|
Figure 2 Thermal ellipsoid plot (Barbour, 2001) of the second molecule of Sn4O2(C4H9)8(CH3O)2(C3H4N3S)2 at the 70% probability level; hydrogen atoms are drawn as spheres of arbitrary radius. |
|
Figure 2 Thermal ellipsoid plot (Barbour, 2001) of the second molecule of Sn4O2(C4H9)8(CH3O)2(C3H4N3S)2 at the 70% probability level; hydrogen atoms are drawn as spheres of arbitrary radius. |