organic compounds
1-(2-Hydroxyethyl)-4-{3-[(E)-2-(trifluoromethyl)-9H-thioxanthen-9-ylidene]propyl}piperazine-1,4-diium bis(3-carboxyprop-2-enoate)
aDepartment of Studies in Chemistry, University of Mysore, Manasagangotri, Mysore 570 006, India, bDepartment of Chemistry, Howard University, 525 College Street NW, Washington, DC 20059, USA, cDepartment of Physics, Faculty of Sciences, Erciyes University, 38039 Kayseri, Turkey, and dR. L. Fine Chem, Bangalore 560 064, India
*Correspondence e-mail: [email protected]
In the title salt, C23H27F3N2OS+·2C4H3O4−, a non-merohedral twin [ratio of the twin components = 0.402 (1):0.598 (1)], the –CF3 group is disordered over two sets of sites with occupancy factors in the ratio 0.873 (2):0.127 (2). The dihedral angle between the two outer aromatic rings of the 9H-thioxanthene unit, whose thiopyran ring has a screw-boat conformation, is 33.01 (9)°. The diprotonated piperazine ring adopts a chair conformation. In the crystal, intermolecular O—H⋯O, N—H⋯O and C—H⋯O hydrogen bonds between neighboring molecules form zigzag chains along the a axis and contribute to the stabilization of the packing.
Related literature
The title compound was formed by the reaction of flupentixol (systematic name: 2-[4-[3-[(EZ)-2-(trifluoromethyl)-9H-thioxanthen-9-ylidene]propyl]piperazin-1-yl]ethanol and fumaric acid. For the antidepressant action of flupentixol, see: Robertson & Trimble, (1981
). For related structures, see: Post et al. (1975a
,b
); Jones et al. (1977
). For ring puckering parameters, see: Cremer & Pople (1975
).
Experimental
Crystal data
|
Refinement
|
|
Data collection: CrysAlis PRO (Oxford Diffraction, 2007
); cell refinement: CrysAlis PRO; data reduction: CrysAlis RED (Oxford Diffraction, 2007
); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: ORTEP-3 for Windows (Farrugia, 1997
); software used to prepare material for publication: WinGX (Farrugia, 1999
) and PLATON (Spek, 2009
).
Supporting information
contains datablocks global, I. DOI: 10.1107/S160053681102722X/tk2763sup1.cif
Structure factors: contains datablock I. DOI: 10.1107/S160053681102722X/tk2763Isup2.hkl
Supporting information file. DOI: 10.1107/S160053681102722X/tk2763Isup3.cml
Flupenthixol base (2.0 g, 0.046 mol) was dissolved in 10 ml of ethyl acetate and fumaric acid (1.067 g, 0.092 mol) was added at 323 K. The solution was stirred in a round bottomed flask at 343 K for 30 min. The mixture was cooled to room temperature and the product formed was filtered and dried. X-ray quality crystals were obtained from a 1:1 mixture of dichloromethane and methanol by slow evaporation (M.pt.: 431-433 K).
All H atoms were positioned geometrically and allowed to ride on their parent atoms, with C—H = 0.93–0.97 Å, N–H = 0.91 Å and O–H = 0.82 Å, and with Uiso(H) = 1.5Ueq(O) for hydroxyl H atoms and 1.2Ueq(C) for other H atoms. The CF3 group is disordered over two sets of sites with occupations of 0.873 (2) and 0.127 (2), respectively. The structure was refined as a non-merohedral twin (using HKLF 5 in SHELXL) with the final ratio of the twin components being 0.402 (1):0.598 (1); as such there is no value for Rint.
Data collection: CrysAlis PRO (Oxford Diffraction, 2007); cell CrysAlis PRO (Oxford Diffraction, 2007); data reduction: CrysAlis RED (Oxford Diffraction, 2007); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: ORTEP-3 for Windows (Farrugia, 1997); software used to prepare material for publication: WinGX (Farrugia, 1999) and PLATON (Spek, 2009).
| C23H27F3N2OS2+·2C4H3O4− | Z = 2 |
| Mr = 666.66 | F(000) = 696 |
| Triclinic, P1 | Dx = 1.422 Mg m−3 |
| Hall symbol: -P 1 | Cu Kα radiation, λ = 1.54184 Å |
| a = 6.4175 (2) Å | Cell parameters from 5369 reflections |
| b = 9.6185 (4) Å | θ = 4.6–75.4° |
| c = 25.5771 (10) Å | µ = 1.59 mm−1 |
| α = 96.377 (4)° | T = 295 K |
| β = 96.295 (3)° | Thick needle, colourless |
| γ = 92.774 (3)° | 0.53 × 0.17 × 0.12 mm |
| V = 1556.63 (10) Å3 |
| Oxford Diffraction Xcalibur Ruby Gemini diffractometer | 11625 independent reflections |
| Radiation source: Enhance (Cu) X-ray Source | 9926 reflections with i > 2σ(i) |
| Graphite monochromator | Rint = 0.000 |
| Detector resolution: 10.5081 pixels mm-1 | θmax = 75.7°, θmin = 4.6° |
| ω scans | h = −8→5 |
| Absorption correction: multi-scan (CrysAlis PRO; Oxford Diffraction, 2007) | k = −11→12 |
| Tmin = 0.643, Tmax = 1.000 | l = −31→31 |
| 11625 measured reflections |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.055 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.162 | H-atom parameters constrained |
| S = 1.03 | w = 1/[σ2(Fo2) + (0.0915P)2 + 0.2879P] where P = (Fo2 + 2Fc2)/3 |
| 11625 reflections | (Δ/σ)max = 0.001 |
| 430 parameters | Δρmax = 0.47 e Å−3 |
| 12 restraints | Δρmin = −0.27 e Å−3 |
| C23H27F3N2OS2+·2C4H3O4− | γ = 92.774 (3)° |
| Mr = 666.66 | V = 1556.63 (10) Å3 |
| Triclinic, P1 | Z = 2 |
| a = 6.4175 (2) Å | Cu Kα radiation |
| b = 9.6185 (4) Å | µ = 1.59 mm−1 |
| c = 25.5771 (10) Å | T = 295 K |
| α = 96.377 (4)° | 0.53 × 0.17 × 0.12 mm |
| β = 96.295 (3)° |
| Oxford Diffraction Xcalibur Ruby Gemini diffractometer | 11625 independent reflections |
| Absorption correction: multi-scan (CrysAlis PRO; Oxford Diffraction, 2007) | 9926 reflections with i > 2σ(i) |
| Tmin = 0.643, Tmax = 1.000 | Rint = 0.000 |
| 11625 measured reflections |
| R[F2 > 2σ(F2)] = 0.055 | 12 restraints |
| wR(F2) = 0.162 | H-atom parameters constrained |
| S = 1.03 | Δρmax = 0.47 e Å−3 |
| 11625 reflections | Δρmin = −0.27 e Å−3 |
| 430 parameters |
Geometry. Bond distances, angles etc. have been calculated using the rounded fractional coordinates. All su's are estimated from the variances of the (full) variance-covariance matrix. The cell e.s.d.'s are taken into account in the estimation of distances, angles and torsion angles |
Refinement. Refinement on F2 for ALL reflections except those flagged by the user for potential systematic errors. Weighted R-factors wR and all goodnesses of fit S are based on F2, conventional R-factors R are based on F, with F set to zero for negative F2. The observed criterion of F2 > σ(F2) is used only for calculating -R-factor-obs etc. and is not relevant to the choice of reflections for refinement. R-factors based on F2 are statistically about twice as large as those based on F, and R-factors based on ALL data will be even larger. |
| x | y | z | Uiso*/Ueq | Occ. (<1) | |
| S1 | −0.28261 (7) | 0.43649 (6) | 0.60072 (2) | 0.0659 (2) | |
| F1A | 0.4612 (4) | 0.9150 (2) | 0.57634 (7) | 0.1255 (9) | 0.873 (2) |
| F2A | 0.4440 (3) | 0.8145 (2) | 0.49990 (8) | 0.0980 (7) | 0.873 (2) |
| F3A | 0.2283 (3) | 0.9651 (2) | 0.51652 (13) | 0.1469 (15) | 0.873 (2) |
| O1 | 1.32172 (19) | 0.39302 (13) | 0.98491 (5) | 0.0546 (4) | |
| N1 | 0.66238 (16) | 0.39316 (11) | 0.79768 (4) | 0.0305 (3) | |
| N2 | 0.91809 (17) | 0.37193 (11) | 0.89824 (4) | 0.0306 (3) | |
| C1 | 0.1779 (2) | 0.48863 (17) | 0.64991 (6) | 0.0438 (4) | |
| C2 | 0.1109 (3) | 0.56962 (18) | 0.60557 (6) | 0.0477 (5) | |
| C3 | 0.2459 (3) | 0.66960 (18) | 0.58916 (7) | 0.0516 (5) | |
| C4 | 0.1775 (3) | 0.7513 (2) | 0.55001 (8) | 0.0582 (6) | |
| C5 | −0.0262 (3) | 0.7307 (2) | 0.52472 (8) | 0.0656 (7) | |
| C6 | −0.1606 (3) | 0.6297 (2) | 0.53930 (8) | 0.0651 (7) | |
| C7 | −0.0948 (3) | 0.55110 (19) | 0.58004 (7) | 0.0521 (5) | |
| C8 | 0.3238 (3) | 0.8631 (2) | 0.53587 (8) | 0.0680 (7) | |
| C9 | −0.1214 (3) | 0.3095 (2) | 0.62478 (7) | 0.0547 (5) | |
| C10 | −0.2118 (4) | 0.1745 (2) | 0.62336 (9) | 0.0729 (7) | |
| C11 | −0.0916 (4) | 0.0699 (2) | 0.64065 (10) | 0.0856 (9) | |
| C12 | 0.1184 (4) | 0.0977 (2) | 0.65792 (9) | 0.0724 (8) | |
| C13 | 0.2079 (3) | 0.23213 (19) | 0.66001 (7) | 0.0562 (6) | |
| C14 | 0.0877 (3) | 0.34244 (18) | 0.64521 (6) | 0.0477 (5) | |
| C15 | 0.3059 (2) | 0.54985 (16) | 0.69190 (6) | 0.0451 (5) | |
| C16 | 0.3723 (2) | 0.49081 (16) | 0.74246 (6) | 0.0429 (4) | |
| C17 | 0.6030 (2) | 0.45802 (15) | 0.74784 (5) | 0.0371 (4) | |
| C18 | 0.8816 (2) | 0.34649 (14) | 0.79991 (5) | 0.0341 (3) | |
| C19 | 0.9388 (2) | 0.27621 (13) | 0.84905 (5) | 0.0340 (4) | |
| C20 | 0.6999 (2) | 0.42049 (14) | 0.89560 (5) | 0.0340 (3) | |
| C21 | 0.6437 (2) | 0.49041 (13) | 0.84642 (5) | 0.0337 (4) | |
| C22 | 0.9676 (2) | 0.30256 (14) | 0.94779 (6) | 0.0382 (4) | |
| C23 | 1.1958 (3) | 0.27466 (16) | 0.95978 (6) | 0.0461 (5) | |
| F3B | 0.268 (2) | 0.8830 (13) | 0.4868 (3) | 0.1469 (15) | 0.127 (2) |
| F1B | 0.304 (2) | 0.9803 (8) | 0.5651 (4) | 0.1255 (9) | 0.127 (2) |
| F2B | 0.5195 (10) | 0.8365 (13) | 0.5404 (5) | 0.0980 (7) | 0.127 (2) |
| O1A | 0.35437 (16) | 0.18909 (10) | 0.79446 (5) | 0.0436 (3) | |
| O2A | 0.60481 (16) | 0.05328 (11) | 0.77149 (6) | 0.0524 (4) | |
| O3A | 0.02774 (18) | −0.30289 (11) | 0.78941 (6) | 0.0588 (4) | |
| O4A | −0.25463 (17) | −0.18840 (12) | 0.77479 (7) | 0.0663 (5) | |
| C1A | 0.4234 (2) | 0.07131 (14) | 0.78390 (6) | 0.0364 (4) | |
| C2A | 0.2834 (2) | −0.05762 (14) | 0.78550 (6) | 0.0385 (4) | |
| C3A | 0.0781 (2) | −0.06083 (14) | 0.78089 (6) | 0.0383 (4) | |
| C4A | −0.0509 (2) | −0.19431 (14) | 0.78216 (7) | 0.0422 (4) | |
| O1B | 0.24341 (15) | 0.57369 (10) | 0.90547 (4) | 0.0412 (3) | |
| O2B | −0.01770 (15) | 0.70858 (11) | 0.92034 (5) | 0.0456 (3) | |
| O3B | 0.55830 (18) | 1.06667 (11) | 0.90607 (7) | 0.0639 (5) | |
| O4B | 0.84275 (17) | 0.95113 (12) | 0.91559 (7) | 0.0623 (5) | |
| C1B | 0.1684 (2) | 0.69183 (13) | 0.91202 (5) | 0.0337 (4) | |
| C2B | 0.3074 (2) | 0.82060 (14) | 0.91032 (6) | 0.0391 (4) | |
| C3B | 0.5119 (2) | 0.82417 (13) | 0.91468 (6) | 0.0362 (4) | |
| C4B | 0.6382 (2) | 0.95740 (14) | 0.91189 (7) | 0.0424 (4) | |
| H1A | 0.57380 | 0.31640 | 0.79770 | 0.0370* | |
| H5A | −0.07150 | 0.78460 | 0.49810 | 0.0790* | |
| H2A | 1.00930 | 0.44800 | 0.89960 | 0.0370* | |
| H3A | 0.38440 | 0.68180 | 0.60470 | 0.0620* | |
| H1 | 1.32630 | 0.45270 | 0.96450 | 0.0820* | |
| H12A | 0.20020 | 0.02600 | 0.66820 | 0.0870* | |
| H13A | 0.35030 | 0.24980 | 0.67140 | 0.0670* | |
| H15A | 0.36010 | 0.64000 | 0.68930 | 0.0540* | |
| H16A | 0.28670 | 0.40570 | 0.74390 | 0.0510* | |
| H6A | −0.29610 | 0.61380 | 0.52190 | 0.0780* | |
| H10A | −0.35280 | 0.15480 | 0.61080 | 0.0870* | |
| H11A | −0.15280 | −0.01970 | 0.64060 | 0.1030* | |
| H18A | 0.97870 | 0.42690 | 0.79980 | 0.0410* | |
| H18B | 0.89440 | 0.28150 | 0.76880 | 0.0410* | |
| H19A | 0.84760 | 0.19230 | 0.84800 | 0.0410* | |
| H19B | 1.08220 | 0.24840 | 0.84970 | 0.0410* | |
| H20A | 0.68780 | 0.48600 | 0.92660 | 0.0410* | |
| H20B | 0.60140 | 0.34090 | 0.89590 | 0.0410* | |
| H21A | 0.50090 | 0.51950 | 0.84580 | 0.0400* | |
| H21B | 0.73650 | 0.57340 | 0.84710 | 0.0400* | |
| H22A | 0.92550 | 0.36180 | 0.97760 | 0.0460* | |
| H22B | 0.88450 | 0.21440 | 0.94430 | 0.0460* | |
| H23A | 1.20680 | 0.20010 | 0.98240 | 0.0550* | |
| H23B | 1.25010 | 0.24220 | 0.92690 | 0.0550* | |
| H16B | 0.34780 | 0.55750 | 0.77210 | 0.0510* | |
| H17A | 0.62940 | 0.39420 | 0.71750 | 0.0450* | |
| H17B | 0.68950 | 0.54370 | 0.74820 | 0.0450* | |
| H2AA | 0.34710 | −0.14090 | 0.79010 | 0.0460* | |
| H3AA | 0.01080 | 0.02140 | 0.77670 | 0.0460* | |
| H4A | −0.28400 | −0.10740 | 0.77180 | 0.0990* | |
| H2BA | 0.24320 | 0.90380 | 0.90580 | 0.0470* | |
| H3BA | 0.58020 | 0.74270 | 0.91960 | 0.0430* | |
| H4B | 0.87370 | 0.87110 | 0.91980 | 0.0930* |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| S1 | 0.0438 (2) | 0.0814 (3) | 0.0728 (3) | −0.0019 (2) | 0.0006 (2) | 0.0191 (2) |
| F1A | 0.170 (2) | 0.1107 (15) | 0.0830 (12) | −0.0800 (15) | −0.0226 (12) | 0.0305 (11) |
| F2A | 0.1009 (13) | 0.0998 (12) | 0.0986 (13) | −0.0100 (10) | 0.0312 (10) | 0.0223 (11) |
| F3A | 0.1041 (14) | 0.0976 (15) | 0.267 (4) | 0.0260 (11) | 0.0317 (17) | 0.126 (2) |
| O1 | 0.0495 (6) | 0.0579 (7) | 0.0531 (6) | −0.0124 (5) | −0.0078 (5) | 0.0118 (5) |
| N1 | 0.0287 (5) | 0.0269 (5) | 0.0353 (5) | −0.0042 (4) | 0.0045 (4) | 0.0035 (4) |
| N2 | 0.0294 (5) | 0.0255 (5) | 0.0361 (5) | −0.0052 (4) | 0.0029 (4) | 0.0036 (4) |
| C1 | 0.0413 (8) | 0.0470 (8) | 0.0442 (7) | 0.0051 (6) | 0.0033 (6) | 0.0112 (6) |
| C2 | 0.0482 (9) | 0.0500 (8) | 0.0446 (8) | 0.0046 (7) | −0.0014 (6) | 0.0097 (6) |
| C3 | 0.0498 (9) | 0.0530 (9) | 0.0525 (9) | 0.0025 (7) | −0.0012 (7) | 0.0155 (7) |
| C4 | 0.0674 (11) | 0.0531 (10) | 0.0563 (10) | 0.0080 (8) | 0.0036 (8) | 0.0175 (8) |
| C5 | 0.0748 (13) | 0.0643 (11) | 0.0585 (10) | 0.0112 (9) | −0.0086 (9) | 0.0239 (9) |
| C6 | 0.0575 (11) | 0.0723 (12) | 0.0632 (11) | 0.0093 (9) | −0.0139 (8) | 0.0161 (9) |
| C7 | 0.0477 (9) | 0.0575 (9) | 0.0508 (9) | 0.0049 (7) | −0.0001 (7) | 0.0096 (7) |
| C8 | 0.0813 (14) | 0.0591 (11) | 0.0668 (12) | 0.0025 (10) | 0.0049 (10) | 0.0258 (9) |
| C9 | 0.0535 (10) | 0.0628 (10) | 0.0470 (8) | −0.0071 (8) | 0.0020 (7) | 0.0115 (7) |
| C10 | 0.0738 (13) | 0.0746 (13) | 0.0660 (12) | −0.0245 (11) | −0.0044 (10) | 0.0145 (10) |
| C11 | 0.112 (2) | 0.0604 (12) | 0.0783 (14) | −0.0293 (12) | −0.0090 (13) | 0.0156 (11) |
| C12 | 0.0983 (17) | 0.0516 (10) | 0.0644 (12) | −0.0033 (10) | −0.0059 (11) | 0.0127 (9) |
| C13 | 0.0656 (11) | 0.0499 (9) | 0.0516 (9) | 0.0005 (8) | −0.0009 (8) | 0.0088 (7) |
| C14 | 0.0534 (9) | 0.0508 (9) | 0.0386 (7) | −0.0028 (7) | 0.0030 (6) | 0.0084 (6) |
| C15 | 0.0456 (8) | 0.0420 (8) | 0.0477 (8) | 0.0038 (6) | −0.0003 (6) | 0.0109 (6) |
| C16 | 0.0417 (8) | 0.0444 (8) | 0.0425 (7) | 0.0044 (6) | 0.0009 (6) | 0.0081 (6) |
| C17 | 0.0380 (7) | 0.0363 (7) | 0.0372 (7) | −0.0030 (5) | 0.0030 (5) | 0.0086 (5) |
| C18 | 0.0300 (6) | 0.0335 (6) | 0.0390 (6) | −0.0002 (5) | 0.0084 (5) | 0.0020 (5) |
| C19 | 0.0322 (7) | 0.0283 (6) | 0.0407 (7) | 0.0011 (5) | 0.0048 (5) | 0.0003 (5) |
| C20 | 0.0301 (6) | 0.0337 (6) | 0.0382 (6) | −0.0014 (5) | 0.0078 (5) | 0.0021 (5) |
| C21 | 0.0320 (7) | 0.0287 (6) | 0.0396 (7) | 0.0015 (5) | 0.0045 (5) | 0.0010 (5) |
| C22 | 0.0410 (8) | 0.0324 (6) | 0.0406 (7) | −0.0061 (5) | 0.0016 (5) | 0.0085 (5) |
| C23 | 0.0504 (9) | 0.0390 (7) | 0.0479 (8) | 0.0036 (6) | −0.0044 (6) | 0.0099 (6) |
| F3B | 0.1041 (14) | 0.0976 (15) | 0.267 (4) | 0.0260 (11) | 0.0317 (17) | 0.126 (2) |
| F1B | 0.170 (2) | 0.1107 (15) | 0.0830 (12) | −0.0800 (15) | −0.0226 (12) | 0.0305 (11) |
| F2B | 0.1009 (13) | 0.0998 (12) | 0.0986 (13) | −0.0100 (10) | 0.0312 (10) | 0.0223 (11) |
| O1A | 0.0335 (5) | 0.0286 (5) | 0.0689 (7) | −0.0024 (4) | 0.0080 (4) | 0.0069 (4) |
| O2A | 0.0296 (5) | 0.0373 (5) | 0.0908 (9) | −0.0036 (4) | 0.0150 (5) | 0.0038 (5) |
| O3A | 0.0432 (6) | 0.0316 (5) | 0.1042 (10) | −0.0014 (4) | 0.0123 (6) | 0.0179 (6) |
| O4A | 0.0322 (6) | 0.0350 (5) | 0.1307 (13) | −0.0056 (4) | 0.0127 (6) | 0.0059 (7) |
| C1A | 0.0283 (7) | 0.0299 (6) | 0.0501 (7) | −0.0038 (5) | 0.0012 (5) | 0.0071 (5) |
| C2A | 0.0328 (7) | 0.0274 (6) | 0.0561 (8) | −0.0006 (5) | 0.0046 (6) | 0.0101 (5) |
| C3A | 0.0327 (7) | 0.0264 (6) | 0.0558 (8) | −0.0015 (5) | 0.0062 (6) | 0.0055 (5) |
| C4A | 0.0343 (7) | 0.0295 (6) | 0.0630 (9) | −0.0034 (5) | 0.0104 (6) | 0.0046 (6) |
| O1B | 0.0353 (5) | 0.0274 (4) | 0.0616 (6) | −0.0028 (4) | 0.0073 (4) | 0.0085 (4) |
| O2B | 0.0287 (5) | 0.0359 (5) | 0.0730 (7) | −0.0039 (4) | 0.0117 (4) | 0.0066 (5) |
| O3B | 0.0389 (6) | 0.0322 (5) | 0.1227 (12) | −0.0019 (4) | 0.0075 (6) | 0.0216 (6) |
| O4B | 0.0291 (6) | 0.0342 (5) | 0.1242 (12) | −0.0051 (4) | 0.0110 (6) | 0.0134 (6) |
| C1B | 0.0293 (7) | 0.0292 (6) | 0.0423 (7) | −0.0045 (5) | 0.0024 (5) | 0.0076 (5) |
| C2B | 0.0318 (7) | 0.0266 (6) | 0.0599 (8) | −0.0007 (5) | 0.0047 (6) | 0.0113 (6) |
| C3B | 0.0301 (7) | 0.0260 (6) | 0.0522 (8) | −0.0024 (5) | 0.0029 (5) | 0.0071 (5) |
| C4B | 0.0305 (7) | 0.0296 (6) | 0.0671 (9) | −0.0037 (5) | 0.0051 (6) | 0.0087 (6) |
| S1—C7 | 1.757 (2) | C12—C13 | 1.382 (3) |
| S1—C9 | 1.758 (2) | C13—C14 | 1.403 (3) |
| F1A—C8 | 1.319 (3) | C15—C16 | 1.497 (2) |
| F1B—C8 | 1.301 (9) | C16—C17 | 1.5233 (18) |
| F2A—C8 | 1.325 (3) | C18—C19 | 1.5110 (18) |
| F2B—C8 | 1.289 (7) | C20—C21 | 1.5088 (18) |
| F3A—C8 | 1.297 (3) | C22—C23 | 1.506 (2) |
| F3B—C8 | 1.304 (8) | C3—H3A | 0.9300 |
| O1—C23 | 1.413 (2) | C5—H5A | 0.9300 |
| O1—H1 | 0.8200 | C6—H6A | 0.9300 |
| O1A—C1A | 1.2488 (17) | C10—H10A | 0.9300 |
| O2A—C1A | 1.2548 (17) | C11—H11A | 0.9300 |
| O3A—C4A | 1.2055 (18) | C12—H12A | 0.9300 |
| O4A—C4A | 1.3053 (17) | C13—H13A | 0.9300 |
| O4A—H4A | 0.8200 | C15—H15A | 0.9300 |
| O1B—C1B | 1.2567 (16) | C16—H16B | 0.9700 |
| O2B—C1B | 1.2507 (16) | C16—H16A | 0.9700 |
| O3B—C4B | 1.2083 (18) | C17—H17A | 0.9700 |
| O4B—C4B | 1.3105 (17) | C17—H17B | 0.9700 |
| O4B—H4B | 0.8200 | C18—H18B | 0.9700 |
| N1—C21 | 1.4927 (16) | C18—H18A | 0.9700 |
| N1—C18 | 1.4944 (17) | C19—H19A | 0.9700 |
| N1—C17 | 1.5009 (17) | C19—H19B | 0.9700 |
| N2—C22 | 1.5074 (18) | C20—H20B | 0.9700 |
| N2—C20 | 1.4943 (17) | C20—H20A | 0.9700 |
| N2—C19 | 1.4965 (16) | C21—H21B | 0.9700 |
| N1—H1A | 0.9100 | C21—H21A | 0.9700 |
| N2—H2A | 0.9100 | C22—H22B | 0.9700 |
| C1—C14 | 1.482 (2) | C22—H22A | 0.9700 |
| C1—C15 | 1.340 (2) | C23—H23A | 0.9700 |
| C1—C2 | 1.483 (2) | C23—H23B | 0.9700 |
| C2—C7 | 1.401 (3) | C1A—C2A | 1.5028 (19) |
| C2—C3 | 1.393 (3) | C2A—C3A | 1.3084 (18) |
| C3—C4 | 1.387 (3) | C3A—C4A | 1.4990 (19) |
| C4—C5 | 1.388 (3) | C2A—H2AA | 0.9300 |
| C4—C8 | 1.494 (3) | C3A—H3AA | 0.9300 |
| C5—C6 | 1.377 (3) | C1B—C2B | 1.4984 (18) |
| C6—C7 | 1.395 (3) | C2B—C3B | 1.3033 (18) |
| C9—C10 | 1.391 (3) | C3B—C4B | 1.4956 (19) |
| C9—C14 | 1.394 (3) | C2B—H2BA | 0.9300 |
| C10—C11 | 1.379 (3) | C3B—H3BA | 0.9300 |
| C11—C12 | 1.375 (4) | ||
| C7—S1—C9 | 100.77 (9) | C10—C11—H11A | 120.00 |
| C23—O1—H1 | 110.00 | C11—C12—H12A | 120.00 |
| C4A—O4A—H4A | 109.00 | C13—C12—H12A | 120.00 |
| C4B—O4B—H4B | 109.00 | C14—C13—H13A | 119.00 |
| C17—N1—C21 | 112.51 (10) | C12—C13—H13A | 119.00 |
| C17—N1—C18 | 111.12 (10) | C1—C15—H15A | 116.00 |
| C18—N1—C21 | 108.81 (9) | C16—C15—H15A | 116.00 |
| C20—N2—C22 | 109.94 (10) | C15—C16—H16B | 109.00 |
| C19—N2—C22 | 112.35 (10) | C17—C16—H16B | 109.00 |
| C19—N2—C20 | 109.06 (10) | H16A—C16—H16B | 108.00 |
| C18—N1—H1A | 108.00 | C15—C16—H16A | 109.00 |
| C21—N1—H1A | 108.00 | C17—C16—H16A | 109.00 |
| C17—N1—H1A | 108.00 | N1—C17—H17B | 109.00 |
| C22—N2—H2A | 108.00 | N1—C17—H17A | 109.00 |
| C20—N2—H2A | 108.00 | H17A—C17—H17B | 108.00 |
| C19—N2—H2A | 109.00 | C16—C17—H17A | 109.00 |
| C14—C1—C15 | 123.86 (14) | C16—C17—H17B | 109.00 |
| C2—C1—C15 | 120.13 (15) | N1—C18—H18B | 109.00 |
| C2—C1—C14 | 115.96 (13) | C19—C18—H18B | 109.00 |
| C1—C2—C3 | 121.69 (16) | H18A—C18—H18B | 108.00 |
| C3—C2—C7 | 117.77 (16) | C19—C18—H18A | 109.00 |
| C1—C2—C7 | 120.50 (15) | N1—C18—H18A | 109.00 |
| C2—C3—C4 | 121.22 (17) | N2—C19—H19B | 109.00 |
| C3—C4—C5 | 120.28 (18) | C18—C19—H19B | 109.00 |
| C3—C4—C8 | 119.45 (17) | H19A—C19—H19B | 108.00 |
| C5—C4—C8 | 120.27 (18) | N2—C19—H19A | 109.00 |
| C4—C5—C6 | 119.44 (18) | C18—C19—H19A | 109.00 |
| C5—C6—C7 | 120.41 (18) | N2—C20—H20B | 109.00 |
| C2—C7—C6 | 120.82 (17) | C21—C20—H20A | 109.00 |
| S1—C7—C2 | 121.38 (14) | H20A—C20—H20B | 108.00 |
| S1—C7—C6 | 117.70 (15) | N2—C20—H20A | 109.00 |
| F1B—C8—F2B | 108.3 (8) | C21—C20—H20B | 109.00 |
| F1B—C8—F3B | 107.2 (7) | N1—C21—H21A | 109.00 |
| F2B—C8—F3B | 108.1 (8) | C20—C21—H21B | 109.00 |
| F2A—C8—F3A | 105.9 (2) | H21A—C21—H21B | 108.00 |
| F2A—C8—C4 | 112.33 (17) | C20—C21—H21A | 109.00 |
| F2B—C8—C4 | 115.3 (6) | N1—C21—H21B | 109.00 |
| F1B—C8—C4 | 109.6 (5) | N2—C22—H22B | 109.00 |
| F1A—C8—F2A | 103.16 (19) | C23—C22—H22A | 109.00 |
| F1A—C8—F3A | 109.0 (2) | H22A—C22—H22B | 108.00 |
| F1A—C8—C4 | 112.26 (18) | C23—C22—H22B | 109.00 |
| F3A—C8—C4 | 113.45 (18) | N2—C22—H22A | 109.00 |
| F3B—C8—C4 | 108.1 (6) | C22—C23—H23A | 109.00 |
| S1—C9—C14 | 121.65 (14) | O1—C23—H23A | 109.00 |
| S1—C9—C10 | 117.29 (16) | O1—C23—H23B | 109.00 |
| C10—C9—C14 | 121.06 (18) | H23A—C23—H23B | 108.00 |
| C9—C10—C11 | 119.8 (2) | C22—C23—H23B | 109.00 |
| C10—C11—C12 | 120.24 (19) | O2A—C1A—C2A | 117.17 (12) |
| C11—C12—C13 | 120.02 (19) | O1A—C1A—O2A | 123.74 (13) |
| C12—C13—C14 | 121.17 (19) | O1A—C1A—C2A | 119.10 (12) |
| C1—C14—C9 | 120.51 (16) | C1A—C2A—C3A | 124.55 (13) |
| C9—C14—C13 | 117.48 (17) | C2A—C3A—C4A | 121.36 (12) |
| C1—C14—C13 | 122.01 (16) | O4A—C4A—C3A | 116.89 (12) |
| C1—C15—C16 | 127.88 (14) | O3A—C4A—O4A | 120.88 (13) |
| C15—C16—C17 | 112.50 (11) | O3A—C4A—C3A | 122.23 (12) |
| N1—C17—C16 | 111.24 (11) | C1A—C2A—H2AA | 118.00 |
| N1—C18—C19 | 111.20 (10) | C3A—C2A—H2AA | 118.00 |
| N2—C19—C18 | 111.35 (10) | C4A—C3A—H3AA | 119.00 |
| N2—C20—C21 | 111.66 (10) | C2A—C3A—H3AA | 119.00 |
| N1—C21—C20 | 110.95 (10) | O1B—C1B—O2B | 123.45 (12) |
| N2—C22—C23 | 114.20 (11) | O2B—C1B—C2B | 117.50 (11) |
| O1—C23—C22 | 113.68 (13) | O1B—C1B—C2B | 119.05 (12) |
| C4—C3—H3A | 119.00 | C1B—C2B—C3B | 124.58 (12) |
| C2—C3—H3A | 119.00 | C2B—C3B—C4B | 120.93 (12) |
| C6—C5—H5A | 120.00 | O3B—C4B—C3B | 122.51 (12) |
| C4—C5—H5A | 120.00 | O4B—C4B—C3B | 116.97 (12) |
| C7—C6—H6A | 120.00 | O3B—C4B—O4B | 120.52 (13) |
| C5—C6—H6A | 120.00 | C1B—C2B—H2BA | 118.00 |
| C9—C10—H10A | 120.00 | C3B—C2B—H2BA | 118.00 |
| C11—C10—H10A | 120.00 | C2B—C3B—H3BA | 120.00 |
| C12—C11—H11A | 120.00 | C4B—C3B—H3BA | 120.00 |
| C9—S1—C7—C2 | −30.94 (17) | C3—C4—C8—F1A | −29.5 (3) |
| C9—S1—C7—C6 | 152.85 (15) | C3—C4—C8—F2A | 86.2 (2) |
| C7—S1—C9—C10 | −152.63 (16) | C3—C4—C8—F3A | −153.7 (2) |
| C7—S1—C9—C14 | 28.28 (17) | C5—C4—C8—F1A | 149.5 (2) |
| C18—N1—C17—C16 | 173.66 (11) | C5—C4—C8—F2A | −94.8 (2) |
| C21—N1—C17—C16 | −64.06 (14) | C5—C4—C8—F3A | 25.4 (3) |
| C17—N1—C18—C19 | −177.84 (10) | C4—C5—C6—C7 | 1.7 (3) |
| C21—N1—C18—C19 | 57.75 (13) | C5—C6—C7—S1 | 173.90 (15) |
| C17—N1—C21—C20 | 178.72 (10) | C5—C6—C7—C2 | −2.3 (3) |
| C18—N1—C21—C20 | −57.70 (13) | S1—C9—C10—C11 | 178.60 (18) |
| C20—N2—C19—C18 | 55.99 (13) | C14—C9—C10—C11 | −2.3 (3) |
| C22—N2—C19—C18 | 178.15 (10) | S1—C9—C14—C1 | 3.3 (2) |
| C19—N2—C20—C21 | −56.27 (13) | S1—C9—C14—C13 | −175.63 (13) |
| C22—N2—C20—C21 | −179.87 (11) | C10—C9—C14—C1 | −175.76 (17) |
| C19—N2—C22—C23 | 69.51 (14) | C10—C9—C14—C13 | 5.3 (3) |
| C20—N2—C22—C23 | −168.83 (11) | C9—C10—C11—C12 | −1.8 (4) |
| C14—C1—C2—C3 | −146.11 (16) | C10—C11—C12—C13 | 2.6 (4) |
| C14—C1—C2—C7 | 36.3 (2) | C11—C12—C13—C14 | 0.6 (3) |
| C15—C1—C2—C3 | 36.4 (2) | C12—C13—C14—C1 | 176.62 (17) |
| C15—C1—C2—C7 | −141.17 (16) | C12—C13—C14—C9 | −4.5 (3) |
| C2—C1—C14—C9 | −39.3 (2) | C1—C15—C16—C17 | 110.09 (16) |
| C2—C1—C14—C13 | 139.62 (16) | C15—C16—C17—N1 | −177.47 (12) |
| C15—C1—C14—C9 | 138.10 (16) | N1—C18—C19—N2 | −58.15 (14) |
| C15—C1—C14—C13 | −43.0 (2) | N2—C20—C21—N1 | 58.42 (13) |
| C2—C1—C15—C16 | 173.11 (14) | N2—C22—C23—O1 | 81.02 (15) |
| C14—C1—C15—C16 | −4.1 (2) | O1A—C1A—C2A—C3A | 22.3 (2) |
| C1—C2—C3—C4 | −175.68 (17) | O2A—C1A—C2A—C3A | −157.25 (16) |
| C7—C2—C3—C4 | 2.0 (3) | C1A—C2A—C3A—C4A | 179.16 (14) |
| C1—C2—C7—S1 | 2.1 (2) | C2A—C3A—C4A—O3A | 2.8 (3) |
| C1—C2—C7—C6 | 178.20 (16) | C2A—C3A—C4A—O4A | −176.90 (16) |
| C3—C2—C7—S1 | −175.58 (14) | O1B—C1B—C2B—C3B | −16.6 (2) |
| C3—C2—C7—C6 | 0.5 (3) | O2B—C1B—C2B—C3B | 162.92 (15) |
| C2—C3—C4—C5 | −2.7 (3) | C1B—C2B—C3B—C4B | 179.28 (14) |
| C2—C3—C4—C8 | 176.38 (17) | C2B—C3B—C4B—O3B | 0.7 (3) |
| C3—C4—C5—C6 | 0.8 (3) | C2B—C3B—C4B—O4B | −178.69 (16) |
| C8—C4—C5—C6 | −178.23 (18) |
| D—H···A | D—H | H···A | D···A | D—H···A |
| O1—H1···O1Bi | 0.82 | 2.05 | 2.8365 (16) | 162 |
| N1—H1A···O1A | 0.91 | 1.81 | 2.7055 (15) | 168 |
| N1—H1A···O2A | 0.91 | 2.57 | 3.2580 (15) | 133 |
| N2—H2A···O1Bi | 0.91 | 1.86 | 2.7572 (15) | 167 |
| N2—H2A···O2Bi | 0.91 | 2.52 | 3.2230 (15) | 134 |
| O4A—H4A···O2Aii | 0.82 | 1.73 | 2.5406 (16) | 167 |
| O4B—H4B···O2Bi | 0.82 | 1.74 | 2.5497 (16) | 168 |
| C2A—H2AA···O3A | 0.93 | 2.51 | 2.8251 (17) | 100 |
| C2B—H2BA···O3B | 0.93 | 2.50 | 2.8165 (17) | 100 |
| C16—H16B···O3Aiii | 0.97 | 2.56 | 3.2782 (19) | 131 |
| C17—H17B···O4Aiv | 0.97 | 2.59 | 3.4520 (19) | 148 |
| C19—H19A···O2A | 0.97 | 2.57 | 3.2871 (18) | 131 |
| C19—H19B···O1Ai | 0.97 | 2.41 | 3.2461 (17) | 144 |
| C20—H20A···O1v | 0.97 | 2.44 | 3.3877 (18) | 167 |
| C21—H21A···O1B | 0.97 | 2.41 | 3.2098 (16) | 140 |
| C21—H21B···O2Bi | 0.97 | 2.51 | 3.2367 (17) | 132 |
| C22—H22B···O3Bvi | 0.97 | 2.51 | 3.3848 (18) | 150 |
| C22—H22B···O4Bvi | 0.97 | 2.55 | 3.4236 (18) | 150 |
| Symmetry codes: (i) x+1, y, z; (ii) x−1, y, z; (iii) x, y+1, z; (iv) x+1, y+1, z; (v) −x+2, −y+1, −z+2; (vi) x, y−1, z. |
Experimental details
| Crystal data | |
| Chemical formula | C23H27F3N2OS2+·2C4H3O4− |
| Mr | 666.66 |
| Crystal system, space group | Triclinic, P1 |
| Temperature (K) | 295 |
| a, b, c (Å) | 6.4175 (2), 9.6185 (4), 25.5771 (10) |
| α, β, γ (°) | 96.377 (4), 96.295 (3), 92.774 (3) |
| V (Å3) | 1556.63 (10) |
| Z | 2 |
| Radiation type | Cu Kα |
| µ (mm−1) | 1.59 |
| Crystal size (mm) | 0.53 × 0.17 × 0.12 |
| Data collection | |
| Diffractometer | Oxford Diffraction Xcalibur Ruby Gemini diffractometer |
| Absorption correction | Multi-scan (CrysAlis PRO; Oxford Diffraction, 2007) |
| Tmin, Tmax | 0.643, 1.000 |
| No. of measured, independent and observed [i > 2σ(i)] reflections | 11625, 11625, 9926 |
| Rint | 0.000 |
| (sin θ/λ)max (Å−1) | 0.628 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.055, 0.162, 1.03 |
| No. of reflections | 11625 |
| No. of parameters | 430 |
| No. of restraints | 12 |
| H-atom treatment | H-atom parameters constrained |
| Δρmax, Δρmin (e Å−3) | 0.47, −0.27 |
Computer programs: CrysAlis PRO (Oxford Diffraction, 2007), CrysAlis RED (Oxford Diffraction, 2007), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), ORTEP-3 for Windows (Farrugia, 1997), WinGX (Farrugia, 1999) and PLATON (Spek, 2009).
| D—H···A | D—H | H···A | D···A | D—H···A |
| O1—H1···O1Bi | 0.82 | 2.05 | 2.8365 (16) | 162 |
| N1—H1A···O1A | 0.91 | 1.81 | 2.7055 (15) | 168 |
| N1—H1A···O2A | 0.91 | 2.57 | 3.2580 (15) | 133 |
| N2—H2A···O1Bi | 0.91 | 1.86 | 2.7572 (15) | 167 |
| N2—H2A···O2Bi | 0.91 | 2.52 | 3.2230 (15) | 134 |
| O4A—H4A···O2Aii | 0.82 | 1.73 | 2.5406 (16) | 167 |
| O4B—H4B···O2Bi | 0.82 | 1.74 | 2.5497 (16) | 168 |
| C2A—H2AA···O3A | 0.93 | 2.51 | 2.8251 (17) | 100 |
| C2B—H2BA···O3B | 0.93 | 2.50 | 2.8165 (17) | 100 |
| C16—H16B···O3Aiii | 0.97 | 2.56 | 3.2782 (19) | 131 |
| C17—H17B···O4Aiv | 0.97 | 2.59 | 3.4520 (19) | 148 |
| C19—H19A···O2A | 0.97 | 2.57 | 3.2871 (18) | 131 |
| C19—H19B···O1Ai | 0.97 | 2.41 | 3.2461 (17) | 144 |
| C20—H20A···O1v | 0.97 | 2.44 | 3.3877 (18) | 167 |
| C21—H21A···O1B | 0.97 | 2.41 | 3.2098 (16) | 140 |
| C21—H21B···O2Bi | 0.97 | 2.51 | 3.2367 (17) | 132 |
| C22—H22B···O3Bvi | 0.97 | 2.51 | 3.3848 (18) | 150 |
| C22—H22B···O4Bvi | 0.97 | 2.55 | 3.4236 (18) | 150 |
| Symmetry codes: (i) x+1, y, z; (ii) x−1, y, z; (iii) x, y+1, z; (iv) x+1, y+1, z; (v) −x+2, −y+1, −z+2; (vi) x, y−1, z. |
Acknowledgements
MSS thanks the University of Mysore for the research facilities. RJB wishes to acknowledge the NSF–MRI program (grant CHE-0619278) for funds to purchase the diffractometer.
References
Cremer, D. & Pople, J. A. (1975). J. Am. Chem. Soc. 97, 1354–1358. CrossRef CAS Web of Science Google Scholar
Farrugia, L. J. (1997). J. Appl. Cryst. 30, 565. CrossRef IUCr Journals Google Scholar
Farrugia, L. J. (1999). J. Appl. Cryst. 32, 837–838. CrossRef CAS IUCr Journals Google Scholar
Jones, P. G., Kennard, O. & Horn, A. S. (1977). Acta Cryst. B33, 3744–3747. CSD CrossRef CAS IUCr Journals Web of Science Google Scholar
Oxford Diffraction (2007). CrysAlis PRO and CrysAlis RED. Oxford Diffraction Ltd, Abingdon, England. Google Scholar
Post, M. L., Kennard, O. & Horn, A. S. (1975a). Acta Cryst. B31, 2724–2726. CSD CrossRef CAS IUCr Journals Web of Science Google Scholar
Post, M. L., Kennard, O., Sheldrick, G. M. & Horn, A. S. (1975b). Acta Cryst. B31, 2366–2368. CSD CrossRef CAS IUCr Journals Web of Science Google Scholar
Robertson, M. M. & Trimble, M. R. (1981). Practitioner, 225, 761–763. CAS PubMed Web of Science Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Spek, A. L. (2009). Acta Cryst. D65, 148–155. Web of Science CrossRef CAS IUCr Journals Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
![[P \overline 1] Mathematical equation](teximages/tk2763fi1.gif)
![[Figure 1]](./tk2763fig1thm.gif)
![[Figure 2]](./tk2763fig2thm.gif)




Flupentixol (systematic IUPAC name: 2-[4-[3-[(EZ)-2-(trifluoromethyl)-9H-thioxanthen-9-ylidene] propyl]piperazin-1-yl]ethanol is a typical antipsychotic drug of the thioxanthene class. In addition to pure drug preparations, it is also available as deanxit, a combination product containing both melitracen and flupentixol.The antidepressant action of flupentixol has been described (Robertson & Trimble, 1981). The crystal structures of α-flupenthixol (Post et al., 1975b), β-flupenthixol (Post et al., 1975a) and piflutixol (Jones et al., 1977) have been reported. In view of the importance of flupentixol, this paper reports the crystal structure of the title salt, (I), C23H27F3N2+OS2.2[C4H3O4-], formed by the reaction of flupentixol and fumaric acid.
The crystal studied was a non-merohedral twin, the ratio of the twin components being 0.402 (1): 0.598 (1). In (I), Fig. 1, the thiopyran ring of the 9H-thioxanthene ring system (S1/C1/C2/C7C9/C14) has a screw-boat conformation: the puckering parameters (Cremer & Pople, 1975) of QT = 0.5118 (15) Å, θ = 87.53 (19)° and ϕ = 3.2 (2) °. The dihedral angle between the two outer aromatic rings of the 9H-thioxanthene unit is 33.01 (9) °. The diprotonated piperazine ring (N1/N2/C18–C21) adopts a chair conformation with puckering parameters QT = 0.580 (13) Å, θ = 178.76 (12) ° and ϕ = 177 (7) °.
In the crystal structure, intermolecular O—H···O, N—H···O and C—H···O hydrogen bonds (Table 1) contributes to crystal packing forming the zigzag chains parallel to the [100] direction (Fig. 2).