organic compounds
4-[Bis(3-phenyl-1H-pyrazol-1-yl)methyl]benzene-1,2-diol
aInstitut für Anorganische Chemie, J. W. Goethe-Universität Frankfurt, Max-von-Laue-Strasse 7, 60438 Frankfurt/Main, Germany
*Correspondence e-mail: [email protected]
The title compound, C25H20N4O2, is a ditopic ortho-hydroquinone-based bis(pyrazol-1-yl)methane ligand. The dihedral angles between the planes of the pyrazole rings and their attached phenyl rings are 17.4 (3) and 5.9 (4)°. The pyrazole rings make a dihedral angle of 87.84 (16)°. One of the two hydroxy groups forms an intramolecular hydrogen bond to the other hydroxy group, whereas the second is involved in an intermolecular O—H⋯N hydrogen bond. As a result of these intermolecular hydrogen bonds, helical chains running along the b axis are formed.
Related literature
For the synthesis, structural characterization and coordination behavior of ditopic ortho-hydroquinone-based bis(pyrazol-1-yl)methane ligands, see: Blasberg et al. (2011
).
Experimental
Crystal data
|
Data collection
|
Refinement
|
| ||||||||||||||||||||||
Data collection: X-AREA (Stoe & Cie, 2001
); cell refinement: X-AREA; data reduction: X-AREA; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: XP (Sheldrick, 2008
); software used to prepare material for publication: SHELXL97 and PLATON (Spek, 2009
).
Supporting information
contains datablocks I, global. DOI: https://doi.org/10.1107/S1600536811037949/ez2261sup1.cif
Structure factors: contains datablock I. DOI: https://doi.org/10.1107/S1600536811037949/ez2261Isup2.hkl
Supporting information file. DOI: https://doi.org/10.1107/S1600536811037949/ez2261Isup3.cml
Neat 3-phenylpyrazole (2.00 g, 13.87 mmol) was added to NaH (0.33 g, 13.87 mmol) suspended in THF (60 ml) at r.t. After 30 min SOCl2 (0.50 ml, 0.83 g, 6.94 mmol) was added in one portion and the resulting mixture stirred at r.t. for 5 min. After 3,4-dihydroxybenzaldehyde (0.96 g, 6.94 mmol) and pyridine (5.60 ml, 4.78 g, 60.40 mmol) were added, the reaction mixture was kept at reflux temperature for 16 h. H2O (50 ml) was added and the aqueous phase extracted into CH2Cl2 (3×50 ml). The combined organic extracts were washed with brine, dried (MgSO4), filtered, and the filtrate was evaporated to dryness in vacuo. The crude product was purified by (silica gel; CHCl3/EtOAc 1:1) and all product-containing fractions were concentrated by rotary evaporation at 40°C to ca. half of the original volume. Upon cooling to r.t. colorless crystals of the title compound precipitated, which were isolated by filtration and washed with Et2O. Yield: 1.53 g (54%). Single crystals suitable for X-ray diffraction were obtained by repeatedly dissolving the compound in refluxing MeCN and letting the clear colorless solution cool to room temperature. After three cycles needles of sufficient size were obtained. R</f = 0.63 (silica gel, CHCl3/EtOAc 1:1). 1H NMR (400.1 MHz, d6-DMSO) δ = 6.48 (dd, 3JHH = 8.3, 4JHH = 2.0, 1 H; HQ—H6), 6.66 (d, 4JHH = 2.0, 1 H; HQ—H2), 6.76 (d, 3JHH = 8.3, 1 H; HQ—H5), 6.84 (d, 3JHH = 2.5, 2 H; pz-H4), 7.31 (m, 2 H; Ph—H4), 7.41 (m, 4 H; Ph—H3), 7.82 (m, 4 H; Ph—H2), 7.91 (s, 1H, CH), 7.94 (d, 3JHH = 2.5, 2 H; pz-H5), 9.15 (bs, 2 H; OH). 13C NMR (100.6 MHz, d6-DMSO) δ = 76.7 (Cpz2), 103.5 (pz-C4), 114.4 (HQ—C2), 115.5 (HQ—C5), 118.2 (HQ—C6), 125.3 (Ph—C2), 127.2 (HQ—C1), 127.8 (Ph—C4), 128.7 (Ph—C3), 131.9 (pz-C5), 132.8 (Ph—C1), 145.3, 146.1 (HQ—C3,4), 151.0 (pz-C3). ESI-MS: m/z (%) 263 (67) [M—Phpz]-, 408 (100) [M—H]-. Anal. Calcd (%) for C25H20N4O2 (408.45): C 73.51, H 4.94, N 13.72. Found: C 73.22, H 4.86, N 13.67.
All H atoms were geometrically positioned and refined using a riding model with fixed individual displacement parameters [U(H) = 1.2 Ueq(C) or U(H) = 1.5 Ueq(O, Cmethyl)] using a riding model with O—H = 0.84 Å, C—H(aromatic) = 0.95Å or C—H(methine) = 1.00 Å, respectively. The H—O—C—C torsions angles of the hydroxy groups were refined.
Very recently we have reported on the synthesis, structural characterization, and coordination behavior of ditopic ortho-hydroquinone-based bis(pyrazol-1-yl)methane ligands (Blasberg et al., 2011). In this report, we have already noted ortho-(OH)2C6H3-4-CH(3-Phpz)2, but metric parameters will be discussed here. The bis(pyrazol-1-yl)methane derivative (I) was prepared in a three-step one-pot procedure as shown in Fig. 1.
The dihedral angles between the planes of the pyrazol rings and the attached phenyl rings are 20.9 (3)° and 5.9 (4)°. One of the two hydroxy groups forms an intramolecular hydrogen bond to the other hydroxy group, whereas the second one is involved in an intermolecular O—H···N hydrogen bond. As a result of these intermolecular hydrogen bonds, helical chains running along the b axis are formed.
For the synthesis, structural characterization and coordination behavior of ditopic ortho-hydroquinone-based bis(pyrazol-1-yl)methane ligands, see: Blasberg et al. (2011).
Data collection: X-AREA (Stoe & Cie, 2001); cell X-AREA (Stoe & Cie, 2001); data reduction: X-AREA (Stoe & Cie, 2001); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: XP (Sheldrick, 2008); software used to prepare material for publication: SHELXL97 (Sheldrick, 2008) and PLATON (Spek, 2009).
| C25H20N4O2 | F(000) = 856 |
| Mr = 408.45 | Dx = 1.383 Mg m−3 |
| Monoclinic, P21/n | Mo Kα radiation, λ = 0.71073 Å |
| Hall symbol: -P 2yn | Cell parameters from 2882 reflections |
| a = 13.493 (3) Å | θ = 3.7–25.8° |
| b = 5.6288 (11) Å | µ = 0.09 mm−1 |
| c = 26.309 (5) Å | T = 173 K |
| β = 100.87 (3)° | Needle, colourless |
| V = 1962.3 (7) Å3 | 0.40 × 0.15 × 0.10 mm |
| Z = 4 |
| Stoe IPDS II two-circle diffractometer | 1434 reflections with I > 2σ(I) |
| Radiation source: fine-focus sealed tube | Rint = 0.111 |
| Graphite monochromator | θmax = 25.0°, θmin = 3.7° |
| ω scans | h = −16→16 |
| 16343 measured reflections | k = −6→6 |
| 3450 independent reflections | l = −31→31 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.069 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.121 | H-atom parameters constrained |
| S = 0.82 | w = 1/[σ2(Fo2) + (0.003P)2] where P = (Fo2 + 2Fc2)/3 |
| 3450 reflections | (Δ/σ)max < 0.001 |
| 282 parameters | Δρmax = 0.22 e Å−3 |
| 0 restraints | Δρmin = −0.27 e Å−3 |
| C25H20N4O2 | V = 1962.3 (7) Å3 |
| Mr = 408.45 | Z = 4 |
| Monoclinic, P21/n | Mo Kα radiation |
| a = 13.493 (3) Å | µ = 0.09 mm−1 |
| b = 5.6288 (11) Å | T = 173 K |
| c = 26.309 (5) Å | 0.40 × 0.15 × 0.10 mm |
| β = 100.87 (3)° |
| Stoe IPDS II two-circle diffractometer | 1434 reflections with I > 2σ(I) |
| 16343 measured reflections | Rint = 0.111 |
| 3450 independent reflections |
| R[F2 > 2σ(F2)] = 0.069 | 0 restraints |
| wR(F2) = 0.121 | H-atom parameters constrained |
| S = 0.82 | Δρmax = 0.22 e Å−3 |
| 3450 reflections | Δρmin = −0.27 e Å−3 |
| 282 parameters |
Experimental. ; |
Geometry. All e.s.d.'s (except the e.s.d. in the dihedral angle between two l.s. planes) are estimated using the full covariance matrix. The cell e.s.d.'s are taken into account individually in the estimation of e.s.d.'s in distances, angles and torsion angles; correlations between e.s.d.'s in cell parameters are only used when they are defined by crystal symmetry. An approximate (isotropic) treatment of cell e.s.d.'s is used for estimating e.s.d.'s involving l.s. planes. |
Refinement. Refinement of F2 against ALL reflections. The weighted R-factor wR and goodness of fit S are based on F2, conventional R-factors R are based on F, with F set to zero for negative F2. The threshold expression of F2 > σ(F2) is used only for calculating R-factors(gt) etc. and is not relevant to the choice of reflections for refinement. R-factors based on F2 are statistically about twice as large as those based on F, and R- factors based on ALL data will be even larger. |
| x | y | z | Uiso*/Ueq | ||
| N1 | 0.6081 (3) | 0.2494 (7) | 0.30782 (15) | 0.0162 (10) | |
| C1 | 0.5052 (4) | 0.2507 (9) | 0.31608 (19) | 0.0199 (12) | |
| H1 | 0.4873 | 0.0847 | 0.3245 | 0.024* | |
| N2 | 0.6784 (3) | 0.1200 (7) | 0.34051 (15) | 0.0181 (9) | |
| C3 | 0.7672 (4) | 0.1933 (8) | 0.33129 (19) | 0.0189 (12) | |
| C4 | 0.7529 (4) | 0.3725 (8) | 0.29212 (19) | 0.0216 (12) | |
| H4 | 0.8037 | 0.4530 | 0.2782 | 0.026* | |
| C5 | 0.6523 (4) | 0.4033 (9) | 0.27902 (19) | 0.0224 (12) | |
| H5 | 0.6184 | 0.5127 | 0.2542 | 0.027* | |
| N11 | 0.4994 (3) | 0.4008 (7) | 0.36107 (14) | 0.0171 (9) | |
| N12 | 0.4236 (3) | 0.3584 (6) | 0.38778 (15) | 0.0165 (10) | |
| C13 | 0.4318 (4) | 0.5389 (8) | 0.42204 (18) | 0.0171 (12) | |
| C14 | 0.5103 (4) | 0.6909 (8) | 0.4161 (2) | 0.0214 (12) | |
| H14 | 0.5308 | 0.8302 | 0.4356 | 0.026* | |
| C15 | 0.5517 (4) | 0.6011 (9) | 0.37699 (19) | 0.0239 (12) | |
| H15 | 0.6064 | 0.6659 | 0.3635 | 0.029* | |
| C21 | 0.4313 (4) | 0.3296 (8) | 0.26841 (19) | 0.0179 (12) | |
| C22 | 0.4107 (4) | 0.1733 (8) | 0.22619 (19) | 0.0209 (12) | |
| H22 | 0.4464 | 0.0273 | 0.2272 | 0.025* | |
| C23 | 0.3402 (4) | 0.2291 (9) | 0.1838 (2) | 0.0214 (12) | |
| O23 | 0.3195 (3) | 0.0753 (6) | 0.14321 (13) | 0.0287 (9) | |
| H23 | 0.2640 | 0.1116 | 0.1245 | 0.043* | |
| C24 | 0.2880 (4) | 0.4488 (8) | 0.18097 (19) | 0.0168 (11) | |
| O24 | 0.2181 (3) | 0.4800 (6) | 0.13669 (13) | 0.0237 (9) | |
| H24 | 0.1816 | 0.5976 | 0.1402 | 0.036* | |
| C25 | 0.3102 (4) | 0.6034 (8) | 0.22209 (18) | 0.0196 (12) | |
| H25 | 0.2768 | 0.7525 | 0.2206 | 0.024* | |
| C26 | 0.3800 (4) | 0.5442 (8) | 0.26527 (19) | 0.0193 (12) | |
| H26 | 0.3935 | 0.6523 | 0.2935 | 0.023* | |
| C31 | 0.8626 (4) | 0.0957 (8) | 0.36075 (19) | 0.0190 (11) | |
| C32 | 0.9534 (4) | 0.2161 (8) | 0.3623 (2) | 0.0238 (13) | |
| H32 | 0.9540 | 0.3577 | 0.3427 | 0.029* | |
| C33 | 1.0414 (4) | 0.1348 (9) | 0.3913 (2) | 0.0312 (14) | |
| H33 | 1.1021 | 0.2212 | 0.3919 | 0.037* | |
| C34 | 1.0433 (4) | −0.0750 (10) | 0.4203 (2) | 0.0317 (14) | |
| H34 | 1.1042 | −0.1318 | 0.4409 | 0.038* | |
| C35 | 0.9530 (5) | −0.1962 (9) | 0.4177 (2) | 0.0332 (15) | |
| H35 | 0.9531 | −0.3406 | 0.4364 | 0.040* | |
| C36 | 0.8634 (4) | −0.1155 (9) | 0.38900 (19) | 0.0249 (13) | |
| H36 | 0.8027 | −0.2021 | 0.3884 | 0.030* | |
| C41 | 0.3634 (4) | 0.5541 (8) | 0.45945 (19) | 0.0176 (12) | |
| C42 | 0.3673 (4) | 0.7591 (9) | 0.4918 (2) | 0.0263 (13) | |
| H42 | 0.4139 | 0.8830 | 0.4891 | 0.032* | |
| C43 | 0.3040 (4) | 0.7773 (9) | 0.5268 (2) | 0.0272 (14) | |
| H43 | 0.3078 | 0.9133 | 0.5485 | 0.033* | |
| C44 | 0.2345 (4) | 0.6001 (9) | 0.53102 (19) | 0.0239 (12) | |
| H44 | 0.1905 | 0.6154 | 0.5551 | 0.029* | |
| C45 | 0.2296 (4) | 0.4007 (9) | 0.49981 (19) | 0.0248 (12) | |
| H45 | 0.1820 | 0.2790 | 0.5023 | 0.030* | |
| C46 | 0.2950 (4) | 0.3786 (8) | 0.46467 (19) | 0.0223 (12) | |
| H46 | 0.2922 | 0.2396 | 0.4440 | 0.027* |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| N1 | 0.019 (3) | 0.014 (2) | 0.016 (2) | −0.0032 (19) | 0.0029 (19) | 0.0009 (17) |
| C1 | 0.019 (3) | 0.021 (3) | 0.021 (3) | −0.001 (2) | 0.006 (2) | −0.003 (2) |
| N2 | 0.019 (2) | 0.017 (2) | 0.019 (2) | −0.0002 (19) | 0.0042 (19) | −0.0018 (18) |
| C3 | 0.019 (3) | 0.016 (2) | 0.022 (3) | 0.000 (2) | 0.005 (2) | −0.004 (2) |
| C4 | 0.016 (3) | 0.026 (3) | 0.025 (3) | −0.002 (2) | 0.010 (2) | 0.001 (2) |
| C5 | 0.031 (3) | 0.018 (3) | 0.019 (3) | −0.003 (2) | 0.004 (2) | 0.004 (2) |
| N11 | 0.019 (2) | 0.019 (2) | 0.016 (2) | −0.005 (2) | 0.0077 (19) | −0.0038 (18) |
| N12 | 0.021 (3) | 0.014 (2) | 0.014 (2) | 0.0026 (18) | 0.0023 (19) | −0.0035 (17) |
| C13 | 0.018 (3) | 0.019 (3) | 0.013 (3) | −0.002 (2) | 0.000 (2) | 0.002 (2) |
| C14 | 0.022 (3) | 0.019 (3) | 0.023 (3) | −0.005 (2) | 0.004 (2) | −0.012 (2) |
| C15 | 0.020 (3) | 0.022 (3) | 0.027 (3) | −0.006 (2) | −0.001 (2) | 0.002 (2) |
| C21 | 0.015 (3) | 0.023 (3) | 0.018 (3) | −0.002 (2) | 0.008 (2) | 0.000 (2) |
| C22 | 0.027 (3) | 0.015 (2) | 0.021 (3) | −0.002 (2) | 0.006 (3) | −0.006 (2) |
| C23 | 0.021 (3) | 0.020 (3) | 0.024 (3) | −0.005 (2) | 0.005 (2) | −0.009 (2) |
| O23 | 0.032 (2) | 0.024 (2) | 0.025 (2) | 0.0058 (18) | −0.0061 (18) | −0.0090 (17) |
| C24 | 0.009 (3) | 0.020 (3) | 0.023 (3) | 0.005 (2) | 0.005 (2) | 0.002 (2) |
| O24 | 0.026 (2) | 0.0201 (19) | 0.022 (2) | 0.0082 (16) | −0.0056 (17) | −0.0014 (14) |
| C25 | 0.018 (3) | 0.016 (2) | 0.024 (3) | 0.002 (2) | 0.000 (2) | 0.001 (2) |
| C26 | 0.020 (3) | 0.017 (3) | 0.024 (3) | −0.002 (2) | 0.011 (2) | −0.008 (2) |
| C31 | 0.020 (3) | 0.020 (2) | 0.018 (3) | −0.005 (2) | 0.008 (2) | −0.007 (2) |
| C32 | 0.025 (3) | 0.021 (3) | 0.025 (3) | −0.010 (2) | 0.004 (3) | 0.005 (2) |
| C33 | 0.020 (3) | 0.036 (3) | 0.038 (4) | −0.007 (3) | 0.008 (3) | 0.000 (3) |
| C34 | 0.022 (3) | 0.037 (3) | 0.034 (3) | 0.012 (3) | 0.002 (3) | 0.006 (3) |
| C35 | 0.034 (4) | 0.027 (3) | 0.039 (4) | 0.003 (3) | 0.007 (3) | 0.012 (3) |
| C36 | 0.024 (3) | 0.020 (3) | 0.029 (3) | −0.002 (2) | 0.003 (3) | −0.001 (2) |
| C41 | 0.020 (3) | 0.014 (3) | 0.019 (3) | −0.001 (2) | 0.001 (2) | −0.002 (2) |
| C42 | 0.032 (3) | 0.022 (3) | 0.027 (3) | −0.001 (3) | 0.008 (3) | −0.002 (2) |
| C43 | 0.032 (4) | 0.025 (3) | 0.027 (3) | 0.001 (3) | 0.012 (3) | −0.010 (2) |
| C44 | 0.030 (3) | 0.026 (3) | 0.017 (3) | 0.002 (3) | 0.008 (2) | −0.002 (2) |
| C45 | 0.026 (3) | 0.028 (3) | 0.022 (3) | −0.006 (3) | 0.010 (2) | 0.003 (3) |
| C46 | 0.027 (3) | 0.016 (2) | 0.024 (3) | −0.005 (2) | 0.003 (2) | −0.006 (2) |
| N1—C5 | 1.360 (6) | C24—C25 | 1.377 (7) |
| N1—N2 | 1.364 (5) | O24—H24 | 0.8400 |
| N1—C1 | 1.445 (7) | C25—C26 | 1.373 (7) |
| C1—N11 | 1.468 (6) | C25—H25 | 0.9500 |
| C1—C21 | 1.515 (6) | C26—H26 | 0.9500 |
| C1—H1 | 1.0000 | C31—C32 | 1.394 (7) |
| N2—C3 | 1.333 (7) | C31—C36 | 1.401 (7) |
| C3—C4 | 1.429 (7) | C32—C33 | 1.364 (7) |
| C3—C31 | 1.477 (7) | C32—H32 | 0.9500 |
| C4—C5 | 1.348 (7) | C33—C34 | 1.403 (7) |
| C4—H4 | 0.9500 | C33—H33 | 0.9500 |
| C5—H5 | 0.9500 | C34—C35 | 1.387 (8) |
| N11—C15 | 1.354 (6) | C34—H34 | 0.9500 |
| N11—N12 | 1.367 (6) | C35—C36 | 1.376 (7) |
| N12—C13 | 1.349 (6) | C35—H35 | 0.9500 |
| C13—C14 | 1.392 (7) | C36—H36 | 0.9500 |
| C13—C41 | 1.473 (7) | C41—C46 | 1.376 (7) |
| C14—C15 | 1.358 (7) | C41—C42 | 1.430 (7) |
| C14—H14 | 0.9500 | C42—C43 | 1.373 (7) |
| C15—H15 | 0.9500 | C42—H42 | 0.9500 |
| C21—C26 | 1.386 (6) | C43—C44 | 1.388 (7) |
| C21—C22 | 1.403 (6) | C43—H43 | 0.9500 |
| C22—C23 | 1.360 (7) | C44—C45 | 1.385 (7) |
| C22—H22 | 0.9500 | C44—H44 | 0.9500 |
| C23—O23 | 1.362 (6) | C45—C46 | 1.398 (8) |
| C23—C24 | 1.418 (6) | C45—H45 | 0.9500 |
| O23—H23 | 0.8400 | C46—H46 | 0.9500 |
| C24—O24 | 1.365 (6) | ||
| C5—N1—N2 | 111.4 (4) | C25—C24—C23 | 118.6 (4) |
| C5—N1—C1 | 128.0 (4) | C24—O24—H24 | 109.5 |
| N2—N1—C1 | 118.7 (4) | C26—C25—C24 | 120.7 (5) |
| N1—C1—N11 | 108.8 (4) | C26—C25—H25 | 119.7 |
| N1—C1—C21 | 112.2 (4) | C24—C25—H25 | 119.7 |
| N11—C1—C21 | 111.8 (4) | C25—C26—C21 | 121.2 (4) |
| N1—C1—H1 | 107.9 | C25—C26—H26 | 119.4 |
| N11—C1—H1 | 107.9 | C21—C26—H26 | 119.4 |
| C21—C1—H1 | 107.9 | C32—C31—C36 | 118.6 (5) |
| C3—N2—N1 | 105.2 (4) | C32—C31—C3 | 120.5 (4) |
| N2—C3—C4 | 110.2 (5) | C36—C31—C3 | 120.8 (5) |
| N2—C3—C31 | 120.9 (4) | C33—C32—C31 | 121.4 (5) |
| C4—C3—C31 | 128.8 (5) | C33—C32—H32 | 119.3 |
| C5—C4—C3 | 105.5 (5) | C31—C32—H32 | 119.3 |
| C5—C4—H4 | 127.2 | C32—C33—C34 | 120.7 (5) |
| C3—C4—H4 | 127.2 | C32—C33—H33 | 119.6 |
| C4—C5—N1 | 107.6 (4) | C34—C33—H33 | 119.6 |
| C4—C5—H5 | 126.2 | C35—C34—C33 | 117.5 (5) |
| N1—C5—H5 | 126.2 | C35—C34—H34 | 121.3 |
| C15—N11—N12 | 112.5 (4) | C33—C34—H34 | 121.3 |
| C15—N11—C1 | 128.7 (4) | C36—C35—C34 | 122.6 (5) |
| N12—N11—C1 | 118.2 (4) | C36—C35—H35 | 118.7 |
| C13—N12—N11 | 103.7 (4) | C34—C35—H35 | 118.7 |
| N12—C13—C14 | 110.9 (5) | C35—C36—C31 | 119.2 (5) |
| N12—C13—C41 | 120.5 (4) | C35—C36—H36 | 120.4 |
| C14—C13—C41 | 128.7 (4) | C31—C36—H36 | 120.4 |
| C15—C14—C13 | 106.7 (4) | C46—C41—C42 | 118.1 (5) |
| C15—C14—H14 | 126.7 | C46—C41—C13 | 122.8 (4) |
| C13—C14—H14 | 126.7 | C42—C41—C13 | 119.1 (5) |
| N11—C15—C14 | 106.2 (5) | C43—C42—C41 | 120.1 (5) |
| N11—C15—H15 | 126.9 | C43—C42—H42 | 119.9 |
| C14—C15—H15 | 126.9 | C41—C42—H42 | 119.9 |
| C26—C21—C22 | 118.5 (5) | C42—C43—C44 | 121.0 (5) |
| C26—C21—C1 | 123.3 (4) | C42—C43—H43 | 119.5 |
| C22—C21—C1 | 118.2 (4) | C44—C43—H43 | 119.5 |
| C23—C22—C21 | 120.5 (5) | C45—C44—C43 | 119.5 (5) |
| C23—C22—H22 | 119.7 | C45—C44—H44 | 120.3 |
| C21—C22—H22 | 119.7 | C43—C44—H44 | 120.3 |
| C22—C23—O23 | 120.3 (5) | C44—C45—C46 | 119.9 (5) |
| C22—C23—C24 | 120.6 (4) | C44—C45—H45 | 120.0 |
| O23—C23—C24 | 119.1 (4) | C46—C45—H45 | 120.0 |
| C23—O23—H23 | 109.5 | C41—C46—C45 | 121.4 (5) |
| O24—C24—C25 | 127.0 (4) | C41—C46—H46 | 119.3 |
| O24—C24—C23 | 114.4 (4) | C45—C46—H46 | 119.3 |
| C5—N1—C1—N11 | −88.4 (5) | C22—C23—C24—O24 | −178.9 (5) |
| N2—N1—C1—N11 | 74.6 (5) | O23—C23—C24—O24 | 1.8 (7) |
| C5—N1—C1—C21 | 35.9 (6) | C22—C23—C24—C25 | −0.2 (8) |
| N2—N1—C1—C21 | −161.0 (4) | O23—C23—C24—C25 | −179.6 (5) |
| C5—N1—N2—C3 | −0.7 (5) | O24—C24—C25—C26 | 177.4 (5) |
| C1—N1—N2—C3 | −166.4 (4) | C23—C24—C25—C26 | −1.1 (8) |
| N1—N2—C3—C4 | 0.1 (5) | C24—C25—C26—C21 | 1.0 (8) |
| N1—N2—C3—C31 | 178.5 (4) | C22—C21—C26—C25 | 0.4 (8) |
| N2—C3—C4—C5 | 0.6 (6) | C1—C21—C26—C25 | −176.9 (5) |
| C31—C3—C4—C5 | −177.7 (5) | N2—C3—C31—C32 | −161.3 (5) |
| C3—C4—C5—N1 | −1.0 (6) | C4—C3—C31—C32 | 16.8 (8) |
| N2—N1—C5—C4 | 1.1 (5) | N2—C3—C31—C36 | 16.7 (7) |
| C1—N1—C5—C4 | 165.2 (4) | C4—C3—C31—C36 | −165.2 (5) |
| N1—C1—N11—C15 | 34.3 (6) | C36—C31—C32—C33 | −1.3 (8) |
| C21—C1—N11—C15 | −90.2 (6) | C3—C31—C32—C33 | 176.8 (5) |
| N1—C1—N11—N12 | −155.2 (4) | C31—C32—C33—C34 | 0.6 (9) |
| C21—C1—N11—N12 | 80.2 (5) | C32—C33—C34—C35 | 0.7 (9) |
| C15—N11—N12—C13 | −1.2 (5) | C33—C34—C35—C36 | −1.4 (9) |
| C1—N11—N12—C13 | −173.1 (4) | C34—C35—C36—C31 | 0.7 (9) |
| N11—N12—C13—C14 | 0.7 (5) | C32—C31—C36—C35 | 0.6 (8) |
| N11—N12—C13—C41 | −178.6 (4) | C3—C31—C36—C35 | −177.4 (5) |
| N12—C13—C14—C15 | 0.0 (6) | N12—C13—C41—C46 | 5.9 (7) |
| C41—C13—C14—C15 | 179.3 (5) | C14—C13—C41—C46 | −173.3 (5) |
| N12—N11—C15—C14 | 1.2 (5) | N12—C13—C41—C42 | −173.9 (4) |
| C1—N11—C15—C14 | 172.1 (5) | C14—C13—C41—C42 | 6.8 (8) |
| C13—C14—C15—N11 | −0.7 (5) | C46—C41—C42—C43 | −0.1 (8) |
| N1—C1—C21—C26 | −110.4 (6) | C13—C41—C42—C43 | 179.7 (5) |
| N11—C1—C21—C26 | 12.2 (7) | C41—C42—C43—C44 | −0.8 (8) |
| N1—C1—C21—C22 | 72.2 (6) | C42—C43—C44—C45 | 0.7 (8) |
| N11—C1—C21—C22 | −165.1 (5) | C43—C44—C45—C46 | 0.4 (8) |
| C26—C21—C22—C23 | −1.7 (8) | C42—C41—C46—C45 | 1.2 (7) |
| C1—C21—C22—C23 | 175.8 (5) | C13—C41—C46—C45 | −178.6 (5) |
| C21—C22—C23—O23 | −179.1 (5) | C44—C45—C46—C41 | −1.4 (8) |
| C21—C22—C23—C24 | 1.6 (8) |
| D—H···A | D—H | H···A | D···A | D—H···A |
| O23—H23···O24 | 0.84 | 2.21 | 2.646 (5) | 113 |
| O24—H24···N12i | 0.84 | 2.08 | 2.853 (5) | 153 |
| Symmetry code: (i) −x+1/2, y+1/2, −z+1/2. |
Experimental details
| Crystal data | |
| Chemical formula | C25H20N4O2 |
| Mr | 408.45 |
| Crystal system, space group | Monoclinic, P21/n |
| Temperature (K) | 173 |
| a, b, c (Å) | 13.493 (3), 5.6288 (11), 26.309 (5) |
| β (°) | 100.87 (3) |
| V (Å3) | 1962.3 (7) |
| Z | 4 |
| Radiation type | Mo Kα |
| µ (mm−1) | 0.09 |
| Crystal size (mm) | 0.40 × 0.15 × 0.10 |
| Data collection | |
| Diffractometer | Stoe IPDS II two-circle |
| Absorption correction | – |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 16343, 3450, 1434 |
| Rint | 0.111 |
| (sin θ/λ)max (Å−1) | 0.595 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.069, 0.121, 0.82 |
| No. of reflections | 3450 |
| No. of parameters | 282 |
| H-atom treatment | H-atom parameters constrained |
| Δρmax, Δρmin (e Å−3) | 0.22, −0.27 |
Computer programs: X-AREA (Stoe & Cie, 2001), SHELXS97 (Sheldrick, 2008), XP (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008) and PLATON (Spek, 2009).
| D—H···A | D—H | H···A | D···A | D—H···A |
| O23—H23···O24 | 0.84 | 2.21 | 2.646 (5) | 112.8 |
| O24—H24···N12i | 0.84 | 2.08 | 2.853 (5) | 153.3 |
| Symmetry code: (i) −x+1/2, y+1/2, −z+1/2. |
References
Blasberg, F., Bolte, M., Wagner, M. & Lerner, H.-W. (2011). J. Organomet. Chem. doi:10.1016/j.jorganchem.2011.08.002. Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Spek, A. L. (2009). Acta Cryst. D65, 148–155. Web of Science CrossRef CAS IUCr Journals Google Scholar
Stoe & Cie (2001). X-AREA. Stoe & Cie, Darmstadt, Germany. Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
. ![[Figure 1]](./ez2261fig1thm.gif)
![[Figure 2]](./ez2261fig2thm.gif)




Very recently we have reported on the synthesis, structural characterization, and coordination behavior of ditopic ortho-hydroquinone-based bis(pyrazol-1-yl)methane ligands (Blasberg et al., 2011). In this report, we have already noted ortho-(OH)2C6H3-4-CH(3-Phpz)2, but metric parameters will be discussed here. The bis(pyrazol-1-yl)methane derivative (I) was prepared in a three-step one-pot procedure as shown in Fig. 1.
The dihedral angles between the planes of the pyrazol rings and the attached phenyl rings are 20.9 (3)° and 5.9 (4)°. One of the two hydroxy groups forms an intramolecular hydrogen bond to the other hydroxy group, whereas the second one is involved in an intermolecular O—H···N hydrogen bond. As a result of these intermolecular hydrogen bonds, helical chains running along the b axis are formed.