metal-organic compounds
(2-Carboxyacetato-κ2O1,O1′)(rac-5,5,7,12,12,14-hexamethyl-1,4,8,11-tetraazacyclotetradecane-κ4N,N′,N′′,N′′′)nickel(II) perchlorate acetonitrile solvate
aDepartment of Biology and Chemistry, Hunan University of Science and Engineering, Yongzhou Hunan 425100, People's Republic of China, and bDepartment of Chemistry, University of Malaya, 50603 Kuala Lumpur, Malaysia
*Correspondence e-mail: [email protected]
In the of the title salt, [Ni(C3H3O4)(C16H36N4)]ClO4·CH3CN, the macrocycle folds around the NiII atom, which is also chelated by the carboxylate monoanion. The geometry is a distorted NiN4O2 octahedron. The formula units are connected by N—H⋯O hydrogen bonds into centrosymmetric dimers. Further N—H⋯O and O—H⋯O hydrogen bonds link the complex molecules and the perchlorate ions.
Related literature
For three related structures, see: Jiang et al. (2005
); Ou, Zhang & Yuan (2009
); Ou, Zhou & Ng (2009
).
Experimental
Crystal data
|
Refinement
|
|
Data collection: SMART (Bruker, 2003
); cell refinement: SAINT (Bruker, 2003
); data reduction: SAINT; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: X-SEED (Barbour, 2001
); software used to prepare material for publication: publCIF (Westrip, 2010
).
Supporting information
contains datablocks global, I. DOI: https://doi.org/10.1107/S1600536810042637/bt5383sup1.cif
Structure factors: contains datablock I. DOI: https://doi.org/10.1107/S1600536810042637/bt5383Isup2.hkl
Malonic acid (0.208 g, 2 mmol) and sodium hydroxide (0.08 g, 2 mmol) were dissolved in water (10 ml). To the solution was added [Ni(rac-L)](ClO4)2 (0.108 g, 2 mmol) dissolved in acetonitrile (10 ml) (rac-L = 5,5,7,12,12,14-hexamethyl-1,4,8,11tetraazacyclotetradecane). The solution was left to stand at room temperature; blue crystals formed after several days.
Carbon-bound H-atoms were placed in calculated positions (C–H 0.95–1.00 Å) and were included in the in the riding model approximation, with Uiso(H) set to 1.2–1.5Ueq(C).
The amino H-atoms were similarly restrained [N–H 0.88 Å] with Uiso(H) set to 1.2–1.5Ueq(N).
The carboxylic acid H-atom was located in a difference Fourier map, and was refined isotropically with a distance restraint of O–H 0.84±0.01 Å.
We have reported adducts of 5,5,7,12,12,14-hexamethyl-1,4,8,11-tetraazacyclotetradecane with nickel carboxylates; in the synthesis, the perchlorate counterion reactant is sometimes incorporated into the so that the macrocycle-chelated entity is formally a mono-cation. When a dicarboxylic acid is used, only one carboxylic acid –CO2H end is deprotonated, as noted in the butenoate (Jiang et al., 2005), phthalate (Ou, Zhang & Yuan, 2009) and malate (Ou, Zhou & Ng, 2009) salts. In Ni(C16H36N4)(C3H3O4)+.ClO4-.CH3CN (Scheme I), the macrocycle folds around the nickel(II) atom, which is also chelated by the carboxylate monoanion. The geometry is an NiN4O2 octahedron (Fig. 1). Adjacent cations and anions are linked by N–H···O hydrogen bonds to form a centrosymmetric dimer (Table 1). The acetonitrile molecule does not engage in any interaction.
For three related structures, see: Jiang et al. (2005); Ou, Zhang & Yuan (2009); Ou, Zhou & Ng (2009).
Data collection: SMART (Bruker, 2003); cell SAINT (Bruker, 2003); data reduction: SAINT (Bruker, 2003); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: X-SEED (Barbour, 2001); software used to prepare material for publication: publCIF (Westrip, 2010).
| Fig. 1. Thermal ellipsoid plot (Barbour, 2001) of [Ni(C16H36N4)(C3H3O4)]+.ClO4-.CH3CN at the 70% probability level; hydrogen atoms are shown as spheres of arbitrary radius. |
| [Ni(C3H3O4)(C16H36N4)]ClO4·C2H3N | Z = 2 |
| Mr = 586.76 | F(000) = 624 |
| Triclinic, P1 | Dx = 1.449 Mg m−3 |
| Hall symbol: -P 1 | Mo Kα radiation, λ = 0.71073 Å |
| a = 9.5236 (4) Å | Cell parameters from 7463 reflections |
| b = 10.1766 (4) Å | θ = 2.3–27.0° |
| c = 15.3372 (6) Å | µ = 0.87 mm−1 |
| α = 92.899 (1)° | T = 173 K |
| β = 107.388 (1)° | Block, blue |
| γ = 106.516 (1)° | 0.45 × 0.40 × 0.20 mm |
| V = 1344.99 (9) Å3 |
| Bruker SMART APEX diffractometer | 5701 independent reflections |
| Radiation source: fine-focus sealed tube | 4946 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.019 |
| φ and ω scans | θmax = 27.0°, θmin = 1.4° |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | h = −12→12 |
| Tmin = 0.695, Tmax = 0.845 | k = −12→12 |
| 11181 measured reflections | l = −19→19 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.031 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.090 | H atoms treated by a mixture of independent and constrained refinement |
| S = 1.03 | w = 1/[σ2(Fo2) + (0.0459P)2 + 0.9446P] where P = (Fo2 + 2Fc2)/3 |
| 5701 reflections | (Δ/σ)max = 0.001 |
| 330 parameters | Δρmax = 0.55 e Å−3 |
| 1 restraint | Δρmin = −0.54 e Å−3 |
| [Ni(C3H3O4)(C16H36N4)]ClO4·C2H3N | γ = 106.516 (1)° |
| Mr = 586.76 | V = 1344.99 (9) Å3 |
| Triclinic, P1 | Z = 2 |
| a = 9.5236 (4) Å | Mo Kα radiation |
| b = 10.1766 (4) Å | µ = 0.87 mm−1 |
| c = 15.3372 (6) Å | T = 173 K |
| α = 92.899 (1)° | 0.45 × 0.40 × 0.20 mm |
| β = 107.388 (1)° |
| Bruker SMART APEX diffractometer | 5701 independent reflections |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | 4946 reflections with I > 2σ(I) |
| Tmin = 0.695, Tmax = 0.845 | Rint = 0.019 |
| 11181 measured reflections |
| R[F2 > 2σ(F2)] = 0.031 | 1 restraint |
| wR(F2) = 0.090 | H atoms treated by a mixture of independent and constrained refinement |
| S = 1.03 | Δρmax = 0.55 e Å−3 |
| 5701 reflections | Δρmin = −0.54 e Å−3 |
| 330 parameters |
| x | y | z | Uiso*/Ueq | ||
| Ni1 | 0.44427 (3) | 0.26403 (2) | 0.226567 (15) | 0.01746 (8) | |
| Cl1 | 0.11013 (6) | 0.48419 (5) | 0.33697 (4) | 0.02939 (12) | |
| O1 | 0.53455 (15) | 0.20193 (14) | 0.11561 (9) | 0.0226 (3) | |
| O2 | 0.63737 (15) | 0.19233 (14) | 0.26257 (9) | 0.0232 (3) | |
| O3 | 0.60045 (17) | −0.08012 (15) | 0.05987 (10) | 0.0296 (3) | |
| H3O | 0.565 (3) | −0.119 (3) | 0.0053 (9) | 0.048 (8)* | |
| O4 | 0.75796 (18) | 0.07704 (17) | 0.00664 (10) | 0.0366 (4) | |
| O5 | 0.0676 (2) | 0.4372 (3) | 0.24039 (14) | 0.0642 (6) | |
| O6 | −0.0232 (2) | 0.4920 (2) | 0.35800 (12) | 0.0452 (4) | |
| O7 | 0.1767 (2) | 0.3921 (2) | 0.39064 (17) | 0.0605 (6) | |
| O9 | 0.2239 (2) | 0.6171 (2) | 0.35917 (14) | 0.0593 (5) | |
| N1 | 0.26807 (18) | 0.07075 (16) | 0.17735 (11) | 0.0211 (3) | |
| H1 | 0.2850 | 0.0349 | 0.1295 | 0.025* | |
| N2 | 0.27765 (18) | 0.34713 (17) | 0.15032 (11) | 0.0225 (3) | |
| H2 | 0.2373 | 0.3773 | 0.1888 | 0.027* | |
| N3 | 0.60664 (18) | 0.46469 (16) | 0.27909 (11) | 0.0211 (3) | |
| H3 | 0.6984 | 0.4527 | 0.2954 | 0.025* | |
| N4 | 0.41760 (19) | 0.26668 (16) | 0.35641 (11) | 0.0212 (3) | |
| H4 | 0.3344 | 0.2903 | 0.3533 | 0.025* | |
| N5 | 0.9236 (3) | 0.0264 (3) | 0.37545 (18) | 0.0560 (6) | |
| C1 | 0.1245 (2) | 0.1067 (2) | 0.13879 (15) | 0.0292 (4) | |
| H1A | 0.0876 | 0.1312 | 0.1894 | 0.035* | |
| H1B | 0.0427 | 0.0260 | 0.0967 | 0.035* | |
| C2 | 0.1553 (2) | 0.2276 (2) | 0.08669 (14) | 0.0282 (4) | |
| H2A | 0.1890 | 0.2023 | 0.0349 | 0.034* | |
| H2B | 0.0593 | 0.2523 | 0.0609 | 0.034* | |
| C3 | 0.3327 (2) | 0.4644 (2) | 0.10165 (13) | 0.0255 (4) | |
| H3A | 0.3813 | 0.4323 | 0.0588 | 0.031* | |
| C4 | 0.1996 (3) | 0.5125 (3) | 0.04463 (16) | 0.0371 (5) | |
| H4A | 0.1210 | 0.4342 | 0.0002 | 0.056* | |
| H4B | 0.2396 | 0.5861 | 0.0113 | 0.056* | |
| H4C | 0.1532 | 0.5480 | 0.0858 | 0.056* | |
| C5 | 0.4547 (2) | 0.5866 (2) | 0.17060 (14) | 0.0276 (4) | |
| H5A | 0.4677 | 0.6684 | 0.1380 | 0.033* | |
| H5B | 0.4118 | 0.6060 | 0.2194 | 0.033* | |
| C6 | 0.6159 (2) | 0.5764 (2) | 0.21848 (13) | 0.0249 (4) | |
| C7 | 0.6890 (2) | 0.5397 (2) | 0.14827 (14) | 0.0291 (4) | |
| H7A | 0.6248 | 0.4492 | 0.1117 | 0.044* | |
| H7B | 0.7931 | 0.5362 | 0.1809 | 0.044* | |
| H7C | 0.6959 | 0.6104 | 0.1072 | 0.044* | |
| C8 | 0.7192 (3) | 0.7183 (2) | 0.27434 (16) | 0.0346 (5) | |
| H8A | 0.8235 | 0.7139 | 0.3057 | 0.052* | |
| H8B | 0.6752 | 0.7435 | 0.3204 | 0.052* | |
| H8C | 0.7251 | 0.7880 | 0.2327 | 0.052* | |
| C9 | 0.5823 (2) | 0.5038 (2) | 0.36648 (13) | 0.0269 (4) | |
| H9A | 0.4917 | 0.5381 | 0.3531 | 0.032* | |
| H9B | 0.6745 | 0.5791 | 0.4063 | 0.032* | |
| C10 | 0.5551 (2) | 0.3792 (2) | 0.41571 (13) | 0.0268 (4) | |
| H10A | 0.6472 | 0.3470 | 0.4308 | 0.032* | |
| H10B | 0.5389 | 0.4049 | 0.4742 | 0.032* | |
| C11 | 0.4025 (2) | 0.1328 (2) | 0.39390 (13) | 0.0256 (4) | |
| H11 | 0.4951 | 0.1043 | 0.3949 | 0.031* | |
| C12 | 0.3970 (3) | 0.1463 (2) | 0.49289 (15) | 0.0367 (5) | |
| H12A | 0.4898 | 0.2191 | 0.5325 | 0.055* | |
| H12B | 0.3933 | 0.0580 | 0.5164 | 0.055* | |
| H12C | 0.3044 | 0.1703 | 0.4930 | 0.055* | |
| C13 | 0.2577 (2) | 0.0191 (2) | 0.33284 (14) | 0.0287 (4) | |
| H13A | 0.2388 | −0.0589 | 0.3684 | 0.034* | |
| H13B | 0.1692 | 0.0557 | 0.3227 | 0.034* | |
| C14 | 0.2539 (2) | −0.0404 (2) | 0.23828 (14) | 0.0260 (4) | |
| C15 | 0.3865 (3) | −0.0994 (2) | 0.24651 (15) | 0.0309 (5) | |
| H15A | 0.4856 | −0.0254 | 0.2739 | 0.046* | |
| H15B | 0.3793 | −0.1385 | 0.1850 | 0.046* | |
| H15C | 0.3801 | −0.1722 | 0.2859 | 0.046* | |
| C16 | 0.1011 (3) | −0.1599 (2) | 0.19501 (17) | 0.0394 (5) | |
| H16A | 0.0967 | −0.1994 | 0.1343 | 0.059* | |
| H16B | 0.0134 | −0.1246 | 0.1880 | 0.059* | |
| H16C | 0.0961 | −0.2318 | 0.2352 | 0.059* | |
| C17 | 0.6356 (2) | 0.17427 (19) | 0.18083 (13) | 0.0213 (4) | |
| C18 | 0.7602 (2) | 0.1236 (2) | 0.16206 (14) | 0.0287 (4) | |
| H18A | 0.8514 | 0.2045 | 0.1679 | 0.034* | |
| H18B | 0.7930 | 0.0660 | 0.2094 | 0.034* | |
| C19 | 0.7075 (2) | 0.0401 (2) | 0.06769 (14) | 0.0249 (4) | |
| C20 | 0.9213 (3) | 0.1114 (3) | 0.42492 (17) | 0.0367 (5) | |
| C21 | 0.9193 (3) | 0.2199 (3) | 0.48808 (19) | 0.0461 (6) | |
| H21A | 0.9908 | 0.2222 | 0.5497 | 0.069* | |
| H21B | 0.8143 | 0.2020 | 0.4909 | 0.069* | |
| H21C | 0.9517 | 0.3092 | 0.4666 | 0.069* |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Ni1 | 0.01746 (13) | 0.02064 (13) | 0.01497 (12) | 0.00797 (9) | 0.00478 (9) | 0.00037 (8) |
| Cl1 | 0.0266 (2) | 0.0302 (3) | 0.0345 (3) | 0.0106 (2) | 0.0132 (2) | 0.0033 (2) |
| O1 | 0.0187 (6) | 0.0258 (7) | 0.0217 (7) | 0.0075 (5) | 0.0045 (5) | −0.0003 (5) |
| O2 | 0.0232 (7) | 0.0264 (7) | 0.0210 (7) | 0.0109 (6) | 0.0063 (5) | −0.0014 (5) |
| O3 | 0.0314 (8) | 0.0322 (8) | 0.0216 (7) | 0.0082 (6) | 0.0062 (6) | −0.0020 (6) |
| O4 | 0.0302 (8) | 0.0473 (10) | 0.0276 (8) | 0.0037 (7) | 0.0127 (7) | −0.0075 (7) |
| O5 | 0.0548 (12) | 0.0906 (16) | 0.0429 (11) | 0.0162 (11) | 0.0208 (9) | −0.0196 (11) |
| O6 | 0.0388 (9) | 0.0625 (12) | 0.0471 (10) | 0.0282 (9) | 0.0211 (8) | 0.0056 (9) |
| O7 | 0.0582 (12) | 0.0579 (12) | 0.0934 (17) | 0.0388 (11) | 0.0410 (12) | 0.0382 (12) |
| O9 | 0.0513 (12) | 0.0460 (11) | 0.0582 (13) | −0.0053 (9) | 0.0046 (10) | 0.0128 (9) |
| N1 | 0.0205 (8) | 0.0244 (8) | 0.0190 (8) | 0.0070 (6) | 0.0080 (6) | 0.0001 (6) |
| N2 | 0.0221 (8) | 0.0279 (8) | 0.0188 (8) | 0.0119 (7) | 0.0050 (6) | 0.0020 (6) |
| N3 | 0.0211 (8) | 0.0238 (8) | 0.0187 (8) | 0.0086 (6) | 0.0058 (6) | 0.0014 (6) |
| N4 | 0.0241 (8) | 0.0230 (8) | 0.0185 (8) | 0.0105 (6) | 0.0072 (6) | 0.0023 (6) |
| N5 | 0.0522 (14) | 0.0499 (14) | 0.0606 (16) | 0.0148 (11) | 0.0148 (12) | −0.0084 (12) |
| C1 | 0.0182 (9) | 0.0338 (11) | 0.0307 (11) | 0.0060 (8) | 0.0035 (8) | 0.0011 (8) |
| C2 | 0.0202 (9) | 0.0354 (11) | 0.0242 (10) | 0.0103 (8) | −0.0006 (8) | 0.0013 (8) |
| C3 | 0.0288 (10) | 0.0318 (11) | 0.0214 (9) | 0.0168 (9) | 0.0089 (8) | 0.0067 (8) |
| C4 | 0.0373 (12) | 0.0470 (14) | 0.0342 (12) | 0.0252 (11) | 0.0091 (10) | 0.0163 (10) |
| C5 | 0.0356 (11) | 0.0248 (10) | 0.0271 (10) | 0.0153 (9) | 0.0109 (9) | 0.0069 (8) |
| C6 | 0.0284 (10) | 0.0222 (9) | 0.0225 (10) | 0.0062 (8) | 0.0077 (8) | 0.0034 (7) |
| C7 | 0.0290 (11) | 0.0325 (11) | 0.0272 (10) | 0.0082 (9) | 0.0126 (9) | 0.0056 (8) |
| C8 | 0.0382 (12) | 0.0247 (11) | 0.0345 (12) | 0.0025 (9) | 0.0100 (10) | 0.0014 (9) |
| C9 | 0.0343 (11) | 0.0245 (10) | 0.0195 (9) | 0.0086 (8) | 0.0067 (8) | −0.0026 (7) |
| C10 | 0.0331 (11) | 0.0273 (10) | 0.0168 (9) | 0.0088 (8) | 0.0050 (8) | −0.0014 (7) |
| C11 | 0.0316 (11) | 0.0273 (10) | 0.0200 (9) | 0.0117 (8) | 0.0089 (8) | 0.0048 (8) |
| C12 | 0.0539 (15) | 0.0362 (12) | 0.0211 (10) | 0.0121 (11) | 0.0156 (10) | 0.0071 (9) |
| C13 | 0.0329 (11) | 0.0284 (10) | 0.0270 (10) | 0.0061 (9) | 0.0163 (9) | 0.0054 (8) |
| C14 | 0.0302 (11) | 0.0230 (10) | 0.0253 (10) | 0.0064 (8) | 0.0117 (8) | 0.0030 (8) |
| C15 | 0.0423 (12) | 0.0248 (10) | 0.0320 (11) | 0.0157 (9) | 0.0163 (10) | 0.0050 (8) |
| C16 | 0.0404 (13) | 0.0302 (12) | 0.0393 (13) | −0.0012 (10) | 0.0132 (10) | 0.0019 (9) |
| C17 | 0.0181 (9) | 0.0201 (9) | 0.0240 (9) | 0.0043 (7) | 0.0071 (7) | −0.0030 (7) |
| C18 | 0.0190 (9) | 0.0415 (12) | 0.0236 (10) | 0.0121 (9) | 0.0037 (8) | −0.0086 (8) |
| C19 | 0.0179 (9) | 0.0330 (11) | 0.0243 (10) | 0.0129 (8) | 0.0044 (8) | −0.0040 (8) |
| C20 | 0.0310 (12) | 0.0379 (13) | 0.0383 (13) | 0.0099 (10) | 0.0080 (10) | 0.0062 (10) |
| C21 | 0.0508 (15) | 0.0462 (15) | 0.0453 (15) | 0.0162 (12) | 0.0213 (12) | 0.0014 (11) |
| Ni1—N4 | 2.0813 (16) | C5—H5A | 0.9900 |
| Ni1—N2 | 2.0868 (16) | C5—H5B | 0.9900 |
| Ni1—O2 | 2.1014 (13) | C6—C7 | 1.529 (3) |
| Ni1—N1 | 2.1144 (16) | C6—C8 | 1.533 (3) |
| Ni1—N3 | 2.1223 (16) | C7—H7A | 0.9800 |
| Ni1—O1 | 2.2603 (13) | C7—H7B | 0.9800 |
| Ni1—C17 | 2.5082 (18) | C7—H7C | 0.9800 |
| Cl1—O6 | 1.4222 (16) | C8—H8A | 0.9800 |
| Cl1—O9 | 1.4213 (19) | C8—H8B | 0.9800 |
| Cl1—O5 | 1.4306 (19) | C8—H8C | 0.9800 |
| Cl1—O7 | 1.4359 (19) | C9—C10 | 1.507 (3) |
| O1—C17 | 1.270 (2) | C9—H9A | 0.9900 |
| O2—C17 | 1.252 (2) | C9—H9B | 0.9900 |
| O3—C19 | 1.324 (3) | C10—H10A | 0.9900 |
| O3—H3o | 0.83 (1) | C10—H10B | 0.9900 |
| O4—C19 | 1.204 (3) | C11—C13 | 1.526 (3) |
| N1—C1 | 1.475 (2) | C11—C12 | 1.535 (3) |
| N1—C14 | 1.505 (2) | C11—H11 | 1.0000 |
| N1—H1 | 0.8800 | C12—H12A | 0.9800 |
| N2—C2 | 1.478 (3) | C12—H12B | 0.9800 |
| N2—C3 | 1.491 (3) | C12—H12C | 0.9800 |
| N2—H2 | 0.8800 | C13—C14 | 1.529 (3) |
| N3—C9 | 1.481 (2) | C13—H13A | 0.9900 |
| N3—C6 | 1.504 (2) | C13—H13B | 0.9900 |
| N3—H3 | 0.8800 | C14—C15 | 1.521 (3) |
| N4—C10 | 1.478 (2) | C14—C16 | 1.540 (3) |
| N4—C11 | 1.491 (2) | C15—H15A | 0.9800 |
| N4—H4 | 0.8800 | C15—H15B | 0.9800 |
| N5—C20 | 1.131 (3) | C15—H15C | 0.9800 |
| C1—C2 | 1.508 (3) | C16—H16A | 0.9800 |
| C1—H1A | 0.9900 | C16—H16B | 0.9800 |
| C1—H1B | 0.9900 | C16—H16C | 0.9800 |
| C2—H2A | 0.9900 | C17—C18 | 1.515 (3) |
| C2—H2B | 0.9900 | C18—C19 | 1.506 (3) |
| C3—C4 | 1.531 (3) | C18—H18A | 0.9900 |
| C3—C5 | 1.525 (3) | C18—H18B | 0.9900 |
| C3—H3A | 1.0000 | C20—C21 | 1.439 (3) |
| C4—H4A | 0.9800 | C21—H21A | 0.9800 |
| C4—H4B | 0.9800 | C21—H21B | 0.9800 |
| C4—H4C | 0.9800 | C21—H21C | 0.9800 |
| C5—C6 | 1.527 (3) | ||
| N4—Ni1—N2 | 104.09 (6) | C5—C6—C7 | 111.33 (16) |
| N4—Ni1—O2 | 95.69 (6) | N3—C6—C8 | 111.54 (16) |
| N2—Ni1—O2 | 159.77 (6) | C5—C6—C8 | 108.18 (17) |
| N4—Ni1—N1 | 91.55 (6) | C7—C6—C8 | 108.01 (17) |
| N2—Ni1—N1 | 85.19 (6) | C6—C7—H7A | 109.5 |
| O2—Ni1—N1 | 98.65 (6) | C6—C7—H7B | 109.5 |
| N4—Ni1—N3 | 85.63 (6) | H7A—C7—H7B | 109.5 |
| N2—Ni1—N3 | 91.43 (6) | C6—C7—H7C | 109.5 |
| O2—Ni1—N3 | 85.80 (6) | H7A—C7—H7C | 109.5 |
| N1—Ni1—N3 | 174.96 (6) | H7B—C7—H7C | 109.5 |
| N4—Ni1—O1 | 154.65 (6) | C6—C8—H8A | 109.5 |
| N2—Ni1—O1 | 100.65 (6) | C6—C8—H8B | 109.5 |
| O2—Ni1—O1 | 60.22 (5) | H8A—C8—H8B | 109.5 |
| N1—Ni1—O1 | 85.06 (5) | C6—C8—H8C | 109.5 |
| N3—Ni1—O1 | 99.27 (5) | H8A—C8—H8C | 109.5 |
| N4—Ni1—C17 | 125.20 (6) | H8B—C8—H8C | 109.5 |
| N2—Ni1—C17 | 130.70 (6) | N3—C9—C10 | 109.34 (16) |
| O2—Ni1—C17 | 29.89 (6) | N3—C9—H9A | 109.8 |
| N1—Ni1—C17 | 92.09 (6) | C10—C9—H9A | 109.8 |
| N3—Ni1—C17 | 92.95 (6) | N3—C9—H9B | 109.8 |
| O1—Ni1—C17 | 30.33 (6) | C10—C9—H9B | 109.8 |
| O6—Cl1—O9 | 110.07 (13) | H9A—C9—H9B | 108.3 |
| O6—Cl1—O5 | 109.36 (12) | N4—C10—C9 | 109.92 (16) |
| O9—Cl1—O5 | 108.85 (13) | N4—C10—H10A | 109.7 |
| O6—Cl1—O7 | 110.15 (12) | C9—C10—H10A | 109.7 |
| O9—Cl1—O7 | 107.90 (13) | N4—C10—H10B | 109.7 |
| O5—Cl1—O7 | 110.50 (14) | C9—C10—H10B | 109.7 |
| C17—O1—Ni1 | 85.69 (11) | H10A—C10—H10B | 108.2 |
| C17—O2—Ni1 | 93.34 (11) | N4—C11—C13 | 111.13 (16) |
| C19—O3—H3O | 110 (2) | N4—C11—C12 | 111.90 (16) |
| C1—N1—C14 | 113.93 (15) | C13—C11—C12 | 109.05 (17) |
| C1—N1—Ni1 | 104.51 (12) | N4—C11—H11 | 108.2 |
| C14—N1—Ni1 | 120.56 (12) | C13—C11—H11 | 108.2 |
| C1—N1—H1 | 105.6 | C12—C11—H11 | 108.2 |
| C14—N1—H1 | 105.6 | C11—C12—H12A | 109.5 |
| Ni1—N1—H1 | 105.6 | C11—C12—H12B | 109.5 |
| C2—N2—C3 | 112.71 (15) | H12A—C12—H12B | 109.5 |
| C2—N2—Ni1 | 104.89 (12) | C11—C12—H12C | 109.5 |
| C3—N2—Ni1 | 116.63 (12) | H12A—C12—H12C | 109.5 |
| C2—N2—H2 | 107.4 | H12B—C12—H12C | 109.5 |
| C3—N2—H2 | 107.4 | C14—C13—C11 | 119.18 (17) |
| Ni1—N2—H2 | 107.4 | C14—C13—H13A | 107.5 |
| C9—N3—C6 | 114.03 (15) | C11—C13—H13A | 107.5 |
| C9—N3—Ni1 | 104.30 (11) | C14—C13—H13B | 107.5 |
| C6—N3—Ni1 | 120.41 (12) | C11—C13—H13B | 107.5 |
| C9—N3—H3 | 105.7 | H13A—C13—H13B | 107.0 |
| C6—N3—H3 | 105.7 | N1—C14—C15 | 107.74 (16) |
| Ni1—N3—H3 | 105.7 | N1—C14—C13 | 110.42 (16) |
| C10—N4—C11 | 112.07 (15) | C15—C14—C13 | 111.55 (17) |
| C10—N4—Ni1 | 104.22 (12) | N1—C14—C16 | 111.13 (17) |
| C11—N4—Ni1 | 115.03 (11) | C15—C14—C16 | 107.64 (18) |
| C10—N4—H4 | 108.4 | C13—C14—C16 | 108.34 (17) |
| C11—N4—H4 | 108.4 | C14—C15—H15A | 109.5 |
| Ni1—N4—H4 | 108.4 | C14—C15—H15B | 109.5 |
| N1—C1—C2 | 109.58 (16) | H15A—C15—H15B | 109.5 |
| N1—C1—H1A | 109.8 | C14—C15—H15C | 109.5 |
| C2—C1—H1A | 109.8 | H15A—C15—H15C | 109.5 |
| N1—C1—H1B | 109.8 | H15B—C15—H15C | 109.5 |
| C2—C1—H1B | 109.8 | C14—C16—H16A | 109.5 |
| H1A—C1—H1B | 108.2 | C14—C16—H16B | 109.5 |
| N2—C2—C1 | 109.16 (16) | H16A—C16—H16B | 109.5 |
| N2—C2—H2A | 109.8 | C14—C16—H16C | 109.5 |
| C1—C2—H2A | 109.8 | H16A—C16—H16C | 109.5 |
| N2—C2—H2B | 109.8 | H16B—C16—H16C | 109.5 |
| C1—C2—H2B | 109.8 | O2—C17—O1 | 120.74 (17) |
| H2A—C2—H2B | 108.3 | O2—C17—C18 | 118.42 (17) |
| N2—C3—C4 | 112.02 (17) | O1—C17—C18 | 120.80 (17) |
| N2—C3—C5 | 110.60 (16) | O2—C17—Ni1 | 56.76 (9) |
| C4—C3—C5 | 109.25 (17) | O1—C17—Ni1 | 63.98 (10) |
| N2—C3—H3A | 108.3 | C18—C17—Ni1 | 174.93 (14) |
| C4—C3—H3A | 108.3 | C19—C18—C17 | 113.04 (16) |
| C5—C3—H3A | 108.3 | C19—C18—H18A | 109.0 |
| C3—C4—H4A | 109.5 | C17—C18—H18A | 109.0 |
| C3—C4—H4B | 109.5 | C19—C18—H18B | 109.0 |
| H4A—C4—H4B | 109.5 | C17—C18—H18B | 109.0 |
| C3—C4—H4C | 109.5 | H18A—C18—H18B | 107.8 |
| H4A—C4—H4C | 109.5 | O4—C19—O3 | 123.73 (18) |
| H4B—C4—H4C | 109.5 | O4—C19—C18 | 124.16 (19) |
| C6—C5—C3 | 119.38 (16) | O3—C19—C18 | 112.10 (18) |
| C6—C5—H5A | 107.5 | N5—C20—C21 | 179.6 (3) |
| C3—C5—H5A | 107.5 | C20—C21—H21A | 109.5 |
| C6—C5—H5B | 107.5 | C20—C21—H21B | 109.5 |
| C3—C5—H5B | 107.5 | H21A—C21—H21B | 109.5 |
| H5A—C5—H5B | 107.0 | C20—C21—H21C | 109.5 |
| N3—C6—C5 | 110.32 (16) | H21A—C21—H21C | 109.5 |
| N3—C6—C7 | 107.46 (16) | H21B—C21—H21C | 109.5 |
| D—H···A | D—H | H···A | D···A | D—H···A |
| O3—H3o···O1i | 0.83 (1) | 1.84 (1) | 2.669 (2) | 173 (3) |
| N1—H1···O4i | 0.88 | 2.19 | 3.038 (2) | 161 |
| N2—H2···O5 | 0.88 | 2.21 | 3.052 (2) | 160 |
| N3—H3···O6ii | 0.88 | 2.44 | 3.291 (2) | 163 |
| N4—H4···O7 | 0.88 | 2.24 | 3.080 (2) | 161 |
| Symmetry codes: (i) −x+1, −y, −z; (ii) x+1, y, z. |
Experimental details
| Crystal data | |
| Chemical formula | [Ni(C3H3O4)(C16H36N4)]ClO4·C2H3N |
| Mr | 586.76 |
| Crystal system, space group | Triclinic, P1 |
| Temperature (K) | 173 |
| a, b, c (Å) | 9.5236 (4), 10.1766 (4), 15.3372 (6) |
| α, β, γ (°) | 92.899 (1), 107.388 (1), 106.516 (1) |
| V (Å3) | 1344.99 (9) |
| Z | 2 |
| Radiation type | Mo Kα |
| µ (mm−1) | 0.87 |
| Crystal size (mm) | 0.45 × 0.40 × 0.20 |
| Data collection | |
| Diffractometer | Bruker SMART APEX |
| Absorption correction | Multi-scan (SADABS; Sheldrick, 1996) |
| Tmin, Tmax | 0.695, 0.845 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 11181, 5701, 4946 |
| Rint | 0.019 |
| (sin θ/λ)max (Å−1) | 0.639 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.031, 0.090, 1.03 |
| No. of reflections | 5701 |
| No. of parameters | 330 |
| No. of restraints | 1 |
| H-atom treatment | H atoms treated by a mixture of independent and constrained refinement |
| Δρmax, Δρmin (e Å−3) | 0.55, −0.54 |
Computer programs: SMART (Bruker, 2003), SAINT (Bruker, 2003), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), X-SEED (Barbour, 2001), publCIF (Westrip, 2010).
| D—H···A | D—H | H···A | D···A | D—H···A |
| O3—H3o···O1i | 0.83 (1) | 1.84 (1) | 2.669 (2) | 173 (3) |
| N1—H1···O4i | 0.88 | 2.19 | 3.038 (2) | 161 |
| N2—H2···O5 | 0.88 | 2.21 | 3.052 (2) | 160 |
| N3—H3···O6ii | 0.88 | 2.44 | 3.291 (2) | 163 |
| N4—H4···O7 | 0.88 | 2.24 | 3.080 (2) | 161 |
| Symmetry codes: (i) −x+1, −y, −z; (ii) x+1, y, z. |
Acknowledgements
We thank the Key Subject Construction Project of Hunan Province (2006–180), the Scientific Research Fund of Hunan Provincial Education Department (10B039), the Scientific Research Fund of Hunan Provincial Education Department (10 C0730) and the University of Malaya for supporting this study.
References
Barbour, L. J. (2001). J. Supramol. Chem. 1, 189–191. CrossRef CAS Google Scholar
Bruker (2003). SAINT and SMART. Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
Jiang, L., Feng, X.-L. & Lu, T.-B. (2005). Cryst. Growth Des. 5, 1469–1475. Web of Science CSD CrossRef CAS Google Scholar
Ou, G.-C., Zhang, M. & Yuan, X.-Y. (2009). Acta Cryst. E65, m726. Web of Science CSD CrossRef IUCr Journals Google Scholar
Ou, G.-C., Zhou, Q. & Ng, S. W. (2009). Acta Cryst. E65, m728. Web of Science CSD CrossRef IUCr Journals Google Scholar
Sheldrick, G. M. (1996). SADABS. University of Göttingen, Germany. Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Westrip, S. P. (2010). J. Appl. Cryst. 43, 920–925. Web of Science CrossRef CAS IUCr Journals Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
![[P \overline 1] Mathematical equation](teximages/bt5383fi1.gif)
![[Figure 1]](./bt5383fig1thm.gif)




We have reported adducts of 5,5,7,12,12,14-hexamethyl-1,4,8,11-tetraazacyclotetradecane with nickel carboxylates; in the synthesis, the perchlorate counterion reactant is sometimes incorporated into the crystal structure, so that the macrocycle-chelated entity is formally a mono-cation. When a dicarboxylic acid is used, only one carboxylic acid –CO2H end is deprotonated, as noted in the butenoate (Jiang et al., 2005), phthalate (Ou, Zhang & Yuan, 2009) and malate (Ou, Zhou & Ng, 2009) salts. In Ni(C16H36N4)(C3H3O4)+.ClO4-.CH3CN (Scheme I), the macrocycle folds around the nickel(II) atom, which is also chelated by the carboxylate monoanion. The geometry is an NiN4O2 octahedron (Fig. 1). Adjacent cations and anions are linked by N–H···O hydrogen bonds to form a centrosymmetric dimer (Table 1). The acetonitrile molecule does not engage in any interaction.