metal-organic compounds
{μ-6,6′-Dimethoxy-2,2′-[cyclohexane-1,2-diylbis(nitrilomethylidyne)]diphenolato}methanol-μ-nitrato-dinitratocopper(II)europium(III)
aSchool of Chemistry and Materials Science, Heilongjiang University, Harbin 150080, People's Republic of China
*Correspondence e-mail: [email protected]
In the title dinuclear salen-type complex, [CuEu(C22H24N2O4)(NO3)3(CH3OH)], the CuII ion is five-coordinated to two imine N atoms and two phenolate O atoms and one O from the bridging nitrate group. The EuIII ion is ligated to three nitrate groups, four O atoms from the salen-type ligand and one methanol molecule, leading to a distorted tenfold coordination for the rare earth cation. One of the three nitrate anions is disordered over two positions in a 0.66 (5):0.34 (5) ratio.
Related literature
For the synthesis of the ligand, see: Aslantaş et al. (2007
); Mohamed et al. (2003
). For similar copper lanthanide complexes with a similar salen-like ligand, see: Costes et al. (2000
, 2008
); Koner et al. (2005
); Sun et al. (2009
).
Experimental
Crystal data
|
Data collection: SMART (Bruker, 2001
); cell refinement: SAINT-Plus (Bruker, 2003
); data reduction: SAINT-Plus; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: SHELXTL (Sheldrick, 2008
); software used to prepare material for publication: SHELXL97.
Supporting information
contains datablocks global, I. DOI: https://doi.org/10.1107/S1600536810039103/rk2221sup1.cif
Structure factors: contains datablock I. DOI: https://doi.org/10.1107/S1600536810039103/rk2221Isup2.hkl
To a 2:3 MeOH/MeCN solution (35 ml) of [(H2L)Eu(NO3)3] (0.2253 g, 0.3 mmol) was added an aqueous solution (10 ml) of Cu(OAc)2˙H2O (0.0597 g, 0.3 mmol) at ambient temperature. After stirring for 5 hrs, the solution was filtered to remove the suspended particles. Red single crystals suitable for X-ray determination were obtained by slow diffusion of diethylether into the filtrate in one week. For CuEu(C22H24N2O4)(NO3)3CH3OH elemental anal. - Calc.: for C23H28N5O14EuCu: C, 33.93; H, 3.47; N, 8.60 wt%, Found: C, 33.85; H, 3.55; N, 8.58 wt%.
H atoms bound to C atoms were placed in calculated positions and treated as riding on their parent atoms, with C–H = 0.93Å (aromatic C), C–H = 0.97Å (methylene C), and with Uiso(H) = 1.2Ueq(C) or C–H = 0.96Å (methly C) and with Uiso(H) = 1.5Ueq(C). H atom bound to O atom was found from the Fourier difference map, the O–H distance was fixed, Uiso value is refined isotropically.
In continuation of our studies of salen-type lanthanide complexes (Aslantaş et al., 2007, Mohamed et al., 2003, Sun et al., 2009), we present here the of the title compound. The EuIII center is ligated to two bidentate nitrate groups and four oxygen atoms from the ligand, one oxygen, from the bridging nitrate group and one methanol molecule (Fig. 1). It is similar to the previously reported structures (Costes et al., 2000, 2008; Koner et al., 2005). The decacoordinated EuIII ion presents a narrow spread in Eu–O bond distances 2.338 (18)-2.786 (4)Å. The Cu(II) ion is five-coordinated by two imine nitrogen atoms, two phenol oxygen atoms from the imine-phenolate ligand and one oxygen atom from the bridgin nitrate group.
For the synthesis of the ligand, see: Aslantaş et al. (2007); Mohamed et al. (2003). For similar copper lanthanide complexes with the similar salen-like ligand, see: Costes et al. (2000, 2008); Koner et al. (2005); Sun et al. (2009).
Data collection: SMART (Bruker, 2001); cell SAINT-Plus (Bruker, 2003); data reduction: SAINT-Plus (Bruker, 2003); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: SHELXTL (Sheldrick, 2008).
| [CuEu(C22H24N2O4)(NO3)3(CH4O)] | F(000) = 3240 |
| Mr = 814.02 | Dx = 1.884 Mg m−3 |
| Monoclinic, C2/c | Mo Kα radiation, λ = 0.71073 Å |
| Hall symbol: -C 2yc | Cell parameters from 5035 reflections |
| a = 29.305 (6) Å | θ = 3.2–27.5° |
| b = 14.233 (3) Å | µ = 2.99 mm−1 |
| c = 14.141 (3) Å | T = 295 K |
| β = 103.36 (3)° | Block, red |
| V = 5739 (2) Å3 | 0.14 × 0.12 × 0.11 mm |
| Z = 8 |
| Bruker SMART1000 CCD diffractometer | 6537 independent reflections |
| Radiation source: fine-focus sealed tube | 4621 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.061 |
| φ and ω scans | θmax = 27.5°, θmin = 3.2° |
| Absorption correction: multi-scan (SADABS; Sheldrick, 2003) | h = −37→37 |
| Tmin = 0.677, Tmax = 0.727 | k = −18→18 |
| 27154 measured reflections | l = −15→18 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.049 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.091 | H-atom parameters constrained |
| S = 1.07 | w = 1/[σ2(Fo2) + (0.0119P)2 + 37.7609P] where P = (Fo2 + 2Fc2)/3 |
| 6537 reflections | (Δ/σ)max = 0.001 |
| 420 parameters | Δρmax = 0.80 e Å−3 |
| 13 restraints | Δρmin = −1.11 e Å−3 |
| [CuEu(C22H24N2O4)(NO3)3(CH4O)] | V = 5739 (2) Å3 |
| Mr = 814.02 | Z = 8 |
| Monoclinic, C2/c | Mo Kα radiation |
| a = 29.305 (6) Å | µ = 2.99 mm−1 |
| b = 14.233 (3) Å | T = 295 K |
| c = 14.141 (3) Å | 0.14 × 0.12 × 0.11 mm |
| β = 103.36 (3)° |
| Bruker SMART1000 CCD diffractometer | 6537 independent reflections |
| Absorption correction: multi-scan (SADABS; Sheldrick, 2003) | 4621 reflections with I > 2σ(I) |
| Tmin = 0.677, Tmax = 0.727 | Rint = 0.061 |
| 27154 measured reflections |
| R[F2 > 2σ(F2)] = 0.049 | 13 restraints |
| wR(F2) = 0.091 | H-atom parameters constrained |
| S = 1.07 | w = 1/[σ2(Fo2) + (0.0119P)2 + 37.7609P] where P = (Fo2 + 2Fc2)/3 |
| 6537 reflections | Δρmax = 0.80 e Å−3 |
| 420 parameters | Δρmin = −1.11 e Å−3 |
Geometry. All s.u.'s (except the s.u. in the dihedral angle between two l.s. planes) are estimated using the full covariance matrix. The cell s.u.'s are taken into account individually in the estimation of s.u.'s in distances, angles and torsion angles; correlations between s.u.'s in cell parameters are only used when they are defined by crystal symmetry. An approximate (isotropic) treatment of cell s.u.'s is used for estimating s.u.'s involving l.s. planes. |
Refinement. Refinement of F2 against ALL reflections. The weighted R-factor wR and goodness of fit S are based on F2, conventional R-factors R are based on F, with F set to zero for negative F2. The threshold expression of F2 > 2σ(F2) is used only for calculating R-factors(gt) etc. and is not relevant to the choice of reflections for refinement. R-factors based on F2 are statistically about twice as large as those based on F, and R-factors based on ALL data will be even larger. |
| x | y | z | Uiso*/Ueq | Occ. (<1) | |
| C1 | 0.3809 (2) | 0.1512 (4) | 1.0213 (4) | 0.0473 (14) | |
| C2 | 0.3876 (2) | 0.1293 (4) | 1.1185 (4) | 0.0547 (16) | |
| H2 | 0.4176 | 0.1285 | 1.1584 | 0.066* | |
| C3 | 0.3492 (2) | 0.1086 (4) | 1.1562 (4) | 0.0584 (16) | |
| H3 | 0.3537 | 0.0939 | 1.2218 | 0.070* | |
| C4 | 0.3048 (2) | 0.1093 (4) | 1.0985 (4) | 0.0532 (15) | |
| H4 | 0.2795 | 0.0954 | 1.1253 | 0.064* | |
| C5 | 0.2970 (2) | 0.1309 (4) | 0.9987 (4) | 0.0441 (13) | |
| C6 | 0.33567 (19) | 0.1511 (4) | 0.9591 (4) | 0.0436 (13) | |
| C7 | 0.2496 (2) | 0.1251 (4) | 0.9423 (4) | 0.0537 (15) | |
| H7 | 0.2265 | 0.1118 | 0.9759 | 0.064* | |
| C8 | 0.1873 (2) | 0.1153 (7) | 0.7934 (5) | 0.083 (2) | |
| H8 | 0.1880 | 0.0502 | 0.7713 | 0.099* | |
| C9 | 0.1494 (2) | 0.1200 (6) | 0.8445 (5) | 0.082 (2) | |
| H9B | 0.1488 | 0.1819 | 0.8728 | 0.099* | |
| H9A | 0.1549 | 0.0742 | 0.8967 | 0.099* | |
| C10 | 0.1024 (3) | 0.1002 (7) | 0.7742 (6) | 0.107 (3) | |
| H10B | 0.1015 | 0.0348 | 0.7545 | 0.128* | |
| H10A | 0.0774 | 0.1098 | 0.8079 | 0.128* | |
| C11 | 0.0934 (3) | 0.1604 (7) | 0.6856 (6) | 0.101 (3) | |
| H11B | 0.0643 | 0.1411 | 0.6419 | 0.121* | |
| H11A | 0.0898 | 0.2252 | 0.7040 | 0.121* | |
| C12 | 0.1320 (2) | 0.1540 (6) | 0.6347 (5) | 0.080 (2) | |
| H12B | 0.1263 | 0.1980 | 0.5808 | 0.096* | |
| H12A | 0.1327 | 0.0912 | 0.6084 | 0.096* | |
| C13 | 0.1794 (2) | 0.1757 (6) | 0.7026 (5) | 0.0666 (19) | |
| H13 | 0.1787 | 0.2414 | 0.7230 | 0.080* | |
| C14 | 0.21981 (19) | 0.1500 (4) | 0.5736 (4) | 0.0474 (14) | |
| H14 | 0.1905 | 0.1488 | 0.5308 | 0.057* | |
| C15 | 0.26093 (18) | 0.1363 (3) | 0.5334 (4) | 0.0385 (12) | |
| C16 | 0.25278 (19) | 0.1125 (4) | 0.4346 (4) | 0.0460 (13) | |
| H16 | 0.2222 | 0.1086 | 0.3976 | 0.055* | |
| C17 | 0.2893 (2) | 0.0952 (4) | 0.3927 (4) | 0.0509 (15) | |
| H17 | 0.2832 | 0.0795 | 0.3271 | 0.061* | |
| C18 | 0.3357 (2) | 0.1004 (4) | 0.4462 (4) | 0.0490 (14) | |
| H18 | 0.3604 | 0.0866 | 0.4175 | 0.059* | |
| C19 | 0.34390 (18) | 0.1265 (4) | 0.5425 (4) | 0.0403 (12) | |
| C20 | 0.30715 (18) | 0.1460 (4) | 0.5875 (4) | 0.0386 (12) | |
| C21 | 0.4269 (2) | 0.1079 (5) | 0.5650 (4) | 0.0580 (16) | |
| H21C | 0.4224 | 0.0446 | 0.5411 | 0.087* | |
| H21B | 0.4552 | 0.1113 | 0.6151 | 0.087* | |
| H21A | 0.4292 | 0.1493 | 0.5128 | 0.087* | |
| C22 | 0.4637 (2) | 0.1721 (6) | 1.0336 (5) | 0.078 (2) | |
| H22C | 0.4670 | 0.2154 | 1.0868 | 0.117* | |
| H22B | 0.4849 | 0.1891 | 0.9940 | 0.117* | |
| H22A | 0.4707 | 0.1097 | 1.0584 | 0.117* | |
| Cu1 | 0.27684 (2) | 0.16473 (5) | 0.76583 (5) | 0.04484 (17) | |
| Eu1 | 0.391175 (10) | 0.21945 (2) | 0.78342 (2) | 0.04713 (10) | |
| N1 | 0.23598 (16) | 0.1366 (4) | 0.8502 (3) | 0.0517 (12) | |
| N2 | 0.22134 (15) | 0.1633 (3) | 0.6631 (3) | 0.0479 (11) | |
| N3 | 0.4412 (2) | 0.0431 (4) | 0.8185 (4) | 0.0630 (14) | |
| N4 | 0.4195 (2) | 0.3467 (4) | 0.6366 (4) | 0.0655 (15) | |
| N5 | 0.3249 (2) | 0.3768 (4) | 0.8509 (4) | 0.0585 (14) | |
| O1 | 0.41630 (13) | 0.1752 (3) | 0.9760 (3) | 0.0545 (10) | |
| O2 | 0.33298 (13) | 0.1674 (3) | 0.8659 (3) | 0.0512 (10) | |
| O3 | 0.31885 (12) | 0.1711 (3) | 0.6814 (2) | 0.0460 (9) | |
| O4 | 0.38772 (12) | 0.1352 (3) | 0.6041 (3) | 0.0486 (9) | |
| O5 | 0.39729 (16) | 0.0448 (3) | 0.8079 (3) | 0.0659 (12) | |
| O6 | 0.4629 (2) | −0.0297 (4) | 0.8364 (4) | 0.1043 (19) | |
| O7 | 0.46107 (14) | 0.1212 (3) | 0.8105 (3) | 0.0603 (11) | |
| O8 | 0.44971 (15) | 0.2885 (3) | 0.6778 (3) | 0.0654 (11) | |
| O9 | 0.4283 (2) | 0.4068 (4) | 0.5823 (4) | 0.109 (2) | |
| O10 | 0.37998 (17) | 0.3414 (3) | 0.6562 (3) | 0.0713 (13) | |
| O11' | 0.3692 (5) | 0.3500 (9) | 0.882 (2) | 0.087 (5) | 0.66 (5) |
| O11 | 0.3575 (9) | 0.3580 (12) | 0.823 (3) | 0.052 (8) | 0.34 (5) |
| O12 | 0.31496 (19) | 0.4366 (4) | 0.9023 (4) | 0.0886 (17) | |
| O13' | 0.3033 (13) | 0.3411 (8) | 0.7776 (11) | 0.102 (9) | 0.66 (5) |
| O13 | 0.2839 (6) | 0.3421 (16) | 0.806 (2) | 0.056 (6) | 0.34 (5) |
| O14 | 0.45773 (15) | 0.3208 (3) | 0.8693 (3) | 0.0666 (12) | |
| H14O | 0.4821 | 0.3055 | 0.8486 | 0.08 (2)* | |
| C23 | 0.4620 (4) | 0.4001 (7) | 0.9424 (8) | 0.145 (4) | |
| H23C | 0.4639 | 0.4590 | 0.9104 | 0.218* | |
| H23B | 0.4898 | 0.3913 | 0.9930 | 0.218* | |
| H23A | 0.4350 | 0.4003 | 0.9700 | 0.218* |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| C1 | 0.048 (3) | 0.053 (3) | 0.038 (3) | 0.008 (3) | 0.004 (3) | −0.005 (3) |
| C2 | 0.060 (4) | 0.060 (4) | 0.036 (3) | 0.017 (3) | −0.006 (3) | −0.004 (3) |
| C3 | 0.075 (5) | 0.065 (4) | 0.034 (3) | 0.017 (3) | 0.011 (3) | 0.004 (3) |
| C4 | 0.063 (4) | 0.058 (4) | 0.040 (3) | 0.005 (3) | 0.015 (3) | 0.002 (3) |
| C5 | 0.048 (3) | 0.049 (3) | 0.034 (3) | 0.005 (3) | 0.008 (2) | 0.001 (2) |
| C6 | 0.047 (3) | 0.048 (3) | 0.033 (3) | 0.007 (3) | 0.003 (2) | −0.001 (2) |
| C7 | 0.051 (4) | 0.068 (4) | 0.047 (4) | 0.008 (3) | 0.020 (3) | 0.013 (3) |
| C8 | 0.035 (4) | 0.154 (8) | 0.055 (4) | 0.007 (4) | 0.005 (3) | 0.027 (5) |
| C9 | 0.064 (5) | 0.111 (6) | 0.071 (5) | −0.007 (4) | 0.013 (4) | 0.019 (4) |
| C10 | 0.055 (5) | 0.157 (9) | 0.104 (7) | −0.025 (5) | 0.011 (5) | 0.050 (6) |
| C11 | 0.056 (5) | 0.154 (9) | 0.090 (6) | −0.005 (5) | 0.011 (4) | 0.014 (6) |
| C12 | 0.033 (3) | 0.139 (7) | 0.066 (5) | 0.015 (4) | 0.004 (3) | 0.013 (4) |
| C13 | 0.035 (3) | 0.109 (6) | 0.056 (4) | 0.005 (3) | 0.010 (3) | 0.017 (4) |
| C14 | 0.035 (3) | 0.058 (4) | 0.044 (3) | −0.002 (3) | −0.004 (2) | 0.003 (3) |
| C15 | 0.037 (3) | 0.040 (3) | 0.035 (3) | 0.001 (2) | 0.003 (2) | 0.005 (2) |
| C16 | 0.041 (3) | 0.053 (3) | 0.037 (3) | −0.004 (3) | −0.006 (2) | 0.002 (2) |
| C17 | 0.060 (4) | 0.060 (4) | 0.031 (3) | −0.002 (3) | 0.007 (3) | 0.000 (3) |
| C18 | 0.050 (3) | 0.059 (4) | 0.040 (3) | 0.001 (3) | 0.014 (3) | −0.002 (3) |
| C19 | 0.039 (3) | 0.049 (3) | 0.033 (3) | −0.003 (2) | 0.010 (2) | 0.002 (2) |
| C20 | 0.040 (3) | 0.043 (3) | 0.031 (3) | −0.001 (2) | 0.005 (2) | 0.006 (2) |
| C21 | 0.042 (3) | 0.079 (5) | 0.055 (4) | 0.008 (3) | 0.016 (3) | −0.002 (3) |
| C22 | 0.045 (4) | 0.108 (6) | 0.067 (5) | 0.008 (4) | −0.014 (3) | 0.003 (4) |
| Cu1 | 0.0323 (3) | 0.0680 (5) | 0.0333 (4) | 0.0023 (3) | 0.0059 (3) | 0.0017 (3) |
| Eu1 | 0.03248 (14) | 0.06129 (19) | 0.04366 (16) | −0.00211 (15) | 0.00070 (11) | −0.00113 (15) |
| N1 | 0.037 (3) | 0.077 (4) | 0.041 (3) | 0.005 (2) | 0.009 (2) | 0.014 (2) |
| N2 | 0.030 (2) | 0.069 (3) | 0.042 (3) | 0.001 (2) | 0.003 (2) | 0.003 (2) |
| N3 | 0.066 (4) | 0.070 (4) | 0.047 (3) | 0.017 (3) | 0.000 (3) | 0.001 (3) |
| N4 | 0.074 (4) | 0.074 (4) | 0.045 (3) | −0.010 (3) | 0.005 (3) | 0.004 (3) |
| N5 | 0.077 (4) | 0.053 (3) | 0.053 (4) | −0.003 (3) | 0.028 (3) | 0.004 (3) |
| O1 | 0.037 (2) | 0.081 (3) | 0.040 (2) | 0.007 (2) | −0.0019 (18) | 0.0002 (19) |
| O2 | 0.039 (2) | 0.078 (3) | 0.034 (2) | 0.003 (2) | 0.0021 (17) | 0.0062 (19) |
| O3 | 0.034 (2) | 0.070 (3) | 0.033 (2) | −0.0068 (18) | 0.0078 (16) | −0.0075 (18) |
| O4 | 0.032 (2) | 0.073 (3) | 0.040 (2) | 0.0018 (18) | 0.0079 (17) | −0.0034 (19) |
| O5 | 0.052 (3) | 0.072 (3) | 0.068 (3) | −0.008 (2) | 0.004 (2) | −0.003 (2) |
| O6 | 0.098 (4) | 0.082 (4) | 0.121 (5) | 0.035 (3) | 0.000 (4) | 0.017 (3) |
| O7 | 0.040 (2) | 0.077 (3) | 0.060 (3) | 0.002 (2) | 0.005 (2) | 0.004 (2) |
| O8 | 0.052 (3) | 0.078 (3) | 0.062 (3) | 0.000 (2) | 0.003 (2) | 0.004 (2) |
| O9 | 0.117 (5) | 0.120 (5) | 0.090 (4) | −0.014 (4) | 0.025 (4) | 0.041 (4) |
| O10 | 0.057 (3) | 0.077 (3) | 0.078 (3) | 0.001 (2) | 0.011 (3) | 0.011 (3) |
| O11' | 0.059 (6) | 0.086 (7) | 0.114 (16) | 0.011 (5) | 0.019 (8) | −0.003 (7) |
| O11 | 0.038 (11) | 0.047 (8) | 0.082 (18) | −0.001 (6) | 0.034 (11) | −0.008 (9) |
| O12 | 0.111 (4) | 0.077 (3) | 0.098 (4) | −0.006 (3) | 0.065 (4) | −0.024 (3) |
| O13' | 0.19 (2) | 0.064 (6) | 0.036 (6) | 0.013 (8) | −0.014 (9) | 0.001 (4) |
| O13 | 0.045 (10) | 0.091 (11) | 0.034 (11) | 0.017 (7) | 0.011 (6) | 0.005 (8) |
| O14 | 0.049 (3) | 0.083 (3) | 0.067 (3) | −0.015 (2) | 0.013 (2) | −0.022 (2) |
| C23 | 0.121 (9) | 0.118 (8) | 0.174 (11) | −0.018 (7) | −0.012 (8) | −0.056 (8) |
| C1—C2 | 1.378 (8) | C20—O3 | 1.340 (6) |
| C1—O1 | 1.383 (7) | C21—O4 | 1.437 (6) |
| C1—C6 | 1.411 (7) | C21—H21C | 0.9600 |
| C2—C3 | 1.383 (8) | C21—H21B | 0.9600 |
| C2—H2 | 0.9300 | C21—H21A | 0.9600 |
| C3—C4 | 1.366 (8) | C22—O1 | 1.439 (7) |
| C3—H3 | 0.9300 | C22—H22C | 0.9600 |
| C4—C5 | 1.411 (7) | C22—H22B | 0.9600 |
| C4—H4 | 0.9300 | C22—H22A | 0.9600 |
| C5—C6 | 1.404 (7) | Cu1—O3 | 1.905 (3) |
| C5—C7 | 1.436 (8) | Cu1—O2 | 1.906 (4) |
| C6—O2 | 1.323 (6) | Cu1—N2 | 1.914 (4) |
| C7—N1 | 1.282 (7) | Cu1—N1 | 1.917 (5) |
| C7—H7 | 0.9300 | Cu1—Eu1 | 3.3927 (10) |
| C8—C9 | 1.458 (9) | Eu1—O11 | 2.330 (17) |
| C8—N1 | 1.497 (8) | Eu1—O3 | 2.374 (3) |
| C8—C13 | 1.518 (9) | Eu1—O2 | 2.395 (4) |
| C8—H8 | 0.9800 | Eu1—O7 | 2.436 (4) |
| C9—C10 | 1.528 (10) | Eu1—O10 | 2.467 (5) |
| C9—H9B | 0.9700 | Eu1—O11' | 2.494 (18) |
| C9—H9A | 0.9700 | Eu1—O14 | 2.503 (4) |
| C10—C11 | 1.490 (10) | Eu1—O5 | 2.511 (5) |
| C10—H10B | 0.9700 | Eu1—O8 | 2.706 (4) |
| C10—H10A | 0.9700 | Eu1—O1 | 2.725 (4) |
| C11—C12 | 1.478 (10) | Eu1—O4 | 2.785 (4) |
| C11—H11B | 0.9700 | Eu1—N3 | 2.891 (6) |
| C11—H11A | 0.9700 | N3—O6 | 1.212 (7) |
| C12—C13 | 1.525 (8) | N3—O5 | 1.261 (6) |
| C12—H12B | 0.9700 | N3—O7 | 1.271 (7) |
| C12—H12A | 0.9700 | N4—O9 | 1.215 (7) |
| C13—N2 | 1.475 (7) | N4—O8 | 1.254 (7) |
| C13—H13 | 0.9800 | N4—O10 | 1.254 (7) |
| C14—N2 | 1.270 (7) | N5—O11 | 1.146 (16) |
| C14—C15 | 1.459 (7) | N5—O13' | 1.196 (12) |
| C14—H14 | 0.9300 | N5—O12 | 1.199 (7) |
| C15—C20 | 1.400 (7) | N5—O13 | 1.32 (2) |
| C15—C16 | 1.403 (7) | N5—O11' | 1.324 (16) |
| C16—C17 | 1.360 (8) | O11'—O11 | 0.829 (18) |
| C16—H16 | 0.9300 | O11—O13' | 1.59 (2) |
| C17—C18 | 1.396 (8) | O13'—O13 | 0.77 (2) |
| C17—H17 | 0.9300 | O14—C23 | 1.516 (10) |
| C18—C19 | 1.379 (7) | O14—H14O | 0.8608 |
| C18—H18 | 0.9300 | C23—H23C | 0.9600 |
| C19—O4 | 1.381 (6) | C23—H23B | 0.9600 |
| C19—C20 | 1.399 (7) | C23—H23A | 0.9600 |
| C2—C1—O1 | 124.7 (5) | O7—Eu1—O14 | 73.87 (16) |
| C2—C1—C6 | 121.2 (6) | O10—Eu1—O14 | 84.60 (16) |
| O1—C1—C6 | 114.1 (5) | O11'—Eu1—O14 | 64.7 (3) |
| C1—C2—C3 | 119.4 (6) | O11—Eu1—O5 | 145.6 (6) |
| C1—C2—H2 | 120.3 | O3—Eu1—O5 | 79.76 (14) |
| C3—C2—H2 | 120.3 | O2—Eu1—O5 | 70.27 (14) |
| C4—C3—C2 | 121.0 (6) | O7—Eu1—O5 | 51.62 (14) |
| C4—C3—H3 | 119.5 | O10—Eu1—O5 | 142.23 (15) |
| C2—C3—H3 | 119.5 | O11'—Eu1—O5 | 132.8 (6) |
| C3—C4—C5 | 120.8 (6) | O14—Eu1—O5 | 118.75 (15) |
| C3—C4—H4 | 119.6 | O11—Eu1—O8 | 100.6 (5) |
| C5—C4—H4 | 119.6 | O3—Eu1—O8 | 111.12 (12) |
| C6—C5—C4 | 118.9 (5) | O2—Eu1—O8 | 174.02 (13) |
| C6—C5—C7 | 123.9 (5) | O7—Eu1—O8 | 71.23 (15) |
| C4—C5—C7 | 117.1 (5) | O10—Eu1—O8 | 48.42 (14) |
| O2—C6—C5 | 124.4 (5) | O11'—Eu1—O8 | 108.4 (4) |
| O2—C6—C1 | 116.9 (5) | O14—Eu1—O8 | 62.38 (14) |
| C5—C6—C1 | 118.7 (5) | O5—Eu1—O8 | 113.67 (15) |
| N1—C7—C5 | 126.2 (5) | O11—Eu1—O1 | 89.2 (10) |
| N1—C7—H7 | 116.9 | O3—Eu1—O1 | 122.53 (12) |
| C5—C7—H7 | 116.9 | O2—Eu1—O1 | 60.03 (12) |
| C9—C8—N1 | 117.7 (6) | O7—Eu1—O1 | 71.76 (13) |
| C9—C8—C13 | 114.0 (6) | O10—Eu1—O1 | 148.33 (15) |
| N1—C8—C13 | 106.2 (5) | O11'—Eu1—O1 | 70.1 (7) |
| C9—C8—H8 | 106.0 | O14—Eu1—O1 | 69.39 (14) |
| N1—C8—H8 | 106.0 | O5—Eu1—O1 | 68.86 (13) |
| C13—C8—H8 | 106.0 | O8—Eu1—O1 | 125.17 (12) |
| C8—C9—C10 | 110.2 (7) | O11—Eu1—O4 | 130.9 (11) |
| C8—C9—H9B | 109.6 | O3—Eu1—O4 | 58.82 (11) |
| C10—C9—H9B | 109.6 | O2—Eu1—O4 | 115.45 (12) |
| C8—C9—H9A | 109.6 | O7—Eu1—O4 | 75.43 (13) |
| C10—C9—H9A | 109.6 | O10—Eu1—O4 | 70.60 (14) |
| H9B—C9—H9A | 108.1 | O11'—Eu1—O4 | 150.3 (7) |
| C11—C10—C9 | 113.5 (7) | O14—Eu1—O4 | 123.37 (13) |
| C11—C10—H10B | 108.9 | O5—Eu1—O4 | 71.69 (13) |
| C9—C10—H10B | 108.9 | O8—Eu1—O4 | 63.13 (12) |
| C11—C10—H10A | 108.9 | O1—Eu1—O4 | 139.01 (12) |
| C9—C10—H10A | 108.9 | O11—Eu1—N3 | 156.8 (10) |
| H10B—C10—H10A | 107.7 | O3—Eu1—N3 | 101.48 (15) |
| C12—C11—C10 | 111.5 (7) | O2—Eu1—N3 | 92.16 (16) |
| C12—C11—H11B | 109.3 | O7—Eu1—N3 | 25.85 (14) |
| C10—C11—H11B | 109.3 | O10—Eu1—N3 | 135.45 (16) |
| C12—C11—H11A | 109.3 | O11'—Eu1—N3 | 137.5 (7) |
| C10—C11—H11A | 109.3 | O14—Eu1—N3 | 96.30 (17) |
| H11B—C11—H11A | 108.0 | O5—Eu1—N3 | 25.78 (14) |
| C11—C12—C13 | 111.6 (6) | O8—Eu1—N3 | 92.80 (16) |
| C11—C12—H12B | 109.3 | O1—Eu1—N3 | 67.59 (13) |
| C13—C12—H12B | 109.3 | O4—Eu1—N3 | 72.12 (13) |
| C11—C12—H12A | 109.3 | C7—N1—C8 | 123.6 (5) |
| C13—C12—H12A | 109.3 | C7—N1—Cu1 | 124.5 (4) |
| H12B—C12—H12A | 108.0 | C8—N1—Cu1 | 111.3 (4) |
| N2—C13—C8 | 105.9 (5) | C14—N2—C13 | 123.7 (5) |
| N2—C13—C12 | 117.0 (6) | C14—N2—Cu1 | 125.9 (4) |
| C8—C13—C12 | 110.9 (6) | C13—N2—Cu1 | 110.4 (4) |
| N2—C13—H13 | 107.5 | O6—N3—O5 | 120.8 (7) |
| C8—C13—H13 | 107.5 | O6—N3—O7 | 122.5 (6) |
| C12—C13—H13 | 107.5 | O5—N3—O7 | 116.7 (5) |
| N2—C14—C15 | 124.5 (5) | O6—N3—Eu1 | 177.7 (5) |
| N2—C14—H14 | 117.8 | O5—N3—Eu1 | 60.0 (3) |
| C15—C14—H14 | 117.8 | O7—N3—Eu1 | 56.7 (3) |
| C20—C15—C16 | 119.2 (5) | O9—N4—O8 | 122.0 (7) |
| C20—C15—C14 | 123.8 (5) | O9—N4—O10 | 121.5 (7) |
| C16—C15—C14 | 117.0 (5) | O8—N4—O10 | 116.5 (6) |
| C17—C16—C15 | 120.5 (5) | O9—N4—Eu1 | 172.0 (6) |
| C17—C16—H16 | 119.7 | O8—N4—Eu1 | 63.9 (3) |
| C15—C16—H16 | 119.7 | O10—N4—Eu1 | 52.8 (3) |
| C16—C17—C18 | 121.3 (5) | O11—N5—O13' | 85.5 (11) |
| C16—C17—H17 | 119.4 | O11—N5—O12 | 135.6 (13) |
| C18—C17—H17 | 119.4 | O13'—N5—O12 | 132.2 (17) |
| C19—C18—C17 | 118.4 (5) | O11—N5—O13 | 119.4 (13) |
| C19—C18—H18 | 120.8 | O13'—N5—O13 | 35.4 (10) |
| C17—C18—H18 | 120.8 | O12—N5—O13 | 103.4 (12) |
| C18—C19—O4 | 124.9 (5) | O11—N5—O11' | 38.4 (11) |
| C18—C19—C20 | 121.7 (5) | O13'—N5—O11' | 116.5 (11) |
| O4—C19—C20 | 113.4 (4) | O12—N5—O11' | 111.2 (12) |
| O3—C20—C19 | 117.1 (5) | O13—N5—O11' | 139.9 (11) |
| O3—C20—C15 | 124.1 (5) | C1—O1—C22 | 117.3 (5) |
| C19—C20—C15 | 118.8 (5) | C1—O1—Eu1 | 117.5 (3) |
| O4—C21—H21C | 109.5 | C22—O1—Eu1 | 125.1 (4) |
| O4—C21—H21B | 109.5 | C6—O2—Cu1 | 125.4 (3) |
| H21C—C21—H21B | 109.5 | C6—O2—Eu1 | 130.9 (3) |
| O4—C21—H21A | 109.5 | Cu1—O2—Eu1 | 103.56 (16) |
| H21C—C21—H21A | 109.5 | C20—O3—Cu1 | 123.6 (3) |
| H21B—C21—H21A | 109.5 | C20—O3—Eu1 | 131.9 (3) |
| O1—C22—H22C | 109.5 | Cu1—O3—Eu1 | 104.37 (15) |
| O1—C22—H22B | 109.5 | C19—O4—C21 | 116.2 (4) |
| H22C—C22—H22B | 109.5 | C19—O4—Eu1 | 116.5 (3) |
| O1—C22—H22A | 109.5 | C21—O4—Eu1 | 127.0 (3) |
| H22C—C22—H22A | 109.5 | N3—O5—Eu1 | 94.2 (4) |
| H22B—C22—H22A | 109.5 | N3—O7—Eu1 | 97.5 (3) |
| O3—Cu1—O2 | 83.82 (15) | N4—O8—Eu1 | 91.6 (4) |
| O3—Cu1—N2 | 94.78 (18) | N4—O10—Eu1 | 103.3 (4) |
| O2—Cu1—N2 | 178.52 (19) | O11—O11'—N5 | 59.1 (16) |
| O3—Cu1—N1 | 170.7 (2) | O11—O11'—Eu1 | 69 (2) |
| O2—Cu1—N1 | 95.66 (18) | N5—O11'—Eu1 | 113.0 (14) |
| N2—Cu1—N1 | 85.8 (2) | O11'—O11—N5 | 83 (2) |
| O3—Cu1—Eu1 | 42.67 (10) | O11'—O11—O13' | 122 (2) |
| O2—Cu1—Eu1 | 43.33 (11) | N5—O11—O13' | 48.6 (8) |
| N2—Cu1—Eu1 | 135.19 (14) | O11'—O11—Eu1 | 92 (2) |
| N1—Cu1—Eu1 | 138.63 (15) | N5—O11—Eu1 | 135.5 (12) |
| O11—Eu1—O3 | 91.4 (8) | O13'—O11—Eu1 | 102.4 (15) |
| O11—Eu1—O2 | 75.9 (5) | O13—O13'—N5 | 81 (2) |
| O3—Eu1—O2 | 64.54 (12) | O13—O13'—O11 | 125 (2) |
| O11—Eu1—O7 | 146.6 (9) | N5—O13'—O11 | 45.9 (8) |
| O3—Eu1—O7 | 121.96 (14) | O13—O13'—Eu1 | 135 (2) |
| O2—Eu1—O7 | 114.39 (14) | N5—O13'—Eu1 | 86.7 (16) |
| O11—Eu1—O10 | 65.7 (9) | O11—O13'—Eu1 | 47.4 (11) |
| O3—Eu1—O10 | 79.09 (14) | O13'—O13—N5 | 64 (2) |
| O2—Eu1—O10 | 125.68 (14) | C23—O14—Eu1 | 133.8 (5) |
| O7—Eu1—O10 | 118.94 (16) | C23—O14—H14O | 118.5 |
| O11—Eu1—O11' | 19.4 (5) | Eu1—O14—H14O | 107.7 |
| O3—Eu1—O11' | 104.2 (4) | O14—C23—H23C | 109.5 |
| O2—Eu1—O11' | 69.7 (4) | O14—C23—H23B | 109.5 |
| O7—Eu1—O11' | 131.0 (6) | H23C—C23—H23B | 109.5 |
| O10—Eu1—O11' | 82.8 (7) | O14—C23—H23A | 109.5 |
| O11—Eu1—O14 | 73.8 (7) | H23C—C23—H23A | 109.5 |
| O3—Eu1—O14 | 161.47 (15) | H23B—C23—H23A | 109.5 |
| O2—Eu1—O14 | 120.33 (14) |
Experimental details
| Crystal data | |
| Chemical formula | [CuEu(C22H24N2O4)(NO3)3(CH4O)] |
| Mr | 814.02 |
| Crystal system, space group | Monoclinic, C2/c |
| Temperature (K) | 295 |
| a, b, c (Å) | 29.305 (6), 14.233 (3), 14.141 (3) |
| β (°) | 103.36 (3) |
| V (Å3) | 5739 (2) |
| Z | 8 |
| Radiation type | Mo Kα |
| µ (mm−1) | 2.99 |
| Crystal size (mm) | 0.14 × 0.12 × 0.11 |
| Data collection | |
| Diffractometer | Bruker SMART1000 CCD |
| Absorption correction | Multi-scan (SADABS; Sheldrick, 2003) |
| Tmin, Tmax | 0.677, 0.727 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 27154, 6537, 4621 |
| Rint | 0.061 |
| (sin θ/λ)max (Å−1) | 0.649 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.049, 0.091, 1.07 |
| No. of reflections | 6537 |
| No. of parameters | 420 |
| No. of restraints | 13 |
| H-atom treatment | H-atom parameters constrained |
| w = 1/[σ2(Fo2) + (0.0119P)2 + 37.7609P] where P = (Fo2 + 2Fc2)/3 | |
| Δρmax, Δρmin (e Å−3) | 0.80, −1.11 |
Computer programs: SMART (Bruker, 2001), SAINT-Plus (Bruker, 2003), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), SHELXTL (Sheldrick, 2008).
Acknowledgements
This work was supported financially by the National Natural Science Foundation of China (grant Nos. 20872030 and 20972043), Heilongjiang Province (grant Nos. 2009RFXXG201, GC09A402 and 2010td03) and Heilongjiang University.
References
Aslantaş, M., Tümer, M., Şahin, E. & Tümer, F. (2007). Acta Cryst. E63, o644–o645. Web of Science CSD CrossRef IUCr Journals Google Scholar
Bruker (2001). SMART. Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
Bruker (2003). SAINT-Plus. Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
Costes, J. P., Dahan, F. & Dupuis, A. (2000). Inorg. Chem. 39, 165–168. Web of Science CSD CrossRef PubMed CAS Google Scholar
Costes, J. P., Donnadieu, B., Gheorghe, R. & Tuchagues, J. P. (2008). Eur. J. Inorg. Chem. pp. 5235–5244. Web of Science CSD CrossRef Google Scholar
Koner, R., Lee, G. H., Wang, Y., Wei, H. H. & Mohanta, S. (2005). Eur. J. Inorg. Chem. pp. 1500–1505. Web of Science CSD CrossRef Google Scholar
Mohamed, E. M., Muralidharan, S., Panchanatheswaran, K., Ramesh, R., Low, J. N. & Glidewell, C. (2003). Acta Cryst. C59, o367–o369. Web of Science CSD CrossRef CAS IUCr Journals Google Scholar
Sheldrick, G. M. (2003). SADABS. University of Göttingen, Germany. Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Sun, W.-B., Yan, P.-F., Li, G.-M. & Hou, G.-F. (2009). Acta Cryst. E65, m780–m781. Web of Science CSD CrossRef IUCr Journals Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
![[Figure 1]](./rk2221fig1thm.gif)




In continuation of our studies of salen-type lanthanide complexes (Aslantaş et al., 2007, Mohamed et al., 2003, Sun et al., 2009), we present here the crystal structure of the title compound. The EuIII center is ligated to two bidentate nitrate groups and four oxygen atoms from the ligand, one oxygen, from the bridging nitrate group and one methanol molecule (Fig. 1). It is similar to the previously reported structures (Costes et al., 2000, 2008; Koner et al., 2005). The decacoordinated EuIII ion presents a narrow spread in Eu–O bond distances 2.338 (18)-2.786 (4)Å. The Cu(II) ion is five-coordinated by two imine nitrogen atoms, two phenol oxygen atoms from the imine-phenolate ligand and one oxygen atom from the bridgin nitrate group.