metal-organic compounds
Hexaaquacobalt(II) bis[4-(pyridin-2-ylmethoxy)benzoate] dihydrate
aKey Laboratory of Functional Inorganic Material Chemistry, Ministry of Education, Heilongjiang University, Harbin 150080, People's Republic of China, bDepartment of Chemistry, University of Malaya, 50603 Kuala Lumpur, Malaysia, and cChemistry Department, Faculty of Science, King Abdulaziz University, PO Box 80203 Jeddah, Saudi Arabia
*Correspondence e-mail: [email protected]
The CoII atom in the title salt, [Co(H2O)6](C13H10NO3)2·2H2O, lies on a center of inversion in an octahedron of water molecules. The cations, anions and uncoordinated water molecules are linked by O—H⋯O and O—H⋯N hydrogen bonds into a three-dimensional network. The anion is essentially planar, with an r.m.s. deviation of all non-H atoms of 0.066 Å.
Related literature
There are many examples of hexaaquacobalt(II) benzoates; these benzoates possess substitutents capable of serving as hydrogen-bond acceptors/donors, see: Deng et al. (2006
). For the isotypic Mn(II) salt, see: Zhang et al. (2011
).
Experimental
Crystal data
|
Refinement
|
|
Data collection: RAPID-AUTO (Rigaku, 1998
); cell refinement: RAPID-AUTO; data reduction: CrystalClear (Rigaku/MSC, 2002
); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: X-SEED (Barbour, 2001
); software used to prepare material for publication: publCIF (Westrip, 2010
).
Supporting information
contains datablocks global, I. DOI: 10.1107/S1600536811040931/bt5664sup1.cif
Structure factors: contains datablock I. DOI: 10.1107/S1600536811040931/bt5664Isup2.hkl
Cobalt nitrate (1 mmol) was added to an aqueous solution of 4-(pyridin-2-ylmethoxy)benzoic acid (2 mmol) that was earlier been treated with 1M sodium hydroxide to a pH of 6. The filtered solution was set aside for several days, after which pink prismatic crystals separated from solution.
Carbon-bound H-atoms were placed in calculated positions (C–H 0.93 Å) and were included in the in the riding model approximation, with U(H) set to 1.2U(C). The water H-atoms were located in a difference Fourier map, and were refined with distance restraints of O–H 0.84±0.01 Å and H···H 1.37±0.01 Å; their displacement factors were refined.
The anisotropic displacement ellipsoids of the lattice water O were restrained to an isotropic behaviour.
The (2 2 7) reflection was omitted owing to bad agreement.
Data collection: RAPID-AUTO (Rigaku, 1998); cell RAPID-AUTO (Rigaku, 1998); data reduction: CrystalClear (Rigaku/MSC, 2002); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: X-SEED (Barbour, 2001); software used to prepare material for publication: publCIF (Westrip, 2010).
| Fig. 1. Anisotropic displacement ellipsoid plot (Barbour, 2001) of Co(H2O)6.2(C13H10NO3).2H2O at the 50% probability level; hydrogen atoms are drawn as spheres of arbitrary radius. |
| [Co(H2O)6](C13H10NO3)2·2H2O | Z = 1 |
| Mr = 659.50 | F(000) = 345 |
| Triclinic, P1 | Dx = 1.496 Mg m−3 |
| Hall symbol: -P 1 | Mo Kα radiation, λ = 0.71073 Å |
| a = 7.4349 (3) Å | Cell parameters from 5547 reflections |
| b = 7.5431 (3) Å | θ = 3.1–27.4° |
| c = 13.7531 (6) Å | µ = 0.66 mm−1 |
| α = 84.307 (1)° | T = 293 K |
| β = 83.153 (1)° | Prism, pink |
| γ = 73.333 (1)° | 0.21 × 0.15 × 0.13 mm |
| V = 731.91 (5) Å3 |
| Rigaku R-AXIS RAPID IP diffractometer | 3314 independent reflections |
| Radiation source: fine-focus sealed tube | 2401 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.026 |
| ω scans | θmax = 27.4°, θmin = 3.1° |
| Absorption correction: multi-scan (ABSCOR; Higashi, 1995) | h = −9→9 |
| Tmin = 0.874, Tmax = 0.919 | k = −9→9 |
| 7251 measured reflections | l = −17→17 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.036 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.138 | H atoms treated by a mixture of independent and constrained refinement |
| S = 1.15 | w = 1/[σ2(Fo2) + (0.0658P)2 + 0.3695P] where P = (Fo2 + 2Fc2)/3 |
| 3314 reflections | (Δ/σ)max = 0.001 |
| 228 parameters | Δρmax = 0.63 e Å−3 |
| 18 restraints | Δρmin = −0.69 e Å−3 |
| [Co(H2O)6](C13H10NO3)2·2H2O | γ = 73.333 (1)° |
| Mr = 659.50 | V = 731.91 (5) Å3 |
| Triclinic, P1 | Z = 1 |
| a = 7.4349 (3) Å | Mo Kα radiation |
| b = 7.5431 (3) Å | µ = 0.66 mm−1 |
| c = 13.7531 (6) Å | T = 293 K |
| α = 84.307 (1)° | 0.21 × 0.15 × 0.13 mm |
| β = 83.153 (1)° |
| Rigaku R-AXIS RAPID IP diffractometer | 3314 independent reflections |
| Absorption correction: multi-scan (ABSCOR; Higashi, 1995) | 2401 reflections with I > 2σ(I) |
| Tmin = 0.874, Tmax = 0.919 | Rint = 0.026 |
| 7251 measured reflections |
| R[F2 > 2σ(F2)] = 0.036 | 18 restraints |
| wR(F2) = 0.138 | H atoms treated by a mixture of independent and constrained refinement |
| S = 1.15 | Δρmax = 0.63 e Å−3 |
| 3314 reflections | Δρmin = −0.69 e Å−3 |
| 228 parameters |
| x | y | z | Uiso*/Ueq | ||
| Co1 | 0.5000 | 0.5000 | 0.5000 | 0.02876 (18) | |
| O1 | 0.4152 (3) | 0.8175 (3) | 0.26860 (15) | 0.0429 (5) | |
| O2 | 0.3638 (3) | 1.0264 (3) | 0.37899 (14) | 0.0415 (5) | |
| O3 | 0.2477 (4) | 1.5730 (3) | −0.00100 (15) | 0.0493 (6) | |
| O1W | 0.2738 (3) | 0.5989 (3) | 0.41333 (15) | 0.0368 (5) | |
| O2W | 0.4601 (3) | 0.7721 (2) | 0.52791 (14) | 0.0368 (5) | |
| O3W | 0.3196 (3) | 0.4485 (3) | 0.62650 (14) | 0.0376 (5) | |
| O4W | 0.0843 (4) | 1.2664 (5) | 0.5083 (3) | 0.0673 (8) | |
| N1 | 0.1751 (4) | 1.7407 (3) | −0.25030 (18) | 0.0403 (6) | |
| C1 | 0.3773 (4) | 0.9820 (4) | 0.2913 (2) | 0.0321 (6) | |
| C2 | 0.3421 (4) | 1.1356 (4) | 0.21207 (19) | 0.0301 (6) | |
| C3 | 0.3111 (5) | 1.3191 (4) | 0.2343 (2) | 0.0373 (7) | |
| H3 | 0.3107 | 1.3462 | 0.2989 | 0.045* | |
| C4 | 0.2809 (5) | 1.4610 (4) | 0.1611 (2) | 0.0403 (7) | |
| H4 | 0.2604 | 1.5830 | 0.1764 | 0.048* | |
| C5 | 0.2812 (4) | 1.4210 (4) | 0.0650 (2) | 0.0345 (6) | |
| C6 | 0.3114 (5) | 1.2396 (4) | 0.0414 (2) | 0.0366 (7) | |
| H6 | 0.3109 | 1.2130 | −0.0232 | 0.044* | |
| C7 | 0.3425 (4) | 1.0985 (4) | 0.1154 (2) | 0.0338 (6) | |
| H7 | 0.3641 | 0.9765 | 0.0998 | 0.041* | |
| C8 | 0.2360 (5) | 1.5490 (4) | −0.1010 (2) | 0.0363 (7) | |
| H8A | 0.1397 | 1.4877 | −0.1062 | 0.044* | |
| H8B | 0.3557 | 1.4734 | −0.1294 | 0.044* | |
| C9 | 0.1869 (4) | 1.7387 (4) | −0.15412 (19) | 0.0317 (6) | |
| C10 | 0.1258 (5) | 1.9066 (5) | −0.3007 (2) | 0.0452 (8) | |
| H10 | 0.1169 | 1.9094 | −0.3678 | 0.054* | |
| C11 | 0.0878 (5) | 2.0720 (5) | −0.2581 (3) | 0.0490 (8) | |
| H11A | 0.0534 | 2.1840 | −0.2955 | 0.059* | |
| C12 | 0.1014 (5) | 2.0687 (5) | −0.1596 (3) | 0.0502 (8) | |
| H12A | 0.0765 | 2.1787 | −0.1288 | 0.060* | |
| C13 | 0.1528 (5) | 1.8992 (4) | −0.1062 (2) | 0.0434 (7) | |
| H13 | 0.1642 | 1.8936 | −0.0393 | 0.052* | |
| H11 | 0.304 (5) | 0.677 (4) | 0.372 (2) | 0.065 (13)* | |
| H12 | 0.167 (3) | 0.646 (5) | 0.442 (3) | 0.069 (14)* | |
| H21 | 0.430 (5) | 0.853 (3) | 0.4814 (16) | 0.048 (10)* | |
| H22 | 0.503 (5) | 0.816 (4) | 0.5708 (17) | 0.053 (11)* | |
| H31 | 0.390 (5) | 0.361 (3) | 0.660 (2) | 0.065 (12)* | |
| H32 | 0.271 (5) | 0.536 (3) | 0.664 (2) | 0.065 (12)* | |
| H41 | 0.117 (7) | 1.227 (7) | 0.4522 (18) | 0.10 (2)* | |
| H42 | 0.149 (10) | 1.336 (11) | 0.518 (5) | 0.24 (5)* |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Co1 | 0.0379 (3) | 0.0210 (3) | 0.0273 (3) | −0.0075 (2) | −0.0068 (2) | 0.00113 (19) |
| O1 | 0.0675 (15) | 0.0234 (9) | 0.0361 (11) | −0.0079 (10) | −0.0129 (10) | 0.0013 (8) |
| O2 | 0.0683 (15) | 0.0294 (10) | 0.0284 (10) | −0.0143 (10) | −0.0137 (10) | 0.0032 (8) |
| O3 | 0.0880 (18) | 0.0294 (10) | 0.0294 (11) | −0.0134 (11) | −0.0167 (11) | 0.0073 (8) |
| O1W | 0.0426 (13) | 0.0308 (10) | 0.0367 (11) | −0.0092 (9) | −0.0095 (10) | 0.0021 (9) |
| O2W | 0.0612 (14) | 0.0230 (9) | 0.0277 (10) | −0.0109 (9) | −0.0136 (9) | −0.0005 (8) |
| O3W | 0.0462 (13) | 0.0312 (10) | 0.0294 (10) | −0.0035 (9) | −0.0002 (9) | 0.0000 (9) |
| O4W | 0.0531 (17) | 0.0683 (18) | 0.077 (2) | −0.0156 (14) | 0.0123 (15) | −0.0117 (16) |
| N1 | 0.0455 (15) | 0.0375 (13) | 0.0312 (12) | −0.0026 (11) | −0.0027 (11) | 0.0020 (10) |
| C1 | 0.0416 (17) | 0.0266 (13) | 0.0296 (14) | −0.0098 (12) | −0.0121 (12) | 0.0026 (11) |
| C2 | 0.0354 (15) | 0.0248 (12) | 0.0294 (13) | −0.0071 (11) | −0.0063 (11) | 0.0022 (10) |
| C3 | 0.0537 (19) | 0.0300 (14) | 0.0274 (13) | −0.0080 (13) | −0.0094 (13) | −0.0021 (11) |
| C4 | 0.060 (2) | 0.0231 (13) | 0.0366 (15) | −0.0077 (13) | −0.0107 (14) | 0.0000 (11) |
| C5 | 0.0428 (17) | 0.0305 (14) | 0.0286 (13) | −0.0084 (12) | −0.0074 (12) | 0.0057 (11) |
| C6 | 0.0532 (19) | 0.0309 (14) | 0.0244 (13) | −0.0088 (13) | −0.0065 (12) | −0.0016 (11) |
| C7 | 0.0404 (16) | 0.0253 (13) | 0.0336 (15) | −0.0044 (12) | −0.0067 (12) | −0.0026 (11) |
| C8 | 0.0474 (18) | 0.0315 (14) | 0.0273 (13) | −0.0076 (13) | −0.0042 (12) | 0.0019 (11) |
| C9 | 0.0348 (15) | 0.0329 (14) | 0.0251 (13) | −0.0078 (12) | −0.0024 (11) | 0.0040 (11) |
| C10 | 0.0486 (19) | 0.0471 (18) | 0.0302 (15) | −0.0013 (15) | −0.0044 (13) | 0.0087 (13) |
| C11 | 0.058 (2) | 0.0365 (16) | 0.0501 (19) | −0.0103 (15) | −0.0161 (16) | 0.0150 (14) |
| C12 | 0.071 (2) | 0.0336 (15) | 0.0473 (19) | −0.0124 (16) | −0.0194 (17) | 0.0016 (14) |
| C13 | 0.060 (2) | 0.0358 (15) | 0.0352 (15) | −0.0120 (15) | −0.0145 (14) | 0.0008 (12) |
| Co1—O2W | 2.0559 (18) | C2—C7 | 1.385 (4) |
| Co1—O2Wi | 2.0559 (18) | C2—C3 | 1.395 (4) |
| Co1—O1Wi | 2.094 (2) | C3—C4 | 1.383 (4) |
| Co1—O1W | 2.094 (2) | C3—H3 | 0.9300 |
| Co1—O3Wi | 2.141 (2) | C4—C5 | 1.384 (4) |
| Co1—O3W | 2.141 (2) | C4—H4 | 0.9300 |
| O1—C1 | 1.254 (3) | C5—C6 | 1.387 (4) |
| O2—C1 | 1.268 (3) | C6—C7 | 1.387 (4) |
| O3—C5 | 1.372 (3) | C6—H6 | 0.9300 |
| O3—C8 | 1.420 (3) | C7—H7 | 0.9300 |
| O1W—H11 | 0.837 (10) | C8—C9 | 1.507 (4) |
| O1W—H12 | 0.838 (10) | C8—H8A | 0.9700 |
| O2W—H21 | 0.841 (10) | C8—H8B | 0.9700 |
| O2W—H22 | 0.841 (10) | C9—C13 | 1.381 (4) |
| O3W—H31 | 0.847 (10) | C10—C11 | 1.372 (5) |
| O3W—H32 | 0.846 (10) | C10—H10 | 0.9300 |
| O4W—H41 | 0.837 (10) | C11—C12 | 1.369 (5) |
| O4W—H42 | 0.839 (10) | C11—H11A | 0.9300 |
| N1—C9 | 1.334 (4) | C12—C13 | 1.386 (4) |
| N1—C10 | 1.344 (4) | C12—H12A | 0.9300 |
| C1—C2 | 1.497 (4) | C13—H13 | 0.9300 |
| O2W—Co1—O2Wi | 180.000 (1) | C2—C3—H3 | 119.8 |
| O2W—Co1—O1Wi | 93.59 (8) | C3—C4—C5 | 119.9 (3) |
| O2Wi—Co1—O1Wi | 86.41 (8) | C3—C4—H4 | 120.1 |
| O2W—Co1—O1W | 86.41 (8) | C5—C4—H4 | 120.1 |
| O2Wi—Co1—O1W | 93.59 (8) | O3—C5—C4 | 114.6 (2) |
| O1Wi—Co1—O1W | 180.0 | O3—C5—C6 | 124.8 (3) |
| O2W—Co1—O3Wi | 86.46 (8) | C4—C5—C6 | 120.5 (2) |
| O2Wi—Co1—O3Wi | 93.54 (8) | C5—C6—C7 | 119.0 (3) |
| O1Wi—Co1—O3Wi | 92.45 (9) | C5—C6—H6 | 120.5 |
| O1W—Co1—O3Wi | 87.55 (8) | C7—C6—H6 | 120.5 |
| O2W—Co1—O3W | 93.54 (8) | C2—C7—C6 | 121.3 (3) |
| O2Wi—Co1—O3W | 86.46 (8) | C2—C7—H7 | 119.3 |
| O1Wi—Co1—O3W | 87.55 (8) | C6—C7—H7 | 119.3 |
| O1W—Co1—O3W | 92.45 (9) | O3—C8—C9 | 107.6 (2) |
| O3Wi—Co1—O3W | 180.000 (1) | O3—C8—H8A | 110.2 |
| C5—O3—C8 | 119.4 (2) | C9—C8—H8A | 110.2 |
| Co1—O1W—H11 | 106 (3) | O3—C8—H8B | 110.2 |
| Co1—O1W—H12 | 117 (3) | C9—C8—H8B | 110.2 |
| H11—O1W—H12 | 109.7 (17) | H8A—C8—H8B | 108.5 |
| Co1—O2W—H21 | 117 (2) | N1—C9—C13 | 122.4 (3) |
| Co1—O2W—H22 | 130 (2) | N1—C9—C8 | 115.3 (2) |
| H21—O2W—H22 | 109.4 (16) | C13—C9—C8 | 122.3 (2) |
| Co1—O3W—H31 | 104 (3) | N1—C10—C11 | 123.2 (3) |
| Co1—O3W—H32 | 117 (3) | N1—C10—H10 | 118.4 |
| H31—O3W—H32 | 107.6 (16) | C11—C10—H10 | 118.4 |
| H41—O4W—H42 | 109 (6) | C12—C11—C10 | 118.7 (3) |
| C9—N1—C10 | 117.8 (3) | C12—C11—H11A | 120.7 |
| O1—C1—O2 | 123.3 (2) | C10—C11—H11A | 120.7 |
| O1—C1—C2 | 119.1 (2) | C11—C12—C13 | 119.1 (3) |
| O2—C1—C2 | 117.6 (2) | C11—C12—H12A | 120.4 |
| C7—C2—C3 | 118.8 (2) | C13—C12—H12A | 120.4 |
| C7—C2—C1 | 120.9 (2) | C9—C13—C12 | 118.8 (3) |
| C3—C2—C1 | 120.4 (2) | C9—C13—H13 | 120.6 |
| C4—C3—C2 | 120.5 (3) | C12—C13—H13 | 120.6 |
| C4—C3—H3 | 119.8 | ||
| O1—C1—C2—C7 | 3.0 (4) | C1—C2—C7—C6 | −179.5 (3) |
| O2—C1—C2—C7 | −175.9 (3) | C5—C6—C7—C2 | 0.6 (5) |
| O1—C1—C2—C3 | −176.1 (3) | C5—O3—C8—C9 | 176.6 (3) |
| O2—C1—C2—C3 | 5.1 (4) | C10—N1—C9—C13 | −0.8 (5) |
| C7—C2—C3—C4 | 0.1 (5) | C10—N1—C9—C8 | 177.9 (3) |
| C1—C2—C3—C4 | 179.2 (3) | O3—C8—C9—N1 | 178.4 (3) |
| C2—C3—C4—C5 | 0.1 (5) | O3—C8—C9—C13 | −2.9 (4) |
| C8—O3—C5—C4 | −177.1 (3) | C9—N1—C10—C11 | 0.1 (5) |
| C8—O3—C5—C6 | 2.2 (5) | N1—C10—C11—C12 | 0.3 (6) |
| C3—C4—C5—O3 | 179.3 (3) | C10—C11—C12—C13 | 0.0 (6) |
| C3—C4—C5—C6 | 0.1 (5) | N1—C9—C13—C12 | 1.1 (5) |
| O3—C5—C6—C7 | −179.6 (3) | C8—C9—C13—C12 | −177.6 (3) |
| C4—C5—C6—C7 | −0.4 (5) | C11—C12—C13—C9 | −0.6 (5) |
| C3—C2—C7—C6 | −0.5 (5) |
| Symmetry code: (i) −x+1, −y+1, −z+1. |
| D—H···A | D—H | H···A | D···A | D—H···A |
| O1w—H11···O1 | 0.84 (1) | 1.94 (1) | 2.762 (3) | 169 (3) |
| O1w—H12···O4wii | 0.84 (1) | 1.87 (1) | 2.696 (4) | 171 (4) |
| O2w—H21···O2 | 0.84 (1) | 1.84 (1) | 2.678 (3) | 179 (3) |
| O2w—H22···O2iii | 0.84 (1) | 1.97 (2) | 2.755 (3) | 156 (3) |
| O3w—H31···O1i | 0.85 (1) | 1.96 (1) | 2.798 (3) | 170 (4) |
| O3w—H32···N1iv | 0.85 (1) | 1.95 (1) | 2.799 (3) | 177 (4) |
| O4w—H41···O2 | 0.84 (1) | 2.22 (4) | 2.891 (4) | 137 (5) |
| O4w—H42···O3wv | 0.84 (1) | 2.42 (4) | 3.176 (4) | 151 (7) |
| Symmetry codes: (i) −x+1, −y+1, −z+1; (ii) −x, −y+2, −z+1; (iii) −x+1, −y+2, −z+1; (iv) x, y−1, z+1; (v) x, y+1, z. |
Experimental details
| Crystal data | |
| Chemical formula | [Co(H2O)6](C13H10NO3)2·2H2O |
| Mr | 659.50 |
| Crystal system, space group | Triclinic, P1 |
| Temperature (K) | 293 |
| a, b, c (Å) | 7.4349 (3), 7.5431 (3), 13.7531 (6) |
| α, β, γ (°) | 84.307 (1), 83.153 (1), 73.333 (1) |
| V (Å3) | 731.91 (5) |
| Z | 1 |
| Radiation type | Mo Kα |
| µ (mm−1) | 0.66 |
| Crystal size (mm) | 0.21 × 0.15 × 0.13 |
| Data collection | |
| Diffractometer | Rigaku R-AXIS RAPID IP diffractometer |
| Absorption correction | Multi-scan (ABSCOR; Higashi, 1995) |
| Tmin, Tmax | 0.874, 0.919 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 7251, 3314, 2401 |
| Rint | 0.026 |
| (sin θ/λ)max (Å−1) | 0.648 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.036, 0.138, 1.15 |
| No. of reflections | 3314 |
| No. of parameters | 228 |
| No. of restraints | 18 |
| H-atom treatment | H atoms treated by a mixture of independent and constrained refinement |
| Δρmax, Δρmin (e Å−3) | 0.63, −0.69 |
Computer programs: RAPID-AUTO (Rigaku, 1998), CrystalClear (Rigaku/MSC, 2002), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), X-SEED (Barbour, 2001), publCIF (Westrip, 2010).
| D—H···A | D—H | H···A | D···A | D—H···A |
| O1w—H11···O1 | 0.84 (1) | 1.94 (1) | 2.762 (3) | 169 (3) |
| O1w—H12···O4wi | 0.84 (1) | 1.87 (1) | 2.696 (4) | 171 (4) |
| O2w—H21···O2 | 0.84 (1) | 1.84 (1) | 2.678 (3) | 179 (3) |
| O2w—H22···O2ii | 0.84 (1) | 1.97 (2) | 2.755 (3) | 156 (3) |
| O3w—H31···O1iii | 0.85 (1) | 1.96 (1) | 2.798 (3) | 170 (4) |
| O3w—H32···N1iv | 0.85 (1) | 1.95 (1) | 2.799 (3) | 177 (4) |
| O4w—H41···O2 | 0.84 (1) | 2.22 (4) | 2.891 (4) | 137 (5) |
| O4w—H42···O3wv | 0.84 (1) | 2.42 (4) | 3.176 (4) | 151 (7) |
| Symmetry codes: (i) −x, −y+2, −z+1; (ii) −x+1, −y+2, −z+1; (iii) −x+1, −y+1, −z+1; (iv) x, y−1, z+1; (v) x, y+1, z. |
Acknowledgements
This work was supported by the Key Project of the Natural Science Foundation of Heilongjiang Province (No. ZD200903), the Innovation Team of the Education Bureau of Heilongjiang Province (No. 2010 t d03), the Key Project of the Education Bureau of Heilongjiang Province (No. 12511z023) and the University of Malaya.
References
Barbour, L. J. (2001). J. Supramol. Chem. 1, 189–191. CrossRef CAS Google Scholar
Deng, Z.-P., Gao, S. & Ng, S. W. (2006). Acta Cryst. E62, m3423–m3424. Web of Science CSD CrossRef IUCr Journals Google Scholar
Higashi, T. (1995). ABSCOR. Rigaku Corporation, Tokyo, Japan. Google Scholar
Rigaku (1998). RAPID-AUTO. Rigaku Corporation, Tokyo, Japan. Google Scholar
Rigaku/MSC (2002). CrystalClear. Rigaku/MSC Inc., The Woodlands, Texas, USA. Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Westrip, S. P. (2010). J. Appl. Cryst. 43, 920–925. Web of Science CrossRef CAS IUCr Journals Google Scholar
Zhang, L.-W., Gao, S. & Ng, S. W. (2011). Acta Cryst. E67, m1520. Web of Science CSD CrossRef IUCr Journals Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
![[P \overline 1] Mathematical equation](teximages/bt5664fi1.gif)
![[Figure 1]](./bt5664fig1thm.gif)




First-row transition metal dications form a plethora of metal dicarboxylates; however, occasionally, no direct metal–carboxylate bond is formed, and the product consists of hexaaquametal cations and carboxylate ions, the anion interacting indirectly in an outer-sphere type of coordination. 4-(Pyridin-2-ylmethoxy)benzoic acid is a commercially available carboxylic acid but there are no reports on its metal carboxylates. The reaction of the deprotonated acid with cobalt(II) ions gives the hexaaquacobalt(II) salt (Scheme I, Fig. 1). The CoII atom in the salt lies on a center-of-inversion in an octahedron of water molecules. The metal atom interacts with the carboxylate ion indirectly, through the coordinated water molecules, in an outer-sphere type of coordination. The cations, anions and lattice water molecules are linked by O···H···O and O–H···N hydrogen bonds into a three-dimensional network (Table 1).