metal-organic compounds
trans-Acetyldicarbonyl(η5-cyclopentadienyl)[tris(furan-2-yl)phosphane-κP]molybdenum(II)
aDepartment of Chemistry, Carleton College, 1 N. College St, Northfield, MN 55057, USA, and bDepartment of Chemistry, St Catherine University, 2004 Randolph Ave., St Paul, MN 55105, USA
*Correspondence e-mail: [email protected]
The title compound, [Mo(C5H5)(C2H3O)(C12H9O3P)(CO)2], was prepared by reaction of [Mo(C5H5)(CO)3(CH3)] with tris(furan-2-yl)phosphane. The MoII atom exhibits a four-legged piano-stool coordination geometry with the acetyl and phosphine ligands trans to each other. The O atom of the acetyl ligand points down, away from the Cp ring. In the crystal, molecules form centrosymmetrical dimers via π–π interactions between furyl rings [the centroid–centroid distance is 3.396 (4) Å]. The dimers are linked by C—H⋯O hydrogen bonds into layers parallel to (100).
Related literature
For synthetic details for a related complex, see: Gladysz et al. (1979
). For related structures, see: Churchill & Fennessey (1968
); Barnett et al. (1972
); Michelini-Rodriguez et al. (1993
); Adams et al. (1997
, 2000
); Whited et al. (2012
).
Experimental
Crystal data
|
| ||||||||||||||||||||||||||||
| ||||||||||||||||||||||
Data collection: CrystalClear (Rigaku Americas and Rigaku, 2011
); cell refinement: CrystalClear; data reduction: CrystalClear; program(s) used to solve structure: SIR2004 (Burla et al., 2005
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: CrystalStructure (Rigaku Americas and Rigaku, 2010
); software used to prepare material for publication: CrystalStructure.
Supporting information
contains datablocks General, I. DOI: 10.1107/S160053681302059X/kq2007sup1.cif
Structure factors: contains datablock I. DOI: 10.1107/S160053681302059X/kq2007Isup2.hkl
Supporting information file. DOI: 10.1107/S160053681302059X/kq2007Isup3.cdx
CpMo(CO)3(CH3). This compound was prepared by a modification of the method used by Gladysz et al. (1979), as previously reported by Whited et al. (2012).
CpMo(CO)2(P(2-Fur)3)(COCH3) (I). In an inert-atmosphere CpMo(CO)3(CH3) (30.6 mg, 0.118 mmol) was dissolved in 2 ml acetonitrile. In a separate vial, tris(furan-2-yl)phosphane (42.0 mg, 0.181 mmol) was dissolved in 2 ml acetonitrile. The vials were combined and the resulting solution was stirred for 1 week. Solvent was removed in vacuo, leaving an orange oil that was triturated with pentane (5 mL) and isolated by filtration to afford the desired product in pure form as a yellow powder (21.6 mg, 37.2%), as confirmed by IR and NMR (1H, 13C, and 31P) spectral analyses. Crystalline material was obtained as yellow-orange prisms by vapor diffusion of pentane into a concentrated solution of I in diethyl ether at 233 K.
H-atoms were treated in calculated positions and refined in the riding model approximation with distances of C—H = 0.95, 1.00 and 0.98 Å for the furanyl, cyclopentadienyl and methyl groups, respectively, and with Uiso(H) = k×Ueq(C), k = 1.2 for furanyl and cyclopentadienyl groups and 1.5 for methyl groups. Methyl group H atoms were allowed to rotate in order to find the best rotameric conformation. The maximum and minimum electron densities in the final difference Fourier map are located 0.98 and 0.77 Å, respectively, from atom Mo1.
Eight low-angle reflections were rejected from the high-quality data set due to the arrangement of the instrument with a conservatively sized beam stop and a fixed-position detector. The large number of reflections in this data set (and the Fourier-transform relationship of intensities to atoms) ensures that no particular bias was thereby introduced into this routine structure determination.
Data collection: CrystalClear (Rigaku Americas and Rigaku, 2011); cell CrystalClear (Rigaku Americas and Rigaku, 2011); data reduction: CrystalClear (Rigaku Americas and Rigaku, 2011); program(s) used to solve structure: SIR2004 (Burla et al., 2005); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: CrystalStructure (Rigaku Americas and Rigaku, 2010); software used to prepare material for publication: CrystalStructure (Rigaku Americas and Rigaku, 2010).
| [Mo(C5H5)(C2H3O)(C12H9O3P)(CO)2] | F(000) = 992.00 |
| Mr = 492.28 | Dx = 1.644 Mg m−3 |
| Monoclinic, P21/c | Mo Kα radiation, λ = 0.71075 Å |
| Hall symbol: -P 2ybc | Cell parameters from 13392 reflections |
| a = 8.050 (2) Å | θ = 3.2–27.6° |
| b = 15.762 (4) Å | µ = 0.78 mm−1 |
| c = 16.073 (4) Å | T = 173 K |
| β = 102.852 (8)° | Prism, orange |
| V = 1988.4 (9) Å3 | 0.24 × 0.17 × 0.15 mm |
| Z = 4 |
| Rigaku XtaLAB mini diffractometer | 3799 reflections with F2 > 2σ(F2) |
| Detector resolution: 6.827 pixels mm-1 | Rint = 0.044 |
| ω scans | θmax = 27.5° |
| Absorption correction: multi-scan (REQAB; Rigaku, 1998) | h = −10→9 |
| Tmin = 0.709, Tmax = 0.890 | k = −20→20 |
| 16222 measured reflections | l = −20→20 |
| 4539 independent reflections |
| Refinement on F2 | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.035 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.075 | H-atom parameters constrained |
| S = 1.06 | w = 1/[σ2(Fo2) + (0.025P)2 + 1.9823P] where P = (Fo2 + 2Fc2)/3 |
| 4539 reflections | (Δ/σ)max < 0.001 |
| 263 parameters | Δρmax = 0.55 e Å−3 |
| 0 restraints | Δρmin = −0.52 e Å−3 |
| Primary atom site location: structure-invariant direct methods |
| [Mo(C5H5)(C2H3O)(C12H9O3P)(CO)2] | V = 1988.4 (9) Å3 |
| Mr = 492.28 | Z = 4 |
| Monoclinic, P21/c | Mo Kα radiation |
| a = 8.050 (2) Å | µ = 0.78 mm−1 |
| b = 15.762 (4) Å | T = 173 K |
| c = 16.073 (4) Å | 0.24 × 0.17 × 0.15 mm |
| β = 102.852 (8)° |
| Rigaku XtaLAB mini diffractometer | 4539 independent reflections |
| Absorption correction: multi-scan (REQAB; Rigaku, 1998) | 3799 reflections with F2 > 2σ(F2) |
| Tmin = 0.709, Tmax = 0.890 | Rint = 0.044 |
| 16222 measured reflections |
| R[F2 > 2σ(F2)] = 0.035 | 0 restraints |
| wR(F2) = 0.075 | H-atom parameters constrained |
| S = 1.06 | Δρmax = 0.55 e Å−3 |
| 4539 reflections | Δρmin = −0.52 e Å−3 |
| 263 parameters |
Refinement. Refinement was performed using all reflections. The weighted R-factor (wR) and goodness of fit (S) are based on F2. R-factor (gt) are based on F. The threshold expression of F2 > 2.0 σ(F2) is used only for calculating R-factor (gt). |
| x | y | z | Uiso*/Ueq | ||
| Mo1 | 0.28931 (3) | 0.203772 (14) | 0.114671 (14) | 0.01996 (7) | |
| P1 | 0.43789 (8) | 0.33427 (4) | 0.16296 (4) | 0.02053 (15) | |
| O1 | 0.2805 (4) | 0.17390 (16) | −0.07804 (14) | 0.0472 (6) | |
| O2 | 0.6441 (3) | 0.15779 (14) | 0.07963 (13) | 0.0357 (5) | |
| O3 | 0.1064 (3) | 0.33025 (14) | −0.02625 (14) | 0.0419 (6) | |
| O4 | 0.7480 (3) | 0.2905 (2) | 0.25444 (14) | 0.0615 (9) | |
| O5 | 0.3794 (3) | 0.49098 (13) | 0.22768 (13) | 0.0345 (5) | |
| O6 | 0.6466 (3) | 0.45252 (13) | 0.11535 (13) | 0.0334 (5) | |
| C1 | 0.2624 (4) | 0.1388 (2) | −0.01250 (19) | 0.0338 (7) | |
| C2 | 0.2310 (7) | 0.0460 (3) | −0.0174 (3) | 0.0706 (14) | |
| C3 | 0.5144 (4) | 0.17806 (17) | 0.09207 (16) | 0.0243 (6) | |
| C4 | 0.1775 (4) | 0.28439 (17) | 0.02493 (18) | 0.0282 (7) | |
| C5 | 0.0773 (4) | 0.11426 (19) | 0.14393 (19) | 0.0331 (7) | |
| C6 | 0.2380 (4) | 0.08037 (19) | 0.18492 (19) | 0.0354 (7) | |
| C7 | 0.3150 (4) | 0.1382 (2) | 0.24888 (18) | 0.0356 (7) | |
| C8 | 0.2035 (4) | 0.2073 (2) | 0.24670 (18) | 0.0333 (7) | |
| C9 | 0.0548 (4) | 0.19244 (19) | 0.18202 (19) | 0.0325 (7) | |
| C10 | 0.6004 (4) | 0.32891 (18) | 0.26045 (17) | 0.0247 (6) | |
| C11 | 0.6050 (4) | 0.3458 (2) | 0.34274 (18) | 0.0342 (7) | |
| C12 | 0.7657 (5) | 0.3184 (3) | 0.39118 (19) | 0.0423 (9) | |
| C13 | 0.8462 (5) | 0.2861 (4) | 0.3364 (3) | 0.0703 (15) | |
| C14 | 0.3049 (4) | 0.41841 (17) | 0.18893 (17) | 0.0254 (6) | |
| C15 | 0.1340 (4) | 0.4247 (2) | 0.17555 (19) | 0.0354 (7) | |
| C16 | 0.0987 (5) | 0.5054 (2) | 0.2072 (2) | 0.0406 (8) | |
| C17 | 0.2480 (5) | 0.5421 (2) | 0.2373 (2) | 0.0393 (8) | |
| C18 | 0.5519 (4) | 0.38037 (17) | 0.08986 (16) | 0.0237 (6) | |
| C19 | 0.5672 (4) | 0.35793 (19) | 0.01093 (18) | 0.0315 (7) | |
| C20 | 0.6773 (4) | 0.4186 (2) | −0.0150 (2) | 0.0374 (8) | |
| C21 | 0.7201 (4) | 0.4734 (2) | 0.0491 (2) | 0.0392 (8) | |
| H2A | 0.1192 | 0.0339 | −0.0055 | 0.0847* | |
| H2B | 0.3196 | 0.0170 | 0.0247 | 0.0847* | |
| H2C | 0.2336 | 0.0256 | −0.0747 | 0.0847* | |
| H5 | −0.0110 | 0.0843 | 0.1003 | 0.0397* | |
| H6 | 0.2812 | 0.0224 | 0.1758 | 0.0425* | |
| H7 | 0.4236 | 0.1288 | 0.2922 | 0.0427* | |
| H8 | 0.2210 | 0.2559 | 0.2877 | 0.0399* | |
| H9 | −0.0506 | 0.2280 | 0.1698 | 0.0390* | |
| H11 | 0.5168 | 0.3715 | 0.3646 | 0.0410* | |
| H12 | 0.8064 | 0.3227 | 0.4512 | 0.0507* | |
| H13 | 0.9576 | 0.2626 | 0.3511 | 0.0844* | |
| H15 | 0.0529 | 0.3833 | 0.1500 | 0.0425* | |
| H16 | −0.0105 | 0.5285 | 0.2068 | 0.0487* | |
| H17 | 0.2620 | 0.5969 | 0.2624 | 0.0471* | |
| H19 | 0.5147 | 0.3108 | −0.0213 | 0.0378* | |
| H20 | 0.7128 | 0.4196 | −0.0675 | 0.0449* | |
| H21 | 0.7925 | 0.5210 | 0.0490 | 0.0470* |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Mo1 | 0.01978 (12) | 0.02049 (12) | 0.01972 (11) | −0.00095 (9) | 0.00462 (8) | −0.00145 (9) |
| P1 | 0.0182 (4) | 0.0218 (4) | 0.0205 (4) | 0.0010 (3) | 0.0019 (3) | −0.0024 (3) |
| O1 | 0.0551 (16) | 0.0590 (16) | 0.0275 (12) | 0.0048 (13) | 0.0091 (11) | −0.0021 (11) |
| O2 | 0.0297 (12) | 0.0416 (13) | 0.0372 (12) | 0.0077 (10) | 0.0102 (10) | 0.0013 (10) |
| O3 | 0.0439 (14) | 0.0342 (12) | 0.0386 (13) | −0.0032 (11) | −0.0101 (11) | 0.0062 (10) |
| O4 | 0.0363 (14) | 0.120 (3) | 0.0239 (11) | 0.0383 (15) | −0.0028 (10) | −0.0109 (13) |
| O5 | 0.0311 (11) | 0.0289 (11) | 0.0408 (12) | 0.0030 (9) | 0.0017 (10) | −0.0134 (9) |
| O6 | 0.0317 (12) | 0.0309 (11) | 0.0359 (12) | −0.0088 (9) | 0.0038 (9) | −0.0006 (9) |
| C1 | 0.0271 (16) | 0.0452 (19) | 0.0288 (16) | −0.0002 (14) | 0.0053 (13) | −0.0068 (14) |
| C2 | 0.108 (4) | 0.050 (3) | 0.065 (3) | −0.035 (3) | 0.044 (3) | −0.029 (2) |
| C3 | 0.0289 (15) | 0.0229 (14) | 0.0211 (13) | −0.0022 (12) | 0.0057 (11) | 0.0016 (11) |
| C4 | 0.0254 (15) | 0.0255 (15) | 0.0310 (15) | −0.0065 (12) | 0.0003 (12) | −0.0062 (12) |
| C5 | 0.0334 (17) | 0.0321 (16) | 0.0370 (16) | −0.0103 (13) | 0.0148 (13) | −0.0029 (13) |
| C6 | 0.0445 (19) | 0.0270 (16) | 0.0406 (17) | 0.0012 (14) | 0.0218 (15) | 0.0086 (13) |
| C7 | 0.0347 (17) | 0.048 (2) | 0.0257 (15) | 0.0015 (15) | 0.0112 (13) | 0.0113 (14) |
| C8 | 0.0359 (17) | 0.0427 (18) | 0.0249 (14) | −0.0079 (15) | 0.0147 (13) | −0.0057 (13) |
| C9 | 0.0267 (15) | 0.0382 (17) | 0.0363 (16) | −0.0044 (13) | 0.0150 (13) | 0.0002 (13) |
| C10 | 0.0189 (13) | 0.0305 (15) | 0.0243 (14) | 0.0023 (11) | 0.0039 (11) | −0.0020 (11) |
| C11 | 0.0296 (16) | 0.0474 (19) | 0.0258 (15) | 0.0029 (14) | 0.0068 (13) | −0.0042 (13) |
| C12 | 0.0366 (18) | 0.064 (3) | 0.0228 (15) | 0.0043 (16) | −0.0011 (13) | 0.0006 (15) |
| C13 | 0.039 (2) | 0.138 (5) | 0.0272 (17) | 0.041 (3) | −0.0083 (16) | −0.006 (3) |
| C14 | 0.0267 (15) | 0.0216 (14) | 0.0265 (14) | 0.0027 (12) | 0.0028 (11) | −0.0060 (11) |
| C15 | 0.0245 (15) | 0.0375 (18) | 0.0432 (18) | 0.0015 (14) | 0.0052 (13) | −0.0118 (14) |
| C16 | 0.0329 (17) | 0.047 (2) | 0.0402 (18) | 0.0157 (15) | 0.0039 (14) | −0.0132 (15) |
| C17 | 0.047 (2) | 0.0330 (17) | 0.0368 (17) | 0.0138 (15) | 0.0060 (15) | −0.0141 (14) |
| C18 | 0.0226 (14) | 0.0218 (13) | 0.0249 (13) | −0.0017 (11) | 0.0012 (11) | 0.0012 (11) |
| C19 | 0.0364 (17) | 0.0312 (16) | 0.0269 (15) | 0.0001 (14) | 0.0069 (13) | 0.0021 (12) |
| C20 | 0.0359 (17) | 0.0452 (19) | 0.0335 (16) | 0.0007 (15) | 0.0124 (14) | 0.0131 (15) |
| C21 | 0.0298 (17) | 0.0414 (19) | 0.0445 (19) | −0.0075 (15) | 0.0045 (14) | 0.0147 (15) |
| Mo1—P1 | 2.4189 (8) | C10—C11 | 1.342 (4) |
| Mo1—C1 | 2.253 (4) | C11—C12 | 1.421 (5) |
| Mo1—C3 | 1.968 (3) | C12—C13 | 1.307 (6) |
| Mo1—C4 | 1.982 (3) | C14—C15 | 1.348 (5) |
| Mo1—C5 | 2.341 (4) | C15—C16 | 1.422 (5) |
| Mo1—C6 | 2.332 (4) | C16—C17 | 1.325 (5) |
| Mo1—C7 | 2.359 (3) | C18—C19 | 1.349 (4) |
| Mo1—C8 | 2.374 (4) | C19—C20 | 1.427 (5) |
| Mo1—C9 | 2.382 (4) | C20—C21 | 1.330 (5) |
| P1—C10 | 1.806 (3) | C2—H2A | 0.980 |
| P1—C14 | 1.810 (3) | C2—H2B | 0.980 |
| P1—C18 | 1.797 (3) | C2—H2C | 0.980 |
| O1—C1 | 1.227 (4) | C5—H5 | 1.000 |
| O2—C3 | 1.150 (4) | C6—H6 | 1.000 |
| O3—C4 | 1.148 (4) | C7—H7 | 1.000 |
| O4—C10 | 1.356 (4) | C8—H8 | 1.000 |
| O4—C13 | 1.379 (4) | C9—H9 | 1.000 |
| O5—C14 | 1.375 (4) | C11—H11 | 0.950 |
| O5—C17 | 1.365 (4) | C12—H12 | 0.950 |
| O6—C18 | 1.380 (4) | C13—H13 | 0.950 |
| O6—C21 | 1.368 (5) | C15—H15 | 0.950 |
| C1—C2 | 1.484 (6) | C16—H16 | 0.950 |
| C5—C6 | 1.419 (5) | C17—H17 | 0.950 |
| C5—C9 | 1.406 (5) | C19—H19 | 0.950 |
| C6—C7 | 1.410 (5) | C20—H20 | 0.950 |
| C7—C8 | 1.406 (5) | C21—H21 | 0.950 |
| C8—C9 | 1.420 (4) | ||
| P1···O3 | 3.573 (3) | C2···H5xiii | 2.8413 |
| O1···O2 | 3.428 (3) | C2···H11i | 3.5382 |
| O1···O3 | 3.041 (4) | C3···H9iv | 3.5348 |
| O1···C3 | 2.956 (4) | C3···H17v | 2.9114 |
| O1···C4 | 2.659 (4) | C4···H12ii | 3.4063 |
| O2···O4 | 3.453 (4) | C4···H13ii | 3.0478 |
| O2···C1 | 3.114 (4) | C4···H21vi | 3.3179 |
| O2···C18 | 3.597 (4) | C5···H2Axiii | 3.3681 |
| O2···C19 | 3.354 (4) | C5···H2Cxiii | 3.3355 |
| O3···C1 | 3.258 (4) | C5···H12ii | 3.5118 |
| O3···C15 | 3.531 (4) | C5···H16ix | 2.9065 |
| O4···O6 | 3.373 (4) | C5···H17ix | 3.4107 |
| O4···C3 | 3.362 (4) | C6···H16ix | 2.9100 |
| O4···C18 | 3.105 (4) | C7···H16ix | 3.2069 |
| O5···O6 | 3.160 (4) | C7···H17v | 3.5114 |
| O5···C10 | 3.091 (4) | C8···H13viii | 2.9953 |
| O5···C11 | 3.234 (4) | C8···H16ix | 3.3813 |
| O5···C18 | 3.353 (4) | C9···H13viii | 3.1884 |
| O6···C10 | 3.124 (4) | C9···H16ix | 3.2067 |
| O6···C14 | 3.271 (4) | C9···H17ix | 3.2533 |
| C2···C3 | 3.294 (5) | C10···H6vii | 3.2903 |
| C2···C5 | 3.293 (6) | C11···H2Bvii | 3.4072 |
| C2···C6 | 3.285 (6) | C11···H6vii | 2.9657 |
| C3···C10 | 3.553 (4) | C11···H19x | 3.4790 |
| C3···C18 | 3.204 (4) | C12···H2Bvii | 3.5370 |
| C3···C19 | 3.188 (5) | C12···H6vii | 3.3854 |
| C4···C14 | 3.356 (4) | C12···H19x | 3.3869 |
| C4···C15 | 3.355 (5) | C13···H8iv | 3.3152 |
| C4···C18 | 3.326 (4) | C13···H9iv | 3.1123 |
| C4···C19 | 3.398 (5) | C13···H17v | 3.3987 |
| C8···C14 | 3.597 (5) | C14···H20vi | 3.1976 |
| C11···C14 | 3.255 (4) | C15···H20vi | 3.3925 |
| O1···C8i | 3.324 (4) | C15···H21viii | 3.3930 |
| O1···C11i | 3.166 (5) | C16···H2Cx | 3.4656 |
| O1···C13ii | 3.518 (5) | C16···H5xii | 3.5488 |
| O2···C2iii | 3.574 (5) | C16···H20vi | 3.2027 |
| O2···C5iv | 3.479 (4) | C16···H21viii | 3.1327 |
| O2···C9iv | 3.394 (4) | C17···H2Cx | 3.2303 |
| O2···C12i | 3.405 (5) | C17···H7vii | 3.1047 |
| O2···C17v | 3.406 (4) | C17···H20vi | 2.8803 |
| O3···C13ii | 3.250 (5) | C18···H21vi | 3.5115 |
| O3···C21vi | 3.449 (4) | C19···H7i | 3.4546 |
| O4···C9iv | 3.335 (5) | C19···H21vi | 3.4225 |
| O5···C6vii | 3.395 (4) | C20···H7i | 3.3946 |
| O5···C7vii | 3.342 (4) | C20···H15iv | 3.5936 |
| O6···C20vi | 3.414 (4) | C21···H15iv | 3.1450 |
| C2···O2iii | 3.574 (5) | C21···H16iv | 3.0711 |
| C5···O2viii | 3.479 (4) | H2A···C2xiii | 3.1828 |
| C5···C16ix | 3.491 (5) | H2A···C5xiii | 3.3681 |
| C6···O5v | 3.395 (4) | H2A···H2Axiii | 2.2378 |
| C7···O5v | 3.342 (4) | H2A···H2Bxiii | 3.5677 |
| C8···O1x | 3.324 (4) | H2A···H2Cxiii | 3.4984 |
| C9···O2viii | 3.394 (4) | H2A···H5xiii | 2.4410 |
| C9···O4viii | 3.335 (5) | H2A···H12v | 3.4606 |
| C11···O1x | 3.166 (5) | H2A···H12ii | 3.3393 |
| C12···O2x | 3.405 (5) | H2B···O2iii | 3.2721 |
| C13···O1xi | 3.518 (5) | H2B···C11v | 3.4072 |
| C13···O3xi | 3.250 (5) | H2B···C12v | 3.5370 |
| C15···C21viii | 3.579 (4) | H2B···H2Axiii | 3.5677 |
| C16···C5xii | 3.491 (5) | H2B···H2Biii | 3.2227 |
| C16···C21viii | 3.543 (5) | H2B···H2Ciii | 3.5712 |
| C17···O2vii | 3.406 (4) | H2B···H5xiii | 3.2452 |
| C18···C21vi | 3.595 (4) | H2B···H11v | 3.0188 |
| C19···C21vi | 3.515 (5) | H2B···H12v | 3.2762 |
| C20···O6vi | 3.414 (4) | H2C···O2iii | 3.0612 |
| C20···C21vi | 3.557 (5) | H2C···C5xiii | 3.3355 |
| C21···O3vi | 3.449 (4) | H2C···C16i | 3.4656 |
| C21···C15iv | 3.579 (4) | H2C···C17i | 3.2303 |
| C21···C16iv | 3.543 (5) | H2C···H2Axiii | 3.4984 |
| C21···C18vi | 3.595 (4) | H2C···H2Biii | 3.5712 |
| C21···C19vi | 3.515 (5) | H2C···H5xiii | 2.4602 |
| C21···C20vi | 3.557 (5) | H2C···H11i | 3.1246 |
| Mo1···H2A | 3.4052 | H2C···H17i | 3.3020 |
| Mo1···H2B | 3.3128 | H5···O2viii | 2.9591 |
| Mo1···H15 | 3.5256 | H5···C2xiii | 2.8413 |
| Mo1···H19 | 3.5603 | H5···C16ix | 3.5488 |
| P1···H8 | 3.1866 | H5···H2Axiii | 2.4410 |
| P1···H11 | 3.2156 | H5···H2Bxiii | 3.2452 |
| P1···H15 | 3.1555 | H5···H2Cxiii | 2.4602 |
| P1···H19 | 3.1787 | H5···H12ii | 2.9127 |
| O1···H2A | 2.9305 | H5···H16ix | 3.1909 |
| O1···H2B | 2.9517 | H5···H17ix | 3.3139 |
| O1···H2C | 2.3698 | H6···O5v | 2.8696 |
| O1···H19 | 2.8766 | H6···O6v | 3.4567 |
| O2···H2B | 3.3917 | H6···C10v | 3.2903 |
| O2···H19 | 2.9626 | H6···C11v | 2.9657 |
| O3···H15 | 3.0736 | H6···C12v | 3.3854 |
| O3···H19 | 3.2846 | H6···H11v | 3.0322 |
| O4···H11 | 3.1144 | H6···H16ix | 3.1850 |
| O4···H12 | 3.1337 | H7···O5v | 2.7503 |
| O5···H11 | 2.9209 | H7···O6v | 3.2600 |
| O5···H15 | 3.1445 | H7···C17v | 3.1047 |
| O5···H16 | 3.1378 | H7···C19x | 3.4546 |
| O6···H19 | 3.1475 | H7···C20x | 3.3946 |
| O6···H20 | 3.1439 | H7···H17v | 2.9010 |
| C1···H5 | 3.2622 | H7···H19x | 3.0750 |
| C1···H6 | 3.5136 | H7···H20x | 2.9593 |
| C1···H19 | 3.4091 | H8···O1x | 2.3768 |
| C2···H5 | 3.0620 | H8···O3x | 3.5861 |
| C2···H6 | 3.0642 | H8···C1x | 3.5639 |
| C3···H2B | 3.0535 | H8···C13viii | 3.3152 |
| C3···H6 | 3.5333 | H8···H13viii | 2.5503 |
| C3···H7 | 3.5392 | H8···H19x | 3.5900 |
| C3···H19 | 2.7741 | H9···O2viii | 2.7898 |
| C4···H9 | 3.3890 | H9···O4viii | 2.5358 |
| C4···H15 | 2.8933 | H9···C3viii | 3.5348 |
| C4···H19 | 2.9982 | H9···C13viii | 3.1123 |
| C5···H2A | 2.8007 | H9···H12ii | 3.5362 |
| C5···H2B | 3.3893 | H9···H13viii | 2.9508 |
| C5···H7 | 3.2477 | H9···H17ix | 3.0301 |
| C5···H8 | 3.2364 | H11···O1x | 2.4000 |
| C6···H2A | 3.0845 | H11···O2x | 3.4100 |
| C6···H2B | 2.9686 | H11···C1x | 3.1494 |
| C6···H8 | 3.2410 | H11···C2x | 3.5382 |
| C6···H9 | 3.2593 | H11···H2Bvii | 3.0188 |
| C7···H5 | 3.2448 | H11···H2Cx | 3.1246 |
| C7···H9 | 3.2588 | H11···H6vii | 3.0322 |
| C8···H5 | 3.2368 | H11···H19x | 3.4104 |
| C8···H6 | 3.2403 | H12···O2x | 2.6951 |
| C8···H15 | 3.2779 | H12···O3xi | 3.3742 |
| C9···H6 | 3.2549 | H12···C4xi | 3.4063 |
| C9···H7 | 3.2582 | H12···C5xi | 3.5118 |
| C9···H15 | 3.0516 | H12···H2Avii | 3.4606 |
| C10···H7 | 3.5430 | H12···H2Axi | 3.3393 |
| C10···H8 | 3.3826 | H12···H2Bvii | 3.2762 |
| C10···H12 | 3.1464 | H12···H5xi | 2.9127 |
| C10···H13 | 3.1018 | H12···H9xi | 3.5362 |
| C11···H8 | 3.3365 | H12···H19x | 3.2551 |
| C11···H13 | 3.1033 | H13···O1xi | 2.7818 |
| C13···H11 | 3.0967 | H13···O3xi | 2.5324 |
| C14···H8 | 3.1651 | H13···C1xi | 3.2942 |
| C14···H11 | 3.0477 | H13···C4xi | 3.0478 |
| C14···H16 | 3.1411 | H13···C8iv | 2.9953 |
| C14···H17 | 3.1002 | H13···C9iv | 3.1884 |
| C15···H8 | 3.2035 | H13···H8iv | 2.5503 |
| C15···H9 | 3.4305 | H13···H9iv | 2.9508 |
| C15···H17 | 3.1200 | H13···H17v | 3.4406 |
| C17···H15 | 3.1177 | H15···O4viii | 3.5809 |
| C18···H20 | 3.1487 | H15···O6viii | 3.3749 |
| C18···H21 | 3.1083 | H15···C20viii | 3.5936 |
| C19···H21 | 3.1265 | H15···C21viii | 3.1450 |
| C21···H19 | 3.1235 | H15···H21viii | 3.1980 |
| H2A···H5 | 2.3253 | H16···O6viii | 3.0672 |
| H2A···H6 | 2.9215 | H16···C5xii | 2.9065 |
| H2B···H5 | 3.3341 | H16···C6xii | 2.9100 |
| H2B···H6 | 2.5171 | H16···C7xii | 3.2069 |
| H5···H6 | 2.5858 | H16···C8xii | 3.3813 |
| H5···H9 | 2.5780 | H16···C9xii | 3.2067 |
| H6···H7 | 2.5833 | H16···C21viii | 3.0711 |
| H7···H8 | 2.5739 | H16···H5xii | 3.1909 |
| H8···H9 | 2.5930 | H16···H6xii | 3.1850 |
| H8···H11 | 3.0352 | H16···H21viii | 2.6784 |
| H8···H15 | 3.0715 | H17···O2vii | 2.6622 |
| H9···H15 | 2.6274 | H17···O4vii | 3.0622 |
| H11···H12 | 2.5539 | H17···C3vii | 2.9114 |
| H12···H13 | 2.4165 | H17···C5xii | 3.4107 |
| H15···H16 | 2.5576 | H17···C7vii | 3.5114 |
| H16···H17 | 2.4292 | H17···C9xii | 3.2533 |
| H19···H20 | 2.5627 | H17···C13vii | 3.3987 |
| H20···H21 | 2.4355 | H17···H2Cx | 3.3020 |
| O1···H8i | 2.3768 | H17···H5xii | 3.3139 |
| O1···H11i | 2.4000 | H17···H7vii | 2.9010 |
| O1···H13ii | 2.7818 | H17···H9xii | 3.0301 |
| O2···H2Biii | 3.2721 | H17···H13vii | 3.4406 |
| O2···H2Ciii | 3.0612 | H17···H20vi | 3.1945 |
| O2···H5iv | 2.9591 | H19···C11i | 3.4790 |
| O2···H9iv | 2.7898 | H19···C12i | 3.3869 |
| O2···H11i | 3.4100 | H19···H7i | 3.0750 |
| O2···H12i | 2.6951 | H19···H8i | 3.5900 |
| O2···H17v | 2.6622 | H19···H11i | 3.4104 |
| O3···H8i | 3.5861 | H19···H12i | 3.2551 |
| O3···H12ii | 3.3742 | H19···H21vi | 3.5859 |
| O3···H13ii | 2.5324 | H20···O3iv | 3.3953 |
| O3···H20viii | 3.3953 | H20···O5vi | 2.8838 |
| O3···H21vi | 2.5352 | H20···O6vi | 3.4695 |
| O4···H9iv | 2.5358 | H20···C14vi | 3.1976 |
| O4···H15iv | 3.5809 | H20···C15vi | 3.3925 |
| O4···H17v | 3.0622 | H20···C16vi | 3.2027 |
| O5···H6vii | 2.8696 | H20···C17vi | 2.8803 |
| O5···H7vii | 2.7503 | H20···H7i | 2.9593 |
| O5···H20vi | 2.8838 | H20···H17vi | 3.1945 |
| O6···H6vii | 3.4567 | H21···O3vi | 2.5352 |
| O6···H7vii | 3.2600 | H21···C4vi | 3.3179 |
| O6···H15iv | 3.3749 | H21···C15iv | 3.3930 |
| O6···H16iv | 3.0672 | H21···C16iv | 3.1327 |
| O6···H20vi | 3.4695 | H21···C18vi | 3.5115 |
| C1···H8i | 3.5639 | H21···C19vi | 3.4225 |
| C1···H11i | 3.1494 | H21···H15iv | 3.1980 |
| C1···H13ii | 3.2942 | H21···H16iv | 2.6784 |
| C2···H2Axiii | 3.1828 | H21···H19vi | 3.5859 |
| P1—Mo1—C1 | 128.21 (9) | C7—C8—C9 | 108.7 (3) |
| P1—Mo1—C3 | 79.89 (8) | Mo1—C9—C5 | 71.1 (2) |
| P1—Mo1—C4 | 78.48 (8) | Mo1—C9—C8 | 72.30 (19) |
| P1—Mo1—C5 | 141.13 (8) | C5—C9—C8 | 107.1 (3) |
| P1—Mo1—C6 | 133.02 (8) | P1—C10—O4 | 115.9 (2) |
| P1—Mo1—C7 | 98.20 (8) | P1—C10—C11 | 134.6 (3) |
| P1—Mo1—C8 | 85.10 (8) | O4—C10—C11 | 109.1 (3) |
| P1—Mo1—C9 | 107.65 (8) | C10—C11—C12 | 107.5 (3) |
| C1—Mo1—C3 | 69.24 (11) | C11—C12—C13 | 106.1 (3) |
| C1—Mo1—C4 | 72.24 (12) | O4—C13—C12 | 111.0 (4) |
| C1—Mo1—C5 | 88.91 (12) | P1—C14—O5 | 119.6 (2) |
| C1—Mo1—C6 | 93.91 (12) | P1—C14—C15 | 130.7 (3) |
| C1—Mo1—C7 | 126.97 (12) | O5—C14—C15 | 109.7 (3) |
| C1—Mo1—C8 | 146.42 (12) | C14—C15—C16 | 106.7 (3) |
| C1—Mo1—C9 | 116.88 (11) | C15—C16—C17 | 106.4 (3) |
| C3—Mo1—C4 | 106.58 (12) | O5—C17—C16 | 111.4 (3) |
| C3—Mo1—C5 | 130.94 (11) | P1—C18—O6 | 117.9 (2) |
| C3—Mo1—C6 | 100.79 (12) | P1—C18—C19 | 132.5 (3) |
| C3—Mo1—C7 | 100.46 (11) | O6—C18—C19 | 109.6 (3) |
| C3—Mo1—C8 | 129.25 (10) | C18—C19—C20 | 106.9 (3) |
| C3—Mo1—C9 | 157.46 (11) | C19—C20—C21 | 106.3 (3) |
| C4—Mo1—C5 | 107.42 (11) | O6—C21—C20 | 111.3 (3) |
| C4—Mo1—C6 | 141.87 (11) | C1—C2—H2A | 109.475 |
| C4—Mo1—C7 | 151.60 (13) | C1—C2—H2B | 109.476 |
| C4—Mo1—C8 | 117.41 (12) | C1—C2—H2C | 109.471 |
| C4—Mo1—C9 | 95.82 (12) | H2A—C2—H2B | 109.480 |
| C5—Mo1—C6 | 35.35 (11) | H2A—C2—H2C | 109.467 |
| C5—Mo1—C7 | 58.13 (11) | H2B—C2—H2C | 109.459 |
| C5—Mo1—C8 | 57.63 (11) | Mo1—C5—H5 | 125.465 |
| C5—Mo1—C9 | 34.61 (11) | C6—C5—H5 | 125.462 |
| C6—Mo1—C7 | 34.99 (11) | C9—C5—H5 | 125.463 |
| C6—Mo1—C8 | 57.89 (11) | Mo1—C6—H6 | 125.921 |
| C6—Mo1—C9 | 58.25 (11) | C5—C6—H6 | 125.931 |
| C7—Mo1—C8 | 34.57 (11) | C7—C6—H6 | 125.919 |
| C7—Mo1—C9 | 57.92 (11) | Mo1—C7—H7 | 125.887 |
| C8—Mo1—C9 | 34.73 (10) | C6—C7—H7 | 125.888 |
| Mo1—P1—C10 | 116.72 (10) | C8—C7—H7 | 125.885 |
| Mo1—P1—C14 | 114.92 (10) | Mo1—C8—H8 | 125.541 |
| Mo1—P1—C18 | 114.96 (9) | C7—C8—H8 | 125.535 |
| C10—P1—C14 | 100.70 (13) | C9—C8—H8 | 125.540 |
| C10—P1—C18 | 102.09 (13) | Mo1—C9—H9 | 126.321 |
| C14—P1—C18 | 105.58 (13) | C5—C9—H9 | 126.319 |
| C10—O4—C13 | 106.3 (3) | C8—C9—H9 | 126.314 |
| C14—O5—C17 | 105.8 (3) | C10—C11—H11 | 126.232 |
| C18—O6—C21 | 105.9 (3) | C12—C11—H11 | 126.226 |
| Mo1—C1—O1 | 124.6 (3) | C11—C12—H12 | 126.961 |
| Mo1—C1—C2 | 118.5 (3) | C13—C12—H12 | 126.951 |
| O1—C1—C2 | 116.8 (3) | O4—C13—H13 | 124.493 |
| Mo1—C3—O2 | 175.7 (3) | C12—C13—H13 | 124.484 |
| Mo1—C4—O3 | 177.1 (3) | C14—C15—H15 | 126.643 |
| Mo1—C5—C6 | 71.96 (19) | C16—C15—H15 | 126.650 |
| Mo1—C5—C9 | 74.30 (19) | C15—C16—H16 | 126.781 |
| C6—C5—C9 | 108.7 (3) | C17—C16—H16 | 126.780 |
| Mo1—C6—C5 | 72.69 (18) | O5—C17—H17 | 124.313 |
| Mo1—C6—C7 | 73.56 (19) | C16—C17—H17 | 124.310 |
| C5—C6—C7 | 107.6 (3) | C18—C19—H19 | 126.546 |
| Mo1—C7—C6 | 71.45 (18) | C20—C19—H19 | 126.540 |
| Mo1—C7—C8 | 73.29 (18) | C19—C20—H20 | 126.865 |
| C6—C7—C8 | 107.9 (3) | C21—C20—H20 | 126.858 |
| Mo1—C8—C7 | 72.14 (19) | O6—C21—H21 | 124.340 |
| Mo1—C8—C9 | 72.97 (19) | C20—C21—H21 | 124.322 |
| P1—Mo1—C1—O1 | −21.0 (3) | C8—Mo1—C5—C6 | −78.82 (14) |
| P1—Mo1—C1—C2 | 155.15 (13) | C8—Mo1—C5—C9 | 37.38 (11) |
| C1—Mo1—P1—C10 | −123.99 (11) | C5—Mo1—C9—C5 | 0.00 (12) |
| C1—Mo1—P1—C14 | 118.42 (11) | C5—Mo1—C9—C8 | 115.8 (2) |
| C1—Mo1—P1—C18 | −4.46 (11) | C9—Mo1—C5—C6 | −116.2 (2) |
| C3—Mo1—P1—C10 | −70.77 (9) | C9—Mo1—C5—C9 | 0.00 (12) |
| C3—Mo1—P1—C14 | 171.65 (8) | C6—Mo1—C7—C6 | 0.00 (15) |
| C3—Mo1—P1—C18 | 48.76 (8) | C6—Mo1—C7—C8 | −116.1 (3) |
| C4—Mo1—P1—C10 | 179.83 (10) | C7—Mo1—C6—C5 | 115.0 (3) |
| C4—Mo1—P1—C14 | 62.25 (10) | C7—Mo1—C6—C7 | 0.00 (15) |
| C4—Mo1—P1—C18 | −60.64 (10) | C6—Mo1—C8—C7 | 37.45 (12) |
| P1—Mo1—C5—C6 | −97.48 (14) | C6—Mo1—C8—C9 | −79.32 (14) |
| P1—Mo1—C5—C9 | 18.72 (19) | C8—Mo1—C6—C5 | 77.99 (15) |
| C5—Mo1—P1—C10 | 76.30 (12) | C8—Mo1—C6—C7 | −36.99 (12) |
| C5—Mo1—P1—C14 | −41.29 (12) | C6—Mo1—C9—C5 | −37.63 (11) |
| C5—Mo1—P1—C18 | −164.17 (11) | C6—Mo1—C9—C8 | 78.21 (13) |
| P1—Mo1—C6—C5 | 121.66 (9) | C9—Mo1—C6—C5 | 36.82 (12) |
| P1—Mo1—C6—C7 | 6.7 (2) | C9—Mo1—C6—C7 | −78.17 (15) |
| C6—Mo1—P1—C10 | 24.61 (13) | C7—Mo1—C8—C7 | 0.00 (14) |
| C6—Mo1—P1—C14 | −92.97 (12) | C7—Mo1—C8—C9 | −116.8 (3) |
| C6—Mo1—P1—C18 | 144.14 (12) | C8—Mo1—C7—C6 | 116.1 (3) |
| P1—Mo1—C7—C6 | −175.07 (11) | C8—Mo1—C7—C8 | 0.00 (13) |
| P1—Mo1—C7—C8 | 68.84 (12) | C7—Mo1—C9—C5 | −79.11 (14) |
| C7—Mo1—P1—C10 | 28.47 (10) | C7—Mo1—C9—C8 | 36.73 (12) |
| C7—Mo1—P1—C14 | −89.11 (9) | C9—Mo1—C7—C6 | 79.19 (15) |
| C7—Mo1—P1—C18 | 148.00 (9) | C9—Mo1—C7—C8 | −36.89 (12) |
| P1—Mo1—C8—C7 | −112.11 (11) | C8—Mo1—C9—C5 | −115.8 (3) |
| P1—Mo1—C8—C9 | 131.13 (12) | C8—Mo1—C9—C8 | −0.00 (14) |
| C8—Mo1—P1—C10 | 60.56 (8) | C9—Mo1—C8—C7 | 116.8 (3) |
| C8—Mo1—P1—C14 | −57.03 (8) | C9—Mo1—C8—C9 | −0.00 (13) |
| C8—Mo1—P1—C18 | −179.91 (8) | Mo1—P1—C10—O4 | 74.1 (2) |
| P1—Mo1—C9—C5 | −167.80 (8) | Mo1—P1—C10—C11 | −96.6 (3) |
| P1—Mo1—C9—C8 | −51.96 (12) | Mo1—P1—C14—O5 | 171.31 (15) |
| C9—Mo1—P1—C10 | 87.32 (8) | Mo1—P1—C14—C15 | −9.8 (3) |
| C9—Mo1—P1—C14 | −30.26 (8) | Mo1—P1—C18—O6 | −176.72 (13) |
| C9—Mo1—P1—C18 | −153.15 (8) | Mo1—P1—C18—C19 | 2.5 (3) |
| C3—Mo1—C1—O1 | −78.4 (3) | C10—P1—C14—O5 | 45.0 (3) |
| C3—Mo1—C1—C2 | 97.7 (2) | C10—P1—C14—C15 | −136.2 (3) |
| C4—Mo1—C1—O1 | 37.8 (3) | C14—P1—C10—O4 | −160.81 (19) |
| C4—Mo1—C1—C2 | −146.1 (3) | C14—P1—C10—C11 | 28.5 (3) |
| C1—Mo1—C5—C6 | 98.33 (14) | C10—P1—C18—O6 | −49.4 (2) |
| C1—Mo1—C5—C9 | −145.47 (13) | C10—P1—C18—C19 | 129.9 (3) |
| C5—Mo1—C1—O1 | 146.5 (3) | C18—P1—C10—O4 | −52.1 (3) |
| C5—Mo1—C1—C2 | −37.42 (19) | C18—P1—C10—C11 | 137.2 (3) |
| C1—Mo1—C6—C5 | −82.56 (14) | C14—P1—C18—O6 | 55.5 (2) |
| C1—Mo1—C6—C7 | 162.46 (14) | C14—P1—C18—C19 | −125.2 (3) |
| C6—Mo1—C1—O1 | −178.5 (3) | C18—P1—C14—O5 | −60.9 (2) |
| C6—Mo1—C1—C2 | −2.4 (2) | C18—P1—C14—C15 | 117.9 (3) |
| C1—Mo1—C7—C6 | −22.1 (2) | C10—O4—C13—C12 | 0.9 (5) |
| C1—Mo1—C7—C8 | −138.20 (13) | C13—O4—C10—P1 | −174.4 (3) |
| C7—Mo1—C1—O1 | −166.0 (2) | C13—O4—C10—C11 | −1.4 (4) |
| C7—Mo1—C1—C2 | 10.1 (3) | C14—O5—C17—C16 | 0.1 (3) |
| C1—Mo1—C8—C7 | 74.4 (3) | C17—O5—C14—P1 | 178.9 (2) |
| C1—Mo1—C8—C9 | −42.4 (3) | C17—O5—C14—C15 | −0.2 (3) |
| C8—Mo1—C1—O1 | 150.83 (19) | C18—O6—C21—C20 | −0.3 (3) |
| C8—Mo1—C1—C2 | −33.1 (3) | C21—O6—C18—P1 | 179.48 (19) |
| C1—Mo1—C9—C5 | 39.45 (16) | C21—O6—C18—C19 | 0.1 (3) |
| C1—Mo1—C9—C8 | 155.29 (12) | Mo1—C5—C6—Mo1 | 0.0 |
| C9—Mo1—C1—O1 | 125.3 (3) | Mo1—C5—C6—C7 | 65.80 (19) |
| C9—Mo1—C1—C2 | −58.6 (2) | Mo1—C5—C9—Mo1 | 0.0 |
| C3—Mo1—C5—C6 | 37.40 (19) | Mo1—C5—C9—C8 | −63.79 (19) |
| C3—Mo1—C5—C9 | 153.60 (11) | C6—C5—C9—Mo1 | 64.2 (3) |
| C3—Mo1—C6—C5 | −152.15 (13) | C6—C5—C9—C8 | 0.4 (4) |
| C3—Mo1—C6—C7 | 92.86 (14) | C9—C5—C6—Mo1 | −65.8 (3) |
| C3—Mo1—C7—C6 | −93.92 (14) | C9—C5—C6—C7 | 0.0 (4) |
| C3—Mo1—C7—C8 | 150.00 (13) | Mo1—C6—C7—Mo1 | 0.0 |
| C3—Mo1—C8—C7 | −39.42 (19) | Mo1—C6—C7—C8 | 64.70 (19) |
| C3—Mo1—C8—C9 | −156.19 (12) | C5—C6—C7—Mo1 | −65.2 (3) |
| C3—Mo1—C9—C5 | −61.2 (3) | C5—C6—C7—C8 | −0.5 (4) |
| C3—Mo1—C9—C8 | 54.6 (4) | Mo1—C7—C8—Mo1 | 0.0 |
| C4—Mo1—C5—C6 | 169.32 (13) | Mo1—C7—C8—C9 | 64.30 (19) |
| C4—Mo1—C5—C9 | −74.48 (14) | C6—C7—C8—Mo1 | −63.5 (3) |
| C4—Mo1—C6—C5 | −16.6 (3) | C6—C7—C8—C9 | 0.8 (4) |
| C4—Mo1—C6—C7 | −131.62 (17) | Mo1—C8—C9—Mo1 | 0.0 |
| C4—Mo1—C7—C6 | 104.0 (3) | Mo1—C8—C9—C5 | 62.99 (19) |
| C4—Mo1—C7—C8 | −12.1 (3) | C7—C8—C9—Mo1 | −63.8 (3) |
| C4—Mo1—C8—C7 | 173.56 (11) | C7—C8—C9—C5 | −0.8 (4) |
| C4—Mo1—C8—C9 | 56.80 (17) | P1—C10—C11—C12 | 172.5 (3) |
| C4—Mo1—C9—C5 | 112.47 (13) | O4—C10—C11—C12 | 1.4 (4) |
| C4—Mo1—C9—C8 | −131.70 (13) | C10—C11—C12—C13 | −0.8 (4) |
| C5—Mo1—C6—C5 | 0.00 (14) | C11—C12—C13—O4 | −0.0 (5) |
| C5—Mo1—C6—C7 | −115.0 (3) | P1—C14—C15—C16 | −178.7 (2) |
| C6—Mo1—C5—C6 | 0.00 (14) | O5—C14—C15—C16 | 0.2 (3) |
| C6—Mo1—C5—C9 | 116.2 (3) | C14—C15—C16—C17 | −0.1 (4) |
| C5—Mo1—C7—C6 | 38.14 (13) | C15—C16—C17—O5 | −0.0 (4) |
| C5—Mo1—C7—C8 | −77.95 (15) | P1—C18—C19—C20 | −179.13 (19) |
| C7—Mo1—C5—C6 | −37.74 (12) | O6—C18—C19—C20 | 0.1 (3) |
| C7—Mo1—C5—C9 | 78.46 (14) | C18—C19—C20—C21 | −0.3 (4) |
| C5—Mo1—C8—C7 | 79.52 (14) | C19—C20—C21—O6 | 0.4 (4) |
| C5—Mo1—C8—C9 | −37.25 (12) |
| Symmetry codes: (i) x, −y+1/2, z−1/2; (ii) x−1, −y+1/2, z−1/2; (iii) −x+1, −y, −z; (iv) x+1, y, z; (v) −x+1, y−1/2, −z+1/2; (vi) −x+1, −y+1, −z; (vii) −x+1, y+1/2, −z+1/2; (viii) x−1, y, z; (ix) −x, y−1/2, −z+1/2; (x) x, −y+1/2, z+1/2; (xi) x+1, −y+1/2, z+1/2; (xii) −x, y+1/2, −z+1/2; (xiii) −x, −y, −z. |
| D—H···A | D—H | H···A | D···A | D—H···A |
| C8—H8···O1x | 1.00 | 2.38 | 3.324 (4) | 158 |
| C11—H11···O1x | 0.95 | 2.40 | 3.166 (5) | 137 |
| Symmetry code: (x) x, −y+1/2, z+1/2. |
| Mo1—P1 | 2.4189 (8) | Mo1—C7 | 2.359 (3) |
| Mo1—C1 | 2.253 (4) | Mo1—C8 | 2.374 (4) |
| Mo1—C3 | 1.968 (3) | Mo1—C9 | 2.382 (4) |
| Mo1—C4 | 1.982 (3) | O1—C1 | 1.227 (4) |
| Mo1—C5 | 2.341 (4) | O2—C3 | 1.150 (4) |
| Mo1—C6 | 2.332 (4) | O3—C4 | 1.148 (4) |
| D—H···A | D—H | H···A | D···A | D—H···A |
| C8—H8···O1i | 1.00 | 2.377 | 3.324 (4) | 157.7 |
| C11—H11···O1i | 0.95 | 2.400 | 3.166 (5) | 137.4 |
| Symmetry code: (i) x, −y+1/2, z+1/2. |
Acknowledgements
The authors gratefully acknowledge St. Catherine University and NSF–MRI award #1125975 "MRI Consortium: Acquisition of a Single Crystal X-ray Diffractometer for a Regional PUI Molecular Structure Facility". Additional funding was provided by a grant to Carleton College from the Howard Hughes Medical Institute and from the Department of Chemistry at Carleton College.
References
Adams, H., Bailey, N. A., Blenkiron, P. & Morris, M. J. (1997). J. Chem. Soc. Dalton Trans. pp. 3589–3598. CSD CrossRef Web of Science Google Scholar
Adams, H., Bailey, N. A., Blenkiron, P. & Morris, M. J. (2000). J. Chem. Soc. Dalton Trans. pp. 3074–3081. Web of Science CSD CrossRef Google Scholar
Barnett, K. W., Pollman, T. G. & Solomon, T. W. (1972). J. Organomet. Chem. 36, C23–C26. CrossRef CAS Web of Science Google Scholar
Burla, M. C., Caliandro, R., Camalli, M., Carrozzini, B., Cascarano, G. L., De Caro, L., Giacovazzo, C., Polidori, G. & Spagna, R. (2005). J. Appl. Cryst. 38, 381–388. Web of Science CrossRef CAS IUCr Journals Google Scholar
Churchill, M. R. & Fennessey, J. P. (1968). Inorg. Chem. 7, 953–959. CSD CrossRef CAS Web of Science Google Scholar
Gladysz, J. A., Williams, G. M., Tam, W., Johnson, D. L., Parker, D. W. & Selover, J. C. (1979). Inorg. Chem. 18, 553–558. CrossRef CAS Web of Science Google Scholar
Michelini-Rodriguez, I., Romero, A. L., Kapoor, R. N., Cervanres-Lee, F. & Pannell, K. H. (1993). Organometallics, 12, 1221–1224. Google Scholar
Rigaku (1998). REQAB. Rigaku Corporation, Tokyo, Japan. Google Scholar
Rigaku Americas and Rigaku (2010). CrystalStructure. Rigaku Americas, The Woodlands, Texas, USA, and Rigaku Corporation, Tokyo, Japan. Google Scholar
Rigaku Americas and Rigaku (2011). CrystalClear. Rigaku Americas, The Woodlands, Texas, USA, and Rigaku Corporation, Tokyo, Japan. Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Whited, M. T., Boerma, J. W., McClellan, M. J., Padilla, C. E. & Janzen, D. E. (2012). Acta Cryst. E68, m1158–m1159. CSD CrossRef CAS IUCr Journals Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
. ![[Figure 1]](./kq2007fig1thm.gif)
![[Figure 2]](./kq2007fig2thm.gif)
![[Figure 3]](./kq2007fig3thm.gif)
![[Figure 4]](./kq2007fig4thm.gif)




Synthesis of the title complex, [Mo(C5H5)(C2H3O)(CO)2(C12H12O3P)] (I), has not previously been reported, though several analogues containing various phosphine ligands have been reported and their reactivity studied (Adams et al., 1997; Barnett et al., 1972). The most closely related complexes, for which structural information is available, contain a triphenylphosphine or methyldiphenylphosphine ligand (Churchill & Fennessey, 1968; Whited et al., 2012).
The molecular structure of I consists of a Mo(II) atom coordinated to a cyclopentadienyl ring in an η5 fashion, two CO ligands, one tris(furan-2-yl)phosphane ligand, and one acetyl ligand (Fig. 1, Table 1). The orientation of the CO ligands can be described as trans (Fig. 2). The Mo—Cp centroid distance is 2.029 (2) Å.
In the crystal, the molecules of I form centrosymmetrical dimers via the π—π interactions between furyl rings (the centroid-to-centroid distance is 3.396 (4) Å, Fig. 3).
There are several particularly short intermolecular distances involving H atoms. One short contact (2.38 Å) is present between O1 of the acetyl carbonyl on one Mo complex and H8 of a Cp ring on another (Table 2). Another short contact (2.40 Å) involves O1 of the acetyl group of one Mo complex and H11 of a furyl group on another (Table 2). These contacts between the acetyl carbonyl and hydrogen atoms may contribute to the unusual geometry adopted by the acetyl ligand, where the carbonyl points down, away from the Cp ring. In related structures reported by this laboratory (Whited et al., 2012) and others (Churchill & Fennessey, 1968; Michelini-Rodriguez et al., 1993; Adams et al., 1997, 2000), the carbonyl points up toward the Cp ring. These hydrogen-bonding interactions lead to the formation of layers parallel to (100), as shown in Fig. 4.