organic compounds
(1,2-Dicarba-closo-dodecaboranyl)trimethylmethanaminium iodide
aDepartment of Chemistry, College of Natural Sciences, Chosun University, Gwangju 501-759, Republic of Korea, bDepartment of Advanced Materials Chemistry, Korea University, Sejong Campus, Chungnam 339-700, Republic of Korea, and cReSEAT Program, Korea Institute of Science and Technology Information, 335 Eoeun-dong, Yuseong-gu, Daejeon 305-806, Republic of Korea
*Correspondence e-mail: [email protected]
The title compound, [1-(CH3)3NCH2-1,2-C2B10H11]+·I− or C6H22B10N+·I−, was obtained by the reaction of (1,2-dicarba-closo-dodecaboranyl)dimethylmethanamine with methyl iodide. The asymmetric unit contains two iodide anions and two (o-carboranyl)tetramethylammonium cations. The bond lengths and angles in the carborane cage are within normal ranges, but the N—Cmethylene—Ccage angle is very large [120.2 (2)°] because of repulsion between the carborane and tetramethylammonium units. In the crystal, ions are linked through C—H⋯I hydrogen bonds.
Related literature
For background to quaternaryammonium salts, see: Wiebcke & Felsche (2001
); Zhang et al. (2004
); Carr et al. (2006
). For background to o-carborane structures, see: Davidson et al. (1996
); Lee et al. (2000
); Welch et al. (2001
). For a related structure, see: Lee et al. (1999
).
Experimental
Crystal data
|
Refinement
|
| |||||||||||||||||||||||||||
Data collection: SMART (Bruker, 1999
); cell refinement: SAINT-Plus (Bruker, 1999
); data reduction: SAINT-Plus; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: ORTEP-3 for Windows (Farrugia, 1997
); software used to prepare material for publication: SHELXL97.
Supporting information
contains datablocks global, I. DOI: 10.1107/S160053681102928X/dn2706sup1.cif
Structure factors: contains datablock I. DOI: 10.1107/S160053681102928X/dn2706Isup2.hkl
A mixture of N,N-dimethyl-(1,2-dicarba-closo-dodecaboranyl)methanamine (0.2 g, 1.0 mmol) and 1.2 equiv of methyl iodide (0.17 g, 1.2 mmol) was dissolved in distilled diethyl ether (10 ml) and stirred at room temperature for 30 min. The resulting white solid was collected by filtration and washed with cold diethyl ether (quantitative yield, m.p. 389 K). The purity was checked by 1H, 13C, and 11B NMR spectroscopies. Suitable single crystals of (I) were obtained by recrystallization from acetone.
All of the hydrogen atoms were placed at idealized positions and treated using a riding model, with constrained distances and Uiso(H) values fixed at xUeq (parent atom) [C/B—H = 1.1 Å and x = 1.2 for carborane H atoms, C—H = 0.97 Å, and x = 1.2 for methylene H atoms, and C—H = 0.96 Å and x = 1.5 for methyl H atoms].
Data collection: SMART (Bruker, 1999); cell SAINT-Plus (Bruker, 1999); data reduction: SAINT-Plus (Bruker, 1999); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: ORTEP-3 for Windows (Farrugia, 1997); software used to prepare material for publication: SHELXL97 (Sheldrick, 2008).
| C6H22B10N+·I− | F(000) = 1344 |
| Mr = 343.25 | Dx = 1.451 Mg m−3 |
| Monoclinic, P21/n | Mo Kα radiation, λ = 0.71073 Å |
| Hall symbol: -P 2yn | Cell parameters from 5251 reflections |
| a = 6.7435 (14) Å | θ = 2.3–27.3° |
| b = 25.013 (5) Å | µ = 2.01 mm−1 |
| c = 18.694 (4) Å | T = 293 K |
| β = 94.800 (4)° | Block, colourless |
| V = 3142.2 (11) Å3 | 0.28 × 0.25 × 0.20 mm |
| Z = 8 |
| Bruker SMART 1000 CCD diffractometer | 7772 independent reflections |
| Radiation source: fine-focus sealed tube | 5834 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.032 |
| ω scans | θmax = 28.3°, θmin = 1.4° |
| Absorption correction: multi-scan (SADABS; Sheldrick, 2008) | h = −8→8 |
| Tmin = 0.603, Tmax = 0.689 | k = −33→33 |
| 32138 measured reflections | l = −24→24 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.031 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.076 | H-atom parameters constrained |
| S = 1.02 | w = 1/[σ2(Fo2) + (0.0267P)2 + 2.9488P] where P = (Fo2 + 2Fc2)/3 |
| 7772 reflections | (Δ/σ)max = 0.002 |
| 325 parameters | Δρmax = 0.88 e Å−3 |
| 0 restraints | Δρmin = −0.92 e Å−3 |
| C6H22B10N+·I− | V = 3142.2 (11) Å3 |
| Mr = 343.25 | Z = 8 |
| Monoclinic, P21/n | Mo Kα radiation |
| a = 6.7435 (14) Å | µ = 2.01 mm−1 |
| b = 25.013 (5) Å | T = 293 K |
| c = 18.694 (4) Å | 0.28 × 0.25 × 0.20 mm |
| β = 94.800 (4)° |
| Bruker SMART 1000 CCD diffractometer | 7772 independent reflections |
| Absorption correction: multi-scan (SADABS; Sheldrick, 2008) | 5834 reflections with I > 2σ(I) |
| Tmin = 0.603, Tmax = 0.689 | Rint = 0.032 |
| 32138 measured reflections |
| R[F2 > 2σ(F2)] = 0.031 | 0 restraints |
| wR(F2) = 0.076 | H-atom parameters constrained |
| S = 1.02 | Δρmax = 0.88 e Å−3 |
| 7772 reflections | Δρmin = −0.92 e Å−3 |
| 325 parameters |
Geometry. All e.s.d.'s (except the e.s.d. in the dihedral angle between two l.s. planes) are estimated using the full covariance matrix. The cell e.s.d.'s are taken into account individually in the estimation of e.s.d.'s in distances, angles and torsion angles; correlations between e.s.d.'s in cell parameters are only used when they are defined by crystal symmetry. An approximate (isotropic) treatment of cell e.s.d.'s is used for estimating e.s.d.'s involving l.s. planes. |
Refinement. Refinement of F2 against ALL reflections. The weighted R-factor wR and goodness of fit S are based on F2, conventional R-factors R are based on F, with F set to zero for negative F2. The threshold expression of F2 > σ(F2) is used only for calculating R-factors(gt) etc. and is not relevant to the choice of reflections for refinement. R-factors based on F2 are statistically about twice as large as those based on F, and R- factors based on ALL data will be even larger. |
| x | y | z | Uiso*/Ueq | ||
| I2 | 0.30391 (3) | 0.913655 (9) | 0.909132 (12) | 0.05540 (7) | |
| I1 | 0.26909 (3) | 0.657927 (8) | 0.774753 (12) | 0.04975 (7) | |
| N1 | 0.6119 (4) | 0.55189 (9) | 0.62825 (12) | 0.0392 (5) | |
| B3 | 0.5023 (5) | 0.46207 (12) | 0.79957 (17) | 0.0363 (6) | |
| H3 | 0.3559 | 0.4472 | 0.7779 | 0.044* | |
| B4 | 0.7252 (5) | 0.44574 (12) | 0.76026 (17) | 0.0356 (6) | |
| H4 | 0.7240 | 0.4198 | 0.7127 | 0.043* | |
| B5 | 0.8919 (5) | 0.50059 (13) | 0.77262 (18) | 0.0385 (7) | |
| H5 | 0.9993 | 0.5100 | 0.7333 | 0.046* | |
| B6 | 0.7713 (5) | 0.55209 (13) | 0.81841 (17) | 0.0406 (7) | |
| H6 | 0.7968 | 0.5948 | 0.8088 | 0.049* | |
| B7 | 0.6790 (5) | 0.42083 (12) | 0.84662 (17) | 0.0404 (7) | |
| H7 | 0.6493 | 0.3783 | 0.8559 | 0.048* | |
| B8 | 0.5593 (5) | 0.47206 (13) | 0.89249 (18) | 0.0431 (7) | |
| H8 | 0.4497 | 0.4635 | 0.9313 | 0.052* | |
| B9 | 0.7252 (6) | 0.52692 (14) | 0.90438 (18) | 0.0462 (8) | |
| H9 | 0.7227 | 0.5536 | 0.9511 | 0.055* | |
| B10 | 0.9492 (6) | 0.51054 (15) | 0.86573 (19) | 0.0490 (8) | |
| H10 | 1.0944 | 0.5262 | 0.8874 | 0.059* | |
| B11 | 0.9206 (5) | 0.44426 (14) | 0.82976 (19) | 0.0449 (8) | |
| H11 | 1.0474 | 0.4168 | 0.8281 | 0.054* | |
| B12 | 0.8182 (6) | 0.46069 (14) | 0.91206 (18) | 0.0480 (8) | |
| H12 | 0.8790 | 0.4440 | 0.9638 | 0.058* | |
| C1 | 0.6407 (4) | 0.50998 (9) | 0.75779 (13) | 0.0307 (5) | |
| C2 | 0.5473 (4) | 0.52448 (10) | 0.83484 (14) | 0.0373 (6) | |
| H2 | 0.4198 | 0.5518 | 0.8356 | 0.045* | |
| C3 | 0.5144 (4) | 0.53300 (10) | 0.69337 (14) | 0.0353 (6) | |
| H3A | 0.4176 | 0.5060 | 0.6774 | 0.042* | |
| H3B | 0.4406 | 0.5630 | 0.7106 | 0.042* | |
| C4 | 0.7509 (5) | 0.59801 (12) | 0.64407 (18) | 0.0549 (8) | |
| H4A | 0.7942 | 0.6116 | 0.5999 | 0.082* | |
| H4B | 0.8643 | 0.5862 | 0.6744 | 0.082* | |
| H4C | 0.6833 | 0.6257 | 0.6679 | 0.082* | |
| C5 | 0.7167 (5) | 0.50697 (12) | 0.59283 (16) | 0.0512 (8) | |
| H5A | 0.7591 | 0.5191 | 0.5478 | 0.077* | |
| H5B | 0.6272 | 0.4773 | 0.5846 | 0.077* | |
| H5C | 0.8305 | 0.4959 | 0.6235 | 0.077* | |
| C6 | 0.4426 (5) | 0.57103 (14) | 0.57671 (17) | 0.0558 (8) | |
| H6A | 0.3784 | 0.6009 | 0.5973 | 0.084* | |
| H6B | 0.3483 | 0.5426 | 0.5676 | 0.084* | |
| H6C | 0.4935 | 0.5818 | 0.5325 | 0.084* | |
| N2 | 0.7834 (3) | 0.77280 (8) | 0.79247 (11) | 0.0325 (5) | |
| B23 | 0.8766 (5) | 0.67804 (12) | 0.96808 (17) | 0.0367 (7) | |
| H23 | 0.9569 | 0.6459 | 0.9426 | 0.044* | |
| B24 | 0.9750 (5) | 0.74312 (13) | 0.97941 (17) | 0.0380 (7) | |
| H24 | 1.1216 | 0.7534 | 0.9615 | 0.046* | |
| B25 | 0.7765 (6) | 0.78988 (13) | 0.97298 (18) | 0.0479 (8) | |
| H25 | 0.7942 | 0.8304 | 0.9514 | 0.058* | |
| B26 | 0.5520 (5) | 0.75335 (18) | 0.9567 (2) | 0.0550 (10) | |
| H26 | 0.4227 | 0.7695 | 0.9239 | 0.066* | |
| B27 | 0.6239 (8) | 0.7764 (2) | 1.0435 (2) | 0.0782 (16) | |
| H27 | 0.5411 | 0.8084 | 1.0682 | 0.094* | |
| B28 | 0.8867 (7) | 0.76998 (15) | 1.05814 (19) | 0.0594 (11) | |
| H28 | 0.9769 | 0.7979 | 1.0927 | 0.071* | |
| B29 | 0.9465 (5) | 0.70112 (13) | 1.05485 (17) | 0.0389 (7) | |
| H29 | 1.0750 | 0.6841 | 1.0872 | 0.047* | |
| B30 | 0.7242 (5) | 0.66515 (15) | 1.03832 (18) | 0.0453 (8) | |
| H30 | 0.7053 | 0.6244 | 1.0587 | 0.054* | |
| B31 | 0.5269 (6) | 0.7114 (2) | 1.0320 (2) | 0.0712 (14) | |
| H31 | 0.3797 | 0.7005 | 1.0488 | 0.085* | |
| B32 | 0.7311 (6) | 0.72198 (17) | 1.09454 (19) | 0.0555 (10) | |
| H32 | 0.7188 | 0.7188 | 1.1527 | 0.067* | |
| C21 | 0.7687 (3) | 0.73285 (9) | 0.92250 (13) | 0.0281 (5) | |
| C22 | 0.6242 (4) | 0.68780 (13) | 0.95729 (16) | 0.0488 (8) | |
| H22 | 0.5352 | 0.6600 | 0.9221 | 0.059* | |
| C23 | 0.7767 (4) | 0.72499 (9) | 0.84162 (13) | 0.0309 (5) | |
| H23A | 0.8930 | 0.7033 | 0.8348 | 0.037* | |
| H23B | 0.6613 | 0.7039 | 0.8248 | 0.037* | |
| C24 | 0.6028 (4) | 0.80804 (11) | 0.79378 (16) | 0.0439 (7) | |
| H24A | 0.4848 | 0.7869 | 0.7839 | 0.066* | |
| H24B | 0.6074 | 0.8355 | 0.7580 | 0.066* | |
| H24C | 0.6009 | 0.8242 | 0.8403 | 0.066* | |
| C25 | 0.7839 (5) | 0.74947 (13) | 0.71782 (15) | 0.0486 (7) | |
| H25A | 0.6646 | 0.7291 | 0.7070 | 0.073* | |
| H25B | 0.8977 | 0.7266 | 0.7156 | 0.073* | |
| H25C | 0.7899 | 0.7779 | 0.6836 | 0.073* | |
| C26 | 0.9719 (4) | 0.80439 (12) | 0.80762 (16) | 0.0450 (7) | |
| H26A | 0.9709 | 0.8345 | 0.7757 | 0.067* | |
| H26B | 1.0843 | 0.7821 | 0.8004 | 0.067* | |
| H26C | 0.9808 | 0.8168 | 0.8564 | 0.067* |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| I2 | 0.05902 (14) | 0.04948 (13) | 0.05873 (14) | 0.00517 (10) | 0.01109 (10) | −0.00694 (10) |
| I1 | 0.04172 (11) | 0.04153 (11) | 0.06601 (14) | 0.00482 (8) | 0.00458 (9) | −0.00515 (9) |
| N1 | 0.0525 (14) | 0.0311 (11) | 0.0343 (12) | −0.0003 (10) | 0.0058 (10) | 0.0047 (9) |
| B3 | 0.0390 (16) | 0.0297 (14) | 0.0411 (17) | −0.0052 (12) | 0.0085 (13) | 0.0027 (12) |
| B4 | 0.0421 (17) | 0.0274 (14) | 0.0384 (16) | 0.0028 (12) | 0.0097 (13) | −0.0001 (12) |
| B5 | 0.0339 (16) | 0.0387 (16) | 0.0433 (17) | −0.0013 (13) | 0.0058 (13) | 0.0018 (13) |
| B6 | 0.0488 (19) | 0.0333 (15) | 0.0399 (17) | −0.0108 (13) | 0.0057 (14) | −0.0052 (13) |
| B7 | 0.0510 (19) | 0.0300 (15) | 0.0406 (17) | −0.0011 (13) | 0.0054 (14) | 0.0077 (13) |
| B8 | 0.054 (2) | 0.0395 (17) | 0.0371 (17) | −0.0033 (14) | 0.0116 (15) | 0.0043 (13) |
| B9 | 0.065 (2) | 0.0397 (17) | 0.0338 (17) | −0.0077 (16) | 0.0063 (15) | −0.0031 (13) |
| B10 | 0.048 (2) | 0.052 (2) | 0.0456 (19) | −0.0099 (16) | −0.0047 (15) | 0.0051 (16) |
| B11 | 0.0425 (18) | 0.0448 (18) | 0.0473 (19) | 0.0059 (14) | 0.0033 (15) | 0.0075 (15) |
| B12 | 0.060 (2) | 0.0464 (19) | 0.0371 (18) | −0.0033 (16) | −0.0004 (15) | 0.0065 (14) |
| C1 | 0.0362 (13) | 0.0259 (12) | 0.0307 (13) | −0.0020 (10) | 0.0070 (10) | −0.0003 (10) |
| C2 | 0.0451 (15) | 0.0326 (13) | 0.0357 (14) | 0.0003 (11) | 0.0122 (12) | −0.0015 (11) |
| C3 | 0.0398 (14) | 0.0322 (13) | 0.0344 (14) | 0.0025 (11) | 0.0058 (11) | 0.0013 (10) |
| C4 | 0.071 (2) | 0.0380 (16) | 0.0564 (19) | −0.0159 (15) | 0.0067 (16) | 0.0079 (14) |
| C5 | 0.071 (2) | 0.0469 (17) | 0.0379 (16) | 0.0065 (15) | 0.0173 (15) | −0.0019 (13) |
| C6 | 0.074 (2) | 0.0516 (18) | 0.0401 (17) | 0.0082 (16) | −0.0035 (15) | 0.0089 (14) |
| N2 | 0.0334 (11) | 0.0323 (11) | 0.0321 (11) | 0.0008 (9) | 0.0039 (9) | 0.0047 (9) |
| B23 | 0.0446 (17) | 0.0276 (14) | 0.0379 (16) | 0.0026 (12) | 0.0026 (13) | 0.0054 (12) |
| B24 | 0.0312 (15) | 0.0415 (17) | 0.0402 (17) | −0.0075 (12) | −0.0050 (12) | 0.0089 (13) |
| B25 | 0.072 (2) | 0.0325 (16) | 0.0386 (18) | 0.0116 (16) | 0.0014 (16) | −0.0033 (13) |
| B26 | 0.0347 (17) | 0.088 (3) | 0.0447 (19) | 0.0240 (18) | 0.0151 (15) | 0.0210 (19) |
| B27 | 0.103 (4) | 0.092 (3) | 0.043 (2) | 0.061 (3) | 0.026 (2) | 0.007 (2) |
| B28 | 0.097 (3) | 0.0415 (19) | 0.0372 (19) | 0.001 (2) | −0.0105 (19) | −0.0030 (15) |
| B29 | 0.0345 (16) | 0.0450 (18) | 0.0363 (16) | −0.0003 (13) | −0.0032 (13) | 0.0074 (13) |
| B30 | 0.0448 (18) | 0.053 (2) | 0.0371 (17) | −0.0124 (15) | −0.0004 (14) | 0.0158 (15) |
| B31 | 0.0376 (19) | 0.126 (4) | 0.053 (2) | 0.019 (2) | 0.0188 (17) | 0.039 (2) |
| B32 | 0.063 (2) | 0.073 (3) | 0.0321 (17) | 0.020 (2) | 0.0106 (16) | 0.0080 (17) |
| C21 | 0.0240 (11) | 0.0290 (12) | 0.0314 (12) | −0.0008 (9) | 0.0026 (9) | 0.0026 (10) |
| C22 | 0.0415 (16) | 0.065 (2) | 0.0392 (16) | −0.0214 (14) | −0.0028 (12) | 0.0161 (14) |
| C23 | 0.0347 (13) | 0.0274 (12) | 0.0307 (13) | −0.0005 (10) | 0.0035 (10) | 0.0020 (10) |
| C24 | 0.0394 (15) | 0.0400 (15) | 0.0521 (17) | 0.0115 (12) | 0.0030 (13) | 0.0123 (13) |
| C25 | 0.067 (2) | 0.0497 (17) | 0.0295 (14) | 0.0054 (15) | 0.0049 (13) | 0.0047 (12) |
| C26 | 0.0378 (15) | 0.0455 (16) | 0.0516 (17) | −0.0081 (12) | 0.0034 (13) | 0.0124 (13) |
| N1—C4 | 1.500 (4) | N2—C26 | 1.503 (3) |
| N1—C3 | 1.507 (3) | N2—C24 | 1.505 (3) |
| N1—C5 | 1.510 (4) | N2—C23 | 1.511 (3) |
| N1—C6 | 1.509 (4) | N2—C25 | 1.513 (3) |
| B3—C2 | 1.712 (4) | B23—C22 | 1.714 (4) |
| B3—C1 | 1.743 (4) | B23—C21 | 1.741 (4) |
| B3—B7 | 1.756 (5) | B23—B29 | 1.749 (4) |
| B3—B8 | 1.765 (5) | B23—B30 | 1.763 (5) |
| B3—B4 | 1.775 (4) | B23—B24 | 1.764 (4) |
| B3—H3 | 1.1000 | B23—H23 | 1.1000 |
| B4—C1 | 1.704 (4) | B24—C21 | 1.699 (4) |
| B4—B11 | 1.772 (5) | B24—B28 | 1.766 (5) |
| B4—B5 | 1.776 (4) | B24—B25 | 1.774 (5) |
| B4—B7 | 1.782 (4) | B24—B29 | 1.782 (4) |
| B4—H4 | 1.1000 | B24—H24 | 1.1000 |
| B5—C1 | 1.710 (4) | B25—C21 | 1.709 (4) |
| B5—B10 | 1.769 (5) | B25—B26 | 1.772 (6) |
| B5—B11 | 1.769 (5) | B25—B28 | 1.771 (5) |
| B5—B6 | 1.780 (5) | B25—B27 | 1.772 (6) |
| B5—H5 | 1.1000 | B25—H25 | 1.1000 |
| B6—C2 | 1.712 (4) | B26—C22 | 1.710 (5) |
| B6—C1 | 1.733 (4) | B26—C21 | 1.722 (4) |
| B6—B10 | 1.767 (5) | B26—B27 | 1.751 (6) |
| B6—B9 | 1.778 (5) | B26—B31 | 1.774 (5) |
| B6—H6 | 1.1000 | B26—H26 | 1.1000 |
| B7—B8 | 1.773 (5) | B27—B31 | 1.757 (8) |
| B7—B12 | 1.783 (5) | B27—B32 | 1.779 (6) |
| B7—B11 | 1.784 (5) | B27—B28 | 1.778 (7) |
| B7—H7 | 1.1000 | B27—H27 | 1.1000 |
| B8—C2 | 1.695 (4) | B28—B32 | 1.768 (6) |
| B8—B9 | 1.773 (5) | B28—B29 | 1.771 (5) |
| B8—B12 | 1.776 (5) | B28—H28 | 1.1000 |
| B8—H8 | 1.1000 | B29—B30 | 1.753 (5) |
| B9—C2 | 1.695 (5) | B29—B32 | 1.765 (5) |
| B9—B12 | 1.773 (5) | B29—H29 | 1.1000 |
| B9—B10 | 1.776 (5) | B30—C22 | 1.703 (4) |
| B9—H9 | 1.1000 | B30—B31 | 1.761 (6) |
| B10—B11 | 1.794 (5) | B30—B32 | 1.766 (6) |
| B10—B12 | 1.793 (5) | B30—H30 | 1.1000 |
| B10—H10 | 1.1000 | B31—C22 | 1.699 (5) |
| B11—B12 | 1.786 (5) | B31—B32 | 1.750 (6) |
| B11—H11 | 1.1000 | B31—H31 | 1.1000 |
| B12—H12 | 1.1000 | B32—H32 | 1.1000 |
| C1—C3 | 1.528 (4) | C21—C23 | 1.530 (3) |
| C1—C2 | 1.660 (3) | C21—C22 | 1.658 (4) |
| C2—H2 | 1.1000 | C22—H22 | 1.1000 |
| C3—H3A | 0.9700 | C23—H23A | 0.9700 |
| C3—H3B | 0.9700 | C23—H23B | 0.9700 |
| C4—H4A | 0.9600 | C24—H24A | 0.9600 |
| C4—H4B | 0.9600 | C24—H24B | 0.9600 |
| C4—H4C | 0.9600 | C24—H24C | 0.9600 |
| C5—H5A | 0.9600 | C25—H25A | 0.9600 |
| C5—H5B | 0.9600 | C25—H25B | 0.9600 |
| C5—H5C | 0.9600 | C25—H25C | 0.9600 |
| C6—H6A | 0.9600 | C26—H26A | 0.9600 |
| C6—H6B | 0.9600 | C26—H26B | 0.9600 |
| C6—H6C | 0.9600 | C26—H26C | 0.9600 |
| C4—N1—C3 | 112.9 (2) | C26—N2—C24 | 111.2 (2) |
| C4—N1—C5 | 110.5 (2) | C26—N2—C23 | 111.7 (2) |
| C3—N1—C5 | 111.9 (2) | C24—N2—C23 | 112.83 (19) |
| C4—N1—C6 | 108.0 (2) | C26—N2—C25 | 108.0 (2) |
| C3—N1—C6 | 104.9 (2) | C24—N2—C25 | 107.8 (2) |
| C5—N1—C6 | 108.2 (2) | C23—N2—C25 | 105.0 (2) |
| C2—B3—C1 | 57.41 (15) | C22—B23—C21 | 57.34 (16) |
| C2—B3—B7 | 104.6 (2) | C22—B23—B29 | 104.5 (2) |
| C1—B3—B7 | 105.2 (2) | C21—B23—B29 | 105.3 (2) |
| C2—B3—B8 | 58.33 (17) | C22—B23—B30 | 58.61 (18) |
| C1—B3—B8 | 105.3 (2) | C21—B23—B30 | 105.2 (2) |
| B7—B3—B8 | 60.48 (19) | B29—B23—B30 | 59.89 (18) |
| C2—B3—B4 | 103.9 (2) | C22—B23—B24 | 104.0 (2) |
| C1—B3—B4 | 57.94 (15) | C21—B23—B24 | 57.98 (15) |
| B7—B3—B4 | 60.62 (18) | B29—B23—B24 | 60.96 (18) |
| B8—B3—B4 | 108.5 (2) | B30—B23—B24 | 108.4 (2) |
| C2—B3—H3 | 125.1 | C22—B23—H23 | 125.0 |
| C1—B3—H3 | 124.4 | C21—B23—H23 | 124.4 |
| B7—B3—H3 | 122.5 | B29—B23—H23 | 122.6 |
| B8—B3—H3 | 121.7 | B30—B23—H23 | 121.8 |
| B4—B3—H3 | 122.3 | B24—B23—H23 | 122.2 |
| C1—B4—B3 | 60.09 (16) | C21—B24—B23 | 60.33 (16) |
| C1—B4—B11 | 105.4 (2) | C21—B24—B28 | 105.3 (2) |
| B3—B4—B11 | 107.7 (2) | B23—B24—B28 | 107.5 (2) |
| C1—B4—B5 | 58.79 (16) | C21—B24—B25 | 58.90 (17) |
| B3—B4—B5 | 108.5 (2) | B23—B24—B25 | 109.0 (2) |
| B11—B4—B5 | 59.82 (18) | B28—B24—B25 | 60.0 (2) |
| C1—B4—B7 | 105.7 (2) | C21—B24—B29 | 105.6 (2) |
| B3—B4—B7 | 59.15 (18) | B23—B24—B29 | 59.10 (17) |
| B11—B4—B7 | 60.25 (19) | B28—B24—B29 | 59.90 (19) |
| B5—B4—B7 | 108.0 (2) | B25—B24—B29 | 108.2 (2) |
| C1—B4—H4 | 123.7 | C21—B24—H24 | 123.7 |
| B3—B4—H4 | 121.4 | B23—B24—H24 | 121.2 |
| B11—B4—H4 | 122.4 | B28—B24—H24 | 122.6 |
| B5—B4—H4 | 121.5 | B25—B24—H24 | 121.1 |
| B7—B4—H4 | 122.4 | B29—B24—H24 | 122.5 |
| C1—B5—B10 | 105.8 (2) | C21—B25—B26 | 59.24 (19) |
| C1—B5—B11 | 105.3 (2) | C21—B25—B28 | 104.7 (2) |
| B10—B5—B11 | 60.9 (2) | B26—B25—B28 | 107.3 (3) |
| C1—B5—B4 | 58.50 (16) | C21—B25—B24 | 58.36 (16) |
| B10—B5—B4 | 108.7 (2) | B26—B25—B24 | 107.5 (2) |
| B11—B5—B4 | 59.96 (18) | B28—B25—B24 | 59.8 (2) |
| C1—B5—B6 | 59.51 (17) | C21—B25—B27 | 105.0 (3) |
| B10—B5—B6 | 59.7 (2) | B26—B25—B27 | 59.2 (3) |
| B11—B5—B6 | 108.5 (2) | B28—B25—B27 | 60.2 (2) |
| B4—B5—B6 | 108.2 (2) | B24—B25—B27 | 107.8 (2) |
| C1—B5—H5 | 124.2 | C21—B25—H25 | 124.4 |
| B10—B5—H5 | 121.7 | B26—B25—H25 | 121.9 |
| B11—B5—H5 | 121.9 | B28—B25—H25 | 122.5 |
| B4—B5—H5 | 121.5 | B24—B25—H25 | 121.8 |
| B6—B5—H5 | 121.3 | B27—B25—H25 | 122.4 |
| C2—B6—C1 | 57.59 (15) | C22—B26—C21 | 57.77 (17) |
| C2—B6—B10 | 104.2 (2) | C22—B26—B27 | 104.6 (3) |
| C1—B6—B10 | 104.9 (2) | C21—B26—B27 | 105.3 (3) |
| C2—B6—B9 | 58.07 (18) | C22—B26—B25 | 104.8 (2) |
| C1—B6—B9 | 105.0 (2) | C21—B26—B25 | 58.53 (17) |
| B10—B6—B9 | 60.1 (2) | B27—B26—B25 | 60.4 (3) |
| C2—B6—B5 | 103.9 (2) | C22—B26—B31 | 58.3 (2) |
| C1—B6—B5 | 58.22 (16) | C21—B26—B31 | 105.0 (2) |
| B10—B6—B5 | 59.8 (2) | B27—B26—B31 | 59.8 (3) |
| B9—B6—B5 | 107.5 (2) | B25—B26—B31 | 107.8 (3) |
| C2—B6—H6 | 125.0 | C22—B26—H26 | 124.5 |
| C1—B6—H6 | 124.2 | C21—B26—H26 | 124.0 |
| B10—B6—H6 | 123.0 | B27—B26—H26 | 122.8 |
| B9—B6—H6 | 122.2 | B25—B26—H26 | 122.2 |
| B5—B6—H6 | 122.8 | B31—B26—H26 | 122.3 |
| B3—B7—B8 | 60.02 (18) | B26—B27—B31 | 60.8 (3) |
| B3—B7—B12 | 108.1 (2) | B26—B27—B25 | 60.4 (2) |
| B8—B7—B12 | 59.9 (2) | B31—B27—B25 | 108.6 (3) |
| B3—B7—B11 | 108.1 (2) | B26—B27—B32 | 108.3 (3) |
| B8—B7—B11 | 107.9 (2) | B31—B27—B32 | 59.3 (2) |
| B12—B7—B11 | 60.1 (2) | B25—B27—B32 | 108.0 (3) |
| B3—B7—B4 | 60.23 (17) | B26—B27—B28 | 107.9 (3) |
| B8—B7—B4 | 107.9 (2) | B31—B27—B28 | 107.0 (3) |
| B12—B7—B4 | 107.7 (2) | B25—B27—B28 | 59.9 (2) |
| B11—B7—B4 | 59.58 (18) | B32—B27—B28 | 59.6 (2) |
| B3—B7—H7 | 121.5 | B26—B27—H27 | 121.2 |
| B8—B7—H7 | 121.8 | B31—B27—H27 | 121.8 |
| B12—B7—H7 | 121.7 | B25—B27—H27 | 121.3 |
| B11—B7—H7 | 121.8 | B32—B27—H27 | 122.0 |
| B4—B7—H7 | 121.9 | B28—B27—H27 | 122.4 |
| C2—B8—B3 | 59.26 (17) | B24—B28—B32 | 108.4 (3) |
| C2—B8—B9 | 58.46 (18) | B24—B28—B25 | 60.21 (19) |
| B3—B8—B9 | 108.4 (2) | B32—B28—B25 | 108.6 (3) |
| C2—B8—B7 | 104.5 (2) | B24—B28—B29 | 60.50 (19) |
| B3—B8—B7 | 59.50 (18) | B32—B28—B29 | 59.8 (2) |
| B9—B8—B7 | 108.2 (2) | B25—B28—B29 | 108.8 (2) |
| C2—B8—B12 | 104.4 (2) | B24—B28—B27 | 107.9 (3) |
| B3—B8—B12 | 108.0 (2) | B32—B28—B27 | 60.2 (3) |
| B9—B8—B12 | 59.9 (2) | B25—B28—B27 | 59.9 (2) |
| B7—B8—B12 | 60.3 (2) | B29—B28—B27 | 108.0 (3) |
| C2—B8—H8 | 124.9 | B24—B28—H28 | 121.5 |
| B3—B8—H8 | 121.3 | B32—B28—H28 | 121.5 |
| B9—B8—H8 | 121.3 | B25—B28—H28 | 121.3 |
| B7—B8—H8 | 122.4 | B29—B28—H28 | 121.5 |
| B12—B8—H8 | 122.4 | B27—B28—H28 | 121.9 |
| C2—B9—B8 | 58.48 (18) | B23—B29—B30 | 60.46 (19) |
| C2—B9—B12 | 104.6 (2) | B23—B29—B32 | 108.7 (2) |
| B8—B9—B12 | 60.1 (2) | B30—B29—B32 | 60.3 (2) |
| C2—B9—B10 | 104.5 (2) | B23—B29—B28 | 108.0 (2) |
| B8—B9—B10 | 108.6 (2) | B30—B29—B28 | 108.2 (3) |
| B12—B9—B10 | 60.7 (2) | B32—B29—B28 | 60.0 (2) |
| C2—B9—B6 | 59.03 (18) | B23—B29—B24 | 59.94 (17) |
| B8—B9—B6 | 108.5 (2) | B30—B29—B24 | 108.1 (2) |
| B12—B9—B6 | 108.5 (2) | B32—B29—B24 | 107.8 (2) |
| B10—B9—B6 | 59.65 (19) | B28—B29—B24 | 59.6 (2) |
| C2—B9—H9 | 125.0 | B23—B29—H29 | 121.4 |
| B8—B9—H9 | 121.2 | B30—B29—H29 | 121.4 |
| B12—B9—H9 | 122.1 | B32—B29—H29 | 121.5 |
| B10—B9—H9 | 122.2 | B28—B29—H29 | 121.9 |
| B6—B9—H9 | 121.2 | B24—B29—H29 | 122.0 |
| B6—B10—B5 | 60.46 (18) | C22—B30—B29 | 104.8 (2) |
| B6—B10—B9 | 60.2 (2) | C22—B30—B23 | 59.26 (18) |
| B5—B10—B9 | 108.0 (2) | B29—B30—B23 | 59.65 (18) |
| B6—B10—B11 | 108.0 (2) | C22—B30—B31 | 58.7 (2) |
| B5—B10—B11 | 59.54 (19) | B29—B30—B31 | 107.7 (3) |
| B9—B10—B11 | 107.3 (2) | B23—B30—B31 | 108.3 (2) |
| B6—B10—B12 | 108.0 (3) | C22—B30—B32 | 104.5 (3) |
| B5—B10—B12 | 107.5 (2) | B29—B30—B32 | 60.2 (2) |
| B9—B10—B12 | 59.6 (2) | B23—B30—B32 | 107.9 (2) |
| B11—B10—B12 | 59.7 (2) | B31—B30—B32 | 59.5 (2) |
| B6—B10—H10 | 121.3 | C22—B30—H30 | 124.6 |
| B5—B10—H10 | 121.8 | B29—B30—H30 | 122.5 |
| B9—B10—H10 | 122.0 | B23—B30—H30 | 121.3 |
| B11—B10—H10 | 122.2 | B31—B30—H30 | 121.6 |
| B12—B10—H10 | 122.0 | B32—B30—H30 | 122.6 |
| B5—B11—B4 | 60.22 (18) | C22—B31—B32 | 105.4 (2) |
| B5—B11—B7 | 108.2 (2) | C22—B31—B27 | 104.9 (3) |
| B4—B11—B7 | 60.16 (18) | B32—B31—B27 | 61.0 (3) |
| B5—B11—B12 | 107.8 (2) | C22—B31—B30 | 58.9 (2) |
| B4—B11—B12 | 108.0 (2) | B32—B31—B30 | 60.4 (2) |
| B7—B11—B12 | 59.93 (19) | B27—B31—B30 | 109.1 (3) |
| B5—B11—B10 | 59.54 (19) | C22—B31—B26 | 59.0 (2) |
| B4—B11—B10 | 107.8 (2) | B32—B31—B26 | 108.6 (3) |
| B7—B11—B10 | 108.0 (2) | B27—B31—B26 | 59.5 (2) |
| B12—B11—B10 | 60.1 (2) | B30—B31—B26 | 108.6 (2) |
| B5—B11—H11 | 121.8 | C22—B31—H31 | 124.6 |
| B4—B11—H11 | 121.6 | B32—B31—H31 | 121.7 |
| B7—B11—H11 | 121.6 | B27—B31—H31 | 122.0 |
| B12—B11—H11 | 121.7 | B30—B31—H31 | 120.8 |
| B10—B11—H11 | 121.9 | B26—B31—H31 | 121.4 |
| B9—B12—B8 | 59.9 (2) | B31—B32—B29 | 107.7 (3) |
| B9—B12—B7 | 107.7 (2) | B31—B32—B30 | 60.1 (2) |
| B8—B12—B7 | 59.76 (19) | B29—B32—B30 | 59.54 (19) |
| B9—B12—B11 | 107.8 (2) | B31—B32—B28 | 107.7 (3) |
| B8—B12—B11 | 107.7 (2) | B29—B32—B28 | 60.2 (2) |
| B7—B12—B11 | 59.96 (19) | B30—B32—B28 | 107.7 (2) |
| B9—B12—B10 | 59.8 (2) | B31—B32—B27 | 59.7 (3) |
| B8—B12—B10 | 107.7 (2) | B29—B32—B27 | 108.2 (3) |
| B7—B12—B10 | 108.0 (2) | B30—B32—B27 | 107.9 (3) |
| B11—B12—B10 | 60.2 (2) | B28—B32—B27 | 60.1 (3) |
| B9—B12—H12 | 121.9 | B31—B32—H32 | 121.9 |
| B8—B12—H12 | 122.0 | B29—B32—H32 | 121.8 |
| B7—B12—H12 | 121.8 | B30—B32—H32 | 121.9 |
| B11—B12—H12 | 121.8 | B28—B32—H32 | 121.7 |
| B10—B12—H12 | 121.7 | B27—B32—H32 | 121.6 |
| C3—C1—C2 | 112.0 (2) | C23—C21—C22 | 111.8 (2) |
| C3—C1—B4 | 122.7 (2) | C23—C21—B24 | 122.9 (2) |
| C2—C1—B4 | 109.45 (19) | C22—C21—B24 | 109.54 (19) |
| C3—C1—B5 | 131.2 (2) | C23—C21—B25 | 130.6 (2) |
| C2—C1—B5 | 109.4 (2) | C22—C21—B25 | 110.0 (2) |
| B4—C1—B5 | 62.71 (17) | B24—C21—B25 | 62.74 (19) |
| C3—C1—B6 | 120.4 (2) | C23—C21—B26 | 120.5 (2) |
| C2—C1—B6 | 60.57 (16) | C22—C21—B26 | 60.8 (2) |
| B4—C1—B6 | 113.9 (2) | B24—C21—B26 | 113.5 (2) |
| B5—C1—B6 | 62.28 (18) | B25—C21—B26 | 62.2 (2) |
| C3—C1—B3 | 109.2 (2) | C23—C21—B23 | 109.54 (19) |
| C2—C1—B3 | 60.35 (16) | C22—C21—B23 | 60.52 (17) |
| B4—C1—B3 | 61.97 (16) | B24—C21—B23 | 61.69 (17) |
| B5—C1—B3 | 113.2 (2) | B25—C21—B23 | 113.2 (2) |
| B6—C1—B3 | 112.8 (2) | B26—C21—B23 | 112.7 (2) |
| C1—C2—B9 | 112.2 (2) | C21—C22—B30 | 111.9 (2) |
| C1—C2—B8 | 112.4 (2) | C21—C22—B31 | 111.5 (3) |
| B9—C2—B8 | 63.06 (19) | B30—C22—B31 | 62.3 (2) |
| C1—C2—B6 | 61.84 (16) | C21—C22—B26 | 61.45 (18) |
| B9—C2—B6 | 62.90 (19) | B30—C22—B26 | 114.6 (3) |
| B8—C2—B6 | 115.5 (2) | B31—C22—B26 | 62.7 (2) |
| C1—C2—B3 | 62.24 (16) | C21—C22—B23 | 62.14 (16) |
| B9—C2—B3 | 114.8 (2) | B30—C22—B23 | 62.13 (19) |
| B8—C2—B3 | 62.41 (18) | B31—C22—B23 | 113.6 (2) |
| B6—C2—B3 | 115.4 (2) | B26—C22—B23 | 114.6 (2) |
| C1—C2—H2 | 120.0 | C21—C22—H22 | 120.3 |
| B9—C2—H2 | 118.2 | B30—C22—H22 | 118.5 |
| B8—C2—H2 | 118.0 | B31—C22—H22 | 118.9 |
| B6—C2—H2 | 117.0 | B26—C22—H22 | 117.5 |
| B3—C2—H2 | 117.3 | B23—C22—H22 | 117.8 |
| N1—C3—C1 | 120.2 (2) | N2—C23—C21 | 120.3 (2) |
| N1—C3—H3A | 107.3 | N2—C23—H23A | 107.3 |
| C1—C3—H3A | 107.3 | C21—C23—H23A | 107.3 |
| N1—C3—H3B | 107.3 | N2—C23—H23B | 107.3 |
| C1—C3—H3B | 107.3 | C21—C23—H23B | 107.3 |
| H3A—C3—H3B | 106.9 | H23A—C23—H23B | 106.9 |
| N1—C4—H4A | 109.5 | N2—C24—H24A | 109.5 |
| N1—C4—H4B | 109.5 | N2—C24—H24B | 109.5 |
| H4A—C4—H4B | 109.5 | H24A—C24—H24B | 109.5 |
| N1—C4—H4C | 109.5 | N2—C24—H24C | 109.5 |
| H4A—C4—H4C | 109.5 | H24A—C24—H24C | 109.5 |
| H4B—C4—H4C | 109.5 | H24B—C24—H24C | 109.5 |
| N1—C5—H5A | 109.5 | N2—C25—H25A | 109.5 |
| N1—C5—H5B | 109.5 | N2—C25—H25B | 109.5 |
| H5A—C5—H5B | 109.5 | H25A—C25—H25B | 109.5 |
| N1—C5—H5C | 109.5 | N2—C25—H25C | 109.5 |
| H5A—C5—H5C | 109.5 | H25A—C25—H25C | 109.5 |
| H5B—C5—H5C | 109.5 | H25B—C25—H25C | 109.5 |
| N1—C6—H6A | 109.5 | N2—C26—H26A | 109.5 |
| N1—C6—H6B | 109.5 | N2—C26—H26B | 109.5 |
| H6A—C6—H6B | 109.5 | H26A—C26—H26B | 109.5 |
| N1—C6—H6C | 109.5 | N2—C26—H26C | 109.5 |
| H6A—C6—H6C | 109.5 | H26A—C26—H26C | 109.5 |
| H6B—C6—H6C | 109.5 | H26B—C26—H26C | 109.5 |
| D—H···A | D—H | H···A | D···A | D—H···A |
| C2—H2···I1 | 1.10 | 3.03 | 3.946 (3) | 141 |
| C3—H3B···I1 | 0.97 | 2.94 | 3.904 (3) | 172 |
| C23—H23B···I1 | 0.97 | 2.96 | 3.921 (3) | 170 |
Experimental details
| Crystal data | |
| Chemical formula | C6H22B10N+·I− |
| Mr | 343.25 |
| Crystal system, space group | Monoclinic, P21/n |
| Temperature (K) | 293 |
| a, b, c (Å) | 6.7435 (14), 25.013 (5), 18.694 (4) |
| β (°) | 94.800 (4) |
| V (Å3) | 3142.2 (11) |
| Z | 8 |
| Radiation type | Mo Kα |
| µ (mm−1) | 2.01 |
| Crystal size (mm) | 0.28 × 0.25 × 0.20 |
| Data collection | |
| Diffractometer | Bruker SMART 1000 CCD diffractometer |
| Absorption correction | Multi-scan (SADABS; Sheldrick, 2008) |
| Tmin, Tmax | 0.603, 0.689 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 32138, 7772, 5834 |
| Rint | 0.032 |
| (sin θ/λ)max (Å−1) | 0.667 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.031, 0.076, 1.02 |
| No. of reflections | 7772 |
| No. of parameters | 325 |
| H-atom treatment | H-atom parameters constrained |
| Δρmax, Δρmin (e Å−3) | 0.88, −0.92 |
Computer programs: SMART (Bruker, 1999), SAINT-Plus (Bruker, 1999), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), ORTEP-3 for Windows (Farrugia, 1997).
| D—H···A | D—H | H···A | D···A | D—H···A |
| C2—H2···I1 | 1.10 | 3.03 | 3.946 (3) | 141.1 |
| C3—H3B···I1 | 0.97 | 2.94 | 3.904 (3) | 171.9 |
| C23—H23B···I1 | 0.97 | 2.96 | 3.921 (3) | 169.7 |
Acknowledgements
This study was supported by the research fund of Chosun University, 2010.
References
Bruker (1999). SMART and SAINT-Plus. Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
Carr, M. J., Franken, A., Macías, R. & Kennedy, J. D. (2006). Polyhedron, 25, 1069–1075. Web of Science CSD CrossRef CAS Google Scholar
Davidson, M. G., Hibbert, T. G., Howard, J. A. K., Mackinnon, A. & Wade, K. (1996). Chem. Commun. pp. 2285–2286. CSD CrossRef Web of Science Google Scholar
Farrugia, L. J. (1997). J. Appl. Cryst. 30, 565. CrossRef IUCr Journals Google Scholar
Lee, J.-D., Baek, C. K., Ko, J., Park, K., Cho, S., Min, S. K. & Kang, S. O. (1999). Organometallics, 18, 2189–2197. Web of Science CSD CrossRef CAS Google Scholar
Lee, J.-D., Kim, S.-J., Yoo, D., Ko, J., Cho, S. & Kang, S. O. (2000). Organometallics, 19, 1695–1703. Web of Science CSD CrossRef CAS Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Welch, A. J., Venkatasubramanian, U., Rosair, G. M., Ellis, D. & Donohoe, D. J. (2001). Acta Cryst. C57, 1295–1296. Web of Science CSD CrossRef CAS IUCr Journals Google Scholar
Wiebcke, M. & Felsche, J. (2001). Acta Cryst. C57, 306–308. Web of Science CSD CrossRef CAS IUCr Journals Google Scholar
Zhang, H.-X., Zheng, S.-T. & Yang, G.-Y. (2004). Acta Cryst. C60, o545–o546. Web of Science CSD CrossRef CAS IUCr Journals Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
![[Figure 1]](./dn2706fig1thm.gif)




N,N-dimethyl-(1,2-dicarba-closo-dodecaboranyl)methanamine is a useful intramolecular coordinating ligand for many different metals (Lee et al., 1999, 2000). Since the starting material is an oil, it could not be characterized by X-ray diffraction. However, we found that the corresponding methyl iodide forms crystals suitable for crystallographic study. We report here the synthesis and structure of the title compound (I).
In (I), shown in Fig. 1 and Table 1, the average bond length N—C [1.508 (2) Å] in the tetramethylammonium unit is similar to 1.492 (5) Å in an o-carboranyl organogallium compound [Cl3Ga][N(CH3)2CH2-1,2-C2B10H11] (Lee et al., 1999), 1.505 (2) Å in a benzyltrimethylammonium hydroxide trihydrate system (Wiebcke & Felsche, 2001) and 1.478 (5) Å in a tetramethylammonium pentaborate 0.25-hydrate compound (Zhang et al., 2004).
The average bond angle of Ccage—Cmethylene—N [120.3 (1)°] in (I) is almost same as 120.5 (6)° of o-carboranyl organogallium compound (Lee et al., 1999). Their large difference from the tetrahedral angle might be attributable to the repulsion between the carborane and tetramethylammonium unit. On the other hand, Carr and co-workers reported far smaller angle [113.5 (2)°] for the same methylene unit of [H3NCH2C2B10H11][H3CCH2CB11H11] with a smaller methylammonium unit than tetramethylammonium one. Compared with these two values, it would seem the above-mentioned repulsion logic would be affirmatively accepted.
The carborane moiety forms an icosahedrons consisting of twenty triangles with sides of the average bond length of Ccage—Ccage 1.659 (3), Ccage—Bcage 1.713 (1), and Bcage—Bcage 1.771 (1) Å. All of the compounds containing mono-substituted o-carboranes (Lee et al., 1999; Welch, et al., 2001) including unsubstituted ortho-, meta-, and para-carboranes with hexamethylphosphoramide (Davidson, et al., 1996) surveyed by our group so far exhibit the same trend of d(Ccage—Ccage) < d(Ccage—Bcage) < d(Bcage—Bcage). Since the boron atom has one valence electron less than carbon, this result confirms that the bond lengths will become shorter when more electrons participate in bond formation.
As shown in Table 1 and Figure 1, I1 atom participates in two intramolecular and an intermolecular hydrogen bonds, while I2 atom has only weak interaction with the closest interatomic distances I2···H3Ai 3.126 Å and I2···H5Aii 3.126 Å [symmetry code: (i) 0.5 - x, 1/2 + y, 1.5 - z; (ii) -1/2 + x, 1.5 - y, 1/2 + z]. The shortest interdimer's distance B26···H24iii 2.912 Å [symmetry code: (iii) -1 + x, y, z] suggests the dimer's packing of (I) is governed by van der Waals forces.