metal-organic compounds
1,1′-(Ethane-1,2-diyl)dipyridinium dichromate(VI)
aDepartment of Chemistry, Ferdowsi University of Mashhad, Mashhad 91779, Iran, bDepartment of Chemistry, Sabzevar Tarbiat Moallem University, Sabzevar, Iran, and cDepartment of Chemistry, University of California, San Diego, 9500 Gilman Drive, La Jolla, CA 92093, USA
*Correspondence e-mail: [email protected]
In the cation of the title salt, (C12H14N2)[Cr2O7], the two pyridinium moieties are in an anti orientation with respect to one another. The dihedral angle between the pyridine rings is 6.3 (2)°. The N—C—C—N torsion angle is 177.5 (2)°. In the dianion, the CrVI ions are in a slightly distorted tetrahedral coordination environment and the bond angles at the independent CrVI ions are in the ranges 105.93 (10)–110.60 (11) and 107.35 (11)–111.07 (12)°. The Cr—O—Cr angle is 127.96 (12)°. The crystal used was an with refined components of 0.510 (19) and 0.490 (19).
Related literature
For the crystal structures of the salts with formula [C5H5NCH2CH2NC5H5]2+·2X− [X− = IO3−, IO4−], the preparation of 1,1′-(ethane-1,2-diyl)dipyridinium dibromide and the orientation of pyridine moieties, see: Gholizadeh, Maleki et al. (2011
); Gholizadeh, Hojati et al. (2011
). For dichromate salts, see: Lennartson & Håkansson (2009
); Averbuch-Pouchot et al. (1984
).
Experimental
Crystal data
|
Data collection: APEX2 (Bruker, 2005
); cell refinement: SAINT (Bruker, 2005
); data reduction: SAINT; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: SHELXTL (Sheldrick, 2008
); software used to prepare material for publication: SHELXTL and enCIFer (Allen et al., 2004
).
Supporting information
contains datablocks I, global. DOI: 10.1107/S1600536812005430/lh5410sup1.cif
Structure factors: contains datablock I. DOI: 10.1107/S1600536812005430/lh5410Isup2.hkl
1,1'-(ethane-1,2-diyl)dipyridinium dibromide was prepared according to the procedure reported by Gholizadeh, Maleki et al., 2011 and Gholizadeh, Hojati et al., 2011.
Preparation of title salt: To a solution of 1,1'-(ethane-1,2-diyl)dipyridinium dibromide (10 mmol) in H2O (25 ml), a solution of K2Cr2O7 (10 mmol) in H2O was added and stirred. After 1 h, the precipitate was filtered and washed with H2O. Orange crystals, suitable for X-ray crystallography, were obtained from a solution of the title salt in H2O at room temperature.
All H atoms were placed in their calculated positions and then refined using the riding model with atom—H lengths of 0.950 Å (CH) or 0.990 Å (CH2). Isotropic displacement parameters for these atoms were set to 1.20 times Ueq of the parent atoms.
Data collection: APEX2 (Bruker, 2005); cell SAINT (Bruker, 2005); data reduction: SAINT (Bruker, 2005); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: SHELXTL (Sheldrick, 2008); software used to prepare material for publication: SHELXTL (Sheldrick, 2008) and enCIFer (Allen et al., 2004).
| Fig. 1. The molecular structure of the title compound. Ellipsoids are given at the 50% probability level. |
| (C12H14N2)[Cr2O7] | F(000) = 408 |
| Mr = 402.25 | Dx = 1.774 Mg m−3 |
| Monoclinic, P21 | Mo Kα radiation, λ = 0.71073 Å |
| Hall symbol: P 2yb | Cell parameters from 3255 reflections |
| a = 8.2882 (4) Å | θ = 2.5–26.5° |
| b = 9.0722 (4) Å | µ = 1.48 mm−1 |
| c = 10.0179 (5) Å | T = 100 K |
| β = 91.882 (1)° | Block, orange |
| V = 752.86 (6) Å3 | 0.22 × 0.15 × 0.15 mm |
| Z = 2 |
| Bruker APEXII CCD diffractometer | 2628 independent reflections |
| Radiation source: fine-focus sealed tube | 2546 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.025 |
| ϕ and ω scans | θmax = 25.3°, θmin = 2.0° |
| Absorption correction: multi-scan (SADABS; Bruker, 2005) | h = −9→9 |
| Tmin = 0.737, Tmax = 0.808 | k = −10→10 |
| 5446 measured reflections | l = −12→12 |
| Refinement on F2 | Secondary atom site location: difference Fourier map |
| Least-squares matrix: full | Hydrogen site location: inferred from neighbouring sites |
| R[F2 > 2σ(F2)] = 0.027 | H-atom parameters constrained |
| wR(F2) = 0.067 | w = 1/[σ2(Fo2) + (0.0332P)2 + 0.2849P] where P = (Fo2 + 2Fc2)/3 |
| S = 1.04 | (Δ/σ)max = 0.001 |
| 2628 reflections | Δρmax = 0.47 e Å−3 |
| 209 parameters | Δρmin = −0.21 e Å−3 |
| 1 restraint | Absolute structure: Flack (1983), 1163 Friedel pairs |
| Primary atom site location: structure-invariant direct methods | Absolute structure parameter: 0.510 (19) |
| (C12H14N2)[Cr2O7] | V = 752.86 (6) Å3 |
| Mr = 402.25 | Z = 2 |
| Monoclinic, P21 | Mo Kα radiation |
| a = 8.2882 (4) Å | µ = 1.48 mm−1 |
| b = 9.0722 (4) Å | T = 100 K |
| c = 10.0179 (5) Å | 0.22 × 0.15 × 0.15 mm |
| β = 91.882 (1)° |
| Bruker APEXII CCD diffractometer | 2628 independent reflections |
| Absorption correction: multi-scan (SADABS; Bruker, 2005) | 2546 reflections with I > 2σ(I) |
| Tmin = 0.737, Tmax = 0.808 | Rint = 0.025 |
| 5446 measured reflections |
| R[F2 > 2σ(F2)] = 0.027 | H-atom parameters constrained |
| wR(F2) = 0.067 | Δρmax = 0.47 e Å−3 |
| S = 1.04 | Δρmin = −0.21 e Å−3 |
| 2628 reflections | Absolute structure: Flack (1983), 1163 Friedel pairs |
| 209 parameters | Absolute structure parameter: 0.510 (19) |
| 1 restraint |
Geometry. All e.s.d.'s (except the e.s.d. in the dihedral angle between two l.s. planes) are estimated using the full covariance matrix. The cell e.s.d.'s are taken into account individually in the estimation of e.s.d.'s in distances, angles and torsion angles; correlations between e.s.d.'s in cell parameters are only used when they are defined by crystal symmetry. An approximate (isotropic) treatment of cell e.s.d.'s is used for estimating e.s.d.'s involving l.s. planes. |
Refinement. Refinement of F2 against ALL reflections. The weighted R-factor wR and goodness of fit S are based on F2, conventional R-factors R are based on F, with F set to zero for negative F2. The threshold expression of F2 > σ(F2) is used only for calculating R-factors(gt) etc. and is not relevant to the choice of reflections for refinement. R-factors based on F2 are statistically about twice as large as those based on F, and R- factors based on ALL data will be even larger. |
| x | y | z | Uiso*/Ueq | ||
| Cr1 | 0.65538 (5) | 0.04259 (4) | 0.83530 (4) | 0.01584 (13) | |
| Cr2 | 0.35152 (5) | −0.03987 (5) | 0.64354 (4) | 0.01691 (13) | |
| O1 | 0.7936 (2) | 0.0097 (2) | 0.7300 (2) | 0.0250 (5) | |
| O2 | 0.7001 (2) | 0.1896 (2) | 0.9204 (2) | 0.0230 (5) | |
| O3 | 0.6343 (3) | −0.0968 (2) | 0.9351 (2) | 0.0241 (5) | |
| O4 | 0.4684 (3) | 0.0804 (2) | 0.7502 (2) | 0.0255 (5) | |
| O5 | 0.2177 (3) | −0.1216 (3) | 0.7304 (2) | 0.0312 (6) | |
| O6 | 0.4687 (3) | −0.1613 (2) | 0.5775 (2) | 0.0251 (5) | |
| O7 | 0.2677 (3) | 0.0602 (3) | 0.5277 (2) | 0.0294 (5) | |
| N1 | 0.2884 (3) | 0.3914 (3) | 0.6933 (2) | 0.0177 (6) | |
| N2 | 0.6566 (3) | 0.5863 (3) | 0.8330 (2) | 0.0165 (6) | |
| C1 | 0.1985 (4) | 0.3157 (4) | 0.7779 (3) | 0.0207 (7) | |
| H1 | 0.2448 | 0.2834 | 0.8608 | 0.025* | |
| C2 | 0.0391 (4) | 0.2840 (3) | 0.7460 (3) | 0.0213 (7) | |
| H2 | −0.0241 | 0.2291 | 0.8058 | 0.026* | |
| C3 | −0.0274 (4) | 0.3334 (4) | 0.6255 (3) | 0.0218 (7) | |
| H3 | −0.1367 | 0.3118 | 0.6015 | 0.026* | |
| C4 | 0.0658 (4) | 0.4138 (4) | 0.5407 (3) | 0.0224 (7) | |
| H4 | 0.0204 | 0.4503 | 0.4589 | 0.027* | |
| C5 | 0.2256 (4) | 0.4412 (4) | 0.5753 (3) | 0.0208 (7) | |
| H5 | 0.2913 | 0.4949 | 0.5164 | 0.025* | |
| C6 | 0.4621 (4) | 0.4188 (3) | 0.7282 (3) | 0.0193 (7) | |
| H6A | 0.5255 | 0.4160 | 0.6461 | 0.023* | |
| H6B | 0.5033 | 0.3406 | 0.7891 | 0.023* | |
| C7 | 0.4825 (3) | 0.5674 (4) | 0.7949 (3) | 0.0192 (7) | |
| H7A | 0.4468 | 0.6467 | 0.7328 | 0.023* | |
| H7B | 0.4164 | 0.5724 | 0.8753 | 0.023* | |
| C8 | 0.7158 (3) | 0.5188 (3) | 0.9456 (3) | 0.0179 (6) | |
| H8 | 0.6471 | 0.4605 | 0.9983 | 0.022* | |
| C9 | 0.8761 (4) | 0.5360 (4) | 0.9823 (3) | 0.0217 (6) | |
| H9 | 0.9189 | 0.4901 | 1.0611 | 0.026* | |
| C10 | 0.9750 (4) | 0.6206 (4) | 0.9038 (3) | 0.0219 (7) | |
| H10 | 1.0858 | 0.6328 | 0.9285 | 0.026* | |
| C11 | 0.9116 (4) | 0.6876 (4) | 0.7886 (3) | 0.0197 (7) | |
| H11 | 0.9783 | 0.7456 | 0.7339 | 0.024* | |
| C12 | 0.7493 (4) | 0.6681 (4) | 0.7551 (3) | 0.0197 (7) | |
| H12 | 0.7039 | 0.7129 | 0.6768 | 0.024* |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Cr1 | 0.0149 (2) | 0.0163 (3) | 0.0162 (2) | 0.0001 (2) | −0.00137 (17) | −0.0007 (2) |
| Cr2 | 0.0149 (2) | 0.0192 (3) | 0.0165 (2) | −0.0025 (2) | −0.00182 (17) | 0.0006 (2) |
| O1 | 0.0229 (11) | 0.0267 (13) | 0.0256 (11) | −0.0042 (9) | 0.0042 (9) | −0.0029 (10) |
| O2 | 0.0232 (12) | 0.0214 (12) | 0.0239 (13) | 0.0036 (9) | −0.0064 (9) | −0.0039 (10) |
| O3 | 0.0295 (12) | 0.0219 (12) | 0.0210 (11) | 0.0040 (10) | 0.0034 (9) | 0.0030 (10) |
| O4 | 0.0215 (11) | 0.0208 (12) | 0.0333 (13) | −0.0003 (9) | −0.0105 (9) | −0.0024 (10) |
| O5 | 0.0265 (13) | 0.0378 (15) | 0.0296 (13) | −0.0101 (11) | 0.0055 (10) | −0.0017 (11) |
| O6 | 0.0278 (12) | 0.0271 (13) | 0.0206 (11) | 0.0027 (10) | 0.0020 (9) | −0.0025 (10) |
| O7 | 0.0308 (12) | 0.0277 (13) | 0.0289 (11) | 0.0000 (10) | −0.0100 (9) | 0.0036 (11) |
| N1 | 0.0158 (13) | 0.0200 (14) | 0.0172 (12) | 0.0023 (11) | −0.0016 (10) | −0.0032 (11) |
| N2 | 0.0164 (13) | 0.0161 (14) | 0.0171 (12) | 0.0004 (10) | 0.0018 (10) | −0.0037 (11) |
| C1 | 0.0259 (17) | 0.0168 (16) | 0.0189 (15) | 0.0023 (14) | −0.0047 (12) | −0.0011 (14) |
| C2 | 0.0220 (16) | 0.0193 (16) | 0.0227 (16) | −0.0006 (13) | 0.0002 (12) | 0.0022 (14) |
| C3 | 0.0180 (16) | 0.0227 (17) | 0.0242 (16) | 0.0007 (13) | −0.0032 (12) | −0.0044 (14) |
| C4 | 0.0187 (16) | 0.0319 (19) | 0.0167 (14) | 0.0066 (14) | −0.0010 (12) | 0.0004 (14) |
| C5 | 0.0230 (16) | 0.0236 (18) | 0.0160 (14) | 0.0010 (14) | 0.0025 (11) | 0.0007 (14) |
| C6 | 0.0151 (14) | 0.0199 (16) | 0.0226 (15) | 0.0003 (12) | −0.0034 (12) | −0.0034 (13) |
| C7 | 0.0148 (15) | 0.0204 (16) | 0.0224 (15) | 0.0001 (13) | 0.0002 (11) | 0.0009 (14) |
| C8 | 0.0228 (15) | 0.0164 (16) | 0.0147 (14) | −0.0005 (13) | 0.0029 (11) | −0.0033 (12) |
| C9 | 0.0294 (16) | 0.0213 (16) | 0.0142 (13) | 0.0052 (15) | −0.0021 (11) | −0.0054 (14) |
| C10 | 0.0174 (15) | 0.0215 (17) | 0.0267 (17) | 0.0018 (14) | −0.0025 (12) | −0.0098 (15) |
| C11 | 0.0198 (15) | 0.0161 (15) | 0.0234 (17) | −0.0040 (12) | 0.0037 (12) | −0.0034 (13) |
| C12 | 0.0241 (17) | 0.0182 (16) | 0.0169 (15) | −0.0010 (14) | 0.0009 (12) | −0.0027 (13) |
| Cr1—O1 | 1.611 (2) | C3—H3 | 0.9500 |
| Cr1—O2 | 1.620 (2) | C4—C5 | 1.380 (4) |
| Cr1—O3 | 1.624 (2) | C4—H4 | 0.9500 |
| Cr1—O4 | 1.777 (2) | C5—H5 | 0.9500 |
| Cr2—O5 | 1.612 (2) | C6—C7 | 1.511 (4) |
| Cr2—O7 | 1.613 (2) | C6—H6A | 0.9900 |
| Cr2—O6 | 1.624 (2) | C6—H6B | 0.9900 |
| Cr2—O4 | 1.790 (2) | C7—H7A | 0.9900 |
| N1—C1 | 1.337 (4) | C7—H7B | 0.9900 |
| N1—C5 | 1.353 (4) | C8—C9 | 1.376 (4) |
| N1—C6 | 1.491 (4) | C8—H8 | 0.9500 |
| N2—C12 | 1.338 (4) | C9—C10 | 1.386 (4) |
| N2—C8 | 1.361 (4) | C9—H9 | 0.9500 |
| N2—C7 | 1.491 (3) | C10—C11 | 1.392 (4) |
| C1—C2 | 1.379 (4) | C10—H10 | 0.9500 |
| C1—H1 | 0.9500 | C11—C12 | 1.387 (4) |
| C2—C3 | 1.385 (4) | C11—H11 | 0.9500 |
| C2—H2 | 0.9500 | C12—H12 | 0.9500 |
| C3—C4 | 1.376 (5) | ||
| O1—Cr1—O2 | 110.01 (11) | N1—C5—C4 | 119.8 (3) |
| O1—Cr1—O3 | 110.60 (11) | N1—C5—H5 | 120.1 |
| O2—Cr1—O3 | 110.15 (11) | C4—C5—H5 | 120.1 |
| O1—Cr1—O4 | 110.43 (11) | N1—C6—C7 | 110.2 (2) |
| O2—Cr1—O4 | 105.93 (10) | N1—C6—H6A | 109.6 |
| O3—Cr1—O4 | 109.62 (11) | C7—C6—H6A | 109.6 |
| O5—Cr2—O7 | 111.07 (12) | N1—C6—H6B | 109.6 |
| O5—Cr2—O6 | 109.80 (13) | C7—C6—H6B | 109.6 |
| O7—Cr2—O6 | 109.78 (12) | H6A—C6—H6B | 108.1 |
| O5—Cr2—O4 | 109.08 (11) | N2—C7—C6 | 108.0 (2) |
| O7—Cr2—O4 | 107.35 (11) | N2—C7—H7A | 110.1 |
| O6—Cr2—O4 | 109.72 (10) | C6—C7—H7A | 110.1 |
| Cr1—O4—Cr2 | 127.96 (12) | N2—C7—H7B | 110.1 |
| C1—N1—C5 | 121.2 (3) | C6—C7—H7B | 110.1 |
| C1—N1—C6 | 119.4 (2) | H7A—C7—H7B | 108.4 |
| C5—N1—C6 | 119.3 (3) | N2—C8—C9 | 119.3 (3) |
| C12—N2—C8 | 122.4 (2) | N2—C8—H8 | 120.4 |
| C12—N2—C7 | 119.0 (2) | C9—C8—H8 | 120.4 |
| C8—N2—C7 | 118.7 (2) | C8—C9—C10 | 119.6 (3) |
| N1—C1—C2 | 120.7 (3) | C8—C9—H9 | 120.2 |
| N1—C1—H1 | 119.7 | C10—C9—H9 | 120.2 |
| C2—C1—H1 | 119.7 | C9—C10—C11 | 119.9 (3) |
| C1—C2—C3 | 119.0 (3) | C9—C10—H10 | 120.1 |
| C1—C2—H2 | 120.5 | C11—C10—H10 | 120.1 |
| C3—C2—H2 | 120.5 | C12—C11—C10 | 118.8 (3) |
| C4—C3—C2 | 119.6 (3) | C12—C11—H11 | 120.6 |
| C4—C3—H3 | 120.2 | C10—C11—H11 | 120.6 |
| C2—C3—H3 | 120.2 | N2—C12—C11 | 120.0 (3) |
| C3—C4—C5 | 119.6 (3) | N2—C12—H12 | 120.0 |
| C3—C4—H4 | 120.2 | C11—C12—H12 | 120.0 |
| C5—C4—H4 | 120.2 | ||
| O1—Cr1—O4—Cr2 | 62.94 (19) | C1—N1—C6—C7 | −94.5 (3) |
| O2—Cr1—O4—Cr2 | −177.98 (15) | C5—N1—C6—C7 | 86.8 (3) |
| O3—Cr1—O4—Cr2 | −59.16 (19) | C12—N2—C7—C6 | 100.0 (3) |
| O5—Cr2—O4—Cr1 | 94.27 (18) | C8—N2—C7—C6 | −79.6 (3) |
| O7—Cr2—O4—Cr1 | −145.29 (16) | N1—C6—C7—N2 | 177.5 (2) |
| O6—Cr2—O4—Cr1 | −26.04 (19) | C12—N2—C8—C9 | 0.7 (4) |
| C5—N1—C1—C2 | 1.1 (5) | C7—N2—C8—C9 | −179.7 (3) |
| C6—N1—C1—C2 | −177.6 (3) | N2—C8—C9—C10 | −0.5 (5) |
| N1—C1—C2—C3 | −0.8 (5) | C8—C9—C10—C11 | 0.0 (5) |
| C1—C2—C3—C4 | −0.5 (5) | C9—C10—C11—C12 | 0.2 (5) |
| C2—C3—C4—C5 | 1.6 (5) | C8—N2—C12—C11 | −0.5 (5) |
| C1—N1—C5—C4 | 0.0 (5) | C7—N2—C12—C11 | 179.9 (3) |
| C6—N1—C5—C4 | 178.7 (3) | C10—C11—C12—N2 | 0.1 (5) |
| C3—C4—C5—N1 | −1.3 (5) |
Experimental details
| Crystal data | |
| Chemical formula | (C12H14N2)[Cr2O7] |
| Mr | 402.25 |
| Crystal system, space group | Monoclinic, P21 |
| Temperature (K) | 100 |
| a, b, c (Å) | 8.2882 (4), 9.0722 (4), 10.0179 (5) |
| β (°) | 91.882 (1) |
| V (Å3) | 752.86 (6) |
| Z | 2 |
| Radiation type | Mo Kα |
| µ (mm−1) | 1.48 |
| Crystal size (mm) | 0.22 × 0.15 × 0.15 |
| Data collection | |
| Diffractometer | Bruker APEXII CCD diffractometer |
| Absorption correction | Multi-scan (SADABS; Bruker, 2005) |
| Tmin, Tmax | 0.737, 0.808 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 5446, 2628, 2546 |
| Rint | 0.025 |
| (sin θ/λ)max (Å−1) | 0.602 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.027, 0.067, 1.04 |
| No. of reflections | 2628 |
| No. of parameters | 209 |
| No. of restraints | 1 |
| H-atom treatment | H-atom parameters constrained |
| Δρmax, Δρmin (e Å−3) | 0.47, −0.21 |
| Absolute structure | Flack (1983), 1163 Friedel pairs |
| Absolute structure parameter | 0.510 (19) |
Computer programs: APEX2 (Bruker, 2005), SAINT (Bruker, 2005), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), SHELXTL (Sheldrick, 2008) and enCIFer (Allen et al., 2004).
Acknowledgements
Support of this investigation by Ferdowsi University of Mashhad is gratefully acknowledged.
References
Allen, F. H., Johnson, O., Shields, G. P., Smith, B. R. & Towler, M. (2004). J. Appl. Cryst. 37, 335–338. Web of Science CrossRef CAS IUCr Journals Google Scholar
Averbuch-Pouchot, M. T., El-Horr, N. & Guitel, J. C. (1984). Acta Cryst. C40, 725–728. CrossRef CAS Web of Science IUCr Journals Google Scholar
Bruker (2005). APEX2, SAINT and SADABS. Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
Flack, H. D. (1983). Acta Cryst. A39, 876–881. CrossRef CAS Web of Science IUCr Journals Google Scholar
Gholizadeh, M., Hojati, S. F., Pourayoubi, M., Maleki, B., Kia, M. & Notash, B. (2011). X-ray Struct. Anal. Online, 27, 47–48. CrossRef CAS Google Scholar
Gholizadeh, M., Maleki, B., Pourayoubi, M., Kia, M. & Notash, B. (2011). Acta Cryst. E67, o1614–o1615. Web of Science CSD CrossRef CAS IUCr Journals Google Scholar
Lennartson, A. & Håkansson, M. (2009). Acta Cryst. C65, m182–m184. Web of Science CSD CrossRef CAS IUCr Journals Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
![[Figure 1]](./lh5410fig1thm.gif)




In recently published papers, the structure determinations of [C5H5NCH2CH2NC5H5]2+.2X- [X- = IO3- (Gholizadeh, Maleki et al., 2011) and IO4- (Gholizadeh, Hojati et al., 2011)] have been investigated. Structure determination of the title salt, [C5H5NCH2CH2NC5H5]2+.Cr2O72- (Fig. 1), was performed as a part of a project on the synthesis of a new hybrid compound containing an organic cation and an inorganic oxidant anion.
In the dication, two pyridinium moieties are anti-oriented with respect to one another similar to those observed in the 1,1'-(ethane-1,2-diyl)dipyridinium salts with iodate and periodate counter ions (Gholizadeh, Maleki et al., 2011; Gholizadeh, Hojati et al., 2011). In the dianion, each CrVI ion is in a slightly distorted tetrahedral coordination environment. The two pyridinium fragments in the cation and the two CrO3 units in the anion are not symmetrically equivalent.
The Cr—O bonds (with lengths of 1.777 (2) & 1.790 (2) Å) in the Cr—O—Cr fragment are longer than the other Cr—O bonds (in the range of 1.611 (2) to 1.624 (2) Å). The bond lengths and angles in the dichromate anion are within the expected values in the reported dichromate salts (Lennartson & Håkansson, 2009; Averbuch-Pouchot et al., 1984).