H8C | 109.5 | O2—Cu3—N2 | 86.38 (10) |
| H8A—C8—H8C | 109.5 | O10—Cu3—N2 | 172.39 (10) |
| H8B—C8—H8C | 109.5 | O6—Cu3—N2 | 91.62 (10) |
| O3—C9—C10 | 109.3 (2) | O2—Cu3—O5 | 86.47 (9) |
| O3—C9—H9A | 109.8 | O10—Cu3—O5 | 84.38 (8) |
| C10—C9—H9A | 109.8 | O6—Cu3—O5 | 101.48 (9) |
| O3—C9—H9B | 109.8 | N2—Cu3—O5 | 100.69 (10) |
| C10—C9—H9B | 109.8 | O10—Cu4—O8 | 92.30 (9) |
| H9A—C9—H9B | 108.3 | O10—Cu4—O3 | 89.22 (8) |
| N3—C10—C9 | 109.5 (3) | O8—Cu4—O3 | 168.40 (9) |
| N3—C10—H10A | 109.8 | O10—Cu4—N3 | 173.88 (9) |
| C9—C10—H10A | 109.8 | O8—Cu4—N3 | 93.10 (10) |
| N3—C10—H10B | 109.8 | O3—Cu4—N3 | 84.91 (9) |
| C9—C10—H10B | 109.8 | O10—Cu4—O7 | 87.29 (8) |
| H10A—C10—H10B | 108.2 | O8—Cu4—O7 | 98.53 (9) |
| N3—C11—H11A | 109.5 | O3—Cu4—O7 | 93.03 (8) |
| N3—C11—H11B | 109.5 | N3—Cu4—O7 | 94.73 (9) |
| H11A—C11—H11B | 109.5 | C4—N1—C2 | 110.0 (2) |
| N3—C11—H11C | 109.5 | C4—N1—C3 | 108.8 (3) |
| H11A—C11—H11C | 109.5 | C2—N1—C3 | 111.6 (2) |
| H11B—C11—H11C | 109.5 | C4—N1—Cu2 | 113.88 (19) |
| N3—C12—H12A | 109.5 | C2—N1—Cu2 | 103.03 (19) |
| N3—C12—H12B | 109.5 | C3—N1—Cu2 | 109.54 (19) |
| H12A—C12—H12B | 109.5 | C7—N2—C8 | 109.5 (3) |
| N3—C12—H12C | 109.5 | C7—N2—C6 | 111.2 (3) |
| H12A—C12—H12C | 109.5 | C8—N2—C6 | 109.3 (3) |
| H12B—C12—H12C | 109.5 | C7—N2—Cu3 | 109.3 (2) |
| O5—C13—O4 | 130.9 (3) | C8—N2—Cu3 | 112.3 (2) |
| O5—C13—C14 | 117.0 (3) | C6—N2—Cu3 | 105.17 (19) |
| O4—C13—C14 | 112.1 (3) | C12—N3—C11 | 109.9 (2) |
| F4—C14—F6 | 109.3 (4) | C12—N3—C10 | 109.2 (3) |
| F5B—C14—F4B | 108 (2) | C11—N3—C10 | 111.5 (2) |
| F5B—C14—F6B | 96 (2) | C12—N3—Cu4 | 114.56 (19) |
| F4B—C14—F6B | 105 (2) | C11—N3—Cu4 | 108.6 (2) |
| F4—C14—F5 | 107.6 (4) | C10—N3—Cu4 | 103.00 (18) |
| F6—C14—F5 | 104.0 (3) | C1—O1—Cu1 | 119.59 (18) |
| F4—C14—C13 | 112.7 (3) | C1—O1—Cu2 | 112.44 (19) |
| F6—C14—C13 | 113.2 (3) | Cu1—O1—Cu2 | 105.70 (9) |
| F4B—C14—C13 | 115.1 (10) | C5—O2—Cu3 | 108.43 (17) |
| F6B—C14—C13 | 107.4 (12) | C5—O2—Cu1 | 121.87 (18) |
| F5—C14—C13 | 109.4 (3) | Cu3—O2—Cu1 | 102.93 (10) |
| O7—C15—O6 | 130.7 (3) | C9—O3—Cu1 | 117.73 (17) |
| O7—C15—C16 | 116.1 (3) | C9—O3—Cu4 | 112.83 (17) |
| O6—C15—C16 | 113.2 (3) | Cu1—O3—Cu4 | 106.00 (10) |
| F2—C16—F3 | 107.9 (3) | C13—O4—Cu2 | 127.6 (2) |
| F2—C16—F1 | 106.5 (3) | C13—O5—Cu3 | 125.9 (2) |
| F3—C16—F1 | 107.2 (3) | C15—O6—Cu3 | 127.6 (2) |
| F2—C16—C15 | 113.2 (3) | C15—O7—Cu4 | 125.6 (2) |
| F3—C16—C15 | 109.6 (3) | C17—O8—Cu4 | 127.6 (2) |
| F1—C16—C15 | 112.2 (3) | C17—O9—Cu2 | 124.8 (2) |
| O9—C17—O8 | 131.7 (3) | Cu2—O10—Cu4 | 110.45 (10) |
| O9—C17—C18 | 115.2 (3) | Cu2—O10—Cu3 | 113.15 (10) |
| O8—C17—C18 | 113.1 (3) | Cu4—O10—Cu3 | 108.20 (9) |
| F9—C18—F8 | 107.8 (3) | Cu2—O10—H10 | 108.2 |
| F9—C18—F7 | 106.0 (3) | Cu4—O10—H10 | 108.3 |
| F8—C18—F7 | 106.5 (3) | Cu3—O10—H10 | 108.4 |
| F9—C18—C17 | 113.9 (3) | C19—O11—C22 | 109.0 (3) |
| O1—C1—C2—N1 | −45.7 (3) | O10—Cu3—O2—C5 | −165.02 (19) |
| O2—C5—C6—N2 | 52.7 (3) | N2—Cu3—O2—C5 | 20.4 (2) |
| O3—C9—C10—N3 | −42.2 (3) | O5—Cu3—O2—C5 | −80.55 (19) |
| O5—C13—C14—F5B | −46 (3) | O10—Cu3—O2—Cu1 | 64.62 (9) |
| O4—C13—C14—F5B | 135 (3) | N2—Cu3—O2—Cu1 | −109.95 (11) |
| O5—C13—C14—F4 | 114.5 (4) | O5—Cu3—O2—Cu1 | 149.09 (9) |
| O4—C13—C14—F4 | −64.8 (5) | O1—Cu1—O2—C5 | 146.6 (2) |
| O5—C13—C14—F6 | −10.3 (5) | O3—Cu1—O2—C5 | −113.9 (2) |
| O4—C13—C14—F6 | 170.4 (3) | Cl1—Cu1—O2—C5 | 13.8 (2) |
| O5—C13—C14—F4B | −179.5 (19) | O1—Cu1—O2—Cu3 | −91.71 (10) |
| O4—C13—C14—F4B | 1.2 (19) | O3—Cu1—O2—Cu3 | 7.71 (10) |
| O5—C13—C14—F6B | 63.9 (19) | Cl1—Cu1—O2—Cu3 | 135.49 (6) |
| O4—C13—C14—F6B | −115.4 (19) | C10—C9—O3—Cu1 | 138.4 (2) |
| O5—C13—C14—F5 | −125.8 (4) | C10—C9—O3—Cu4 | 14.3 (3) |
| O4—C13—C14—F5 | 54.9 (4) | O2—Cu1—O3—C9 | 146.95 (19) |
| O7—C15—C16—F2 | 21.6 (4) | O1—Cu1—O3—C9 | −114.43 (19) |
| O6—C15—C16—F2 | −160.1 (3) | Cl1—Cu1—O3—C9 | 15.7 (2) |
| O7—C15—C16—F3 | −98.9 (4) | O2—Cu1—O3—Cu4 | −85.68 (10) |
| O6—C15—C16—F3 | 79.5 (4) | O1—Cu1—O3—Cu4 | 12.93 (11) |
| O7—C15—C16—F1 | 142.1 (3) | Cl1—Cu1—O3—Cu4 | 143.02 (6) |
| O6—C15—C16—F1 | −39.5 (4) | O10—Cu4—O3—C9 | −171.33 (19) |
| O9—C17—C18—F9 | 153.1 (3) | O8—Cu4—O3—C9 | 91.0 (5) |
| O8—C17—C18—F9 | −28.5 (4) | N3—Cu4—O3—C9 | 10.4 (2) |
| O9—C17—C18—F8 | −86.0 (4) | O7—Cu4—O3—C9 | −84.08 (19) |
| O8—C17—C18—F8 | 92.4 (3) | O10—Cu4—O3—Cu1 | 58.43 (10) |
| O9—C17—C18—F7 | 32.4 (4) | O8—Cu4—O3—Cu1 | −39.2 (5) |
| O8—C17—C18—F7 | −149.2 (3) | N3—Cu4—O3—Cu1 | −119.84 (11) |
| O11—C19—C20—C21 | 36.9 (4) | O7—Cu4—O3—Cu1 | 145.67 (9) |
| C19—C20—C21—C22 | −33.5 (4) | O5—C13—O4—Cu2 | 17.2 (5) |
| C20—C21—C22—O11 | 19.0 (4) | C14—C13—O4—Cu2 | −163.6 (2) |
| C1—C2—N1—C4 | 169.3 (3) | O10—Cu2—O4—C13 | −39.4 (3) |
| C1—C2—N1—C3 | −69.9 (3) | O1—Cu2—O4—C13 | 64.3 (4) |
| C1—C2—N1—Cu2 | 47.6 (3) | N1—Cu2—O4—C13 | 142.9 (3) |
| O4—Cu2—N1—C4 | 51.0 (2) | O9—Cu2—O4—C13 | −125.7 (3) |
| O1—Cu2—N1—C4 | −148.2 (2) | O4—C13—O5—Cu3 | −15.7 (5) |
| O9—Cu2—N1—C4 | −51.8 (2) | C14—C13—O5—Cu3 | 165.1 (2) |
| O4—Cu2—N1—C2 | 170.02 (17) | O2—Cu3—O5—C13 | −51.2 (3) |
| O1—Cu2—N1—C2 | −29.17 (17) | O10—Cu3—O5—C13 | 37.4 (3) |
| O9—Cu2—N1—C2 | 67.24 (17) | O6—Cu3—O5—C13 | 129.2 (3) |
| O4—Cu2—N1—C3 | −71.1 (2) | N2—Cu3—O5—C13 | −136.9 (3) |
| O1—Cu2—N1—C3 | 89.7 (2) | O7—C15—O6—Cu3 | 8.0 (5) |
| O9—Cu2—N1—C3 | −173.9 (2) | C16—C15—O6—Cu3 | −170.1 (2) |
| C5—C6—N2—C7 | 84.5 (3) | O10—Cu3—O6—C15 | −41.7 (3) |
| C5—C6—N2—C8 | −154.5 (3) | N2—Cu3—O6—C15 | 132.2 (3) |
| C5—C6—N2—Cu3 | −33.7 (3) | O5—Cu3—O6—C15 | −126.6 (3) |
| O2—Cu3—N2—C7 | −111.5 (2) | O6—C15—O7—Cu4 | −1.2 (5) |
| O6—Cu3—N2—C7 | 76.2 (2) | C16—C15—O7—Cu4 | 176.9 (2) |
| O5—Cu3—N2—C7 | −25.8 (2) | O10—Cu4—O7—C15 | 30.6 (3) |
| O2—Cu3—N2—C8 | 126.7 (2) | O8—Cu4—O7—C15 | 122.6 (3) |
| O6—Cu3—N2—C8 | −45.5 (2) | O3—Cu4—O7—C15 | −58.4 (3) |
| O5—Cu3—N2—C8 | −147.5 (2) | N3—Cu4—O7—C15 | −143.6 (3) |
| O2—Cu3—N2—C6 | 7.9 (2) | O9—C17—O8—Cu4 | −12.4 (5) |
| O6—Cu3—N2—C6 | −164.4 (2) | C18—C17—O8—Cu4 | 169.5 (2) |
| O5—Cu3—N2—C6 | 93.6 (2) | O10—Cu4—O8—C17 | −30.2 (3) |
| C9—C10—N3—C12 | 170.1 (3) | O3—Cu4—O8—C17 | 67.2 (6) |
| C9—C10—N3—C11 | −68.2 (3) | N3—Cu4—O8—C17 | 146.9 (3) |
| C9—C10—N3—Cu4 | 48.0 (3) | O7—Cu4—O8—C17 | −117.8 (3) |
| O8—Cu4—N3—C12 | 41.2 (2) | O8—C17—O9—Cu2 | 15.4 (5) |
| O3—Cu4—N3—C12 | −150.3 (2) | C18—C17—O9—Cu2 | −166.5 (2) |
| O7—Cu4—N3—C12 | −57.7 (2) | O10—Cu2—O9—C17 | 24.9 (3) |
| O8—Cu4—N3—C11 | −82.1 (2) | O4—Cu2—O9—C17 | 118.8 (3) |
| O3—Cu4—N3—C11 | 86.44 (19) | O1—Cu2—O9—C17 | −64.6 (3) |
| O7—Cu4—N3—C11 | 179.06 (19) | N1—Cu2—O9—C17 | −149.8 (3) |
| O8—Cu4—N3—C10 | 159.62 (18) | O4—Cu2—O10—Cu4 | −168.32 (10) |
| O3—Cu4—N3—C10 | −31.84 (18) | O1—Cu2—O10—Cu4 | 30.61 (10) |
| O7—Cu4—N3—C10 | 60.78 (18) | O9—Cu2—O10—Cu4 | −65.89 (10) |
| C2—C1—O1—Cu1 | 144.4 (2) | O4—Cu2—O10—Cu3 | 70.20 (11) |
| C2—C1—O1—Cu2 | 19.6 (3) | O1—Cu2—O10—Cu3 | −90.86 (11) |
| O2—Cu1—O1—C1 | −115.4 (2) | O9—Cu2—O10—Cu3 | 172.64 (11) |
| O3—Cu1—O1—C1 | 144.7 (2) | O8—Cu4—O10—Cu2 | 72.73 (11) |
| Cl1—Cu1—O1—C1 | 17.8 (2) | O3—Cu4—O10—Cu2 | −95.76 (10) |
| O2—Cu1—O1—Cu2 | 12.61 (11) | O7—Cu4—O10—Cu2 | 171.17 (10) |
| O3—Cu1—O1—Cu2 | −87.35 (10) | O8—Cu4—O10—Cu3 | −162.91 (10) |
| Cl1—Cu1—O1—Cu2 | 145.78 (6) | O3—Cu4—O10—Cu3 | 28.60 (10) |
| O10—Cu2—O1—C1 | −170.14 (19) | O7—Cu4—O10—Cu3 | −64.47 (10) |
| O4—Cu2—O1—C1 | 85.4 (3) | O2—Cu3—O10—Cu2 | 23.58 (11) |
| N1—Cu2—O1—C1 | 5.7 (2) | O6—Cu3—O10—Cu2 | −164.31 (11) |
| O9—Cu2—O1—C1 | −84.9 (2) | O5—Cu3—O10—Cu2 | −63.05 (10) |
| O10—Cu2—O1—Cu1 | 57.71 (10) | O2—Cu3—O10—Cu4 | −99.15 (10) |
| O4—Cu2—O1—Cu1 | −46.8 (3) | O6—Cu3—O10—Cu4 | 72.97 (11) |
| N1—Cu2—O1—Cu1 | −126.46 (11) | O5—Cu3—O10—Cu4 | 174.22 (10) |
| O9—Cu2—O1—Cu1 | 143.00 (10) | C20—C19—O11—C22 | −25.9 (4) |
| C6—C5—O2—Cu3 | −44.1 (3) | C21—C22—O11—C19 | 4.2 (4) |
| C6—C5—O2—Cu1 | 74.9 (3) |
Experimental details
| Crystal data | |
| Chemical formula | [Cu4(C2F3O2)3(C4H10NO)3Cl(OH)]·C4H8O |
| Mr | 982.21 |
| Crystal system, space group | Monoclinic, C2/c |
| Temperature (K) | 100 |
| a, b, c (Å) | 16.4353 (14), 12.1893 (12), 35.547 (3) |
| β (°) | 94.678 (2) |
| V (Å3) | 7097.7 (11) |
| Z | 8 |
| Radiation type | Mo Kα |
| µ (mm−1) | 2.54 |
| Crystal size (mm) | 0.41 × 0.38 × 0.28 |
| Data collection | |
| Diffractometer | Bruker SMART APEX CCD diffractometer |
| Absorption correction | Multi-scan (SADABS; Bruker, 2008) |
| Tmin, Tmax | 0.673, 0.746 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 20465, 10267, 7515 |
| Rint | 0.035 |
| (sin θ/λ)max (Å−1) | 0.737 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.043, 0.103, 1.01 |
| No. of reflections | 10267 |
| No. of parameters | 467 |
| No. of restraints | 15 |
| H-atom treatment | H-atom parameters constrained |
| w = 1/[σ2(Fo2) + (0.0396P)2 + 12.2423P] where P = (Fo2 + 2Fc2)/3 | |
| Δρmax, Δρmin (e Å−3) | 0.92, −0.69 |
Computer programs: APEX2 (Bruker, 2008), SAINT (Bruker, 2008), SHELXTL (Sheldrick, 2008), Mercury (Macrae et al., 2008), SHELXTL (Sheldrick, 2008) and publCIF (Westrip, 2010).
Acknowledgements
The authors are grateful to the Higher Education Commission of Pakistan for financial support. The diffractometer was funded by NSF grant 0087210, by Ohio Board of Regents grant CAP-491, and by YSU.
References
Anwander, R., Munck, F. C., Priermeier, T., Scherer, W., Runte, O. & Herrmann, W. A. (1997). Inorg. Chem. 36, 3545–3552. CSD CrossRef PubMed CAS Web of Science Google Scholar
Bruker (2008). APEX2, SAINT and SADABS. Bruker AXS Inc, Madison, Wisconsin, USA. Google Scholar
Coastamagna, J., Vargas, J., Latorre, R. & Alvarado, A. (1992). Coord. Chem. Rev. 119, 67–88. Google Scholar
Macrae, C. F., Bruno, I. J., Chisholm, J. A., Edgington, P. R., McCabe, P., Pidcock, E., Rodriguez-Monge, L., Taylor, R., van de Streek, J. & Wood, P. A. (2008). J. Appl. Cryst. 41, 466–470. Web of Science CrossRef CAS IUCr Journals Google Scholar
Shahid, M., Mazhar, M., Zeller, M. & Hunter, A. D. (2009). Acta Cryst. E65, m345–m346. Web of Science CSD CrossRef IUCr Journals Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Tahir, A. A., Hamid, M., Mazhar, M., Zeller, M., Hunter, A. D., Nadeem, M. & Akhtar, M. J. (2008). Dalton Trans. pp. 1224–1232. Web of Science CSD CrossRef Google Scholar
Westrip, S. P. (2010). J. Appl. Cryst. 43. Submitted. Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
![[Figure 1]](./fj2302fig1thm.gif)
![[Figure 2]](./fj2302fig2thm.gif)




In recent years, there has been a considerable interest towards the synthesis of copper complexes; these complexes are extensively used in catalysis, enzymatic reactions, magnetism and molecular architecture (Coastamagna, Vargas et al., 1992). The present work is a continuation of earlier studies for the preparation and structure eludication of copper (II) complexes (Shahid et al., 2009). The motivation behind the synthesis of the title compound was to use it as a starting material for the synthesis of single source precursors for the deposition of thin films of copper oxides using aerosol assisted chemical vapor deposition (AACVD). We present here the synthesis and crystal structure of the title compound, [Cu4((CH3)2NCH2CH2O)3(F3CCOO)3(OH)Cl] or [Cu4(dmae)3(TFA)3(OH)Cl] (dmae = dimethylaminoethanolate, TFA = trifluoroacetate), which crystallized from THF as the mono solvate with the THF molecule tightly hydrogen bonded to the hydroxyl group.
The title compound has a slightly distorted molecular three fold symmetry with three equivalent Cu(dmae)(TFA) units bridging via their alcoholate oxygen atoms between a Cu—Cl and an hydroxyl unit with the latter two lying on a molecular pseudo threefold axis. The Cu atom bonded to the chlorine has a distorted tetrahedral geometry. The other three copper atoms have distorted square pyramidal geometries with a CNO4 coordination environment from the dmae O and N atoms, the hydroxyl O atom and two TFA anions. The TFA anions are bridging between two neighboring copper ions with one of the oxygen atoms being part of the base of the pyramid of one copper ion, and the other being in the apical position of the neighboring copper ion. The bonds within the CuNO3 bases of the pyramids are strong and quite similar in length with distances between 1.953 (2) and 2.033 (3) Å. The apical Cu—O bonds are significantly longer and between 2.286 (2) and 2.377 (2) Å, thus rendering the µ2-bridge of the TFA ions asymmetric. The square pyramidal geometries are augmented by weak interactions towards a fifth oxygen atom to form a highly distorted octahedral coordination environment (Cu—O distances: O3—Cu3 = 2.712 (2), O2—Cu2 = 2.780 (2), O1—Cu4 = 2.8240 (2) Å).
A similar motif as in the title compound was previously observed for two mixed metal copper-titanium complexes (Tahir et al., 2008). In these complexes the TFA anions were replaced by benzoate or 2-methyl-benzoate ligands, and the Cu—Cl unit was replaced by a titanium atom, which in turn was bonded to another larger Cu—Ti cluster. The [Cu3(dmae)3(TFA)3(OH)] unit in the title compound and the [Cu3((CH3)2NCH2CH2O)3(O2C—C6H5R)3(OH)] units in the Cu—Ti complexes (R = H, Me) are quite similar. In the 2-methyl-benzoate complexes the [Cu3((CH3)2NCH2CH2O)3(O2C—C6H5Me)3(OH)] unit is located on an actual crystallographic three fold axis. The carboxylate anions show coordination modes differing slightly from those observed in the title compound with some of the oxygen atoms being detached from the copper ions and interactions to the fifth oxygen atom, which are very weak in the title compound, being strengthened instead. The overall coordination environment - distorted square pyramidal CNO4 geometries with an additional weak interaction towards a fifth oxygen atom - is however the same in all three compounds, which shows the idiosyncracy commonly observed for copper(II) to form strongly distorted and highly flexible octahedral geometries with a set of four strong bonds in a square planar arrangement and two apical ligands at variable distances. Individual ligand atoms in these kinds of complexes can easily switch from tightly bound to only weakly coordinated as long as the overall coordination environment of the metal center is retained, and energy differences and activation barriers between the different arrangements that can be achieved that way are quite small. The difference in bonding arrangement in the three complexes in the solid state does thus probably not translate into a different chemical nature for the three complexes as the bonding environment around Cu(II) is very flexible and it can be assumed that in solution (i.e. upon release of packing effects) all complexes will attain the same connectivity pattern.
In the title compound the hydroxyl group is O—H···O hydrogen bonded to a tetrahydrofuran molecule (Table 1), which is embedded in a bowl shaped cleft of the complex formed by the three TFA ligands. No such host–guest behavior was observed for the other two related compounds (Tahir et al., 2008).