metal-organic compounds
8-Hydroxy-2-methylquinolinium diiodido(2-methylquinolin-8-olato-κ2N,O)zincate(II) methanol monosolvate
aDepartment of Chemistry, General Campus, Shahid Beheshti University, Tehran 1983963113, Iran, and bDepartment of Chemistry, University of Malaya, 50603 Kuala Lumpur, Malaysia
*Correspondence e-mail: [email protected]
The anion of the title salt, (C10H10NO)[Zn(C10H8NO)I2]·CH3OH, has its metal atom N,O-chelated by the deprotonated 2-methyl-8-hydroxyquinoline ligand. The hydroxy unit of the cation is a hydrogen-bond donor to the alkoxide O atom of the tetrahedrally coordinated anion, whereas the ammonium cation acts as a hydrogen-bond donor to the methanolic O atom. In the crystal, adjacent ion pairs and solvent molecules are linked by a methanol–halogen O—H⋯I hydrogen bond, generating a chain running along the a axis.
Experimental
Crystal data
|
Refinement
|
| |||||||||||||||||||||||||||
Data collection: APEX2 (Bruker, 2009
); cell refinement: SAINT (Bruker, 2009
); data reduction: SAINT; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: X-SEED (Barbour, 2001
); software used to prepare material for publication: publCIF (Westrip, 2010
).
Supporting information
contains datablocks global, I. DOI: 10.1107/S1600536810036718/bt5355sup1.cif
Structure factors: contains datablock I. DOI: 10.1107/S1600536810036718/bt5355Isup2.hkl
Zinc iodide (0.24 g, 0.75 mmol) and 2-methyl-8-hydroxyquinoline (0.24 g, 1.5 mmol) were loaded into a convection tube; the tube was filled with dry methanol and kept at 333 K. Crystals were collected from the side arm after several days.
Hydrogen atoms were placed in calculated positions (C–H 0.93–0.96, N–H 0.86 and O–H 0.82 Å) and were included in the in the riding model approximation, with U(H) set to 1.2–1.5Ueq(C,N,O).
Data collection: APEX2 (Bruker, 2009); cell SAINT (Bruker, 2009); data reduction: SAINT (Bruker, 2009); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: X-SEED (Barbour, 2001); software used to prepare material for publication: publCIF (Westrip, 2010).
| Fig. 1. Anisotropic displacement ellipsoid plot (Barbour, 2001) of the title compound at the 50% probability level. Hydrogen atoms are drawn as spheres of arbitrary radius. |
| (C10H10NO)[Zn(C10H8NO)I2]·CH4O | F(000) = 1288 |
| Mr = 669.58 | Dx = 1.884 Mg m−3 |
| Monoclinic, P21/n | Mo Kα radiation, λ = 0.71073 Å |
| Hall symbol: -P 2yn | Cell parameters from 6864 reflections |
| a = 10.1745 (6) Å | θ = 2.5–25.1° |
| b = 14.6292 (9) Å | µ = 3.68 mm−1 |
| c = 16.5321 (10) Å | T = 295 K |
| β = 106.356 (1)° | Triangular block, yellow |
| V = 2361.1 (2) Å3 | 0.35 × 0.25 × 0.15 mm |
| Z = 4 |
| Bruker SMART APEX diffractometer | 5404 independent reflections |
| Radiation source: fine-focus sealed tube | 4049 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.031 |
| ω scans | θmax = 27.5°, θmin = 1.9° |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | h = −13→13 |
| Tmin = 0.359, Tmax = 0.608 | k = −19→19 |
| 21863 measured reflections | l = −21→18 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.031 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.090 | H-atom parameters constrained |
| S = 1.06 | w = 1/[σ2(Fo2) + (0.0352P)2 + 2.9232P] where P = (Fo2 + 2Fc2)/3 |
| 5404 reflections | (Δ/σ)max = 0.001 |
| 267 parameters | Δρmax = 0.73 e Å−3 |
| 0 restraints | Δρmin = −0.78 e Å−3 |
| (C10H10NO)[Zn(C10H8NO)I2]·CH4O | V = 2361.1 (2) Å3 |
| Mr = 669.58 | Z = 4 |
| Monoclinic, P21/n | Mo Kα radiation |
| a = 10.1745 (6) Å | µ = 3.68 mm−1 |
| b = 14.6292 (9) Å | T = 295 K |
| c = 16.5321 (10) Å | 0.35 × 0.25 × 0.15 mm |
| β = 106.356 (1)° |
| Bruker SMART APEX diffractometer | 5404 independent reflections |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | 4049 reflections with I > 2σ(I) |
| Tmin = 0.359, Tmax = 0.608 | Rint = 0.031 |
| 21863 measured reflections |
| R[F2 > 2σ(F2)] = 0.031 | 0 restraints |
| wR(F2) = 0.090 | H-atom parameters constrained |
| S = 1.06 | Δρmax = 0.73 e Å−3 |
| 5404 reflections | Δρmin = −0.78 e Å−3 |
| 267 parameters |
| x | y | z | Uiso*/Ueq | ||
| I1 | 0.99864 (3) | 0.22364 (2) | 0.185681 (19) | 0.05940 (11) | |
| I2 | 1.12403 (4) | 0.50224 (2) | 0.22894 (2) | 0.06773 (12) | |
| Zn1 | 0.98601 (5) | 0.37087 (4) | 0.26758 (3) | 0.04947 (13) | |
| O1 | 0.7946 (3) | 0.4058 (2) | 0.25987 (17) | 0.0590 (8) | |
| O2 | 0.5880 (3) | 0.3620 (2) | 0.13701 (17) | 0.0575 (8) | |
| H2 | 0.6556 | 0.3798 | 0.1736 | 0.086* | |
| O3 | 0.3218 (4) | 0.2893 (5) | 0.1583 (3) | 0.132 (2) | |
| H3 | 0.2424 | 0.3008 | 0.1573 | 0.198* | |
| N1 | 1.0064 (3) | 0.3664 (2) | 0.39435 (19) | 0.0421 (7) | |
| N2 | 0.3603 (3) | 0.3482 (2) | 0.0082 (2) | 0.0464 (8) | |
| H2N | 0.3620 | 0.3346 | 0.0591 | 0.056* | |
| C1 | 0.8857 (4) | 0.3933 (3) | 0.4085 (2) | 0.0439 (9) | |
| C2 | 0.7747 (4) | 0.4140 (3) | 0.3364 (2) | 0.0491 (10) | |
| C3 | 0.6530 (5) | 0.4435 (3) | 0.3495 (3) | 0.0585 (11) | |
| H3a | 0.5794 | 0.4587 | 0.3036 | 0.070* | |
| C4 | 0.6399 (5) | 0.4505 (4) | 0.4314 (3) | 0.0675 (13) | |
| H4 | 0.5568 | 0.4699 | 0.4386 | 0.081* | |
| C5 | 0.7444 (5) | 0.4301 (3) | 0.5007 (3) | 0.0639 (13) | |
| H5 | 0.7325 | 0.4350 | 0.5543 | 0.077* | |
| C6 | 0.8711 (5) | 0.4016 (3) | 0.4906 (3) | 0.0507 (10) | |
| C7 | 0.9878 (5) | 0.3799 (3) | 0.5575 (3) | 0.0611 (13) | |
| H7 | 0.9831 | 0.3834 | 0.6128 | 0.073* | |
| C8 | 1.1066 (5) | 0.3541 (3) | 0.5424 (3) | 0.0585 (12) | |
| H8 | 1.1828 | 0.3407 | 0.5872 | 0.070* | |
| C9 | 1.1151 (4) | 0.3477 (3) | 0.4589 (2) | 0.0481 (9) | |
| C10 | 1.2444 (5) | 0.3205 (3) | 0.4395 (3) | 0.0625 (12) | |
| H10A | 1.2797 | 0.3717 | 0.4159 | 0.094* | |
| H10B | 1.2260 | 0.2710 | 0.3998 | 0.094* | |
| H10C | 1.3107 | 0.3014 | 0.4904 | 0.094* | |
| C11 | 0.4800 (4) | 0.3758 (3) | −0.0072 (2) | 0.0423 (8) | |
| C12 | 0.6010 (4) | 0.3837 (3) | 0.0609 (2) | 0.0445 (9) | |
| C13 | 0.7190 (4) | 0.4124 (3) | 0.0438 (3) | 0.0487 (9) | |
| H13 | 0.7998 | 0.4173 | 0.0873 | 0.058* | |
| C14 | 0.7184 (5) | 0.4343 (3) | −0.0388 (3) | 0.0558 (11) | |
| H14 | 0.7991 | 0.4541 | −0.0488 | 0.067* | |
| C15 | 0.6026 (5) | 0.4273 (3) | −0.1051 (3) | 0.0548 (11) | |
| H15 | 0.6049 | 0.4417 | −0.1594 | 0.066* | |
| C16 | 0.4804 (4) | 0.3981 (3) | −0.0899 (2) | 0.0461 (9) | |
| C17 | 0.3539 (5) | 0.3907 (3) | −0.1537 (3) | 0.0564 (11) | |
| H17 | 0.3501 | 0.4049 | −0.2091 | 0.068* | |
| C18 | 0.2383 (5) | 0.3632 (3) | −0.1349 (3) | 0.0571 (11) | |
| H18 | 0.1564 | 0.3588 | −0.1776 | 0.069* | |
| C19 | 0.2415 (4) | 0.3414 (3) | −0.0518 (3) | 0.0542 (11) | |
| C20 | 0.1160 (5) | 0.3133 (4) | −0.0273 (4) | 0.0782 (16) | |
| H20A | 0.1130 | 0.3455 | 0.0227 | 0.117* | |
| H20B | 0.1189 | 0.2487 | −0.0168 | 0.117* | |
| H20C | 0.0358 | 0.3277 | −0.0723 | 0.117* | |
| C21 | 0.3972 (6) | 0.2771 (4) | 0.2385 (3) | 0.0768 (15) | |
| H21A | 0.4920 | 0.2717 | 0.2404 | 0.115* | |
| H21B | 0.3680 | 0.2224 | 0.2605 | 0.115* | |
| H21C | 0.3853 | 0.3286 | 0.2718 | 0.115* |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| I1 | 0.06369 (19) | 0.0647 (2) | 0.04850 (17) | −0.01375 (14) | 0.01360 (13) | −0.00404 (13) |
| I2 | 0.0790 (2) | 0.0597 (2) | 0.0736 (2) | −0.00371 (16) | 0.03639 (18) | 0.00974 (15) |
| Zn1 | 0.0457 (3) | 0.0681 (3) | 0.0332 (2) | −0.0018 (2) | 0.00879 (19) | 0.0042 (2) |
| O1 | 0.0437 (16) | 0.099 (2) | 0.0323 (14) | 0.0011 (16) | 0.0070 (12) | 0.0026 (15) |
| O2 | 0.0492 (17) | 0.085 (2) | 0.0346 (15) | −0.0055 (16) | 0.0053 (12) | 0.0056 (15) |
| O3 | 0.058 (2) | 0.279 (7) | 0.061 (3) | 0.008 (3) | 0.022 (2) | 0.046 (3) |
| N1 | 0.0462 (18) | 0.0456 (18) | 0.0308 (15) | −0.0052 (14) | 0.0046 (13) | 0.0035 (13) |
| N2 | 0.0467 (19) | 0.0472 (19) | 0.0412 (18) | 0.0031 (15) | 0.0057 (15) | 0.0036 (15) |
| C1 | 0.052 (2) | 0.045 (2) | 0.0345 (19) | −0.0133 (17) | 0.0110 (17) | 0.0016 (16) |
| C2 | 0.048 (2) | 0.061 (3) | 0.039 (2) | −0.0094 (19) | 0.0128 (18) | 0.0015 (18) |
| C3 | 0.054 (3) | 0.067 (3) | 0.055 (3) | −0.003 (2) | 0.016 (2) | 0.003 (2) |
| C4 | 0.063 (3) | 0.079 (3) | 0.070 (3) | −0.005 (3) | 0.034 (3) | −0.011 (3) |
| C5 | 0.083 (4) | 0.067 (3) | 0.051 (3) | −0.012 (3) | 0.034 (3) | −0.006 (2) |
| C6 | 0.070 (3) | 0.045 (2) | 0.038 (2) | −0.013 (2) | 0.018 (2) | 0.0007 (17) |
| C7 | 0.092 (4) | 0.060 (3) | 0.030 (2) | −0.016 (3) | 0.015 (2) | 0.0013 (19) |
| C8 | 0.075 (3) | 0.054 (3) | 0.036 (2) | −0.005 (2) | −0.001 (2) | 0.0066 (19) |
| C9 | 0.057 (2) | 0.043 (2) | 0.039 (2) | −0.0060 (18) | 0.0048 (18) | 0.0027 (17) |
| C10 | 0.060 (3) | 0.065 (3) | 0.052 (3) | 0.003 (2) | 0.000 (2) | 0.003 (2) |
| C11 | 0.047 (2) | 0.038 (2) | 0.040 (2) | 0.0055 (16) | 0.0097 (17) | −0.0019 (16) |
| C12 | 0.049 (2) | 0.048 (2) | 0.036 (2) | 0.0058 (17) | 0.0106 (17) | 0.0007 (16) |
| C13 | 0.042 (2) | 0.057 (2) | 0.044 (2) | 0.0040 (18) | 0.0080 (17) | −0.0008 (19) |
| C14 | 0.056 (3) | 0.059 (3) | 0.057 (3) | 0.003 (2) | 0.024 (2) | −0.001 (2) |
| C15 | 0.066 (3) | 0.059 (3) | 0.043 (2) | 0.010 (2) | 0.019 (2) | 0.0031 (19) |
| C16 | 0.055 (2) | 0.044 (2) | 0.038 (2) | 0.0074 (18) | 0.0093 (18) | −0.0044 (16) |
| C17 | 0.069 (3) | 0.058 (3) | 0.036 (2) | 0.009 (2) | 0.005 (2) | −0.0038 (19) |
| C18 | 0.053 (3) | 0.063 (3) | 0.047 (2) | 0.004 (2) | −0.001 (2) | −0.006 (2) |
| C19 | 0.049 (2) | 0.051 (2) | 0.054 (3) | 0.0018 (19) | 0.000 (2) | 0.001 (2) |
| C20 | 0.050 (3) | 0.098 (4) | 0.079 (4) | −0.011 (3) | 0.006 (3) | 0.014 (3) |
| C21 | 0.078 (4) | 0.085 (4) | 0.069 (3) | 0.002 (3) | 0.022 (3) | 0.023 (3) |
| I1—Zn1 | 2.5665 (6) | C8—H8 | 0.9300 |
| I2—Zn1 | 2.5649 (6) | C9—C10 | 1.493 (6) |
| Zn1—O1 | 1.982 (3) | C10—H10A | 0.9600 |
| Zn1—N1 | 2.048 (3) | C10—H10B | 0.9600 |
| O1—C2 | 1.341 (5) | C10—H10C | 0.9600 |
| O2—C12 | 1.340 (5) | C11—C16 | 1.407 (5) |
| O2—H2 | 0.8200 | C11—C12 | 1.419 (5) |
| O3—C21 | 1.343 (6) | C12—C13 | 1.375 (6) |
| O3—H3 | 0.8200 | C13—C14 | 1.400 (6) |
| N1—C9 | 1.331 (5) | C13—H13 | 0.9300 |
| N1—C1 | 1.371 (5) | C14—C15 | 1.369 (6) |
| N2—C19 | 1.333 (5) | C14—H14 | 0.9300 |
| N2—C11 | 1.373 (5) | C15—C16 | 1.402 (6) |
| N2—H2N | 0.8600 | C15—H15 | 0.9300 |
| C1—C6 | 1.412 (5) | C16—C17 | 1.420 (6) |
| C1—C2 | 1.425 (6) | C17—C18 | 1.359 (7) |
| C2—C3 | 1.385 (6) | C17—H17 | 0.9300 |
| C3—C4 | 1.402 (7) | C18—C19 | 1.403 (6) |
| C3—H3a | 0.9300 | C18—H18 | 0.9300 |
| C4—C5 | 1.359 (7) | C19—C20 | 1.502 (7) |
| C4—H4 | 0.9300 | C20—H20A | 0.9600 |
| C5—C6 | 1.409 (7) | C20—H20B | 0.9600 |
| C5—H5 | 0.9300 | C20—H20C | 0.9600 |
| C6—C7 | 1.412 (6) | C21—H21A | 0.9600 |
| C7—C8 | 1.354 (7) | C21—H21B | 0.9600 |
| C7—H7 | 0.9300 | C21—H21C | 0.9600 |
| C8—C9 | 1.410 (6) | ||
| O1—Zn1—N1 | 83.61 (12) | H10A—C10—H10B | 109.5 |
| O1—Zn1—I2 | 112.82 (10) | C9—C10—H10C | 109.5 |
| N1—Zn1—I2 | 111.95 (9) | H10A—C10—H10C | 109.5 |
| O1—Zn1—I1 | 112.11 (10) | H10B—C10—H10C | 109.5 |
| N1—Zn1—I1 | 120.50 (9) | N2—C11—C16 | 119.6 (4) |
| I2—Zn1—I1 | 112.65 (2) | N2—C11—C12 | 119.6 (3) |
| C2—O1—Zn1 | 111.6 (2) | C16—C11—C12 | 120.8 (4) |
| C12—O2—H2 | 109.5 | O2—C12—C13 | 126.1 (4) |
| C21—O3—H3 | 109.5 | O2—C12—C11 | 115.6 (4) |
| C9—N1—C1 | 120.2 (3) | C13—C12—C11 | 118.3 (4) |
| C9—N1—Zn1 | 130.5 (3) | C12—C13—C14 | 120.4 (4) |
| C1—N1—Zn1 | 109.2 (2) | C12—C13—H13 | 119.8 |
| C19—N2—C11 | 123.4 (4) | C14—C13—H13 | 119.8 |
| C19—N2—H2N | 118.3 | C15—C14—C13 | 122.0 (4) |
| C11—N2—H2N | 118.3 | C15—C14—H14 | 119.0 |
| N1—C1—C6 | 122.1 (4) | C13—C14—H14 | 119.0 |
| N1—C1—C2 | 117.1 (3) | C14—C15—C16 | 119.1 (4) |
| C6—C1—C2 | 120.9 (4) | C14—C15—H15 | 120.5 |
| O1—C2—C3 | 123.7 (4) | C16—C15—H15 | 120.5 |
| O1—C2—C1 | 118.4 (4) | C15—C16—C11 | 119.3 (4) |
| C3—C2—C1 | 117.9 (4) | C15—C16—C17 | 123.7 (4) |
| C2—C3—C4 | 120.5 (4) | C11—C16—C17 | 117.0 (4) |
| C2—C3—H3a | 119.8 | C18—C17—C16 | 121.0 (4) |
| C4—C3—H3a | 119.8 | C18—C17—H17 | 119.5 |
| C5—C4—C3 | 122.2 (5) | C16—C17—H17 | 119.5 |
| C5—C4—H4 | 118.9 | C17—C18—C19 | 120.5 (4) |
| C3—C4—H4 | 118.9 | C17—C18—H18 | 119.7 |
| C4—C5—C6 | 119.4 (4) | C19—C18—H18 | 119.7 |
| C4—C5—H5 | 120.3 | N2—C19—C18 | 118.5 (4) |
| C6—C5—H5 | 120.3 | N2—C19—C20 | 118.8 (4) |
| C7—C6—C5 | 124.7 (4) | C18—C19—C20 | 122.6 (4) |
| C7—C6—C1 | 116.1 (4) | C19—C20—H20A | 109.5 |
| C5—C6—C1 | 119.1 (4) | C19—C20—H20B | 109.5 |
| C8—C7—C6 | 121.0 (4) | H20A—C20—H20B | 109.5 |
| C8—C7—H7 | 119.5 | C19—C20—H20C | 109.5 |
| C6—C7—H7 | 119.5 | H20A—C20—H20C | 109.5 |
| C7—C8—C9 | 120.2 (4) | H20B—C20—H20C | 109.5 |
| C7—C8—H8 | 119.9 | O3—C21—H21A | 109.5 |
| C9—C8—H8 | 119.9 | O3—C21—H21B | 109.5 |
| N1—C9—C8 | 120.3 (4) | H21A—C21—H21B | 109.5 |
| N1—C9—C10 | 117.8 (4) | O3—C21—H21C | 109.5 |
| C8—C9—C10 | 121.9 (4) | H21A—C21—H21C | 109.5 |
| C9—C10—H10A | 109.5 | H21B—C21—H21C | 109.5 |
| C9—C10—H10B | 109.5 | ||
| N1—Zn1—O1—C2 | 3.3 (3) | C6—C7—C8—C9 | −0.6 (7) |
| I2—Zn1—O1—C2 | −107.9 (3) | C1—N1—C9—C8 | 0.8 (6) |
| I1—Zn1—O1—C2 | 123.7 (3) | Zn1—N1—C9—C8 | 176.2 (3) |
| O1—Zn1—N1—C9 | −178.9 (4) | C1—N1—C9—C10 | −178.8 (4) |
| I2—Zn1—N1—C9 | −66.8 (4) | Zn1—N1—C9—C10 | −3.4 (6) |
| I1—Zn1—N1—C9 | 69.2 (4) | C7—C8—C9—N1 | −0.3 (6) |
| O1—Zn1—N1—C1 | −3.1 (3) | C7—C8—C9—C10 | 179.3 (4) |
| I2—Zn1—N1—C1 | 109.0 (2) | C19—N2—C11—C16 | −0.3 (6) |
| I1—Zn1—N1—C1 | −115.0 (2) | C19—N2—C11—C12 | 178.1 (4) |
| C9—N1—C1—C6 | −0.4 (6) | N2—C11—C12—O2 | 0.6 (5) |
| Zn1—N1—C1—C6 | −176.7 (3) | C16—C11—C12—O2 | 179.0 (4) |
| C9—N1—C1—C2 | 178.7 (4) | N2—C11—C12—C13 | −179.4 (4) |
| Zn1—N1—C1—C2 | 2.4 (4) | C16—C11—C12—C13 | −1.0 (6) |
| Zn1—O1—C2—C3 | 175.7 (4) | O2—C12—C13—C14 | −179.1 (4) |
| Zn1—O1—C2—C1 | −2.9 (5) | C11—C12—C13—C14 | 0.9 (6) |
| N1—C1—C2—O1 | 0.3 (6) | C12—C13—C14—C15 | −0.7 (7) |
| C6—C1—C2—O1 | 179.4 (4) | C13—C14—C15—C16 | 0.6 (7) |
| N1—C1—C2—C3 | −178.4 (4) | C14—C15—C16—C11 | −0.7 (6) |
| C6—C1—C2—C3 | 0.7 (6) | C14—C15—C16—C17 | 178.4 (4) |
| O1—C2—C3—C4 | −179.9 (4) | N2—C11—C16—C15 | 179.3 (4) |
| C1—C2—C3—C4 | −1.3 (7) | C12—C11—C16—C15 | 0.9 (6) |
| C2—C3—C4—C5 | 0.7 (8) | N2—C11—C16—C17 | 0.2 (6) |
| C3—C4—C5—C6 | 0.6 (8) | C12—C11—C16—C17 | −178.2 (4) |
| C4—C5—C6—C7 | 178.9 (5) | C15—C16—C17—C18 | −179.1 (4) |
| C4—C5—C6—C1 | −1.1 (7) | C11—C16—C17—C18 | 0.0 (6) |
| N1—C1—C6—C7 | −0.5 (6) | C16—C17—C18—C19 | −0.1 (7) |
| C2—C1—C6—C7 | −179.6 (4) | C11—N2—C19—C18 | 0.2 (6) |
| N1—C1—C6—C5 | 179.6 (4) | C11—N2—C19—C20 | −178.1 (4) |
| C2—C1—C6—C5 | 0.5 (6) | C17—C18—C19—N2 | 0.0 (7) |
| C5—C6—C7—C8 | −179.1 (4) | C17—C18—C19—C20 | 178.2 (5) |
| C1—C6—C7—C8 | 1.0 (6) |
| D—H···A | D—H | H···A | D···A | D—H···A |
| O2—H2···O1 | 0.82 | 1.74 | 2.559 (4) | 172 |
| O3—H3···I1i | 0.82 | 2.88 | 3.575 (4) | 144 |
| N2—H2n···O3 | 0.86 | 1.92 | 2.757 (5) | 165 |
| Symmetry code: (i) x−1, y, z. |
Experimental details
| Crystal data | |
| Chemical formula | (C10H10NO)[Zn(C10H8NO)I2]·CH4O |
| Mr | 669.58 |
| Crystal system, space group | Monoclinic, P21/n |
| Temperature (K) | 295 |
| a, b, c (Å) | 10.1745 (6), 14.6292 (9), 16.5321 (10) |
| β (°) | 106.356 (1) |
| V (Å3) | 2361.1 (2) |
| Z | 4 |
| Radiation type | Mo Kα |
| µ (mm−1) | 3.68 |
| Crystal size (mm) | 0.35 × 0.25 × 0.15 |
| Data collection | |
| Diffractometer | Bruker SMART APEX diffractometer |
| Absorption correction | Multi-scan (SADABS; Sheldrick, 1996) |
| Tmin, Tmax | 0.359, 0.608 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 21863, 5404, 4049 |
| Rint | 0.031 |
| (sin θ/λ)max (Å−1) | 0.650 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.031, 0.090, 1.06 |
| No. of reflections | 5404 |
| No. of parameters | 267 |
| H-atom treatment | H-atom parameters constrained |
| Δρmax, Δρmin (e Å−3) | 0.73, −0.78 |
Computer programs: APEX2 (Bruker, 2009), SAINT (Bruker, 2009), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), X-SEED (Barbour, 2001), publCIF (Westrip, 2010).
| D—H···A | D—H | H···A | D···A | D—H···A |
| O2—H2···O1 | 0.82 | 1.74 | 2.559 (4) | 172 |
| O3—H3···I1i | 0.82 | 2.88 | 3.575 (4) | 144 |
| N2—H2n···O3 | 0.86 | 1.92 | 2.757 (5) | 165 |
| Symmetry code: (i) x−1, y, z. |
Acknowledgements
We thank Shahid Beheshti University and the University of Malaya for supporting this study.
References
Barbour, L. J. (2001). J. Supramol. Chem. 1, 189–191. CrossRef CAS Google Scholar
Bruker (2009). APEX2 and SAINT. Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
Sattarzadeh, E., Mohammadnezhad, G., Amini, M. M. & Ng, S. W. (2009). Acta Cryst. E65, m553. Web of Science CSD CrossRef IUCr Journals Google Scholar
Sheldrick, G. M. (1996). SADABS. University of Göttingen, Germany. Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Westrip, S. P. (2010). J. Appl. Cryst. 43, 920–925. Web of Science CrossRef CAS IUCr Journals Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
![[Figure 1]](./bt5355fig1thm.gif)




An earlier study reported C10H10NO+.ZnCI2(C10H8NO).CH3OH, which feature cations, tetrahedral anions and solvent molecules linked by N···O, O···O and O···Cl hydrogen bonds into a linear chain (Sattarzadeh et al., 2009). The present iodide analog (Scheme I, Fig. 1) is isostructural, the two compounds displaying matching cell dimensions. The hydroxy unit of the cation is hydrogen-bond donor to the alkoxide O atom of the tetrahedrally coordinated anion whereas the ammonium unit is hydrogen-bond donor to the methanolic O atom. Adjacent ion-pairs and solvent molecules are linked by a O–Hmethanol···I hydrogen bond to generate a linear chain running along the a-axis of the monoclinic unit cell.