metal-organic compounds
[(Nitrato-κ2O,O′)(nitrito-κ2O,O′)(0.25/1.75)]bis(1,10-phenanthroline-κ2N,N′)cadmium(II)
aDepartment of Chemistry, General Campus, Shahid Beheshti University, Tehran 1983963113, Iran, and bDepartment of Chemistry, University of Malaya, 50603 Kuala Lumpur, Malaysia
*Correspondence e-mail: [email protected]
The reaction of cadmium nitrate and sodium nitrite in the presence of 1,10-phenanthroline yields the mixed nitrate–nitrite title complex, [Cd(NO2)1.75(NO3)0.25(C12H8N2)2]. The metal ion is bis-chelated by two N-heterocycles as well as by the nitrate/nitrite ions in a distorted dodecahedral CdN4O4 coordination environment. One nitrite group is ordered; the other is disordered with respect to a nitrate group (ratio 0.75:0.25) concerning the O atom that is not involved in bonding to the metal ion.
Related literature
For the of [Cd(NO3)2(C12H8N2)2], see: Tadjarodi et al. (2001
) and for the crystal structure of [Cd(NO2)2(C12H8N2)2], see: Abedini et al. (2005
).
Experimental
Crystal data
|
Refinement
|
| ||||||||||||||||||||
Data collection: CrysAlis PRO (Agilent Technologies, 2010
); cell refinement: CrysAlis PRO; data reduction: CrysAlis PRO; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: X-SEED (Barbour, 2001
); software used to prepare material for publication: publCIF (Westrip, 2010
).
Supporting information
contains datablocks global, I. DOI: 10.1107/S1600536811002431/wm2452sup1.cif
Structure factors: contains datablock I. DOI: 10.1107/S1600536811002431/wm2452Isup2.hkl
Cadmium nitrate (1 mmol), sodium nitrite (1 mmol) and 1,10-phenanthroline (1 mmol) were loaded into a convection tube. The tube was filled with dry methanol and kept at 333 K. Colorless crystals were collected from the side arm of the tube after several days.
Carbon-bound H-atoms were placed in calculated positions [C—H 0.95 Å, Uiso(H) 1.2Ueq(C)] and were included in the in the riding model approximation.
The structure, when refined as a dinitrite, had a high remaining peak approximately 1.2 Å away from one of the two N atoms of the nitrite groups. This site was allow to refine as an O atom of a disordered nitrate group. As the occupancy refined to nearly 1/4, its occupancy was eventually fixed as 0.25.
Data collection: CrysAlis PRO (Agilent Technologies, 2010); cell CrysAlis PRO (Agilent Technologies, 2010); data reduction: CrysAlis PRO (Agilent Technologies, 2010); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: X-SEED (Barbour, 2001); software used to prepare material for publication: publCIF (Westrip, 2010).
| Fig. 1. Thermal ellipsoid plot (Barbour, 2001) of Cd(NO2)1.75(NO3)0.25(C12H8N2)2 at the 70% probability level; hydrogen atoms are drawn as spheres of arbitrary radius. |
| [Cd(NO2)1.75(NO3)0.25(C12H8N2)2] | Z = 2 |
| Mr = 568.83 | F(000) = 568 |
| Triclinic, P1 | Dx = 1.720 Mg m−3 |
| Hall symbol: -P 1 | Mo Kα radiation, λ = 0.71073 Å |
| a = 9.1470 (4) Å | Cell parameters from 4883 reflections |
| b = 10.1866 (4) Å | θ = 2.4–29.3° |
| c = 13.0057 (6) Å | µ = 1.04 mm−1 |
| α = 76.953 (4)° | T = 100 K |
| β = 77.270 (4)° | Irregular, colorless |
| γ = 70.404 (4)° | 0.30 × 0.20 × 0.10 mm |
| V = 1098.27 (8) Å3 |
| Agilent Technologies SuperNova Dual diffractometer with an Atlas detector | 4852 independent reflections |
| Radiation source: SuperNova X-ray Source | 4256 reflections with I > 2σ(I) |
| Mirror monochromator | Rint = 0.032 |
| Detector resolution: 10.4041 pixels mm-1 | θmax = 27.5°, θmin = 2.4° |
| ω scans | h = −10→11 |
| Absorption correction: multi-scan (CrysAlis PRO; Agilent Technologies, 2010) | k = −13→11 |
| Tmin = 0.745, Tmax = 0.903 | l = −16→12 |
| 8702 measured reflections |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.033 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.073 | H-atom parameters constrained |
| S = 1.02 | w = 1/[σ2(Fo2) + (0.0283P)2 + 0.1342P] where P = (Fo2 + 2Fc2)/3 |
| 4852 reflections | (Δ/σ)max = 0.001 |
| 325 parameters | Δρmax = 0.49 e Å−3 |
| 0 restraints | Δρmin = −0.69 e Å−3 |
| [Cd(NO2)1.75(NO3)0.25(C12H8N2)2] | γ = 70.404 (4)° |
| Mr = 568.83 | V = 1098.27 (8) Å3 |
| Triclinic, P1 | Z = 2 |
| a = 9.1470 (4) Å | Mo Kα radiation |
| b = 10.1866 (4) Å | µ = 1.04 mm−1 |
| c = 13.0057 (6) Å | T = 100 K |
| α = 76.953 (4)° | 0.30 × 0.20 × 0.10 mm |
| β = 77.270 (4)° |
| Agilent Technologies SuperNova Dual diffractometer with an Atlas detector | 4852 independent reflections |
| Absorption correction: multi-scan (CrysAlis PRO; Agilent Technologies, 2010) | 4256 reflections with I > 2σ(I) |
| Tmin = 0.745, Tmax = 0.903 | Rint = 0.032 |
| 8702 measured reflections |
| R[F2 > 2σ(F2)] = 0.033 | 0 restraints |
| wR(F2) = 0.073 | H-atom parameters constrained |
| S = 1.02 | Δρmax = 0.49 e Å−3 |
| 4852 reflections | Δρmin = −0.69 e Å−3 |
| 325 parameters |
Geometry. All e.s.d.'s (except the e.s.d. in the dihedral angle between two l.s. planes) are estimated using the full covariance matrix. The cell e.s.d.'s are taken into account individually in the estimation of e.s.d.'s in distances, angles and torsion angles; correlations between e.s.d.'s in cell parameters are only used when they are defined by crystal symmetry. An approximate (isotropic) treatment of cell e.s.d.'s is used for estimating e.s.d.'s involving l.s. planes. |
| x | y | z | Uiso*/Ueq | Occ. (<1) | |
| Cd1 | 0.55052 (2) | 0.243966 (18) | 0.241633 (15) | 0.01614 (7) | |
| N1 | 0.7446 (3) | −0.0427 (2) | 0.3117 (2) | 0.0230 (5) | |
| N2 | 0.8042 (3) | 0.3662 (3) | 0.1701 (2) | 0.0297 (6) | |
| N3 | 0.4863 (3) | 0.2130 (2) | 0.07978 (17) | 0.0169 (5) | |
| N4 | 0.3528 (3) | 0.1267 (2) | 0.28117 (17) | 0.0154 (5) | |
| N5 | 0.3074 (3) | 0.4518 (2) | 0.22889 (17) | 0.0178 (5) | |
| N6 | 0.4512 (3) | 0.3368 (2) | 0.40496 (18) | 0.0192 (5) | |
| O1 | 0.7414 (2) | 0.01355 (19) | 0.21528 (15) | 0.0232 (4) | |
| O2 | 0.6588 (2) | 0.0353 (2) | 0.37712 (15) | 0.0244 (5) | |
| O3 | 0.6973 (3) | 0.3783 (2) | 0.11795 (17) | 0.0324 (5) | |
| O4 | 0.7905 (3) | 0.2957 (2) | 0.26214 (17) | 0.0311 (5) | |
| O5 | 0.9091 (12) | 0.4103 (10) | 0.1371 (8) | 0.042 (2) | 0.25 |
| C1 | 0.5549 (4) | 0.2514 (3) | −0.0180 (2) | 0.0207 (6) | |
| H1 | 0.6401 | 0.2882 | −0.0259 | 0.025* | |
| C2 | 0.5079 (4) | 0.2403 (3) | −0.1101 (2) | 0.0245 (7) | |
| H2 | 0.5599 | 0.2697 | −0.1788 | 0.029* | |
| C3 | 0.3864 (4) | 0.1866 (3) | −0.1000 (2) | 0.0214 (6) | |
| H3 | 0.3534 | 0.1778 | −0.1617 | 0.026* | |
| C4 | 0.3102 (3) | 0.1446 (3) | 0.0025 (2) | 0.0172 (6) | |
| C5 | 0.3661 (3) | 0.1595 (2) | 0.0909 (2) | 0.0150 (5) | |
| C6 | 0.1825 (3) | 0.0874 (3) | 0.0203 (2) | 0.0212 (6) | |
| H6 | 0.1455 | 0.0768 | −0.0392 | 0.025* | |
| C7 | 0.1132 (4) | 0.0480 (3) | 0.1201 (2) | 0.0220 (6) | |
| H7 | 0.0260 | 0.0133 | 0.1297 | 0.026* | |
| C8 | 0.1691 (3) | 0.0577 (3) | 0.2120 (2) | 0.0181 (6) | |
| C9 | 0.2942 (3) | 0.1139 (2) | 0.1978 (2) | 0.0151 (6) | |
| C10 | 0.1059 (4) | 0.0116 (3) | 0.3171 (2) | 0.0231 (6) | |
| H10 | 0.0202 | −0.0261 | 0.3305 | 0.028* | |
| C11 | 0.1695 (3) | 0.0216 (3) | 0.4007 (2) | 0.0224 (6) | |
| H11 | 0.1302 | −0.0116 | 0.4722 | 0.027* | |
| C12 | 0.2919 (3) | 0.0807 (3) | 0.3790 (2) | 0.0193 (6) | |
| H12 | 0.3337 | 0.0884 | 0.4374 | 0.023* | |
| C13 | 0.2348 (4) | 0.5050 (3) | 0.1442 (2) | 0.0208 (6) | |
| H13 | 0.2824 | 0.4683 | 0.0798 | 0.025* | |
| C14 | 0.0912 (4) | 0.6131 (3) | 0.1453 (2) | 0.0242 (7) | |
| H14 | 0.0419 | 0.6469 | 0.0833 | 0.029* | |
| C15 | 0.0235 (4) | 0.6689 (3) | 0.2363 (2) | 0.0246 (7) | |
| H15 | −0.0732 | 0.7429 | 0.2381 | 0.029* | |
| C16 | 0.0972 (3) | 0.6166 (3) | 0.3281 (2) | 0.0195 (6) | |
| C17 | 0.2391 (3) | 0.5055 (3) | 0.3202 (2) | 0.0171 (6) | |
| C18 | 0.0342 (4) | 0.6698 (3) | 0.4263 (2) | 0.0240 (7) | |
| H18 | −0.0612 | 0.7451 | 0.4309 | 0.029* | |
| C19 | 0.1074 (4) | 0.6156 (3) | 0.5130 (2) | 0.0240 (7) | |
| H19 | 0.0644 | 0.6547 | 0.5768 | 0.029* | |
| C20 | 0.2491 (4) | 0.4999 (3) | 0.5094 (2) | 0.0209 (6) | |
| C21 | 0.3163 (3) | 0.4449 (3) | 0.4137 (2) | 0.0175 (6) | |
| C22 | 0.3269 (4) | 0.4374 (3) | 0.5986 (2) | 0.0242 (7) | |
| H22 | 0.2855 | 0.4706 | 0.6648 | 0.029* | |
| C23 | 0.4628 (4) | 0.3281 (3) | 0.5883 (2) | 0.0269 (7) | |
| H23 | 0.5165 | 0.2837 | 0.6477 | 0.032* | |
| C24 | 0.5216 (4) | 0.2824 (3) | 0.4898 (2) | 0.0233 (6) | |
| H24 | 0.6177 | 0.2080 | 0.4836 | 0.028* |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Cd1 | 0.01776 (13) | 0.01855 (11) | 0.01235 (11) | −0.00468 (8) | −0.00285 (8) | −0.00377 (8) |
| N1 | 0.0219 (14) | 0.0227 (12) | 0.0237 (14) | −0.0033 (10) | −0.0042 (11) | −0.0069 (11) |
| N2 | 0.0284 (17) | 0.0363 (15) | 0.0304 (15) | −0.0163 (13) | 0.0004 (13) | −0.0124 (12) |
| N3 | 0.0190 (13) | 0.0177 (11) | 0.0145 (12) | −0.0060 (9) | −0.0005 (10) | −0.0050 (9) |
| N4 | 0.0149 (13) | 0.0173 (11) | 0.0116 (11) | −0.0024 (9) | −0.0016 (10) | −0.0021 (9) |
| N5 | 0.0247 (14) | 0.0156 (11) | 0.0137 (12) | −0.0073 (10) | −0.0027 (10) | −0.0021 (9) |
| N6 | 0.0219 (14) | 0.0186 (11) | 0.0189 (12) | −0.0043 (10) | −0.0082 (11) | −0.0043 (10) |
| O1 | 0.0218 (12) | 0.0298 (10) | 0.0171 (11) | −0.0051 (9) | −0.0027 (9) | −0.0063 (9) |
| O2 | 0.0224 (12) | 0.0309 (11) | 0.0177 (11) | −0.0022 (9) | −0.0037 (9) | −0.0081 (9) |
| O3 | 0.0370 (15) | 0.0430 (13) | 0.0277 (12) | −0.0244 (11) | −0.0071 (11) | −0.0057 (10) |
| O4 | 0.0328 (14) | 0.0357 (12) | 0.0275 (13) | −0.0096 (10) | −0.0054 (11) | −0.0110 (10) |
| O5 | 0.031 (6) | 0.053 (6) | 0.054 (6) | −0.035 (5) | 0.001 (5) | −0.009 (5) |
| C1 | 0.0216 (17) | 0.0242 (14) | 0.0180 (15) | −0.0102 (12) | −0.0011 (12) | −0.0035 (12) |
| C2 | 0.0307 (19) | 0.0293 (15) | 0.0130 (14) | −0.0130 (13) | 0.0029 (13) | −0.0027 (12) |
| C3 | 0.0274 (18) | 0.0234 (14) | 0.0154 (14) | −0.0083 (12) | −0.0044 (13) | −0.0056 (12) |
| C4 | 0.0192 (16) | 0.0164 (13) | 0.0161 (14) | −0.0030 (11) | −0.0045 (12) | −0.0048 (11) |
| C5 | 0.0160 (15) | 0.0132 (12) | 0.0140 (13) | −0.0003 (10) | −0.0034 (11) | −0.0043 (10) |
| C6 | 0.0227 (17) | 0.0243 (14) | 0.0201 (15) | −0.0068 (12) | −0.0091 (13) | −0.0056 (12) |
| C7 | 0.0182 (16) | 0.0262 (14) | 0.0248 (16) | −0.0086 (12) | −0.0045 (13) | −0.0062 (13) |
| C8 | 0.0148 (15) | 0.0194 (13) | 0.0188 (14) | −0.0032 (11) | −0.0024 (12) | −0.0038 (11) |
| C9 | 0.0148 (15) | 0.0119 (12) | 0.0143 (13) | 0.0020 (10) | −0.0024 (11) | −0.0026 (10) |
| C10 | 0.0166 (16) | 0.0298 (15) | 0.0225 (16) | −0.0090 (12) | −0.0013 (13) | −0.0021 (13) |
| C11 | 0.0176 (16) | 0.0305 (15) | 0.0147 (14) | −0.0076 (12) | 0.0008 (12) | 0.0021 (12) |
| C12 | 0.0162 (15) | 0.0235 (14) | 0.0151 (14) | −0.0032 (11) | −0.0011 (12) | −0.0027 (11) |
| C13 | 0.0279 (18) | 0.0167 (13) | 0.0167 (14) | −0.0053 (12) | −0.0049 (13) | −0.0012 (11) |
| C14 | 0.0268 (18) | 0.0201 (14) | 0.0212 (16) | −0.0029 (12) | −0.0088 (14) | 0.0038 (12) |
| C15 | 0.0252 (18) | 0.0171 (13) | 0.0278 (17) | −0.0012 (12) | −0.0071 (14) | −0.0015 (12) |
| C16 | 0.0213 (17) | 0.0152 (13) | 0.0188 (15) | −0.0046 (11) | 0.0010 (12) | −0.0020 (11) |
| C17 | 0.0195 (16) | 0.0157 (13) | 0.0165 (14) | −0.0073 (11) | 0.0004 (12) | −0.0032 (11) |
| C18 | 0.0243 (17) | 0.0176 (13) | 0.0275 (17) | −0.0053 (12) | 0.0013 (14) | −0.0053 (12) |
| C19 | 0.0297 (18) | 0.0203 (14) | 0.0213 (16) | −0.0088 (13) | 0.0046 (13) | −0.0088 (12) |
| C20 | 0.0231 (17) | 0.0207 (14) | 0.0205 (15) | −0.0101 (12) | −0.0005 (13) | −0.0038 (12) |
| C21 | 0.0214 (16) | 0.0161 (13) | 0.0155 (14) | −0.0086 (11) | −0.0007 (12) | −0.0014 (11) |
| C22 | 0.0327 (19) | 0.0289 (15) | 0.0147 (14) | −0.0134 (14) | 0.0005 (13) | −0.0087 (12) |
| C23 | 0.035 (2) | 0.0279 (15) | 0.0201 (16) | −0.0068 (14) | −0.0116 (14) | −0.0051 (13) |
| C24 | 0.0240 (17) | 0.0238 (14) | 0.0226 (16) | −0.0036 (12) | −0.0077 (13) | −0.0064 (12) |
| Cd1—O3 | 2.355 (2) | C6—H6 | 0.9500 |
| Cd1—N6 | 2.390 (2) | C7—C8 | 1.434 (4) |
| Cd1—N4 | 2.393 (2) | C7—H7 | 0.9500 |
| Cd1—N3 | 2.418 (2) | C8—C10 | 1.403 (4) |
| Cd1—O1 | 2.4547 (19) | C8—C9 | 1.403 (4) |
| Cd1—O4 | 2.503 (2) | C10—C11 | 1.377 (4) |
| Cd1—O2 | 2.5041 (19) | C10—H10 | 0.9500 |
| Cd1—N5 | 2.510 (2) | C11—C12 | 1.391 (4) |
| N1—O2 | 1.250 (3) | C11—H11 | 0.9500 |
| N1—O1 | 1.258 (3) | C12—H12 | 0.9500 |
| N2—O5 | 1.151 (9) | C13—C14 | 1.403 (4) |
| N2—O4 | 1.254 (3) | C13—H13 | 0.9500 |
| N2—O3 | 1.267 (3) | C14—C15 | 1.362 (4) |
| N3—C1 | 1.323 (3) | C14—H14 | 0.9500 |
| N3—C5 | 1.349 (3) | C15—C16 | 1.410 (4) |
| N4—C12 | 1.320 (3) | C15—H15 | 0.9500 |
| N4—C9 | 1.359 (3) | C16—C17 | 1.409 (4) |
| N5—C13 | 1.326 (3) | C16—C18 | 1.428 (4) |
| N5—C17 | 1.356 (3) | C17—C21 | 1.451 (4) |
| N6—C24 | 1.319 (3) | C18—C19 | 1.351 (4) |
| N6—C21 | 1.353 (4) | C18—H18 | 0.9500 |
| C1—C2 | 1.398 (4) | C19—C20 | 1.430 (4) |
| C1—H1 | 0.9500 | C19—H19 | 0.9500 |
| C2—C3 | 1.365 (4) | C20—C22 | 1.409 (4) |
| C2—H2 | 0.9500 | C20—C21 | 1.410 (4) |
| C3—C4 | 1.406 (4) | C22—C23 | 1.367 (4) |
| C3—H3 | 0.9500 | C22—H22 | 0.9500 |
| C4—C5 | 1.414 (3) | C23—C24 | 1.395 (4) |
| C4—C6 | 1.426 (4) | C23—H23 | 0.9500 |
| C5—C9 | 1.447 (4) | C24—H24 | 0.9500 |
| C6—C7 | 1.350 (4) | ||
| O3—Cd1—N6 | 111.58 (7) | N3—C5—C4 | 122.6 (2) |
| O3—Cd1—N4 | 149.81 (7) | N3—C5—C9 | 118.3 (2) |
| N6—Cd1—N4 | 90.18 (8) | C4—C5—C9 | 119.1 (2) |
| O3—Cd1—N3 | 81.88 (7) | C7—C6—C4 | 121.2 (2) |
| N6—Cd1—N3 | 145.83 (8) | C7—C6—H6 | 119.4 |
| N4—Cd1—N3 | 68.85 (7) | C4—C6—H6 | 119.4 |
| O3—Cd1—O1 | 95.42 (7) | C6—C7—C8 | 121.0 (3) |
| N6—Cd1—O1 | 127.58 (7) | C6—C7—H7 | 119.5 |
| N4—Cd1—O1 | 86.59 (7) | C8—C7—H7 | 119.5 |
| N3—Cd1—O1 | 79.44 (7) | C10—C8—C9 | 117.5 (2) |
| O3—Cd1—O4 | 51.44 (7) | C10—C8—C7 | 123.1 (3) |
| N6—Cd1—O4 | 81.44 (8) | C9—C8—C7 | 119.4 (3) |
| N4—Cd1—O4 | 157.42 (7) | N4—C9—C8 | 122.6 (2) |
| N3—Cd1—O4 | 127.41 (8) | N4—C9—C5 | 117.8 (2) |
| O1—Cd1—O4 | 82.14 (7) | C8—C9—C5 | 119.6 (2) |
| O3—Cd1—O2 | 125.56 (7) | C11—C10—C8 | 119.2 (3) |
| N6—Cd1—O2 | 77.83 (7) | C11—C10—H10 | 120.4 |
| N4—Cd1—O2 | 78.09 (7) | C8—C10—H10 | 120.4 |
| N3—Cd1—O2 | 120.90 (6) | C10—C11—C12 | 119.3 (3) |
| O1—Cd1—O2 | 50.33 (6) | C10—C11—H11 | 120.4 |
| O4—Cd1—O2 | 79.66 (7) | C12—C11—H11 | 120.4 |
| O3—Cd1—N5 | 89.71 (8) | N4—C12—C11 | 123.0 (3) |
| N6—Cd1—N5 | 67.54 (7) | N4—C12—H12 | 118.5 |
| N4—Cd1—N5 | 79.26 (7) | C11—C12—H12 | 118.5 |
| N3—Cd1—N5 | 81.80 (7) | N5—C13—C14 | 123.1 (3) |
| O1—Cd1—N5 | 159.63 (7) | N5—C13—H13 | 118.4 |
| O4—Cd1—N5 | 115.94 (7) | C14—C13—H13 | 118.4 |
| O2—Cd1—N5 | 138.17 (7) | C15—C14—C13 | 119.1 (3) |
| O2—N1—O1 | 114.4 (2) | C15—C14—H14 | 120.5 |
| O5—N2—O4 | 121.3 (5) | C13—C14—H14 | 120.5 |
| O5—N2—O3 | 124.7 (6) | C14—C15—C16 | 119.8 (3) |
| O4—N2—O3 | 113.9 (2) | C14—C15—H15 | 120.1 |
| C1—N3—C5 | 118.4 (2) | C16—C15—H15 | 120.1 |
| C1—N3—Cd1 | 124.62 (18) | C17—C16—C15 | 117.0 (3) |
| C5—N3—Cd1 | 116.90 (17) | C17—C16—C18 | 119.7 (3) |
| C12—N4—C9 | 118.3 (2) | C15—C16—C18 | 123.2 (3) |
| C12—N4—Cd1 | 123.87 (17) | N5—C17—C16 | 122.9 (2) |
| C9—N4—Cd1 | 117.69 (17) | N5—C17—C21 | 118.1 (2) |
| C13—N5—C17 | 118.0 (2) | C16—C17—C21 | 119.0 (3) |
| C13—N5—Cd1 | 125.85 (19) | C19—C18—C16 | 121.5 (3) |
| C17—N5—Cd1 | 115.91 (17) | C19—C18—H18 | 119.3 |
| C24—N6—C21 | 118.0 (3) | C16—C18—H18 | 119.3 |
| C24—N6—Cd1 | 121.76 (19) | C18—C19—C20 | 120.5 (3) |
| C21—N6—Cd1 | 120.25 (17) | C18—C19—H19 | 119.7 |
| N1—O1—Cd1 | 98.71 (15) | C20—C19—H19 | 119.7 |
| N1—O2—Cd1 | 96.51 (15) | C22—C20—C21 | 117.6 (3) |
| N2—O3—Cd1 | 100.74 (17) | C22—C20—C19 | 122.5 (3) |
| N2—O4—Cd1 | 93.91 (16) | C21—C20—C19 | 119.9 (3) |
| N3—C1—C2 | 123.1 (3) | N6—C21—C20 | 122.6 (2) |
| N3—C1—H1 | 118.5 | N6—C21—C17 | 118.0 (2) |
| C2—C1—H1 | 118.5 | C20—C21—C17 | 119.3 (3) |
| C3—C2—C1 | 119.1 (3) | C23—C22—C20 | 119.0 (3) |
| C3—C2—H2 | 120.4 | C23—C22—H22 | 120.5 |
| C1—C2—H2 | 120.4 | C20—C22—H22 | 120.5 |
| C2—C3—C4 | 119.6 (2) | C22—C23—C24 | 119.3 (3) |
| C2—C3—H3 | 120.2 | C22—C23—H23 | 120.4 |
| C4—C3—H3 | 120.2 | C24—C23—H23 | 120.4 |
| C3—C4—C5 | 117.2 (2) | N6—C24—C23 | 123.5 (3) |
| C3—C4—C6 | 123.3 (2) | N6—C24—H24 | 118.2 |
| C5—C4—C6 | 119.5 (3) | C23—C24—H24 | 118.2 |
| O3—Cd1—N3—C1 | 9.7 (2) | O3—N2—O4—Cd1 | 1.6 (2) |
| N6—Cd1—N3—C1 | 126.5 (2) | O3—Cd1—O4—N2 | −0.98 (16) |
| N4—Cd1—N3—C1 | −177.9 (2) | N6—Cd1—O4—N2 | −127.53 (17) |
| O1—Cd1—N3—C1 | −87.4 (2) | N4—Cd1—O4—N2 | 163.19 (18) |
| O4—Cd1—N3—C1 | −16.0 (2) | N3—Cd1—O4—N2 | 32.21 (19) |
| O2—Cd1—N3—C1 | −117.2 (2) | O1—Cd1—O4—N2 | 102.42 (17) |
| N5—Cd1—N3—C1 | 100.5 (2) | O2—Cd1—O4—N2 | 153.38 (17) |
| O3—Cd1—N3—C5 | −166.68 (19) | N5—Cd1—O4—N2 | −67.72 (18) |
| N6—Cd1—N3—C5 | −49.9 (2) | C5—N3—C1—C2 | 0.6 (4) |
| N4—Cd1—N3—C5 | 5.81 (17) | Cd1—N3—C1—C2 | −175.7 (2) |
| O1—Cd1—N3—C5 | 96.22 (18) | N3—C1—C2—C3 | −0.4 (4) |
| O4—Cd1—N3—C5 | 167.70 (16) | C1—C2—C3—C4 | 0.4 (4) |
| O2—Cd1—N3—C5 | 66.5 (2) | C2—C3—C4—C5 | −0.5 (4) |
| N5—Cd1—N3—C5 | −75.80 (18) | C2—C3—C4—C6 | −179.9 (3) |
| O3—Cd1—N4—C12 | −167.40 (19) | C1—N3—C5—C4 | −0.7 (4) |
| N6—Cd1—N4—C12 | −30.0 (2) | Cd1—N3—C5—C4 | 175.90 (19) |
| N3—Cd1—N4—C12 | 177.7 (2) | C1—N3—C5—C9 | 178.3 (2) |
| O1—Cd1—N4—C12 | 97.7 (2) | Cd1—N3—C5—C9 | −5.2 (3) |
| O4—Cd1—N4—C12 | 37.7 (3) | C3—C4—C5—N3 | 0.7 (4) |
| O2—Cd1—N4—C12 | 47.6 (2) | C6—C4—C5—N3 | −179.9 (2) |
| N5—Cd1—N4—C12 | −97.0 (2) | C3—C4—C5—C9 | −178.3 (2) |
| O3—Cd1—N4—C9 | 8.8 (3) | C6—C4—C5—C9 | 1.2 (4) |
| N6—Cd1—N4—C9 | 146.27 (18) | C3—C4—C6—C7 | 179.8 (3) |
| N3—Cd1—N4—C9 | −6.09 (17) | C5—C4—C6—C7 | 0.4 (4) |
| O1—Cd1—N4—C9 | −86.08 (18) | C4—C6—C7—C8 | −2.2 (4) |
| O4—Cd1—N4—C9 | −146.08 (19) | C6—C7—C8—C10 | −176.7 (3) |
| O2—Cd1—N4—C9 | −136.21 (19) | C6—C7—C8—C9 | 2.3 (4) |
| N5—Cd1—N4—C9 | 79.19 (18) | C12—N4—C9—C8 | 1.8 (4) |
| O3—Cd1—N5—C13 | 68.5 (2) | Cd1—N4—C9—C8 | −174.59 (18) |
| N6—Cd1—N5—C13 | −177.9 (2) | C12—N4—C9—C5 | −177.6 (2) |
| N4—Cd1—N5—C13 | −83.2 (2) | Cd1—N4—C9—C5 | 6.0 (3) |
| N3—Cd1—N5—C13 | −13.3 (2) | C10—C8—C9—N4 | −1.0 (4) |
| O1—Cd1—N5—C13 | −36.4 (3) | C7—C8—C9—N4 | 179.8 (2) |
| O4—Cd1—N5—C13 | 114.5 (2) | C10—C8—C9—C5 | 178.4 (2) |
| O2—Cd1—N5—C13 | −141.39 (19) | C7—C8—C9—C5 | −0.7 (4) |
| O3—Cd1—N5—C17 | −117.09 (18) | N3—C5—C9—N4 | −0.5 (3) |
| N6—Cd1—N5—C17 | −3.51 (17) | C4—C5—C9—N4 | 178.5 (2) |
| N4—Cd1—N5—C17 | 91.18 (19) | N3—C5—C9—C8 | −179.9 (2) |
| N3—Cd1—N5—C17 | 161.08 (19) | C4—C5—C9—C8 | −1.0 (4) |
| O1—Cd1—N5—C17 | 138.0 (2) | C9—C8—C10—C11 | −0.8 (4) |
| O4—Cd1—N5—C17 | −71.16 (19) | C7—C8—C10—C11 | 178.3 (3) |
| O2—Cd1—N5—C17 | 33.0 (2) | C8—C10—C11—C12 | 1.8 (4) |
| O3—Cd1—N6—C24 | −99.0 (2) | C9—N4—C12—C11 | −0.8 (4) |
| N4—Cd1—N6—C24 | 102.5 (2) | Cd1—N4—C12—C11 | 175.4 (2) |
| N3—Cd1—N6—C24 | 152.85 (19) | C10—C11—C12—N4 | −1.0 (4) |
| O1—Cd1—N6—C24 | 16.6 (2) | C17—N5—C13—C14 | −0.4 (4) |
| O4—Cd1—N6—C24 | −56.5 (2) | Cd1—N5—C13—C14 | 173.9 (2) |
| O2—Cd1—N6—C24 | 24.7 (2) | N5—C13—C14—C15 | 1.4 (4) |
| N5—Cd1—N6—C24 | −179.2 (2) | C13—C14—C15—C16 | −0.7 (4) |
| O3—Cd1—N6—C21 | 83.4 (2) | C14—C15—C16—C17 | −0.9 (4) |
| N4—Cd1—N6—C21 | −75.1 (2) | C14—C15—C16—C18 | 179.7 (3) |
| N3—Cd1—N6—C21 | −24.8 (3) | C13—N5—C17—C16 | −1.4 (4) |
| O1—Cd1—N6—C21 | −160.97 (17) | Cd1—N5—C17—C16 | −176.21 (19) |
| O4—Cd1—N6—C21 | 125.9 (2) | C13—N5—C17—C21 | 178.5 (2) |
| O2—Cd1—N6—C21 | −152.9 (2) | Cd1—N5—C17—C21 | 3.7 (3) |
| N5—Cd1—N6—C21 | 3.16 (18) | C15—C16—C17—N5 | 2.0 (4) |
| O2—N1—O1—Cd1 | −1.1 (2) | C18—C16—C17—N5 | −178.5 (2) |
| O3—Cd1—O1—N1 | 133.52 (16) | C15—C16—C17—C21 | −177.9 (2) |
| N6—Cd1—O1—N1 | 10.90 (19) | C18—C16—C17—C21 | 1.6 (4) |
| N4—Cd1—O1—N1 | −76.70 (16) | C17—C16—C18—C19 | −0.3 (4) |
| N3—Cd1—O1—N1 | −145.80 (16) | C15—C16—C18—C19 | 179.2 (3) |
| O4—Cd1—O1—N1 | 83.69 (16) | C16—C18—C19—C20 | −1.6 (4) |
| O2—Cd1—O1—N1 | 0.64 (14) | C18—C19—C20—C22 | −178.1 (3) |
| N5—Cd1—O1—N1 | −122.5 (2) | C18—C19—C20—C21 | 2.2 (4) |
| O1—N1—O2—Cd1 | 1.1 (2) | C24—N6—C21—C20 | −0.4 (4) |
| O3—Cd1—O2—N1 | −64.39 (17) | Cd1—N6—C21—C20 | 177.34 (19) |
| N6—Cd1—O2—N1 | −172.34 (17) | C24—N6—C21—C17 | 179.7 (2) |
| N4—Cd1—O2—N1 | 94.86 (16) | Cd1—N6—C21—C17 | −2.6 (3) |
| N3—Cd1—O2—N1 | 38.65 (18) | C22—C20—C21—N6 | −0.5 (4) |
| O1—Cd1—O2—N1 | −0.64 (14) | C19—C20—C21—N6 | 179.1 (2) |
| O4—Cd1—O2—N1 | −88.97 (16) | C22—C20—C21—C17 | 179.4 (2) |
| N5—Cd1—O2—N1 | 153.45 (15) | C19—C20—C21—C17 | −0.9 (4) |
| O5—N2—O3—Cd1 | 175.7 (6) | N5—C17—C21—N6 | −0.9 (4) |
| O4—N2—O3—Cd1 | −1.7 (3) | C16—C17—C21—N6 | 179.0 (2) |
| N6—Cd1—O3—N2 | 59.66 (19) | N5—C17—C21—C20 | 179.1 (2) |
| N4—Cd1—O3—N2 | −167.00 (16) | C16—C17—C21—C20 | −1.0 (4) |
| N3—Cd1—O3—N2 | −152.96 (18) | C21—C20—C22—C23 | 0.4 (4) |
| O1—Cd1—O3—N2 | −74.47 (18) | C19—C20—C22—C23 | −179.3 (3) |
| O4—Cd1—O3—N2 | 0.99 (16) | C20—C22—C23—C24 | 0.6 (4) |
| O2—Cd1—O3—N2 | −30.6 (2) | C21—N6—C24—C23 | 1.5 (4) |
| N5—Cd1—O3—N2 | 125.28 (18) | Cd1—N6—C24—C23 | −176.2 (2) |
| O5—N2—O4—Cd1 | −175.9 (6) | C22—C23—C24—N6 | −1.6 (5) |
Experimental details
| Crystal data | |
| Chemical formula | [Cd(NO2)1.75(NO3)0.25(C12H8N2)2] |
| Mr | 568.83 |
| Crystal system, space group | Triclinic, P1 |
| Temperature (K) | 100 |
| a, b, c (Å) | 9.1470 (4), 10.1866 (4), 13.0057 (6) |
| α, β, γ (°) | 76.953 (4), 77.270 (4), 70.404 (4) |
| V (Å3) | 1098.27 (8) |
| Z | 2 |
| Radiation type | Mo Kα |
| µ (mm−1) | 1.04 |
| Crystal size (mm) | 0.30 × 0.20 × 0.10 |
| Data collection | |
| Diffractometer | Agilent Technologies SuperNova Dual diffractometer with an Atlas detector |
| Absorption correction | Multi-scan (CrysAlis PRO; Agilent Technologies, 2010) |
| Tmin, Tmax | 0.745, 0.903 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 8702, 4852, 4256 |
| Rint | 0.032 |
| (sin θ/λ)max (Å−1) | 0.649 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.033, 0.073, 1.02 |
| No. of reflections | 4852 |
| No. of parameters | 325 |
| H-atom treatment | H-atom parameters constrained |
| Δρmax, Δρmin (e Å−3) | 0.49, −0.69 |
Computer programs: CrysAlis PRO (Agilent Technologies, 2010), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), X-SEED (Barbour, 2001), publCIF (Westrip, 2010).
| Cd1—O3 | 2.355 (2) | Cd1—O1 | 2.4547 (19) |
| Cd1—N6 | 2.390 (2) | Cd1—O4 | 2.503 (2) |
| Cd1—N4 | 2.393 (2) | Cd1—O2 | 2.5041 (19) |
| Cd1—N3 | 2.418 (2) | Cd1—N5 | 2.510 (2) |
Acknowledgements
We thank Shahid Beheshti University and the University of Malaya for supporting this study.
References
Abedini, J., Morsali, A. & Kempe, R. (2005). J. Coord. Chem. 58, 1161–1167. Web of Science CSD CrossRef CAS Google Scholar
Agilent Technologies (2010). CrysAlis PRO. Agilent Technologies, Yarnton, England. Google Scholar
Barbour, L. J. (2001). J. Supramol. Chem. 1, 189–191. CrossRef CAS Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Tadjarodi, A., Taeb, A. & Ng, S. W. (2001). Main Group Met. Chem. 24, 805–806. CrossRef CAS Google Scholar
Westrip, S. P. (2010). J. Appl. Cryst. 43, 920–925. Web of Science CrossRef CAS IUCr Journals Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
![[P \overline 1] Mathematical equation](teximages/wm2452fi1.gif)
![[Figure 1]](./wm2452fig1thm.gif)




We had previously reported the structure of the 1,10-phenanthroline adduct of cadmium nitrate. In the corresponding structure, the cadmium ion, situated on a twofold rotation axis, shows eightfold coordination, which is somewhat less common (Tadjarodi et al., 2001). The compound is conveniently synthesized by the direct addition of 1,10-phenanthroline to a cadmium nitrate solution. In a similar reaction, but when nitrite ions present, a mixed nitrate/nitrite compound is obtained.
In the title compound, Cd(NO2)1.75(NO3)0.25(C12H8N2)2 (Scheme I), the metal ion also exists in an eight-coordinate distorted dodecahedral CdN4O4 geometry (Fig. 1). The metal ion is bis-chelated by two N-heterocycles as well as by the nitrate/nitrite ions. The molecule lies on a general position, and one nitrite group is disordered with respect to a nitrate group (ratio 0.75:0.25).