metal-organic compounds
Bromido(quinolin-8-ol-κ2N,O)(quinolin-8-olato-κ2N,O)zinc(II) methanol monosolvate
aDepartment of Chemistry, General Campus, Shahid Beheshti University, Tehran 1983963113, Iran, and bDepartment of Chemistry, University of Malaya, 50603 Kuala Lumpur, Malaysia
*Correspondence e-mail: [email protected]
The title compound, [ZnBr(C9H6NO)(C9H7NO)]·CH3OH, has its metal atom N,O-chelated by a neutral and a deprotonated 8-hydroxyquinoline ligand. The hydroxy unit of the neutral ligand is a hydrogen-bond donor to the methanol O atom and the alkoxy O atom of the monoanionic ligand is a hydrogen-bond acceptor to the methanol O atom. In the crystal, adjacent molecules are linked by these two hydrogen bonds, generating a chain running along the a axis.
Experimental
Crystal data
|
Refinement
|
| ||||||||||||||||||||||
Data collection: APEX2 (Bruker, 2009
); cell refinement: SAINT (Bruker, 2009
); data reduction: SAINT; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: X-SEED (Barbour, 2001
); software used to prepare material for publication: publCIF (Westrip, 2010
).
Supporting information
contains datablocks global, I. DOI: 10.1107/S160053681003672X/bt5356sup1.cif
Structure factors: contains datablock I. DOI: 10.1107/S160053681003672X/bt5356Isup2.hkl
Zinc bromide (0.19 g, 0.75 mmol) and 8-hydroxyquinoline (0.22 g, 1.5 mmol) were loaded into a convection tube; the tube was filled with dry methanol and kept at 333 K. Crystals were collected from the side arm after several days.
Hydrogen atoms were placed in calculated positions (C–H 0.95–0.98, O–H 0.84 Å) and were included in the in the riding model approximation, with U(H) set to 1.2–1.5Ueq(C,O).
Data collection: APEX2 (Bruker, 2009); cell SAINT (Bruker, 2009); data reduction: SAINT (Bruker, 2009); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: X-SEED (Barbour, 2001); software used to prepare material for publication: publCIF (Westrip, 2010).
| [ZnBr(C9H6NO)(C9H7NO)]·CH4O | Z = 2 |
| Mr = 466.63 | F(000) = 468 |
| Triclinic, P1 | Dx = 1.751 Mg m−3 |
| Hall symbol: -P 1 | Mo Kα radiation, λ = 0.71073 Å |
| a = 8.4485 (7) Å | Cell parameters from 3867 reflections |
| b = 8.6968 (7) Å | θ = 2.5–28.2° |
| c = 13.1868 (10) Å | µ = 3.67 mm−1 |
| α = 97.241 (1)° | T = 100 K |
| β = 99.209 (1)° | Prism, yellow |
| γ = 109.470 (1)° | 0.30 × 0.20 × 0.10 mm |
| V = 884.81 (12) Å3 |
| Bruker SMART APEX diffractometer | 4022 independent reflections |
| Radiation source: fine-focus sealed tube | 3354 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.028 |
| ω scans | θmax = 27.5°, θmin = 2.5° |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | h = −10→10 |
| Tmin = 0.406, Tmax = 0.711 | k = −11→11 |
| 8392 measured reflections | l = −15→17 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.032 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.103 | H-atom parameters constrained |
| S = 1.10 | w = 1/[σ2(Fo2) + (0.0457P)2 + 1.9422P] where P = (Fo2 + 2Fc2)/3 |
| 4022 reflections | (Δ/σ)max = 0.001 |
| 237 parameters | Δρmax = 0.78 e Å−3 |
| 0 restraints | Δρmin = −0.85 e Å−3 |
| [ZnBr(C9H6NO)(C9H7NO)]·CH4O | γ = 109.470 (1)° |
| Mr = 466.63 | V = 884.81 (12) Å3 |
| Triclinic, P1 | Z = 2 |
| a = 8.4485 (7) Å | Mo Kα radiation |
| b = 8.6968 (7) Å | µ = 3.67 mm−1 |
| c = 13.1868 (10) Å | T = 100 K |
| α = 97.241 (1)° | 0.30 × 0.20 × 0.10 mm |
| β = 99.209 (1)° |
| Bruker SMART APEX diffractometer | 4022 independent reflections |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | 3354 reflections with I > 2σ(I) |
| Tmin = 0.406, Tmax = 0.711 | Rint = 0.028 |
| 8392 measured reflections |
| R[F2 > 2σ(F2)] = 0.032 | 0 restraints |
| wR(F2) = 0.103 | H-atom parameters constrained |
| S = 1.10 | Δρmax = 0.78 e Å−3 |
| 4022 reflections | Δρmin = −0.85 e Å−3 |
| 237 parameters |
| x | y | z | Uiso*/Ueq | ||
| Zn1 | 0.45338 (5) | 0.64466 (5) | 0.71737 (3) | 0.01184 (12) | |
| Br1 | 0.58054 (4) | 0.92415 (4) | 0.81357 (3) | 0.01654 (11) | |
| O1 | 0.6864 (3) | 0.6465 (3) | 0.64187 (19) | 0.0152 (5) | |
| O2 | 0.2092 (3) | 0.5306 (3) | 0.73396 (19) | 0.0145 (5) | |
| H2 | 0.1230 | 0.5461 | 0.7024 | 0.022* | |
| O3 | 0.9908 (3) | 0.6800 (3) | 0.7299 (2) | 0.0209 (6) | |
| H3 | 0.8908 | 0.6707 | 0.7016 | 0.031* | |
| N1 | 0.3868 (4) | 0.6687 (4) | 0.5653 (2) | 0.0119 (6) | |
| N2 | 0.5025 (4) | 0.4869 (3) | 0.8093 (2) | 0.0121 (6) | |
| C1 | 0.5180 (4) | 0.7280 (4) | 0.5148 (3) | 0.0110 (6) | |
| C2 | 0.6796 (4) | 0.7212 (4) | 0.5573 (3) | 0.0128 (7) | |
| C3 | 0.8163 (4) | 0.7842 (4) | 0.5120 (3) | 0.0150 (7) | |
| H3A | 0.9255 | 0.7819 | 0.5415 | 0.018* | |
| C4 | 0.7946 (5) | 0.8531 (5) | 0.4209 (3) | 0.0177 (7) | |
| H4 | 0.8897 | 0.8950 | 0.3892 | 0.021* | |
| C5 | 0.6384 (4) | 0.8603 (4) | 0.3777 (3) | 0.0151 (7) | |
| H5 | 0.6264 | 0.9080 | 0.3172 | 0.018* | |
| C6 | 0.4957 (5) | 0.7963 (4) | 0.4238 (3) | 0.0141 (7) | |
| C7 | 0.3290 (5) | 0.7915 (4) | 0.3821 (3) | 0.0153 (7) | |
| H7 | 0.3085 | 0.8350 | 0.3208 | 0.018* | |
| C8 | 0.1969 (5) | 0.7238 (5) | 0.4304 (3) | 0.0173 (7) | |
| H8 | 0.0835 | 0.7166 | 0.4020 | 0.021* | |
| C9 | 0.2328 (4) | 0.6652 (4) | 0.5232 (3) | 0.0156 (7) | |
| H9 | 0.1412 | 0.6208 | 0.5571 | 0.019* | |
| C10 | 0.3596 (4) | 0.4025 (4) | 0.8429 (3) | 0.0109 (6) | |
| C11 | 0.2035 (4) | 0.4283 (4) | 0.8012 (3) | 0.0138 (7) | |
| C12 | 0.0569 (4) | 0.3427 (4) | 0.8339 (3) | 0.0150 (7) | |
| H12 | −0.0481 | 0.3560 | 0.8074 | 0.018* | |
| C13 | 0.0599 (5) | 0.2365 (5) | 0.9055 (3) | 0.0165 (7) | |
| H13 | −0.0433 | 0.1800 | 0.9263 | 0.020* | |
| C14 | 0.2083 (5) | 0.2119 (4) | 0.9464 (3) | 0.0165 (7) | |
| H14 | 0.2079 | 0.1400 | 0.9951 | 0.020* | |
| C15 | 0.3606 (4) | 0.2956 (4) | 0.9146 (3) | 0.0128 (7) | |
| C16 | 0.5206 (5) | 0.2803 (4) | 0.9519 (3) | 0.0145 (7) | |
| H16 | 0.5282 | 0.2085 | 0.9996 | 0.017* | |
| C17 | 0.6636 (5) | 0.3682 (4) | 0.9194 (3) | 0.0153 (7) | |
| H17 | 0.7716 | 0.3604 | 0.9457 | 0.018* | |
| C18 | 0.6497 (4) | 0.4706 (4) | 0.8467 (3) | 0.0134 (7) | |
| H18 | 0.7494 | 0.5301 | 0.8235 | 0.016* | |
| C19 | 1.0704 (5) | 0.8335 (5) | 0.8036 (3) | 0.0271 (9) | |
| H19A | 1.0933 | 0.8107 | 0.8743 | 0.041* | |
| H19B | 0.9936 | 0.8967 | 0.8004 | 0.041* | |
| H19C | 1.1789 | 0.8984 | 0.7867 | 0.041* |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Zn1 | 0.0117 (2) | 0.0145 (2) | 0.0111 (2) | 0.00508 (15) | 0.00377 (15) | 0.00635 (15) |
| Br1 | 0.0208 (2) | 0.01368 (17) | 0.01481 (19) | 0.00510 (14) | 0.00314 (14) | 0.00568 (13) |
| O1 | 0.0162 (12) | 0.0189 (12) | 0.0138 (12) | 0.0078 (10) | 0.0056 (10) | 0.0078 (10) |
| O2 | 0.0105 (11) | 0.0194 (12) | 0.0163 (13) | 0.0080 (10) | 0.0012 (9) | 0.0076 (10) |
| O3 | 0.0130 (12) | 0.0228 (13) | 0.0256 (15) | 0.0072 (11) | −0.0002 (11) | 0.0035 (11) |
| N1 | 0.0106 (13) | 0.0158 (14) | 0.0101 (14) | 0.0054 (11) | 0.0026 (11) | 0.0030 (11) |
| N2 | 0.0159 (14) | 0.0129 (13) | 0.0080 (13) | 0.0037 (11) | 0.0045 (11) | 0.0049 (11) |
| C1 | 0.0104 (15) | 0.0115 (15) | 0.0109 (16) | 0.0041 (12) | 0.0033 (12) | −0.0001 (12) |
| C2 | 0.0159 (17) | 0.0138 (15) | 0.0117 (16) | 0.0083 (13) | 0.0044 (13) | 0.0042 (13) |
| C3 | 0.0115 (16) | 0.0187 (17) | 0.0171 (18) | 0.0080 (13) | 0.0034 (13) | 0.0043 (14) |
| C4 | 0.0172 (18) | 0.0193 (17) | 0.0155 (18) | 0.0026 (14) | 0.0076 (14) | 0.0052 (14) |
| C5 | 0.0169 (17) | 0.0161 (16) | 0.0107 (16) | 0.0044 (14) | 0.0015 (13) | 0.0030 (13) |
| C6 | 0.0185 (17) | 0.0126 (15) | 0.0114 (16) | 0.0046 (13) | 0.0061 (14) | 0.0027 (13) |
| C7 | 0.0180 (17) | 0.0180 (17) | 0.0099 (16) | 0.0072 (14) | −0.0003 (13) | 0.0043 (13) |
| C8 | 0.0159 (17) | 0.0236 (18) | 0.0126 (17) | 0.0076 (14) | 0.0010 (14) | 0.0061 (14) |
| C9 | 0.0120 (16) | 0.0209 (17) | 0.0161 (18) | 0.0077 (14) | 0.0045 (14) | 0.0045 (14) |
| C10 | 0.0124 (15) | 0.0120 (15) | 0.0089 (15) | 0.0056 (12) | 0.0025 (12) | 0.0011 (12) |
| C11 | 0.0145 (16) | 0.0158 (16) | 0.0118 (16) | 0.0062 (13) | 0.0025 (13) | 0.0034 (13) |
| C12 | 0.0108 (16) | 0.0208 (17) | 0.0123 (17) | 0.0054 (13) | 0.0003 (13) | 0.0038 (13) |
| C13 | 0.0146 (17) | 0.0199 (17) | 0.0152 (18) | 0.0041 (14) | 0.0063 (14) | 0.0062 (14) |
| C14 | 0.0206 (18) | 0.0153 (16) | 0.0152 (18) | 0.0056 (14) | 0.0069 (14) | 0.0066 (14) |
| C15 | 0.0151 (16) | 0.0123 (15) | 0.0082 (16) | 0.0029 (13) | 0.0004 (13) | −0.0002 (12) |
| C16 | 0.0197 (18) | 0.0145 (16) | 0.0127 (17) | 0.0105 (14) | 0.0021 (14) | 0.0048 (13) |
| C17 | 0.0143 (17) | 0.0208 (17) | 0.0127 (17) | 0.0093 (14) | 0.0009 (13) | 0.0043 (14) |
| C18 | 0.0121 (16) | 0.0171 (16) | 0.0143 (17) | 0.0081 (13) | 0.0049 (13) | 0.0045 (13) |
| C19 | 0.0193 (19) | 0.027 (2) | 0.029 (2) | 0.0051 (16) | 0.0007 (17) | −0.0014 (17) |
| Zn1—O2 | 2.030 (2) | C7—C8 | 1.372 (5) |
| Zn1—N2 | 2.040 (3) | C7—H7 | 0.9500 |
| Zn1—N1 | 2.050 (3) | C8—C9 | 1.411 (5) |
| Zn1—O1 | 2.340 (2) | C8—H8 | 0.9500 |
| Zn1—Br1 | 2.3911 (5) | C9—H9 | 0.9500 |
| O1—C2 | 1.362 (4) | C10—C15 | 1.409 (5) |
| O2—C11 | 1.328 (4) | C10—C11 | 1.445 (5) |
| O2—H2 | 0.8400 | C11—C12 | 1.383 (5) |
| O3—C19 | 1.430 (5) | C12—C13 | 1.404 (5) |
| O3—H3 | 0.8400 | C12—H12 | 0.9500 |
| N1—C9 | 1.319 (4) | C13—C14 | 1.378 (5) |
| N1—C1 | 1.372 (4) | C13—H13 | 0.9500 |
| N2—C18 | 1.322 (4) | C14—C15 | 1.410 (5) |
| N2—C10 | 1.361 (4) | C14—H14 | 0.9500 |
| C1—C2 | 1.414 (5) | C15—C16 | 1.417 (5) |
| C1—C6 | 1.418 (5) | C16—C17 | 1.364 (5) |
| C2—C3 | 1.368 (5) | C16—H16 | 0.9500 |
| C3—C4 | 1.422 (5) | C17—C18 | 1.406 (5) |
| C3—H3A | 0.9500 | C17—H17 | 0.9500 |
| C4—C5 | 1.376 (5) | C18—H18 | 0.9500 |
| C4—H4 | 0.9500 | C19—H19A | 0.9800 |
| C5—C6 | 1.416 (5) | C19—H19B | 0.9800 |
| C5—H5 | 0.9500 | C19—H19C | 0.9800 |
| C6—C7 | 1.412 (5) | ||
| O2—Zn1—N2 | 82.51 (11) | C6—C7—H7 | 120.1 |
| O2—Zn1—N1 | 95.88 (11) | C7—C8—C9 | 118.8 (3) |
| N2—Zn1—N1 | 143.75 (11) | C7—C8—H8 | 120.6 |
| O2—Zn1—O1 | 150.98 (10) | C9—C8—H8 | 120.6 |
| N2—Zn1—O1 | 90.06 (10) | N1—C9—C8 | 123.4 (3) |
| N1—Zn1—O1 | 73.91 (10) | N1—C9—H9 | 118.3 |
| O2—Zn1—Br1 | 112.41 (7) | C8—C9—H9 | 118.3 |
| N2—Zn1—Br1 | 109.66 (8) | N2—C10—C15 | 122.9 (3) |
| N1—Zn1—Br1 | 104.40 (8) | N2—C10—C11 | 116.5 (3) |
| O1—Zn1—Br1 | 96.52 (6) | C15—C10—C11 | 120.7 (3) |
| C2—O1—Zn1 | 108.4 (2) | O2—C11—C12 | 124.4 (3) |
| C11—O2—Zn1 | 111.3 (2) | O2—C11—C10 | 118.4 (3) |
| C11—O2—H2 | 124.4 | C12—C11—C10 | 117.2 (3) |
| Zn1—O2—H2 | 124.4 | C11—C12—C13 | 121.4 (3) |
| C19—O3—H3 | 109.5 | C11—C12—H12 | 119.3 |
| C9—N1—C1 | 118.4 (3) | C13—C12—H12 | 119.3 |
| C9—N1—Zn1 | 122.8 (2) | C14—C13—C12 | 121.9 (3) |
| C1—N1—Zn1 | 117.2 (2) | C14—C13—H13 | 119.0 |
| C18—N2—C10 | 119.0 (3) | C12—C13—H13 | 119.0 |
| C18—N2—Zn1 | 129.8 (2) | C13—C14—C15 | 118.6 (3) |
| C10—N2—Zn1 | 110.8 (2) | C13—C14—H14 | 120.7 |
| N1—C1—C2 | 117.6 (3) | C15—C14—H14 | 120.7 |
| N1—C1—C6 | 122.0 (3) | C10—C15—C14 | 120.1 (3) |
| C2—C1—C6 | 120.3 (3) | C10—C15—C16 | 116.4 (3) |
| O1—C2—C3 | 124.0 (3) | C14—C15—C16 | 123.5 (3) |
| O1—C2—C1 | 116.0 (3) | C17—C16—C15 | 120.2 (3) |
| C3—C2—C1 | 119.9 (3) | C17—C16—H16 | 119.9 |
| C2—C3—C4 | 119.9 (3) | C15—C16—H16 | 119.9 |
| C2—C3—H3A | 120.0 | C16—C17—C18 | 119.3 (3) |
| C4—C3—H3A | 120.0 | C16—C17—H17 | 120.4 |
| C5—C4—C3 | 121.2 (3) | C18—C17—H17 | 120.4 |
| C5—C4—H4 | 119.4 | N2—C18—C17 | 122.2 (3) |
| C3—C4—H4 | 119.4 | N2—C18—H18 | 118.9 |
| C4—C5—C6 | 119.7 (3) | C17—C18—H18 | 118.9 |
| C4—C5—H5 | 120.2 | O3—C19—H19A | 109.5 |
| C6—C5—H5 | 120.2 | O3—C19—H19B | 109.5 |
| C7—C6—C5 | 123.5 (3) | H19A—C19—H19B | 109.5 |
| C7—C6—C1 | 117.5 (3) | O3—C19—H19C | 109.5 |
| C5—C6—C1 | 118.9 (3) | H19A—C19—H19C | 109.5 |
| C8—C7—C6 | 119.8 (3) | H19B—C19—H19C | 109.5 |
| C8—C7—H7 | 120.1 | ||
| O2—Zn1—O1—C2 | 94.6 (3) | C4—C5—C6—C7 | −177.0 (3) |
| N2—Zn1—O1—C2 | 169.1 (2) | C4—C5—C6—C1 | 0.9 (5) |
| N1—Zn1—O1—C2 | 22.0 (2) | N1—C1—C6—C7 | −4.1 (5) |
| Br1—Zn1—O1—C2 | −81.1 (2) | C2—C1—C6—C7 | 176.7 (3) |
| N2—Zn1—O2—C11 | 6.3 (2) | N1—C1—C6—C5 | 177.9 (3) |
| N1—Zn1—O2—C11 | 149.9 (2) | C2—C1—C6—C5 | −1.3 (5) |
| O1—Zn1—O2—C11 | 82.7 (3) | C5—C6—C7—C8 | 178.5 (3) |
| Br1—Zn1—O2—C11 | −101.9 (2) | C1—C6—C7—C8 | 0.6 (5) |
| O2—Zn1—N1—C9 | 21.6 (3) | C6—C7—C8—C9 | 2.0 (5) |
| N2—Zn1—N1—C9 | 106.9 (3) | C1—N1—C9—C8 | −1.9 (5) |
| O1—Zn1—N1—C9 | 173.8 (3) | Zn1—N1—C9—C8 | 162.7 (3) |
| Br1—Zn1—N1—C9 | −93.4 (3) | C7—C8—C9—N1 | −1.4 (6) |
| O2—Zn1—N1—C1 | −173.6 (2) | C18—N2—C10—C15 | −1.2 (5) |
| N2—Zn1—N1—C1 | −88.3 (3) | Zn1—N2—C10—C15 | −174.5 (3) |
| O1—Zn1—N1—C1 | −21.3 (2) | C18—N2—C10—C11 | 178.6 (3) |
| Br1—Zn1—N1—C1 | 71.4 (2) | Zn1—N2—C10—C11 | 5.2 (4) |
| O2—Zn1—N2—C18 | −178.6 (3) | Zn1—O2—C11—C12 | 175.2 (3) |
| N1—Zn1—N2—C18 | 91.6 (3) | Zn1—O2—C11—C10 | −5.4 (4) |
| O1—Zn1—N2—C18 | 29.5 (3) | N2—C10—C11—O2 | 0.1 (5) |
| Br1—Zn1—N2—C18 | −67.5 (3) | C15—C10—C11—O2 | 179.8 (3) |
| O2—Zn1—N2—C10 | −6.2 (2) | N2—C10—C11—C12 | 179.6 (3) |
| N1—Zn1—N2—C10 | −96.0 (3) | C15—C10—C11—C12 | −0.7 (5) |
| O1—Zn1—N2—C10 | −158.1 (2) | O2—C11—C12—C13 | −179.9 (3) |
| Br1—Zn1—N2—C10 | 104.9 (2) | C10—C11—C12—C13 | 0.7 (5) |
| C9—N1—C1—C2 | −176.1 (3) | C11—C12—C13—C14 | −0.2 (6) |
| Zn1—N1—C1—C2 | 18.4 (4) | C12—C13—C14—C15 | −0.3 (5) |
| C9—N1—C1—C6 | 4.7 (5) | N2—C10—C15—C14 | 179.9 (3) |
| Zn1—N1—C1—C6 | −160.8 (3) | C11—C10—C15—C14 | 0.2 (5) |
| Zn1—O1—C2—C3 | 161.4 (3) | N2—C10—C15—C16 | 0.5 (5) |
| Zn1—O1—C2—C1 | −20.0 (3) | C11—C10—C15—C16 | −179.2 (3) |
| N1—C1—C2—O1 | 3.7 (4) | C13—C14—C15—C10 | 0.3 (5) |
| C6—C1—C2—O1 | −177.1 (3) | C13—C14—C15—C16 | 179.7 (3) |
| N1—C1—C2—C3 | −177.7 (3) | C10—C15—C16—C17 | 1.0 (5) |
| C6—C1—C2—C3 | 1.6 (5) | C14—C15—C16—C17 | −178.5 (3) |
| O1—C2—C3—C4 | 177.1 (3) | C15—C16—C17—C18 | −1.7 (5) |
| C1—C2—C3—C4 | −1.4 (5) | C10—N2—C18—C17 | 0.4 (5) |
| C2—C3—C4—C5 | 1.0 (6) | Zn1—N2—C18—C17 | 172.3 (3) |
| C3—C4—C5—C6 | −0.8 (5) | C16—C17—C18—N2 | 1.0 (5) |
| D—H···A | D—H | H···A | D···A | D—H···A |
| O2—H2···O3i | 0.84 | 1.90 | 2.585 (4) | 137 |
| O3—H3···O1 | 0.84 | 1.71 | 2.551 (4) | 178 |
| Symmetry code: (i) x−1, y, z. |
Experimental details
| Crystal data | |
| Chemical formula | [ZnBr(C9H6NO)(C9H7NO)]·CH4O |
| Mr | 466.63 |
| Crystal system, space group | Triclinic, P1 |
| Temperature (K) | 100 |
| a, b, c (Å) | 8.4485 (7), 8.6968 (7), 13.1868 (10) |
| α, β, γ (°) | 97.241 (1), 99.209 (1), 109.470 (1) |
| V (Å3) | 884.81 (12) |
| Z | 2 |
| Radiation type | Mo Kα |
| µ (mm−1) | 3.67 |
| Crystal size (mm) | 0.30 × 0.20 × 0.10 |
| Data collection | |
| Diffractometer | Bruker SMART APEX diffractometer |
| Absorption correction | Multi-scan (SADABS; Sheldrick, 1996) |
| Tmin, Tmax | 0.406, 0.711 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 8392, 4022, 3354 |
| Rint | 0.028 |
| (sin θ/λ)max (Å−1) | 0.650 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.032, 0.103, 1.10 |
| No. of reflections | 4022 |
| No. of parameters | 237 |
| H-atom treatment | H-atom parameters constrained |
| Δρmax, Δρmin (e Å−3) | 0.78, −0.85 |
Computer programs: APEX2 (Bruker, 2009), SAINT (Bruker, 2009), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), X-SEED (Barbour, 2001), publCIF (Westrip, 2010).
| D—H···A | D—H | H···A | D···A | D—H···A |
| O2—H2···O3i | 0.84 | 1.90 | 2.585 (4) | 137 |
| O3—H3···O1 | 0.84 | 1.71 | 2.551 (4) | 178 |
| Symmetry code: (i) x−1, y, z. |
Acknowledgements
We thank Shahid Beheshti University and the University of Malaya for supporting this study.
References
Barbour, L. J. (2001). J. Supramol. Chem. 1, 189–191. CrossRef CAS Google Scholar
Bruker (2009). APEX2 and SAINT. Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
Najafi, E., Amini, M. M. & Ng, S. W. (2010). Acta Cryst. E66, m1276. Web of Science CSD CrossRef IUCr Journals Google Scholar
Sheldrick, G. M. (1996). SADABS. University of Göttingen, Germany. Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Westrip, S. P. (2010). J. Appl. Cryst. 43, 920–925. Web of Science CrossRef CAS IUCr Journals Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
![[P \overline 1] Mathematical equation](teximages/bt5356fi1.gif)
![[Figure 1]](./bt5356fig1thm.gif)
![[Figure 2]](./bt5356fig2thm.gif)




An earlier study reported C10H10NO+.ZnBr2(C10H8NO).CH3OH, which feature cations, tetrahedral anions and solvent molecules linked by N···O, O···O and O···Br hydrogen bonds into a linear chain. The salt was synthesized by reacting zinc bromide and 2-methyl-8-hydroxyquinoline in methanol; no base was added (Najafi et al., 2010). The present study uses 8-hydoxyquinoline instead of 2-methy-8-hydroxyquinoline as the organic reactant. The product is a mono-solavated neutral molecule (Scheme I, Fig. 1). The methanol-solvated compound, ZnBr(C9H6NO)(C9H7NO).CH3OH, has its metal atom N,O-chelated by a neutral and deprotonated 8-hydroxyquinoline ligand. The hydroxy unit of the neutral ligand is hydrogen-bond donor methanol O atom and the alkoxy O atom of the monoanionic ligand is hydrogen-bond acceptor to methanol O atom. Adjacent molecules are linked by these two hydrogen bonds to generate a linear chain running along the a-axis of the triclinic unit cell (Fig. 2).