metal-organic compounds
Di-μ2-methanolato-bis(μ-4-methyl-5-sulfanylidene-4,5-dihydro-1H-1,2,4-triazolido-κ2N1:N2)di-μ3-oxido-tetrakis[dimethyltin(IV)]
aDepartment of Chemistry, General Campus, Shahid Beheshti University, Tehran 1983963113, Iran, and bDepartment of Chemistry, University of Malaya, 50603 Kuala Lumpur, Malaysia
*Correspondence e-mail: [email protected]
The title distannoxane, [Sn4(CH3)8(C3H4N3S)2(CH3O)2O2], lies about a center of inversion; the tetranuclear molecule features a three-rung-staircase Sn4O4 core in which the two crystallographically independent SnIV atoms are bridged by the triazolide group. The negatively charged N atom of the triazolide group binds to the terminal Sn atom at a shorter distance [Sn—N = 2.239 (2) Å] compared with the neutral N atom that binds to the central Sn atom [Sn← N = 2.757 (3) Å]. The oxide O atom is three-coordinate whereas the methanolate O atom is two-coordinate. The terminal Sn atom is five-coordinate in a cis-C3SnNO trigonal–bipyramidal environment, whereas the central Sn atom is six-coordinate in a C2SnNO3 skew-trapezoidal–bipyramidal geometry.
Experimental
Crystal data
|
Data collection: CrysAlis PRO (Agilent Technologies, 2010
); cell refinement: CrysAlis PRO; data reduction: CrysAlis PRO; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: X-SEED (Barbour, 2001
); software used to prepare material for publication: publCIF (Westrip, 2010
).
Supporting information
contains datablocks global, I. DOI: 10.1107/S1600536811001905/xu5141sup1.cif
Structure factors: contains datablock I. DOI: 10.1107/S1600536811001905/xu5141Isup2.hkl
Dimethyltin diisothiocyanate (1 mmol), 4-methyl-4H-1,2,4-triazole-3-thiol (1 mmol) and 1,10-phenanthroline (1 mmol) were loaded into a convection tube; several drops of triethylamine were added. The tube was filled with dry methanol and kept at 333 K. Colorless crystals were collected from the side arm after several days.
Carbon-bound H-atoms were placed in calculated positions [C—H 0.95 to 0.98 Å, Uiso(H) 1.2 to 1.5Ueq(C)] and were included in the in the riding model approximation.
Data collection: CrysAlis PRO (Agilent Technologies, 2010); cell CrysAlis PRO (Agilent Technologies, 2010); data reduction: CrysAlis PRO (Agilent Technologies, 2010); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: X-SEED (Barbour, 2001); software used to prepare material for publication: publCIF (Westrip, 2010).
| Fig. 1. Thermal ellipsoid plot (Barbour, 2001) of Sn4O2(CH3)8(CH3O)2(C3H4N3S)2 at the 70% probability level; hydrogen atoms are drawn as spheres of arbitrary radius. |
| [Sn4(CH3)8(C3H4N3S)2(CH3O)2O2] | Z = 1 |
| Mr = 917.40 | F(000) = 440 |
| Triclinic, P1 | Dx = 2.023 Mg m−3 |
| Hall symbol: -P 1 | Mo Kα radiation, λ = 0.71073 Å |
| a = 7.3693 (6) Å | Cell parameters from 3945 reflections |
| b = 9.3457 (8) Å | θ = 2.3–29.2° |
| c = 11.9930 (9) Å | µ = 3.45 mm−1 |
| α = 71.681 (7)° | T = 100 K |
| β = 76.780 (6)° | Block, colorless |
| γ = 77.118 (7)° | 0.30 × 0.25 × 0.20 mm |
| V = 753.07 (11) Å3 |
| Agilent SuperNova Dual diffractometer with an Atlas detector | 3328 independent reflections |
| Radiation source: SuperNova (Mo) X-ray Source | 2919 reflections with I > 2σ(I) |
| Mirror monochromator | Rint = 0.029 |
| Detector resolution: 10.4041 pixels mm-1 | θmax = 27.5°, θmin = 2.3° |
| ω scans | h = −7→9 |
| Absorption correction: multi-scan (CrysAlis PRO; Agilent, 2010) | k = −12→11 |
| Tmin = 0.425, Tmax = 0.546 | l = −14→15 |
| 5805 measured reflections |
| Refinement on F2 | Secondary atom site location: difference Fourier map |
| Least-squares matrix: full | Hydrogen site location: inferred from neighbouring sites |
| R[F2 > 2σ(F2)] = 0.024 | H-atom parameters constrained |
| wR(F2) = 0.047 | w = 1/[σ2(Fo2) + (0.0144P)2] where P = (Fo2 + 2Fc2)/3 |
| S = 0.98 | (Δ/σ)max = 0.001 |
| 3328 reflections | Δρmax = 0.83 e Å−3 |
| 152 parameters | Δρmin = −0.77 e Å−3 |
| 0 restraints | Extinction correction: SHELXL97 (Sheldrick, 2008), Fc*=kFc[1+0.001xFc2λ3/sin(2θ)]-1/4 |
| Primary atom site location: structure-invariant direct methods | Extinction coefficient: 0.0086 (3) |
| [Sn4(CH3)8(C3H4N3S)2(CH3O)2O2] | γ = 77.118 (7)° |
| Mr = 917.40 | V = 753.07 (11) Å3 |
| Triclinic, P1 | Z = 1 |
| a = 7.3693 (6) Å | Mo Kα radiation |
| b = 9.3457 (8) Å | µ = 3.45 mm−1 |
| c = 11.9930 (9) Å | T = 100 K |
| α = 71.681 (7)° | 0.30 × 0.25 × 0.20 mm |
| β = 76.780 (6)° |
| Agilent SuperNova Dual diffractometer with an Atlas detector | 3328 independent reflections |
| Absorption correction: multi-scan (CrysAlis PRO; Agilent, 2010) | 2919 reflections with I > 2σ(I) |
| Tmin = 0.425, Tmax = 0.546 | Rint = 0.029 |
| 5805 measured reflections |
| R[F2 > 2σ(F2)] = 0.024 | 0 restraints |
| wR(F2) = 0.047 | H-atom parameters constrained |
| S = 0.98 | Δρmax = 0.83 e Å−3 |
| 3328 reflections | Δρmin = −0.77 e Å−3 |
| 152 parameters |
| x | y | z | Uiso*/Ueq | ||
| Sn1 | 0.23531 (3) | 0.50079 (2) | 0.258264 (16) | 0.01270 (7) | |
| Sn2 | 0.57195 (3) | 0.31342 (2) | 0.021831 (16) | 0.01318 (7) | |
| S1 | 0.14046 (14) | 0.21699 (10) | 0.54808 (7) | 0.0233 (2) | |
| O1 | 0.2321 (3) | 0.7285 (2) | 0.13758 (16) | 0.0188 (5) | |
| O2 | 0.3998 (3) | 0.4777 (2) | 0.10279 (16) | 0.0154 (5) | |
| N1 | 0.3105 (4) | 0.2459 (3) | 0.3171 (2) | 0.0156 (6) | |
| N2 | 0.4081 (4) | 0.1541 (3) | 0.2438 (2) | 0.0200 (6) | |
| N3 | 0.3234 (4) | 0.0093 (3) | 0.4248 (2) | 0.0170 (6) | |
| C1 | −0.0559 (5) | 0.5013 (4) | 0.2716 (3) | 0.0196 (7) | |
| H1A | −0.1291 | 0.5928 | 0.2934 | 0.029* | |
| H1B | −0.0926 | 0.4099 | 0.3329 | 0.029* | |
| H1C | −0.0808 | 0.5014 | 0.1948 | 0.029* | |
| C2 | 0.3814 (5) | 0.5474 (4) | 0.3718 (3) | 0.0206 (7) | |
| H2A | 0.3203 | 0.6445 | 0.3888 | 0.031* | |
| H2B | 0.5127 | 0.5542 | 0.3327 | 0.031* | |
| H2C | 0.3791 | 0.4651 | 0.4465 | 0.031* | |
| C3 | 0.4119 (5) | 0.0140 (4) | 0.3117 (3) | 0.0203 (7) | |
| H3A | 0.4696 | −0.0738 | 0.2852 | 0.024* | |
| C4 | 0.2588 (5) | 0.1574 (3) | 0.4269 (2) | 0.0158 (7) | |
| C5 | 0.2958 (5) | −0.1263 (3) | 0.5236 (2) | 0.0220 (8) | |
| H5A | 0.2864 | −0.1025 | 0.5989 | 0.033* | |
| H5B | 0.4033 | −0.2079 | 0.5155 | 0.033* | |
| H5C | 0.1793 | −0.1599 | 0.5231 | 0.033* | |
| C6 | 0.7959 (5) | 0.2468 (4) | 0.1196 (3) | 0.0234 (8) | |
| H6A | 0.7568 | 0.2827 | 0.1912 | 0.035* | |
| H6B | 0.9060 | 0.2915 | 0.0701 | 0.035* | |
| H6C | 0.8288 | 0.1351 | 0.1427 | 0.035* | |
| C7 | 0.3661 (5) | 0.2266 (4) | −0.0232 (3) | 0.0218 (7) | |
| H7A | 0.2444 | 0.2463 | 0.0280 | 0.033* | |
| H7B | 0.4044 | 0.1162 | −0.0117 | 0.033* | |
| H7C | 0.3538 | 0.2769 | −0.1068 | 0.033* | |
| C8 | 0.1025 (5) | 0.8628 (3) | 0.1446 (3) | 0.0236 (8) | |
| H8A | 0.0946 | 0.8810 | 0.2218 | 0.035* | |
| H8B | −0.0223 | 0.8510 | 0.1364 | 0.035* | |
| H8C | 0.1450 | 0.9496 | 0.0804 | 0.035* |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Sn1 | 0.01333 (13) | 0.01317 (12) | 0.01025 (11) | −0.00160 (9) | −0.00007 (8) | −0.00313 (8) |
| Sn2 | 0.01480 (13) | 0.01053 (11) | 0.01182 (11) | −0.00096 (9) | 0.00021 (8) | −0.00231 (8) |
| S1 | 0.0276 (5) | 0.0250 (4) | 0.0145 (4) | −0.0043 (4) | 0.0027 (3) | −0.0063 (3) |
| O1 | 0.0232 (14) | 0.0111 (10) | 0.0144 (10) | 0.0027 (10) | 0.0031 (9) | −0.0012 (8) |
| O2 | 0.0194 (13) | 0.0125 (10) | 0.0090 (9) | −0.0008 (9) | 0.0043 (9) | −0.0016 (8) |
| N1 | 0.0175 (16) | 0.0139 (13) | 0.0134 (12) | −0.0016 (11) | −0.0005 (11) | −0.0031 (10) |
| N2 | 0.0265 (18) | 0.0168 (14) | 0.0144 (12) | −0.0033 (13) | 0.0013 (12) | −0.0047 (11) |
| N3 | 0.0187 (16) | 0.0154 (13) | 0.0168 (12) | −0.0066 (12) | −0.0015 (11) | −0.0029 (10) |
| C1 | 0.0143 (19) | 0.0224 (17) | 0.0223 (16) | −0.0030 (14) | −0.0044 (14) | −0.0055 (13) |
| C2 | 0.024 (2) | 0.0227 (17) | 0.0196 (16) | −0.0058 (15) | −0.0079 (14) | −0.0071 (13) |
| C3 | 0.027 (2) | 0.0149 (16) | 0.0173 (15) | −0.0011 (15) | 0.0006 (14) | −0.0065 (13) |
| C4 | 0.0167 (19) | 0.0150 (15) | 0.0151 (15) | −0.0033 (13) | −0.0060 (13) | −0.0004 (12) |
| C5 | 0.030 (2) | 0.0157 (16) | 0.0172 (15) | −0.0087 (15) | −0.0033 (14) | 0.0029 (13) |
| C6 | 0.023 (2) | 0.0249 (18) | 0.0221 (17) | −0.0021 (15) | −0.0051 (15) | −0.0062 (14) |
| C7 | 0.018 (2) | 0.0245 (17) | 0.0253 (17) | −0.0083 (15) | −0.0032 (14) | −0.0073 (14) |
| C8 | 0.028 (2) | 0.0155 (16) | 0.0206 (16) | 0.0016 (15) | 0.0046 (14) | −0.0057 (13) |
| Sn1—O2 | 2.0235 (19) | N3—C5 | 1.453 (4) |
| Sn1—C2 | 2.110 (3) | C1—H1A | 0.9800 |
| Sn1—C1 | 2.114 (3) | C1—H1B | 0.9800 |
| Sn1—O1 | 2.1637 (19) | C1—H1C | 0.9800 |
| Sn1—N1 | 2.239 (2) | C2—H2A | 0.9800 |
| Sn2—O2i | 2.0717 (19) | C2—H2B | 0.9800 |
| Sn2—O2 | 2.1014 (19) | C2—H2C | 0.9800 |
| Sn2—C7 | 2.110 (3) | C3—H3A | 0.9500 |
| Sn2—C6 | 2.110 (3) | C5—H5A | 0.9800 |
| Sn2—O1i | 2.202 (2) | C5—H5B | 0.9800 |
| Sn2—N2 | 2.757 (3) | C5—H5C | 0.9800 |
| S1—C4 | 1.702 (3) | C6—H6A | 0.9800 |
| O1—C8 | 1.410 (4) | C6—H6B | 0.9800 |
| O1—Sn2i | 2.202 (2) | C6—H6C | 0.9800 |
| O2—Sn2i | 2.0717 (19) | C7—H7A | 0.9800 |
| N1—C4 | 1.338 (4) | C7—H7B | 0.9800 |
| N1—N2 | 1.392 (3) | C7—H7C | 0.9800 |
| N2—C3 | 1.304 (4) | C8—H8A | 0.9800 |
| N3—C3 | 1.356 (4) | C8—H8B | 0.9800 |
| N3—C4 | 1.366 (4) | C8—H8C | 0.9800 |
| O2—Sn1—C2 | 113.32 (11) | Sn1—C1—H1B | 109.5 |
| O2—Sn1—C1 | 115.63 (10) | H1A—C1—H1B | 109.5 |
| C2—Sn1—C1 | 130.58 (13) | Sn1—C1—H1C | 109.5 |
| O2—Sn1—O1 | 73.45 (8) | H1A—C1—H1C | 109.5 |
| C2—Sn1—O1 | 92.65 (10) | H1B—C1—H1C | 109.5 |
| C1—Sn1—O1 | 94.71 (11) | Sn1—C2—H2A | 109.5 |
| O2—Sn1—N1 | 83.59 (8) | Sn1—C2—H2B | 109.5 |
| C2—Sn1—N1 | 96.97 (11) | H2A—C2—H2B | 109.5 |
| C1—Sn1—N1 | 94.75 (11) | Sn1—C2—H2C | 109.5 |
| O1—Sn1—N1 | 157.03 (8) | H2A—C2—H2C | 109.5 |
| O2i—Sn2—O2 | 74.62 (8) | H2B—C2—H2C | 109.5 |
| O2i—Sn2—C7 | 106.60 (11) | N2—C3—N3 | 111.7 (3) |
| O2—Sn2—C7 | 100.71 (11) | N2—C3—H3A | 124.2 |
| O2i—Sn2—C6 | 109.11 (11) | N3—C3—H3A | 124.2 |
| O2—Sn2—C6 | 99.99 (10) | N1—C4—N3 | 107.2 (2) |
| C7—Sn2—C6 | 142.30 (13) | N1—C4—S1 | 126.7 (2) |
| O2i—Sn2—O1i | 71.73 (7) | N3—C4—S1 | 126.0 (2) |
| O2—Sn2—O1i | 146.35 (8) | N3—C5—H5A | 109.5 |
| C7—Sn2—O1i | 89.12 (11) | N3—C5—H5B | 109.5 |
| C6—Sn2—O1i | 90.78 (11) | H5A—C5—H5B | 109.5 |
| O2i—Sn2—N2 | 148.29 (8) | N3—C5—H5C | 109.5 |
| O2—Sn2—N2 | 73.68 (7) | H5A—C5—H5C | 109.5 |
| C7—Sn2—N2 | 78.86 (10) | H5B—C5—H5C | 109.5 |
| C6—Sn2—N2 | 77.22 (11) | Sn2—C6—H6A | 109.5 |
| O1i—Sn2—N2 | 139.97 (7) | Sn2—C6—H6B | 109.5 |
| C8—O1—Sn1 | 128.80 (18) | H6A—C6—H6B | 109.5 |
| C8—O1—Sn2i | 126.87 (17) | Sn2—C6—H6C | 109.5 |
| Sn1—O1—Sn2i | 102.34 (8) | H6A—C6—H6C | 109.5 |
| Sn1—O2—Sn2i | 112.30 (9) | H6B—C6—H6C | 109.5 |
| Sn1—O2—Sn2 | 142.18 (10) | Sn2—C7—H7A | 109.5 |
| Sn2i—O2—Sn2 | 105.38 (8) | Sn2—C7—H7B | 109.5 |
| C4—N1—N2 | 109.3 (2) | H7A—C7—H7B | 109.5 |
| C4—N1—Sn1 | 125.19 (19) | Sn2—C7—H7C | 109.5 |
| N2—N1—Sn1 | 125.43 (17) | H7A—C7—H7C | 109.5 |
| C3—N2—N1 | 105.4 (2) | H7B—C7—H7C | 109.5 |
| C3—N2—Sn2 | 139.7 (2) | O1—C8—H8A | 109.5 |
| N1—N2—Sn2 | 114.07 (17) | O1—C8—H8B | 109.5 |
| C3—N3—C4 | 106.5 (2) | H8A—C8—H8B | 109.5 |
| C3—N3—C5 | 127.0 (3) | O1—C8—H8C | 109.5 |
| C4—N3—C5 | 126.5 (3) | H8A—C8—H8C | 109.5 |
| Sn1—C1—H1A | 109.5 | H8B—C8—H8C | 109.5 |
| O2—Sn1—O1—C8 | 161.3 (3) | O2—Sn1—N1—N2 | −7.7 (2) |
| C2—Sn1—O1—C8 | −85.1 (3) | C2—Sn1—N1—N2 | −120.5 (3) |
| C1—Sn1—O1—C8 | 46.0 (3) | C1—Sn1—N1—N2 | 107.6 (3) |
| N1—Sn1—O1—C8 | 160.0 (3) | O1—Sn1—N1—N2 | −6.4 (4) |
| O2—Sn1—O1—Sn2i | −3.20 (8) | C4—N1—N2—C3 | −0.1 (4) |
| C2—Sn1—O1—Sn2i | 110.35 (12) | Sn1—N1—N2—C3 | −176.4 (2) |
| C1—Sn1—O1—Sn2i | −118.56 (11) | C4—N1—N2—Sn2 | −171.7 (2) |
| N1—Sn1—O1—Sn2i | −4.5 (3) | Sn1—N1—N2—Sn2 | 11.9 (3) |
| C2—Sn1—O2—Sn2i | −82.07 (13) | O2i—Sn2—N2—C3 | −177.7 (3) |
| C1—Sn1—O2—Sn2i | 90.87 (13) | O2—Sn2—N2—C3 | −176.5 (4) |
| O1—Sn1—O2—Sn2i | 3.60 (9) | C7—Sn2—N2—C3 | 78.7 (4) |
| N1—Sn1—O2—Sn2i | −176.92 (12) | C6—Sn2—N2—C3 | −71.9 (4) |
| C2—Sn1—O2—Sn2 | 92.7 (2) | O1i—Sn2—N2—C3 | 3.7 (4) |
| C1—Sn1—O2—Sn2 | −94.4 (2) | O2i—Sn2—N2—N1 | −10.1 (3) |
| O1—Sn1—O2—Sn2 | 178.3 (2) | O2—Sn2—N2—N1 | −8.9 (2) |
| N1—Sn1—O2—Sn2 | −2.17 (19) | C7—Sn2—N2—N1 | −113.7 (2) |
| O2i—Sn2—O2—Sn1 | −175.0 (3) | C6—Sn2—N2—N1 | 95.6 (2) |
| C7—Sn2—O2—Sn1 | 80.6 (2) | O1i—Sn2—N2—N1 | 171.27 (18) |
| C6—Sn2—O2—Sn1 | −67.7 (2) | N1—N2—C3—N3 | −0.2 (4) |
| O1i—Sn2—O2—Sn1 | −174.57 (14) | Sn2—N2—C3—N3 | 168.0 (2) |
| N2—Sn2—O2—Sn1 | 5.68 (17) | C4—N3—C3—N2 | 0.4 (4) |
| O2i—Sn2—O2—Sn2i | 0.0 | C5—N3—C3—N2 | 178.3 (3) |
| C7—Sn2—O2—Sn2i | −104.44 (12) | N2—N1—C4—N3 | 0.3 (4) |
| C6—Sn2—O2—Sn2i | 107.23 (12) | Sn1—N1—C4—N3 | 176.7 (2) |
| O1i—Sn2—O2—Sn2i | 0.4 (2) | N2—N1—C4—S1 | 178.7 (2) |
| N2—Sn2—O2—Sn2i | −179.36 (12) | Sn1—N1—C4—S1 | −5.0 (4) |
| O2—Sn1—N1—C4 | 176.5 (3) | C3—N3—C4—N1 | −0.5 (4) |
| C2—Sn1—N1—C4 | 63.7 (3) | C5—N3—C4—N1 | −178.4 (3) |
| C1—Sn1—N1—C4 | −68.2 (3) | C3—N3—C4—S1 | −178.8 (3) |
| O1—Sn1—N1—C4 | 177.8 (2) | C5—N3—C4—S1 | 3.3 (5) |
| Symmetry code: (i) −x+1, −y+1, −z. |
Experimental details
| Crystal data | |
| Chemical formula | [Sn4(CH3)8(C3H4N3S)2(CH3O)2O2] |
| Mr | 917.40 |
| Crystal system, space group | Triclinic, P1 |
| Temperature (K) | 100 |
| a, b, c (Å) | 7.3693 (6), 9.3457 (8), 11.9930 (9) |
| α, β, γ (°) | 71.681 (7), 76.780 (6), 77.118 (7) |
| V (Å3) | 753.07 (11) |
| Z | 1 |
| Radiation type | Mo Kα |
| µ (mm−1) | 3.45 |
| Crystal size (mm) | 0.30 × 0.25 × 0.20 |
| Data collection | |
| Diffractometer | Agilent SuperNova Dual diffractometer with an Atlas detector |
| Absorption correction | Multi-scan (CrysAlis PRO; Agilent, 2010) |
| Tmin, Tmax | 0.425, 0.546 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 5805, 3328, 2919 |
| Rint | 0.029 |
| (sin θ/λ)max (Å−1) | 0.650 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.024, 0.047, 0.98 |
| No. of reflections | 3328 |
| No. of parameters | 152 |
| H-atom treatment | H-atom parameters constrained |
| Δρmax, Δρmin (e Å−3) | 0.83, −0.77 |
Computer programs: CrysAlis PRO (Agilent Technologies, 2010), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), X-SEED (Barbour, 2001), publCIF (Westrip, 2010).
Acknowledgements
We thank Shahid Beheshti University and the University of Malaya for supporting this study.
References
Agilent Technologies (2010). CrysAlis PRO. Agilent Technologies, Yarnton, England. Google Scholar
Barbour, L. J. (2001). J. Supramol. Chem. 1, 189–191. CrossRef CAS Google Scholar
Ma, C.-L., Sun, J.-S., Zhang, R.-F. & Wang, D.-Q. (2007). J. Organomet. Chem. 692, 4029–4042. Web of Science CSD CrossRef CAS Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Westrip, S. P. (2010). J. Appl. Cryst. 43, 920–925. Web of Science CrossRef CAS IUCr Journals Google Scholar
Yu, H.-X., Ma, J.-F., Xu, G.-H., Li, S.-L., Yang, J., Liu, Y.-Y. & Chen, Y.-X. (2006). J. Organomet. Chem. 691, 3531–3539. Web of Science CSD CrossRef CAS Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
![[P \overline 1] Mathematical equation](teximages/xu5141fi1.gif)
![[Figure 1]](./xu5141fig1thm.gif)




The title compound (Scheme I, Fig. 1), a distannoxane, was the unexpected product from an attempt at synthesizing a dimethyltin 4,-methyl-4H-1,2,4-triazol-3-thiolate that possesses a tin-sulfur linkage. In the reaction of diorganotin oxides with organic acids (particularly carboxylic acid), tetranuclear distannoxanes are sometimes formed; these compounds have four organic groups. In the present reaction, two of the four organic groups are replaced by methoxide groups.
Tetranuclear Sn4O2(CH3)8(CH3O)2(C3H4N3S)2 distannoxane lies about a center-of-inversion; the molecule features a three-rung-staircase Sn4O4 core in which two Sn atoms are bridged by the C3H4N3S triazolide group. The negatively-charged N atom of the group binds to the terminal Sn atom at a shorter distance [Sn–N 2.239 (2) Å] compared with the neutral N atom that binds to the central Sn atom [Sn←N 2.757 (2) Å]. The oxo O atom is three-coordinate whereas the methanolate O atom is two-coordinate. The terminal Sn atom is five-coordinate in a cis-C3SnNO trigonal bipyramid whereas the central Sn atom is six-coordinate in a C2SnNO3 skew-trazepoidal bipyramidal geometry.
The formation of similar distannoxanes that feature bridging triazolides are limited to the 4-(benzylideneamino)-3-methyl-5-thioxo-1,2,4-triazolide, 4-(2-furylmethylene)amino-3-methyl-5-thioxo-1,2,4-triazolide, 4-(2-thienylmethylene)amino-3-methyl-5-thioxo-1,2,4-triazolide and 5-(2-thienylmethylene)amino-2-thioxo-1,3,4-thiadiazolates only (Ma et al., 2007; Yu et al., 2006).