metal-organic compounds
Aquabis(4-chlorobenzyl)bis(nicotinato-κ2O,O′)tin(IV)
aDepartment of Chemistry, University of Malaya, 50603 Kuala Lumpur, Malaysia
*Correspondence e-mail: [email protected]
In the title molecule, [Sn(C7H6Cl)2(C6H4NO2)2(H2O)], the O atoms of the two chelating nicotinate groups and the O atom of the coordinated water molecule comprise the pentagonal plane of the trans-C2SnO5 pentagonal–bipyramid [C—Sn—C = 178.62 (11) °] surrounding the SnIV atom. In the crystal, adjacent molecules are linked by O—H⋯N hydrogen bonds, generating a chain running along the body diagonal of the triclinic unit cell.
Related literature
For the direct synthesis of the organotin chloride reactant, see: Sisido et al. (1961
). For the dinuclear bromo analog, see: Keng et al. (2010
). For a review of the crystal structures of organotin carboxylates, see: Tiekink (1991
, 1994
).
Experimental
Crystal data
|
Refinement
|
| ||||||||||||||||||||||
Data collection: APEX2 (Bruker, 2009
); cell refinement: SAINT (Bruker, 2009
); data reduction: SAINT; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: X-SEED (Barbour, 2001
); software used to prepare material for publication: publCIF (Westrip, 2010
).
Supporting information
contains datablocks global, I. DOI: https://doi.org/10.1107/S1600536811015728/bt5527sup1.cif
Structure factors: contains datablock I. DOI: https://doi.org/10.1107/S1600536811015728/bt5527Isup2.hkl
Di(4-chlorobenzyl)tin oxide was prepared by the base hydrolysis of di(4-chlorobenzyl)tin dichloride with 10% sodium hydroxide. The diorganotin dichloride was synthesized by the direct reaction of 4-chlorobenzyl chloride and metallic tin according to a literature procedure (Sisido et al., 1961). The diorganotin oxide (0.39 g, 1 mmol) and nicotinic acid (0.25 g, 2 mmol) were heated in ethanol (100 ml) for an hour until the oxide dissolved. The solution was filtered; slow evaporation of the filtrate gave colorless crystals.
Carbon-bound H-atoms were placed in calculated positions (C—H 0.95 to 0.99, O–H 0.84 Å) and were included in the in the riding model approximation, with U(H) set to 1.2–1.5 times Ueq(C,O).
The final difference Fourier map had a peak in the vicinity of Sn1 as well as a hole in the vicinity of the same atom. The peaks/holes affected the the weighting scheme, which had a somewhat large value as the first parameter but a small value for the second parameter. The weighting scheme could be marginally improved by lowering the 2θ limit to 50 °.
Nicotinic acid affords a large number of compounds with organotins. For the diorganotin system in particular, the nicotinate ion can behave as an O,O'-chelate, but when two ions bind to a diorganotin cation, there is some space in the to admit a small ligand such as a water molecule (Tiekink, 1991; 1994). The bromo analog of the title compound (Scheme I) exists as a dinuclear compound as the N atom engages in coordination (Keng et al., 2010). The O atoms of the two chelating nicotinate groups and the O atom of the coordinated water molecule comprise the pentagonal plane of the trans-C2SnO5 pentagonal-bipyramid [C–Sn–C 178.6 (1) °] surrounding the SnIV atom in title compound (Fig. 1). The N atom does not engage in binding to an adjacent metal center. Instead, both N atoms serve as hydrogen bond acceptors (Table 1). Adjacent molecules are linked by O–H···N hydrogen bonds to generate a chain along [1 - 1 1].
For the direct synthesis of the organotin chloride reactant, see: Sisido et al. (1961). For the dinuclear bromo analog, see: Keng et al. (2010). For a review of the crystal structures of organotin carboxylates, see: Tiekink (1991, 1994).
Data collection: APEX2 (Bruker, 2009); cell SAINT (Bruker, 2009); data reduction: SAINT (Bruker, 2009); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: X-SEED (Barbour, 2001); software used to prepare material for publication: publCIF (Westrip, 2010).
| Fig. 1. Thermal ellipsoid plot (Barbour, 2001) of Sn(H2O)(C7H6Cl)2(C6H4NO2)2 at the 70% probability level; hydrogen atoms are drawn as spheres of arbitrary radius. |
| Fig. 2. Packing diagram. |
| [Sn(C7H6Cl)2(C6H4NO2)2(H2O)] | Z = 2 |
| Mr = 632.05 | F(000) = 632 |
| Triclinic, P1 | Dx = 1.670 Mg m−3 |
| Hall symbol: -P 1 | Mo Kα radiation, λ = 0.71073 Å |
| a = 9.0219 (1) Å | Cell parameters from 9937 reflections |
| b = 10.5929 (1) Å | θ = 2.5–28.4° |
| c = 14.5866 (2) Å | µ = 1.27 mm−1 |
| α = 79.6490 (5)° | T = 100 K |
| β = 87.6290 (5)° | Block, colorless |
| γ = 66.5051 (4)° | 0.35 × 0.30 × 0.25 mm |
| V = 1256.93 (3) Å3 |
| Bruker SMART APEX diffractometer | 5673 independent reflections |
| Radiation source: fine-focus sealed tube | 5416 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.022 |
| ω scans | θmax = 27.5°, θmin = 2.3° |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | h = −11→11 |
| Tmin = 0.665, Tmax = 0.742 | k = −13→13 |
| 11404 measured reflections | l = −18→18 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.039 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.133 | H-atom parameters constrained |
| S = 1.07 | w = 1/[σ2(Fo2) + (0.1028P)2 + 1.3179P] where P = (Fo2 + 2Fc2)/3 |
| 5673 reflections | (Δ/σ)max = 0.001 |
| 326 parameters | Δρmax = 2.51 e Å−3 |
| 0 restraints | Δρmin = −1.96 e Å−3 |
| [Sn(C7H6Cl)2(C6H4NO2)2(H2O)] | γ = 66.5051 (4)° |
| Mr = 632.05 | V = 1256.93 (3) Å3 |
| Triclinic, P1 | Z = 2 |
| a = 9.0219 (1) Å | Mo Kα radiation |
| b = 10.5929 (1) Å | µ = 1.27 mm−1 |
| c = 14.5866 (2) Å | T = 100 K |
| α = 79.6490 (5)° | 0.35 × 0.30 × 0.25 mm |
| β = 87.6290 (5)° |
| Bruker SMART APEX diffractometer | 5673 independent reflections |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | 5416 reflections with I > 2σ(I) |
| Tmin = 0.665, Tmax = 0.742 | Rint = 0.022 |
| 11404 measured reflections |
| R[F2 > 2σ(F2)] = 0.039 | 0 restraints |
| wR(F2) = 0.133 | H-atom parameters constrained |
| S = 1.07 | Δρmax = 2.51 e Å−3 |
| 5673 reflections | Δρmin = −1.96 e Å−3 |
| 326 parameters |
| x | y | z | Uiso*/Ueq | ||
| Sn1 | 0.63205 (2) | 0.308637 (17) | 0.300723 (11) | 0.01463 (11) | |
| Cl1 | 0.23192 (13) | 0.32379 (11) | −0.10807 (6) | 0.0365 (2) | |
| Cl2 | 1.16041 (10) | 0.23720 (10) | 0.67438 (6) | 0.02660 (19) | |
| O1 | 0.5519 (3) | 0.3053 (2) | 0.45081 (15) | 0.0183 (4) | |
| O2 | 0.7813 (3) | 0.1357 (2) | 0.42515 (15) | 0.0172 (4) | |
| O3 | 0.3946 (3) | 0.5014 (2) | 0.27412 (15) | 0.0198 (4) | |
| O4 | 0.5422 (3) | 0.4480 (2) | 0.15155 (15) | 0.0170 (4) | |
| O1W | 0.8289 (3) | 0.1801 (2) | 0.21474 (15) | 0.0202 (4) | |
| H1 | 0.9173 | 0.1454 | 0.2452 | 0.030* | |
| H2 | 0.8364 | 0.2314 | 0.1653 | 0.030* | |
| N1 | 0.8693 (3) | −0.0102 (3) | 0.71325 (18) | 0.0180 (5) | |
| N2 | 0.1562 (3) | 0.7425 (3) | −0.02511 (18) | 0.0191 (5) | |
| C1 | 0.5052 (4) | 0.1792 (4) | 0.2843 (2) | 0.0213 (6) | |
| H1A | 0.5814 | 0.0799 | 0.2990 | 0.026* | |
| H1B | 0.4182 | 0.1941 | 0.3299 | 0.026* | |
| C2 | 0.4330 (4) | 0.2070 (3) | 0.1894 (2) | 0.0195 (6) | |
| C3 | 0.5243 (4) | 0.1420 (4) | 0.1180 (2) | 0.0225 (6) | |
| H3 | 0.6308 | 0.0730 | 0.1323 | 0.027* | |
| C4 | 0.4630 (4) | 0.1761 (4) | 0.0277 (2) | 0.0268 (7) | |
| H4 | 0.5276 | 0.1323 | −0.0199 | 0.032* | |
| C5 | 0.3059 (5) | 0.2749 (4) | 0.0068 (2) | 0.0251 (7) | |
| C6 | 0.2098 (4) | 0.3362 (4) | 0.0761 (3) | 0.0247 (7) | |
| H6 | 0.1012 | 0.4009 | 0.0619 | 0.030* | |
| C7 | 0.2735 (4) | 0.3024 (3) | 0.1670 (2) | 0.0207 (6) | |
| H7 | 0.2074 | 0.3448 | 0.2146 | 0.025* | |
| C8 | 0.7636 (4) | 0.4347 (3) | 0.3155 (2) | 0.0204 (6) | |
| H8A | 0.8347 | 0.4327 | 0.2618 | 0.025* | |
| H8B | 0.6853 | 0.5327 | 0.3126 | 0.025* | |
| C9 | 0.8648 (4) | 0.3911 (3) | 0.4032 (2) | 0.0176 (6) | |
| C10 | 1.0255 (4) | 0.2947 (3) | 0.4075 (2) | 0.0188 (6) | |
| H10 | 1.0731 | 0.2611 | 0.3526 | 0.023* | |
| C11 | 1.1167 (4) | 0.2473 (3) | 0.4901 (2) | 0.0205 (6) | |
| H11 | 1.2255 | 0.1808 | 0.4923 | 0.025* | |
| C12 | 1.0476 (4) | 0.2978 (3) | 0.5691 (2) | 0.0180 (6) | |
| C13 | 0.8903 (4) | 0.3960 (3) | 0.5674 (2) | 0.0190 (6) | |
| H13 | 0.8452 | 0.4316 | 0.6221 | 0.023* | |
| C14 | 0.7993 (4) | 0.4417 (3) | 0.4843 (2) | 0.0184 (6) | |
| H14 | 0.6907 | 0.5084 | 0.4826 | 0.022* | |
| C15 | 0.4151 (4) | 0.5225 (3) | 0.1867 (2) | 0.0162 (5) | |
| C16 | 0.2813 (3) | 0.6374 (3) | 0.1270 (2) | 0.0150 (5) | |
| C17 | 0.1543 (4) | 0.7338 (3) | 0.1676 (2) | 0.0180 (6) | |
| H17 | 0.1538 | 0.7305 | 0.2332 | 0.022* | |
| C18 | 0.0282 (4) | 0.8350 (3) | 0.1102 (2) | 0.0208 (6) | |
| H18 | −0.0597 | 0.9035 | 0.1353 | 0.025* | |
| C19 | 0.0336 (4) | 0.8336 (3) | 0.0151 (2) | 0.0197 (6) | |
| H19 | −0.0545 | 0.9010 | −0.0237 | 0.024* | |
| C20 | 0.2787 (4) | 0.6464 (3) | 0.0306 (2) | 0.0192 (6) | |
| H20 | 0.3673 | 0.5818 | 0.0032 | 0.023* | |
| C21 | 0.6771 (3) | 0.1968 (3) | 0.48055 (19) | 0.0141 (5) | |
| C22 | 0.6982 (4) | 0.1403 (3) | 0.5829 (2) | 0.0155 (5) | |
| C23 | 0.5673 (4) | 0.1831 (3) | 0.6405 (2) | 0.0191 (6) | |
| H23 | 0.4650 | 0.2506 | 0.6157 | 0.023* | |
| C24 | 0.5882 (4) | 0.1257 (4) | 0.7348 (2) | 0.0193 (6) | |
| H24 | 0.5006 | 0.1519 | 0.7756 | 0.023* | |
| C25 | 0.7402 (4) | 0.0293 (3) | 0.7676 (2) | 0.0191 (6) | |
| H25 | 0.7543 | −0.0112 | 0.8319 | 0.023* | |
| C26 | 0.8467 (4) | 0.0453 (3) | 0.6216 (2) | 0.0166 (5) | |
| H26 | 0.9363 | 0.0181 | 0.5822 | 0.020* |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Sn1 | 0.01514 (15) | 0.01586 (15) | 0.00806 (15) | −0.00249 (10) | −0.00275 (9) | 0.00174 (9) |
| Cl1 | 0.0496 (5) | 0.0521 (6) | 0.0153 (4) | −0.0313 (5) | −0.0098 (4) | 0.0043 (4) |
| Cl2 | 0.0204 (4) | 0.0416 (5) | 0.0149 (4) | −0.0118 (3) | −0.0048 (3) | 0.0020 (3) |
| O1 | 0.0197 (10) | 0.0194 (10) | 0.0089 (10) | −0.0026 (8) | −0.0024 (7) | 0.0030 (8) |
| O2 | 0.0180 (10) | 0.0174 (10) | 0.0124 (10) | −0.0041 (8) | −0.0009 (8) | −0.0004 (8) |
| O3 | 0.0190 (10) | 0.0217 (10) | 0.0101 (10) | −0.0008 (8) | −0.0013 (8) | 0.0017 (8) |
| O4 | 0.0175 (10) | 0.0173 (10) | 0.0122 (10) | −0.0039 (8) | −0.0021 (8) | 0.0005 (8) |
| O1W | 0.0174 (10) | 0.0237 (11) | 0.0095 (9) | 0.0003 (8) | −0.0043 (8) | 0.0028 (8) |
| N1 | 0.0192 (12) | 0.0180 (11) | 0.0116 (12) | −0.0035 (9) | −0.0051 (9) | 0.0022 (9) |
| N2 | 0.0208 (12) | 0.0206 (12) | 0.0119 (12) | −0.0060 (10) | −0.0045 (9) | 0.0029 (10) |
| C1 | 0.0223 (15) | 0.0242 (15) | 0.0148 (15) | −0.0090 (13) | −0.0055 (12) | 0.0038 (12) |
| C2 | 0.0222 (15) | 0.0215 (14) | 0.0161 (15) | −0.0115 (12) | −0.0025 (11) | 0.0009 (11) |
| C3 | 0.0233 (15) | 0.0241 (15) | 0.0204 (16) | −0.0100 (12) | −0.0018 (12) | −0.0027 (12) |
| C4 | 0.0326 (17) | 0.0342 (18) | 0.0211 (16) | −0.0198 (15) | 0.0022 (13) | −0.0078 (14) |
| C5 | 0.0357 (18) | 0.0303 (17) | 0.0152 (15) | −0.0216 (15) | −0.0060 (13) | 0.0025 (13) |
| C6 | 0.0237 (15) | 0.0241 (15) | 0.0233 (17) | −0.0096 (13) | −0.0088 (13) | 0.0054 (13) |
| C7 | 0.0215 (14) | 0.0224 (14) | 0.0169 (15) | −0.0089 (12) | −0.0023 (11) | 0.0008 (12) |
| C8 | 0.0264 (16) | 0.0196 (14) | 0.0111 (14) | −0.0074 (12) | −0.0052 (12) | 0.0047 (11) |
| C9 | 0.0229 (14) | 0.0177 (13) | 0.0127 (14) | −0.0097 (12) | −0.0026 (11) | 0.0008 (11) |
| C10 | 0.0213 (14) | 0.0202 (14) | 0.0146 (14) | −0.0084 (12) | 0.0018 (11) | −0.0027 (11) |
| C11 | 0.0186 (14) | 0.0212 (14) | 0.0208 (15) | −0.0069 (11) | 0.0009 (11) | −0.0035 (12) |
| C12 | 0.0189 (14) | 0.0222 (14) | 0.0122 (14) | −0.0091 (12) | −0.0035 (11) | 0.0020 (11) |
| C13 | 0.0226 (15) | 0.0202 (14) | 0.0151 (14) | −0.0097 (12) | 0.0010 (11) | −0.0027 (11) |
| C14 | 0.0209 (14) | 0.0168 (13) | 0.0146 (14) | −0.0060 (11) | −0.0023 (11) | 0.0012 (11) |
| C15 | 0.0193 (13) | 0.0154 (13) | 0.0121 (13) | −0.0063 (11) | −0.0026 (10) | 0.0013 (10) |
| C16 | 0.0156 (13) | 0.0168 (13) | 0.0103 (13) | −0.0058 (11) | −0.0030 (10) | 0.0030 (10) |
| C17 | 0.0197 (13) | 0.0180 (13) | 0.0115 (13) | −0.0043 (11) | −0.0017 (10) | 0.0022 (11) |
| C18 | 0.0193 (14) | 0.0182 (13) | 0.0172 (15) | −0.0014 (11) | −0.0005 (11) | 0.0014 (11) |
| C19 | 0.0178 (13) | 0.0182 (13) | 0.0165 (15) | −0.0030 (11) | −0.0071 (11) | 0.0051 (11) |
| C20 | 0.0215 (14) | 0.0199 (14) | 0.0117 (14) | −0.0048 (11) | −0.0014 (11) | 0.0004 (11) |
| C21 | 0.0151 (12) | 0.0152 (12) | 0.0081 (13) | −0.0044 (10) | −0.0031 (10) | 0.0043 (10) |
| C22 | 0.0196 (13) | 0.0168 (13) | 0.0091 (13) | −0.0072 (11) | −0.0017 (10) | 0.0005 (10) |
| C23 | 0.0178 (13) | 0.0201 (14) | 0.0138 (14) | −0.0039 (11) | −0.0019 (10) | 0.0022 (11) |
| C24 | 0.0210 (15) | 0.0252 (15) | 0.0093 (14) | −0.0080 (12) | 0.0018 (11) | −0.0002 (11) |
| C25 | 0.0225 (14) | 0.0216 (14) | 0.0106 (13) | −0.0081 (12) | −0.0037 (11) | 0.0028 (11) |
| C26 | 0.0183 (13) | 0.0154 (12) | 0.0135 (13) | −0.0047 (11) | −0.0012 (10) | −0.0003 (10) |
| Sn1—C8 | 2.151 (3) | C7—H7 | 0.9500 |
| Sn1—C1 | 2.153 (3) | C8—C9 | 1.494 (4) |
| Sn1—O1W | 2.254 (2) | C8—H8A | 0.9900 |
| Sn1—O1 | 2.276 (2) | C8—H8B | 0.9900 |
| Sn1—O3 | 2.281 (2) | C9—C14 | 1.398 (4) |
| Sn1—O2 | 2.346 (2) | C9—C10 | 1.397 (4) |
| Sn1—O4 | 2.368 (2) | C10—C11 | 1.385 (4) |
| Sn1—C21 | 2.653 (3) | C10—H10 | 0.9500 |
| Sn1—C15 | 2.666 (3) | C11—C12 | 1.378 (4) |
| Cl1—C5 | 1.739 (3) | C11—H11 | 0.9500 |
| Cl2—C12 | 1.749 (3) | C12—C13 | 1.383 (4) |
| O1—C21 | 1.269 (4) | C13—C14 | 1.390 (4) |
| O2—C21 | 1.264 (4) | C13—H13 | 0.9500 |
| O3—C15 | 1.273 (4) | C14—H14 | 0.9500 |
| O4—C15 | 1.255 (4) | C15—C16 | 1.494 (4) |
| O1W—H1 | 0.8400 | C16—C17 | 1.391 (4) |
| O1W—H2 | 0.8400 | C16—C20 | 1.393 (4) |
| N1—C25 | 1.347 (4) | C17—C18 | 1.389 (4) |
| N1—C26 | 1.349 (4) | C17—H17 | 0.9500 |
| N2—C19 | 1.340 (4) | C18—C19 | 1.388 (4) |
| N2—C20 | 1.341 (4) | C18—H18 | 0.9500 |
| C1—C2 | 1.483 (4) | C19—H19 | 0.9500 |
| C1—H1A | 0.9900 | C20—H20 | 0.9500 |
| C1—H1B | 0.9900 | C21—C22 | 1.496 (4) |
| C2—C7 | 1.400 (4) | C22—C26 | 1.382 (4) |
| C2—C3 | 1.404 (5) | C22—C23 | 1.391 (4) |
| C3—C4 | 1.380 (5) | C23—C24 | 1.387 (4) |
| C3—H3 | 0.9500 | C23—H23 | 0.9500 |
| C4—C5 | 1.392 (5) | C24—C25 | 1.384 (4) |
| C4—H4 | 0.9500 | C24—H24 | 0.9500 |
| C5—C6 | 1.381 (5) | C25—H25 | 0.9500 |
| C6—C7 | 1.395 (5) | C26—H26 | 0.9500 |
| C6—H6 | 0.9500 | ||
| C8—Sn1—C1 | 178.62 (11) | C2—C7—H7 | 119.4 |
| C8—Sn1—O1W | 90.93 (11) | C9—C8—Sn1 | 115.3 (2) |
| C1—Sn1—O1W | 87.70 (11) | C9—C8—H8A | 108.5 |
| C8—Sn1—O1 | 92.45 (10) | Sn1—C8—H8A | 108.5 |
| C1—Sn1—O1 | 88.51 (11) | C9—C8—H8B | 108.5 |
| O1W—Sn1—O1 | 140.24 (8) | Sn1—C8—H8B | 108.5 |
| C8—Sn1—O3 | 91.45 (11) | H8A—C8—H8B | 107.5 |
| C1—Sn1—O3 | 89.65 (11) | C14—C9—C10 | 118.2 (3) |
| O1W—Sn1—O3 | 137.17 (8) | C14—C9—C8 | 120.8 (3) |
| O1—Sn1—O3 | 82.34 (8) | C10—C9—C8 | 121.0 (3) |
| C8—Sn1—O2 | 91.61 (10) | C11—C10—C9 | 121.2 (3) |
| C1—Sn1—O2 | 88.10 (10) | C11—C10—H10 | 119.4 |
| O1W—Sn1—O2 | 83.33 (8) | C9—C10—H10 | 119.4 |
| O1—Sn1—O2 | 56.98 (8) | C12—C11—C10 | 119.1 (3) |
| O3—Sn1—O2 | 139.30 (8) | C12—C11—H11 | 120.5 |
| C8—Sn1—O4 | 87.44 (10) | C10—C11—H11 | 120.5 |
| C1—Sn1—O4 | 92.48 (10) | C11—C12—C13 | 121.5 (3) |
| O1W—Sn1—O4 | 80.87 (8) | C11—C12—Cl2 | 119.6 (2) |
| O1—Sn1—O4 | 138.86 (8) | C13—C12—Cl2 | 118.8 (2) |
| O3—Sn1—O4 | 56.55 (8) | C12—C13—C14 | 118.9 (3) |
| O2—Sn1—O4 | 164.15 (8) | C12—C13—H13 | 120.6 |
| C8—Sn1—C21 | 91.62 (10) | C14—C13—H13 | 120.6 |
| C1—Sn1—C21 | 88.76 (11) | C13—C14—C9 | 121.1 (3) |
| O1W—Sn1—C21 | 111.77 (8) | C13—C14—H14 | 119.5 |
| O1—Sn1—C21 | 28.55 (8) | C9—C14—H14 | 119.5 |
| O3—Sn1—C21 | 110.90 (8) | O4—C15—O3 | 121.3 (3) |
| O2—Sn1—C21 | 28.44 (8) | O4—C15—C16 | 121.0 (3) |
| O4—Sn1—C21 | 167.35 (9) | O3—C15—C16 | 117.7 (3) |
| C8—Sn1—C15 | 90.37 (10) | O4—C15—Sn1 | 62.65 (16) |
| C1—Sn1—C15 | 90.20 (11) | O3—C15—Sn1 | 58.73 (15) |
| O1W—Sn1—C15 | 108.75 (8) | C16—C15—Sn1 | 174.4 (2) |
| O1—Sn1—C15 | 110.83 (8) | C17—C16—C20 | 119.1 (3) |
| O3—Sn1—C15 | 28.49 (8) | C17—C16—C15 | 120.2 (3) |
| O2—Sn1—C15 | 167.73 (9) | C20—C16—C15 | 120.6 (3) |
| O4—Sn1—C15 | 28.09 (9) | C18—C17—C16 | 118.5 (3) |
| C21—Sn1—C15 | 139.38 (9) | C18—C17—H17 | 120.8 |
| C21—O1—Sn1 | 92.46 (17) | C16—C17—H17 | 120.8 |
| C21—O2—Sn1 | 89.38 (17) | C19—C18—C17 | 118.4 (3) |
| C15—O3—Sn1 | 92.78 (18) | C19—C18—H18 | 120.8 |
| C15—O4—Sn1 | 89.26 (18) | C17—C18—H18 | 120.8 |
| Sn1—O1W—H1 | 109.5 | N2—C19—C18 | 123.8 (3) |
| Sn1—O1W—H2 | 109.5 | N2—C19—H19 | 118.1 |
| H1—O1W—H2 | 109.5 | C18—C19—H19 | 118.1 |
| C25—N1—C26 | 117.6 (3) | N2—C20—C16 | 122.7 (3) |
| C19—N2—C20 | 117.5 (3) | N2—C20—H20 | 118.7 |
| C2—C1—Sn1 | 113.9 (2) | C16—C20—H20 | 118.7 |
| C2—C1—H1A | 108.8 | O2—C21—O1 | 121.1 (3) |
| Sn1—C1—H1A | 108.8 | O2—C21—C22 | 120.1 (3) |
| C2—C1—H1B | 108.8 | O1—C21—C22 | 118.7 (3) |
| Sn1—C1—H1B | 108.8 | O2—C21—Sn1 | 62.18 (15) |
| H1A—C1—H1B | 107.7 | O1—C21—Sn1 | 58.99 (14) |
| C7—C2—C3 | 117.6 (3) | C22—C21—Sn1 | 177.4 (2) |
| C7—C2—C1 | 121.3 (3) | C26—C22—C23 | 119.1 (3) |
| C3—C2—C1 | 121.0 (3) | C26—C22—C21 | 120.9 (3) |
| C4—C3—C2 | 121.5 (3) | C23—C22—C21 | 120.0 (3) |
| C4—C3—H3 | 119.2 | C24—C23—C22 | 119.0 (3) |
| C2—C3—H3 | 119.2 | C24—C23—H23 | 120.5 |
| C3—C4—C5 | 119.5 (3) | C22—C23—H23 | 120.5 |
| C3—C4—H4 | 120.3 | C25—C24—C23 | 118.2 (3) |
| C5—C4—H4 | 120.3 | C25—C24—H24 | 120.9 |
| C6—C5—C4 | 120.6 (3) | C23—C24—H24 | 120.9 |
| C6—C5—Cl1 | 120.0 (3) | N1—C25—C24 | 123.5 (3) |
| C4—C5—Cl1 | 119.5 (3) | N1—C25—H25 | 118.2 |
| C5—C6—C7 | 119.5 (3) | C24—C25—H25 | 118.2 |
| C5—C6—H6 | 120.3 | N1—C26—C22 | 122.5 (3) |
| C7—C6—H6 | 120.3 | N1—C26—H26 | 118.8 |
| C6—C7—C2 | 121.2 (3) | C22—C26—H26 | 118.8 |
| C6—C7—H7 | 119.4 | ||
| C8—Sn1—O1—C21 | −88.89 (19) | C12—C13—C14—C9 | −0.7 (5) |
| C1—Sn1—O1—C21 | 90.13 (19) | C10—C9—C14—C13 | −1.0 (4) |
| O1W—Sn1—O1—C21 | 5.5 (2) | C8—C9—C14—C13 | 176.6 (3) |
| O3—Sn1—O1—C21 | 179.97 (18) | Sn1—O4—C15—O3 | 3.8 (3) |
| O2—Sn1—O1—C21 | 1.43 (16) | Sn1—O4—C15—C16 | −175.1 (2) |
| O4—Sn1—O1—C21 | −177.81 (15) | Sn1—O3—C15—O4 | −3.9 (3) |
| C15—Sn1—O1—C21 | 179.78 (17) | Sn1—O3—C15—C16 | 175.0 (2) |
| C8—Sn1—O2—C21 | 90.45 (19) | C8—Sn1—C15—O4 | 83.86 (19) |
| C1—Sn1—O2—C21 | −90.90 (19) | C1—Sn1—C15—O4 | −94.88 (19) |
| O1W—Sn1—O2—C21 | −178.80 (18) | O1W—Sn1—C15—O4 | −7.25 (19) |
| O1—Sn1—O2—C21 | −1.44 (16) | O1—Sn1—C15—O4 | 176.63 (16) |
| O3—Sn1—O2—C21 | −3.7 (2) | O3—Sn1—C15—O4 | 176.2 (3) |
| O4—Sn1—O2—C21 | 176.7 (2) | O2—Sn1—C15—O4 | −176.8 (3) |
| C15—Sn1—O2—C21 | −8.7 (5) | C21—Sn1—C15—O4 | 176.79 (15) |
| C8—Sn1—O3—C15 | 88.09 (19) | C8—Sn1—C15—O3 | −92.37 (19) |
| C1—Sn1—O3—C15 | −91.08 (19) | C1—Sn1—C15—O3 | 88.88 (19) |
| O1W—Sn1—O3—C15 | −4.9 (2) | O1W—Sn1—C15—O3 | 176.52 (17) |
| O1—Sn1—O3—C15 | −179.63 (18) | O1—Sn1—C15—O3 | 0.40 (19) |
| O2—Sn1—O3—C15 | −177.75 (15) | O2—Sn1—C15—O3 | 6.9 (5) |
| O4—Sn1—O3—C15 | 2.13 (16) | O4—Sn1—C15—O3 | −176.2 (3) |
| C21—Sn1—O3—C15 | −179.61 (17) | C21—Sn1—C15—O3 | 0.6 (2) |
| C8—Sn1—O4—C15 | −95.59 (19) | O4—C15—C16—C17 | −169.0 (3) |
| C1—Sn1—O4—C15 | 85.78 (19) | O3—C15—C16—C17 | 12.1 (4) |
| O1W—Sn1—O4—C15 | 173.05 (18) | O4—C15—C16—C20 | 13.6 (4) |
| O1—Sn1—O4—C15 | −4.8 (2) | O3—C15—C16—C20 | −165.4 (3) |
| O3—Sn1—O4—C15 | −2.15 (16) | C20—C16—C17—C18 | 0.6 (4) |
| O2—Sn1—O4—C15 | 177.5 (2) | C15—C16—C17—C18 | −176.9 (3) |
| C21—Sn1—O4—C15 | −9.6 (4) | C16—C17—C18—C19 | 1.1 (4) |
| O1W—Sn1—C1—C2 | −73.1 (2) | C20—N2—C19—C18 | 1.0 (5) |
| O1—Sn1—C1—C2 | 146.5 (2) | C17—C18—C19—N2 | −2.0 (5) |
| O3—Sn1—C1—C2 | 64.2 (2) | C19—N2—C20—C16 | 0.9 (5) |
| O2—Sn1—C1—C2 | −156.5 (2) | C17—C16—C20—N2 | −1.7 (4) |
| O4—Sn1—C1—C2 | 7.7 (2) | C15—C16—C20—N2 | 175.8 (3) |
| C21—Sn1—C1—C2 | 175.1 (2) | Sn1—O2—C21—O1 | 2.5 (3) |
| C15—Sn1—C1—C2 | 35.7 (2) | Sn1—O2—C21—C22 | −178.6 (2) |
| Sn1—C1—C2—C7 | −92.4 (3) | Sn1—O1—C21—O2 | −2.6 (3) |
| Sn1—C1—C2—C3 | 85.4 (3) | Sn1—O1—C21—C22 | 178.5 (2) |
| C7—C2—C3—C4 | 3.5 (5) | C8—Sn1—C21—O2 | −90.37 (18) |
| C1—C2—C3—C4 | −174.3 (3) | C1—Sn1—C21—O2 | 88.30 (19) |
| C2—C3—C4—C5 | −1.4 (5) | O1W—Sn1—C21—O2 | 1.28 (19) |
| C3—C4—C5—C6 | −1.7 (5) | O1—Sn1—C21—O2 | 177.5 (3) |
| C3—C4—C5—Cl1 | 177.0 (3) | O3—Sn1—C21—O2 | 177.45 (16) |
| C4—C5—C6—C7 | 2.5 (5) | O4—Sn1—C21—O2 | −175.9 (3) |
| Cl1—C5—C6—C7 | −176.2 (2) | C15—Sn1—C21—O2 | 177.16 (15) |
| C5—C6—C7—C2 | −0.2 (5) | C8—Sn1—C21—O1 | 92.15 (19) |
| C3—C2—C7—C6 | −2.7 (5) | C1—Sn1—C21—O1 | −89.18 (19) |
| C1—C2—C7—C6 | 175.1 (3) | O1W—Sn1—C21—O1 | −176.20 (16) |
| O1W—Sn1—C8—C9 | −95.9 (2) | O3—Sn1—C21—O1 | −0.03 (19) |
| O1—Sn1—C8—C9 | 44.4 (2) | O2—Sn1—C21—O1 | −177.5 (3) |
| O3—Sn1—C8—C9 | 126.8 (2) | O4—Sn1—C21—O1 | 6.6 (5) |
| O2—Sn1—C8—C9 | −12.6 (2) | C15—Sn1—C21—O1 | −0.3 (2) |
| O4—Sn1—C8—C9 | −176.8 (2) | O2—C21—C22—C26 | 16.9 (4) |
| C21—Sn1—C8—C9 | 15.9 (2) | O1—C21—C22—C26 | −164.2 (3) |
| C15—Sn1—C8—C9 | 155.3 (2) | O2—C21—C22—C23 | −163.0 (3) |
| Sn1—C8—C9—C14 | −87.8 (3) | O1—C21—C22—C23 | 15.9 (4) |
| Sn1—C8—C9—C10 | 89.7 (3) | C26—C22—C23—C24 | −2.1 (4) |
| C14—C9—C10—C11 | 1.7 (4) | C21—C22—C23—C24 | 177.8 (3) |
| C8—C9—C10—C11 | −175.9 (3) | C22—C23—C24—C25 | 0.9 (5) |
| C9—C10—C11—C12 | −0.8 (5) | C26—N1—C25—C24 | −1.7 (5) |
| C10—C11—C12—C13 | −0.9 (5) | C23—C24—C25—N1 | 1.0 (5) |
| C10—C11—C12—Cl2 | 179.2 (2) | C25—N1—C26—C22 | 0.4 (4) |
| C11—C12—C13—C14 | 1.6 (5) | C23—C22—C26—N1 | 1.4 (4) |
| Cl2—C12—C13—C14 | −178.5 (2) | C21—C22—C26—N1 | −178.4 (3) |
| D—H···A | D—H | H···A | D···A | D—H···A |
| O1w—H1···N1i | 0.84 | 1.93 | 2.721 (3) | 158 |
| O1w—H2···N2ii | 0.84 | 2.01 | 2.754 (3) | 146 |
| Symmetry codes: (i) −x+2, −y, −z+1; (ii) −x+1, −y+1, −z. |
Experimental details
| Crystal data | |
| Chemical formula | [Sn(C7H6Cl)2(C6H4NO2)2(H2O)] |
| Mr | 632.05 |
| Crystal system, space group | Triclinic, P1 |
| Temperature (K) | 100 |
| a, b, c (Å) | 9.0219 (1), 10.5929 (1), 14.5866 (2) |
| α, β, γ (°) | 79.6490 (5), 87.6290 (5), 66.5051 (4) |
| V (Å3) | 1256.93 (3) |
| Z | 2 |
| Radiation type | Mo Kα |
| µ (mm−1) | 1.27 |
| Crystal size (mm) | 0.35 × 0.30 × 0.25 |
| Data collection | |
| Diffractometer | Bruker SMART APEX |
| Absorption correction | Multi-scan (SADABS; Sheldrick, 1996) |
| Tmin, Tmax | 0.665, 0.742 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 11404, 5673, 5416 |
| Rint | 0.022 |
| (sin θ/λ)max (Å−1) | 0.650 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.039, 0.133, 1.07 |
| No. of reflections | 5673 |
| No. of parameters | 326 |
| H-atom treatment | H-atom parameters constrained |
| Δρmax, Δρmin (e Å−3) | 2.51, −1.96 |
Computer programs: APEX2 (Bruker, 2009), SAINT (Bruker, 2009), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), X-SEED (Barbour, 2001), publCIF (Westrip, 2010).
| D—H···A | D—H | H···A | D···A | D—H···A |
| O1w—H1···N1i | 0.84 | 1.93 | 2.721 (3) | 158 |
| O1w—H2···N2ii | 0.84 | 2.01 | 2.754 (3) | 146 |
| Symmetry codes: (i) −x+2, −y, −z+1; (ii) −x+1, −y+1, −z. |
Acknowledgements
We thank the University of Malaya (grant No. RG020/09AFR) for supporting this study.
References
Barbour, L. J. (2001). J. Supramol. Chem. 1, 189–191. CrossRef CAS Google Scholar
Bruker (2009). APEX2 and SAINT. Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
Keng, C. T., Lo, K. M. & Ng, S. W. (2010). Acta Cryst. E66, m1008. Web of Science CSD CrossRef IUCr Journals Google Scholar
Sheldrick, G. M. (1996). SADABS. University of Göttingen, Germany. Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Sisido, K., Takeda, Y. & Kinugawa, Z. (1961). J. Am. Chem. Soc. 83, 538–541. CrossRef Web of Science Google Scholar
Tiekink, E. R. T. (1991). Appl. Organomet. Chem. 5, 1–23. CrossRef CAS Web of Science Google Scholar
Tiekink, E. R. T. (1994). Trends Organomet. Chem. 1, 71–116. Google Scholar
Westrip, S. P. (2010). J. Appl. Cryst. 43, 920–925. Web of Science CrossRef CAS IUCr Journals Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.

journal menu
access
![[Figure 1]](./bt5527fig1thm.gif)
![[Figure 2]](./bt5527fig2thm.gif)




Nicotinic acid affords a large number of compounds with organotins. For the diorganotin system in particular, the nicotinate ion can behave as an O,O'-chelate, but when two ions bind to a diorganotin cation, there is some space in the coordination polyhedron to admit a small ligand such as a water molecule (Tiekink, 1991; 1994). The bromo analog of the title compound (Scheme I) exists as a dinuclear compound as the N atom engages in coordination (Keng et al., 2010). The O atoms of the two chelating nicotinate groups and the O atom of the coordinated water molecule comprise the pentagonal plane of the trans-C2SnO5 pentagonal-bipyramid [C–Sn–C 178.6 (1) °] surrounding the SnIV atom in title compound (Fig. 1). The N atom does not engage in binding to an adjacent metal center. Instead, both N atoms serve as hydrogen bond acceptors (Table 1). Adjacent molecules are linked by O–H···N hydrogen bonds to generate a chain along [1 - 1 1].