metal-organic compounds
(N,N-Diethylnicotinamide-κN1)bis[4,4,4-trifluoro-1-(thien-2-yl)butane-1,3-dionato-κ2O,O′]copper(II)
aDepartment of Organic Chemistry, Baku State University, Baku, Azerbaijan, and bDepartment of Chemistry, University of Malaya, 50603 Kuala Lumpur, Malaysia
*Correspondence e-mail: [email protected]
In the title compound, [Cu(C8H4F3O2S)2(C10H14N2O)], the CuII atom exists in a distorted CuNO4 square-pyramidal geometry; the metal atom lies above a square plane defined by four O atoms of the two chelating anionic ligands, displaced in the direction of the axial occupant, the pyridine N atom, by 0.179 (1) Å. Weak intermolecular C—H⋯O and C—H⋯F hydrogen bonding is present in the One thienyl ring is disordered over two orientations in an occupancy ratio of 0.69 (1):0.31.
Related literature
For the related of bis[4,4,4-trifluoro-1-(thien-2-yl)butane-1,3-dionato]copper(II), see: Lecomte et al. (1988
); Wang et al. (1996
); Xu et al. (2010
). For some adducts with N-heterocycles, see: Gou et al. (1991
); Li et al. (1994
); Liu et al. (1986
); Yu et al. (1988
).
Experimental
Crystal data
|
Refinement
|
| ||||||||||||||
| |||||||||||||||||||||||||||
Data collection: APEX2 (Bruker, 2005
); cell refinement: SAINT (Bruker, 2005
); data reduction: SAINT; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: X-SEED (Barbour, 2001
); software used to prepare material for publication: publCIF (Westrip, 2010
).
Supporting information
contains datablocks global, I. DOI: https://doi.org/10.1107/S1600536811014401/xu5194sup1.cif
Structure factors: contains datablock I. DOI: https://doi.org/10.1107/S1600536811014401/xu5194Isup2.hkl
Bis[4,4,4-trifluoro-1-(thien-2-yl)butane-1,3-dionato]copper was synthesized by using a literature procedure (Lecomte et al., 1988; Wang et al., 1996; Xu et al., 2010). A solution of theonyltrifluoroacetylacetone (0.44 g, 0.002 mol) in ethanol (50 ml) and N,N-diethylnicotinamide (0.18 g, 0.001 mol) was added to a solution of copper sulfate pentahydrate (0.25 g, 0.001 mol) dissolved in water (50 ml). The resulting green solution has heated for a hour and then set aside for a week. The solid was filtered and recrystallized from ethanol (80%, m.p. 515 K); yield 65%. CHN&S elemental analysis. Found: C 45.69, H 3.31, S 9.48, F 16.75%; calculated for C26H22N2O5CuF6S2: C 45.61, H 3.22, S 9.36, F 16.67%.
Carbon-bound H-atoms were placed in calculated positions [C–H 0.93 to 0.97 Å; U(H) 1.2 to 1.5U(C)] and were included in the in the riding model approximation.
One thienyl ring is disodered over two positions in a 69 (1): 31 ratio. The C–S distances were restrained to 1.70±0.01 Å and the C–C distances to 1.35±0.01 Å. The disordered rings were restrained to be nearly flat. The anisotropic temperature factors of S2 was set to those of C11', those of C9 to those of C10', those of C10 to that of C9' and those of C11 to those of S2'. The anisotropic temperature factors were restrained to be nearly isotropic.
The C–C distances of the ethyl chains were tightly restrained to 1.540±0.005 Å.
The anisotropic temperature factors of the fluorine atoms were also restrained to be nearly isotropic.
Square-planar bis[4,4,4-trifluoro-1-(thien-2-yl)butane-1,3-dionato]copper is a that forms adducts with a number of N-heterocycles. The parent exists as a square-planar molecule; its has been determined several times (Lecomte et al., 1988; Wang et al., 1996; Xu et al., 2010). For most adducts, the Cu atom exists in a six-coordinate geometry, e.g., the pyridine adduct (Liu et al., 1986). The 4,4'-bipyridine adduct exists in two forms; in one form, the Cu atom is octahedrally coordinated (Gou et al., 1991). The other is a dinuclear adduct in which the Cu atom shows the square-pyramidal coordination. In the title N,N-diethylbenzamide adduct (Scheme I), the Cu atom is similarly five-coordinate. The metal atom lies above the square plane defined by the O atoms of the two chelating anionic ligands in the direction of the axial occupant by 0.179 (1) Å.
For the related of bis[4,4,4-trifluoro-1-(thien-2-yl)butane-1,3-dionato]copper, see: Lecomte et al. (1988); Wang et al. (1996); Xu et al. (2010). For some adducts with N-heterocycles, see: Gou et al. (1991); Li et al. (1994); Liu et al. (1986); Yu et al. (1988).
Data collection: APEX2 (Bruker, 2005); cell SAINT (Bruker, 2005); data reduction: SAINT (Bruker, 2005); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: X-SEED (Barbour, 2001); software used to prepare material for publication: publCIF (Westrip, 2010).
| Fig. 1. Thermal ellipsoid plot (Barbour, 2001) of Cu(C10H14N2O)(C8H4F3O2S)2 at the 50% probability level; hydrogen atoms are drawn as spheres of arbitrary radius. The disorder is not shown. |
| [Cu(C8H4F3O2S)2(C10H14N2O)] | Z = 2 |
| Mr = 684.12 | F(000) = 694 |
| Triclinic, P1 | Dx = 1.522 Mg m−3 |
| Hall symbol: -P 1 | Mo Kα radiation, λ = 0.71073 Å |
| a = 11.4324 (5) Å | Cell parameters from 5935 reflections |
| b = 12.8606 (5) Å | θ = 2.4–27.9° |
| c = 13.0104 (5) Å | µ = 0.95 mm−1 |
| α = 62.837 (1)° | T = 293 K |
| β = 64.110 (1)° | Prism, green |
| γ = 88.783 (1)° | 0.30 × 0.30 × 0.30 mm |
| V = 1492.72 (10) Å3 |
| Bruker APEXII diffractometer | 6849 independent reflections |
| Radiation source: fine-focus sealed tube | 5423 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.021 |
| φ and ω scans | θmax = 27.5°, θmin = 1.8° |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | h = −14→14 |
| Tmin = 0.618, Tmax = 0.746 | k = −16→16 |
| 16434 measured reflections | l = −16→16 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.048 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.152 | H-atom parameters constrained |
| S = 1.05 | w = 1/[σ2(Fo2) + (0.0881P)2 + 0.5656P] where P = (Fo2 + 2Fc2)/3 |
| 6849 reflections | (Δ/σ)max = 0.001 |
| 392 parameters | Δρmax = 0.80 e Å−3 |
| 80 restraints | Δρmin = −0.48 e Å−3 |
| [Cu(C8H4F3O2S)2(C10H14N2O)] | γ = 88.783 (1)° |
| Mr = 684.12 | V = 1492.72 (10) Å3 |
| Triclinic, P1 | Z = 2 |
| a = 11.4324 (5) Å | Mo Kα radiation |
| b = 12.8606 (5) Å | µ = 0.95 mm−1 |
| c = 13.0104 (5) Å | T = 293 K |
| α = 62.837 (1)° | 0.30 × 0.30 × 0.30 mm |
| β = 64.110 (1)° |
| Bruker APEXII diffractometer | 6849 independent reflections |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | 5423 reflections with I > 2σ(I) |
| Tmin = 0.618, Tmax = 0.746 | Rint = 0.021 |
| 16434 measured reflections |
| R[F2 > 2σ(F2)] = 0.048 | 80 restraints |
| wR(F2) = 0.152 | H-atom parameters constrained |
| S = 1.05 | Δρmax = 0.80 e Å−3 |
| 6849 reflections | Δρmin = −0.48 e Å−3 |
| 392 parameters |
| x | y | z | Uiso*/Ueq | Occ. (<1) | |
| Cu1 | 0.30419 (3) | 0.56562 (3) | 0.41193 (3) | 0.04574 (14) | |
| S1 | 0.54183 (10) | 0.72016 (9) | 0.54939 (11) | 0.0756 (3) | |
| S2 | 0.6254 (2) | 0.8905 (2) | −0.13505 (17) | 0.1145 (10) | 0.690 (4) |
| S2' | 0.6483 (8) | 0.9072 (7) | 0.0696 (9) | 0.1087 (19) | 0.310 (4) |
| F1 | 0.0837 (4) | 0.2134 (3) | 0.8976 (3) | 0.1525 (16) | |
| F2 | 0.1339 (5) | 0.1709 (2) | 0.7503 (4) | 0.176 (2) | |
| F3 | −0.0184 (3) | 0.2524 (3) | 0.7936 (4) | 0.1409 (14) | |
| F4 | 0.2363 (3) | 0.4454 (3) | 0.1471 (4) | 0.1172 (10) | |
| F5 | 0.0665 (2) | 0.5072 (3) | 0.2318 (2) | 0.0937 (8) | |
| F6 | 0.2142 (3) | 0.6186 (3) | 0.0325 (2) | 0.1167 (11) | |
| O1 | 0.39754 (19) | 0.59008 (18) | 0.4959 (2) | 0.0488 (4) | |
| O2 | 0.1956 (2) | 0.41288 (18) | 0.5671 (2) | 0.0517 (5) | |
| O3 | 0.4426 (2) | 0.69749 (19) | 0.2487 (2) | 0.0571 (5) | |
| O4 | 0.2310 (2) | 0.5291 (2) | 0.3203 (2) | 0.0563 (5) | |
| O5 | 0.2239 (4) | 1.0114 (2) | 0.4841 (4) | 0.0956 (10) | |
| N1 | 0.1673 (2) | 0.6845 (2) | 0.4613 (2) | 0.0492 (5) | |
| N2 | 0.1538 (5) | 0.8623 (4) | 0.6909 (4) | 0.1059 (14) | |
| C1 | 0.5746 (4) | 0.7210 (4) | 0.6636 (5) | 0.0816 (12) | |
| H1 | 0.6319 | 0.7840 | 0.6463 | 0.098* | |
| C2 | 0.5103 (4) | 0.6226 (4) | 0.7807 (5) | 0.0777 (11) | |
| H2 | 0.5200 | 0.6105 | 0.8524 | 0.093* | |
| C3 | 0.4245 (3) | 0.5360 (3) | 0.7883 (4) | 0.0575 (8) | |
| H3 | 0.3709 | 0.4635 | 0.8628 | 0.069* | |
| C4 | 0.4369 (3) | 0.5821 (3) | 0.6599 (3) | 0.0504 (6) | |
| C5 | 0.3676 (3) | 0.5306 (3) | 0.6161 (3) | 0.0451 (6) | |
| C6 | 0.2716 (3) | 0.4211 (3) | 0.7077 (3) | 0.0548 (7) | |
| H6 | 0.2583 | 0.3806 | 0.7935 | 0.066* | |
| C7 | 0.1978 (3) | 0.3724 (3) | 0.6751 (3) | 0.0490 (6) | |
| C8 | 0.1005 (4) | 0.2514 (3) | 0.7805 (3) | 0.0661 (9) | |
| C9 | 0.7529 (7) | 0.9912 (6) | −0.1766 (11) | 0.122 (3) | 0.690 (4) |
| H9 | 0.8160 | 1.0435 | −0.2634 | 0.147* | 0.690 (4) |
| C10 | 0.7554 (10) | 0.9894 (8) | −0.0739 (10) | 0.122 (3) | 0.690 (4) |
| H10 | 0.8190 | 1.0391 | −0.0801 | 0.146* | 0.690 (4) |
| C11 | 0.6508 (12) | 0.9040 (9) | 0.0415 (15) | 0.1087 (19) | 0.690 (4) |
| H11 | 0.6366 | 0.8905 | 0.1230 | 0.130* | 0.690 (4) |
| C9' | 0.734 (2) | 1.0246 (18) | −0.0845 (17) | 0.122 (3) | 0.31 |
| H9' | 0.7950 | 1.0882 | −0.1074 | 0.146* | 0.310 (4) |
| C10' | 0.7052 (18) | 1.0171 (19) | −0.170 (3) | 0.122 (3) | 0.31 |
| H10' | 0.7414 | 1.0720 | −0.2599 | 0.147* | 0.310 (4) |
| C11' | 0.6135 (16) | 0.9143 (16) | −0.1017 (10) | 0.1145 (10) | 0.31 |
| H11' | 0.5798 | 0.8933 | −0.1447 | 0.137* | 0.310 (4) |
| C12 | 0.5686 (4) | 0.8400 (3) | 0.0299 (4) | 0.0743 (10) | |
| C13 | 0.4566 (3) | 0.7379 (3) | 0.1354 (3) | 0.0562 (7) | |
| C14 | 0.3739 (4) | 0.6899 (3) | 0.1052 (3) | 0.0648 (9) | |
| H14 | 0.3900 | 0.7269 | 0.0185 | 0.078* | |
| C15 | 0.2713 (3) | 0.5912 (3) | 0.1982 (3) | 0.0556 (7) | |
| C16 | 0.1958 (4) | 0.5407 (4) | 0.1521 (3) | 0.0730 (10) | |
| C17 | 0.0474 (3) | 0.6793 (3) | 0.4681 (3) | 0.0534 (7) | |
| H17 | 0.0212 | 0.6284 | 0.4456 | 0.064* | |
| C18 | −0.0389 (3) | 0.7461 (3) | 0.5069 (4) | 0.0635 (8) | |
| H18 | −0.1210 | 0.7415 | 0.5089 | 0.076* | |
| C19 | −0.0020 (3) | 0.8193 (3) | 0.5426 (3) | 0.0612 (8) | |
| H19 | −0.0591 | 0.8649 | 0.5697 | 0.073* | |
| C20 | 0.1210 (3) | 0.8250 (3) | 0.5380 (3) | 0.0523 (7) | |
| C21 | 0.2024 (3) | 0.7576 (3) | 0.4951 (3) | 0.0523 (7) | |
| H21 | 0.2863 | 0.7629 | 0.4894 | 0.063* | |
| C22 | 0.1703 (4) | 0.9079 (3) | 0.5698 (4) | 0.0650 (9) | |
| C23 | 0.0985 (10) | 0.7336 (7) | 0.7935 (6) | 0.176 (4) | |
| H23A | 0.1451 | 0.7088 | 0.8449 | 0.211* | |
| H23B | 0.1097 | 0.6845 | 0.7526 | 0.211* | |
| C24 | −0.0489 (10) | 0.7181 (11) | 0.8820 (10) | 0.280 (9) | |
| H24A | −0.0870 | 0.6352 | 0.9483 | 0.419* | |
| H24B | −0.0939 | 0.7437 | 0.8301 | 0.419* | |
| H24C | −0.0589 | 0.7656 | 0.9235 | 0.419* | |
| C25 | 0.1991 (7) | 0.9431 (6) | 0.7257 (7) | 0.129 (2) | |
| H25A | 0.1360 | 0.9222 | 0.8154 | 0.154* | |
| H25B | 0.2010 | 1.0251 | 0.6680 | 0.154* | |
| C26 | 0.3380 (8) | 0.9343 (6) | 0.7135 (8) | 0.159 (3) | |
| H26A | 0.3657 | 0.9904 | 0.7325 | 0.238* | |
| H26B | 0.4002 | 0.9527 | 0.6255 | 0.238* | |
| H26C | 0.3351 | 0.8545 | 0.7748 | 0.238* |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Cu1 | 0.0466 (2) | 0.0444 (2) | 0.0387 (2) | −0.00173 (14) | −0.01578 (15) | −0.01905 (15) |
| S1 | 0.0621 (5) | 0.0736 (6) | 0.0836 (7) | −0.0044 (4) | −0.0266 (5) | −0.0406 (5) |
| S2 | 0.1000 (14) | 0.1279 (17) | 0.0473 (9) | −0.0235 (11) | −0.0234 (9) | −0.0022 (9) |
| S2' | 0.097 (2) | 0.0894 (19) | 0.091 (4) | −0.0344 (15) | −0.034 (2) | −0.0166 (19) |
| F1 | 0.195 (3) | 0.123 (2) | 0.0635 (16) | −0.084 (2) | −0.056 (2) | 0.0088 (16) |
| F2 | 0.219 (4) | 0.0509 (15) | 0.139 (3) | −0.0227 (19) | 0.008 (3) | −0.0456 (17) |
| F3 | 0.0871 (19) | 0.100 (2) | 0.145 (3) | −0.0385 (16) | −0.046 (2) | −0.0009 (19) |
| F4 | 0.131 (2) | 0.138 (2) | 0.165 (3) | 0.042 (2) | −0.093 (2) | −0.116 (2) |
| F5 | 0.0675 (14) | 0.127 (2) | 0.0798 (15) | −0.0058 (13) | −0.0363 (12) | −0.0444 (15) |
| F6 | 0.117 (2) | 0.148 (3) | 0.0627 (14) | −0.0227 (18) | −0.0517 (15) | −0.0253 (15) |
| O1 | 0.0455 (10) | 0.0478 (10) | 0.0471 (11) | 0.0010 (8) | −0.0206 (9) | −0.0203 (9) |
| O2 | 0.0570 (12) | 0.0456 (10) | 0.0452 (11) | −0.0042 (9) | −0.0225 (9) | −0.0186 (9) |
| O3 | 0.0571 (12) | 0.0524 (11) | 0.0442 (11) | −0.0072 (9) | −0.0162 (10) | −0.0178 (9) |
| O4 | 0.0608 (12) | 0.0578 (12) | 0.0423 (11) | −0.0058 (10) | −0.0194 (10) | −0.0234 (10) |
| O5 | 0.123 (3) | 0.0534 (15) | 0.117 (3) | 0.0057 (16) | −0.073 (2) | −0.0324 (16) |
| N1 | 0.0512 (13) | 0.0482 (13) | 0.0499 (13) | 0.0069 (10) | −0.0247 (11) | −0.0251 (11) |
| N2 | 0.172 (4) | 0.076 (2) | 0.086 (3) | 0.004 (2) | −0.062 (3) | −0.051 (2) |
| C1 | 0.061 (2) | 0.093 (3) | 0.120 (4) | 0.013 (2) | −0.044 (2) | −0.074 (3) |
| C2 | 0.077 (3) | 0.098 (3) | 0.094 (3) | 0.021 (2) | −0.054 (2) | −0.063 (3) |
| C3 | 0.0663 (19) | 0.0606 (18) | 0.071 (2) | 0.0141 (15) | −0.0448 (17) | −0.0397 (16) |
| C4 | 0.0415 (14) | 0.0540 (16) | 0.0604 (17) | 0.0091 (12) | −0.0245 (13) | −0.0317 (14) |
| C5 | 0.0410 (14) | 0.0476 (14) | 0.0485 (15) | 0.0098 (11) | −0.0203 (12) | −0.0262 (12) |
| C6 | 0.0559 (17) | 0.0551 (17) | 0.0452 (15) | −0.0030 (13) | −0.0221 (14) | −0.0203 (13) |
| C7 | 0.0496 (15) | 0.0436 (14) | 0.0449 (15) | 0.0010 (12) | −0.0174 (13) | −0.0200 (12) |
| C8 | 0.075 (2) | 0.0557 (18) | 0.0492 (17) | −0.0144 (16) | −0.0257 (16) | −0.0150 (15) |
| C9 | 0.078 (6) | 0.105 (5) | 0.082 (4) | −0.013 (4) | −0.024 (5) | 0.017 (4) |
| C10 | 0.090 (4) | 0.079 (6) | 0.121 (5) | −0.026 (4) | −0.046 (4) | 0.004 (4) |
| C11 | 0.097 (2) | 0.0894 (19) | 0.091 (4) | −0.0344 (15) | −0.034 (2) | −0.0166 (19) |
| C9' | 0.090 (4) | 0.079 (6) | 0.121 (5) | −0.026 (4) | −0.046 (4) | 0.004 (4) |
| C10' | 0.078 (6) | 0.105 (5) | 0.082 (4) | −0.013 (4) | −0.024 (5) | 0.017 (4) |
| C11' | 0.1000 (14) | 0.1279 (17) | 0.0473 (9) | −0.0235 (11) | −0.0234 (9) | −0.0022 (9) |
| C12 | 0.067 (2) | 0.064 (2) | 0.0507 (19) | −0.0076 (17) | −0.0194 (17) | −0.0047 (16) |
| C13 | 0.0550 (17) | 0.0488 (16) | 0.0433 (15) | 0.0010 (13) | −0.0152 (13) | −0.0144 (13) |
| C14 | 0.069 (2) | 0.064 (2) | 0.0433 (16) | −0.0022 (16) | −0.0234 (15) | −0.0156 (15) |
| C15 | 0.0583 (18) | 0.0597 (18) | 0.0472 (16) | 0.0064 (14) | −0.0244 (14) | −0.0260 (14) |
| C16 | 0.074 (2) | 0.088 (3) | 0.057 (2) | 0.002 (2) | −0.0340 (19) | −0.0326 (19) |
| C17 | 0.0526 (16) | 0.0541 (16) | 0.0524 (16) | 0.0036 (13) | −0.0256 (14) | −0.0249 (14) |
| C18 | 0.0512 (18) | 0.068 (2) | 0.069 (2) | 0.0117 (15) | −0.0291 (16) | −0.0324 (18) |
| C19 | 0.0613 (19) | 0.0570 (18) | 0.0599 (19) | 0.0201 (15) | −0.0257 (16) | −0.0287 (16) |
| C20 | 0.0638 (18) | 0.0424 (14) | 0.0487 (16) | 0.0109 (13) | −0.0266 (14) | −0.0214 (13) |
| C21 | 0.0568 (17) | 0.0479 (15) | 0.0616 (18) | 0.0118 (13) | −0.0347 (15) | −0.0284 (14) |
| C22 | 0.081 (2) | 0.0492 (18) | 0.083 (2) | 0.0232 (17) | −0.047 (2) | −0.0395 (18) |
| C23 | 0.298 (12) | 0.133 (5) | 0.088 (4) | −0.042 (6) | −0.093 (6) | −0.045 (4) |
| C24 | 0.330 (17) | 0.313 (16) | 0.147 (8) | −0.124 (13) | −0.039 (9) | −0.141 (10) |
| C25 | 0.192 (7) | 0.111 (4) | 0.128 (5) | 0.015 (4) | −0.081 (5) | −0.089 (4) |
| C26 | 0.222 (9) | 0.123 (5) | 0.202 (8) | 0.032 (6) | −0.136 (8) | −0.099 (6) |
| Cu1—O1 | 1.9432 (19) | C9—C10 | 1.339 (8) |
| Cu1—O2 | 1.942 (2) | C9—H9 | 0.9300 |
| Cu1—O3 | 1.944 (2) | C10—C11 | 1.369 (10) |
| Cu1—O4 | 1.934 (2) | C10—H10 | 0.9300 |
| Cu1—N1 | 2.262 (2) | C11—C12 | 1.361 (10) |
| S1—C1 | 1.688 (4) | C11—H11 | 0.9300 |
| S1—C4 | 1.707 (3) | C9'—C10' | 1.338 (11) |
| S2—C9 | 1.687 (8) | C9'—H9' | 0.9300 |
| S2—C12 | 1.725 (4) | C10'—C11' | 1.344 (11) |
| S2'—C12 | 1.641 (9) | C10'—H10' | 0.9300 |
| S2'—C9' | 1.686 (10) | C11'—C12 | 1.367 (10) |
| F1—C8 | 1.290 (4) | C11'—H11' | 0.9300 |
| F2—C8 | 1.264 (4) | C12—C13 | 1.463 (4) |
| F3—C8 | 1.295 (4) | C13—C14 | 1.414 (5) |
| F4—C16 | 1.321 (4) | C14—C15 | 1.369 (5) |
| F5—C16 | 1.315 (4) | C14—H14 | 0.9300 |
| F6—C16 | 1.331 (4) | C15—C16 | 1.535 (5) |
| O1—C5 | 1.265 (3) | C17—C18 | 1.376 (5) |
| O2—C7 | 1.268 (3) | C17—H17 | 0.9300 |
| O3—C13 | 1.252 (4) | C18—C19 | 1.365 (5) |
| O4—C15 | 1.262 (4) | C18—H18 | 0.9300 |
| O5—C22 | 1.214 (5) | C19—C20 | 1.383 (5) |
| N1—C17 | 1.335 (4) | C19—H19 | 0.9300 |
| N1—C21 | 1.337 (4) | C20—C21 | 1.373 (4) |
| N2—C22 | 1.329 (5) | C20—C22 | 1.502 (4) |
| N2—C23 | 1.487 (8) | C21—H21 | 0.9300 |
| N2—C25 | 1.487 (5) | C23—C24 | 1.522 (5) |
| C1—C2 | 1.328 (6) | C23—H23A | 0.9700 |
| C1—H1 | 0.9300 | C23—H23B | 0.9700 |
| C2—C3 | 1.440 (5) | C24—H24A | 0.9600 |
| C2—H2 | 0.9300 | C24—H24B | 0.9600 |
| C3—C4 | 1.433 (5) | C24—H24C | 0.9600 |
| C3—H3 | 0.9300 | C25—C26 | 1.532 (5) |
| C4—C5 | 1.467 (4) | C25—H25A | 0.9700 |
| C5—C6 | 1.414 (4) | C25—H25B | 0.9700 |
| C6—C7 | 1.365 (4) | C26—H26A | 0.9600 |
| C6—H6 | 0.9300 | C26—H26B | 0.9600 |
| C7—C8 | 1.527 (4) | C26—H26C | 0.9600 |
| O4—Cu1—O1 | 171.65 (9) | C10'—C11'—H11' | 119.2 |
| O4—Cu1—O2 | 87.74 (9) | C12—C11'—H11' | 119.2 |
| O1—Cu1—O2 | 92.01 (8) | C11—C12—C13 | 127.8 (7) |
| O4—Cu1—O3 | 92.32 (9) | C11'—C12—C13 | 134.9 (10) |
| O1—Cu1—O3 | 86.06 (9) | C11'—C12—S2' | 105.0 (10) |
| O2—Cu1—O3 | 167.13 (10) | C13—C12—S2' | 118.7 (4) |
| O4—Cu1—N1 | 97.55 (9) | C11—C12—S2 | 108.8 (7) |
| O1—Cu1—N1 | 90.74 (8) | C13—C12—S2 | 123.2 (3) |
| O2—Cu1—N1 | 98.28 (9) | S2'—C12—S2 | 118.1 (4) |
| O3—Cu1—N1 | 94.47 (9) | O3—C13—C14 | 124.4 (3) |
| C1—S1—C4 | 91.7 (2) | O3—C13—C12 | 115.9 (3) |
| C9—S2—C12 | 90.7 (4) | C14—C13—C12 | 119.8 (3) |
| C12—S2'—C9' | 94.1 (12) | C15—C14—C13 | 122.7 (3) |
| C5—O1—Cu1 | 127.36 (18) | C15—C14—H14 | 118.6 |
| C7—O2—Cu1 | 123.57 (18) | C13—C14—H14 | 118.6 |
| C13—O3—Cu1 | 127.3 (2) | O4—C15—C14 | 129.2 (3) |
| C15—O4—Cu1 | 123.9 (2) | O4—C15—C16 | 112.7 (3) |
| C17—N1—C21 | 117.6 (3) | C14—C15—C16 | 118.1 (3) |
| C17—N1—Cu1 | 123.2 (2) | F5—C16—F4 | 106.9 (3) |
| C21—N1—Cu1 | 119.0 (2) | F5—C16—F6 | 106.9 (3) |
| C22—N2—C23 | 124.4 (4) | F4—C16—F6 | 106.7 (3) |
| C22—N2—C25 | 118.5 (4) | F5—C16—C15 | 112.5 (3) |
| C23—N2—C25 | 117.1 (4) | F4—C16—C15 | 110.5 (3) |
| C2—C1—S1 | 113.3 (3) | F6—C16—C15 | 113.1 (3) |
| C2—C1—H1 | 123.4 | N1—C17—C18 | 122.8 (3) |
| S1—C1—H1 | 123.4 | N1—C17—H17 | 118.6 |
| C1—C2—C3 | 115.0 (4) | C18—C17—H17 | 118.6 |
| C1—C2—H2 | 122.5 | C19—C18—C17 | 118.9 (3) |
| C3—C2—H2 | 122.5 | C19—C18—H18 | 120.6 |
| C4—C3—C2 | 107.4 (3) | C17—C18—H18 | 120.6 |
| C4—C3—H3 | 126.3 | C18—C19—C20 | 119.4 (3) |
| C2—C3—H3 | 126.3 | C18—C19—H19 | 120.3 |
| C3—C4—C5 | 129.2 (3) | C20—C19—H19 | 120.3 |
| C3—C4—S1 | 112.5 (2) | C21—C20—C19 | 118.1 (3) |
| C5—C4—S1 | 118.2 (2) | C21—C20—C22 | 119.8 (3) |
| O1—C5—C6 | 123.8 (3) | C19—C20—C22 | 122.1 (3) |
| O1—C5—C4 | 116.4 (3) | N1—C21—C20 | 123.3 (3) |
| C6—C5—C4 | 119.7 (3) | N1—C21—H21 | 118.4 |
| C7—C6—C5 | 122.5 (3) | C20—C21—H21 | 118.4 |
| C7—C6—H6 | 118.7 | O5—C22—N2 | 123.7 (4) |
| C5—C6—H6 | 118.7 | O5—C22—C20 | 118.8 (3) |
| O2—C7—C6 | 129.7 (3) | N2—C22—C20 | 117.4 (3) |
| O2—C7—C8 | 112.2 (2) | N2—C23—C24 | 108.1 (8) |
| C6—C7—C8 | 118.1 (3) | N2—C23—H23A | 110.1 |
| F2—C8—F3 | 103.8 (4) | C24—C23—H23A | 110.1 |
| F2—C8—F1 | 108.3 (4) | N2—C23—H23B | 110.1 |
| F3—C8—F1 | 104.5 (4) | C24—C23—H23B | 110.1 |
| F2—C8—C7 | 111.5 (3) | H23A—C23—H23B | 108.4 |
| F3—C8—C7 | 112.6 (3) | C23—C24—H24A | 109.5 |
| F1—C8—C7 | 115.2 (3) | C23—C24—H24B | 109.5 |
| C10—C9—S2 | 114.3 (8) | H24A—C24—H24B | 109.5 |
| C10—C9—H9 | 122.8 | C23—C24—H24C | 109.5 |
| S2—C9—H9 | 122.8 | H24A—C24—H24C | 109.5 |
| C9—C10—C11 | 110.2 (12) | H24B—C24—H24C | 109.5 |
| C9—C10—H10 | 124.9 | N2—C25—C26 | 111.8 (5) |
| C11—C10—H10 | 124.9 | N2—C25—H25A | 109.3 |
| C12—C11—C10 | 116.1 (12) | C26—C25—H25A | 109.3 |
| C12—C11—H11 | 122.0 | N2—C25—H25B | 109.3 |
| C10—C11—H11 | 122.0 | C26—C25—H25B | 109.3 |
| C10'—C9'—S2' | 113 (2) | H25A—C25—H25B | 107.9 |
| C10'—C9'—H9' | 123.4 | C25—C26—H26A | 109.5 |
| S2'—C9'—H9' | 123.4 | C25—C26—H26B | 109.5 |
| C9'—C10'—C11' | 106 (2) | H26A—C26—H26B | 109.5 |
| C9'—C10'—H10' | 126.9 | C25—C26—H26C | 109.5 |
| C11'—C10'—H10' | 126.9 | H26A—C26—H26C | 109.5 |
| C10'—C11'—C12 | 122 (2) | H26B—C26—H26C | 109.5 |
| O2—Cu1—O1—C5 | −11.0 (2) | C10'—C11'—C12—C11 | −3.7 (9) |
| O3—Cu1—O1—C5 | −178.3 (2) | C10'—C11'—C12—C13 | 166.2 (9) |
| N1—Cu1—O1—C5 | 87.3 (2) | C10'—C11'—C12—S2' | 0.7 (6) |
| O4—Cu1—O2—C7 | 177.2 (2) | C10'—C11'—C12—S2 | −137 (3) |
| O1—Cu1—O2—C7 | 5.6 (2) | C9'—S2'—C12—C11 | 27 (4) |
| O3—Cu1—O2—C7 | 86.7 (4) | C9'—S2'—C12—C11' | −0.4 (4) |
| N1—Cu1—O2—C7 | −85.5 (2) | C9'—S2'—C12—C13 | −168.8 (7) |
| O4—Cu1—O3—C13 | 5.1 (3) | C9'—S2'—C12—S2 | 13.4 (6) |
| O1—Cu1—O3—C13 | 176.9 (3) | C9—S2—C12—C11 | 0.3 (4) |
| O2—Cu1—O3—C13 | 95.1 (5) | C9—S2—C12—C11' | 50 (2) |
| N1—Cu1—O3—C13 | −92.7 (3) | C9—S2—C12—C13 | −175.1 (4) |
| O2—Cu1—O4—C15 | −172.3 (3) | C9—S2—C12—S2' | 2.6 (5) |
| O3—Cu1—O4—C15 | −5.2 (3) | Cu1—O3—C13—C14 | −2.5 (5) |
| N1—Cu1—O4—C15 | 89.6 (3) | Cu1—O3—C13—C12 | 178.7 (2) |
| O4—Cu1—N1—C17 | 23.0 (2) | C11—C12—C13—O3 | −7.5 (6) |
| O1—Cu1—N1—C17 | −158.0 (2) | C11'—C12—C13—O3 | −174.7 (9) |
| O2—Cu1—N1—C17 | −65.8 (2) | S2'—C12—C13—O3 | −10.7 (6) |
| O3—Cu1—N1—C17 | 115.9 (2) | S2—C12—C13—O3 | 167.0 (3) |
| O4—Cu1—N1—C21 | −162.3 (2) | C11—C12—C13—C14 | 173.7 (5) |
| O1—Cu1—N1—C21 | 16.8 (2) | C11'—C12—C13—C14 | 6.5 (10) |
| O2—Cu1—N1—C21 | 108.9 (2) | S2'—C12—C13—C14 | 170.5 (5) |
| O3—Cu1—N1—C21 | −69.3 (2) | S2—C12—C13—C14 | −11.8 (5) |
| C4—S1—C1—C2 | −0.1 (3) | O3—C13—C14—C15 | −1.8 (6) |
| S1—C1—C2—C3 | −0.9 (5) | C12—C13—C14—C15 | 176.9 (4) |
| C1—C2—C3—C4 | 1.6 (5) | Cu1—O4—C15—C14 | 3.2 (5) |
| C2—C3—C4—C5 | −177.9 (3) | Cu1—O4—C15—C16 | 179.6 (2) |
| C2—C3—C4—S1 | −1.6 (4) | C13—C14—C15—O4 | 1.4 (6) |
| C1—S1—C4—C3 | 1.0 (3) | C13—C14—C15—C16 | −174.9 (3) |
| C1—S1—C4—C5 | 177.7 (3) | O4—C15—C16—F5 | 43.8 (4) |
| Cu1—O1—C5—C6 | 11.2 (4) | C14—C15—C16—F5 | −139.3 (4) |
| Cu1—O1—C5—C4 | −167.59 (18) | O4—C15—C16—F4 | −75.6 (4) |
| C3—C4—C5—O1 | −179.8 (3) | C14—C15—C16—F4 | 101.3 (4) |
| S1—C4—C5—O1 | 4.1 (4) | O4—C15—C16—F6 | 165.0 (3) |
| C3—C4—C5—C6 | 1.3 (5) | C14—C15—C16—F6 | −18.1 (5) |
| S1—C4—C5—C6 | −174.7 (2) | C21—N1—C17—C18 | 0.6 (5) |
| O1—C5—C6—C7 | −3.1 (5) | Cu1—N1—C17—C18 | 175.4 (2) |
| C4—C5—C6—C7 | 175.7 (3) | N1—C17—C18—C19 | −1.3 (5) |
| Cu1—O2—C7—C6 | −0.4 (5) | C17—C18—C19—C20 | 0.4 (5) |
| Cu1—O2—C7—C8 | 179.1 (2) | C18—C19—C20—C21 | 1.1 (5) |
| C5—C6—C7—O2 | −2.7 (5) | C18—C19—C20—C22 | 177.1 (3) |
| C5—C6—C7—C8 | 177.8 (3) | C17—N1—C21—C20 | 1.1 (5) |
| O2—C7—C8—F2 | 65.6 (5) | Cu1—N1—C21—C20 | −174.0 (2) |
| C6—C7—C8—F2 | −114.9 (4) | C19—C20—C21—N1 | −1.9 (5) |
| O2—C7—C8—F3 | −50.6 (4) | C22—C20—C21—N1 | −178.0 (3) |
| C6—C7—C8—F3 | 128.9 (4) | C23—N2—C22—O5 | −174.8 (6) |
| O2—C7—C8—F1 | −170.4 (4) | C25—N2—C22—O5 | 2.2 (7) |
| C6—C7—C8—F1 | 9.1 (5) | C23—N2—C22—C20 | 4.3 (8) |
| C12—S2—C9—C10 | −0.12 (18) | C25—N2—C22—C20 | −178.7 (5) |
| S2—C9—C10—C11 | −0.1 (2) | C21—C20—C22—O5 | 92.2 (4) |
| C9—C10—C11—C12 | 0.3 (5) | C19—C20—C22—O5 | −83.7 (5) |
| C12—S2'—C9'—C10' | 0.14 (19) | C21—C20—C22—N2 | −86.9 (5) |
| S2'—C9'—C10'—C11' | 0.2 (2) | C19—C20—C22—N2 | 97.2 (5) |
| C9'—C10'—C11'—C12 | −0.6 (5) | C22—N2—C23—C24 | −97.6 (7) |
| C10—C11—C12—C11' | −14.3 (9) | C25—N2—C23—C24 | 85.4 (7) |
| C10—C11—C12—C13 | 174.7 (5) | C22—N2—C25—C26 | −97.1 (7) |
| C10—C11—C12—S2' | −168 (4) | C23—N2—C25—C26 | 80.1 (8) |
| C10—C11—C12—S2 | −0.4 (6) |
| D—H···A | D—H | H···A | D···A | D—H···A |
| C1—H1···O5i | 0.93 | 2.49 | 3.358 (7) | 156 |
| C19—H19···O5ii | 0.93 | 2.56 | 3.338 (6) | 141 |
| C24—H24C···F1iii | 0.96 | 2.36 | 3.233 (13) | 151 |
| Symmetry codes: (i) −x+1, −y+2, −z+1; (ii) −x, −y+2, −z+1; (iii) −x, −y+1, −z+2. |
Experimental details
| Crystal data | |
| Chemical formula | [Cu(C8H4F3O2S)2(C10H14N2O)] |
| Mr | 684.12 |
| Crystal system, space group | Triclinic, P1 |
| Temperature (K) | 293 |
| a, b, c (Å) | 11.4324 (5), 12.8606 (5), 13.0104 (5) |
| α, β, γ (°) | 62.837 (1), 64.110 (1), 88.783 (1) |
| V (Å3) | 1492.72 (10) |
| Z | 2 |
| Radiation type | Mo Kα |
| µ (mm−1) | 0.95 |
| Crystal size (mm) | 0.30 × 0.30 × 0.30 |
| Data collection | |
| Diffractometer | Bruker APEXII |
| Absorption correction | Multi-scan (SADABS; Sheldrick, 1996) |
| Tmin, Tmax | 0.618, 0.746 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 16434, 6849, 5423 |
| Rint | 0.021 |
| (sin θ/λ)max (Å−1) | 0.650 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.048, 0.152, 1.05 |
| No. of reflections | 6849 |
| No. of parameters | 392 |
| No. of restraints | 80 |
| H-atom treatment | H-atom parameters constrained |
| Δρmax, Δρmin (e Å−3) | 0.80, −0.48 |
Computer programs: APEX2 (Bruker, 2005), SAINT (Bruker, 2005), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), X-SEED (Barbour, 2001), publCIF (Westrip, 2010).
| Cu1—O1 | 1.9432 (19) | Cu1—O4 | 1.934 (2) |
| Cu1—O2 | 1.942 (2) | Cu1—N1 | 2.262 (2) |
| Cu1—O3 | 1.944 (2) |
| D—H···A | D—H | H···A | D···A | D—H···A |
| C1—H1···O5i | 0.93 | 2.49 | 3.358 (7) | 156 |
| C19—H19···O5ii | 0.93 | 2.56 | 3.338 (6) | 141 |
| C24—H24C···F1iii | 0.96 | 2.36 | 3.233 (13) | 151 |
| Symmetry codes: (i) −x+1, −y+2, −z+1; (ii) −x, −y+2, −z+1; (iii) −x, −y+1, −z+2. |
Acknowledgements
We thank Baku State University and the University of Malaya for supporting this study.
References
Barbour, L. J. (2001). J. Supramol. Chem. 1, 189–191. CrossRef CAS Google Scholar
Bruker (2005). APEX2 and SAINT. Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
Gou, S.-H., You, X.-Z., Xu, Z., Zhou, Z.-Y., Yu, K.-B., Yu, Y.-P. & Zhu, D.-L. (1991). Acta Cryst. C47, 1303–1305. CSD CrossRef CAS Web of Science IUCr Journals Google Scholar
Lecomte, C., Bayeul, D., Senglet, N. & Guilard, R. (1988). Polyhedron, 7, 303–306. CAS Google Scholar
Li, M.-X., Xu, Z., You, X.-Z. & Chen, C.-G. (1994). Acta Cryst. C50, 1699–1701. CSD CrossRef CAS Web of Science IUCr Journals Google Scholar
Liu, X.-S., Lin, C.-C., Xu, Z., Yu, Y.-P. & You, X.-Z. (1986). Chin. J. Struct. Chem. 5, 135–138. CAS Google Scholar
Sheldrick, G. M. (1996). SADABS. University of Göttingen, Germany. Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Wang, D.-M., Yang, R.-N., Hu, Y.-M. & Jin, D.-M. (1996). Chin. J. Struct. Chem. 15, 3327–3329. Google Scholar
Westrip, S. P. (2010). J. Appl. Cryst. 43, 920–925. Web of Science CrossRef CAS IUCr Journals Google Scholar
Xu, D.-F., Shen, Z.-H., Shi, Y., He, Q. & Xia, Q.-C. (2010). Russ. J. Coord. Chem. 36, 458–462. Web of Science CrossRef CAS Google Scholar
Yu, Y.-P., Xu, Z., You, X.-Z., Lu, J.-N., Shi, S., Liu, S.-X. & Lin, C.-C. (1988). Chin. J. Inorg. Chem. 4, 30–34. CAS Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.

journal menu
access
![[Figure 1]](./xu5194fig1thm.gif)




Square-planar bis[4,4,4-trifluoro-1-(thien-2-yl)butane-1,3-dionato]copper is a Lewis acid that forms adducts with a number of N-heterocycles. The parent Lewis acid exists as a square-planar molecule; its crystal structure has been determined several times (Lecomte et al., 1988; Wang et al., 1996; Xu et al., 2010). For most adducts, the Cu atom exists in a six-coordinate geometry, e.g., the pyridine adduct (Liu et al., 1986). The 4,4'-bipyridine adduct exists in two forms; in one form, the Cu atom is octahedrally coordinated (Gou et al., 1991). The other is a dinuclear adduct in which the Cu atom shows the square-pyramidal coordination. In the title N,N-diethylbenzamide adduct (Scheme I), the Cu atom is similarly five-coordinate. The metal atom lies above the square plane defined by the O atoms of the two chelating anionic ligands in the direction of the axial occupant by 0.179 (1) Å.