organic compounds
accessN-(2,4-Dimethylphenyl)-2,2-diphenylacetamide
aX-ray Crystallography Unit, School of Physics, Universiti Sains Malaysia, 11800 USM, Penang, Malaysia, bDepartment of Studies in Chemistry, Mangalore University, Mangalagangotri 574 199, India, and cDepartment of Chemistry, P.A. College of Engineering, Nadupadavu, Montepadavu, PO, Mangalore 574 153, India
*Correspondence e-mail: [email protected]
The of the title compound, C22H21NO, consists of two crystallographically independent molecules (A and B). Each molecule contains two benzene rings and one dimethylbenzene ring. The dihedral angle between the two benzene rings is 87.75 (16)° in molecule A and 89.25 (16)° in molecule B. In molecule A, the dimethylbenzene ring forms dihedral angles of 89.65 (8) and 42.98 (11)° with the two benzene rings, whereas the corresponding angles are equal to 63.15 (7) and 58.67 (10)° in molecule B. An intramolecular C—H⋯O hydrogen bond generates an S(6) ring motif in each molecule. In the crystal, molecules are linked by bifurcated (N,C)—H⋯O hydrogen bonds, generating R21(6) ring motifs and forming infinite chains along the a axis. The crystal is further stabilized by C—H⋯π and π–π interactions with centroid–centroid distances of 3.8543 (18) and 3.930 (2) Å.
Related literature
For the structural similarity of N-substituted 2-arylacetamides to the lateral chain of natural benzylpenicillin, see: Mijin & Marinkovic (2006
); Mijin et al. (2008
). For the coordination abilities of amides, see: Wu et al. (2008
, 2010
). For related structures, see: Praveen et al. (2011a
,b
,c
); Fun et al. (2011a
,b
). For hydrogen-bond motifs, see: Bernstein et al. (1995
). For reference bond lengths, see: Allen et al. (1987
).
Experimental
Crystal data
|
Refinement
|
|
Data collection: APEX2 (Bruker, 2009
); cell refinement: SAINT (Bruker, 2009
); data reduction: SAINT; program(s) used to solve structure: SHELXTL (Sheldrick, 2008
); program(s) used to refine structure: SHELXTL; molecular graphics: SHELXTL; software used to prepare material for publication: SHELXTL and PLATON (Spek, 2009
).
Supporting information
contains datablocks global, I. DOI: https://doi.org/10.1107/S1600536812014079/ez2289sup1.cif
Structure factors: contains datablock I. DOI: https://doi.org/10.1107/S1600536812014079/ez2289Isup2.hkl
Supporting information file. DOI: https://doi.org/10.1107/S1600536812014079/ez2289Isup3.cml
Diphenylacetic acid (0.212 g, 1 mmol), 2,4-dimethylaniline (0.1 ml, 1 mmol) and 1-ethyl-3-(3-dimethylaminopropyl)-carbodiimide hydrochloride (1.0 g, 0.01 mol) were dissolved in dichloromethane (20 ml). The mixture was stirred in the presence of triethylamine at 273 K for about 3 h. The contents were poured into 100 ml of ice-cold aqueous hydrochloric acid with stirring which was then extracted thrice with dichloromethane. Organic layer was washed with saturated NaHCO3 solution and brine solution, dried and concentrated under reduced pressure to give the title compound (I). Single crystals were grown from methylene chloride and ethanol (1:1) mixture by the slow evaporation method (M.P.: 430–432 K).
Atom H1NA and H1NB were located from difference fourier map and refined freely [N—H = 0.88 (4) and 0.86 (5) Å]. The remaining H atoms were positioned geometrically [C—H = 0.95, 0.98 and 1.00 Å] and refined using a riding model with Uiso(H) = 1.2 or 1.5Ueq(C). A rotating group model was applied to the methyl group. Three outliers (-3 1 3), (4 - 1 6) and (1 - 1 13) were omitted.
N-Substituted 2-arylacetamides are very interesting compounds because of their structural similarity to the lateral chain of natural benzylpenicillin (Mijin & Marinkovic, 2006; Mijin et al., 2008). are also used as ligands due to their excellent coordination abilities (Wu et al., 2008, 2010). Crystal structures of some acetamide derivatives viz., N-(4-chloro-1,3-benzothiazol-2-yl)-2-(3-methylphenyl)acetamide monohydrate, N-(3-chloro-4-fluorophenyl)-2,2-diphenylacetamide and N-(3-chloro-4-fluorophenyl)-2-(naphthalen-1-yl)acetamide (Praveen et al., 2011a,b,c) have been reported. In continuation of our work on synthesis of (Fun et al., 2011a,b), we report herein the of the title compound (I).
The of the title compound consists of two crystallographically independent molecules (A and B) as shown in Fig. 1. Each molecule contains two benzene rings (C1–C6 & C8–C13) and one dimethylbenzene ring (C15–C22) [maximum deviation = 0.0185 (27) Å at atom C19A in molecule A and 0.0155 (21) Å at atom C21B in molecule B]. The dihedral angle between the two benzene rings is 87.75 (16)° in molecule A and 89.25 (16)° in molecule B. In molecule A, the dimethylbenzene ring forms dihedral angles of 89.65 (8) and 42.98 (11)° with the two benzene rings (C1–C6 and C8–C13 respectively), whereas the corresponding angles are equal to 63.15 (7) and 58.67 (10)° in molecule B. Bond lengths (Allen et al., 1987) and angles are within normal ranges and are comparable to related structures (Fun et al., 2011a,b). Intramolecular C9A—H9AA···O1A hydrogen bond (Table 1) generates an S(6) ring motif (Fig. 1; Bernstein et al., 1995) in molecule A, whereas the same ring motif is generated by C13B—H13B···O1B hydrogen bonds in molecule B.
In the crystal, molecules are linked by intermolecular bifurcated N1A—H1NA···O1B, N1B—H1NB···O1A, C7A—H7AA···O1B and C7B—H7BA···O1A hydrogen bonds (Table 1), generating R21(6) ring motifs and forming infinite chains along the a axis. The crystal is further stabilized by C—H···π interactions, involving Cg1, Cg4 and Cg5 which are the centroids of C1A–C6A, C1B–C6B and C8B–C13B rings, respectively. π—π interactions are also observed with Cg3···Cg3 and Cg6···Cg6 distances of 3.8543 (18) Å[symmetry code: –X,-Y,-Z] and 3.930 (2) Å[symmetry code: 1-X,1-Y,-Z], where Cg3 and Cg6 are the centroids of C15A–C20A and C15B–C20B, respectively.
For the structural similarity of N-substituted 2-arylacetamides to the lateral chain of natural benzylpenicillin, see: Mijin & Marinkovic (2006); Mijin et al. (2008). For the coordination abilities of see: Wu et al. (2008, 2010). For related structures, see: Praveen et al. (2011a,b,c); Fun et al. (2011a,b). For hydrogen-bond motifs, see: Bernstein et al. (1995). For reference bond lengths, see: Allen et al. (1987).
Data collection: APEX2 (Bruker, 2009); cell SAINT (Bruker, 2009); data reduction: SAINT (Bruker, 2009); program(s) used to solve structure: SHELXTL (Sheldrick, 2008); program(s) used to refine structure: SHELXTL (Sheldrick, 2008); molecular graphics: SHELXTL (Sheldrick, 2008); software used to prepare material for publication: SHELXTL (Sheldrick, 2008) and PLATON (Spek, 2009).
| C22H21NO | Z = 4 |
| Mr = 315.40 | F(000) = 672 |
| Triclinic, P1 | Dx = 1.212 Mg m−3 |
| Hall symbol: -P 1 | Mo Kα radiation, λ = 0.71073 Å |
| a = 9.5520 (9) Å | Cell parameters from 9946 reflections |
| b = 10.2011 (10) Å | θ = 2.3–32.3° |
| c = 17.9656 (17) Å | µ = 0.07 mm−1 |
| α = 91.030 (2)° | T = 100 K |
| β = 98.957 (2)° | Block, colourless |
| γ = 90.377 (2)° | 0.41 × 0.19 × 0.17 mm |
| V = 1728.9 (3) Å3 |
| Bruker APEX DUO CCD area-detector diffractometer | 7858 independent reflections |
| Radiation source: fine-focus sealed tube | 6570 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.040 |
| φ and ω scans | θmax = 27.5°, θmin = 2.0° |
| Absorption correction: multi-scan (SADABS; Bruker, 2009) | h = −12→12 |
| Tmin = 0.970, Tmax = 0.987 | k = −13→13 |
| 30869 measured reflections | l = −23→23 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.085 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.261 | H atoms treated by a mixture of independent and constrained refinement |
| S = 1.14 | w = 1/[σ2(Fo2) + (0.097P)2 + 5.029P] where P = (Fo2 + 2Fc2)/3 |
| 7858 reflections | (Δ/σ)max < 0.001 |
| 445 parameters | Δρmax = 0.61 e Å−3 |
| 0 restraints | Δρmin = −0.41 e Å−3 |
| C22H21NO | γ = 90.377 (2)° |
| Mr = 315.40 | V = 1728.9 (3) Å3 |
| Triclinic, P1 | Z = 4 |
| a = 9.5520 (9) Å | Mo Kα radiation |
| b = 10.2011 (10) Å | µ = 0.07 mm−1 |
| c = 17.9656 (17) Å | T = 100 K |
| α = 91.030 (2)° | 0.41 × 0.19 × 0.17 mm |
| β = 98.957 (2)° |
| Bruker APEX DUO CCD area-detector diffractometer | 7858 independent reflections |
| Absorption correction: multi-scan (SADABS; Bruker, 2009) | 6570 reflections with I > 2σ(I) |
| Tmin = 0.970, Tmax = 0.987 | Rint = 0.040 |
| 30869 measured reflections |
| R[F2 > 2σ(F2)] = 0.085 | 0 restraints |
| wR(F2) = 0.261 | H atoms treated by a mixture of independent and constrained refinement |
| S = 1.14 | Δρmax = 0.61 e Å−3 |
| 7858 reflections | Δρmin = −0.41 e Å−3 |
| 445 parameters |
Experimental. The crystal was placed in the cold stream of an Oxford Cryosystems Cobra open-flow nitrogen cryostat (Cosier & Glazer, 1986) operating at 100.0 (1) K. |
Geometry. All e.s.d.'s (except the e.s.d. in the dihedral angle between two l.s. planes) are estimated using the full covariance matrix. The cell e.s.d.'s are taken into account individually in the estimation of e.s.d.'s in distances, angles and torsion angles; correlations between e.s.d.'s in cell parameters are only used when they are defined by crystal symmetry. An approximate (isotropic) treatment of cell e.s.d.'s is used for estimating e.s.d.'s involving l.s. planes. |
Refinement. Refinement of F2 against ALL reflections. The weighted R-factor wR and goodness of fit S are based on F2, conventional R-factors R are based on F, with F set to zero for negative F2. The threshold expression of F2 > σ(F2) is used only for calculating R-factors(gt) etc. and is not relevant to the choice of reflections for refinement. R-factors based on F2 are statistically about twice as large as those based on F, and R- factors based on ALL data will be even larger. |
| x | y | z | Uiso*/Ueq | ||
| O1A | 0.2422 (2) | 0.2899 (2) | 0.22082 (12) | 0.0202 (5) | |
| N1A | 0.0206 (3) | 0.2282 (3) | 0.16612 (14) | 0.0173 (5) | |
| C1A | 0.0812 (3) | 0.1366 (3) | 0.3930 (2) | 0.0233 (6) | |
| H1AA | −0.0062 | 0.0995 | 0.3692 | 0.028* | |
| C2A | 0.1554 (4) | 0.0785 (3) | 0.4571 (2) | 0.0281 (7) | |
| H2AA | 0.1171 | 0.0032 | 0.4772 | 0.034* | |
| C3A | 0.2845 (4) | 0.1301 (3) | 0.49134 (18) | 0.0255 (7) | |
| H3AA | 0.3344 | 0.0902 | 0.5349 | 0.031* | |
| C4A | 0.3407 (4) | 0.2397 (3) | 0.46204 (18) | 0.0226 (6) | |
| H4AA | 0.4301 | 0.2743 | 0.4848 | 0.027* | |
| C5A | 0.2655 (3) | 0.2991 (3) | 0.39907 (17) | 0.0190 (6) | |
| H5AA | 0.3033 | 0.3753 | 0.3796 | 0.023* | |
| C6A | 0.1347 (3) | 0.2479 (3) | 0.36411 (16) | 0.0163 (6) | |
| C7A | 0.0518 (3) | 0.3118 (3) | 0.29485 (16) | 0.0159 (6) | |
| H7AA | −0.0467 | 0.2749 | 0.2878 | 0.019* | |
| C8A | 0.0405 (3) | 0.4598 (3) | 0.30493 (16) | 0.0166 (6) | |
| C9A | 0.1067 (4) | 0.5504 (3) | 0.26542 (19) | 0.0271 (7) | |
| H9AA | 0.1658 | 0.5209 | 0.2307 | 0.033* | |
| C10A | 0.0877 (4) | 0.6843 (4) | 0.2758 (2) | 0.0321 (8) | |
| H10A | 0.1340 | 0.7454 | 0.2484 | 0.039* | |
| C11A | 0.0020 (4) | 0.7286 (3) | 0.3260 (2) | 0.0273 (7) | |
| H11A | −0.0126 | 0.8199 | 0.3323 | 0.033* | |
| C12A | −0.0624 (4) | 0.6392 (3) | 0.3667 (2) | 0.0289 (7) | |
| H12A | −0.1192 | 0.6694 | 0.4024 | 0.035* | |
| C13A | −0.0448 (3) | 0.5061 (3) | 0.35622 (19) | 0.0238 (7) | |
| H13A | −0.0911 | 0.4455 | 0.3840 | 0.029* | |
| C14A | 0.1152 (3) | 0.2754 (3) | 0.22425 (16) | 0.0153 (5) | |
| C15A | 0.0619 (3) | 0.1939 (3) | 0.09481 (16) | 0.0173 (6) | |
| C16A | 0.0185 (3) | 0.2723 (3) | 0.03354 (17) | 0.0218 (6) | |
| H16A | −0.0384 | 0.3469 | 0.0389 | 0.026* | |
| C17A | 0.0588 (3) | 0.2413 (3) | −0.03656 (18) | 0.0247 (7) | |
| H17A | 0.0294 | 0.2954 | −0.0785 | 0.030* | |
| C18A | 0.1409 (3) | 0.1327 (3) | −0.04488 (17) | 0.0224 (6) | |
| C19A | 0.1815 (3) | 0.0544 (3) | 0.01743 (18) | 0.0215 (6) | |
| H19A | 0.2365 | −0.0213 | 0.0115 | 0.026* | |
| C20A | 0.1447 (3) | 0.0825 (3) | 0.08783 (17) | 0.0188 (6) | |
| C21A | 0.1879 (4) | 0.0999 (4) | −0.11911 (19) | 0.0303 (8) | |
| H21A | 0.1206 | 0.1363 | −0.1602 | 0.045* | |
| H21B | 0.1912 | 0.0044 | −0.1257 | 0.045* | |
| H21C | 0.2823 | 0.1375 | −0.1198 | 0.045* | |
| C22A | 0.1939 (4) | −0.0053 (3) | 0.15325 (19) | 0.0258 (7) | |
| H22A | 0.2083 | −0.0941 | 0.1343 | 0.039* | |
| H22B | 0.1220 | −0.0078 | 0.1866 | 0.039* | |
| H22C | 0.2832 | 0.0288 | 0.1813 | 0.039* | |
| O1B | 0.7412 (2) | 0.1999 (2) | 0.21860 (12) | 0.0192 (5) | |
| N1B | 0.5215 (3) | 0.2611 (3) | 0.16445 (14) | 0.0171 (5) | |
| C1B | 0.5909 (3) | 0.3858 (3) | 0.36734 (19) | 0.0216 (6) | |
| H1BA | 0.5300 | 0.4273 | 0.3280 | 0.026* | |
| C2B | 0.6464 (4) | 0.4580 (3) | 0.4319 (2) | 0.0250 (7) | |
| H2BA | 0.6213 | 0.5472 | 0.4370 | 0.030* | |
| C3B | 0.7388 (4) | 0.3989 (3) | 0.48871 (18) | 0.0259 (7) | |
| H3BA | 0.7778 | 0.4475 | 0.5327 | 0.031* | |
| C4B | 0.7732 (4) | 0.2688 (3) | 0.48044 (18) | 0.0255 (7) | |
| H4BA | 0.8368 | 0.2284 | 0.5190 | 0.031* | |
| C5B | 0.7163 (3) | 0.1959 (3) | 0.41661 (18) | 0.0215 (6) | |
| H5BA | 0.7411 | 0.1065 | 0.4120 | 0.026* | |
| C6B | 0.6232 (3) | 0.2537 (3) | 0.35958 (15) | 0.0155 (5) | |
| C7B | 0.5484 (3) | 0.1774 (3) | 0.29080 (16) | 0.0149 (5) | |
| H7BA | 0.4486 | 0.2093 | 0.2816 | 0.018* | |
| C8B | 0.5398 (3) | 0.0301 (3) | 0.30118 (15) | 0.0155 (5) | |
| C9B | 0.4277 (3) | −0.0183 (3) | 0.33470 (18) | 0.0209 (6) | |
| H9BA | 0.3620 | 0.0409 | 0.3511 | 0.025* | |
| C10B | 0.4114 (4) | −0.1520 (3) | 0.3442 (2) | 0.0267 (7) | |
| H10B | 0.3354 | −0.1835 | 0.3675 | 0.032* | |
| C11B | 0.5055 (4) | −0.2397 (3) | 0.3198 (2) | 0.0277 (7) | |
| H11B | 0.4936 | −0.3313 | 0.3257 | 0.033* | |
| C12B | 0.6170 (4) | −0.1927 (3) | 0.28682 (19) | 0.0275 (7) | |
| H12B | 0.6817 | −0.2526 | 0.2700 | 0.033* | |
| C13B | 0.6355 (3) | −0.0590 (3) | 0.27790 (18) | 0.0220 (6) | |
| H13B | 0.7134 | −0.0281 | 0.2559 | 0.026* | |
| C14B | 0.6141 (3) | 0.2129 (3) | 0.22130 (16) | 0.0150 (5) | |
| C15B | 0.5644 (3) | 0.3007 (3) | 0.09483 (16) | 0.0175 (6) | |
| C16B | 0.5224 (3) | 0.2252 (3) | 0.03030 (17) | 0.0221 (6) | |
| H16B | 0.4661 | 0.1488 | 0.0326 | 0.027* | |
| C17B | 0.5623 (4) | 0.2607 (4) | −0.03800 (18) | 0.0267 (7) | |
| H17B | 0.5340 | 0.2078 | −0.0819 | 0.032* | |
| C18B | 0.6432 (3) | 0.3733 (4) | −0.04225 (18) | 0.0249 (7) | |
| C19B | 0.6823 (3) | 0.4486 (3) | 0.02270 (19) | 0.0229 (6) | |
| H19B | 0.7368 | 0.5261 | 0.0198 | 0.028* | |
| C20B | 0.6451 (3) | 0.4153 (3) | 0.09239 (17) | 0.0198 (6) | |
| C21B | 0.6900 (4) | 0.4120 (4) | −0.1154 (2) | 0.0352 (9) | |
| H21D | 0.6675 | 0.5043 | −0.1251 | 0.053* | |
| H21E | 0.6405 | 0.3572 | −0.1567 | 0.053* | |
| H21F | 0.7925 | 0.3996 | −0.1118 | 0.053* | |
| C22B | 0.6906 (4) | 0.5003 (3) | 0.16090 (19) | 0.0266 (7) | |
| H22D | 0.7101 | 0.5894 | 0.1454 | 0.040* | |
| H22E | 0.7766 | 0.4645 | 0.1901 | 0.040* | |
| H22F | 0.6149 | 0.5028 | 0.1920 | 0.040* | |
| H1NA | −0.069 (4) | 0.224 (3) | 0.172 (2) | 0.015 (8)* | |
| H1NB | 0.434 (5) | 0.262 (4) | 0.171 (2) | 0.030 (11)* |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| O1A | 0.0105 (9) | 0.0352 (12) | 0.0149 (10) | −0.0014 (8) | 0.0022 (8) | −0.0017 (8) |
| N1A | 0.0088 (11) | 0.0310 (14) | 0.0120 (12) | −0.0012 (9) | 0.0017 (9) | −0.0047 (10) |
| C1A | 0.0153 (14) | 0.0243 (15) | 0.0304 (17) | −0.0004 (11) | 0.0034 (12) | 0.0034 (13) |
| C2A | 0.0234 (16) | 0.0298 (17) | 0.0338 (19) | 0.0040 (13) | 0.0117 (14) | 0.0122 (14) |
| C3A | 0.0277 (16) | 0.0323 (17) | 0.0171 (15) | 0.0087 (13) | 0.0046 (12) | 0.0042 (12) |
| C4A | 0.0251 (15) | 0.0241 (15) | 0.0176 (15) | 0.0040 (12) | 0.0006 (12) | −0.0024 (11) |
| C5A | 0.0214 (14) | 0.0184 (14) | 0.0167 (14) | 0.0007 (11) | 0.0014 (11) | −0.0012 (11) |
| C6A | 0.0148 (13) | 0.0218 (14) | 0.0131 (13) | 0.0024 (10) | 0.0044 (10) | −0.0005 (10) |
| C7A | 0.0084 (12) | 0.0256 (15) | 0.0141 (13) | −0.0003 (10) | 0.0030 (10) | −0.0006 (11) |
| C8A | 0.0093 (12) | 0.0274 (15) | 0.0121 (13) | 0.0011 (10) | −0.0013 (10) | 0.0014 (11) |
| C9A | 0.0295 (17) | 0.0312 (17) | 0.0234 (16) | −0.0005 (13) | 0.0125 (13) | 0.0030 (13) |
| C10A | 0.037 (2) | 0.0266 (17) | 0.0335 (19) | −0.0049 (14) | 0.0076 (15) | 0.0053 (14) |
| C11A | 0.0243 (16) | 0.0240 (16) | 0.0308 (18) | 0.0018 (12) | −0.0049 (13) | −0.0005 (13) |
| C12A | 0.0221 (16) | 0.0320 (18) | 0.0328 (19) | 0.0059 (13) | 0.0052 (14) | −0.0023 (14) |
| C13A | 0.0194 (15) | 0.0280 (16) | 0.0262 (16) | 0.0025 (12) | 0.0099 (12) | 0.0001 (13) |
| C14A | 0.0114 (12) | 0.0238 (14) | 0.0109 (13) | 0.0005 (10) | 0.0024 (10) | −0.0002 (10) |
| C15A | 0.0117 (12) | 0.0286 (15) | 0.0114 (13) | −0.0021 (11) | 0.0014 (10) | −0.0041 (11) |
| C16A | 0.0192 (14) | 0.0293 (16) | 0.0163 (14) | 0.0028 (12) | 0.0016 (11) | −0.0028 (12) |
| C17A | 0.0241 (16) | 0.0349 (18) | 0.0139 (14) | −0.0017 (13) | −0.0004 (12) | −0.0003 (12) |
| C18A | 0.0176 (14) | 0.0345 (17) | 0.0153 (14) | −0.0078 (12) | 0.0043 (11) | −0.0069 (12) |
| C19A | 0.0156 (14) | 0.0268 (16) | 0.0221 (15) | −0.0006 (11) | 0.0040 (11) | −0.0063 (12) |
| C20A | 0.0120 (13) | 0.0260 (15) | 0.0178 (14) | −0.0023 (11) | 0.0013 (10) | −0.0022 (11) |
| C21A | 0.0262 (17) | 0.046 (2) | 0.0197 (16) | −0.0060 (15) | 0.0089 (13) | −0.0096 (14) |
| C22A | 0.0242 (16) | 0.0276 (16) | 0.0244 (16) | 0.0021 (12) | 0.0004 (13) | 0.0010 (13) |
| O1B | 0.0102 (9) | 0.0326 (12) | 0.0149 (10) | −0.0001 (8) | 0.0023 (7) | 0.0016 (8) |
| N1B | 0.0094 (11) | 0.0297 (14) | 0.0125 (12) | 0.0004 (9) | 0.0027 (9) | 0.0034 (9) |
| C1B | 0.0173 (14) | 0.0231 (15) | 0.0239 (16) | 0.0006 (11) | 0.0021 (11) | 0.0009 (12) |
| C2B | 0.0233 (16) | 0.0210 (15) | 0.0322 (18) | −0.0007 (12) | 0.0101 (13) | −0.0050 (13) |
| C3B | 0.0305 (17) | 0.0308 (17) | 0.0159 (15) | −0.0051 (13) | 0.0035 (12) | −0.0064 (12) |
| C4B | 0.0273 (16) | 0.0314 (17) | 0.0167 (15) | −0.0003 (13) | 0.0001 (12) | 0.0023 (12) |
| C5B | 0.0246 (15) | 0.0203 (14) | 0.0192 (15) | 0.0018 (12) | 0.0018 (12) | 0.0007 (11) |
| C6B | 0.0135 (12) | 0.0234 (14) | 0.0105 (12) | −0.0017 (10) | 0.0052 (10) | −0.0014 (10) |
| C7B | 0.0110 (12) | 0.0216 (14) | 0.0123 (13) | 0.0011 (10) | 0.0023 (10) | −0.0002 (10) |
| C8B | 0.0115 (12) | 0.0228 (14) | 0.0111 (12) | −0.0001 (10) | −0.0013 (10) | −0.0003 (10) |
| C9B | 0.0186 (14) | 0.0240 (15) | 0.0211 (15) | 0.0008 (11) | 0.0061 (11) | 0.0002 (11) |
| C10B | 0.0252 (16) | 0.0282 (17) | 0.0272 (17) | −0.0048 (13) | 0.0052 (13) | 0.0055 (13) |
| C11B | 0.0344 (18) | 0.0190 (15) | 0.0271 (17) | −0.0022 (13) | −0.0029 (14) | 0.0004 (12) |
| C12B | 0.0305 (17) | 0.0274 (17) | 0.0241 (16) | 0.0080 (13) | 0.0029 (13) | −0.0039 (13) |
| C13B | 0.0201 (15) | 0.0276 (16) | 0.0191 (15) | 0.0040 (12) | 0.0058 (11) | 0.0001 (12) |
| C14B | 0.0122 (12) | 0.0200 (14) | 0.0125 (13) | −0.0011 (10) | 0.0010 (10) | −0.0003 (10) |
| C15B | 0.0101 (12) | 0.0298 (16) | 0.0128 (13) | 0.0018 (11) | 0.0016 (10) | 0.0045 (11) |
| C16B | 0.0160 (14) | 0.0330 (17) | 0.0165 (14) | −0.0026 (12) | −0.0001 (11) | 0.0015 (12) |
| C17B | 0.0236 (16) | 0.0416 (19) | 0.0141 (14) | 0.0036 (13) | 0.0005 (12) | 0.0005 (13) |
| C18B | 0.0183 (14) | 0.0414 (19) | 0.0167 (14) | 0.0093 (13) | 0.0068 (11) | 0.0108 (13) |
| C19B | 0.0136 (13) | 0.0318 (17) | 0.0242 (16) | 0.0019 (11) | 0.0042 (11) | 0.0096 (13) |
| C20B | 0.0140 (13) | 0.0276 (16) | 0.0176 (14) | 0.0014 (11) | 0.0015 (11) | 0.0043 (11) |
| C21B | 0.0275 (18) | 0.059 (2) | 0.0227 (17) | 0.0099 (16) | 0.0135 (14) | 0.0159 (16) |
| C22B | 0.0272 (17) | 0.0266 (16) | 0.0249 (17) | −0.0036 (13) | 0.0009 (13) | 0.0005 (13) |
| O1A—C14A | 1.233 (3) | O1B—C14B | 1.231 (3) |
| N1A—C14A | 1.350 (4) | N1B—C14B | 1.345 (4) |
| N1A—C15A | 1.436 (4) | N1B—C15B | 1.440 (4) |
| N1A—H1NA | 0.88 (4) | N1B—H1NB | 0.86 (5) |
| C1A—C6A | 1.384 (4) | C1B—C2B | 1.393 (5) |
| C1A—C2A | 1.398 (5) | C1B—C6B | 1.394 (4) |
| C1A—H1AA | 0.9500 | C1B—H1BA | 0.9500 |
| C2A—C3A | 1.385 (5) | C2B—C3B | 1.390 (5) |
| C2A—H2AA | 0.9500 | C2B—H2BA | 0.9500 |
| C3A—C4A | 1.385 (5) | C3B—C4B | 1.380 (5) |
| C3A—H3AA | 0.9500 | C3B—H3BA | 0.9500 |
| C4A—C5A | 1.393 (4) | C4B—C5B | 1.390 (4) |
| C4A—H4AA | 0.9500 | C4B—H4BA | 0.9500 |
| C5A—C6A | 1.401 (4) | C5B—C6B | 1.391 (4) |
| C5A—H5AA | 0.9500 | C5B—H5BA | 0.9500 |
| C6A—C7A | 1.526 (4) | C6B—C7B | 1.525 (4) |
| C7A—C8A | 1.523 (4) | C7B—C8B | 1.521 (4) |
| C7A—C14A | 1.529 (4) | C7B—C14B | 1.530 (4) |
| C7A—H7AA | 1.0000 | C7B—H7BA | 1.0000 |
| C8A—C9A | 1.383 (4) | C8B—C13B | 1.397 (4) |
| C8A—C13A | 1.400 (4) | C8B—C9B | 1.399 (4) |
| C9A—C10A | 1.392 (5) | C9B—C10B | 1.388 (5) |
| C9A—H9AA | 0.9500 | C9B—H9BA | 0.9500 |
| C10A—C11A | 1.381 (5) | C10B—C11B | 1.385 (5) |
| C10A—H10A | 0.9500 | C10B—H10B | 0.9500 |
| C11A—C12A | 1.380 (5) | C11B—C12B | 1.385 (5) |
| C11A—H11A | 0.9500 | C11B—H11B | 0.9500 |
| C12A—C13A | 1.383 (5) | C12B—C13B | 1.389 (5) |
| C12A—H12A | 0.9500 | C12B—H12B | 0.9500 |
| C13A—H13A | 0.9500 | C13B—H13B | 0.9500 |
| C15A—C16A | 1.385 (4) | C15B—C16B | 1.385 (4) |
| C15A—C20A | 1.404 (4) | C15B—C20B | 1.401 (4) |
| C16A—C17A | 1.404 (4) | C16B—C17B | 1.393 (4) |
| C16A—H16A | 0.9500 | C16B—H16B | 0.9500 |
| C17A—C18A | 1.381 (5) | C17B—C18B | 1.390 (5) |
| C17A—H17A | 0.9500 | C17B—H17B | 0.9500 |
| C18A—C19A | 1.394 (5) | C18B—C19B | 1.385 (5) |
| C18A—C21A | 1.505 (4) | C18B—C21B | 1.511 (4) |
| C19A—C20A | 1.390 (4) | C19B—C20B | 1.401 (4) |
| C19A—H19A | 0.9500 | C19B—H19B | 0.9500 |
| C20A—C22A | 1.508 (4) | C20B—C22B | 1.499 (4) |
| C21A—H21A | 0.9800 | C21B—H21D | 0.9800 |
| C21A—H21B | 0.9800 | C21B—H21E | 0.9800 |
| C21A—H21C | 0.9800 | C21B—H21F | 0.9800 |
| C22A—H22A | 0.9800 | C22B—H22D | 0.9800 |
| C22A—H22B | 0.9800 | C22B—H22E | 0.9800 |
| C22A—H22C | 0.9800 | C22B—H22F | 0.9800 |
| C14A—N1A—C15A | 121.6 (2) | C14B—N1B—C15B | 122.0 (2) |
| C14A—N1A—H1NA | 118 (2) | C14B—N1B—H1NB | 116 (3) |
| C15A—N1A—H1NA | 120 (2) | C15B—N1B—H1NB | 122 (3) |
| C6A—C1A—C2A | 120.2 (3) | C2B—C1B—C6B | 121.0 (3) |
| C6A—C1A—H1AA | 119.9 | C2B—C1B—H1BA | 119.5 |
| C2A—C1A—H1AA | 119.9 | C6B—C1B—H1BA | 119.5 |
| C3A—C2A—C1A | 120.4 (3) | C3B—C2B—C1B | 119.8 (3) |
| C3A—C2A—H2AA | 119.8 | C3B—C2B—H2BA | 120.1 |
| C1A—C2A—H2AA | 119.8 | C1B—C2B—H2BA | 120.1 |
| C4A—C3A—C2A | 119.9 (3) | C4B—C3B—C2B | 119.3 (3) |
| C4A—C3A—H3AA | 120.0 | C4B—C3B—H3BA | 120.4 |
| C2A—C3A—H3AA | 120.0 | C2B—C3B—H3BA | 120.4 |
| C3A—C4A—C5A | 119.6 (3) | C3B—C4B—C5B | 121.2 (3) |
| C3A—C4A—H4AA | 120.2 | C3B—C4B—H4BA | 119.4 |
| C5A—C4A—H4AA | 120.2 | C5B—C4B—H4BA | 119.4 |
| C4A—C5A—C6A | 120.9 (3) | C4B—C5B—C6B | 120.1 (3) |
| C4A—C5A—H5AA | 119.6 | C4B—C5B—H5BA | 119.9 |
| C6A—C5A—H5AA | 119.6 | C6B—C5B—H5BA | 119.9 |
| C1A—C6A—C5A | 118.9 (3) | C5B—C6B—C1B | 118.6 (3) |
| C1A—C6A—C7A | 119.8 (3) | C5B—C6B—C7B | 123.0 (3) |
| C5A—C6A—C7A | 121.3 (3) | C1B—C6B—C7B | 118.3 (3) |
| C8A—C7A—C6A | 112.4 (2) | C8B—C7B—C6B | 114.6 (2) |
| C8A—C7A—C14A | 111.8 (2) | C8B—C7B—C14B | 112.5 (2) |
| C6A—C7A—C14A | 110.6 (2) | C6B—C7B—C14B | 109.8 (2) |
| C8A—C7A—H7AA | 107.3 | C8B—C7B—H7BA | 106.4 |
| C6A—C7A—H7AA | 107.3 | C6B—C7B—H7BA | 106.4 |
| C14A—C7A—H7AA | 107.3 | C14B—C7B—H7BA | 106.4 |
| C9A—C8A—C13A | 118.4 (3) | C13B—C8B—C9B | 118.5 (3) |
| C9A—C8A—C7A | 124.0 (3) | C13B—C8B—C7B | 123.7 (3) |
| C13A—C8A—C7A | 117.6 (3) | C9B—C8B—C7B | 117.7 (3) |
| C8A—C9A—C10A | 120.8 (3) | C10B—C9B—C8B | 120.7 (3) |
| C8A—C9A—H9AA | 119.6 | C10B—C9B—H9BA | 119.6 |
| C10A—C9A—H9AA | 119.6 | C8B—C9B—H9BA | 119.6 |
| C11A—C10A—C9A | 120.3 (3) | C11B—C10B—C9B | 120.3 (3) |
| C11A—C10A—H10A | 119.9 | C11B—C10B—H10B | 119.8 |
| C9A—C10A—H10A | 119.9 | C9B—C10B—H10B | 119.8 |
| C12A—C11A—C10A | 119.4 (3) | C12B—C11B—C10B | 119.4 (3) |
| C12A—C11A—H11A | 120.3 | C12B—C11B—H11B | 120.3 |
| C10A—C11A—H11A | 120.3 | C10B—C11B—H11B | 120.3 |
| C11A—C12A—C13A | 120.6 (3) | C11B—C12B—C13B | 120.8 (3) |
| C11A—C12A—H12A | 119.7 | C11B—C12B—H12B | 119.6 |
| C13A—C12A—H12A | 119.7 | C13B—C12B—H12B | 119.6 |
| C12A—C13A—C8A | 120.5 (3) | C12B—C13B—C8B | 120.2 (3) |
| C12A—C13A—H13A | 119.7 | C12B—C13B—H13B | 119.9 |
| C8A—C13A—H13A | 119.7 | C8B—C13B—H13B | 119.9 |
| O1A—C14A—N1A | 123.1 (3) | O1B—C14B—N1B | 123.4 (3) |
| O1A—C14A—C7A | 122.3 (3) | O1B—C14B—C7B | 122.4 (2) |
| N1A—C14A—C7A | 114.6 (2) | N1B—C14B—C7B | 114.2 (2) |
| C16A—C15A—C20A | 121.0 (3) | C16B—C15B—C20B | 120.7 (3) |
| C16A—C15A—N1A | 118.8 (3) | C16B—C15B—N1B | 118.9 (3) |
| C20A—C15A—N1A | 120.2 (3) | C20B—C15B—N1B | 120.3 (3) |
| C15A—C16A—C17A | 119.8 (3) | C15B—C16B—C17B | 120.4 (3) |
| C15A—C16A—H16A | 120.1 | C15B—C16B—H16B | 119.8 |
| C17A—C16A—H16A | 120.1 | C17B—C16B—H16B | 119.8 |
| C18A—C17A—C16A | 120.4 (3) | C18B—C17B—C16B | 120.3 (3) |
| C18A—C17A—H17A | 119.8 | C18B—C17B—H17B | 119.8 |
| C16A—C17A—H17A | 119.8 | C16B—C17B—H17B | 119.8 |
| C17A—C18A—C19A | 118.6 (3) | C19B—C18B—C17B | 118.4 (3) |
| C17A—C18A—C21A | 121.1 (3) | C19B—C18B—C21B | 120.5 (3) |
| C19A—C18A—C21A | 120.3 (3) | C17B—C18B—C21B | 121.1 (3) |
| C20A—C19A—C18A | 122.7 (3) | C18B—C19B—C20B | 122.8 (3) |
| C20A—C19A—H19A | 118.7 | C18B—C19B—H19B | 118.6 |
| C18A—C19A—H19A | 118.7 | C20B—C19B—H19B | 118.6 |
| C19A—C20A—C15A | 117.5 (3) | C19B—C20B—C15B | 117.3 (3) |
| C19A—C20A—C22A | 120.0 (3) | C19B—C20B—C22B | 120.5 (3) |
| C15A—C20A—C22A | 122.5 (3) | C15B—C20B—C22B | 122.2 (3) |
| C18A—C21A—H21A | 109.5 | C18B—C21B—H21D | 109.5 |
| C18A—C21A—H21B | 109.5 | C18B—C21B—H21E | 109.5 |
| H21A—C21A—H21B | 109.5 | H21D—C21B—H21E | 109.5 |
| C18A—C21A—H21C | 109.5 | C18B—C21B—H21F | 109.5 |
| H21A—C21A—H21C | 109.5 | H21D—C21B—H21F | 109.5 |
| H21B—C21A—H21C | 109.5 | H21E—C21B—H21F | 109.5 |
| C20A—C22A—H22A | 109.5 | C20B—C22B—H22D | 109.5 |
| C20A—C22A—H22B | 109.5 | C20B—C22B—H22E | 109.5 |
| H22A—C22A—H22B | 109.5 | H22D—C22B—H22E | 109.5 |
| C20A—C22A—H22C | 109.5 | C20B—C22B—H22F | 109.5 |
| H22A—C22A—H22C | 109.5 | H22D—C22B—H22F | 109.5 |
| H22B—C22A—H22C | 109.5 | H22E—C22B—H22F | 109.5 |
| C6A—C1A—C2A—C3A | −1.4 (5) | C6B—C1B—C2B—C3B | 1.8 (5) |
| C1A—C2A—C3A—C4A | −0.1 (5) | C1B—C2B—C3B—C4B | −0.5 (5) |
| C2A—C3A—C4A—C5A | 1.3 (5) | C2B—C3B—C4B—C5B | −0.5 (5) |
| C3A—C4A—C5A—C6A | −1.2 (5) | C3B—C4B—C5B—C6B | 0.1 (5) |
| C2A—C1A—C6A—C5A | 1.5 (5) | C4B—C5B—C6B—C1B | 1.2 (5) |
| C2A—C1A—C6A—C7A | −179.1 (3) | C4B—C5B—C6B—C7B | −175.4 (3) |
| C4A—C5A—C6A—C1A | −0.3 (4) | C2B—C1B—C6B—C5B | −2.2 (5) |
| C4A—C5A—C6A—C7A | −179.7 (3) | C2B—C1B—C6B—C7B | 174.6 (3) |
| C1A—C6A—C7A—C8A | 132.8 (3) | C5B—C6B—C7B—C8B | 20.8 (4) |
| C5A—C6A—C7A—C8A | −47.8 (4) | C1B—C6B—C7B—C8B | −155.8 (3) |
| C1A—C6A—C7A—C14A | −101.5 (3) | C5B—C6B—C7B—C14B | −107.0 (3) |
| C5A—C6A—C7A—C14A | 77.9 (3) | C1B—C6B—C7B—C14B | 76.5 (3) |
| C6A—C7A—C8A—C9A | 111.8 (3) | C6B—C7B—C8B—C13B | −96.5 (3) |
| C14A—C7A—C8A—C9A | −13.2 (4) | C14B—C7B—C8B—C13B | 29.9 (4) |
| C6A—C7A—C8A—C13A | −69.7 (3) | C6B—C7B—C8B—C9B | 84.7 (3) |
| C14A—C7A—C8A—C13A | 165.3 (3) | C14B—C7B—C8B—C9B | −148.9 (3) |
| C13A—C8A—C9A—C10A | −0.6 (5) | C13B—C8B—C9B—C10B | −0.4 (5) |
| C7A—C8A—C9A—C10A | 177.9 (3) | C7B—C8B—C9B—C10B | 178.4 (3) |
| C8A—C9A—C10A—C11A | −0.1 (6) | C8B—C9B—C10B—C11B | −0.6 (5) |
| C9A—C10A—C11A—C12A | 1.3 (6) | C9B—C10B—C11B—C12B | 0.8 (5) |
| C10A—C11A—C12A—C13A | −1.8 (5) | C10B—C11B—C12B—C13B | 0.0 (5) |
| C11A—C12A—C13A—C8A | 1.1 (5) | C11B—C12B—C13B—C8B | −1.1 (5) |
| C9A—C8A—C13A—C12A | 0.1 (5) | C9B—C8B—C13B—C12B | 1.2 (4) |
| C7A—C8A—C13A—C12A | −178.5 (3) | C7B—C8B—C13B—C12B | −177.5 (3) |
| C15A—N1A—C14A—O1A | −1.3 (5) | C15B—N1B—C14B—O1B | 0.5 (5) |
| C15A—N1A—C14A—C7A | 177.7 (3) | C15B—N1B—C14B—C7B | 179.5 (3) |
| C8A—C7A—C14A—O1A | 73.9 (3) | C8B—C7B—C14B—O1B | −72.0 (3) |
| C6A—C7A—C14A—O1A | −52.1 (4) | C6B—C7B—C14B—O1B | 56.9 (4) |
| C8A—C7A—C14A—N1A | −105.2 (3) | C8B—C7B—C14B—N1B | 108.9 (3) |
| C6A—C7A—C14A—N1A | 128.8 (3) | C6B—C7B—C14B—N1B | −122.1 (3) |
| C14A—N1A—C15A—C16A | −109.0 (3) | C14B—N1B—C15B—C16B | 109.1 (3) |
| C14A—N1A—C15A—C20A | 71.1 (4) | C14B—N1B—C15B—C20B | −72.1 (4) |
| C20A—C15A—C16A—C17A | −0.7 (5) | C20B—C15B—C16B—C17B | 1.3 (5) |
| N1A—C15A—C16A—C17A | 179.4 (3) | N1B—C15B—C16B—C17B | −179.9 (3) |
| C15A—C16A—C17A—C18A | 0.3 (5) | C15B—C16B—C17B—C18B | −0.8 (5) |
| C16A—C17A—C18A—C19A | 0.6 (5) | C16B—C17B—C18B—C19B | −0.2 (5) |
| C16A—C17A—C18A—C21A | −178.6 (3) | C16B—C17B—C18B—C21B | 178.7 (3) |
| C17A—C18A—C19A—C20A | −1.2 (5) | C17B—C18B—C19B—C20B | 0.7 (5) |
| C21A—C18A—C19A—C20A | 178.0 (3) | C21B—C18B—C19B—C20B | −178.2 (3) |
| C18A—C19A—C20A—C15A | 0.8 (5) | C18B—C19B—C20B—C15B | −0.2 (5) |
| C18A—C19A—C20A—C22A | −179.1 (3) | C18B—C19B—C20B—C22B | 179.9 (3) |
| C16A—C15A—C20A—C19A | 0.2 (4) | C16B—C15B—C20B—C19B | −0.8 (4) |
| N1A—C15A—C20A—C19A | −179.9 (3) | N1B—C15B—C20B—C19B | −179.6 (3) |
| C16A—C15A—C20A—C22A | −179.9 (3) | C16B—C15B—C20B—C22B | 179.1 (3) |
| N1A—C15A—C20A—C22A | −0.1 (4) | N1B—C15B—C20B—C22B | 0.4 (4) |
| Cg1, Cg4 and Cg5 are the centroids of the C1A–C6A, C1B–C6B and C8B–C13B rings, respectively. |
| D—H···A | D—H | H···A | D···A | D—H···A |
| N1A—H1NA···O1Bi | 0.88 (4) | 2.13 (4) | 2.980 (3) | 163 (3) |
| N1B—H1NB···O1A | 0.86 (5) | 2.18 (5) | 3.012 (3) | 162 (3) |
| C7A—H7AA···O1Bi | 1.00 | 2.32 | 3.258 (4) | 155 |
| C9A—H9AA···O1A | 0.95 | 2.48 | 3.110 (4) | 123 |
| C7B—H7BA···O1A | 1.00 | 2.27 | 3.225 (4) | 160 |
| C13B—H13B···O1B | 0.95 | 2.46 | 3.087 (4) | 124 |
| C3A—H3AA···Cg5ii | 0.95 | 2.89 | 3.754 (4) | 151 |
| C4A—H4AA···Cg4 | 0.95 | 2.84 | 3.539 (4) | 131 |
| C13A—H13A···Cg4i | 0.95 | 2.68 | 3.561 (3) | 154 |
| C9B—H9BA···Cg1 | 0.95 | 2.62 | 3.546 (3) | 167 |
| Symmetry codes: (i) x−1, y, z; (ii) −x+1, −y, −z+1. |
Experimental details
| Crystal data | |
| Chemical formula | C22H21NO |
| Mr | 315.40 |
| Crystal system, space group | Triclinic, P1 |
| Temperature (K) | 100 |
| a, b, c (Å) | 9.5520 (9), 10.2011 (10), 17.9656 (17) |
| α, β, γ (°) | 91.030 (2), 98.957 (2), 90.377 (2) |
| V (Å3) | 1728.9 (3) |
| Z | 4 |
| Radiation type | Mo Kα |
| µ (mm−1) | 0.07 |
| Crystal size (mm) | 0.41 × 0.19 × 0.17 |
| Data collection | |
| Diffractometer | Bruker APEX DUO CCD area-detector |
| Absorption correction | Multi-scan (SADABS; Bruker, 2009) |
| Tmin, Tmax | 0.970, 0.987 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 30869, 7858, 6570 |
| Rint | 0.040 |
| (sin θ/λ)max (Å−1) | 0.650 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.085, 0.261, 1.14 |
| No. of reflections | 7858 |
| No. of parameters | 445 |
| H-atom treatment | H atoms treated by a mixture of independent and constrained refinement |
| Δρmax, Δρmin (e Å−3) | 0.61, −0.41 |
Computer programs: APEX2 (Bruker, 2009), SAINT (Bruker, 2009), SHELXTL (Sheldrick, 2008) and PLATON (Spek, 2009).
| Cg1, Cg4 and Cg5 are the centroids of the C1A–C6A, C1B–C6B and C8B–C13B rings, respectively. |
| D—H···A | D—H | H···A | D···A | D—H···A |
| N1A—H1NA···O1Bi | 0.88 (4) | 2.13 (4) | 2.980 (3) | 163 (3) |
| N1B—H1NB···O1A | 0.86 (5) | 2.18 (5) | 3.012 (3) | 162 (3) |
| C7A—H7AA···O1Bi | 1.0000 | 2.3200 | 3.258 (4) | 155.00 |
| C9A—H9AA···O1A | 0.9500 | 2.4800 | 3.110 (4) | 123.00 |
| C7B—H7BA···O1A | 1.0000 | 2.2700 | 3.225 (4) | 160.00 |
| C13B—H13B···O1B | 0.9500 | 2.4600 | 3.087 (4) | 124.00 |
| C3A—H3AA···Cg5ii | 0.95 | 2.89 | 3.754 (4) | 151 |
| C4A—H4AA···Cg4 | 0.95 | 2.84 | 3.539 (4) | 131 |
| C13A—H13A···Cg4i | 0.95 | 2.68 | 3.561 (3) | 154 |
| C9B—H9BA···Cg1 | 0.95 | 2.62 | 3.546 (3) | 167 |
| Symmetry codes: (i) x−1, y, z; (ii) −x+1, −y, −z+1. |
Footnotes
‡Thomson Reuters ResearcherID: A-3561-2009.
Acknowledgements
HKF and TSC thank Universiti Sains Malaysia (USM) for the Research University Grant (1001/PFIZIK/811160). BN thanks UGC, New Delhi and Government of India for the purchase of chemicals through the SAP-DRS-Phase 1 programme.
References
Allen, F. H., Kennard, O., Watson, D. G., Brammer, L., Orpen, A. G. & Taylor, R. (1987). J. Chem. Soc. Perkin Trans. 2, pp. S1–19. CrossRef Web of Science Google Scholar
Bernstein, J., Davis, R. E., Shimoni, L. & Chang, N.-L. (1995). Angew. Chem. Int. Ed. Engl. 34, 1555–1573. CrossRef CAS Web of Science Google Scholar
Bruker (2009). SADABS, APEX2 and SAINT. Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
Fun, H.-K., Quah, C. K., Narayana, B., Nayak, P. S. & Sarojini, B. K. (2011a). Acta Cryst. E67, o2926–o2927. Web of Science CSD CrossRef CAS IUCr Journals Google Scholar
Fun, H.-K., Quah, C. K., Narayana, B., Nayak, P. S. & Sarojini, B. K. (2011b). Acta Cryst. E67, o2941–o2942. Web of Science CSD CrossRef CAS IUCr Journals Google Scholar
Mijin, D. & Marinkovic, A. (2006). Synth. Commun. 36, 193–198. Web of Science CrossRef CAS Google Scholar
Mijin, D. Z., Prascevic, M. & Petrovic, S. D. (2008). J. Serb. Chem. Soc. 73, 945–950. Web of Science CrossRef CAS Google Scholar
Praveen, A. S., Jasinski, J. P., Golen, J. A., Narayana, B. & Yathirajan, H. S. (2011a). Acta Cryst. E67, o1826. Web of Science CSD CrossRef IUCr Journals Google Scholar
Praveen, A. S., Jasinski, J. P., Golen, J. A., Yathirajan, H. S. & Narayana, B. (2011b). Acta Cryst. E67, o2602–o2603. Web of Science CSD CrossRef CAS IUCr Journals Google Scholar
Praveen, A. S., Jasinski, J. P., Golen, J. A., Narayana, B. & Yathirajan, H. S. (2011c). Acta Cryst. E67, o2604. Web of Science CSD CrossRef IUCr Journals Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Spek, A. L. (2009). Acta Cryst. D65, 148–155. Web of Science CrossRef CAS IUCr Journals Google Scholar
Wu, W.-N., Cheng, F.-X., Yan, L. & Tang, N. (2008). J. Coord. Chem. 61, 2207–2215. Web of Science CrossRef CAS Google Scholar
Wu, W.-N., Wang, Y., Zhang, A.-Y., Zhao, R.-Q. & Wang, Q.-F. (2010). Acta Cryst. E66, m288. Web of Science CSD CrossRef IUCr Journals Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.
access
journal menu
![[Figure 1]](./ez2289fig1thm.gif)
![[Figure 2]](./ez2289fig2thm.gif)




N-Substituted 2-arylacetamides are very interesting compounds because of their structural similarity to the lateral chain of natural benzylpenicillin (Mijin & Marinkovic, 2006; Mijin et al., 2008). Amides are also used as ligands due to their excellent coordination abilities (Wu et al., 2008, 2010). Crystal structures of some acetamide derivatives viz., N-(4-chloro-1,3-benzothiazol-2-yl)-2-(3-methylphenyl)acetamide monohydrate, N-(3-chloro-4-fluorophenyl)-2,2-diphenylacetamide and N-(3-chloro-4-fluorophenyl)-2-(naphthalen-1-yl)acetamide (Praveen et al., 2011a,b,c) have been reported. In continuation of our work on synthesis of amides (Fun et al., 2011a,b), we report herein the crystal structure of the title compound (I).
The asymmetric unit of the title compound consists of two crystallographically independent molecules (A and B) as shown in Fig. 1. Each molecule contains two benzene rings (C1–C6 & C8–C13) and one dimethylbenzene ring (C15–C22) [maximum deviation = 0.0185 (27) Å at atom C19A in molecule A and 0.0155 (21) Å at atom C21B in molecule B]. The dihedral angle between the two benzene rings is 87.75 (16)° in molecule A and 89.25 (16)° in molecule B. In molecule A, the dimethylbenzene ring forms dihedral angles of 89.65 (8) and 42.98 (11)° with the two benzene rings (C1–C6 and C8–C13 respectively), whereas the corresponding angles are equal to 63.15 (7) and 58.67 (10)° in molecule B. Bond lengths (Allen et al., 1987) and angles are within normal ranges and are comparable to related structures (Fun et al., 2011a,b). Intramolecular C9A—H9AA···O1A hydrogen bond (Table 1) generates an S(6) ring motif (Fig. 1; Bernstein et al., 1995) in molecule A, whereas the same ring motif is generated by C13B—H13B···O1B hydrogen bonds in molecule B.
In the crystal, molecules are linked by intermolecular bifurcated N1A—H1NA···O1B, N1B—H1NB···O1A, C7A—H7AA···O1B and C7B—H7BA···O1A hydrogen bonds (Table 1), generating R21(6) ring motifs and forming infinite chains along the a axis. The crystal is further stabilized by C—H···π interactions, involving Cg1, Cg4 and Cg5 which are the centroids of C1A–C6A, C1B–C6B and C8B–C13B rings, respectively. π—π interactions are also observed with Cg3···Cg3 and Cg6···Cg6 distances of 3.8543 (18) Å[symmetry code: –X,-Y,-Z] and 3.930 (2) Å[symmetry code: 1-X,1-Y,-Z], where Cg3 and Cg6 are the centroids of C15A–C20A and C15B–C20B, respectively.