metal-organic compounds
{μ-1,2-Bis[bis(4-methoxyphenyl)phosphanyl]-1,2-diethylhydrazine-κ2P:P′}bis[chloridogold(I)] tetrahydrofuran disolvate
aAuTEK, Mintek, Private Bag X3015, Randburg, 2125, South Africa, and bMolecular Science Institute, School of Chemistry, University of the Witwatersrand, PO Wits, 2050, Johannesburg, South Africa
*Correspondence e-mail: [email protected]
The title compound, [Au2Cl2(C32H38N2O4P2)]·2C4H8O, is formed from a bidentate phosphine ligand complexed to two linear gold(I) nuclei [P—Au—Cl = 175.98 (3)°]. The nuclei are 3.1414 (2) Å apart. The molecule exhibits a twofold symmetry axis. Stacks of the compound are formed through intermolecular C—H⋯Cl interactions, while the tetrahydrofuran (THF) solvate is further attached to the stacks through weak C—H⋯O hydrogen bonding from the THF O atom to two separate H atoms on the complex.
Related literature
For the synthesis of the parent ligand and related structures utilizing alternative metals see: Reddy et al. (1994
, 1995
); Slawin et al. (2002
); Kriel et al. (2011a
,b
,c
). For Au⋯Au interactions, see: Holleman & Wiberg (2001
). For the biological activity of the title complex, see: Fonteh & Meyer (2009
).
Experimental
Crystal data
|
Refinement
|
| |||||||||||||||||||||||||||
Data collection: APEX2 (Bruker, 1999
); cell refinement: SAINT-Plus (Bruker, 1999
); data reduction: SAINT-Plus; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: Mercury (Macrae et al., 2006
); software used to prepare material for publication: WinGX (Farrugia, 1999
).
Supporting information
contains datablocks I, New_Global_Publ_Block. DOI: https://doi.org/10.1107/S1600536811038499/bh2379sup1.cif
Structure factors: contains datablock I. DOI: https://doi.org/10.1107/S1600536811038499/bh2379Isup2.hkl
The complex was synthesized by dissolving tetrahydrothiophenegold(I) chloride [(THT)AuCl] in DCM and adding 0.5 equivalents of the corresponding ligand, bis(di(4-methoxyphenyl)phosphino)-1,2-diethylhydrazine. The addition of a few drops of THF led to the growth of crystals suitable for use in single-crystal X-Ray analysis. The presence of THF during the initial complexation led to undesirable side products as a result of the breakdown of the ligand.
The H atoms were positioned geometrically and allowed to ride on their respective parent atoms, with C—H = 0.95 (aromatic CH), 0.99 (CH2) or 0.98 (CH3) Å, and with Ueq = 1.2 (CH, CH2) or 1.5 (CH3) times Ueq(C).
The title compound, C32H38Au2Cl2N2O4P2.2(C4H8O), formed from a bidentate phosphine ligand complexed to two linear gold(I) nuclei, readily crystallizes out of dichloromethane (DCM) with the addition of a few drops of tetrahydrofuran (THF). The includes two THF solvent molecules. The complex molecule is bisected by a twofold axis through the N—N' and Au—Au' lines (Fig. 1). Gold(I) has an almost linear coordination with a P—Au—Cl angle of 175.98 (3)°. The Au—Au distance within the complex is 3.141 (2) Å, well within the range of aurophilic interactions (described in Holleman & Wiberg, 2001, as being normally between 2.7 Å and 3.4 Å). Other bond lengths are within expected ranges.
The structure exhibits columns of complexes arranged head-to-tail along b, forming channels filled with THF. There is an intracolumnar contact involving Cl atoms in one molecule and H atoms on the ethyl substituted hydrazine bridge of a neighboring one, in the same column (Cl···H1Ai: 2.80 Å, (i): 2-x, -1+y, 3/2-z; site A in Fig. 2). There are also weak intercolumnar H-bonding contacts (O1···H13ii: 2.61 Å, (ii): 3/2-x, 1/2-y, 1-z; site B in Fig. 2). Finally, the THF solvate molecule is weakly attached to the columns by a pair of O···H contacts (O3···H15 = 2.63 Å, O3···H17B = 2.53 Å; site C in Fig. 2).
The biological activity of the title complex is discussed in Fonteh & Meyer (2009), and related structures with other dialkyl hydrazine derivatives have been also reported (Kriel et al., 2011a,b,c; Reddy et al., 1994, 1995; Slawin et al., 2002).
For the synthesis of the parent ligand and related structures utilizing alternative metals see: Reddy et al. (1994, 1995); Slawin et al. (2002); Kriel et al. (2011a,b,c). For Au···Au interactions, see: Holleman & Wiberg (2001). For the biological activity of the title complex, see: Fonteh & Meyer (2009).
Data collection: APEX2 (Bruker, 1999); cell SAINT-Plus (Bruker, 1999); data reduction: SAINT-Plus (Bruker, 1999); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: Mercury (Macrae et al., 2006); software used to prepare material for publication: WinGX (Farrugia, 1999).
| [Au2Cl2(C32H38N2O4P2)]·2C4H8O | F(000) = 2312 |
| Mr = 1185.63 | Dx = 1.809 Mg m−3 |
| Monoclinic, C2/c | Melting point: 369 K |
| Hall symbol: -C 2yc | Mo Kα radiation, λ = 0.71073 Å |
| a = 23.6375 (4) Å | Cell parameters from 7364 reflections |
| b = 9.1260 (1) Å | θ = 2.4–34.2° |
| c = 20.2269 (3) Å | µ = 6.98 mm−1 |
| β = 93.976 (1)° | T = 173 K |
| V = 4352.76 (11) Å3 | Plate, colourless |
| Z = 4 | 0.36 × 0.20 × 0.07 mm |
| Bruker APEXII CCD diffractometer | 5253 independent reflections |
| Radiation source: fine-focus sealed tube | 4694 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.046 |
| φ and ω scans | θmax = 28.0°, θmin = 1.7° |
| Absorption correction: integration (SADABS; Bruker, 1999) | h = −31→31 |
| Tmin = 0.188, Tmax = 0.641 | k = −12→12 |
| 38471 measured reflections | l = −26→26 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.022 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.059 | H-atom parameters constrained |
| S = 1.05 | w = 1/[σ2(Fo2) + (0.0337P)2 + 7.339P] where P = (Fo2 + 2Fc2)/3 |
| 5253 reflections | (Δ/σ)max = 0.011 |
| 244 parameters | Δρmax = 1.74 e Å−3 |
| 0 restraints | Δρmin = −0.64 e Å−3 |
| 0 constraints |
| [Au2Cl2(C32H38N2O4P2)]·2C4H8O | V = 4352.76 (11) Å3 |
| Mr = 1185.63 | Z = 4 |
| Monoclinic, C2/c | Mo Kα radiation |
| a = 23.6375 (4) Å | µ = 6.98 mm−1 |
| b = 9.1260 (1) Å | T = 173 K |
| c = 20.2269 (3) Å | 0.36 × 0.20 × 0.07 mm |
| β = 93.976 (1)° |
| Bruker APEXII CCD diffractometer | 5253 independent reflections |
| Absorption correction: integration (SADABS; Bruker, 1999) | 4694 reflections with I > 2σ(I) |
| Tmin = 0.188, Tmax = 0.641 | Rint = 0.046 |
| 38471 measured reflections |
| R[F2 > 2σ(F2)] = 0.022 | 0 restraints |
| wR(F2) = 0.059 | H-atom parameters constrained |
| S = 1.05 | Δρmax = 1.74 e Å−3 |
| 5253 reflections | Δρmin = −0.64 e Å−3 |
| 244 parameters |
| x | y | z | Uiso*/Ueq | ||
| C1 | 0.93455 (12) | 0.1681 (3) | 0.72815 (16) | 0.0287 (6) | |
| H1A | 0.9526 | 0.0814 | 0.7502 | 0.034* | |
| H1B | 0.9217 | 0.1393 | 0.6824 | 0.034* | |
| C2 | 0.88305 (13) | 0.2110 (4) | 0.76481 (18) | 0.0385 (8) | |
| H2A | 0.8564 | 0.1286 | 0.7643 | 0.058* | |
| H2B | 0.8644 | 0.2958 | 0.7430 | 0.058* | |
| H2C | 0.8951 | 0.2362 | 0.8107 | 0.058* | |
| C11 | 0.91251 (13) | 0.4084 (3) | 0.62384 (15) | 0.0247 (6) | |
| C12 | 0.88945 (13) | 0.3154 (4) | 0.57400 (16) | 0.0335 (7) | |
| H12 | 0.9132 | 0.2472 | 0.5537 | 0.040* | |
| C13 | 0.83239 (14) | 0.3221 (4) | 0.55403 (18) | 0.0415 (8) | |
| H13 | 0.8171 | 0.2584 | 0.5202 | 0.050* | |
| C14 | 0.79741 (14) | 0.4216 (4) | 0.58318 (18) | 0.0365 (7) | |
| C15 | 0.81971 (14) | 0.5188 (4) | 0.63099 (16) | 0.0336 (7) | |
| H15 | 0.7962 | 0.5902 | 0.6496 | 0.040* | |
| C16 | 0.87698 (13) | 0.5096 (3) | 0.65111 (15) | 0.0287 (6) | |
| H16 | 0.8923 | 0.5745 | 0.6845 | 0.034* | |
| C17 | 0.70206 (17) | 0.4959 (6) | 0.5975 (3) | 0.0676 (14) | |
| H17A | 0.6636 | 0.4817 | 0.5772 | 0.101* | |
| H17B | 0.7118 | 0.6003 | 0.5966 | 0.101* | |
| H17C | 0.7038 | 0.4617 | 0.6435 | 0.101* | |
| C21 | 1.01949 (12) | 0.2838 (3) | 0.59644 (14) | 0.0245 (6) | |
| C22 | 1.02334 (13) | 0.1309 (3) | 0.59963 (15) | 0.0268 (6) | |
| H22 | 1.0068 | 0.0799 | 0.6344 | 0.032* | |
| C23 | 1.05087 (13) | 0.0534 (3) | 0.55277 (16) | 0.0288 (6) | |
| H23 | 1.0540 | −0.0502 | 0.5560 | 0.035* | |
| C24 | 1.07393 (13) | 0.1270 (4) | 0.50081 (16) | 0.0294 (6) | |
| C25 | 1.07051 (14) | 0.2790 (4) | 0.49653 (16) | 0.0341 (7) | |
| H25 | 1.0862 | 0.3294 | 0.4610 | 0.041* | |
| C26 | 1.04377 (13) | 0.3562 (3) | 0.54489 (16) | 0.0295 (6) | |
| H26 | 1.0421 | 0.4601 | 0.5427 | 0.035* | |
| C27 | 1.1244 (3) | 0.1104 (5) | 0.4032 (3) | 0.0730 (17) | |
| H27A | 1.1420 | 0.0368 | 0.3759 | 0.109* | |
| H27B | 1.1533 | 0.1806 | 0.4201 | 0.109* | |
| H27C | 1.0947 | 0.1623 | 0.3763 | 0.109* | |
| C44 | 0.7033 (5) | −0.0784 (7) | 0.5960 (4) | 0.128 (4) | |
| H44A | 0.7209 | −0.0644 | 0.5534 | 0.154* | |
| H44B | 0.6678 | −0.1352 | 0.5877 | 0.154* | |
| O3 | 0.74324 (16) | −0.1558 (4) | 0.6450 (2) | 0.0791 (10) | |
| C41 | 0.75325 (17) | −0.0776 (5) | 0.7055 (2) | 0.0461 (9) | |
| H41A | 0.7941 | −0.0731 | 0.7198 | 0.055* | |
| H41B | 0.7321 | −0.1202 | 0.7415 | 0.055* | |
| C42 | 0.7289 (4) | 0.0785 (8) | 0.6826 (4) | 0.115 (3) | |
| H42A | 0.7078 | 0.1229 | 0.7183 | 0.138* | |
| H42B | 0.7603 | 0.1450 | 0.6729 | 0.138* | |
| N | 0.97751 (9) | 0.2854 (3) | 0.72518 (11) | 0.0227 (5) | |
| P | 0.98471 (3) | 0.38920 (7) | 0.65760 (4) | 0.02138 (14) | |
| Cl | 1.08170 (4) | 0.80680 (9) | 0.70523 (5) | 0.0473 (2) | |
| Au | 1.029954 (5) | 0.597871 (11) | 0.683068 (5) | 0.02524 (5) | |
| O1 | 0.74131 (11) | 0.4147 (3) | 0.56141 (16) | 0.0535 (8) | |
| O2 | 1.10005 (11) | 0.0398 (3) | 0.45758 (13) | 0.0411 (6) | |
| C43 | 0.6922 (5) | 0.0576 (11) | 0.6251 (5) | 0.165 (5) | |
| H43A | 0.6523 | 0.0608 | 0.6370 | 0.198* | |
| H43B | 0.6979 | 0.1374 | 0.5930 | 0.198* |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| C1 | 0.0257 (14) | 0.0246 (14) | 0.0351 (16) | −0.0070 (11) | −0.0025 (12) | 0.0033 (12) |
| C2 | 0.0240 (14) | 0.0454 (19) | 0.0458 (19) | −0.0060 (14) | 0.0009 (13) | 0.0105 (16) |
| C11 | 0.0255 (13) | 0.0239 (14) | 0.0241 (13) | 0.0025 (11) | −0.0019 (11) | 0.0018 (11) |
| C12 | 0.0314 (15) | 0.0355 (17) | 0.0331 (16) | 0.0056 (13) | −0.0025 (13) | −0.0108 (14) |
| C13 | 0.0344 (17) | 0.047 (2) | 0.0407 (19) | 0.0064 (15) | −0.0116 (14) | −0.0181 (16) |
| C14 | 0.0280 (15) | 0.0442 (19) | 0.0360 (18) | 0.0052 (14) | −0.0073 (13) | −0.0009 (14) |
| C15 | 0.0317 (16) | 0.0338 (17) | 0.0350 (16) | 0.0087 (13) | −0.0009 (13) | −0.0030 (14) |
| C16 | 0.0304 (15) | 0.0286 (15) | 0.0262 (14) | 0.0046 (12) | −0.0028 (12) | −0.0043 (12) |
| C17 | 0.0301 (19) | 0.080 (3) | 0.091 (4) | 0.018 (2) | −0.009 (2) | −0.020 (3) |
| C21 | 0.0239 (13) | 0.0236 (14) | 0.0256 (14) | 0.0011 (11) | −0.0011 (11) | −0.0025 (11) |
| C22 | 0.0289 (15) | 0.0243 (14) | 0.0273 (15) | −0.0001 (11) | 0.0017 (12) | 0.0004 (11) |
| C23 | 0.0283 (15) | 0.0234 (14) | 0.0344 (16) | 0.0030 (12) | −0.0003 (12) | −0.0045 (12) |
| C24 | 0.0251 (14) | 0.0310 (15) | 0.0324 (16) | 0.0009 (12) | 0.0033 (12) | −0.0081 (13) |
| C25 | 0.0397 (17) | 0.0331 (17) | 0.0304 (16) | −0.0013 (14) | 0.0099 (13) | −0.0006 (13) |
| C26 | 0.0338 (16) | 0.0249 (14) | 0.0301 (16) | 0.0027 (12) | 0.0051 (13) | 0.0019 (12) |
| C27 | 0.097 (4) | 0.057 (3) | 0.073 (3) | −0.025 (3) | 0.058 (3) | −0.029 (2) |
| C44 | 0.237 (11) | 0.060 (4) | 0.077 (4) | 0.002 (5) | −0.059 (6) | 0.001 (3) |
| O3 | 0.071 (2) | 0.072 (2) | 0.094 (3) | 0.0068 (19) | −0.001 (2) | −0.015 (2) |
| C41 | 0.0394 (19) | 0.057 (2) | 0.042 (2) | −0.0079 (17) | 0.0039 (16) | −0.0123 (18) |
| C42 | 0.172 (9) | 0.085 (5) | 0.087 (5) | 0.024 (5) | 0.011 (5) | −0.013 (4) |
| N | 0.0215 (11) | 0.0234 (11) | 0.0228 (11) | −0.0029 (9) | −0.0022 (9) | 0.0016 (9) |
| P | 0.0227 (3) | 0.0190 (3) | 0.0222 (3) | 0.0010 (3) | 0.0003 (3) | −0.0005 (3) |
| Cl | 0.0596 (6) | 0.0271 (4) | 0.0557 (5) | −0.0170 (4) | 0.0083 (4) | −0.0046 (4) |
| Au | 0.03037 (7) | 0.01883 (7) | 0.02676 (7) | −0.00279 (4) | 0.00365 (4) | 0.00018 (4) |
| O1 | 0.0284 (12) | 0.069 (2) | 0.0603 (18) | 0.0115 (12) | −0.0135 (12) | −0.0204 (14) |
| O2 | 0.0434 (14) | 0.0348 (13) | 0.0473 (14) | −0.0030 (11) | 0.0187 (11) | −0.0139 (11) |
| C43 | 0.239 (12) | 0.156 (8) | 0.101 (6) | 0.127 (9) | 0.019 (7) | 0.032 (6) |
| C1—N | 1.480 (4) | C23—H23 | 0.9500 |
| C1—C2 | 1.520 (5) | C24—O2 | 1.362 (4) |
| C1—H1A | 0.9900 | C24—C25 | 1.392 (5) |
| C1—H1B | 0.9900 | C25—C26 | 1.393 (4) |
| C2—H2A | 0.9800 | C25—H25 | 0.9500 |
| C2—H2B | 0.9800 | C26—H26 | 0.9500 |
| C2—H2C | 0.9800 | C27—O2 | 1.430 (5) |
| C11—C16 | 1.389 (4) | C27—H27A | 0.9800 |
| C11—C12 | 1.399 (4) | C27—H27B | 0.9800 |
| C11—P | 1.802 (3) | C27—H27C | 0.9800 |
| C12—C13 | 1.382 (4) | C44—C43 | 1.406 (10) |
| C12—H12 | 0.9500 | C44—O3 | 1.498 (8) |
| C13—C14 | 1.387 (5) | C44—H44A | 0.9900 |
| C13—H13 | 0.9500 | C44—H44B | 0.9900 |
| C14—O1 | 1.369 (4) | O3—C41 | 1.423 (5) |
| C14—C15 | 1.389 (5) | C41—C42 | 1.594 (8) |
| C15—C16 | 1.389 (4) | C41—H41A | 0.9900 |
| C15—H15 | 0.9500 | C41—H41B | 0.9900 |
| C16—H16 | 0.9500 | C42—C43 | 1.415 (12) |
| C17—O1 | 1.427 (5) | C42—H42A | 0.9900 |
| C17—H17A | 0.9800 | C42—H42B | 0.9900 |
| C17—H17B | 0.9800 | N—Ni | 1.411 (4) |
| C17—H17C | 0.9800 | N—P | 1.681 (2) |
| C21—C26 | 1.392 (4) | P—Au | 2.2269 (7) |
| C21—C22 | 1.400 (4) | Cl—Au | 2.2927 (8) |
| C21—P | 1.809 (3) | Au—Aui | 3.1414 (2) |
| C22—C23 | 1.381 (4) | C43—H43A | 0.9900 |
| C22—H22 | 0.9500 | C43—H43B | 0.9900 |
| C23—C24 | 1.390 (5) | ||
| N—C1—C2 | 114.1 (3) | C26—C25—H25 | 120.4 |
| N—C1—H1A | 108.7 | C21—C26—C25 | 121.1 (3) |
| C2—C1—H1A | 108.7 | C21—C26—H26 | 119.4 |
| N—C1—H1B | 108.7 | C25—C26—H26 | 119.4 |
| C2—C1—H1B | 108.7 | O2—C27—H27A | 109.5 |
| H1A—C1—H1B | 107.6 | O2—C27—H27B | 109.5 |
| C1—C2—H2A | 109.5 | H27A—C27—H27B | 109.5 |
| C1—C2—H2B | 109.5 | O2—C27—H27C | 109.5 |
| H2A—C2—H2B | 109.5 | H27A—C27—H27C | 109.5 |
| C1—C2—H2C | 109.5 | H27B—C27—H27C | 109.5 |
| H2A—C2—H2C | 109.5 | C43—C44—O3 | 105.4 (6) |
| H2B—C2—H2C | 109.5 | C43—C44—H44A | 110.7 |
| C16—C11—C12 | 118.3 (3) | O3—C44—H44A | 110.7 |
| C16—C11—P | 119.8 (2) | C43—C44—H44B | 110.7 |
| C12—C11—P | 121.7 (2) | O3—C44—H44B | 110.7 |
| C13—C12—C11 | 120.5 (3) | H44A—C44—H44B | 108.8 |
| C13—C12—H12 | 119.8 | C41—O3—C44 | 113.2 (4) |
| C11—C12—H12 | 119.8 | O3—C41—C42 | 99.3 (4) |
| C12—C13—C14 | 120.2 (3) | O3—C41—H41A | 111.9 |
| C12—C13—H13 | 119.9 | C42—C41—H41A | 111.9 |
| C14—C13—H13 | 119.9 | O3—C41—H41B | 111.9 |
| O1—C14—C13 | 115.2 (3) | C42—C41—H41B | 111.9 |
| O1—C14—C15 | 124.4 (3) | H41A—C41—H41B | 109.6 |
| C13—C14—C15 | 120.4 (3) | C43—C42—C41 | 107.9 (6) |
| C16—C15—C14 | 118.7 (3) | C43—C42—H42A | 110.1 |
| C16—C15—H15 | 120.6 | C41—C42—H42A | 110.1 |
| C14—C15—H15 | 120.6 | C43—C42—H42B | 110.1 |
| C11—C16—C15 | 121.9 (3) | C41—C42—H42B | 110.1 |
| C11—C16—H16 | 119.1 | H42A—C42—H42B | 108.4 |
| C15—C16—H16 | 119.1 | Ni—N—C1 | 117.2 (2) |
| O1—C17—H17A | 109.5 | Ni—N—P | 117.71 (19) |
| O1—C17—H17B | 109.5 | C1—N—P | 123.29 (19) |
| H17A—C17—H17B | 109.5 | N—P—C11 | 102.49 (13) |
| O1—C17—H17C | 109.5 | N—P—C21 | 109.45 (13) |
| H17A—C17—H17C | 109.5 | C11—P—C21 | 104.82 (13) |
| H17B—C17—H17C | 109.5 | N—P—Au | 111.57 (9) |
| C26—C21—C22 | 118.6 (3) | C11—P—Au | 115.57 (9) |
| C26—C21—P | 119.4 (2) | C21—P—Au | 112.28 (10) |
| C22—C21—P | 122.0 (2) | P—Au—Cl | 175.98 (3) |
| C23—C22—C21 | 120.8 (3) | P—Au—Aui | 87.787 (19) |
| C23—C22—H22 | 119.6 | Cl—Au—Aui | 95.61 (3) |
| C21—C22—H22 | 119.6 | C14—O1—C17 | 117.4 (3) |
| C22—C23—C24 | 119.9 (3) | C24—O2—C27 | 117.1 (3) |
| C22—C23—H23 | 120.0 | C44—C43—C42 | 110.0 (7) |
| C24—C23—H23 | 120.0 | C44—C43—H43A | 109.7 |
| O2—C24—C23 | 114.9 (3) | C42—C43—H43A | 109.7 |
| O2—C24—C25 | 124.7 (3) | C44—C43—H43B | 109.7 |
| C23—C24—C25 | 120.3 (3) | C42—C43—H43B | 109.7 |
| C24—C25—C26 | 119.2 (3) | H43A—C43—H43B | 108.2 |
| C24—C25—H25 | 120.4 | ||
| C16—C11—C12—C13 | −1.8 (5) | Ni—N—P—C11 | −160.78 (18) |
| P—C11—C12—C13 | 173.0 (3) | C1—N—P—C11 | 35.1 (3) |
| C11—C12—C13—C14 | 0.2 (6) | Ni—N—P—C21 | 88.37 (19) |
| C12—C13—C14—O1 | −177.5 (4) | C1—N—P—C21 | −75.8 (2) |
| C12—C13—C14—C15 | 2.3 (6) | Ni—N—P—Au | −36.5 (2) |
| O1—C14—C15—C16 | 176.8 (3) | C1—N—P—Au | 159.4 (2) |
| C13—C14—C15—C16 | −3.0 (5) | C16—C11—P—N | 79.6 (3) |
| C12—C11—C16—C15 | 1.1 (5) | C12—C11—P—N | −95.1 (3) |
| P—C11—C16—C15 | −173.8 (3) | C16—C11—P—C21 | −166.2 (2) |
| C14—C15—C16—C11 | 1.3 (5) | C12—C11—P—C21 | 19.2 (3) |
| C26—C21—C22—C23 | 0.3 (5) | C16—C11—P—Au | −42.0 (3) |
| P—C21—C22—C23 | −179.1 (2) | C12—C11—P—Au | 143.3 (2) |
| C21—C22—C23—C24 | −1.5 (5) | C26—C21—P—N | −162.5 (2) |
| C22—C23—C24—O2 | 180.0 (3) | C22—C21—P—N | 16.8 (3) |
| C22—C23—C24—C25 | 1.4 (5) | C26—C21—P—C11 | 88.2 (3) |
| O2—C24—C25—C26 | −178.4 (3) | C22—C21—P—C11 | −92.5 (3) |
| C23—C24—C25—C26 | 0.0 (5) | C26—C21—P—Au | −38.0 (3) |
| C22—C21—C26—C25 | 1.2 (5) | C22—C21—P—Au | 141.3 (2) |
| P—C21—C26—C25 | −179.5 (2) | C13—C14—O1—C17 | 169.4 (4) |
| C24—C25—C26—C21 | −1.3 (5) | C15—C14—O1—C17 | −10.4 (6) |
| C43—C44—O3—C41 | 5.1 (10) | C23—C24—O2—C27 | 179.9 (4) |
| C44—O3—C41—C42 | −14.9 (7) | C25—C24—O2—C27 | −1.5 (6) |
| O3—C41—C42—C43 | 20.2 (8) | O3—C44—C43—C42 | 9.3 (13) |
| C2—C1—N—Ni | 93.9 (3) | C41—C42—C43—C44 | −18.8 (12) |
| C2—C1—N—P | −101.9 (3) |
| Symmetry code: (i) −x+2, y, −z+3/2. |
| D—H···A | D—H | H···A | D···A | D—H···A |
| C1—H1A···Clii | 0.99 | 2.80 | 3.592 (3) | 137 |
| C13—H13···O1iii | 0.95 | 2.61 | 3.549 (4) | 170 |
| C15—H15···O3iv | 0.95 | 2.63 | 3.497 (5) | 152 |
| C17—H17B···O3iv | 0.98 | 2.53 | 3.444 (7) | 156 |
| Symmetry codes: (ii) −x+2, y−1, −z+3/2; (iii) −x+3/2, −y+1/2, −z+1; (iv) x, y+1, z. |
Experimental details
| Crystal data | |
| Chemical formula | [Au2Cl2(C32H38N2O4P2)]·2C4H8O |
| Mr | 1185.63 |
| Crystal system, space group | Monoclinic, C2/c |
| Temperature (K) | 173 |
| a, b, c (Å) | 23.6375 (4), 9.1260 (1), 20.2269 (3) |
| β (°) | 93.976 (1) |
| V (Å3) | 4352.76 (11) |
| Z | 4 |
| Radiation type | Mo Kα |
| µ (mm−1) | 6.98 |
| Crystal size (mm) | 0.36 × 0.20 × 0.07 |
| Data collection | |
| Diffractometer | Bruker APEXII CCD |
| Absorption correction | Integration (SADABS; Bruker, 1999) |
| Tmin, Tmax | 0.188, 0.641 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 38471, 5253, 4694 |
| Rint | 0.046 |
| (sin θ/λ)max (Å−1) | 0.661 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.022, 0.059, 1.05 |
| No. of reflections | 5253 |
| No. of parameters | 244 |
| H-atom treatment | H-atom parameters constrained |
| Δρmax, Δρmin (e Å−3) | 1.74, −0.64 |
Computer programs: APEX2 (Bruker, 1999), SAINT-Plus (Bruker, 1999), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), Mercury (Macrae et al., 2006), WinGX (Farrugia, 1999).
| D—H···A | D—H | H···A | D···A | D—H···A |
| C1—H1A···Cli | 0.99 | 2.80 | 3.592 (3) | 137.2 |
| C15—H15···O3ii | 0.95 | 2.63 | 3.497 (5) | 151.6 |
| C17—H17B···O3ii | 0.98 | 2.53 | 3.444 (7) | 155.7 |
| Symmetry codes: (i) −x+2, y−1, −z+3/2; (ii) x, y+1, z. |
Acknowledgements
The authors would like to thank Project AuTEK (Mintek and Harmony) for financial support and the University of the Witwatersrand for the use of their facilities.
References
Bruker (1999). APEX2, SAINT-Plus and SADABS. Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
Farrugia, L. J. (1999). J. Appl. Cryst. 32, 837–838. CrossRef CAS IUCr Journals Google Scholar
Fonteh, P. & Meyer, D. (2009). Metallomics, 1, 427–433. Web of Science CrossRef CAS PubMed Google Scholar
Holleman, A. F. & Wiberg, E. (2001). Inorganic Chemistry, p. 1248. San-Diego: Academic Press. Google Scholar
Kriel, F. H., Fernandes, M. A. & Coates, J. (2011a). Acta Cryst. E67, m42. Web of Science CSD CrossRef IUCr Journals Google Scholar
Kriel, F. H., Fernandes, M. A. & Coates, J. (2011b). Acta Cryst. E67, m155. Web of Science CSD CrossRef IUCr Journals Google Scholar
Kriel, F. H., Fernandes, M. A. & Coates, J. (2011c). Acta Cryst. E67, m1163. Web of Science CSD CrossRef IUCr Journals Google Scholar
Macrae, C. F., Edgington, P. R., McCabe, P., Pidcock, E., Shields, G. P., Taylor, R., Towler, M. & van de Streek, J. (2006). J. Appl. Cryst. 39, 453–457. Web of Science CSD CrossRef CAS IUCr Journals Google Scholar
Reddy, V. S., Katti, K. V. & Barnes, C. L. (1994). Chem. Ber. 127, 1355–1357. CrossRef CAS Google Scholar
Reddy, V. S., Katti, K. V. & Barnes, C. L. (1995). Inorg. Chem. 34, 5483–5488. CrossRef CAS Web of Science Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Slawin, A. M. Z., Wainwright, M. & Woollins, J. D. (2002). J. Chem. Soc. Dalton Trans. pp. 513–519. Web of Science CSD CrossRef Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
; (ii) ![[Figure 1]](./bh2379fig1thm.gif)
![[Figure 2]](./bh2379fig2thm.gif)




The title compound, C32H38Au2Cl2N2O4P2.2(C4H8O), formed from a bidentate phosphine ligand complexed to two linear gold(I) nuclei, readily crystallizes out of dichloromethane (DCM) with the addition of a few drops of tetrahydrofuran (THF). The crystal structure includes two THF solvent molecules. The complex molecule is bisected by a twofold axis through the N—N' and Au—Au' lines (Fig. 1). Gold(I) has an almost linear coordination with a P—Au—Cl angle of 175.98 (3)°. The Au—Au distance within the complex is 3.141 (2) Å, well within the range of aurophilic interactions (described in Holleman & Wiberg, 2001, as being normally between 2.7 Å and 3.4 Å). Other bond lengths are within expected ranges.
The structure exhibits columns of complexes arranged head-to-tail along b, forming channels filled with THF. There is an intracolumnar contact involving Cl atoms in one molecule and H atoms on the ethyl substituted hydrazine bridge of a neighboring one, in the same column (Cl···H1Ai: 2.80 Å, (i): 2-x, -1+y, 3/2-z; site A in Fig. 2). There are also weak intercolumnar H-bonding contacts (O1···H13ii: 2.61 Å, (ii): 3/2-x, 1/2-y, 1-z; site B in Fig. 2). Finally, the THF solvate molecule is weakly attached to the columns by a pair of O···H contacts (O3···H15 = 2.63 Å, O3···H17B = 2.53 Å; site C in Fig. 2).
The biological activity of the title complex is discussed in Fonteh & Meyer (2009), and related structures with other dialkyl hydrazine derivatives have been also reported (Kriel et al., 2011a,b,c; Reddy et al., 1994, 1995; Slawin et al., 2002).