metal-organic compounds
Diaquabis(N,N-diethylpyridine-3-carboxamide-κN1)bis{4-[2-(2,4-dioxopentan-3-ylidene)hydrazin-1-yl]benzoato-κO}copper(II)
aDepartment of Organic Chemistry, Baku State University, Baku, Azerbaijan, bDepartment of Chemistry, University of Malaya, 50603 Kuala Lumpur, Malaysia, and cChemistry Department, Faculty of Science, King Abdulaziz University, PO Box 80203 Jeddah, Saudi Arabia
*Correspondence e-mail: [email protected]
In the title compound, [Cu(C12H11N2O4)2(C10H14N2O)2(H2O)2], the CuII atom lies on a center of inversion and is coordinated by carboxylate O atoms, pyridine N atoms and two water molecules in an elongated octahedral geometry. The pyridine ring is oriented at a dihedral angle of 74.83 (12)° with respect to the benzene ring. Intramolecular O—H⋯O and N—H⋯O hydrogen bonding is observed. The water molecule is a hydrogen-bond donor to the carbonyl O atom of an adjacent carboxylate group, generating a chain running along the a axis. One of the ethyl groups is disordered over two sets of sites in a 0.787 (5):0.213 ratio.
Experimental
Crystal data
|
Refinement
|
| ||||||||||
| |||||||||||||||||||||||||||
Data collection: APEX2 (Bruker, 2005
); cell refinement: SAINT (Bruker, 2005
); data reduction: SAINT; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: X-SEED (Barbour, 2001
); software used to prepare material for publication: publCIF (Westrip, 2010
).
Supporting information
contains datablocks global, I. DOI: 10.1107/S1600536811056200/xu5431sup1.cif
Structure factors: contains datablock I. DOI: 10.1107/S1600536811056200/xu5431Isup2.hkl
4-[(2,4-Dioxopentan-3-yl)diazenyl]benzoic acid and N,N-diethylpyridine-3-carboxamide were purchased from a chemical supplier. The carboxylic acid (0.0248 g, 0.01 mol) in water (50 ml) and an excess of cardioamine (5 ml) were added to a solution of copper acetate hydrate (0.0156 g, 0.01 mol) in water (50 ml). The green solution was filtered and then set aside for the growth of crystals within a week; yield 70%.
Carbon-bound H-atoms were placed in calculated positions [C–H 0.93 to 0.98 Å; U(H) 1.2 to 1.5U(C)] and were included in the in the riding model approximation.
The water and amino- H-atoms were similarly positioned [O–H 0.84 and N–H 0.88 Å; U(H) 1.2 to 1.5U(N,O)].
Omitted were (0 0 1) and (1 1 0).
One of the ethyl chains of the neutral N-heterocycle is disordered over two positions in a 0.787 (5): 0.213 ratio. The pair of N–C distances were restrained to 0.01 Å of each other, and were the pair of C–C distances. The acetylacetate part of the substituted benzoate show somewhat elongated ellipsoids; the anisotropic temperature factors of these five atoms were restrained to be nearly isotropic.
Data collection: APEX2 (Bruker, 2005); cell SAINT (Bruker, 2005); data reduction: SAINT (Bruker, 2005); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: X-SEED (Barbour, 2001); software used to prepare material for publication: publCIF (Westrip, 2010).
| Fig. 1. Thermal ellipsoid plot (Barbour, 2001) of Cu(H2O)2(C10H14N2O)2(C12H11N2O4)2 at the 50% probability level; hydrogen atoms are drawn as spheres of arbitrary radius. The disorder is not shown. |
| [Cu(C12H11N2O4)2(C10H14N2O)2(H2O)2] | Z = 1 |
| Mr = 950.49 | F(000) = 499 |
| Triclinic, P1 | Dx = 1.371 Mg m−3 |
| Hall symbol: -P 1 | Mo Kα radiation, λ = 0.71073 Å |
| a = 7.7429 (4) Å | Cell parameters from 4939 reflections |
| b = 8.7029 (4) Å | θ = 2.6–28.4° |
| c = 19.0069 (9) Å | µ = 0.54 mm−1 |
| α = 85.695 (1)° | T = 296 K |
| β = 83.218 (1)° | Prism, blue |
| γ = 64.882 (1)° | 0.30 × 0.30 × 0.20 mm |
| V = 1151.12 (10) Å3 |
| Bruker SMART APEX diffractometer | 5775 independent reflections |
| Radiation source: fine-focus sealed tube | 4780 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.021 |
| ϕ and ω scans | θmax = 28.4°, θmin = 2.2° |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | h = −10→10 |
| Tmin = 0.854, Tmax = 0.899 | k = −11→11 |
| 13589 measured reflections | l = −25→25 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.046 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.134 | H-atom parameters constrained |
| S = 1.04 | w = 1/[σ2(Fo2) + (0.0788P)2 + 0.3231P] where P = (Fo2 + 2Fc2)/3 |
| 5775 reflections | (Δ/σ)max = 0.001 |
| 305 parameters | Δρmax = 0.87 e Å−3 |
| 38 restraints | Δρmin = −0.60 e Å−3 |
| [Cu(C12H11N2O4)2(C10H14N2O)2(H2O)2] | γ = 64.882 (1)° |
| Mr = 950.49 | V = 1151.12 (10) Å3 |
| Triclinic, P1 | Z = 1 |
| a = 7.7429 (4) Å | Mo Kα radiation |
| b = 8.7029 (4) Å | µ = 0.54 mm−1 |
| c = 19.0069 (9) Å | T = 296 K |
| α = 85.695 (1)° | 0.30 × 0.30 × 0.20 mm |
| β = 83.218 (1)° |
| Bruker SMART APEX diffractometer | 5775 independent reflections |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | 4780 reflections with I > 2σ(I) |
| Tmin = 0.854, Tmax = 0.899 | Rint = 0.021 |
| 13589 measured reflections |
| R[F2 > 2σ(F2)] = 0.046 | 38 restraints |
| wR(F2) = 0.134 | H-atom parameters constrained |
| S = 1.04 | Δρmax = 0.87 e Å−3 |
| 5775 reflections | Δρmin = −0.60 e Å−3 |
| 305 parameters |
| x | y | z | Uiso*/Ueq | Occ. (<1) | |
| Cu1 | 0.5000 | 0.5000 | 0.5000 | 0.03554 (14) | |
| O1 | 0.3598 (2) | 0.6157 (2) | 0.41786 (8) | 0.0404 (4) | |
| O2 | 0.5907 (3) | 0.6225 (3) | 0.33710 (10) | 0.0507 (4) | |
| O3 | −0.3219 (4) | 0.6427 (5) | 0.09450 (14) | 0.1056 (11) | |
| O4 | −0.1745 (8) | 0.8431 (10) | −0.0897 (2) | 0.227 (3) | |
| O5 | 0.1024 (3) | 0.1348 (3) | 0.40938 (10) | 0.0572 (5) | |
| O1W | 0.8200 (3) | 0.4833 (3) | 0.44344 (11) | 0.0595 (5) | |
| H11 | 0.8057 | 0.5337 | 0.4036 | 0.089* | |
| H12 | 0.8971 | 0.3811 | 0.4384 | 0.089* | |
| N1 | −0.0399 (3) | 0.6766 (3) | 0.13788 (11) | 0.0530 (6) | |
| H1 | −0.1407 | 0.6544 | 0.1492 | 0.064* | |
| N2 | −0.0036 (4) | 0.7205 (4) | 0.07303 (12) | 0.0596 (6) | |
| N3 | 0.5343 (3) | 0.2781 (2) | 0.46170 (9) | 0.0332 (4) | |
| N4 | 0.2425 (3) | 0.1170 (3) | 0.29832 (12) | 0.0548 (6) | |
| C1 | 0.4304 (3) | 0.6252 (3) | 0.35487 (12) | 0.0349 (4) | |
| C2 | 0.3041 (3) | 0.6390 (3) | 0.29785 (11) | 0.0344 (4) | |
| C3 | 0.1242 (3) | 0.6404 (3) | 0.31392 (11) | 0.0374 (5) | |
| H3 | 0.0787 | 0.6335 | 0.3610 | 0.045* | |
| C4 | 0.0114 (3) | 0.6519 (3) | 0.26069 (12) | 0.0415 (5) | |
| H4 | −0.1087 | 0.6515 | 0.2718 | 0.050* | |
| C5 | 0.0797 (4) | 0.6640 (3) | 0.19063 (12) | 0.0430 (5) | |
| C6 | 0.2596 (4) | 0.6615 (4) | 0.17352 (13) | 0.0491 (6) | |
| H6 | 0.3050 | 0.6687 | 0.1264 | 0.059* | |
| C7 | 0.3706 (4) | 0.6480 (4) | 0.22731 (12) | 0.0441 (5) | |
| H7 | 0.4922 | 0.6450 | 0.2161 | 0.053* | |
| C8 | −0.4004 (7) | 0.7049 (9) | −0.0225 (3) | 0.129 (2) | |
| H8A | −0.4899 | 0.6572 | −0.0064 | 0.193* | |
| H8B | −0.3189 | 0.6437 | −0.0625 | 0.193* | |
| H8C | −0.4689 | 0.8220 | −0.0361 | 0.193* | |
| C9 | −0.2808 (5) | 0.6920 (6) | 0.03616 (17) | 0.0761 (10) | |
| C10 | −0.1170 (4) | 0.7337 (5) | 0.02394 (15) | 0.0648 (8) | |
| C11 | −0.0650 (7) | 0.7972 (8) | −0.0451 (2) | 0.1111 (18) | |
| C12 | 0.1209 (7) | 0.8104 (8) | −0.0604 (2) | 0.1074 (16) | |
| H12A | 0.1154 | 0.8841 | −0.1012 | 0.161* | |
| H12B | 0.2216 | 0.6998 | −0.0697 | 0.161* | |
| H12C | 0.1460 | 0.8560 | −0.0203 | 0.161* | |
| C13 | 0.6999 (3) | 0.1395 (3) | 0.46307 (12) | 0.0377 (5) | |
| H13 | 0.7986 | 0.1436 | 0.4853 | 0.045* | |
| C14 | 0.7286 (4) | −0.0088 (3) | 0.43248 (14) | 0.0449 (5) | |
| H14 | 0.8446 | −0.1038 | 0.4347 | 0.054* | |
| C15 | 0.5843 (4) | −0.0161 (3) | 0.39847 (13) | 0.0432 (5) | |
| H15 | 0.6025 | −0.1147 | 0.3767 | 0.052* | |
| C16 | 0.4116 (3) | 0.1270 (3) | 0.39742 (11) | 0.0345 (4) | |
| C17 | 0.3914 (3) | 0.2698 (3) | 0.43054 (11) | 0.0342 (4) | |
| H17 | 0.2743 | 0.3644 | 0.4314 | 0.041* | |
| C18 | 0.2401 (3) | 0.1260 (3) | 0.36835 (12) | 0.0372 (5) | |
| C19 | 0.3737 (6) | 0.1654 (6) | 0.24655 (19) | 0.0557 (10) | 0.787 (5) |
| H19A | 0.4367 | 0.2170 | 0.2716 | 0.067* | 0.787 (5) |
| H19B | 0.2989 | 0.2488 | 0.2126 | 0.067* | 0.787 (5) |
| C19' | 0.4245 (16) | 0.0383 (16) | 0.2512 (7) | 0.056* | 0.213 (5) |
| H19C | 0.4122 | −0.0242 | 0.2134 | 0.067* | 0.213 (5) |
| H19D | 0.5315 | −0.0346 | 0.2774 | 0.067* | 0.213 (5) |
| C20 | 0.5230 (6) | 0.0140 (7) | 0.2076 (2) | 0.0766 (14) | 0.787 (5) |
| H20A | 0.6053 | 0.0494 | 0.1754 | 0.115* | 0.787 (5) |
| H20B | 0.4611 | −0.0353 | 0.1816 | 0.115* | 0.787 (5) |
| H20C | 0.5977 | −0.0686 | 0.2411 | 0.115* | 0.787 (5) |
| C20' | 0.439 (3) | 0.200 (2) | 0.2245 (11) | 0.077* | 0.213 (5) |
| H20D | 0.5386 | 0.2116 | 0.2463 | 0.115* | 0.213 (5) |
| H20E | 0.3193 | 0.2951 | 0.2361 | 0.115* | 0.213 (5) |
| H20F | 0.4691 | 0.1967 | 0.1740 | 0.115* | 0.213 (5) |
| C21 | 0.0848 (4) | 0.0938 (4) | 0.27090 (17) | 0.0589 (7) | |
| H21A | 0.0448 | 0.0222 | 0.3041 | 0.071* | |
| H21B | 0.1313 | 0.0360 | 0.2263 | 0.071* | |
| C22 | −0.0839 (5) | 0.2577 (5) | 0.2597 (2) | 0.0864 (12) | |
| H22A | −0.1821 | 0.2360 | 0.2419 | 0.130* | |
| H22B | −0.0458 | 0.3283 | 0.2261 | 0.130* | |
| H22C | −0.1323 | 0.3145 | 0.3039 | 0.130* |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Cu1 | 0.0516 (3) | 0.0368 (2) | 0.0268 (2) | −0.02437 (18) | −0.01424 (16) | 0.00124 (14) |
| O1 | 0.0516 (9) | 0.0441 (9) | 0.0290 (8) | −0.0215 (8) | −0.0134 (7) | 0.0016 (6) |
| O2 | 0.0466 (10) | 0.0675 (12) | 0.0454 (10) | −0.0294 (9) | −0.0143 (8) | 0.0039 (8) |
| O3 | 0.0876 (18) | 0.210 (4) | 0.0570 (15) | −0.099 (2) | −0.0132 (13) | 0.0126 (18) |
| O4 | 0.184 (4) | 0.498 (9) | 0.082 (2) | −0.224 (5) | −0.083 (3) | 0.115 (4) |
| O5 | 0.0441 (10) | 0.0895 (15) | 0.0458 (10) | −0.0355 (10) | −0.0040 (8) | −0.0016 (10) |
| O1W | 0.0570 (12) | 0.0683 (13) | 0.0441 (10) | −0.0167 (10) | −0.0075 (9) | −0.0026 (9) |
| N1 | 0.0507 (12) | 0.0858 (17) | 0.0326 (10) | −0.0375 (12) | −0.0123 (9) | 0.0053 (10) |
| N2 | 0.0576 (14) | 0.0968 (19) | 0.0350 (11) | −0.0416 (14) | −0.0148 (10) | 0.0078 (11) |
| N3 | 0.0383 (9) | 0.0379 (9) | 0.0295 (9) | −0.0203 (8) | −0.0083 (7) | −0.0015 (7) |
| N4 | 0.0488 (12) | 0.0846 (17) | 0.0400 (11) | −0.0339 (12) | −0.0082 (9) | −0.0130 (11) |
| C1 | 0.0445 (12) | 0.0303 (10) | 0.0326 (10) | −0.0164 (9) | −0.0117 (9) | 0.0010 (8) |
| C2 | 0.0416 (11) | 0.0357 (10) | 0.0283 (10) | −0.0175 (9) | −0.0088 (9) | 0.0011 (8) |
| C3 | 0.0415 (12) | 0.0445 (12) | 0.0265 (10) | −0.0183 (10) | −0.0045 (9) | 0.0014 (8) |
| C4 | 0.0389 (12) | 0.0551 (14) | 0.0337 (11) | −0.0228 (11) | −0.0056 (9) | 0.0023 (10) |
| C5 | 0.0456 (13) | 0.0589 (14) | 0.0300 (11) | −0.0259 (11) | −0.0113 (9) | 0.0023 (10) |
| C6 | 0.0511 (14) | 0.0775 (18) | 0.0263 (11) | −0.0347 (14) | −0.0050 (10) | 0.0025 (11) |
| C7 | 0.0432 (13) | 0.0639 (15) | 0.0329 (11) | −0.0303 (12) | −0.0062 (10) | 0.0045 (10) |
| C8 | 0.106 (3) | 0.240 (6) | 0.085 (3) | −0.110 (4) | −0.048 (3) | 0.023 (4) |
| C9 | 0.0617 (19) | 0.131 (3) | 0.0475 (17) | −0.050 (2) | −0.0140 (14) | −0.0019 (18) |
| C10 | 0.0590 (17) | 0.110 (3) | 0.0374 (14) | −0.0452 (18) | −0.0163 (12) | 0.0070 (15) |
| C11 | 0.101 (3) | 0.215 (6) | 0.051 (2) | −0.098 (4) | −0.033 (2) | 0.035 (3) |
| C12 | 0.105 (3) | 0.186 (5) | 0.061 (2) | −0.092 (3) | −0.014 (2) | 0.023 (3) |
| C13 | 0.0352 (11) | 0.0465 (12) | 0.0352 (11) | −0.0197 (10) | −0.0072 (9) | −0.0019 (9) |
| C14 | 0.0363 (12) | 0.0443 (12) | 0.0493 (14) | −0.0105 (10) | −0.0062 (10) | −0.0089 (10) |
| C15 | 0.0452 (13) | 0.0408 (12) | 0.0454 (13) | −0.0180 (10) | −0.0036 (10) | −0.0129 (10) |
| C16 | 0.0381 (11) | 0.0408 (11) | 0.0306 (10) | −0.0216 (9) | −0.0051 (8) | −0.0030 (8) |
| C17 | 0.0357 (11) | 0.0363 (10) | 0.0336 (10) | −0.0169 (9) | −0.0080 (9) | −0.0007 (8) |
| C18 | 0.0394 (12) | 0.0387 (11) | 0.0377 (11) | −0.0189 (9) | −0.0076 (9) | −0.0045 (9) |
| C19 | 0.063 (2) | 0.076 (3) | 0.0377 (17) | −0.038 (2) | −0.0095 (16) | 0.0061 (16) |
| C20 | 0.066 (3) | 0.101 (4) | 0.051 (2) | −0.026 (2) | 0.004 (2) | −0.001 (2) |
| C21 | 0.0562 (16) | 0.0630 (17) | 0.0628 (18) | −0.0236 (14) | −0.0216 (14) | −0.0170 (14) |
| C22 | 0.078 (2) | 0.076 (2) | 0.100 (3) | −0.0175 (19) | −0.039 (2) | −0.017 (2) |
| Cu1—O1 | 1.9661 (15) | C8—H8B | 0.9600 |
| Cu1—O1i | 1.9661 (15) | C8—H8C | 0.9600 |
| Cu1—N3 | 2.0151 (17) | C9—C10 | 1.450 (5) |
| Cu1—N3i | 2.0151 (17) | C10—C11 | 1.466 (5) |
| Cu1—O1W | 2.531 (2) | C11—C12 | 1.485 (6) |
| O1—C1 | 1.268 (3) | C12—H12A | 0.9600 |
| O2—C1 | 1.239 (3) | C12—H12B | 0.9600 |
| O3—C9 | 1.215 (4) | C12—H12C | 0.9600 |
| O4—C11 | 1.195 (5) | C13—C14 | 1.376 (3) |
| O5—C18 | 1.222 (3) | C13—H13 | 0.9300 |
| O1W—H11 | 0.8400 | C14—C15 | 1.380 (3) |
| O1W—H12 | 0.8400 | C14—H14 | 0.9300 |
| N1—N2 | 1.297 (3) | C15—C16 | 1.389 (3) |
| N1—C5 | 1.411 (3) | C15—H15 | 0.9300 |
| N1—H1 | 0.8800 | C16—C17 | 1.377 (3) |
| N2—C10 | 1.322 (3) | C16—C18 | 1.500 (3) |
| N3—C13 | 1.338 (3) | C17—H17 | 0.9300 |
| N3—C17 | 1.345 (3) | C19—C20 | 1.507 (6) |
| N4—C18 | 1.337 (3) | C19—H19A | 0.9700 |
| N4—C21 | 1.476 (3) | C19—H19B | 0.9700 |
| N4—C19' | 1.493 (10) | C19'—C20' | 1.506 (11) |
| N4—C19 | 1.497 (4) | C19'—H19C | 0.9700 |
| C1—C2 | 1.509 (3) | C19'—H19D | 0.9700 |
| C2—C3 | 1.386 (3) | C20—H20A | 0.9600 |
| C2—C7 | 1.387 (3) | C20—H20B | 0.9600 |
| C3—C4 | 1.384 (3) | C20—H20C | 0.9600 |
| C3—H3 | 0.9300 | C20'—H20D | 0.9600 |
| C4—C5 | 1.387 (3) | C20'—H20E | 0.9600 |
| C4—H4 | 0.9300 | C20'—H20F | 0.9600 |
| C5—C6 | 1.384 (4) | C21—C22 | 1.491 (4) |
| C6—C7 | 1.379 (3) | C21—H21A | 0.9700 |
| C6—H6 | 0.9300 | C21—H21B | 0.9700 |
| C7—H7 | 0.9300 | C22—H22A | 0.9600 |
| C8—C9 | 1.500 (5) | C22—H22B | 0.9600 |
| C8—H8A | 0.9600 | C22—H22C | 0.9600 |
| O1—Cu1—O1i | 180.00 (5) | C10—C11—C12 | 121.0 (3) |
| O1—Cu1—N3 | 88.22 (7) | C11—C12—H12A | 109.5 |
| O1i—Cu1—N3 | 91.78 (7) | C11—C12—H12B | 109.5 |
| O1—Cu1—N3i | 91.78 (7) | H12A—C12—H12B | 109.5 |
| O1i—Cu1—N3i | 88.22 (7) | C11—C12—H12C | 109.5 |
| N3—Cu1—N3i | 180.00 (9) | H12A—C12—H12C | 109.5 |
| O1—Cu1—O1W | 94.78 (7) | H12B—C12—H12C | 109.5 |
| O1i—Cu1—O1W | 85.22 (7) | N3—C13—C14 | 121.9 (2) |
| N3—Cu1—O1W | 94.61 (7) | N3—C13—H13 | 119.1 |
| N3i—Cu1—O1W | 85.39 (7) | C14—C13—H13 | 119.1 |
| C1—O1—Cu1 | 127.21 (15) | C13—C14—C15 | 119.7 (2) |
| Cu1—O1W—H11 | 109.5 | C13—C14—H14 | 120.2 |
| Cu1—O1W—H12 | 109.5 | C15—C14—H14 | 120.2 |
| H11—O1W—H12 | 109.5 | C14—C15—C16 | 118.6 (2) |
| N2—N1—C5 | 121.0 (2) | C14—C15—H15 | 120.7 |
| N2—N1—H1 | 119.5 | C16—C15—H15 | 120.7 |
| C5—N1—H1 | 119.5 | C17—C16—C15 | 118.5 (2) |
| N1—N2—C10 | 120.8 (3) | C17—C16—C18 | 118.7 (2) |
| C13—N3—C17 | 118.55 (18) | C15—C16—C18 | 122.47 (19) |
| C13—N3—Cu1 | 121.68 (14) | N3—C17—C16 | 122.6 (2) |
| C17—N3—Cu1 | 119.68 (15) | N3—C17—H17 | 118.7 |
| C18—N4—C21 | 118.4 (2) | C16—C17—H17 | 118.7 |
| C18—N4—C19' | 122.4 (6) | O5—C18—N4 | 122.2 (2) |
| C21—N4—C19' | 111.2 (6) | O5—C18—C16 | 119.0 (2) |
| C18—N4—C19 | 122.2 (2) | N4—C18—C16 | 118.8 (2) |
| C21—N4—C19 | 118.0 (2) | N4—C19—C20 | 111.8 (4) |
| O2—C1—O1 | 125.9 (2) | N4—C19—H19A | 109.3 |
| O2—C1—C2 | 118.8 (2) | C20—C19—H19A | 109.3 |
| O1—C1—C2 | 115.3 (2) | N4—C19—H19B | 109.3 |
| C3—C2—C7 | 118.9 (2) | C20—C19—H19B | 109.3 |
| C3—C2—C1 | 121.8 (2) | H19A—C19—H19B | 107.9 |
| C7—C2—C1 | 119.3 (2) | N4—C19'—C20' | 97.5 (11) |
| C4—C3—C2 | 120.8 (2) | N4—C19'—H19C | 112.3 |
| C4—C3—H3 | 119.6 | C20'—C19'—H19C | 112.3 |
| C2—C3—H3 | 119.6 | N4—C19'—H19D | 112.3 |
| C3—C4—C5 | 119.2 (2) | C20'—C19'—H19D | 112.3 |
| C3—C4—H4 | 120.4 | H19C—C19'—H19D | 109.9 |
| C5—C4—H4 | 120.4 | C19—C20—H20A | 109.5 |
| C6—C5—C4 | 120.9 (2) | C19—C20—H20B | 109.5 |
| C6—C5—N1 | 121.6 (2) | H20A—C20—H20B | 109.5 |
| C4—C5—N1 | 117.5 (2) | C19—C20—H20C | 109.5 |
| C7—C6—C5 | 119.0 (2) | H20A—C20—H20C | 109.5 |
| C7—C6—H6 | 120.5 | H20B—C20—H20C | 109.5 |
| C5—C6—H6 | 120.5 | C19'—C20'—H20D | 109.5 |
| C6—C7—C2 | 121.2 (2) | C19'—C20'—H20E | 109.5 |
| C6—C7—H7 | 119.4 | H20D—C20'—H20E | 109.5 |
| C2—C7—H7 | 119.4 | C19'—C20'—H20F | 109.5 |
| C9—C8—H8A | 109.5 | H20D—C20'—H20F | 109.5 |
| C9—C8—H8B | 109.5 | H20E—C20'—H20F | 109.5 |
| H8A—C8—H8B | 109.5 | N4—C21—C22 | 112.7 (3) |
| C9—C8—H8C | 109.5 | N4—C21—H21A | 109.1 |
| H8A—C8—H8C | 109.5 | C22—C21—H21A | 109.1 |
| H8B—C8—H8C | 109.5 | N4—C21—H21B | 109.1 |
| O3—C9—C10 | 120.1 (3) | C22—C21—H21B | 109.1 |
| O3—C9—C8 | 118.5 (4) | H21A—C21—H21B | 107.8 |
| C10—C9—C8 | 121.3 (3) | C21—C22—H22A | 109.5 |
| N2—C10—C9 | 124.0 (3) | C21—C22—H22B | 109.5 |
| N2—C10—C11 | 114.1 (3) | H22A—C22—H22B | 109.5 |
| C9—C10—C11 | 121.9 (3) | C21—C22—H22C | 109.5 |
| O4—C11—C10 | 120.1 (4) | H22A—C22—H22C | 109.5 |
| O4—C11—C12 | 118.8 (4) | H22B—C22—H22C | 109.5 |
| N3—Cu1—O1—C1 | −77.11 (18) | N2—C10—C11—O4 | −166.7 (7) |
| N3i—Cu1—O1—C1 | 102.89 (18) | C9—C10—C11—O4 | 12.6 (10) |
| O1W—Cu1—O1—C1 | 17.37 (18) | N2—C10—C11—C12 | 11.7 (7) |
| C5—N1—N2—C10 | −179.4 (3) | C9—C10—C11—C12 | −169.1 (5) |
| O1—Cu1—N3—C13 | 138.76 (18) | C17—N3—C13—C14 | 1.2 (3) |
| O1i—Cu1—N3—C13 | −41.24 (18) | Cu1—N3—C13—C14 | −175.28 (18) |
| O1W—Cu1—N3—C13 | 44.11 (18) | N3—C13—C14—C15 | 0.8 (4) |
| O1—Cu1—N3—C17 | −37.72 (17) | C13—C14—C15—C16 | −1.3 (4) |
| O1i—Cu1—N3—C17 | 142.28 (17) | C14—C15—C16—C17 | −0.2 (4) |
| O1W—Cu1—N3—C17 | −132.37 (16) | C14—C15—C16—C18 | −173.6 (2) |
| Cu1—O1—C1—O2 | −28.8 (3) | C13—N3—C17—C16 | −2.8 (3) |
| Cu1—O1—C1—C2 | 150.44 (15) | Cu1—N3—C17—C16 | 173.76 (16) |
| O2—C1—C2—C3 | 179.1 (2) | C15—C16—C17—N3 | 2.3 (3) |
| O1—C1—C2—C3 | −0.2 (3) | C18—C16—C17—N3 | 176.0 (2) |
| O2—C1—C2—C7 | 0.1 (3) | C21—N4—C18—O5 | −8.4 (4) |
| O1—C1—C2—C7 | −179.2 (2) | C19'—N4—C18—O5 | −154.6 (7) |
| C7—C2—C3—C4 | −0.5 (4) | C19—N4—C18—O5 | 158.5 (3) |
| C1—C2—C3—C4 | −179.5 (2) | C21—N4—C18—C16 | 172.2 (2) |
| C2—C3—C4—C5 | −0.7 (4) | C19'—N4—C18—C16 | 26.0 (7) |
| C3—C4—C5—C6 | 1.2 (4) | C19—N4—C18—C16 | −20.9 (4) |
| C3—C4—C5—N1 | −179.6 (2) | C17—C16—C18—O5 | −64.4 (3) |
| N2—N1—C5—C6 | −14.1 (4) | C15—C16—C18—O5 | 109.1 (3) |
| N2—N1—C5—C4 | 166.8 (3) | C17—C16—C18—N4 | 115.1 (3) |
| C4—C5—C6—C7 | −0.5 (4) | C15—C16—C18—N4 | −71.5 (3) |
| N1—C5—C6—C7 | −179.7 (3) | C18—N4—C19—C20 | 112.8 (4) |
| C5—C6—C7—C2 | −0.7 (4) | C21—N4—C19—C20 | −80.2 (4) |
| C3—C2—C7—C6 | 1.2 (4) | C19'—N4—C19—C20 | 9.6 (9) |
| C1—C2—C7—C6 | −179.7 (2) | C18—N4—C19'—C20' | −99.5 (11) |
| N1—N2—C10—C9 | −3.8 (6) | C21—N4—C19'—C20' | 112.1 (10) |
| N1—N2—C10—C11 | 175.4 (4) | C19—N4—C19'—C20' | 3.3 (9) |
| O3—C9—C10—N2 | 0.6 (7) | C18—N4—C21—C22 | 86.4 (4) |
| C8—C9—C10—N2 | −178.2 (4) | C19'—N4—C21—C22 | −123.8 (6) |
| O3—C9—C10—C11 | −178.6 (5) | C19—N4—C21—C22 | −81.0 (4) |
| C8—C9—C10—C11 | 2.7 (7) |
| Symmetry code: (i) −x+1, −y+1, −z+1. |
| D—H···A | D—H | H···A | D···A | D—H···A |
| N1—H1···O3 | 0.88 | 1.88 | 2.558 (3) | 132 |
| O1w—H11···O2 | 0.84 | 2.06 | 2.712 (3) | 135 |
| O1w—H12···O5ii | 0.84 | 2.12 | 2.955 (3) | 172 |
| Symmetry code: (ii) x+1, y, z. |
Experimental details
| Crystal data | |
| Chemical formula | [Cu(C12H11N2O4)2(C10H14N2O)2(H2O)2] |
| Mr | 950.49 |
| Crystal system, space group | Triclinic, P1 |
| Temperature (K) | 296 |
| a, b, c (Å) | 7.7429 (4), 8.7029 (4), 19.0069 (9) |
| α, β, γ (°) | 85.695 (1), 83.218 (1), 64.882 (1) |
| V (Å3) | 1151.12 (10) |
| Z | 1 |
| Radiation type | Mo Kα |
| µ (mm−1) | 0.54 |
| Crystal size (mm) | 0.30 × 0.30 × 0.20 |
| Data collection | |
| Diffractometer | Bruker SMART APEX diffractometer |
| Absorption correction | Multi-scan (SADABS; Sheldrick, 1996) |
| Tmin, Tmax | 0.854, 0.899 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 13589, 5775, 4780 |
| Rint | 0.021 |
| (sin θ/λ)max (Å−1) | 0.669 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.046, 0.134, 1.04 |
| No. of reflections | 5775 |
| No. of parameters | 305 |
| No. of restraints | 38 |
| H-atom treatment | H-atom parameters constrained |
| Δρmax, Δρmin (e Å−3) | 0.87, −0.60 |
Computer programs: APEX2 (Bruker, 2005), SAINT (Bruker, 2005), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), X-SEED (Barbour, 2001), publCIF (Westrip, 2010).
| D—H···A | D—H | H···A | D···A | D—H···A |
| N1—H1···O3 | 0.88 | 1.88 | 2.558 (3) | 132 |
| O1w—H11···O2 | 0.84 | 2.06 | 2.712 (3) | 135 |
| O1w—H12···O5i | 0.84 | 2.12 | 2.955 (3) | 172 |
| Symmetry code: (i) x+1, y, z. |
Acknowledgements
We thank Baku State University and the University of Malaya for supporting this study.
References
Barbour, L. J. (2001). J. Supramol. Chem. 1, 189–191. CrossRef CAS Google Scholar
Bruker (2005). APEX2 and SAINT. Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
Maharramov, A. M., Mardanova, V. I., Chyraqov, F., Gurbanov, A. V. & Ng, S. W. (2011). Acta Cryst. E67, m708–m709. Web of Science CSD CrossRef IUCr Journals Google Scholar
Sheldrick, G. M. (1996). SADABS. University of Göttingen, Germany. Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Westrip, S. P. (2010). J. Appl. Cryst. 43, 920–925. Web of Science CrossRef CAS IUCr Journals Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
![[P \overline 1] Mathematical equation](teximages/xu5431fi1.gif)
![[Figure 1]](./xu5431fig1thm.gif)




We have been investigating the adducts of 3-diethylpridine-3-carboxamide with copper(II) salts; a previous study reported the copper bis(thienoylacetonate) adduct (Maharramov et al., 2011). The reaction of the N-heterocycle with copper bis(4-[(2,4-dioxopentan-3-yl)diazenyl]benzoate yielded the title diaqua bis-adduct (Scheme I). The CuII atom in Cu(H2O)2(C10H14N2O)2(C12H11N2O4)2 lies on a center-of-inversion, and is coordinated to the O atom of the carboxylate ion, the N atom of the N-heterocycle and a water molecule in an all-trans octahedral geometry (Fig.1). The water molecule is hydrogen-bond donor to the the double-bond carbonyl O atom of adjacent carboxylate and N-heterocycle to generate a linear chain running along the a-axis of the triclinic unit cell (Table 1).