metal-organic compounds
Chloridomethylphenyl(quinoline-2-carboxylato-κ2N,O)tin(IV)
aDepartment of Chemistry, General Campus, Shahid Beheshti University, Tehran 1983963113, Iran, and bDepartment of Chemistry, University of Malaya, 50603 Kuala Lumpur, Malaysia
*Correspondence e-mail: [email protected]
The Sn atom in the title compound, [Sn(CH3)(C6H5)(C10H6NO2)Cl], shows a distorted C2SnNOCl trigonal-bipyramidal coordination; the apical sites are occupied by the N and Cl atoms.
Experimental
Crystal data
|
Refinement
|
| |||||||||||||||||||
Data collection: APEX2 (Bruker, 2009
); cell refinement: SAINT (Bruker, 2009
); data reduction: SAINT; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: X-SEED (Barbour, 2001
); software used to prepare material for publication: publCIF (Westrip, 2010
).
Supporting information
contains datablocks global, I. DOI: https://doi.org/10.1107/S1600536810027595/bt5296sup1.cif
Structure factors: contains datablock I. DOI: https://doi.org/10.1107/S1600536810027595/bt5296Isup2.hkl
Sodium quinoline-2-carboxylate was synthesized by reacting sodium hydroxide and quinoline-2-carboxylic acid in toluene in a Dean-Start apparatus. The compound (0.20 g, 1 mmol) was then stirred with methylphenyltin dichloride (0.35 g, 1 mmol) in toluene; no heat was applied. The precipitate that formed was recrystallized from methanol.
Hydrogen atoms were placed in calculated positions (C–H 0.95–0.98 Å) and were included in the in the riding model approximation, with U(H) set to 1.2–1.5Ueq(C).
The final difference Fourier map had a peak (1.741eÅ-3) at 0.78 Å from Sn1.
The tin atom in chlorodimethyl(quinoline-2-carboxylate)tin shows cis-C2SnNOCl trigonal bipyramidal coordination, with the C2Sn skeleton being bent at 131.8 (2) ° (Wang et al., 2007). Replacing one of the methyl groups by a bulkier phenyl group in the title analog (Scheme I, Fig. 1) leads to only a marginal opening of the angle 138.6 (1) °; the trans angle is also marginally increased.
For chloridodimethyl(quinoline-2-carboxylato)tin, see: Wang et al. (2007).
Data collection: APEX2 (Bruker, 2009); cell SAINT (Bruker, 2009); data reduction: SAINT (Bruker, 2009); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: X-SEED (Barbour, 2001); software used to prepare material for publication: publCIF (Westrip, 2010).
| Fig. 1. Anisotropic displacement ellipsoid plot (Barbour, 2001) of SnCl(CH3)(C6H5)(C10H6NO2) at the 70% probability level. Hydrogen atoms are drawn as spheres of arbitrary radius. |
| [Sn(CH3)(C6H5)(C10H6NO2)Cl] | F(000) = 824 |
| Mr = 418.43 | Dx = 1.757 Mg m−3 |
| Monoclinic, P21/n | Mo Kα radiation, λ = 0.71073 Å |
| Hall symbol: -P 2yn | Cell parameters from 9943 reflections |
| a = 10.6942 (5) Å | θ = 2.4–28.3° |
| b = 13.1463 (6) Å | µ = 1.79 mm−1 |
| c = 11.2733 (5) Å | T = 100 K |
| β = 93.689 (1)° | Prism, colorless |
| V = 1581.6 (1) Å3 | 0.30 × 0.20 × 0.10 mm |
| Z = 4 |
| Bruker SMART APEX diffractometer | 3613 independent reflections |
| Radiation source: fine-focus sealed tube | 3433 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.039 |
| ω scans | θmax = 27.5°, θmin = 2.4° |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | h = −13→12 |
| Tmin = 0.616, Tmax = 0.841 | k = −17→17 |
| 14187 measured reflections | l = −14→14 |
| Refinement on F2 | Secondary atom site location: difference Fourier map |
| Least-squares matrix: full | Hydrogen site location: inferred from neighbouring sites |
| R[F2 > 2σ(F2)] = 0.035 | H-atom parameters constrained |
| wR(F2) = 0.096 | w = 1/[σ2(Fo2) + (0.0523P)2 + 0.1663P] where P = (Fo2 + 2Fc2)/3 |
| S = 1.40 | (Δ/σ)max = 0.001 |
| 3613 reflections | Δρmax = 1.74 e Å−3 |
| 201 parameters | Δρmin = −0.94 e Å−3 |
| 0 restraints | Extinction correction: SHELXL97 (Sheldrick, 2008), Fc*=kFc[1+0.001xFc2λ3/sin(2θ)]-1/4 |
| Primary atom site location: structure-invariant direct methods | Extinction coefficient: 0.0280 (15) |
| [Sn(CH3)(C6H5)(C10H6NO2)Cl] | V = 1581.6 (1) Å3 |
| Mr = 418.43 | Z = 4 |
| Monoclinic, P21/n | Mo Kα radiation |
| a = 10.6942 (5) Å | µ = 1.79 mm−1 |
| b = 13.1463 (6) Å | T = 100 K |
| c = 11.2733 (5) Å | 0.30 × 0.20 × 0.10 mm |
| β = 93.689 (1)° |
| Bruker SMART APEX diffractometer | 3613 independent reflections |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | 3433 reflections with I > 2σ(I) |
| Tmin = 0.616, Tmax = 0.841 | Rint = 0.039 |
| 14187 measured reflections |
| R[F2 > 2σ(F2)] = 0.035 | 0 restraints |
| wR(F2) = 0.096 | H-atom parameters constrained |
| S = 1.40 | Δρmax = 1.74 e Å−3 |
| 3613 reflections | Δρmin = −0.94 e Å−3 |
| 201 parameters |
| x | y | z | Uiso*/Ueq | ||
| Sn1 | 0.813061 (14) | 0.776948 (11) | 0.733408 (14) | 0.01396 (11) | |
| Cl1 | 1.02998 (6) | 0.75394 (6) | 0.68330 (7) | 0.02452 (16) | |
| O1 | 0.77940 (15) | 0.62981 (12) | 0.67664 (15) | 0.0176 (3) | |
| O2 | 0.64876 (17) | 0.49885 (13) | 0.64587 (16) | 0.0217 (4) | |
| C1 | 0.8465 (3) | 0.77556 (17) | 0.9205 (3) | 0.0226 (6) | |
| H1A | 0.7742 | 0.8046 | 0.9575 | 0.034* | |
| H1B | 0.9213 | 0.8160 | 0.9428 | 0.034* | |
| H1C | 0.8596 | 0.7054 | 0.9479 | 0.034* | |
| C2 | 0.7644 (2) | 0.88296 (16) | 0.59620 (19) | 0.0139 (4) | |
| C3 | 0.6502 (2) | 0.87698 (17) | 0.52921 (19) | 0.0161 (4) | |
| H3 | 0.5931 | 0.8236 | 0.5435 | 0.019* | |
| C4 | 0.6195 (2) | 0.94912 (19) | 0.4413 (2) | 0.0193 (5) | |
| H4 | 0.5427 | 0.9438 | 0.3945 | 0.023* | |
| C5 | 0.7010 (2) | 1.02855 (18) | 0.4224 (2) | 0.0203 (5) | |
| H5 | 0.6785 | 1.0791 | 0.3647 | 0.024* | |
| C6 | 0.8157 (2) | 1.03451 (17) | 0.4877 (2) | 0.0197 (5) | |
| H6 | 0.8719 | 1.0887 | 0.4742 | 0.024* | |
| C7 | 0.8479 (2) | 0.96066 (17) | 0.5731 (2) | 0.0167 (4) | |
| H7 | 0.9274 | 0.9634 | 0.6158 | 0.020* | |
| C8 | 0.6698 (2) | 0.58635 (18) | 0.6779 (2) | 0.0163 (4) | |
| C9 | 0.5661 (2) | 0.65049 (17) | 0.72434 (19) | 0.0146 (4) | |
| C10 | 0.4453 (2) | 0.61082 (18) | 0.7341 (2) | 0.0178 (4) | |
| H10 | 0.4255 | 0.5435 | 0.7089 | 0.021* | |
| C11 | 0.3567 (2) | 0.67171 (19) | 0.7810 (2) | 0.0187 (5) | |
| H11 | 0.2747 | 0.6462 | 0.7898 | 0.022* | |
| C12 | 0.3874 (3) | 0.77218 (16) | 0.8162 (2) | 0.0158 (5) | |
| C13 | 0.3008 (2) | 0.83899 (19) | 0.8662 (2) | 0.0193 (5) | |
| H13 | 0.2194 | 0.8153 | 0.8813 | 0.023* | |
| C14 | 0.3339 (2) | 0.9378 (2) | 0.8929 (2) | 0.0207 (5) | |
| H14 | 0.2759 | 0.9819 | 0.9271 | 0.025* | |
| C15 | 0.4546 (2) | 0.97368 (18) | 0.86940 (19) | 0.0186 (5) | |
| H15 | 0.4754 | 1.0429 | 0.8845 | 0.022* | |
| C16 | 0.5418 (2) | 0.91036 (18) | 0.82531 (19) | 0.0172 (4) | |
| H16 | 0.6234 | 0.9351 | 0.8126 | 0.021* | |
| C17 | 0.5105 (2) | 0.80846 (18) | 0.79870 (19) | 0.0140 (4) | |
| N1 | 0.5977 (2) | 0.74461 (18) | 0.75477 (18) | 0.0139 (4) |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Sn1 | 0.01151 (15) | 0.01373 (15) | 0.01635 (15) | −0.00098 (4) | −0.00142 (8) | 0.00397 (4) |
| Cl1 | 0.0122 (3) | 0.0219 (3) | 0.0395 (4) | 0.0004 (3) | 0.0017 (2) | 0.0078 (3) |
| O1 | 0.0146 (8) | 0.0141 (8) | 0.0244 (9) | −0.0003 (6) | 0.0028 (6) | −0.0009 (6) |
| O2 | 0.0208 (9) | 0.0156 (8) | 0.0286 (9) | −0.0014 (7) | 0.0008 (7) | −0.0046 (7) |
| C1 | 0.0274 (15) | 0.0217 (13) | 0.0179 (13) | −0.0011 (9) | −0.0052 (11) | 0.0035 (8) |
| C2 | 0.0152 (10) | 0.0134 (10) | 0.0133 (9) | 0.0019 (8) | 0.0027 (8) | 0.0011 (8) |
| C3 | 0.0148 (11) | 0.0176 (11) | 0.0162 (10) | 0.0009 (8) | 0.0020 (8) | −0.0006 (8) |
| C4 | 0.0192 (11) | 0.0236 (12) | 0.0152 (10) | 0.0072 (9) | 0.0004 (8) | −0.0009 (9) |
| C5 | 0.0302 (13) | 0.0177 (12) | 0.0134 (10) | 0.0090 (10) | 0.0054 (9) | 0.0024 (8) |
| C6 | 0.0268 (12) | 0.0135 (10) | 0.0198 (11) | 0.0006 (9) | 0.0088 (9) | 0.0020 (8) |
| C7 | 0.0179 (11) | 0.0145 (10) | 0.0178 (10) | −0.0005 (8) | 0.0021 (8) | −0.0007 (8) |
| C8 | 0.0174 (11) | 0.0164 (11) | 0.0151 (10) | −0.0006 (8) | 0.0011 (8) | 0.0020 (8) |
| C9 | 0.0139 (11) | 0.0154 (11) | 0.0142 (10) | −0.0005 (8) | −0.0007 (8) | 0.0022 (8) |
| C10 | 0.0166 (11) | 0.0143 (10) | 0.0223 (11) | −0.0033 (8) | −0.0002 (9) | 0.0030 (8) |
| C11 | 0.0142 (11) | 0.0196 (12) | 0.0223 (11) | −0.0028 (9) | 0.0013 (9) | 0.0067 (9) |
| C12 | 0.0133 (12) | 0.0207 (13) | 0.0135 (11) | 0.0010 (8) | 0.0012 (9) | 0.0060 (7) |
| C13 | 0.0170 (11) | 0.0253 (12) | 0.0157 (10) | 0.0016 (9) | 0.0022 (8) | 0.0041 (8) |
| C14 | 0.0218 (12) | 0.0257 (13) | 0.0146 (10) | 0.0059 (10) | 0.0011 (9) | 0.0002 (9) |
| C15 | 0.0245 (12) | 0.0174 (11) | 0.0135 (10) | 0.0005 (9) | −0.0023 (9) | −0.0012 (8) |
| C16 | 0.0193 (11) | 0.0176 (11) | 0.0147 (10) | −0.0016 (8) | −0.0002 (8) | 0.0017 (8) |
| C17 | 0.0144 (11) | 0.0163 (11) | 0.0113 (9) | −0.0004 (9) | 0.0001 (8) | 0.0029 (8) |
| N1 | 0.0136 (10) | 0.0142 (9) | 0.0139 (9) | −0.0009 (8) | 0.0001 (7) | 0.0025 (8) |
| Sn1—C1 | 2.117 (3) | C7—H7 | 0.9500 |
| Sn1—C2 | 2.122 (2) | C8—C9 | 1.513 (3) |
| Sn1—N1 | 2.369 (2) | C9—N1 | 1.322 (3) |
| Sn1—O1 | 2.062 (2) | C9—C10 | 1.404 (3) |
| Sn1—Cl1 | 2.4414 (7) | C10—C11 | 1.373 (3) |
| O1—C8 | 1.305 (3) | C10—H10 | 0.9500 |
| O2—C8 | 1.222 (3) | C11—C12 | 1.412 (4) |
| C1—H1A | 0.9800 | C11—H11 | 0.9500 |
| C1—H1B | 0.9800 | C12—C13 | 1.420 (3) |
| C1—H1C | 0.9800 | C12—C17 | 1.426 (3) |
| C2—C7 | 1.392 (3) | C13—C14 | 1.375 (4) |
| C2—C3 | 1.397 (3) | C13—H13 | 0.9500 |
| C3—C4 | 1.395 (3) | C14—C15 | 1.415 (4) |
| C3—H3 | 0.9500 | C14—H14 | 0.9500 |
| C4—C5 | 1.385 (4) | C15—C16 | 1.367 (3) |
| C4—H4 | 0.9500 | C15—H15 | 0.9500 |
| C5—C6 | 1.392 (4) | C16—C17 | 1.408 (3) |
| C5—H5 | 0.9500 | C16—H16 | 0.9500 |
| C6—C7 | 1.394 (3) | C17—N1 | 1.371 (3) |
| C6—H6 | 0.9500 | ||
| O1—Sn1—C1 | 108.43 (8) | C6—C7—H7 | 119.8 |
| O1—Sn1—C2 | 111.11 (7) | O2—C8—O1 | 123.9 (2) |
| C1—Sn1—C2 | 138.58 (9) | O2—C8—C9 | 120.1 (2) |
| O1—Sn1—N1 | 73.25 (7) | O1—C8—C9 | 116.0 (2) |
| C1—Sn1—N1 | 90.02 (10) | N1—C9—C10 | 123.3 (2) |
| C2—Sn1—N1 | 89.86 (8) | N1—C9—C8 | 115.5 (2) |
| O1—Sn1—Cl1 | 87.79 (5) | C10—C9—C8 | 121.2 (2) |
| C1—Sn1—Cl1 | 97.31 (9) | C11—C10—C9 | 118.4 (2) |
| C2—Sn1—Cl1 | 96.02 (6) | C11—C10—H10 | 120.8 |
| N1—Sn1—Cl1 | 161.00 (7) | C9—C10—H10 | 120.8 |
| C8—O1—Sn1 | 123.13 (14) | C10—C11—C12 | 120.0 (2) |
| Sn1—C1—H1A | 109.5 | C10—C11—H11 | 120.0 |
| Sn1—C1—H1B | 109.5 | C12—C11—H11 | 120.0 |
| H1A—C1—H1B | 109.5 | C11—C12—C13 | 123.0 (2) |
| Sn1—C1—H1C | 109.5 | C11—C12—C17 | 118.3 (2) |
| H1A—C1—H1C | 109.5 | C13—C12—C17 | 118.7 (2) |
| H1B—C1—H1C | 109.5 | C14—C13—C12 | 120.4 (2) |
| C7—C2—C3 | 119.3 (2) | C14—C13—H13 | 119.8 |
| C7—C2—Sn1 | 119.21 (16) | C12—C13—H13 | 119.8 |
| C3—C2—Sn1 | 121.48 (16) | C13—C14—C15 | 120.0 (2) |
| C4—C3—C2 | 120.2 (2) | C13—C14—H14 | 120.0 |
| C4—C3—H3 | 119.9 | C15—C14—H14 | 120.0 |
| C2—C3—H3 | 119.9 | C16—C15—C14 | 121.1 (2) |
| C5—C4—C3 | 120.0 (2) | C16—C15—H15 | 119.4 |
| C5—C4—H4 | 120.0 | C14—C15—H15 | 119.4 |
| C3—C4—H4 | 120.0 | C15—C16—C17 | 119.9 (2) |
| C4—C5—C6 | 120.2 (2) | C15—C16—H16 | 120.1 |
| C4—C5—H5 | 119.9 | C17—C16—H16 | 120.1 |
| C6—C5—H5 | 119.9 | N1—C17—C16 | 120.1 (2) |
| C5—C6—C7 | 119.7 (2) | N1—C17—C12 | 120.1 (2) |
| C5—C6—H6 | 120.1 | C16—C17—C12 | 119.8 (2) |
| C7—C6—H6 | 120.1 | C9—N1—C17 | 119.9 (2) |
| C2—C7—C6 | 120.5 (2) | C9—N1—Sn1 | 112.07 (16) |
| C2—C7—H7 | 119.8 | C17—N1—Sn1 | 127.97 (17) |
| C1—Sn1—O1—C8 | 83.29 (19) | C10—C11—C12—C13 | −179.5 (2) |
| C2—Sn1—O1—C8 | −84.14 (18) | C10—C11—C12—C17 | 1.6 (4) |
| N1—Sn1—O1—C8 | −0.97 (16) | C11—C12—C13—C14 | −176.5 (2) |
| Cl1—Sn1—O1—C8 | −179.74 (16) | C17—C12—C13—C14 | 2.4 (3) |
| O1—Sn1—C2—C7 | −133.04 (16) | C12—C13—C14—C15 | 0.7 (3) |
| C1—Sn1—C2—C7 | 65.2 (2) | C13—C14—C15—C16 | −3.0 (3) |
| N1—Sn1—C2—C7 | 155.02 (17) | C14—C15—C16—C17 | 2.2 (3) |
| Cl1—Sn1—C2—C7 | −43.08 (17) | C15—C16—C17—N1 | −179.8 (2) |
| O1—Sn1—C2—C3 | 47.46 (19) | C15—C16—C17—C12 | 1.0 (3) |
| C1—Sn1—C2—C3 | −114.4 (2) | C11—C12—C17—N1 | −3.5 (3) |
| N1—Sn1—C2—C3 | −24.49 (18) | C13—C12—C17—N1 | 177.5 (2) |
| Cl1—Sn1—C2—C3 | 137.41 (17) | C11—C12—C17—C16 | 175.8 (2) |
| C7—C2—C3—C4 | −1.0 (3) | C13—C12—C17—C16 | −3.2 (3) |
| Sn1—C2—C3—C4 | 178.55 (16) | C10—C9—N1—C17 | 0.2 (3) |
| C2—C3—C4—C5 | −1.7 (3) | C8—C9—N1—C17 | −179.51 (19) |
| C3—C4—C5—C6 | 2.5 (3) | C10—C9—N1—Sn1 | 176.98 (17) |
| C4—C5—C6—C7 | −0.5 (3) | C8—C9—N1—Sn1 | −2.7 (2) |
| C3—C2—C7—C6 | 2.9 (3) | C16—C17—N1—C9 | −176.6 (2) |
| Sn1—C2—C7—C6 | −176.62 (17) | C12—C17—N1—C9 | 2.6 (3) |
| C5—C6—C7—C2 | −2.2 (3) | C16—C17—N1—Sn1 | 7.2 (3) |
| Sn1—O1—C8—O2 | −179.09 (17) | C12—C17—N1—Sn1 | −173.62 (16) |
| Sn1—O1—C8—C9 | −0.1 (3) | O1—Sn1—N1—C9 | 2.05 (15) |
| O2—C8—C9—N1 | −178.9 (2) | C1—Sn1—N1—C9 | −107.22 (17) |
| O1—C8—C9—N1 | 2.1 (3) | C2—Sn1—N1—C9 | 114.19 (16) |
| O2—C8—C9—C10 | 1.4 (3) | Cl1—Sn1—N1—C9 | 5.8 (3) |
| O1—C8—C9—C10 | −177.6 (2) | O1—Sn1—N1—C17 | 178.5 (2) |
| N1—C9—C10—C11 | −2.1 (3) | C1—Sn1—N1—C17 | 69.2 (2) |
| C8—C9—C10—C11 | 177.6 (2) | C2—Sn1—N1—C17 | −69.4 (2) |
| C9—C10—C11—C12 | 1.1 (4) | Cl1—Sn1—N1—C17 | −177.71 (13) |
Experimental details
| Crystal data | |
| Chemical formula | [Sn(CH3)(C6H5)(C10H6NO2)Cl] |
| Mr | 418.43 |
| Crystal system, space group | Monoclinic, P21/n |
| Temperature (K) | 100 |
| a, b, c (Å) | 10.6942 (5), 13.1463 (6), 11.2733 (5) |
| β (°) | 93.689 (1) |
| V (Å3) | 1581.6 (1) |
| Z | 4 |
| Radiation type | Mo Kα |
| µ (mm−1) | 1.79 |
| Crystal size (mm) | 0.30 × 0.20 × 0.10 |
| Data collection | |
| Diffractometer | Bruker SMART APEX diffractometer |
| Absorption correction | Multi-scan (SADABS; Sheldrick, 1996) |
| Tmin, Tmax | 0.616, 0.841 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 14187, 3613, 3433 |
| Rint | 0.039 |
| (sin θ/λ)max (Å−1) | 0.650 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.035, 0.096, 1.40 |
| No. of reflections | 3613 |
| No. of parameters | 201 |
| H-atom treatment | H-atom parameters constrained |
| Δρmax, Δρmin (e Å−3) | 1.74, −0.94 |
Computer programs: APEX2 (Bruker, 2009), SAINT (Bruker, 2009), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), X-SEED (Barbour, 2001), publCIF (Westrip, 2010).
| Sn1—C1 | 2.117 (3) | Sn1—O1 | 2.062 (2) |
| Sn1—C2 | 2.122 (2) | Sn1—Cl1 | 2.4414 (7) |
| Sn1—N1 | 2.369 (2) | ||
| C1—Sn1—C2 | 138.58 (9) |
Acknowledgements
We thank Shahid Beheshti University and the University of Malaya for supporting this study.
References
Barbour, L. J. (2001). J. Supramol. Chem. 1, 189–191. CrossRef CAS Google Scholar
Bruker (2009). APEX2 and SAINT. Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
Sheldrick, G. M. (1996). SADABS. University of Göttingen, Germany. Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Wang, H., Yin, H. & Wang, D. (2007). Acta Cryst. E63, m3059. Web of Science CSD CrossRef IUCr Journals Google Scholar
Westrip, S. P. (2010). J. Appl. Cryst. 43, 920–925. Web of Science CrossRef CAS IUCr Journals Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
![[Figure 1]](./bt5296fig1thm.gif)




The tin atom in chlorodimethyl(quinoline-2-carboxylate)tin shows cis-C2SnNOCl trigonal bipyramidal coordination, with the C2Sn skeleton being bent at 131.8 (2) ° (Wang et al., 2007). Replacing one of the methyl groups by a bulkier phenyl group in the title analog (Scheme I, Fig. 1) leads to only a marginal opening of the angle 138.6 (1) °; the trans angle is also marginally increased.