metal-organic compounds
Pentaaqua(5-carboxypyridine-2-carboxylato-κ2N,O2)(pyridine-2,5-dicarboxylato-κ2N,O2)cerium(III) tetrahydrate
aInstitute of Environmental and Municipal Engineering, North China University of Water Conservancy and Electric Power, Zhengzhou 450011, People's Republic of China, and bHenan Museum, Zhengzhou 450001, People's Republic of China
*Correspondence e-mail: [email protected]
In the title compound, [Ce(C7H3NO4)(C7H4NO4)(H2O)5]·4H2O, the Ce3+ ion is nine-coordinated by two O atoms and two N atoms from one single and from one double deprotonated pyridine-2,5-dicarboxylate ligand and five water molecules in a distorted monocapped square-antiprismatic geometry. In the crystal, extensive O—H⋯O hydrogen-bonding interactions result in a three-dimensional supramolecular architecture.
Related literature
For luminescent lanthanide complexes, see: Faulkner & Pope (2003
). For carboxylic complexes of lanthanides, see: Cao et al. (2002
). For a related europium structure, see: Song et al. (2005
).
Experimental
Crystal data
|
Refinement
|
|
Data collection: SMART (Bruker, 2001
); cell refinement: SAINT-Plus (Bruker, 2001
); data reduction: SAINT-Plus; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: PLATON (Spek, 2009
); software used to prepare material for publication: PLATON.
Supporting information
contains datablocks global, I. DOI: 10.1107/S1600536811052688/ez2275sup1.cif
Structure factors: contains datablock I. DOI: 10.1107/S1600536811052688/ez2275Isup2.hkl
All reagents were commercially available and of analytical grade. The mixture of Ce(NO3)3.6H2O (0.25 mmol, 0.109 g) and 2,5-pyridinedicarboxylic acid (0.5 mmol, 0.084 g) was dissolved in 20 ml H2O, and the mixture was adjusted to pH = 4.5 using NaOH solution. The mixture was stirred and refluxed at 80 °C for one hour. The resulting solution was filtered and the filtrate evaporated at room temperature. Two weeks later, colorless block crystals of (I) were obtained.
The H atoms bonded to water were located in a difference synthesis and refined with distance restraints of O—H = 0.83 (1) Å and H···H = 1.37 (2) Å. The hydroxy H atom (H7) was located in a difference Fourier map and refined with an O—H distance of 0.82 (1) Å. All the remaining H atoms were positioned geometrically, with C—H = 0.93 Å, and were refined as riding with Uiso(H) = 1.2Ueq(C).
Data collection: SMART (Bruker, 2001); cell SAINT-Plus (Bruker, 2001); data reduction: SAINT-Plus (Bruker, 2001); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: PLATON (Spek, 2009); software used to prepare material for publication: PLATON (Spek, 2009).
| [Ce(C7H3NO4)(C7H4NO4)(H2O)5]·4H2O | F(000) = 2536 |
| Mr = 633.48 | Dx = 1.863 Mg m−3 |
| Monoclinic, C2/c | Mo Kα radiation, λ = 0.71073 Å |
| Hall symbol: -C 2yc | Cell parameters from 2168 reflections |
| a = 14.0652 (10) Å | θ = 2.6–22.7° |
| b = 9.6485 (7) Å | µ = 2.10 mm−1 |
| c = 33.345 (2) Å | T = 296 K |
| β = 93.650 (1)° | Block, colorless |
| V = 4516.0 (6) Å3 | 0.36 × 0.24 × 0.17 mm |
| Z = 8 |
| Bruker SMART APEX CCD diffractometer | 3961 independent reflections |
| Radiation source: fine-focus sealed tube | 3705 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.019 |
| phi and ω scans | θmax = 25.0°, θmin = 2.5° |
| Absorption correction: multi-scan (SADABS; Sheldrick, 2001) | h = −16→12 |
| Tmin = 0.518, Tmax = 0.716 | k = −11→11 |
| 11155 measured reflections | l = −38→39 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.021 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.050 | H atoms treated by a mixture of independent and constrained refinement |
| S = 1.07 | w = 1/[σ2(Fo2) + (0.0224P)2 + 6.9052P] where P = (Fo2 + 2Fc2)/3 |
| 3961 reflections | (Δ/σ)max = 0.002 |
| 383 parameters | Δρmax = 0.45 e Å−3 |
| 28 restraints | Δρmin = −0.50 e Å−3 |
| [Ce(C7H3NO4)(C7H4NO4)(H2O)5]·4H2O | V = 4516.0 (6) Å3 |
| Mr = 633.48 | Z = 8 |
| Monoclinic, C2/c | Mo Kα radiation |
| a = 14.0652 (10) Å | µ = 2.10 mm−1 |
| b = 9.6485 (7) Å | T = 296 K |
| c = 33.345 (2) Å | 0.36 × 0.24 × 0.17 mm |
| β = 93.650 (1)° |
| Bruker SMART APEX CCD diffractometer | 3961 independent reflections |
| Absorption correction: multi-scan (SADABS; Sheldrick, 2001) | 3705 reflections with I > 2σ(I) |
| Tmin = 0.518, Tmax = 0.716 | Rint = 0.019 |
| 11155 measured reflections |
| R[F2 > 2σ(F2)] = 0.021 | 28 restraints |
| wR(F2) = 0.050 | H atoms treated by a mixture of independent and constrained refinement |
| S = 1.07 | Δρmax = 0.45 e Å−3 |
| 3961 reflections | Δρmin = −0.50 e Å−3 |
| 383 parameters |
Geometry. All e.s.d.'s (except the e.s.d. in the dihedral angle between two l.s. planes) are estimated using the full covariance matrix. The cell e.s.d.'s are taken into account individually in the estimation of e.s.d.'s in distances, angles and torsion angles; correlations between e.s.d.'s in cell parameters are only used when they are defined by crystal symmetry. An approximate (isotropic) treatment of cell e.s.d.'s is used for estimating e.s.d.'s involving l.s. planes. |
Refinement. Refinement of F2 against ALL reflections. The weighted R-factor wR and goodness of fit S are based on F2, conventional R-factors R are based on F, with F set to zero for negative F2. The threshold expression of F2 > σ(F2) is used only for calculating R-factors(gt) etc. and is not relevant to the choice of reflections for refinement. R-factors based on F2 are statistically about twice as large as those based on F, and R- factors based on ALL data will be even larger. |
| x | y | z | Uiso*/Ueq | ||
| Ce1 | 0.894634 (10) | −0.318396 (14) | 0.381434 (4) | 0.01818 (6) | |
| O1 | 0.97858 (13) | −0.54167 (19) | 0.38596 (5) | 0.0277 (4) | |
| O2 | 1.07372 (15) | −0.70191 (18) | 0.41446 (6) | 0.0304 (4) | |
| O3 | 1.10159 (16) | −0.0673 (2) | 0.53150 (6) | 0.0372 (5) | |
| O4 | 1.17536 (16) | −0.2284 (2) | 0.56975 (6) | 0.0370 (5) | |
| O5 | 0.88653 (14) | −0.15016 (18) | 0.32391 (5) | 0.0285 (4) | |
| O6 | 0.87079 (16) | −0.08997 (19) | 0.25957 (5) | 0.0357 (5) | |
| O7 | 0.88037 (18) | −0.8380 (2) | 0.27999 (6) | 0.0374 (5) | |
| O8 | 0.85018 (17) | −0.79869 (19) | 0.21507 (6) | 0.0385 (5) | |
| N1 | 1.02240 (15) | −0.3588 (2) | 0.44467 (6) | 0.0211 (5) | |
| N2 | 0.87500 (15) | −0.4203 (2) | 0.30610 (6) | 0.0212 (5) | |
| C1 | 1.04597 (19) | −0.2665 (3) | 0.47348 (8) | 0.0235 (6) | |
| H1A | 1.0159 | −0.1805 | 0.4724 | 0.028* | |
| C2 | 1.11345 (19) | −0.2927 (3) | 0.50507 (8) | 0.0229 (6) | |
| C3 | 1.1603 (2) | −0.4173 (3) | 0.50519 (8) | 0.0295 (6) | |
| H3A | 1.2068 | −0.4375 | 0.5254 | 0.035* | |
| C4 | 1.1381 (2) | −0.5126 (3) | 0.47515 (8) | 0.0300 (6) | |
| H4A | 1.1702 | −0.5968 | 0.4746 | 0.036* | |
| C5 | 1.06761 (18) | −0.4811 (3) | 0.44591 (7) | 0.0202 (5) | |
| C6 | 1.1322 (2) | −0.1883 (3) | 0.53826 (8) | 0.0253 (6) | |
| C7 | 1.03803 (18) | −0.5827 (3) | 0.41309 (7) | 0.0219 (6) | |
| C8 | 0.87469 (19) | −0.3296 (3) | 0.27554 (8) | 0.0209 (5) | |
| C9 | 0.8724 (2) | −0.3706 (3) | 0.23619 (8) | 0.0307 (7) | |
| H9A | 0.8722 | −0.3052 | 0.2157 | 0.037* | |
| C10 | 0.8705 (2) | −0.5100 (3) | 0.22733 (8) | 0.0316 (7) | |
| H10A | 0.8691 | −0.5399 | 0.2008 | 0.038* | |
| C11 | 0.87054 (19) | −0.6052 (3) | 0.25841 (8) | 0.0231 (6) | |
| C12 | 0.87281 (18) | −0.5545 (3) | 0.29736 (7) | 0.0228 (6) | |
| H12A | 0.8728 | −0.6177 | 0.3184 | 0.027* | |
| C13 | 0.87783 (19) | −0.1775 (3) | 0.28743 (8) | 0.0222 (6) | |
| C14 | 0.86649 (19) | −0.7566 (3) | 0.24921 (8) | 0.0237 (6) | |
| O1W | 0.92616 (16) | −0.0802 (2) | 0.40398 (6) | 0.0348 (5) | |
| H1WA | 0.939 (2) | −0.024 (2) | 0.3864 (6) | 0.039 (10)* | |
| H1WB | 0.911 (2) | −0.037 (3) | 0.4241 (6) | 0.049 (10)* | |
| O2W | 0.81108 (15) | −0.2775 (2) | 0.44579 (6) | 0.0351 (5) | |
| H2WA | 0.7607 (14) | −0.313 (3) | 0.4527 (9) | 0.048 (11)* | |
| H2WB | 0.837 (2) | −0.235 (4) | 0.4650 (8) | 0.074 (14)* | |
| O3W | 0.78056 (16) | −0.5204 (2) | 0.38981 (7) | 0.0369 (5) | |
| H3WA | 0.7345 (15) | −0.528 (3) | 0.3730 (7) | 0.041 (10)* | |
| H3WB | 0.796 (2) | −0.5992 (18) | 0.3977 (10) | 0.060 (12)* | |
| O4W | 1.05648 (15) | −0.2898 (2) | 0.35667 (7) | 0.0334 (5) | |
| H4WA | 1.076 (2) | −0.2140 (18) | 0.3486 (10) | 0.042 (10)* | |
| H4WB | 1.1030 (15) | −0.339 (3) | 0.3637 (11) | 0.052 (11)* | |
| O5W | 0.72275 (14) | −0.2396 (2) | 0.36277 (6) | 0.0329 (5) | |
| H5WA | 0.6985 (19) | −0.254 (4) | 0.3399 (4) | 0.044 (10)* | |
| H5WB | 0.6823 (18) | −0.240 (4) | 0.3798 (7) | 0.056 (12)* | |
| O6W | 0.64591 (16) | −0.3678 (3) | 0.47916 (7) | 0.0428 (5) | |
| H6WA | 0.611 (2) | −0.333 (3) | 0.4610 (9) | 0.065 (13)* | |
| H6WB | 0.626 (3) | −0.444 (2) | 0.4860 (13) | 0.099 (18)* | |
| O7W | 0.62864 (17) | −0.5498 (2) | 0.33125 (8) | 0.0420 (5) | |
| H7WA | 0.5957 (19) | −0.486 (2) | 0.3394 (8) | 0.034 (10)* | |
| H7WB | 0.639 (3) | −0.539 (4) | 0.3073 (5) | 0.104 (19)* | |
| O8W | 0.99039 (18) | 0.1264 (2) | 0.35587 (7) | 0.0412 (5) | |
| H8WA | 1.001 (3) | 0.192 (2) | 0.3712 (9) | 0.061 (13)* | |
| H8WB | 0.948 (2) | 0.143 (3) | 0.3385 (8) | 0.060 (13)* | |
| O9W | 1.22355 (19) | −0.4211 (3) | 0.37170 (9) | 0.0614 (8) | |
| H9WA | 1.253 (2) | −0.387 (3) | 0.3916 (7) | 0.057 (12)* | |
| H9WB | 1.242 (3) | −0.5001 (19) | 0.3673 (11) | 0.076 (15)* | |
| H7 | 0.872 (3) | −0.9185 (19) | 0.2726 (13) | 0.092 (16)* |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Ce1 | 0.02396 (9) | 0.01492 (9) | 0.01536 (9) | 0.00190 (6) | −0.00097 (6) | −0.00118 (6) |
| O1 | 0.0359 (11) | 0.0211 (9) | 0.0247 (10) | 0.0035 (8) | −0.0088 (8) | −0.0039 (8) |
| O2 | 0.0415 (12) | 0.0176 (10) | 0.0313 (11) | 0.0075 (8) | −0.0046 (9) | −0.0043 (8) |
| O3 | 0.0661 (15) | 0.0216 (11) | 0.0231 (10) | 0.0080 (10) | −0.0039 (10) | −0.0027 (8) |
| O4 | 0.0574 (14) | 0.0276 (11) | 0.0237 (11) | 0.0007 (10) | −0.0157 (10) | −0.0027 (9) |
| O5 | 0.0482 (12) | 0.0171 (9) | 0.0197 (10) | −0.0011 (8) | −0.0015 (9) | −0.0011 (8) |
| O6 | 0.0706 (15) | 0.0152 (9) | 0.0207 (10) | −0.0017 (9) | −0.0025 (10) | 0.0026 (8) |
| O7 | 0.0731 (16) | 0.0152 (10) | 0.0222 (11) | −0.0016 (10) | −0.0101 (10) | −0.0005 (9) |
| O8 | 0.0713 (16) | 0.0210 (11) | 0.0220 (11) | 0.0018 (10) | −0.0055 (10) | −0.0049 (8) |
| N1 | 0.0262 (12) | 0.0199 (11) | 0.0167 (11) | 0.0053 (9) | −0.0028 (9) | −0.0024 (9) |
| N2 | 0.0299 (12) | 0.0148 (11) | 0.0186 (11) | 0.0009 (9) | −0.0013 (9) | −0.0001 (9) |
| C1 | 0.0297 (15) | 0.0191 (13) | 0.0212 (13) | 0.0062 (11) | −0.0021 (11) | −0.0022 (11) |
| C2 | 0.0283 (14) | 0.0203 (13) | 0.0202 (13) | −0.0014 (11) | 0.0015 (11) | −0.0005 (11) |
| C3 | 0.0358 (16) | 0.0270 (15) | 0.0242 (14) | 0.0074 (12) | −0.0102 (12) | −0.0016 (12) |
| C4 | 0.0383 (16) | 0.0230 (15) | 0.0276 (15) | 0.0116 (12) | −0.0059 (12) | −0.0025 (12) |
| C5 | 0.0251 (13) | 0.0184 (13) | 0.0171 (13) | 0.0015 (10) | 0.0011 (10) | 0.0012 (10) |
| C6 | 0.0333 (15) | 0.0220 (14) | 0.0205 (14) | −0.0038 (12) | 0.0018 (12) | −0.0008 (11) |
| C7 | 0.0264 (14) | 0.0200 (14) | 0.0194 (13) | 0.0008 (11) | 0.0027 (11) | 0.0010 (11) |
| C8 | 0.0256 (14) | 0.0166 (13) | 0.0205 (13) | 0.0003 (10) | 0.0002 (11) | 0.0011 (10) |
| C9 | 0.0567 (19) | 0.0186 (14) | 0.0170 (14) | −0.0001 (13) | 0.0035 (13) | 0.0031 (11) |
| C10 | 0.0559 (19) | 0.0238 (15) | 0.0150 (13) | −0.0010 (13) | 0.0005 (13) | −0.0034 (11) |
| C11 | 0.0299 (14) | 0.0178 (13) | 0.0215 (13) | 0.0015 (11) | −0.0003 (11) | −0.0020 (11) |
| C12 | 0.0338 (15) | 0.0164 (13) | 0.0179 (13) | 0.0007 (11) | −0.0006 (11) | 0.0029 (10) |
| C13 | 0.0273 (14) | 0.0163 (13) | 0.0227 (14) | 0.0012 (10) | 0.0001 (11) | 0.0001 (11) |
| C14 | 0.0291 (14) | 0.0213 (14) | 0.0203 (14) | 0.0008 (11) | −0.0022 (11) | −0.0008 (11) |
| O1W | 0.0619 (14) | 0.0211 (10) | 0.0218 (11) | −0.0011 (10) | 0.0059 (10) | −0.0045 (9) |
| O2W | 0.0323 (12) | 0.0480 (14) | 0.0254 (11) | −0.0050 (10) | 0.0057 (9) | −0.0072 (10) |
| O3W | 0.0375 (13) | 0.0286 (12) | 0.0431 (13) | −0.0053 (10) | −0.0086 (10) | 0.0091 (10) |
| O4W | 0.0310 (12) | 0.0286 (12) | 0.0412 (12) | 0.0020 (10) | 0.0078 (10) | 0.0096 (10) |
| O5W | 0.0303 (11) | 0.0440 (13) | 0.0238 (11) | 0.0048 (10) | −0.0025 (9) | −0.0030 (10) |
| O6W | 0.0406 (13) | 0.0395 (14) | 0.0476 (15) | 0.0021 (11) | −0.0033 (11) | 0.0162 (12) |
| O7W | 0.0461 (14) | 0.0355 (13) | 0.0439 (14) | −0.0044 (11) | −0.0002 (11) | 0.0143 (11) |
| O8W | 0.0617 (16) | 0.0291 (12) | 0.0316 (12) | −0.0064 (11) | −0.0068 (11) | −0.0066 (10) |
| O9W | 0.0550 (16) | 0.0467 (16) | 0.078 (2) | 0.0185 (13) | −0.0337 (14) | −0.0271 (15) |
| Ce1—O1W | 2.4493 (19) | C4—H4A | 0.9300 |
| Ce1—O1 | 2.4566 (18) | C5—C7 | 1.508 (4) |
| Ce1—O4W | 2.486 (2) | C8—C9 | 1.369 (4) |
| Ce1—O5 | 2.5098 (18) | C8—C13 | 1.520 (3) |
| Ce1—O2W | 2.542 (2) | C9—C10 | 1.377 (4) |
| Ce1—O3W | 2.551 (2) | C9—H9A | 0.9300 |
| Ce1—O5W | 2.573 (2) | C10—C11 | 1.384 (4) |
| Ce1—N2 | 2.695 (2) | C10—H10A | 0.9300 |
| Ce1—N1 | 2.710 (2) | C11—C12 | 1.386 (4) |
| O1—C7 | 1.256 (3) | C11—C14 | 1.493 (4) |
| O2—C7 | 1.254 (3) | C12—H12A | 0.9300 |
| O3—C6 | 1.259 (3) | O1W—H1WA | 0.828 (10) |
| O4—C6 | 1.241 (3) | O1W—H1WB | 0.830 (10) |
| O5—C13 | 1.243 (3) | O2W—H2WA | 0.832 (10) |
| O6—C13 | 1.255 (3) | O2W—H2WB | 0.829 (10) |
| O7—C14 | 1.297 (3) | O3W—H3WA | 0.833 (10) |
| O7—H7 | 0.820 (10) | O3W—H3WB | 0.831 (10) |
| O8—C14 | 1.217 (3) | O4W—H4WA | 0.830 (10) |
| N1—C1 | 1.337 (3) | O4W—H4WB | 0.828 (10) |
| N1—C5 | 1.340 (3) | O5W—H5WA | 0.828 (10) |
| N2—C12 | 1.327 (3) | O5W—H5WB | 0.829 (10) |
| N2—C8 | 1.343 (3) | O6W—H6WA | 0.826 (10) |
| C1—C2 | 1.395 (4) | O6W—H6WB | 0.827 (10) |
| C1—H1A | 0.9300 | O7W—H7WA | 0.825 (10) |
| C2—C3 | 1.370 (4) | O7W—H7WB | 0.826 (10) |
| C2—C6 | 1.508 (4) | O8W—H8WA | 0.824 (10) |
| C3—C4 | 1.381 (4) | O8W—H8WB | 0.825 (10) |
| C3—H3A | 0.9300 | O9W—H9WA | 0.825 (10) |
| C4—C5 | 1.380 (4) | O9W—H9WB | 0.821 (10) |
| O1W—Ce1—O1 | 136.63 (7) | C4—C3—H3A | 120.1 |
| O1W—Ce1—O4W | 81.14 (7) | C5—C4—C3 | 119.0 (2) |
| O1—Ce1—O4W | 70.80 (7) | C5—C4—H4A | 120.5 |
| O1W—Ce1—O5 | 68.06 (6) | C3—C4—H4A | 120.5 |
| O1—Ce1—O5 | 127.76 (6) | N1—C5—C4 | 122.3 (2) |
| O4W—Ce1—O5 | 70.87 (7) | N1—C5—C7 | 116.2 (2) |
| O1W—Ce1—O2W | 71.32 (7) | C4—C5—C7 | 121.5 (2) |
| O1—Ce1—O2W | 109.29 (7) | O4—C6—O3 | 125.8 (3) |
| O4W—Ce1—O2W | 138.20 (7) | O4—C6—C2 | 117.7 (2) |
| O5—Ce1—O2W | 122.95 (7) | O3—C6—C2 | 116.5 (2) |
| O1W—Ce1—O3W | 141.81 (7) | O2—C7—O1 | 124.2 (2) |
| O1—Ce1—O3W | 68.07 (7) | O2—C7—C5 | 118.6 (2) |
| O4W—Ce1—O3W | 135.80 (7) | O1—C7—C5 | 117.2 (2) |
| O5—Ce1—O3W | 125.42 (7) | N2—C8—C9 | 122.5 (2) |
| O2W—Ce1—O3W | 72.45 (7) | N2—C8—C13 | 115.6 (2) |
| O1W—Ce1—O5W | 86.90 (7) | C9—C8—C13 | 121.8 (2) |
| O1—Ce1—O5W | 135.61 (7) | C8—C9—C10 | 119.1 (2) |
| O4W—Ce1—O5W | 138.86 (7) | C8—C9—H9A | 120.4 |
| O5—Ce1—O5W | 68.15 (7) | C10—C9—H9A | 120.4 |
| O2W—Ce1—O5W | 71.37 (7) | C9—C10—C11 | 119.2 (2) |
| O3W—Ce1—O5W | 70.39 (7) | C9—C10—H10A | 120.4 |
| O1W—Ce1—N2 | 129.35 (6) | C11—C10—H10A | 120.4 |
| O1—Ce1—N2 | 75.98 (6) | C10—C11—C12 | 117.8 (2) |
| O4W—Ce1—N2 | 76.86 (7) | C10—C11—C14 | 119.8 (2) |
| O5—Ce1—N2 | 61.75 (6) | C12—C11—C14 | 122.4 (2) |
| O2W—Ce1—N2 | 144.87 (7) | N2—C12—C11 | 123.3 (2) |
| O3W—Ce1—N2 | 78.20 (7) | N2—C12—H12A | 118.4 |
| O5W—Ce1—N2 | 80.99 (6) | C11—C12—H12A | 118.4 |
| O1W—Ce1—N1 | 78.35 (7) | O5—C13—O6 | 125.5 (2) |
| O1—Ce1—N1 | 62.21 (6) | O5—C13—C8 | 117.3 (2) |
| O4W—Ce1—N1 | 72.46 (7) | O6—C13—C8 | 117.2 (2) |
| O5—Ce1—N1 | 133.10 (7) | O8—C14—O7 | 123.3 (2) |
| O2W—Ce1—N1 | 71.63 (7) | O8—C14—C11 | 121.4 (2) |
| O3W—Ce1—N1 | 101.26 (7) | O7—C14—C11 | 115.3 (2) |
| O5W—Ce1—N1 | 142.85 (6) | Ce1—O1W—H1WA | 116 (2) |
| N2—Ce1—N1 | 134.12 (6) | Ce1—O1W—H1WB | 132 (2) |
| C7—O1—Ce1 | 128.03 (16) | H1WA—O1W—H1WB | 108 (2) |
| C13—O5—Ce1 | 127.41 (16) | Ce1—O2W—H2WA | 128 (2) |
| C14—O7—H7 | 109 (3) | Ce1—O2W—H2WB | 122 (2) |
| C1—N1—C5 | 118.0 (2) | H2WA—O2W—H2WB | 109 (2) |
| C1—N1—Ce1 | 125.81 (17) | Ce1—O3W—H3WA | 117 (2) |
| C5—N1—Ce1 | 116.15 (16) | Ce1—O3W—H3WB | 125 (2) |
| C12—N2—C8 | 118.1 (2) | H3WA—O3W—H3WB | 109 (2) |
| C12—N2—Ce1 | 124.06 (16) | Ce1—O4W—H4WA | 122 (2) |
| C8—N2—Ce1 | 117.68 (16) | Ce1—O4W—H4WB | 124 (2) |
| N1—C1—C2 | 123.2 (2) | H4WA—O4W—H4WB | 109 (2) |
| N1—C1—H1A | 118.4 | Ce1—O5W—H5WA | 120 (2) |
| C2—C1—H1A | 118.4 | Ce1—O5W—H5WB | 121 (2) |
| C3—C2—C1 | 117.7 (2) | H5WA—O5W—H5WB | 112 (2) |
| C3—C2—C6 | 121.5 (2) | H6WA—O6W—H6WB | 112 (2) |
| C1—C2—C6 | 120.8 (2) | H7WA—O7W—H7WB | 111 (2) |
| C2—C3—C4 | 119.7 (3) | H8WA—O8W—H8WB | 112 (2) |
| C2—C3—H3A | 120.1 | H9WA—O9W—H9WB | 111 (2) |
| D—H···A | D—H | H···A | D···A | D—H···A |
| O1W—H1WA···O8W | 0.83 (1) | 1.94 (1) | 2.747 (3) | 165 (3) |
| O1W—H1WB···O3i | 0.83 (1) | 1.81 (1) | 2.630 (3) | 170 (3) |
| O2W—H2WA···O6W | 0.83 (1) | 1.96 (1) | 2.779 (3) | 167 (3) |
| O2W—H2WB···O6Wii | 0.83 (1) | 2.11 (2) | 2.898 (3) | 159 (3) |
| O3W—H3WA···O7W | 0.83 (1) | 1.98 (1) | 2.816 (3) | 177 (3) |
| O3W—H3WB···O4iii | 0.83 (1) | 2.01 (1) | 2.823 (3) | 165 (4) |
| O4W—H4WA···O7Wiv | 0.83 (1) | 1.86 (1) | 2.687 (3) | 175 (3) |
| O4W—H4WB···O9W | 0.83 (1) | 1.88 (1) | 2.689 (3) | 166 (3) |
| O5W—H5WA···O8v | 0.83 (1) | 1.96 (1) | 2.789 (3) | 175 (3) |
| O5W—H5WB···O2vi | 0.83 (1) | 2.01 (1) | 2.821 (3) | 167 (4) |
| O6W—H6WA···O2vi | 0.83 (1) | 2.04 (2) | 2.823 (3) | 157 (3) |
| O6W—H6WB···O3vii | 0.83 (1) | 1.97 (3) | 2.698 (3) | 146 (4) |
| O7W—H7WA···O8Wvii | 0.83 (1) | 1.94 (1) | 2.747 (4) | 164 (3) |
| O7W—H7WB···O6viii | 0.83 (1) | 2.28 (2) | 3.054 (3) | 157 (5) |
| O7W—H7WB···O8v | 0.83 (1) | 2.45 (4) | 2.898 (3) | 115 (3) |
| O8W—H8WA···O2ix | 0.82 (1) | 2.00 (2) | 2.765 (3) | 155 (3) |
| O8W—H8WA···O1ix | 0.82 (1) | 2.64 (2) | 3.364 (3) | 148 (3) |
| O8W—H8WB···O7ix | 0.83 (1) | 2.12 (2) | 2.901 (3) | 158 (4) |
| O9W—H9WA···O4x | 0.83 (1) | 1.94 (1) | 2.750 (3) | 167 (4) |
| O9W—H9WB···O5Wxi | 0.82 (1) | 2.33 (2) | 3.087 (4) | 154 (4) |
| O7—H7···O6xii | 0.82 (1) | 1.71 (1) | 2.526 (3) | 173 (5) |
| Symmetry codes: (i) −x+2, −y, −z+1; (ii) −x+3/2, −y−1/2, −z+1; (iii) −x+2, −y−1, −z+1; (iv) x+1/2, y+1/2, z; (v) −x+3/2, y+1/2, −z+1/2; (vi) x−1/2, y+1/2, z; (vii) x−1/2, y−1/2, z; (viii) −x+3/2, y−1/2, −z+1/2; (ix) x, y+1, z; (x) −x+5/2, −y−1/2, −z+1; (xi) x+1/2, y−1/2, z; (xii) x, y−1, z. |
Experimental details
| Crystal data | |
| Chemical formula | [Ce(C7H3NO4)(C7H4NO4)(H2O)5]·4H2O |
| Mr | 633.48 |
| Crystal system, space group | Monoclinic, C2/c |
| Temperature (K) | 296 |
| a, b, c (Å) | 14.0652 (10), 9.6485 (7), 33.345 (2) |
| β (°) | 93.650 (1) |
| V (Å3) | 4516.0 (6) |
| Z | 8 |
| Radiation type | Mo Kα |
| µ (mm−1) | 2.10 |
| Crystal size (mm) | 0.36 × 0.24 × 0.17 |
| Data collection | |
| Diffractometer | Bruker SMART APEX CCD diffractometer |
| Absorption correction | Multi-scan (SADABS; Sheldrick, 2001) |
| Tmin, Tmax | 0.518, 0.716 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 11155, 3961, 3705 |
| Rint | 0.019 |
| (sin θ/λ)max (Å−1) | 0.595 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.021, 0.050, 1.07 |
| No. of reflections | 3961 |
| No. of parameters | 383 |
| No. of restraints | 28 |
| H-atom treatment | H atoms treated by a mixture of independent and constrained refinement |
| Δρmax, Δρmin (e Å−3) | 0.45, −0.50 |
Computer programs: SMART (Bruker, 2001), SAINT-Plus (Bruker, 2001), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), PLATON (Spek, 2009).
| D—H···A | D—H | H···A | D···A | D—H···A |
| O1W—H1WA···O8W | 0.828 (10) | 1.938 (13) | 2.747 (3) | 165 (3) |
| O1W—H1WB···O3i | 0.830 (10) | 1.808 (12) | 2.630 (3) | 170 (3) |
| O2W—H2WA···O6W | 0.832 (10) | 1.961 (13) | 2.779 (3) | 167 (3) |
| O2W—H2WB···O6Wii | 0.829 (10) | 2.107 (17) | 2.898 (3) | 159 (3) |
| O3W—H3WA···O7W | 0.833 (10) | 1.983 (11) | 2.816 (3) | 177 (3) |
| O3W—H3WB···O4iii | 0.831 (10) | 2.011 (13) | 2.823 (3) | 165 (4) |
| O4W—H4WA···O7Wiv | 0.830 (10) | 1.859 (11) | 2.687 (3) | 175 (3) |
| O4W—H4WB···O9W | 0.828 (10) | 1.877 (14) | 2.689 (3) | 166 (3) |
| O5W—H5WA···O8v | 0.828 (10) | 1.963 (11) | 2.789 (3) | 175 (3) |
| O5W—H5WB···O2vi | 0.829 (10) | 2.006 (14) | 2.821 (3) | 167 (4) |
| O6W—H6WA···O2vi | 0.826 (10) | 2.044 (16) | 2.823 (3) | 157 (3) |
| O6W—H6WB···O3vii | 0.827 (10) | 1.97 (3) | 2.698 (3) | 146 (4) |
| O7W—H7WA···O8Wvii | 0.825 (10) | 1.944 (13) | 2.747 (4) | 164 (3) |
| O7W—H7WB···O6viii | 0.826 (10) | 2.28 (2) | 3.054 (3) | 157 (5) |
| O7W—H7WB···O8v | 0.826 (10) | 2.45 (4) | 2.898 (3) | 115 (3) |
| O8W—H8WA···O2ix | 0.824 (10) | 1.996 (16) | 2.765 (3) | 155 (3) |
| O8W—H8WA···O1ix | 0.824 (10) | 2.64 (2) | 3.364 (3) | 148 (3) |
| O8W—H8WB···O7ix | 0.825 (10) | 2.121 (17) | 2.901 (3) | 158 (4) |
| O9W—H9WA···O4x | 0.825 (10) | 1.941 (13) | 2.750 (3) | 167 (4) |
| O9W—H9WB···O5Wxi | 0.821 (10) | 2.33 (2) | 3.087 (4) | 154 (4) |
| O7—H7···O6xii | 0.820 (10) | 1.711 (12) | 2.526 (3) | 173 (5) |
| Symmetry codes: (i) −x+2, −y, −z+1; (ii) −x+3/2, −y−1/2, −z+1; (iii) −x+2, −y−1, −z+1; (iv) x+1/2, y+1/2, z; (v) −x+3/2, y+1/2, −z+1/2; (vi) x−1/2, y+1/2, z; (vii) x−1/2, y−1/2, z; (viii) −x+3/2, y−1/2, −z+1/2; (ix) x, y+1, z; (x) −x+5/2, −y−1/2, −z+1; (xi) x+1/2, y−1/2, z; (xii) x, y−1, z. |
Acknowledgements
This work was supported financially by the North China University of Water Conservancy and Electric Power, China.
References
Bruker (2001). SAINT-Plus and SMART. Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
Cao, R., Sun, D. F., Liang, Y. C., Hong, M. C., Tatsumi, K. & Shi, Q. (2002). Inorg. Chem. 41, 2087–2094. Web of Science CSD CrossRef PubMed CAS Google Scholar
Faulkner, S. & Pope, S. A. P. (2003). J. Am. Chem. Soc. 125, 10526–10527. Web of Science CrossRef PubMed CAS Google Scholar
Sheldrick, G. M. (2001). SADABS. Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Song, Y., Yan, B. & Chen, Z. (2005). J. Coord. Chem. 58, 811–816. Web of Science CSD CrossRef CAS Google Scholar
Spek, A. L. (2009). Acta Cryst. D65, 148–155. Web of Science CrossRef CAS IUCr Journals Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
; (iii)
; (v)
; (vi)
; (vii)
; (viii)
; (ix)
; (xi)
; (xii) ![[Figure 1]](./ez2275fig1thm.gif)
![[Figure 2]](./ez2275fig2thm.gif)




The design and synthesis of luminescent lanthanide complexes have been attracting chemists' interest, because of their interesting photophysical properties and their potential application in sensors, optical fiber lasers and amplifiers, luminescent labels for biomolecular interactions, and as electroluminescent materials (Faulkner & Pope, 2003). During the past years, lots of such lanthanide compounds based on multifunctional carboxylic acid ligands have been reported (Cao et al., 2002). Herein, we report the title compound (I).
The title complex, Ce(C7H4NO4)(C7H3NO4)(H2O)5.4(H2O), presents a mononuclear molecular structure, which contains a Ce(C7H4NO4)(C7H3NO4)(H2O)5 molecule and four water molecules (Fig.1), and which is isostructural with its europium analogue (Song et al., 2005). In the molecular structure, the Ce atom resides in a distorted square antiprism geometry, which is defined by two oxygen atoms and two nitrogen atoms from two 2,5-pyridinedicarboxylate ligands and five water molecules. Two oxygen atoms from the two 2,5-pyridinedicarboxylate anions have bond distances of 2.4566 (18) Å [Ce(1)–O(1)] and 2.5098 (18) Å [Ce(1)–O(5)]. Two pyridine nitrogen atoms from the two dinic molecules have bond distances of 2.710 (2) Å [Ce(1)–N(1)] and 2.695 (2) Å [Ce(1)–N(2)]. Five oxygen atoms of the coordinated water molecules have Ce–O distances ranging from 2.449 (2) to 2.573 (2) Å. There are two 2,5-pyridinedicarboxylate anions per molecular unit: one is dianionic and the other must be monoprotonated to maintain electroneutrality.
In addition, the presence of many water molecules in the complex leads to numerous O—H···O hydrogen-bonding interactions including intra- and inter- hydrogen bonds (Fig.2, Table 1), which consolidate a stacked arrangement resulting in a three-dimensional supramolecular architecture.