metal-organic compounds
Aquacarbonyl(ferrocenyldithiophosphonato-κ2S,S′)bis(triphenylphosphane-κP)ruthenium(II) dichloromethane monosolvate
aDepartment of Applied Chemistry, School of Petrochemical Engineering, Changzhou University, Jiangsu 213164, People's Republic of China, and bInstitute of Molecular Engineering and Applied Chemistry, Anhui University of Technology, Ma'anshan, Anhui 243002, People's Republic of China
*Correspondence e-mail: [email protected]
The structure of the title complex, [FeRu(C5H5)(C5H4OPS2)(CO)(C18H15P)2(H2O)]·CH2Cl2, consists of one neutral [{FcP(O)S2}Ru(CO)(H2O)(PPh3)2] complex [Fc = Fe(η5-C5H4)(η5-C5H5)] and one CH2Cl2 solvent molecule. The geometry around the RuII atom is pseudo-octahedral, with two cis-binding PPh3 ligands and one chelating bidentate [Fc(O)PS2]2− ligand via two S atoms. The average Ru—S and Ru—P bond lengths are 2.434 (1) and 2.398 (1) Å, and the Ru—O and Ru—C bond lengths are 2.157 (3) and 1.826 (4) Å, respectively. In the crystal, pairs of O—H⋯O hydrogen bonds link adjacent molecules into dimers.
Related literature
For background to ferrocenyl–phosphonodithiolato complexes, see: Foreman et al. (1996
); Gray et al. (2003
, 2004
); Haiduc (2001
); Thomas et al. (2001
); Van Zyl (2010
). For a related structure, see: Liu et al. (2005
); Wang et al. (2010
); Zhang et al. (2001
). For a description of the Cambridge Structural Database, see: Allen (2002
).
Experimental
Crystal data
|
| ||||||||||||||||||||||
Data collection: APEX2 (Bruker, 2005
); cell refinement: SAINT (Bruker, 2005
); data reduction: SAINT; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: SHELXTL (Sheldrick, 2008
); software used to prepare material for publication: SHELXTL.
Supporting information
contains datablocks I, global. DOI: 10.1107/S1600536813014311/ds2231sup1.cif
Structure factors: contains datablock I. DOI: 10.1107/S1600536813014311/ds2231Isup2.hkl
To a slurry of [FcP(S)(µ-S)]2 (56 mg, 0.10 mmol) and 17% NH3.H2O (0.2 ml) in THF (10 ml) was added the grey solid [RuHCl(CO)(PPh3)3] (188 mg, 0.20 mmol). The mixture was stirred at room temperature overnight and the brown solution was obtained. The solvent was removed in vacuo and the residue was recrystallized from CH2Cl2/hexane to give yellow crystalline solids of [{FcP(O)S2}Ru(CO)(H2O)(PPh3)2].CH2Cl2 in five days at room temperature. Yield: 68 mg, 0.065 mmol, 32% (based on Ru). Anal. Calcd. for C47H41O3P3S2FeRu.(CH2Cl2): C, 54.76; H, 4.12%. Found: C, 54.72; H, 4.08%.
The structure was solved by and refined by full-matrix least-squares procedure based on F2. All C Hydrogen atoms were placed in geometrically idealized positions and refined isotropically with a riding model for C-sp2 [C—H = 0.93 Å and with Uiso(H) = 1.2Ueq(C)] and C-sp3 [C—H = 0.97 Å and with Uiso(H) = 1.5Ueq(C)].
Data collection: APEX2 (Bruker, 2005); cell SAINT (Bruker, 2005); data reduction: SAINT (Bruker, 2005); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: SHELXTL (Sheldrick, 2008); software used to prepare material for publication: SHELXTL (Sheldrick, 2008).
| [FeRu(C5H5)(C5H4OPS2)(CO)(C18H15P)2(H2O)]·CH2Cl2 | Z = 2 |
| Mr = 1052.67 | F(000) = 1072 |
| Triclinic, P1 | Dx = 1.535 Mg m−3 |
| Hall symbol: -P 1 | Mo Kα radiation, λ = 0.71073 Å |
| a = 12.1493 (9) Å | Cell parameters from 6761 reflections |
| b = 14.2208 (11) Å | θ = 2.4–25.7° |
| c = 14.7100 (11) Å | µ = 1.01 mm−1 |
| α = 101.811 (1)° | T = 296 K |
| β = 98.278 (1)° | Block, yellow |
| γ = 109.759 (1)° | 0.24 × 0.15 × 0.08 mm |
| V = 2277.7 (3) Å3 |
| Bruker SMART APEXII CCD area-detector diffractometer | 10536 independent reflections |
| Radiation source: fine-focus sealed tube | 8221 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.039 |
| phi and ω scans | θmax = 27.6°, θmin = 2.4° |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1997) | h = −15→15 |
| Tmin = 0.794, Tmax = 0.924 | k = −18→18 |
| 32262 measured reflections | l = −19→19 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.054 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.154 | H atoms treated by a mixture of independent and constrained refinement |
| S = 1.05 | w = 1/[σ2(Fo2) + (0.0853P)2 + 2.0442P] where P = (Fo2 + 2Fc2)/3 |
| 10536 reflections | (Δ/σ)max = 0.001 |
| 549 parameters | Δρmax = 3.98 e Å−3 |
| 2 restraints | Δρmin = −0.67 e Å−3 |
| [FeRu(C5H5)(C5H4OPS2)(CO)(C18H15P)2(H2O)]·CH2Cl2 | γ = 109.759 (1)° |
| Mr = 1052.67 | V = 2277.7 (3) Å3 |
| Triclinic, P1 | Z = 2 |
| a = 12.1493 (9) Å | Mo Kα radiation |
| b = 14.2208 (11) Å | µ = 1.01 mm−1 |
| c = 14.7100 (11) Å | T = 296 K |
| α = 101.811 (1)° | 0.24 × 0.15 × 0.08 mm |
| β = 98.278 (1)° |
| Bruker SMART APEXII CCD area-detector diffractometer | 10536 independent reflections |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1997) | 8221 reflections with I > 2σ(I) |
| Tmin = 0.794, Tmax = 0.924 | Rint = 0.039 |
| 32262 measured reflections |
| R[F2 > 2σ(F2)] = 0.054 | 2 restraints |
| wR(F2) = 0.154 | H atoms treated by a mixture of independent and constrained refinement |
| S = 1.05 | Δρmax = 3.98 e Å−3 |
| 10536 reflections | Δρmin = −0.67 e Å−3 |
| 549 parameters |
Geometry. All e.s.d.'s (except the e.s.d. in the dihedral angle between two l.s. planes) are estimated using the full covariance matrix. The cell e.s.d.'s are taken into account individually in the estimation of e.s.d.'s in distances, angles and torsion angles; correlations between e.s.d.'s in cell parameters are only used when they are defined by crystal symmetry. An approximate (isotropic) treatment of cell e.s.d.'s is used for estimating e.s.d.'s involving l.s. planes. |
Refinement. Refinement of F2 against ALL reflections. The weighted R-factor wR and goodness of fit S are based on F2, conventional R-factors R are based on F, with F set to zero for negative F2. The threshold expression of F2 > σ(F2) is used only for calculating R-factors(gt) etc. and is not relevant to the choice of reflections for refinement. R-factors based on F2 are statistically about twice as large as those based on F, and R- factors based on ALL data will be even larger. |
| x | y | z | Uiso*/Ueq | ||
| Ru1 | 0.57682 (3) | 0.84933 (2) | 0.60821 (2) | 0.02666 (10) | |
| Fe1 | 0.34922 (7) | 0.55279 (5) | 0.22580 (5) | 0.04881 (18) | |
| O3 | 0.5232 (3) | 0.9764 (2) | 0.5934 (2) | 0.0406 (7) | |
| H1S | 0.541 (4) | 1.0333 (16) | 0.632 (2) | 0.029 (11)* | |
| H2S | 0.460 (3) | 0.962 (5) | 0.555 (4) | 0.09 (2)* | |
| S1 | 0.40195 (9) | 0.74574 (8) | 0.47898 (7) | 0.0361 (2) | |
| S2 | 0.66350 (9) | 0.87473 (8) | 0.47088 (7) | 0.0378 (2) | |
| P1 | 0.49822 (9) | 0.78762 (7) | 0.38051 (7) | 0.0305 (2) | |
| P2 | 0.44859 (9) | 0.80208 (7) | 0.71339 (7) | 0.0299 (2) | |
| P3 | 0.76866 (9) | 0.97232 (8) | 0.70618 (7) | 0.0306 (2) | |
| O1 | 0.4530 (3) | 0.8442 (2) | 0.3179 (2) | 0.0418 (7) | |
| O2 | 0.6390 (3) | 0.6647 (2) | 0.6043 (3) | 0.0588 (9) | |
| C1 | 0.5005 (4) | 0.6752 (3) | 0.3034 (3) | 0.0354 (8) | |
| C2 | 0.5009 (5) | 0.5821 (4) | 0.3236 (3) | 0.0514 (12) | |
| H2 | 0.5042 | 0.5688 | 0.3831 | 0.062* | |
| C3 | 0.4953 (5) | 0.5126 (4) | 0.2371 (4) | 0.0593 (13) | |
| H3 | 0.4951 | 0.4461 | 0.2304 | 0.071* | |
| C4 | 0.4899 (5) | 0.5611 (4) | 0.1627 (4) | 0.0629 (14) | |
| H4 | 0.4848 | 0.5321 | 0.0988 | 0.075* | |
| C5 | 0.4937 (5) | 0.6615 (3) | 0.2028 (3) | 0.0495 (11) | |
| H5 | 0.4920 | 0.7104 | 0.1698 | 0.059* | |
| C6 | 0.2098 (7) | 0.5002 (9) | 0.2869 (7) | 0.109 (3) | |
| H6 | 0.2179 | 0.4986 | 0.3503 | 0.131* | |
| C7 | 0.2044 (7) | 0.4244 (6) | 0.2133 (8) | 0.107 (3) | |
| H7 | 0.2062 | 0.3607 | 0.2183 | 0.128* | |
| C8 | 0.1960 (6) | 0.4522 (6) | 0.1304 (6) | 0.093 (2) | |
| H8 | 0.1915 | 0.4117 | 0.0706 | 0.111* | |
| C9 | 0.1952 (7) | 0.5517 (8) | 0.1503 (8) | 0.114 (3) | |
| H9 | 0.1916 | 0.5910 | 0.1074 | 0.136* | |
| C10 | 0.2012 (6) | 0.5817 (7) | 0.2517 (8) | 0.112 (3) | |
| H10 | 0.1995 | 0.6435 | 0.2865 | 0.135* | |
| C11 | 0.3794 (3) | 0.8935 (3) | 0.7572 (3) | 0.0352 (8) | |
| C12 | 0.3908 (4) | 0.9360 (3) | 0.8534 (3) | 0.0473 (10) | |
| H12 | 0.4339 | 0.9171 | 0.8991 | 0.057* | |
| C13 | 0.3380 (5) | 1.0067 (4) | 0.8819 (4) | 0.0642 (14) | |
| H13 | 0.3455 | 1.0344 | 0.9466 | 0.077* | |
| C14 | 0.2758 (5) | 1.0353 (4) | 0.8160 (5) | 0.0689 (17) | |
| H14 | 0.2415 | 1.0832 | 0.8356 | 0.083* | |
| C15 | 0.2630 (5) | 0.9939 (4) | 0.7202 (5) | 0.0608 (14) | |
| H15 | 0.2199 | 1.0137 | 0.6753 | 0.073* | |
| C16 | 0.3142 (4) | 0.9226 (4) | 0.6904 (4) | 0.0479 (11) | |
| H16 | 0.3048 | 0.8942 | 0.6255 | 0.058* | |
| C20 | 0.6172 (3) | 0.7368 (3) | 0.6083 (3) | 0.0349 (8) | |
| C21 | 0.3166 (4) | 0.6803 (3) | 0.6583 (3) | 0.0378 (9) | |
| C22 | 0.3325 (4) | 0.5913 (3) | 0.6148 (3) | 0.0485 (11) | |
| H22 | 0.4094 | 0.5950 | 0.6103 | 0.058* | |
| C23 | 0.2363 (5) | 0.4970 (4) | 0.5777 (4) | 0.0632 (14) | |
| H23 | 0.2485 | 0.4380 | 0.5483 | 0.076* | |
| C24 | 0.1235 (5) | 0.4914 (4) | 0.5847 (5) | 0.0755 (18) | |
| H24 | 0.0585 | 0.4284 | 0.5593 | 0.091* | |
| C25 | 0.1053 (5) | 0.5774 (5) | 0.6287 (5) | 0.0790 (19) | |
| H25 | 0.0285 | 0.5722 | 0.6349 | 0.095* | |
| C26 | 0.2008 (4) | 0.6723 (4) | 0.6642 (4) | 0.0592 (13) | |
| H26 | 0.1874 | 0.7311 | 0.6922 | 0.071* | |
| C31 | 0.5046 (4) | 0.7699 (3) | 0.8209 (3) | 0.0344 (8) | |
| C32 | 0.4262 (4) | 0.7171 (3) | 0.8702 (3) | 0.0430 (10) | |
| H32 | 0.3440 | 0.6993 | 0.8496 | 0.052* | |
| C33 | 0.4688 (5) | 0.6907 (4) | 0.9492 (3) | 0.0532 (12) | |
| H33 | 0.4154 | 0.6559 | 0.9818 | 0.064* | |
| C34 | 0.5900 (5) | 0.7156 (4) | 0.9800 (3) | 0.0547 (12) | |
| H34 | 0.6187 | 0.6975 | 1.0332 | 0.066* | |
| C35 | 0.6690 (5) | 0.7675 (4) | 0.9317 (3) | 0.0531 (12) | |
| H35 | 0.7511 | 0.7843 | 0.9522 | 0.064* | |
| C36 | 0.6264 (4) | 0.7946 (3) | 0.8530 (3) | 0.0420 (9) | |
| H36 | 0.6803 | 0.8300 | 0.8210 | 0.050* | |
| C41 | 0.8587 (3) | 1.0592 (3) | 0.6437 (3) | 0.0332 (8) | |
| C42 | 0.8153 (4) | 1.1299 (3) | 0.6144 (3) | 0.0447 (10) | |
| H42 | 0.7427 | 1.1315 | 0.6262 | 0.054* | |
| C43 | 0.8791 (4) | 1.1975 (3) | 0.5681 (4) | 0.0500 (11) | |
| H43 | 0.8490 | 1.2441 | 0.5485 | 0.060* | |
| C44 | 0.9874 (5) | 1.1962 (4) | 0.5508 (4) | 0.0587 (13) | |
| H44 | 1.0303 | 1.2416 | 0.5194 | 0.070* | |
| C45 | 1.0315 (5) | 1.1275 (4) | 0.5800 (5) | 0.0682 (16) | |
| H45 | 1.1048 | 1.1270 | 0.5691 | 0.082* | |
| C46 | 0.9668 (5) | 1.0587 (4) | 0.6261 (4) | 0.0563 (13) | |
| H46 | 0.9969 | 1.0120 | 0.6452 | 0.068* | |
| C51 | 0.8706 (3) | 0.9121 (3) | 0.7488 (3) | 0.0367 (9) | |
| C52 | 0.8946 (4) | 0.8419 (3) | 0.6820 (3) | 0.0413 (9) | |
| H52 | 0.8600 | 0.8274 | 0.6175 | 0.050* | |
| C53 | 0.9693 (4) | 0.7934 (4) | 0.7102 (4) | 0.0519 (12) | |
| H53 | 0.9858 | 0.7475 | 0.6646 | 0.062* | |
| C54 | 1.0187 (5) | 0.8123 (4) | 0.8038 (4) | 0.0593 (13) | |
| H54 | 1.0689 | 0.7793 | 0.8223 | 0.071* | |
| C55 | 0.9948 (5) | 0.8805 (4) | 0.8720 (4) | 0.0607 (14) | |
| H55 | 1.0275 | 0.8923 | 0.9364 | 0.073* | |
| C56 | 0.9218 (4) | 0.9312 (4) | 0.8444 (3) | 0.0490 (11) | |
| H56 | 0.9072 | 0.9782 | 0.8902 | 0.059* | |
| C61 | 0.7790 (4) | 1.0714 (3) | 0.8121 (3) | 0.0356 (8) | |
| C62 | 0.6762 (4) | 1.0715 (3) | 0.8422 (3) | 0.0453 (10) | |
| H62 | 0.6019 | 1.0203 | 0.8094 | 0.054* | |
| C63 | 0.6843 (5) | 1.1488 (4) | 0.9222 (4) | 0.0610 (14) | |
| H63 | 0.6154 | 1.1477 | 0.9432 | 0.073* | |
| C64 | 0.7919 (5) | 1.2250 (4) | 0.9693 (4) | 0.0605 (14) | |
| H64 | 0.7963 | 1.2762 | 1.0219 | 0.073* | |
| C65 | 0.8950 (5) | 1.2269 (4) | 0.9395 (4) | 0.0604 (13) | |
| H65 | 0.9688 | 1.2789 | 0.9725 | 0.072* | |
| C66 | 0.8888 (4) | 1.1513 (4) | 0.8603 (3) | 0.0508 (11) | |
| H66 | 0.9581 | 1.1540 | 0.8392 | 0.061* | |
| C1S | 0.8456 (18) | 0.6112 (13) | 0.2091 (9) | 0.264 (11) | |
| H1S1 | 0.7820 | 0.5791 | 0.2390 | 0.317* | |
| H1S2 | 0.9174 | 0.6505 | 0.2597 | 0.317* | |
| Cl1S | 0.8099 (3) | 0.6917 (4) | 0.1639 (4) | 0.2144 (19) | |
| Cl2S | 0.8735 (4) | 0.5084 (4) | 0.1346 (4) | 0.2133 (17) |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Ru1 | 0.02830 (16) | 0.02926 (16) | 0.02479 (16) | 0.01314 (12) | 0.00753 (12) | 0.00756 (11) |
| Fe1 | 0.0577 (4) | 0.0377 (3) | 0.0416 (4) | 0.0124 (3) | 0.0055 (3) | 0.0049 (3) |
| O3 | 0.0535 (19) | 0.0318 (15) | 0.0399 (17) | 0.0233 (14) | 0.0068 (15) | 0.0077 (13) |
| S1 | 0.0323 (5) | 0.0421 (5) | 0.0291 (5) | 0.0102 (4) | 0.0071 (4) | 0.0061 (4) |
| S2 | 0.0344 (5) | 0.0441 (5) | 0.0301 (5) | 0.0086 (4) | 0.0113 (4) | 0.0077 (4) |
| P1 | 0.0372 (5) | 0.0279 (4) | 0.0271 (5) | 0.0140 (4) | 0.0073 (4) | 0.0060 (4) |
| P2 | 0.0315 (5) | 0.0345 (5) | 0.0289 (5) | 0.0156 (4) | 0.0109 (4) | 0.0116 (4) |
| P3 | 0.0287 (5) | 0.0366 (5) | 0.0280 (5) | 0.0145 (4) | 0.0065 (4) | 0.0087 (4) |
| O1 | 0.0580 (19) | 0.0330 (14) | 0.0340 (15) | 0.0203 (13) | 0.0051 (13) | 0.0071 (12) |
| O2 | 0.055 (2) | 0.0425 (17) | 0.087 (3) | 0.0301 (16) | 0.0137 (19) | 0.0167 (17) |
| C1 | 0.040 (2) | 0.0319 (19) | 0.033 (2) | 0.0151 (16) | 0.0078 (17) | 0.0031 (15) |
| C2 | 0.072 (3) | 0.048 (2) | 0.046 (3) | 0.037 (2) | 0.012 (2) | 0.015 (2) |
| C3 | 0.083 (4) | 0.042 (2) | 0.058 (3) | 0.035 (3) | 0.018 (3) | 0.004 (2) |
| C4 | 0.087 (4) | 0.048 (3) | 0.048 (3) | 0.024 (3) | 0.029 (3) | −0.002 (2) |
| C5 | 0.067 (3) | 0.041 (2) | 0.039 (2) | 0.018 (2) | 0.021 (2) | 0.0084 (19) |
| C6 | 0.061 (4) | 0.141 (8) | 0.102 (7) | 0.005 (5) | 0.030 (4) | 0.033 (6) |
| C7 | 0.084 (5) | 0.066 (4) | 0.134 (8) | −0.008 (4) | 0.017 (5) | 0.021 (5) |
| C8 | 0.077 (5) | 0.082 (5) | 0.078 (5) | 0.016 (4) | −0.013 (4) | −0.019 (4) |
| C9 | 0.073 (5) | 0.122 (7) | 0.142 (8) | 0.034 (5) | −0.019 (5) | 0.065 (6) |
| C10 | 0.044 (3) | 0.105 (6) | 0.143 (8) | 0.024 (4) | 0.002 (4) | −0.038 (6) |
| C11 | 0.0313 (19) | 0.0363 (19) | 0.043 (2) | 0.0152 (16) | 0.0177 (17) | 0.0122 (17) |
| C12 | 0.049 (3) | 0.049 (2) | 0.046 (3) | 0.023 (2) | 0.016 (2) | 0.006 (2) |
| C13 | 0.067 (3) | 0.055 (3) | 0.073 (4) | 0.032 (3) | 0.027 (3) | 0.001 (3) |
| C14 | 0.065 (3) | 0.047 (3) | 0.114 (5) | 0.037 (3) | 0.042 (4) | 0.021 (3) |
| C15 | 0.054 (3) | 0.067 (3) | 0.092 (4) | 0.040 (3) | 0.034 (3) | 0.046 (3) |
| C16 | 0.046 (3) | 0.055 (3) | 0.057 (3) | 0.027 (2) | 0.022 (2) | 0.027 (2) |
| C20 | 0.0305 (19) | 0.0347 (19) | 0.038 (2) | 0.0132 (16) | 0.0042 (17) | 0.0090 (16) |
| C21 | 0.039 (2) | 0.039 (2) | 0.034 (2) | 0.0123 (17) | 0.0093 (17) | 0.0130 (17) |
| C22 | 0.051 (3) | 0.042 (2) | 0.053 (3) | 0.017 (2) | 0.016 (2) | 0.013 (2) |
| C23 | 0.071 (4) | 0.034 (2) | 0.070 (4) | 0.011 (2) | 0.006 (3) | 0.007 (2) |
| C24 | 0.056 (3) | 0.044 (3) | 0.102 (5) | 0.001 (2) | −0.006 (3) | 0.014 (3) |
| C25 | 0.038 (3) | 0.059 (3) | 0.125 (6) | 0.009 (2) | 0.009 (3) | 0.017 (4) |
| C26 | 0.043 (3) | 0.049 (3) | 0.083 (4) | 0.016 (2) | 0.012 (3) | 0.014 (3) |
| C31 | 0.045 (2) | 0.0371 (19) | 0.0268 (19) | 0.0196 (17) | 0.0129 (17) | 0.0112 (15) |
| C32 | 0.051 (3) | 0.053 (2) | 0.034 (2) | 0.023 (2) | 0.020 (2) | 0.0179 (19) |
| C33 | 0.076 (4) | 0.054 (3) | 0.041 (3) | 0.028 (3) | 0.028 (2) | 0.024 (2) |
| C34 | 0.078 (4) | 0.060 (3) | 0.036 (2) | 0.034 (3) | 0.011 (2) | 0.021 (2) |
| C35 | 0.054 (3) | 0.066 (3) | 0.045 (3) | 0.028 (2) | 0.007 (2) | 0.022 (2) |
| C36 | 0.043 (2) | 0.051 (2) | 0.036 (2) | 0.0176 (19) | 0.0098 (19) | 0.0195 (19) |
| C41 | 0.0304 (19) | 0.0360 (19) | 0.032 (2) | 0.0111 (15) | 0.0083 (16) | 0.0085 (16) |
| C42 | 0.039 (2) | 0.048 (2) | 0.054 (3) | 0.0187 (19) | 0.013 (2) | 0.021 (2) |
| C43 | 0.053 (3) | 0.042 (2) | 0.058 (3) | 0.017 (2) | 0.013 (2) | 0.021 (2) |
| C44 | 0.074 (4) | 0.047 (3) | 0.063 (3) | 0.018 (2) | 0.037 (3) | 0.023 (2) |
| C45 | 0.065 (3) | 0.066 (3) | 0.106 (5) | 0.037 (3) | 0.058 (3) | 0.042 (3) |
| C46 | 0.054 (3) | 0.056 (3) | 0.082 (4) | 0.032 (2) | 0.036 (3) | 0.036 (3) |
| C51 | 0.032 (2) | 0.045 (2) | 0.040 (2) | 0.0177 (17) | 0.0098 (17) | 0.0185 (18) |
| C52 | 0.038 (2) | 0.049 (2) | 0.042 (2) | 0.0217 (19) | 0.0088 (19) | 0.0153 (19) |
| C53 | 0.045 (3) | 0.058 (3) | 0.066 (3) | 0.031 (2) | 0.019 (2) | 0.023 (2) |
| C54 | 0.050 (3) | 0.069 (3) | 0.075 (4) | 0.035 (3) | 0.012 (3) | 0.036 (3) |
| C55 | 0.055 (3) | 0.079 (4) | 0.050 (3) | 0.028 (3) | −0.002 (2) | 0.029 (3) |
| C56 | 0.049 (3) | 0.062 (3) | 0.041 (2) | 0.027 (2) | 0.005 (2) | 0.018 (2) |
| C61 | 0.042 (2) | 0.038 (2) | 0.0287 (19) | 0.0179 (17) | 0.0078 (17) | 0.0077 (16) |
| C62 | 0.046 (2) | 0.044 (2) | 0.043 (2) | 0.0159 (19) | 0.015 (2) | 0.0040 (19) |
| C63 | 0.067 (3) | 0.059 (3) | 0.057 (3) | 0.024 (3) | 0.031 (3) | 0.002 (2) |
| C64 | 0.084 (4) | 0.053 (3) | 0.041 (3) | 0.029 (3) | 0.012 (3) | 0.001 (2) |
| C65 | 0.059 (3) | 0.053 (3) | 0.048 (3) | 0.010 (2) | −0.004 (2) | 0.000 (2) |
| C66 | 0.041 (2) | 0.052 (3) | 0.046 (3) | 0.011 (2) | 0.004 (2) | 0.000 (2) |
| C1S | 0.42 (3) | 0.192 (14) | 0.090 (9) | 0.012 (16) | −0.011 (12) | 0.071 (10) |
| Cl1S | 0.0880 (19) | 0.266 (5) | 0.281 (5) | 0.041 (2) | 0.017 (2) | 0.122 (4) |
| Cl2S | 0.175 (3) | 0.190 (4) | 0.221 (4) | 0.019 (3) | 0.041 (3) | 0.034 (3) |
| Ru1—C20 | 1.826 (4) | C21—C22 | 1.385 (6) |
| Ru1—O3 | 2.157 (3) | C21—C26 | 1.389 (6) |
| Ru1—P2 | 2.3842 (10) | C22—C23 | 1.385 (7) |
| Ru1—P3 | 2.4110 (10) | C22—H22 | 0.9300 |
| Ru1—S1 | 2.4232 (10) | C23—C24 | 1.366 (8) |
| Ru1—S2 | 2.4443 (10) | C23—H23 | 0.9300 |
| Fe1—C7 | 2.015 (7) | C24—C25 | 1.365 (8) |
| Fe1—C6 | 2.023 (7) | C24—H24 | 0.9300 |
| Fe1—C9 | 2.027 (7) | C25—C26 | 1.386 (7) |
| Fe1—C8 | 2.027 (6) | C25—H25 | 0.9300 |
| Fe1—C2 | 2.028 (5) | C26—H26 | 0.9300 |
| Fe1—C1 | 2.033 (4) | C31—C36 | 1.384 (6) |
| Fe1—C5 | 2.033 (5) | C31—C32 | 1.392 (6) |
| Fe1—C3 | 2.035 (5) | C32—C33 | 1.376 (6) |
| Fe1—C4 | 2.040 (5) | C32—H32 | 0.9300 |
| Fe1—C10 | 2.045 (7) | C33—C34 | 1.374 (8) |
| O3—H1S | 0.824 (10) | C33—H33 | 0.9300 |
| O3—H2S | 0.818 (10) | C34—C35 | 1.380 (7) |
| S1—P1 | 2.0472 (14) | C34—H34 | 0.9300 |
| S2—P1 | 2.0517 (14) | C35—C36 | 1.379 (6) |
| P1—O1 | 1.502 (3) | C35—H35 | 0.9300 |
| P1—C1 | 1.772 (4) | C36—H36 | 0.9300 |
| P2—C11 | 1.834 (4) | C41—C46 | 1.376 (6) |
| P2—C31 | 1.836 (4) | C41—C42 | 1.394 (5) |
| P2—C21 | 1.844 (4) | C42—C43 | 1.381 (6) |
| P3—C61 | 1.831 (4) | C42—H42 | 0.9300 |
| P3—C51 | 1.837 (4) | C43—C44 | 1.381 (7) |
| P3—C41 | 1.846 (4) | C43—H43 | 0.9300 |
| O2—C20 | 1.136 (5) | C44—C45 | 1.373 (7) |
| C1—C2 | 1.417 (6) | C44—H44 | 0.9300 |
| C1—C5 | 1.439 (6) | C45—C46 | 1.393 (7) |
| C2—C3 | 1.421 (6) | C45—H45 | 0.9300 |
| C2—H2 | 0.9300 | C46—H46 | 0.9300 |
| C3—C4 | 1.412 (7) | C51—C56 | 1.384 (6) |
| C3—H3 | 0.9300 | C51—C52 | 1.388 (6) |
| C4—C5 | 1.410 (6) | C52—C53 | 1.379 (6) |
| C4—H4 | 0.9300 | C52—H52 | 0.9300 |
| C5—H5 | 0.9300 | C53—C54 | 1.354 (7) |
| C6—C7 | 1.339 (12) | C53—H53 | 0.9300 |
| C6—C10 | 1.391 (12) | C54—C55 | 1.381 (8) |
| C6—H6 | 0.9300 | C54—H54 | 0.9300 |
| C7—C8 | 1.358 (11) | C55—C56 | 1.385 (6) |
| C7—H7 | 0.9300 | C55—H55 | 0.9300 |
| C8—C9 | 1.388 (11) | C56—H56 | 0.9300 |
| C8—H8 | 0.9300 | C61—C62 | 1.384 (6) |
| C9—C10 | 1.449 (12) | C61—C66 | 1.395 (6) |
| C9—H9 | 0.9300 | C62—C63 | 1.403 (6) |
| C10—H10 | 0.9300 | C62—H62 | 0.9300 |
| C11—C12 | 1.387 (6) | C63—C64 | 1.355 (8) |
| C11—C16 | 1.388 (6) | C63—H63 | 0.9300 |
| C12—C13 | 1.393 (6) | C64—C65 | 1.379 (8) |
| C12—H12 | 0.9300 | C64—H64 | 0.9300 |
| C13—C14 | 1.355 (8) | C65—C66 | 1.387 (7) |
| C13—H13 | 0.9300 | C65—H65 | 0.9300 |
| C14—C15 | 1.376 (8) | C66—H66 | 0.9300 |
| C14—H14 | 0.9300 | C1S—Cl1S | 1.582 (16) |
| C15—C16 | 1.391 (6) | C1S—Cl2S | 1.80 (2) |
| C15—H15 | 0.9300 | C1S—H1S1 | 0.9700 |
| C16—H16 | 0.9300 | C1S—H1S2 | 0.9700 |
| C20—Ru1—O3 | 174.49 (15) | C9—C8—H8 | 125.9 |
| C20—Ru1—P2 | 90.26 (13) | Fe1—C8—H8 | 125.7 |
| O3—Ru1—P2 | 92.66 (9) | C8—C9—C10 | 105.8 (8) |
| C20—Ru1—P3 | 94.08 (12) | C8—C9—Fe1 | 70.0 (4) |
| O3—Ru1—P3 | 89.54 (9) | C10—C9—Fe1 | 69.8 (4) |
| P2—Ru1—P3 | 106.97 (4) | C8—C9—H9 | 127.1 |
| C20—Ru1—S1 | 91.03 (13) | C10—C9—H9 | 127.1 |
| O3—Ru1—S1 | 84.48 (9) | Fe1—C9—H9 | 124.7 |
| P2—Ru1—S1 | 86.51 (4) | C6—C10—C9 | 106.7 (7) |
| P3—Ru1—S1 | 165.53 (4) | C6—C10—Fe1 | 69.1 (4) |
| C20—Ru1—S2 | 90.95 (13) | C9—C10—Fe1 | 68.5 (4) |
| O3—Ru1—S2 | 85.10 (9) | C6—C10—H10 | 126.7 |
| P2—Ru1—S2 | 166.20 (4) | C9—C10—H10 | 126.7 |
| P3—Ru1—S2 | 86.65 (3) | Fe1—C10—H10 | 127.3 |
| S1—Ru1—S2 | 79.73 (4) | C12—C11—C16 | 118.7 (4) |
| C7—Fe1—C6 | 38.7 (3) | C12—C11—P2 | 123.2 (3) |
| C7—Fe1—C9 | 66.7 (4) | C16—C11—P2 | 118.0 (3) |
| C6—Fe1—C9 | 68.5 (4) | C11—C12—C13 | 120.3 (5) |
| C7—Fe1—C8 | 39.3 (3) | C11—C12—H12 | 119.8 |
| C6—Fe1—C8 | 66.7 (4) | C13—C12—H12 | 119.8 |
| C9—Fe1—C8 | 40.0 (3) | C14—C13—C12 | 120.3 (5) |
| C7—Fe1—C2 | 118.0 (3) | C14—C13—H13 | 119.8 |
| C6—Fe1—C2 | 106.7 (3) | C12—C13—H13 | 119.8 |
| C9—Fe1—C2 | 166.5 (4) | C13—C14—C15 | 120.3 (5) |
| C8—Fe1—C2 | 151.0 (3) | C13—C14—H14 | 119.8 |
| C7—Fe1—C1 | 152.2 (3) | C15—C14—H14 | 119.8 |
| C6—Fe1—C1 | 119.6 (3) | C14—C15—C16 | 120.1 (5) |
| C9—Fe1—C1 | 129.5 (3) | C14—C15—H15 | 119.9 |
| C8—Fe1—C1 | 167.3 (3) | C16—C15—H15 | 119.9 |
| C2—Fe1—C1 | 40.84 (17) | C11—C16—C15 | 120.1 (5) |
| C7—Fe1—C5 | 164.7 (3) | C11—C16—H16 | 119.9 |
| C6—Fe1—C5 | 155.7 (4) | C15—C16—H16 | 119.9 |
| C9—Fe1—C5 | 109.9 (3) | O2—C20—Ru1 | 176.9 (4) |
| C8—Fe1—C5 | 128.6 (3) | C22—C21—C26 | 118.0 (4) |
| C2—Fe1—C5 | 69.0 (2) | C22—C21—P2 | 119.7 (3) |
| C1—Fe1—C5 | 41.46 (17) | C26—C21—P2 | 122.2 (3) |
| C7—Fe1—C3 | 107.4 (3) | C23—C22—C21 | 121.4 (5) |
| C6—Fe1—C3 | 125.1 (4) | C23—C22—H22 | 119.3 |
| C9—Fe1—C3 | 152.2 (4) | C21—C22—H22 | 119.3 |
| C8—Fe1—C3 | 117.9 (3) | C24—C23—C22 | 119.4 (5) |
| C2—Fe1—C3 | 40.93 (19) | C24—C23—H23 | 120.3 |
| C1—Fe1—C3 | 68.67 (18) | C22—C23—H23 | 120.3 |
| C5—Fe1—C3 | 68.2 (2) | C23—C24—C25 | 120.6 (5) |
| C7—Fe1—C4 | 126.8 (3) | C23—C24—H24 | 119.7 |
| C6—Fe1—C4 | 162.2 (4) | C25—C24—H24 | 119.7 |
| C9—Fe1—C4 | 119.5 (4) | C24—C25—C26 | 120.2 (5) |
| C8—Fe1—C4 | 108.2 (3) | C24—C25—H25 | 119.9 |
| C2—Fe1—C4 | 69.0 (2) | C26—C25—H25 | 119.9 |
| C1—Fe1—C4 | 69.13 (18) | C25—C26—C21 | 120.4 (5) |
| C5—Fe1—C4 | 40.51 (18) | C25—C26—H26 | 119.8 |
| C3—Fe1—C4 | 40.6 (2) | C21—C26—H26 | 119.8 |
| C7—Fe1—C10 | 65.9 (4) | C36—C31—C32 | 118.2 (4) |
| C6—Fe1—C10 | 40.0 (4) | C36—C31—P2 | 120.5 (3) |
| C9—Fe1—C10 | 41.7 (4) | C32—C31—P2 | 121.2 (3) |
| C8—Fe1—C10 | 67.5 (3) | C33—C32—C31 | 120.9 (5) |
| C2—Fe1—C10 | 126.7 (3) | C33—C32—H32 | 119.6 |
| C1—Fe1—C10 | 109.5 (2) | C31—C32—H32 | 119.6 |
| C5—Fe1—C10 | 122.4 (3) | C34—C33—C32 | 120.2 (5) |
| C3—Fe1—C10 | 163.0 (4) | C34—C33—H33 | 119.9 |
| C4—Fe1—C10 | 156.0 (4) | C32—C33—H33 | 119.9 |
| Ru1—O3—H1S | 130 (3) | C33—C34—C35 | 119.8 (4) |
| Ru1—O3—H2S | 116 (5) | C33—C34—H34 | 120.1 |
| H1S—O3—H2S | 110 (5) | C35—C34—H34 | 120.1 |
| P1—S1—Ru1 | 90.85 (5) | C36—C35—C34 | 120.1 (5) |
| P1—S2—Ru1 | 90.15 (4) | C36—C35—H35 | 120.0 |
| O1—P1—C1 | 106.63 (18) | C34—C35—H35 | 120.0 |
| O1—P1—S1 | 116.18 (13) | C35—C36—C31 | 120.9 (4) |
| C1—P1—S1 | 109.51 (14) | C35—C36—H36 | 119.5 |
| O1—P1—S2 | 114.15 (13) | C31—C36—H36 | 119.5 |
| C1—P1—S2 | 111.17 (14) | C46—C41—C42 | 118.7 (4) |
| S1—P1—S2 | 99.14 (6) | C46—C41—P3 | 123.4 (3) |
| C11—P2—C31 | 103.93 (18) | C42—C41—P3 | 117.9 (3) |
| C11—P2—C21 | 102.26 (19) | C43—C42—C41 | 120.7 (4) |
| C31—P2—C21 | 98.52 (18) | C43—C42—H42 | 119.7 |
| C11—P2—Ru1 | 116.26 (13) | C41—C42—H42 | 119.7 |
| C31—P2—Ru1 | 119.75 (13) | C42—C43—C44 | 120.1 (4) |
| C21—P2—Ru1 | 113.37 (13) | C42—C43—H43 | 120.0 |
| C61—P3—C51 | 104.19 (19) | C44—C43—H43 | 120.0 |
| C61—P3—C41 | 98.26 (18) | C45—C44—C43 | 119.7 (4) |
| C51—P3—C41 | 102.50 (18) | C45—C44—H44 | 120.1 |
| C61—P3—Ru1 | 121.33 (14) | C43—C44—H44 | 120.1 |
| C51—P3—Ru1 | 113.93 (14) | C44—C45—C46 | 120.2 (5) |
| C41—P3—Ru1 | 114.01 (13) | C44—C45—H45 | 119.9 |
| C2—C1—C5 | 107.2 (4) | C46—C45—H45 | 119.9 |
| C2—C1—P1 | 129.1 (3) | C41—C46—C45 | 120.6 (4) |
| C5—C1—P1 | 123.5 (3) | C41—C46—H46 | 119.7 |
| C2—C1—Fe1 | 69.4 (3) | C45—C46—H46 | 119.7 |
| C5—C1—Fe1 | 69.3 (2) | C56—C51—C52 | 118.5 (4) |
| P1—C1—Fe1 | 123.3 (2) | C56—C51—P3 | 123.2 (3) |
| C1—C2—C3 | 107.9 (4) | C52—C51—P3 | 118.3 (3) |
| C1—C2—Fe1 | 69.8 (3) | C53—C52—C51 | 120.7 (4) |
| C3—C2—Fe1 | 69.8 (3) | C53—C52—H52 | 119.7 |
| C1—C2—H2 | 126.0 | C51—C52—H52 | 119.7 |
| C3—C2—H2 | 126.0 | C54—C53—C52 | 120.4 (5) |
| Fe1—C2—H2 | 125.9 | C54—C53—H53 | 119.8 |
| C4—C3—C2 | 108.7 (4) | C52—C53—H53 | 119.8 |
| C4—C3—Fe1 | 69.9 (3) | C53—C54—C55 | 120.2 (4) |
| C2—C3—Fe1 | 69.3 (3) | C53—C54—H54 | 119.9 |
| C4—C3—H3 | 125.6 | C55—C54—H54 | 119.9 |
| C2—C3—H3 | 125.6 | C54—C55—C56 | 119.9 (5) |
| Fe1—C3—H3 | 126.8 | C54—C55—H55 | 120.1 |
| C5—C4—C3 | 107.8 (4) | C56—C55—H55 | 120.1 |
| C5—C4—Fe1 | 69.5 (3) | C51—C56—C55 | 120.3 (5) |
| C3—C4—Fe1 | 69.6 (3) | C51—C56—H56 | 119.8 |
| C5—C4—H4 | 126.1 | C55—C56—H56 | 119.8 |
| C3—C4—H4 | 126.1 | C62—C61—C66 | 118.8 (4) |
| Fe1—C4—H4 | 126.4 | C62—C61—P3 | 120.2 (3) |
| C4—C5—C1 | 108.4 (4) | C66—C61—P3 | 120.9 (3) |
| C4—C5—Fe1 | 70.0 (3) | C61—C62—C63 | 120.0 (4) |
| C1—C5—Fe1 | 69.3 (2) | C61—C62—H62 | 120.0 |
| C4—C5—H5 | 125.8 | C63—C62—H62 | 120.0 |
| C1—C5—H5 | 125.8 | C64—C63—C62 | 120.5 (5) |
| Fe1—C5—H5 | 126.5 | C64—C63—H63 | 119.8 |
| C7—C6—C10 | 107.9 (9) | C62—C63—H63 | 119.8 |
| C7—C6—Fe1 | 70.3 (5) | C63—C64—C65 | 120.3 (5) |
| C10—C6—Fe1 | 70.9 (5) | C63—C64—H64 | 119.8 |
| C7—C6—H6 | 126.0 | C65—C64—H64 | 119.8 |
| C10—C6—H6 | 126.0 | C64—C65—C66 | 120.0 (5) |
| Fe1—C6—H6 | 124.4 | C64—C65—H65 | 120.0 |
| C6—C7—C8 | 111.4 (8) | C66—C65—H65 | 120.0 |
| C6—C7—Fe1 | 70.9 (4) | C65—C66—C61 | 120.3 (5) |
| C8—C7—Fe1 | 70.8 (4) | C65—C66—H66 | 119.8 |
| C6—C7—H7 | 124.3 | C61—C66—H66 | 119.8 |
| C8—C7—H7 | 124.3 | Cl1S—C1S—Cl2S | 119.8 (8) |
| Fe1—C7—H7 | 125.5 | Cl1S—C1S—H1S1 | 107.4 |
| C7—C8—C9 | 108.1 (8) | Cl2S—C1S—H1S1 | 107.4 |
| C7—C8—Fe1 | 69.9 (4) | Cl1S—C1S—H1S2 | 107.4 |
| C9—C8—Fe1 | 70.0 (4) | Cl2S—C1S—H1S2 | 107.4 |
| C7—C8—H8 | 125.9 | H1S1—C1S—H1S2 | 106.9 |
| D—H···A | D—H | H···A | D···A | D—H···A |
| O3—H1S···O1i | 0.82 (1) | 1.72 (2) | 2.515 (4) | 162 (4) |
| O3—H2S···O3i | 0.82 (1) | 2.52 (6) | 2.980 (6) | 117 (5) |
| Symmetry code: (i) −x+1, −y+2, −z+1. |
Experimental details
| Crystal data | |
| Chemical formula | [FeRu(C5H5)(C5H4OPS2)(CO)(C18H15P)2(H2O)]·CH2Cl2 |
| Mr | 1052.67 |
| Crystal system, space group | Triclinic, P1 |
| Temperature (K) | 296 |
| a, b, c (Å) | 12.1493 (9), 14.2208 (11), 14.7100 (11) |
| α, β, γ (°) | 101.811 (1), 98.278 (1), 109.759 (1) |
| V (Å3) | 2277.7 (3) |
| Z | 2 |
| Radiation type | Mo Kα |
| µ (mm−1) | 1.01 |
| Crystal size (mm) | 0.24 × 0.15 × 0.08 |
| Data collection | |
| Diffractometer | Bruker SMART APEXII CCD area-detector diffractometer |
| Absorption correction | Multi-scan (SADABS; Sheldrick, 1997) |
| Tmin, Tmax | 0.794, 0.924 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 32262, 10536, 8221 |
| Rint | 0.039 |
| (sin θ/λ)max (Å−1) | 0.653 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.054, 0.154, 1.05 |
| No. of reflections | 10536 |
| No. of parameters | 549 |
| No. of restraints | 2 |
| H-atom treatment | H atoms treated by a mixture of independent and constrained refinement |
| Δρmax, Δρmin (e Å−3) | 3.98, −0.67 |
Computer programs: APEX2 (Bruker, 2005), SAINT (Bruker, 2005), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), SHELXTL (Sheldrick, 2008).
| D—H···A | D—H | H···A | D···A | D—H···A |
| O3—H1S···O1i | 0.824 (10) | 1.720 (17) | 2.515 (4) | 162 (4) |
| O3—H2S···O3i | 0.818 (10) | 2.52 (6) | 2.980 (6) | 117 (5) |
| Symmetry code: (i) −x+1, −y+2, −z+1. |
Acknowledgements
This project was supported by the Natural Science Foundation of China (20771003).
References
Allen, F. H. (2002). Acta Cryst. B58, 380–388. Web of Science CrossRef CAS IUCr Journals Google Scholar
Bruker (2005). APEX2 and SAINT. Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
Foreman, M. R. St J., Slawin, A. M. Z. & Woollins, J. D. (1996). J. Chem. Soc. Dalton Trans. pp. 3653–3657. CSD CrossRef Web of Science Google Scholar
Gray, I. P., Milton, H. L., Slawin, A. M. Z. & Woollins, J. D. (2003). Dalton Trans. pp. 3450–3457. Web of Science CSD CrossRef Google Scholar
Gray, I. P., Slawin, A. M. Z. & Woollins, J. D. (2004). Dalton Trans. pp. 2477–2486. Web of Science CSD CrossRef Google Scholar
Haiduc, I. (2001). J. Organomet. Chem. 623, 29–42. Web of Science CrossRef CAS Google Scholar
Liu, X., Zhang, Q. F. & Leung, W. H. (2005). J. Coord. Chem. 58, 1299–1305. Web of Science CSD CrossRef CAS Google Scholar
Sheldrick, G. M. (1997). SADABS. University of Gőttingen, Germany. Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Thomas, C. M., Neels, A., Stoeckli-Evans, H. & Sűss-Fink, G. (2001). J. Organomet. Chem. 633, 85–90. Web of Science CSD CrossRef CAS Google Scholar
Van Zyl, W. E. (2010). Comments Inorg. Chem. 31, 13–45. Web of Science CrossRef CAS Google Scholar
Wang, X. Y., Li, Y., Ma, Q. & Zhang, Q. F. (2010). Organometallics, 29, 2752–2760. Web of Science CSD CrossRef CAS Google Scholar
Zhang, Q. F., Chim, J. L. C., Lai, W., Wong, W. T. & Leung, W. H. (2001). Inorg. Chem. 40, 2470–2471. Web of Science CSD CrossRef PubMed CAS Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
![[P \overline 1] Mathematical equation](teximages/ds2231fi1.gif)
![[Figure 1]](./ds2231fig1thm.gif)
![[Figure 2]](./ds2231fig2thm.gif)




Lawesson's Reagent (LR) [(p-MeO-C6H4)P(S)(µ-S)]2 was initially used for the purpose of a sulfur transfer reagent, especially to convert ketones to thiones, but was later used to form dithiophosphonic acids as well (Haiduc, 2001; Van Zyl, 2010). LR is formed through the reaction between P4S10 and anisole. Recognizing anisole to be an electron-rich aromatic, Woollins and co-workers skillfully introduced ferrocene, which performs similar electrophilic substitution type chemistry to afford the ferrocenyl derivative [FcP(S)(µ-S)]2 (Fc = Fe(η5-C5H4)(η5-C5H5)) (Gray et al., 2004). This chemistry has been extended further by forming interesting ferrocenyl-type heterocycles. Similarly, [FcP(S)(µ-S)]2 can undergo a ring opening reaction by nucleophilic attack under suitable conditions, resulting in formation of the typical ferrocenyl-dithiophosphonate ligands, which may directly react with a range of metal ions to produce new heterometallic complexes containing the electron-rich and aromatic ferrocene groups (Gray et al., 2003; Thomas et al., 2001). As a part of research interest to the later transition metal-sulfur chemistry, we have recently reported ruthenium complexes with ferrocenyl-phosphonodithiolate as a dithio ligand (Wang et al., 2010). We here describe the crystal structure of a ruthenium(II)-ferrocenyl-dithiophosphonato complex [{FcP(O)S2}Ru(CO)(H2O)(PPh3)2].CH2Cl2 (Fc = Fe(η5-C5H4)(η5-C5H5)) in this paper.
The title complex crystallizes in triclinic space group P-1 with two molecules in the unit cell, as shown in Fig. 1. The ruthenium center has an octahedral coordination environment with the H2O and CO ligands mutually trans. The [FcP(O)S2]2- acts as a chelating ligand through its two sulfur atoms to bond the ruthenium center with the bite angle S(1)—Ru(1)—S(2) of 79.74 (4)° which agrees with those in cis-[Ru(CO){FcP(OCH3)PS2}2(PPh3)] [78.43 (3)° and 79.84 (3)°] (Wang et al., 2010). Two cis PPh3 ligands bind to the ruthenium center with the P—Ru—P angle of 106.97 (4)°, and one chelating [FcP(O)S2]2- ligands form the basal plane. The average Ru—S bond length (av. 2.4337 (20) Å) in the title complex is compatible to that in cis-[Ru(CO){FcP(OCH3)PS2}2(PPh3)] (av. 2.4854 (11) Å) (Wang et al., 2010). The Ru—O bond length of 2.159 (3) Å is similar to that observed for trans-Ru[N(Ph2PS)2]2(H2O)(NH3) (2.118 (4) Å) (Zhang et al., 2001). The Ru—C bond length and Ru—C—O bond angle in the title complex are 1.826 (4) Å and 176.9 (4)°, respectively, which are comparable to those in [Ru(CO){ARP(O)S2}(PPh3)2]2 (Ar = p-C6H4OMe) (Ru—C = 1.804 (4) Å and Ru—C—O = 174.8 (4)°) (Wang et al., 2010) and [RuH(CO){S2P(OEt)2}(PPh3)2] (Ru—C = 1.829 (4) Å and Ru—C—O = 175.4 (4)°) (Liu et al. 2005). A pair of head-to-tail intermolecular O—H···Oa (a: x + 1, y + 2, z + 1) hydrogen bonds (O3—H1S···O1a: 1.719 (16) Å, 2.516 (4) Å, 162 (4)°; O3—H2S···O3a: 2.53 (6) Å, 2.981 (6) Å, 116 (5)°) linking adjacent molecules to form a dimmer was observed in the crystal packing.