research communications
Different hydrogen-bonded chains in the crystal structures of three alkyl N-[(E)-1-(2-benzylidene-1-methylhydrazinyl)-3-hydroxy-1-oxopropan-2-yl]carbamates
aFundação Oswaldo Cruz, Instituto de Tecnologia em Fármacos–FarManguinhos, Rua Sizenando Nabuco, 100, Manguinhos, 21041-250 Rio de Janeiro, RJ, Brazil, and bDepartment of Chemistry, University of Aberdeen, Meston Walk, Aberdeen AB24 3UE, Scotland
*Correspondence e-mail: [email protected]
The crystal structures of three methylated hydrazine carbamate derivatives prepared by multi-step syntheses from L-serine are presented, namely benzyl N-{(E)-1-[2-(4-cyanobenzylidene)-1-methylhydrazinyl]-3-hydroxy-1-oxopropan-2-yl}carbamate, C20H20N4O4, tert-butyl N-{(E)-1-[2-(4-cyanobenzylidene)-1-methylhydrazinyl]-3-hydroxy-1-oxopropan-2-yl}carbamate, C17H22N4O4, and tert-butyl N-[(E)-1-(2-benzylidene-1-methylhydrazinyl)-3-hydroxy-1-oxopropan-2-yl]carbamate, C16H23N3O4. One of them shows that an unexpected racemization has occurred during the mild-condition methylation reaction. In each crystal structure, the molecules are linked into chains by O—H⋯O hydrogen bonds, but with significant differences between them.
Keywords: Carbohydrazide; methylation; hydrogen bonds; chain; crystal structure.
1. Chemical context
As part of our ongoing studies of hydrazine derived from L-serine with possible anti-tubercular activity (Pinheiro et al., 2011
), we now describe the syntheses and structures of three methylated derivatives, viz: benzyl (E)-3-hydroxy-1-[2-(4-cyanobenzyldene)-1-methylhydrazinyl]-1-oxopropan-2-ylcarbamate (I)
, tert-butyl (E)-3-hydroxy-1-[2-(4-cyanobenzylidene)-1-methylhydrazinyl]-1-oxopropan-2-ylcarbamate (II)
and tert-butyl (E)-3-hydroxy-1-[2-benzylidene-1-methylhydrazinyl]-1-oxopropan-2-ylcarbamate (III)
, formed by the reaction of the corresponding (E)-(S)-ROCONHCH(CH2OH)CONHN=CH-benzene (R = t-Bu or PhCH2) compound (Noguiera et al., 2013
) with potassium carbonate and methyl iodide.
In general, the tertiary butyl compounds form simple methylated products as described here, whereas the benzyl compounds lead to cyclized oxazolidin-2-one products (Noguiera et al., 2013
). However, compound (I)
described herein has not cyclized. As described below, compound (III)
has undergone an unexpected during the methylation step. The acidity of the α-hydrogen atom in serine derivatives has been variously reported (e.g., Blaskovich & Lajoie, 1993
; Kovacs et al., 1984
), and apparently can result in racemization in the presence of even a very weak base such as the carbonate ion. Similar racemizations have been observed in the cyclized oxazolidin-2-one products (Noguiera et al., 2015
).
2. Structural commentary
The molecular structure of (I)
is shown in Fig. 1
, which confirms that methylation has occurred at N2 but no cyclization to an oxazolidin-2-one has occurred (Noguiera et al., 2015
). Compound (I)
crystallizes in a but its was indeterminate in the present experiment and C10 was assumed to have an S configuration to match the corresponding atom in the L-serine starting material. The atoms of the C14 benzene ring show notably larger displacement ellipsoids than the rest of the molecule, but attempts to model this as disorder did not lead to a significant improvement in fit. Atom N2 is statistically planar (bond-angle sum = 360°), which implies sp2 for this atom. The C9—N2 bond length of 1.358 (6)Å is typical of an amide and the N1—N2 bond length of 1.374 (5) is shorter than the reference value of 1.40 Å for a nominal N(sp2)—N(sp2) single bond. This suggests at least some electronic conjugation over the almost planar C7/N1/N2/C9/O1 grouping (r.m.s. deviation = 0.010 Å): the C1 benzene ring is twisted by 6.1 (2)° with respect to these atoms. The C7—N1—N2—C8 torsion angle of −1.9 (6)° shows that the carbon atoms are almost eclipsed with respect to the N—N bond whereas the C9—C10—C11—O2 torsion angle of −50.9 (5)° indicates a gauche conformation about the C10—C11 bond. The C9—C10—N3—H3A torsion angle is 38° and the separation between H2A (bonded to O2) and H3A is 2.5 Å.
| Figure 1 The molecular structure of (I) showing 50% displacement ellipsoids. |
The molecular structure of (II)
can be seen in Fig. 2
: again the methylation of N2 has occurred as expected. Because the absolute structure was indeterminate, the configuration of C10 (S) was assumed to be the same as that of the corresponding atom in the L-serine starting material. In terms of the C7/N1/N2/C9/O1 grouping in (II)
, the C9—N2 and N1—N2 bond lengths are 1.385 (6) and 1.388 (5) Å, respectively, which are both notably longer than the corresponding bonds in (I)
, and the r.m.s. deviation from planarity of 0.049 Å for these five atoms is also larger than the corresponding value for (I)
. The dihedral angle between C7/N1/N2/C9/O1 and the C1-benzene ring in (II)
is 10.5 (3)°. The C7—N1—N2—C8 torsion angle is 1.2 (7)° and the C9—C10—C11—O2 torsion angle is −47.4 (6)°, which are similar to the equivalent data for (I)
. The C9—C10—N3—H3 torsion angle in (II)
is 30° and the separation between H2A and H3 is 2.7 Å. These values are evidently sufficiently different from the corresponding data for (I)
to lead to a different hydrogen-bonding pattern in the crystal (see below).
| Figure 2 The molecular structure of (II) showing 50% displacement ellipsoids. |
Compound (III)
, shown in Fig. 3
, crystallizes in a centrosymmetric space group, indicating that racemization of C10 has occurred during the methylation of N2: the C10 atom in the asymmetric unit was arbitrarily assigned an S configuration. The O2—H2 hydroxy group is disordered over two orientations in a 0.802 (7):0.198 (7) ratio. The geometric parameters for (III)
are largely consistent with those for (I)
and (II)
: the C7/N1/N2/C9/O1 grouping (r.m.s. deviation = 0.014 Å) subtends a dihedral angle of 1.9 (4)° with the C1–C6 benzene ring and the C9—N2 and N1—N2 bond lengths are 1.358 (5) and 1.381 (4) Å, respectively. The C7—N1—N2—C8 torsion angle is 0.8 (5)° and the C9—C10—C11—O2A (major disorder component) torsion angle is −54.9 (4)°. The C9—C10—C11—O2B torsion angle for the minor disorder component is −156.7 (8)°, which has a significant role to play in the hydrogen-bonding pattern in the crystal of (III)
.
| Figure 3 The molecular structure of (III) showing 50% displacement ellipsoids. Only one orientation of the disordered O2—H2 group is shown. |
3. Supramolecular features
In the extended structure of (I)
, the molecules are linked by short O2—H2A⋯O4i (i = 1 + x, y, z) and much longer N3—H3A⋯O4i hydrogen bonds (Table 1
, Fig. 4
) to the same acceptor oxygen atom, generating [100] chains, with adjacent molecules related by simple translation in the a-axis direction. An unusual R21(7) loop arises from these hydrogen bonds; alternately, this could be described as combined C(7) O—H⋯O and C(4) N—H⋯O chains. A pair of weak C—H⋯π interactions are also observed but there is no aromatic π–π stacking (shortest centroid–centroid separation > 4.7 Å).
|
| Figure 4 Fragment of a [100] hydrogen-bonded chain in the crystal of (I) . Symmetry code: (i) 1 + x, y, z. All C-bound H atoms are omitted for clarity. |
The extended structure of (II)
also features [100] chains (Fig. 5
) with adjacent molecules related by translation, but in this case the molecules are only linked by C(7) O2—H2A⋯O4i (i = 1 + x, y, z) hydrogen bonds (Table 2
) with almost the same local geometry as seen in (I)
. The N3—H3 grouping in (II)
is twisted far enough away from O4i to not form an intermolecular hydrogen bond (H3⋯O4i = 3.2 Å), but instead forms an intramolecular link to O1. A very long intermolecular C—H⋯N interaction is observed but there is no π–π stacking in (II)
, as the shortest centroid–centroid separation is greater than 5.3 Å.
| |||||||||||||||||||||||||||
| Figure 5 Fragment of a [100] hydrogen-bonded chain in the crystal of (II) . Symmetry code: (i) 1 + x, y, z. All C-bound H atoms are omitted for clarity. |
The packing in the centrosymmetric structure of (III)
leads to [010] chains (Fig. 6
) with adjacent molecules related by the 21 screw axis, so that the C1-benzene ring is `flipped' from one side of the chain to the other in adjacent molecules. As noted above, the hydroxyl group is disordered over two orientations. The hydrogen bond from the major orientation of O2A—H2A is still a bond to O4i (Table 3
), where i = 1 − x, y −
,
− z. The minor disorder component (O2B—H2B) forms an O—H⋯O hydrogen bond in the opposite chain direction to O1ii (ii = 1 − x, y +
,
− z): O1 also accepts an intramolecular N—H⋯O hydrogen bond, as seen in (II)
. Once again, no aromatic π–π stacking is observed in the crystal of (III)
, as the minimum centroid–centroid separation is greater than 4.6 Å.
|
| Figure 6 Fragment of an [010] hydrogen-bonded chain in the crystal of (III) . Both disorder components of the OH group are shown. Symmetry codes: (i) 1 − x, y − , − z; (ii) 1 − x, y + , − z. All C-bound H atoms are omitted for clarity. |
4. Database survey
There are no –OCONHCH(CH2OH)CON(CH3)N=CH– fragments reported in Version 5.36 of the Cambridge Structural Database (Groom & Allen, 2014
) but there are 14 unmethylated –OCONHCH(CH2OH)CONHN=CH– groupings with different substituents at each end of the fragment, all of which have been reported by us in the last few years (Howie et al., 2011
and references therein). All of these materials crystallize in chiral space groups.
5. Synthesis and crystallization
Potassium carbonate (1.76 mmol) was added to a solution of the appropriate (E)-(S)-ROCONHCH(CH2OH)CONHN=CH-benzene compound (Noguiera et al., 2013
) in acetone (10 ml) and the reaction mixture was vigorously stirred at room temperature for 5 minutes, before adding methyl iodide (1.80 mmol). The reaction mixture was stirred at 323 K for 24–48 h and the solvent removed by rotary evaporation. The residue was subjected to column chromatography on silica gel, using a chloroform:methanol (100 → 95%) gradient. The colourless crystals used in the structure determinations were recrystallized from ethanol solution at room temperature. For further details and spectroscopic data, see: Noguiera et al. (2013
).
6. Refinement
Crystal data, data collection and structure details are summarized in Table 4
. The crystal of (I)
gave a poor diffraction pattern and indexing initially established a large triclinic [a = 9.512 (12), b = 13.003 (19), c = 22.94 (3) Å, α = 92.93 (2), β = 91.48 (3), γ = 98.13 (3)°, V = 2804 (7) Å3]. An atomic model could be developed in space group P1 with Z = 6, but a PLATON (Spek, 2009
) symmetry check indicated that the smaller monoclinic cell reported above was more appropriate and the unit cell transformed by the matrix (−
−
0 / −
0 / 0 0 −1). It is notable that the aromatic rings of the benzyl groups of all six molecules in the triclinic showed a high degree of thermal motion. The transformation to monoclinic symmetry resulted in a rather low data completion percentage of 92%, but we consider that the is satisfactory and a good geometrical precision results. For each structure, the O- and N-bound H atoms were located in difference maps, repositioned in idealized locations and refined as riding atoms [H1N was freely refined in structure (III)]. The C-bound H atoms were placed geometrically (C—H = 0.95–1.00 Å) and refined as riding atoms. The constraint Uiso(H) = 1.2Ueq(carrier) or 1.5Ueq(methyl carrier) was applied in all cases. The H atoms of the hydroxyl groups were allowed to rotate about their C—O bond (SHELXL HFIX 83 instruction with O—H = 0.84 Å and C—O—H = 109.5°) to best fit the electron density. The methyl groups were allowed to rotate, but not to tip, to best fit the electron density (AFIX 137 instruction).
|
Supporting information
contains datablocks I, II, III, global. DOI: 10.1107/S2056989015010440/hg5443sup1.cif
Structure factors: contains datablock I. DOI: 10.1107/S2056989015010440/hg5443Isup2.hkl
Structure factors: contains datablock II. DOI: 10.1107/S2056989015010440/hg5443IIsup3.hkl
Structure factors: contains datablock III. DOI: 10.1107/S2056989015010440/hg5443IIIsup4.hkl
Supporting information file. DOI: 10.1107/S2056989015010440/hg5443Isup5.cml
Supporting information file. DOI: 10.1107/S2056989015010440/hg5443IIsup6.cml
Supporting information file. DOI: 10.1107/S2056989015010440/hg5443IIIsup7.cml
As part of our ongoing studies of hydrazine derived from L-serine with possible anti-tubercular activity (Pinheiro et al., 2011), we now describe the syntheses and structures of three methylated derivatives, viz: benzyl (E)-3-hydroxy-1-[2-(4-cyanobenzylidene)-1-methylhydrazinyl]-1-oxopropan-2-ylcarbamate (I), tert-butyl (E)-3-hydroxy-1-[2-(4-cyanobenzylidene)-1-methylhydrazinyl]-1-oxopropan-2-ylcarbamate (II) and tert-butyl (E)-3-hydroxy-1-[2-benzylidene-1-methylhydrazinyl]-1-oxopropan-2-ylcarbamate (III), formed by the reaction of the corresponding (E)-(S)-ROCONHCH(CH2OH)CONHN=CH-benzene (R = t-Bu or PhCH2) compound (Nogueira et al., 2013) with potassium carbonate and methyl iodide. In general, the tertiary butyl compounds form simple methylated products as described here, whereas the benzyl compounds lead to cyclized oxazolidin-2-one products (Nogueira et al., 2013). However, compound (I) described herein has not cyclized. As described below, compound (III) has undergone an unexpected during the methylation step. The acidity of the α-hydrogen atom in serine derivatives has been variously reported (e.g., Blaskovich & Lajoie, 1993; Kovacs et al., 1984), and apparently can result in racemization in the presence of even a very weak base such as the carbonate ion. Similar racemizations have been observed in the cyclized oxazolidin-2-one products (Nogueira et al., 2015).
The molecular structure of (I) is shown in Fig. 1, which confirms that methylation has occurred at N2 but no to an oxazolidin-2-one has occurred (Nogueira et al., 2015). Compound (I) crystallizes in a but its was indeterminate in the present experiment and C10 was assumed to have an S configuration to match the corresponding atom in the L-serine starting material. The atoms of the C14 benzene ring show notably larger displacement ellipsoids than the rest of the molecule, but attempts to model this as disorder did not lead to a significant improvement in fit. Atom N2 is statistically planar (bond-angle sum = 360°), which implies sp2 for this atom. The C9—N2 bond length of 1.358 (6)Å is typical of an amide and the N1—N2 bond length of 1.374 (5) is shorter than the reference value of 1.40 Å for a nominal N(sp2)—N(sp2) single bond. This suggests at least some electronic conjugation over the almost planar C7/N1/N2/C9/O1 grouping (r.m.s. deviation = 0.010 Å): the C1 benzene ring is twisted by 6.1 (2)° with respect to these atoms. The C7—N1—N2—C8 torsion angle of –1.9 (6)° shows that the carbon atoms are almost eclipsed with respect to the N—N bond whereas the C9—C10—C11—O2 torsion angle of –50.9 (5)° indicates a about the C10—C11 bond. The C9—C10—N3—H3A torsion angle is 38° and the separation between H2A (bonded to O2) and H3A is 2.5 Å.
The molecular structure of (II) can be seen in Fig. 2: again the methylation of N2 has occurred as expected. Because the was indeterminate, the configuration of C10 (S) was assumed to be the same as that of the corresponding atom in the L-serine starting material. In terms of the C7/N1/N2/C9/O1 grouping in (II), the C9—N2 and N1—N2 bond lengths are 1.385 (6) and 1.388 (5) Å, respectively, which are both notably longer than the corresponding bonds in (I), and the r.m.s. deviation from planarity of 0.049 Å for these five atoms is also larger than the corresponding value for (I). The dihedral angle between C7/N1/N2/C9/O1 and the C1-benzene ring in (II) is 10.5 (3)°. The C7—N1—N2—C8 torsion angle is 1.2 (7)° and the C9—C10—C11—O2 torsion angle is –47.4 (6)°, which are similar to the equivalent data for (I). The C9—C10—N3—H3 torsion angle in (II) is 30° and the separation between H2A and H3 is 2.7 Å. These values are evidently sufficiently different from the corresponding data for (I) to lead to a different hydrogen-bonding pattern in the crystal (see below).
Compound (III) crystallizes in a centrosymmetric indicating that of C10 has occurred during the methylation of N2: the C10 atom in the was arbitrarily assigned an S configuration. The O2—H2 hydroxy group is disordered over two orientations in a 0.802 (7):0.198 (7) ratio. The geometric parameters for (III) are largely consistent with those for (I) and (II): the C7/N1/N2/C9/O1 grouping (r.m.s. deviation = 0.014 Å) subtends a dihedral angle of 1.9 (4)° with the C1–C6 benzene ring and the C9—N2 and N1—N2 bond lengths are 1.358 (5) and 1.381 (4) Å, respectively. The C7—N1—N2—C8 torsion angle is 0.8 (5)° and the C9—C10—C11—O2A (major disorder component) torsion angle is –54.9 (4)°. The C9—C10—C11—O2B torsion angle for the minor disorder component is –156.7 (8)°, which has a significant role to play in the hydrogen-bonding pattern in the crystal of (III).
In the extended structure of (I), the molecules are linked by short O2—H2A···O4i (i = 1 + x, y, z) and much longer N3—H3A···O4i hydrogen bonds (Table 1, Fig. 4) to the same acceptor oxygen atom, generating [100] chains, with adjacent molecules related by simple translation in the a-axis direction. An unusual R21(7) loop arises from these hydrogen bonds; alternately, this could be described as combined C(7) O—H···O and C(4) N—H···O chains. A pair of weak C—H···π interactions are also observed but there is no aromatic π–π stacking (shortest centroid–centroid separation > 4.7 Å).
The extended structure of (II) also features [100] chains (Fig. 5) with adjacent molecules related by translation, but in this case the molecules are only linked by C(7) O2—H2A···O4i (i = 1 + x, y, z) hydrogen bonds (Table 2) with almost the same local geometry as seen in (I). The N3—H3 grouping in (II) is twisted far enough away from O4i to not form an intermolecular hydrogen bond (H3···O4i = 3.2 Å), but instead forms an intramolecular link to O1. A very long intermolecular C—H···N interaction is observed but there is no π–π stacking in (II), as the shortest centroid–centroid separation is greater than 5.3 Å.
The packing in the centrosymmetric structure of (III) leads to [010] chains (Fig. 6) with adjacent molecules related by the 21 screw axis, so that the C1-benzene ring is `flipped' from one side of the chain to the other in adjacent molecules. As noted above, the hydroxyl group is disordered over two orientations. The hydrogen bond from the major orientation of O2A—H2A is still a bond to O4i (Table 3), where i = 1 – x, y – 1/2, 1/2 – z. The minor disorder component (O2B—H2B) forms an O—H···O hydrogen bond in the opposite chain direction to O1ii (ii = 1 – x, y + 1/2, 1/2 – z): O1 also accepts an intramolecular N—H···O hydrogen bond, as seen in (II). Once again, no aromatic π–π stacking is observed in the crystal of (III), as the minimum centroid–centroid separation is greater than 4.6 Å.
There are no –OCONHCH(CH2OH)CON(CH3)N=CH– fragments reported in Version 5.36 of the Cambridge Structural Database (Groom & Allen, 2014) but there are 14 unmethylated –OCONHCH(CH2OH)CONHN=CH– groupings with different substituents at each end of the fragment, all of which have been reported by us in the last few years (Howie et al., 2011 and references therein). All of these materials crystallize in chiral space groups.
Potassium carbonate (1.76 mmol) was added to a solution of the appropriate (E)-(S)-ROCONHCH(CH2OH)CONHN=CH-benzene compound (Nogueira et al., 2013) in acetone (10 ml) and the reaction mixture was vigorously stirred at room temperature for 5 minutes, before adding methyl iodide (1.80 mmol). The reaction mixture was stirred at 323 K for 24–48 hours and the solvent removed by rotary evaporation. The residue was subjected to on silica gel, using a chloroform:methanol (100 → 95%) gradient. The colourless crystals used in the structure determinations were recrystallized from ethanol solution at room temperature. For further details and spectroscopic data, see: Nogueira et al. (2013).
Crystal data, data collection and structure details are summarized in Table 4. The crystal of (I) gave a poor diffraction pattern and indexing initially established a large triclinic [a = 9.512 (12), b = 13.003 (19), c = 22.94 (3) Å, α = 92.93 (2), β = 91.48 (3), γ = 98.13 (3)°, V = 2804 (7) Å3]. An atomic model could be developed in P1 with Z = 6, but a PLATON (Spek, 2009) symmetry check indicated that the smaller monoclinic cell reported below was more appropriate and the transformed by the matrix (-1/3 -1/3 0 / -2/3 1/3 0 / 0 0 -1). It is notable that the aromatic rings of the benzyl groups of all six molecules in the triclinic showed a high degree of thermal motion. The transformation to monoclinic symmetry resulted in a rather low data completion percentage of 92%, but we consider that the is satisfactory and a good geometrical precision results.
For each structure, the O- and N-bound H atoms were located in difference maps, repositioned in idealized locations and refined as riding atoms [H1N was freely refined in structure (III)]. The C-bound H atoms were placed geometrically (C—H = 0.95–1.00 Å) and refined as riding atoms. The constraint Uiso(H) = 1.2Ueq(carrier) or 1.5Ueq(methyl carrier) was applied in all cases. The H atoms of the hydroxyl groups were allowed to rotate about their C—O bond (SHELXL HFIX 83 instruction with O—H = 0.84 Å and C—O—H = 109.5°) to best fit the electron density. The methyl groups were allowed to rotate, but not to tip, to best fit the electron density (AFIX 137 instruction).
For all compounds, data collection: CrystalClear (Rigaku, 2012); cell CrystalClear (Rigaku, 2012); data reduction: CrystalClear (Rigaku, 2012); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: ORTEP-3 for Windows (Farrugia, 2012); software used to prepare material for publication: publCIF (Westrip, 2010).
| C20H20N4O4 | F(000) = 400 |
| Mr = 380.40 | Dx = 1.352 Mg m−3 |
| Monoclinic, P21 | Mo Kα radiation, λ = 0.71073 Å |
| Hall symbol: P 2yb | Cell parameters from 5405 reflections |
| a = 4.995 (6) Å | θ = 2.2–31.3° |
| b = 8.172 (8) Å | µ = 0.10 mm−1 |
| c = 22.94 (3) Å | T = 100 K |
| β = 93.48 (3)° | Chip, colourless |
| V = 934.7 (19) Å3 | 0.14 × 0.03 × 0.01 mm |
| Z = 2 |
| Rigaku Mercury CCD diffractometer | 3270 reflections with I > 2σ(I) |
| Radiation source: fine-focus sealed tube | Rint = 0.070 |
| Graphite monochromator | θmax = 31.5°, θmin = 2.7° |
| ω scans | h = −7→7 |
| 13928 measured reflections | k = −11→7 |
| 4691 independent reflections | l = −32→33 |
| Refinement on F2 | Secondary atom site location: difference Fourier map |
| Least-squares matrix: full | Hydrogen site location: inferred from neighbouring sites |
| R[F2 > 2σ(F2)] = 0.095 | H-atom parameters constrained |
| wR(F2) = 0.278 | w = 1/[σ2(Fo2) + (0.1373P)2 + 0.3363P] where P = (Fo2 + 2Fc2)/3 |
| S = 1.10 | (Δ/σ)max = 0.005 |
| 4691 reflections | Δρmax = 0.39 e Å−3 |
| 255 parameters | Δρmin = −0.35 e Å−3 |
| 1 restraint | Extinction correction: SHELXL, Fc*=kFc[1+0.001xFc2λ3/sin(2θ)]-1/4 |
| Primary atom site location: structure-invariant direct methods | Extinction coefficient: 0.079 (13) |
| C20H20N4O4 | V = 934.7 (19) Å3 |
| Mr = 380.40 | Z = 2 |
| Monoclinic, P21 | Mo Kα radiation |
| a = 4.995 (6) Å | µ = 0.10 mm−1 |
| b = 8.172 (8) Å | T = 100 K |
| c = 22.94 (3) Å | 0.14 × 0.03 × 0.01 mm |
| β = 93.48 (3)° |
| Rigaku Mercury CCD diffractometer | 3270 reflections with I > 2σ(I) |
| 13928 measured reflections | Rint = 0.070 |
| 4691 independent reflections |
| R[F2 > 2σ(F2)] = 0.095 | 1 restraint |
| wR(F2) = 0.278 | H-atom parameters constrained |
| S = 1.10 | Δρmax = 0.39 e Å−3 |
| 4691 reflections | Δρmin = −0.35 e Å−3 |
| 255 parameters |
Geometry. All e.s.d.'s (except the e.s.d. in the dihedral angle between two l.s. planes) are estimated using the full covariance matrix. The cell e.s.d.'s are taken into account individually in the estimation of e.s.d.'s in distances, angles and torsion angles; correlations between e.s.d.'s in cell parameters are only used when they are defined by crystal symmetry. An approximate (isotropic) treatment of cell e.s.d.'s is used for estimating e.s.d.'s involving l.s. planes. |
Refinement. Refinement of F2 against ALL reflections. The weighted R-factor wR and goodness of fit S are based on F2, conventional R-factors R are based on F, with F set to zero for negative F2. The threshold expression of F2 > σ(F2) is used only for calculating R-factors(gt) etc. and is not relevant to the choice of reflections for refinement. R-factors based on F2 are statistically about twice as large as those based on F, and R- factors based on ALL data will be even larger. |
| x | y | z | Uiso*/Ueq | ||
| C1 | −0.1557 (8) | −0.2306 (6) | 0.04534 (16) | 0.0387 (8) | |
| C2 | −0.0584 (9) | −0.0833 (5) | 0.06903 (16) | 0.0389 (9) | |
| H2 | −0.1380 | 0.0174 | 0.0567 | 0.047* | |
| C3 | 0.1564 (8) | −0.0847 (5) | 0.11093 (16) | 0.0371 (8) | |
| H3 | 0.2225 | 0.0153 | 0.1273 | 0.044* | |
| C4 | 0.2746 (8) | −0.2330 (5) | 0.12891 (15) | 0.0358 (8) | |
| C5 | 0.1737 (9) | −0.3795 (5) | 0.10501 (16) | 0.0393 (9) | |
| H5 | 0.2541 | −0.4802 | 0.1171 | 0.047* | |
| C6 | −0.0422 (9) | −0.3803 (6) | 0.06378 (18) | 0.0404 (9) | |
| H6 | −0.1116 | −0.4806 | 0.0483 | 0.048* | |
| C7 | 0.5009 (8) | −0.2375 (6) | 0.17309 (16) | 0.0378 (8) | |
| H7 | 0.5872 | −0.3388 | 0.1820 | 0.045* | |
| C8 | 0.9329 (10) | −0.2648 (6) | 0.25743 (18) | 0.0443 (10) | |
| H8A | 1.0041 | −0.3156 | 0.2229 | 0.066* | |
| H8B | 0.8063 | −0.3400 | 0.2745 | 0.066* | |
| H8C | 1.0808 | −0.2409 | 0.2862 | 0.066* | |
| C9 | 0.8664 (10) | 0.0289 (6) | 0.26783 (18) | 0.0416 (9) | |
| C10 | 0.7063 (9) | 0.1831 (5) | 0.24991 (18) | 0.0388 (9) | |
| H10 | 0.5107 | 0.1563 | 0.2457 | 0.047* | |
| C11 | 0.7983 (9) | 0.2508 (5) | 0.19144 (16) | 0.0396 (9) | |
| H11A | 0.7380 | 0.1753 | 0.1595 | 0.048* | |
| H11B | 0.7112 | 0.3580 | 0.1835 | 0.048* | |
| C12 | 0.5656 (8) | 0.4037 (6) | 0.31560 (16) | 0.0379 (8) | |
| C13 | 0.4928 (10) | 0.6097 (6) | 0.3865 (2) | 0.0477 (11) | |
| H13A | 0.3119 | 0.5643 | 0.3916 | 0.057* | |
| H13B | 0.4753 | 0.7055 | 0.3602 | 0.057* | |
| C14 | 0.6244 (14) | 0.6577 (9) | 0.4441 (2) | 0.0688 (17) | |
| C15 | 0.8449 (18) | 0.7581 (12) | 0.4483 (4) | 0.105 (3) | |
| H15 | 0.9131 | 0.8020 | 0.4139 | 0.126* | |
| C16 | 0.970 (3) | 0.796 (2) | 0.5025 (7) | 0.163 (5) | |
| H16 | 1.1220 | 0.8664 | 0.5053 | 0.195* | |
| C17 | 0.871 (3) | 0.7322 (17) | 0.5505 (4) | 0.141 (5) | |
| H17 | 0.9569 | 0.7613 | 0.5872 | 0.169* | |
| C18 | 0.671 (3) | 0.6355 (18) | 0.5509 (4) | 0.149 (5) | |
| H18 | 0.6174 | 0.5882 | 0.5862 | 0.179* | |
| C19 | 0.531 (3) | 0.6011 (13) | 0.4962 (3) | 0.125 (4) | |
| H19 | 0.3715 | 0.5381 | 0.4954 | 0.150* | |
| C20 | −0.3731 (8) | −0.2306 (6) | 0.00082 (17) | 0.0411 (9) | |
| N1 | 0.5835 (7) | −0.1082 (5) | 0.19964 (14) | 0.0360 (7) | |
| N2 | 0.7956 (8) | −0.1136 (5) | 0.24061 (15) | 0.0407 (8) | |
| N3 | 0.7554 (7) | 0.2999 (5) | 0.29708 (15) | 0.0422 (8) | |
| H3A | 0.9170 | 0.3037 | 0.3146 | 0.051* | |
| N4 | −0.5474 (8) | −0.2307 (6) | −0.03581 (15) | 0.0480 (9) | |
| O1 | 1.0542 (7) | 0.0348 (4) | 0.30583 (13) | 0.0503 (9) | |
| O2 | 1.0784 (6) | 0.2702 (4) | 0.19126 (12) | 0.0445 (7) | |
| H2A | 1.1303 | 0.3363 | 0.2176 | 0.067* | |
| O3 | 0.6668 (7) | 0.4855 (4) | 0.36255 (12) | 0.0440 (8) | |
| O4 | 0.3405 (6) | 0.4203 (4) | 0.29257 (13) | 0.0443 (7) |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| C1 | 0.046 (2) | 0.038 (2) | 0.0309 (16) | −0.0001 (19) | −0.0025 (14) | −0.0043 (17) |
| C2 | 0.048 (2) | 0.035 (2) | 0.0324 (17) | −0.0014 (19) | −0.0040 (15) | 0.0005 (16) |
| C3 | 0.044 (2) | 0.032 (2) | 0.0344 (17) | 0.0029 (18) | −0.0044 (15) | −0.0008 (15) |
| C4 | 0.043 (2) | 0.0313 (19) | 0.0324 (16) | 0.0012 (18) | −0.0016 (14) | −0.0003 (16) |
| C5 | 0.053 (2) | 0.031 (2) | 0.0333 (18) | −0.0002 (18) | −0.0037 (16) | −0.0020 (15) |
| C6 | 0.049 (2) | 0.035 (2) | 0.0365 (19) | −0.0059 (18) | −0.0001 (16) | −0.0050 (16) |
| C7 | 0.044 (2) | 0.0329 (19) | 0.0360 (17) | −0.0007 (18) | −0.0012 (15) | 0.0032 (16) |
| C8 | 0.060 (3) | 0.040 (2) | 0.0316 (17) | 0.005 (2) | −0.0073 (17) | 0.0056 (16) |
| C9 | 0.050 (2) | 0.039 (2) | 0.0346 (18) | −0.0028 (19) | −0.0080 (16) | −0.0021 (17) |
| C10 | 0.039 (2) | 0.036 (2) | 0.0397 (19) | 0.0014 (17) | −0.0100 (16) | −0.0058 (16) |
| C11 | 0.052 (2) | 0.030 (2) | 0.0355 (18) | 0.0038 (18) | −0.0102 (16) | −0.0012 (15) |
| C12 | 0.043 (2) | 0.037 (2) | 0.0324 (17) | −0.0061 (18) | −0.0066 (15) | −0.0023 (16) |
| C13 | 0.057 (3) | 0.044 (3) | 0.042 (2) | 0.000 (2) | −0.0026 (19) | −0.0129 (19) |
| C14 | 0.092 (4) | 0.071 (4) | 0.042 (2) | 0.003 (3) | −0.009 (3) | −0.016 (3) |
| C15 | 0.116 (6) | 0.087 (6) | 0.107 (6) | −0.015 (5) | −0.035 (5) | −0.048 (5) |
| C16 | 0.189 (11) | 0.144 (11) | 0.145 (9) | −0.013 (10) | −0.080 (9) | −0.057 (9) |
| C17 | 0.232 (15) | 0.110 (9) | 0.075 (6) | 0.032 (9) | −0.048 (8) | −0.044 (6) |
| C18 | 0.242 (16) | 0.140 (11) | 0.066 (5) | −0.048 (11) | 0.006 (7) | −0.020 (6) |
| C19 | 0.207 (11) | 0.113 (8) | 0.054 (4) | 0.005 (8) | 0.005 (5) | −0.011 (5) |
| C20 | 0.046 (2) | 0.038 (2) | 0.0390 (18) | −0.0037 (19) | −0.0011 (16) | −0.0022 (18) |
| N1 | 0.0400 (17) | 0.0363 (18) | 0.0308 (14) | −0.0027 (15) | −0.0057 (12) | 0.0015 (13) |
| N2 | 0.050 (2) | 0.0362 (19) | 0.0343 (15) | 0.0043 (16) | −0.0108 (14) | 0.0038 (14) |
| N3 | 0.0452 (18) | 0.042 (2) | 0.0372 (16) | −0.0023 (16) | −0.0142 (13) | −0.0077 (14) |
| N4 | 0.053 (2) | 0.047 (2) | 0.0423 (18) | −0.0066 (19) | −0.0120 (15) | −0.0048 (18) |
| O1 | 0.058 (2) | 0.0464 (19) | 0.0429 (16) | 0.0028 (16) | −0.0232 (14) | 0.0009 (14) |
| O2 | 0.0532 (17) | 0.0387 (16) | 0.0403 (14) | −0.0021 (14) | −0.0072 (12) | −0.0024 (13) |
| O3 | 0.0546 (19) | 0.0439 (17) | 0.0321 (13) | −0.0040 (14) | −0.0090 (12) | −0.0074 (12) |
| O4 | 0.0466 (16) | 0.0429 (18) | 0.0421 (15) | −0.0021 (14) | −0.0093 (12) | −0.0093 (13) |
| C1—C2 | 1.395 (6) | C11—H11A | 0.9900 |
| C1—C6 | 1.404 (7) | C11—H11B | 0.9900 |
| C1—C20 | 1.445 (5) | C12—O4 | 1.221 (5) |
| C2—C3 | 1.397 (6) | C12—O3 | 1.340 (5) |
| C2—H2 | 0.9500 | C12—N3 | 1.359 (6) |
| C3—C4 | 1.399 (6) | C13—O3 | 1.465 (6) |
| C3—H3 | 0.9500 | C13—C14 | 1.492 (7) |
| C4—C5 | 1.398 (6) | C13—H13A | 0.9900 |
| C4—C7 | 1.472 (5) | C13—H13B | 0.9900 |
| C5—C6 | 1.391 (6) | C14—C15 | 1.372 (11) |
| C5—H5 | 0.9500 | C14—C19 | 1.386 (11) |
| C6—H6 | 0.9500 | C15—C16 | 1.391 (12) |
| C7—N1 | 1.276 (6) | C15—H15 | 0.9500 |
| C7—H7 | 0.9500 | C16—C17 | 1.34 (2) |
| C8—N2 | 1.454 (6) | C16—H16 | 0.9500 |
| C8—H8A | 0.9800 | C17—C18 | 1.274 (17) |
| C8—H8B | 0.9800 | C17—H17 | 0.9500 |
| C8—H8C | 0.9800 | C18—C19 | 1.428 (16) |
| C9—O1 | 1.242 (5) | C18—H18 | 0.9500 |
| C9—N2 | 1.358 (6) | C19—H19 | 0.9500 |
| C9—C10 | 1.535 (6) | C20—N4 | 1.173 (5) |
| C10—N3 | 1.453 (5) | N1—N2 | 1.374 (5) |
| C10—C11 | 1.546 (6) | N3—H3A | 0.8800 |
| C10—H10 | 1.0000 | O2—H2A | 0.8400 |
| C11—O2 | 1.409 (6) | ||
| C2—C1—C6 | 120.6 (3) | C10—C11—H11B | 109.0 |
| C2—C1—C20 | 120.3 (4) | H11A—C11—H11B | 107.8 |
| C6—C1—C20 | 119.0 (4) | O4—C12—O3 | 125.8 (4) |
| C1—C2—C3 | 119.7 (4) | O4—C12—N3 | 125.2 (4) |
| C1—C2—H2 | 120.1 | O3—C12—N3 | 109.0 (3) |
| C3—C2—H2 | 120.1 | O3—C13—C14 | 106.0 (4) |
| C2—C3—C4 | 120.2 (4) | O3—C13—H13A | 110.5 |
| C2—C3—H3 | 119.9 | C14—C13—H13A | 110.5 |
| C4—C3—H3 | 119.9 | O3—C13—H13B | 110.5 |
| C5—C4—C3 | 119.4 (3) | C14—C13—H13B | 110.5 |
| C5—C4—C7 | 119.5 (4) | H13A—C13—H13B | 108.7 |
| C3—C4—C7 | 121.2 (4) | C15—C14—C19 | 116.6 (8) |
| C6—C5—C4 | 121.2 (4) | C15—C14—C13 | 121.9 (6) |
| C6—C5—H5 | 119.4 | C19—C14—C13 | 121.5 (8) |
| C4—C5—H5 | 119.4 | C14—C15—C16 | 120.8 (11) |
| C5—C6—C1 | 118.9 (4) | C14—C15—H15 | 119.6 |
| C5—C6—H6 | 120.6 | C16—C15—H15 | 119.6 |
| C1—C6—H6 | 120.6 | C17—C16—C15 | 118.6 (13) |
| N1—C7—C4 | 121.3 (4) | C17—C16—H16 | 120.7 |
| N1—C7—H7 | 119.3 | C15—C16—H16 | 120.7 |
| C4—C7—H7 | 119.3 | C18—C17—C16 | 125.1 (10) |
| N2—C8—H8A | 109.5 | C18—C17—H17 | 117.4 |
| N2—C8—H8B | 109.5 | C16—C17—H17 | 117.4 |
| H8A—C8—H8B | 109.5 | C17—C18—C19 | 117.2 (11) |
| N2—C8—H8C | 109.5 | C17—C18—H18 | 121.4 |
| H8A—C8—H8C | 109.5 | C19—C18—H18 | 121.4 |
| H8B—C8—H8C | 109.5 | C14—C19—C18 | 121.4 (12) |
| O1—C9—N2 | 121.3 (4) | C14—C19—H19 | 119.3 |
| O1—C9—C10 | 121.0 (4) | C18—C19—H19 | 119.3 |
| N2—C9—C10 | 117.6 (3) | N4—C20—C1 | 179.2 (4) |
| N3—C10—C9 | 106.2 (3) | C7—N1—N2 | 120.9 (4) |
| N3—C10—C11 | 111.4 (4) | C9—N2—N1 | 117.1 (3) |
| C9—C10—C11 | 110.4 (4) | C9—N2—C8 | 120.1 (3) |
| N3—C10—H10 | 109.6 | N1—N2—C8 | 122.7 (3) |
| C9—C10—H10 | 109.6 | C12—N3—C10 | 123.6 (3) |
| C11—C10—H10 | 109.6 | C12—N3—H3A | 118.2 |
| O2—C11—C10 | 113.0 (3) | C10—N3—H3A | 118.2 |
| O2—C11—H11A | 109.0 | C11—O2—H2A | 109.5 |
| C10—C11—H11A | 109.0 | C12—O3—C13 | 116.3 (4) |
| O2—C11—H11B | 109.0 | ||
| C6—C1—C2—C3 | 0.8 (6) | C14—C15—C16—C17 | 0 (2) |
| C20—C1—C2—C3 | −178.3 (4) | C15—C16—C17—C18 | 1 (2) |
| C1—C2—C3—C4 | 0.3 (6) | C16—C17—C18—C19 | −4 (2) |
| C2—C3—C4—C5 | −0.7 (6) | C15—C14—C19—C18 | −4.7 (15) |
| C2—C3—C4—C7 | −179.9 (3) | C13—C14—C19—C18 | 174.5 (10) |
| C3—C4—C5—C6 | −0.1 (6) | C17—C18—C19—C14 | 6 (2) |
| C7—C4—C5—C6 | 179.1 (3) | C2—C1—C20—N4 | 94 (37) |
| C4—C5—C6—C1 | 1.2 (6) | C6—C1—C20—N4 | −85 (37) |
| C2—C1—C6—C5 | −1.6 (6) | C4—C7—N1—N2 | −179.7 (3) |
| C20—C1—C6—C5 | 177.6 (4) | O1—C9—N2—N1 | 179.3 (4) |
| C5—C4—C7—N1 | −173.8 (4) | C10—C9—N2—N1 | −0.8 (6) |
| C3—C4—C7—N1 | 5.4 (6) | O1—C9—N2—C8 | 2.6 (7) |
| O1—C9—C10—N3 | −19.1 (6) | C10—C9—N2—C8 | −177.5 (4) |
| N2—C9—C10—N3 | 161.0 (4) | C7—N1—N2—C9 | −178.4 (4) |
| O1—C9—C10—C11 | 101.8 (5) | C7—N1—N2—C8 | −1.8 (6) |
| N2—C9—C10—C11 | −78.1 (5) | O4—C12—N3—C10 | −5.8 (7) |
| N3—C10—C11—O2 | 66.8 (5) | O3—C12—N3—C10 | 174.9 (4) |
| C9—C10—C11—O2 | −50.9 (5) | C9—C10—N3—C12 | −142.7 (4) |
| O3—C13—C14—C15 | 76.1 (8) | C11—C10—N3—C12 | 97.1 (5) |
| O3—C13—C14—C19 | −103.1 (8) | O4—C12—O3—C13 | −2.4 (6) |
| C19—C14—C15—C16 | 1.5 (15) | N3—C12—O3—C13 | 176.9 (4) |
| C13—C14—C15—C16 | −177.6 (10) | C14—C13—O3—C12 | 168.8 (4) |
| Cg2 is the centroid of the C14-C19 ring. |
| D—H···A | D—H | H···A | D···A | D—H···A |
| N3—H3A···O4i | 0.88 | 2.40 | 3.091 (6) | 135 |
| O2—H2A···O4i | 0.84 | 2.08 | 2.873 (5) | 158 |
| C16—H16···Cg2ii | 0.95 | 2.78 | 3.558 (18) | 140 |
| C19—H19···Cg2iii | 0.95 | 2.86 | 3.598 (13) | 135 |
| Symmetry codes: (i) x+1, y, z; (ii) −x+2, y+1/2, −z+1; (iii) −x+1, y−1/2, −z+1. |
| C17H22N4O4 | F(000) = 368 |
| Mr = 346.39 | Dx = 1.307 Mg m−3 |
| Monoclinic, P21 | Mo Kα radiation, λ = 0.71073 Å |
| Hall symbol: P 2yb | Cell parameters from 2232 reflections |
| a = 5.348 (3) Å | θ = 2.6–31.2° |
| b = 7.883 (5) Å | µ = 0.10 mm−1 |
| c = 20.903 (14) Å | T = 100 K |
| β = 92.763 (1)° | Slab, colourless |
| V = 880.2 (10) Å3 | 0.08 × 0.08 × 0.02 mm |
| Z = 2 |
| Rigaku Mercury CCD diffractometer | 2143 reflections with I > 2σ(I) |
| Radiation source: fine-focus sealed tube | Rint = 0.023 |
| Graphite monochromator | θmax = 26.0°, θmin = 2.9° |
| ω scans | h = −6→5 |
| 3672 measured reflections | k = −9→7 |
| 2483 independent reflections | l = −22→25 |
| Refinement on F2 | Secondary atom site location: difference Fourier map |
| Least-squares matrix: full | Hydrogen site location: inferred from neighbouring sites |
| R[F2 > 2σ(F2)] = 0.057 | H-atom parameters constrained |
| wR(F2) = 0.194 | w = 1/[σ2(Fo2) + (0.0993P)2 + 0.4415P] where P = (Fo2 + 2Fc2)/3 |
| S = 1.13 | (Δ/σ)max < 0.001 |
| 2483 reflections | Δρmax = 0.31 e Å−3 |
| 231 parameters | Δρmin = −0.35 e Å−3 |
| 1 restraint | Extinction correction: SHELXL, Fc*=kFc[1+0.001xFc2λ3/sin(2θ)]-1/4 |
| Primary atom site location: structure-invariant direct methods | Extinction coefficient: 0.027 (8) |
| C17H22N4O4 | V = 880.2 (10) Å3 |
| Mr = 346.39 | Z = 2 |
| Monoclinic, P21 | Mo Kα radiation |
| a = 5.348 (3) Å | µ = 0.10 mm−1 |
| b = 7.883 (5) Å | T = 100 K |
| c = 20.903 (14) Å | 0.08 × 0.08 × 0.02 mm |
| β = 92.763 (1)° |
| Rigaku Mercury CCD diffractometer | 2143 reflections with I > 2σ(I) |
| 3672 measured reflections | Rint = 0.023 |
| 2483 independent reflections |
| R[F2 > 2σ(F2)] = 0.057 | 1 restraint |
| wR(F2) = 0.194 | H-atom parameters constrained |
| S = 1.13 | Δρmax = 0.31 e Å−3 |
| 2483 reflections | Δρmin = −0.35 e Å−3 |
| 231 parameters |
Geometry. All e.s.d.'s (except the e.s.d. in the dihedral angle between two l.s. planes) are estimated using the full covariance matrix. The cell e.s.d.'s are taken into account individually in the estimation of e.s.d.'s in distances, angles and torsion angles; correlations between e.s.d.'s in cell parameters are only used when they are defined by crystal symmetry. An approximate (isotropic) treatment of cell e.s.d.'s is used for estimating e.s.d.'s involving l.s. planes. |
Refinement. Refinement of F2 against ALL reflections. The weighted R-factor wR and goodness of fit S are based on F2, conventional R-factors R are based on F, with F set to zero for negative F2. The threshold expression of F2 > σ(F2) is used only for calculating R-factors(gt) etc. and is not relevant to the choice of reflections for refinement. R-factors based on F2 are statistically about twice as large as those based on F, and R- factors based on ALL data will be even larger. |
| x | y | z | Uiso*/Ueq | ||
| C1 | 0.1123 (9) | 0.5292 (7) | 0.3916 (2) | 0.0253 (11) | |
| H1 | 0.1851 | 0.6345 | 0.3806 | 0.030* | |
| C2 | −0.0770 (9) | 0.5247 (7) | 0.4346 (2) | 0.0283 (12) | |
| H2 | −0.1325 | 0.6272 | 0.4532 | 0.034* | |
| C3 | −0.1848 (9) | 0.3741 (8) | 0.4505 (2) | 0.0268 (11) | |
| C4 | −0.1071 (10) | 0.2210 (7) | 0.4233 (2) | 0.0273 (12) | |
| H4 | −0.1829 | 0.1170 | 0.4347 | 0.033* | |
| C5 | 0.0802 (9) | 0.2224 (7) | 0.3799 (2) | 0.0260 (12) | |
| H5 | 0.1300 | 0.1194 | 0.3606 | 0.031* | |
| C6 | 0.1972 (9) | 0.3760 (7) | 0.3641 (2) | 0.0235 (10) | |
| C7 | 0.3919 (9) | 0.3849 (7) | 0.3194 (2) | 0.0249 (10) | |
| H7 | 0.4750 | 0.4895 | 0.3127 | 0.030* | |
| C8 | 0.7748 (9) | 0.4254 (6) | 0.2344 (2) | 0.0254 (11) | |
| H8A | 0.8529 | 0.4655 | 0.2750 | 0.038* | |
| H8B | 0.6564 | 0.5110 | 0.2174 | 0.038* | |
| H8C | 0.9043 | 0.4061 | 0.2036 | 0.038* | |
| C9 | 0.6871 (9) | 0.1258 (7) | 0.2084 (2) | 0.0242 (11) | |
| C10 | 0.5475 (10) | −0.0357 (6) | 0.2249 (2) | 0.0264 (12) | |
| H10 | 0.3697 | −0.0078 | 0.2334 | 0.032* | |
| C11 | 0.6754 (9) | −0.1158 (7) | 0.2847 (2) | 0.0279 (11) | |
| H11A | 0.6336 | −0.0478 | 0.3226 | 0.034* | |
| H11B | 0.6061 | −0.2311 | 0.2903 | 0.034* | |
| C12 | 0.3719 (9) | −0.2554 (7) | 0.1527 (2) | 0.0234 (11) | |
| C13 | 0.2467 (9) | −0.4533 (7) | 0.0650 (2) | 0.0234 (11) | |
| C14 | 0.3177 (9) | −0.6125 (7) | 0.1010 (2) | 0.0264 (11) | |
| H14A | 0.2701 | −0.6018 | 0.1456 | 0.040* | |
| H14B | 0.4989 | −0.6300 | 0.1001 | 0.040* | |
| H14C | 0.2303 | −0.7095 | 0.0810 | 0.040* | |
| C15 | −0.0334 (9) | −0.4161 (8) | 0.0670 (3) | 0.0333 (13) | |
| H15A | −0.0711 | −0.3082 | 0.0453 | 0.050* | |
| H15B | −0.0803 | −0.4087 | 0.1116 | 0.050* | |
| H15C | −0.1285 | −0.5074 | 0.0453 | 0.050* | |
| C16 | 0.3205 (9) | −0.4594 (7) | −0.0040 (2) | 0.0278 (12) | |
| H16A | 0.2902 | −0.3484 | −0.0241 | 0.042* | |
| H16B | 0.2205 | −0.5458 | −0.0272 | 0.042* | |
| H16C | 0.4985 | −0.4880 | −0.0054 | 0.042* | |
| C17 | −0.3795 (10) | 0.3679 (8) | 0.4971 (2) | 0.0306 (12) | |
| N1 | 0.4545 (7) | 0.2521 (5) | 0.28820 (18) | 0.0224 (9) | |
| N2 | 0.6425 (8) | 0.2680 (5) | 0.24509 (19) | 0.0233 (9) | |
| N3 | 0.5555 (8) | −0.1424 (6) | 0.16859 (19) | 0.0280 (10) | |
| H3 | 0.6837 | −0.1335 | 0.1439 | 0.034* | |
| N4 | −0.5229 (9) | 0.3672 (7) | 0.5357 (2) | 0.0356 (11) | |
| O1 | 0.8318 (6) | 0.1316 (5) | 0.16515 (16) | 0.0292 (9) | |
| O2 | 0.9367 (7) | −0.1279 (5) | 0.28307 (16) | 0.0339 (9) | |
| H2A | 0.9742 | −0.1874 | 0.2516 | 0.041* | |
| O3 | 0.3944 (6) | −0.3085 (5) | 0.09164 (16) | 0.0256 (8) | |
| O4 | 0.2146 (6) | −0.3015 (5) | 0.18845 (16) | 0.0292 (9) |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| C1 | 0.032 (3) | 0.017 (3) | 0.027 (2) | −0.001 (2) | 0.000 (2) | −0.002 (2) |
| C2 | 0.035 (3) | 0.027 (3) | 0.023 (2) | 0.009 (3) | −0.004 (2) | −0.005 (2) |
| C3 | 0.031 (2) | 0.031 (3) | 0.018 (2) | 0.003 (3) | 0.0011 (18) | −0.002 (2) |
| C4 | 0.036 (3) | 0.020 (3) | 0.026 (3) | −0.006 (2) | 0.000 (2) | 0.000 (2) |
| C5 | 0.030 (2) | 0.020 (3) | 0.028 (3) | 0.005 (2) | 0.002 (2) | −0.002 (2) |
| C6 | 0.030 (2) | 0.021 (3) | 0.019 (2) | 0.004 (2) | −0.0026 (18) | −0.001 (2) |
| C7 | 0.033 (2) | 0.016 (2) | 0.026 (2) | 0.003 (2) | −0.0020 (19) | 0.001 (2) |
| C8 | 0.029 (3) | 0.018 (3) | 0.029 (3) | −0.005 (2) | 0.000 (2) | 0.002 (2) |
| C9 | 0.029 (3) | 0.021 (3) | 0.022 (2) | 0.003 (2) | 0.0025 (19) | 0.000 (2) |
| C10 | 0.031 (3) | 0.022 (3) | 0.027 (3) | −0.003 (2) | 0.010 (2) | −0.007 (2) |
| C11 | 0.041 (3) | 0.018 (3) | 0.025 (2) | 0.001 (3) | 0.012 (2) | −0.002 (2) |
| C12 | 0.023 (2) | 0.020 (3) | 0.028 (3) | −0.001 (2) | 0.0047 (19) | −0.002 (2) |
| C13 | 0.022 (2) | 0.019 (3) | 0.029 (2) | −0.005 (2) | −0.0001 (18) | 0.001 (2) |
| C14 | 0.030 (2) | 0.021 (3) | 0.029 (2) | −0.004 (2) | 0.0031 (19) | −0.003 (2) |
| C15 | 0.028 (3) | 0.031 (3) | 0.040 (3) | −0.004 (3) | −0.004 (2) | 0.008 (2) |
| C16 | 0.033 (3) | 0.025 (3) | 0.025 (3) | −0.007 (2) | 0.002 (2) | −0.001 (2) |
| C17 | 0.038 (3) | 0.025 (3) | 0.029 (3) | 0.003 (3) | 0.001 (2) | −0.006 (3) |
| N1 | 0.024 (2) | 0.022 (2) | 0.021 (2) | 0.0006 (19) | 0.0028 (15) | 0.0007 (17) |
| N2 | 0.031 (2) | 0.015 (2) | 0.024 (2) | −0.0043 (19) | 0.0019 (17) | −0.0020 (17) |
| N3 | 0.031 (2) | 0.027 (2) | 0.027 (2) | −0.009 (2) | 0.0088 (17) | −0.010 (2) |
| N4 | 0.041 (3) | 0.031 (3) | 0.035 (2) | 0.003 (3) | 0.012 (2) | −0.002 (2) |
| O1 | 0.0357 (19) | 0.023 (2) | 0.0300 (19) | −0.0063 (17) | 0.0086 (15) | −0.0027 (16) |
| O2 | 0.044 (2) | 0.031 (2) | 0.0270 (18) | 0.002 (2) | 0.0030 (15) | −0.0058 (18) |
| O3 | 0.0299 (18) | 0.0225 (18) | 0.0247 (17) | −0.0042 (16) | 0.0039 (13) | −0.0062 (15) |
| O4 | 0.0305 (18) | 0.028 (2) | 0.0304 (19) | −0.0073 (18) | 0.0109 (15) | −0.0062 (16) |
| C1—C2 | 1.386 (7) | C11—O2 | 1.403 (6) |
| C1—C6 | 1.422 (7) | C11—H11A | 0.9900 |
| C1—H1 | 0.9500 | C11—H11B | 0.9900 |
| C2—C3 | 1.368 (8) | C12—O4 | 1.208 (5) |
| C2—H2 | 0.9500 | C12—O3 | 1.354 (6) |
| C3—C4 | 1.405 (8) | C12—N3 | 1.355 (6) |
| C3—C17 | 1.461 (7) | C13—O3 | 1.481 (6) |
| C4—C5 | 1.384 (7) | C13—C14 | 1.503 (8) |
| C4—H4 | 0.9500 | C13—C16 | 1.514 (6) |
| C5—C6 | 1.409 (8) | C13—C15 | 1.529 (7) |
| C5—H5 | 0.9500 | C14—H14A | 0.9800 |
| C6—C7 | 1.435 (6) | C14—H14B | 0.9800 |
| C7—N1 | 1.286 (6) | C14—H14C | 0.9800 |
| C7—H7 | 0.9500 | C15—H15A | 0.9800 |
| C8—N2 | 1.450 (6) | C15—H15B | 0.9800 |
| C8—H8A | 0.9800 | C15—H15C | 0.9800 |
| C8—H8B | 0.9800 | C16—H16A | 0.9800 |
| C8—H8C | 0.9800 | C16—H16B | 0.9800 |
| C9—O1 | 1.219 (6) | C16—H16C | 0.9800 |
| C9—N2 | 1.385 (6) | C17—N4 | 1.139 (6) |
| C9—C10 | 1.524 (7) | N1—N2 | 1.388 (5) |
| C10—N3 | 1.449 (6) | N3—H3 | 0.8800 |
| C10—C11 | 1.532 (7) | O2—H2A | 0.8400 |
| C10—H10 | 1.0000 | ||
| C2—C1—C6 | 119.9 (5) | C10—C11—H11B | 108.7 |
| C2—C1—H1 | 120.1 | H11A—C11—H11B | 107.6 |
| C6—C1—H1 | 120.1 | O4—C12—O3 | 125.9 (5) |
| C3—C2—C1 | 120.6 (5) | O4—C12—N3 | 124.3 (4) |
| C3—C2—H2 | 119.7 | O3—C12—N3 | 109.8 (4) |
| C1—C2—H2 | 119.7 | O3—C13—C14 | 109.7 (4) |
| C2—C3—C4 | 120.7 (4) | O3—C13—C16 | 103.0 (4) |
| C2—C3—C17 | 120.9 (5) | C14—C13—C16 | 112.3 (4) |
| C4—C3—C17 | 118.4 (5) | O3—C13—C15 | 110.3 (4) |
| C5—C4—C3 | 119.8 (5) | C14—C13—C15 | 111.7 (4) |
| C5—C4—H4 | 120.1 | C16—C13—C15 | 109.4 (4) |
| C3—C4—H4 | 120.1 | C13—C14—H14A | 109.5 |
| C4—C5—C6 | 120.2 (5) | C13—C14—H14B | 109.5 |
| C4—C5—H5 | 119.9 | H14A—C14—H14B | 109.5 |
| C6—C5—H5 | 119.9 | C13—C14—H14C | 109.5 |
| C5—C6—C1 | 118.8 (4) | H14A—C14—H14C | 109.5 |
| C5—C6—C7 | 122.6 (5) | H14B—C14—H14C | 109.5 |
| C1—C6—C7 | 118.6 (5) | C13—C15—H15A | 109.5 |
| N1—C7—C6 | 120.4 (5) | C13—C15—H15B | 109.5 |
| N1—C7—H7 | 119.8 | H15A—C15—H15B | 109.5 |
| C6—C7—H7 | 119.8 | C13—C15—H15C | 109.5 |
| N2—C8—H8A | 109.5 | H15A—C15—H15C | 109.5 |
| N2—C8—H8B | 109.5 | H15B—C15—H15C | 109.5 |
| H8A—C8—H8B | 109.5 | C13—C16—H16A | 109.5 |
| N2—C8—H8C | 109.5 | C13—C16—H16B | 109.5 |
| H8A—C8—H8C | 109.5 | H16A—C16—H16B | 109.5 |
| H8B—C8—H8C | 109.5 | C13—C16—H16C | 109.5 |
| O1—C9—N2 | 120.9 (5) | H16A—C16—H16C | 109.5 |
| O1—C9—C10 | 122.3 (4) | H16B—C16—H16C | 109.5 |
| N2—C9—C10 | 116.8 (4) | N4—C17—C3 | 176.4 (6) |
| N3—C10—C9 | 105.5 (4) | C7—N1—N2 | 118.0 (4) |
| N3—C10—C11 | 113.2 (5) | C9—N2—N1 | 115.8 (4) |
| C9—C10—C11 | 109.0 (4) | C9—N2—C8 | 120.6 (4) |
| N3—C10—H10 | 109.7 | N1—N2—C8 | 123.4 (4) |
| C9—C10—H10 | 109.7 | C12—N3—C10 | 122.1 (4) |
| C11—C10—H10 | 109.7 | C12—N3—H3 | 119.0 |
| O2—C11—C10 | 114.4 (4) | C10—N3—H3 | 119.0 |
| O2—C11—H11A | 108.7 | C11—O2—H2A | 109.5 |
| C10—C11—H11A | 108.7 | C12—O3—C13 | 121.5 (4) |
| O2—C11—H11B | 108.7 | ||
| C6—C1—C2—C3 | −0.5 (7) | C9—C10—C11—O2 | −47.4 (6) |
| C1—C2—C3—C4 | −0.5 (7) | C6—C7—N1—N2 | 179.5 (4) |
| C1—C2—C3—C17 | 178.3 (4) | O1—C9—N2—N1 | 173.2 (4) |
| C2—C3—C4—C5 | 0.0 (7) | C10—C9—N2—N1 | −6.9 (6) |
| C17—C3—C4—C5 | −178.9 (4) | O1—C9—N2—C8 | −2.4 (7) |
| C3—C4—C5—C6 | 1.6 (7) | C10—C9—N2—C8 | 177.5 (4) |
| C4—C5—C6—C1 | −2.5 (7) | C7—N1—N2—C9 | −174.2 (4) |
| C4—C5—C6—C7 | −179.9 (4) | C7—N1—N2—C8 | 1.2 (7) |
| C2—C1—C6—C5 | 2.0 (7) | O4—C12—N3—C10 | −14.8 (8) |
| C2—C1—C6—C7 | 179.4 (4) | O3—C12—N3—C10 | 165.8 (5) |
| C5—C6—C7—N1 | 5.0 (7) | C9—C10—N3—C12 | −150.2 (5) |
| C1—C6—C7—N1 | −172.3 (4) | C11—C10—N3—C12 | 90.7 (6) |
| O1—C9—C10—N3 | −19.4 (7) | O4—C12—O3—C13 | −9.9 (8) |
| N2—C9—C10—N3 | 160.7 (4) | N3—C12—O3—C13 | 169.5 (4) |
| O1—C9—C10—C11 | 102.5 (5) | C14—C13—O3—C12 | −63.4 (5) |
| N2—C9—C10—C11 | −77.5 (5) | C16—C13—O3—C12 | 176.8 (4) |
| N3—C10—C11—O2 | 69.7 (6) | C15—C13—O3—C12 | 60.1 (6) |
| D—H···A | D—H | H···A | D···A | D—H···A |
| N3—H3···O1 | 0.88 | 2.27 | 2.620 (6) | 104 |
| O2—H2A···O4i | 0.84 | 2.09 | 2.877 (5) | 156 |
| C4—H4···N4ii | 0.95 | 2.61 | 3.549 (8) | 168 |
| Symmetry codes: (i) x+1, y, z; (ii) −x−1, y−1/2, −z+1. |
| C16H23N3O4 | F(000) = 688 |
| Mr = 321.37 | Dx = 1.257 Mg m−3 |
| Monoclinic, P21/c | Mo Kα radiation, λ = 0.71075 Å |
| Hall symbol: -P 2ybc | Cell parameters from 3225 reflections |
| a = 10.454 (7) Å | θ = 2.0–27.5° |
| b = 10.571 (7) Å | µ = 0.09 mm−1 |
| c = 15.664 (11) Å | T = 100 K |
| β = 101.172 (12)° | Blade, colourless |
| V = 1698 (2) Å3 | 0.16 × 0.05 × 0.01 mm |
| Z = 4 |
| Rigaku Mercury CCD diffractometer | 2716 reflections with I > 2σ(I) |
| Radiation source: fine-focus sealed tube | Rint = 0.048 |
| Graphite monochromator | θmax = 26.0°, θmin = 2.3° |
| ω scans | h = −11→12 |
| 8546 measured reflections | k = −13→9 |
| 3319 independent reflections | l = −19→19 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.104 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.197 | H atoms treated by a mixture of independent and constrained refinement |
| S = 1.23 | w = 1/[σ2(Fo2) + (0.0376P)2 + 3.1065P] where P = (Fo2 + 2Fc2)/3 |
| 3319 reflections | (Δ/σ)max = 0.002 |
| 220 parameters | Δρmax = 0.44 e Å−3 |
| 0 restraints | Δρmin = −0.26 e Å−3 |
| C16H23N3O4 | V = 1698 (2) Å3 |
| Mr = 321.37 | Z = 4 |
| Monoclinic, P21/c | Mo Kα radiation |
| a = 10.454 (7) Å | µ = 0.09 mm−1 |
| b = 10.571 (7) Å | T = 100 K |
| c = 15.664 (11) Å | 0.16 × 0.05 × 0.01 mm |
| β = 101.172 (12)° |
| Rigaku Mercury CCD diffractometer | 2716 reflections with I > 2σ(I) |
| 8546 measured reflections | Rint = 0.048 |
| 3319 independent reflections |
| R[F2 > 2σ(F2)] = 0.104 | 0 restraints |
| wR(F2) = 0.197 | H atoms treated by a mixture of independent and constrained refinement |
| S = 1.23 | Δρmax = 0.44 e Å−3 |
| 3319 reflections | Δρmin = −0.26 e Å−3 |
| 220 parameters |
Geometry. All e.s.d.'s (except the e.s.d. in the dihedral angle between two l.s. planes) are estimated using the full covariance matrix. The cell e.s.d.'s are taken into account individually in the estimation of e.s.d.'s in distances, angles and torsion angles; correlations between e.s.d.'s in cell parameters are only used when they are defined by crystal symmetry. An approximate (isotropic) treatment of cell e.s.d.'s is used for estimating e.s.d.'s involving l.s. planes. |
Refinement. Refinement of F2 against ALL reflections. The weighted R-factor wR and goodness of fit S are based on F2, conventional R-factors R are based on F, with F set to zero for negative F2. The threshold expression of F2 > σ(F2) is used only for calculating R-factors(gt) etc. and is not relevant to the choice of reflections for refinement. R-factors based on F2 are statistically about twice as large as those based on F, and R- factors based on ALL data will be even larger. |
| x | y | z | Uiso*/Ueq | Occ. (<1) | |
| C1 | 0.7859 (4) | 0.4700 (4) | −0.0477 (3) | 0.0348 (9) | |
| H1 | 0.7784 | 0.4009 | −0.0872 | 0.042* | |
| C2 | 0.8683 (4) | 0.5702 (4) | −0.0568 (3) | 0.0412 (11) | |
| H2 | 0.9170 | 0.5695 | −0.1021 | 0.049* | |
| C3 | 0.8788 (4) | 0.6708 (4) | 0.0004 (3) | 0.0430 (11) | |
| H3 | 0.9349 | 0.7395 | −0.0057 | 0.052* | |
| C4 | 0.8078 (4) | 0.6721 (4) | 0.0669 (3) | 0.0386 (10) | |
| H4 | 0.8158 | 0.7415 | 0.1061 | 0.046* | |
| C5 | 0.7255 (4) | 0.5723 (4) | 0.0762 (3) | 0.0327 (9) | |
| H5 | 0.6769 | 0.5736 | 0.1215 | 0.039* | |
| C6 | 0.7141 (4) | 0.4698 (4) | 0.0188 (2) | 0.0311 (9) | |
| C7 | 0.6264 (4) | 0.3627 (4) | 0.0243 (2) | 0.0296 (9) | |
| H7 | 0.6199 | 0.2956 | −0.0166 | 0.035* | |
| C8 | 0.4643 (4) | 0.1543 (4) | 0.0243 (3) | 0.0344 (9) | |
| H8A | 0.4422 | 0.1880 | −0.0350 | 0.052* | |
| H8B | 0.3956 | 0.0962 | 0.0343 | 0.052* | |
| H8C | 0.5474 | 0.1087 | 0.0317 | 0.052* | |
| C9 | 0.4092 (3) | 0.2560 (3) | 0.1529 (2) | 0.0271 (8) | |
| C10 | 0.4332 (4) | 0.3650 (4) | 0.2184 (2) | 0.0285 (8) | |
| H10 | 0.4347 | 0.4465 | 0.1862 | 0.034* | |
| C11 | 0.5617 (4) | 0.3500 (4) | 0.2828 (3) | 0.0362 (10) | |
| H11A | 0.5651 | 0.2596 | 0.2995 | 0.043* | 0.198 (7) |
| H11B | 0.5700 | 0.4247 | 0.3256 | 0.043* | 0.802 (7) |
| H11C | 0.6349 | 0.3651 | 0.2502 | 0.043* | |
| C12 | 0.2675 (4) | 0.4729 (4) | 0.2834 (2) | 0.0281 (8) | |
| C13 | 0.0726 (4) | 0.5471 (4) | 0.3365 (3) | 0.0341 (9) | |
| C14 | −0.0564 (4) | 0.4811 (5) | 0.3367 (3) | 0.0520 (13) | |
| H14A | −0.0411 | 0.4045 | 0.3725 | 0.078* | |
| H14B | −0.0970 | 0.4580 | 0.2770 | 0.078* | |
| H14C | −0.1144 | 0.5381 | 0.3607 | 0.078* | |
| C15 | 0.1439 (5) | 0.5729 (6) | 0.4287 (3) | 0.0623 (15) | |
| H15A | 0.1576 | 0.4932 | 0.4611 | 0.093* | |
| H15B | 0.0918 | 0.6303 | 0.4574 | 0.093* | |
| H15C | 0.2285 | 0.6121 | 0.4273 | 0.093* | |
| C16 | 0.0522 (5) | 0.6640 (5) | 0.2808 (4) | 0.0669 (16) | |
| H16A | 0.1357 | 0.7076 | 0.2838 | 0.100* | |
| H16B | −0.0093 | 0.7204 | 0.3018 | 0.100* | |
| H16C | 0.0169 | 0.6401 | 0.2204 | 0.100* | |
| N1 | 0.5586 (3) | 0.3598 (3) | 0.08443 (19) | 0.0242 (7) | |
| N2 | 0.4760 (3) | 0.2584 (3) | 0.08675 (19) | 0.0266 (7) | |
| N3 | 0.3211 (3) | 0.3649 (3) | 0.2618 (2) | 0.0314 (8) | |
| H1N | 0.275 (4) | 0.295 (4) | 0.251 (3) | 0.038* | |
| O1 | 0.3346 (3) | 0.1683 (2) | 0.16179 (18) | 0.0340 (7) | |
| O2A | 0.5728 (3) | 0.2373 (3) | 0.3258 (2) | 0.0362 (10)* | 0.802 (7) |
| H2A | 0.5770 | 0.1766 | 0.2917 | 0.043* | 0.802 (7) |
| O2B | 0.5960 (13) | 0.4007 (12) | 0.3635 (8) | 0.029 (4) | 0.198 (7) |
| H2B | 0.5934 | 0.4800 | 0.3600 | 0.035* | 0.198 (7) |
| O3 | 0.1477 (3) | 0.4493 (2) | 0.29998 (18) | 0.0335 (7) | |
| O4 | 0.3204 (3) | 0.5758 (2) | 0.28835 (19) | 0.0383 (7) |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| C1 | 0.034 (2) | 0.042 (2) | 0.029 (2) | 0.0071 (18) | 0.0076 (17) | 0.0056 (18) |
| C2 | 0.032 (2) | 0.056 (3) | 0.038 (2) | 0.001 (2) | 0.0133 (18) | 0.016 (2) |
| C3 | 0.039 (2) | 0.040 (3) | 0.051 (3) | −0.005 (2) | 0.012 (2) | 0.012 (2) |
| C4 | 0.039 (2) | 0.035 (2) | 0.043 (2) | −0.0030 (19) | 0.0095 (19) | 0.0015 (19) |
| C5 | 0.033 (2) | 0.035 (2) | 0.032 (2) | 0.0011 (17) | 0.0091 (17) | 0.0036 (18) |
| C6 | 0.027 (2) | 0.035 (2) | 0.031 (2) | 0.0035 (17) | 0.0064 (16) | 0.0084 (18) |
| C7 | 0.034 (2) | 0.031 (2) | 0.0233 (19) | 0.0052 (17) | 0.0046 (16) | −0.0030 (16) |
| C8 | 0.040 (2) | 0.027 (2) | 0.036 (2) | −0.0023 (17) | 0.0084 (18) | −0.0113 (18) |
| C9 | 0.031 (2) | 0.0163 (18) | 0.034 (2) | 0.0006 (15) | 0.0040 (16) | −0.0021 (15) |
| C10 | 0.035 (2) | 0.0245 (19) | 0.031 (2) | −0.0056 (16) | 0.0168 (17) | −0.0027 (16) |
| C11 | 0.036 (2) | 0.046 (3) | 0.028 (2) | −0.0073 (19) | 0.0087 (17) | −0.0123 (19) |
| C12 | 0.029 (2) | 0.028 (2) | 0.0270 (19) | 0.0001 (16) | 0.0057 (15) | −0.0018 (16) |
| C13 | 0.034 (2) | 0.031 (2) | 0.040 (2) | 0.0102 (17) | 0.0119 (18) | −0.0056 (18) |
| C14 | 0.035 (2) | 0.052 (3) | 0.074 (3) | 0.009 (2) | 0.021 (2) | −0.011 (3) |
| C15 | 0.043 (3) | 0.089 (4) | 0.057 (3) | 0.016 (3) | 0.014 (2) | −0.033 (3) |
| C16 | 0.063 (3) | 0.052 (3) | 0.091 (4) | 0.026 (3) | 0.026 (3) | 0.022 (3) |
| N1 | 0.0251 (16) | 0.0186 (15) | 0.0286 (16) | −0.0003 (12) | 0.0046 (13) | −0.0010 (13) |
| N2 | 0.0318 (17) | 0.0237 (16) | 0.0242 (16) | −0.0026 (14) | 0.0053 (13) | −0.0036 (13) |
| N3 | 0.0373 (19) | 0.0188 (16) | 0.043 (2) | −0.0010 (14) | 0.0211 (16) | −0.0022 (15) |
| O1 | 0.0369 (16) | 0.0228 (14) | 0.0443 (17) | −0.0052 (12) | 0.0125 (13) | −0.0011 (12) |
| O2B | 0.043 (8) | 0.017 (7) | 0.027 (7) | 0.006 (6) | 0.005 (6) | 0.001 (5) |
| O3 | 0.0355 (15) | 0.0233 (14) | 0.0465 (16) | 0.0034 (12) | 0.0200 (13) | −0.0026 (12) |
| O4 | 0.0441 (17) | 0.0231 (14) | 0.0529 (18) | −0.0055 (13) | 0.0226 (14) | −0.0072 (13) |
| C1—C2 | 1.389 (6) | C11—H11A | 0.9900 |
| C1—C6 | 1.398 (5) | C11—H11B | 1.0278 |
| C1—H1 | 0.9500 | C11—H11C | 1.0114 |
| C2—C3 | 1.382 (6) | C12—O4 | 1.216 (4) |
| C2—H2 | 0.9500 | C12—N3 | 1.344 (5) |
| C3—C4 | 1.391 (6) | C12—O3 | 1.350 (4) |
| C3—H3 | 0.9500 | C13—O3 | 1.478 (4) |
| C4—C5 | 1.386 (5) | C13—C16 | 1.504 (6) |
| C4—H4 | 0.9500 | C13—C15 | 1.516 (6) |
| C5—C6 | 1.398 (6) | C13—C14 | 1.519 (6) |
| C5—H5 | 0.9500 | C14—H14A | 0.9800 |
| C6—C7 | 1.470 (5) | C14—H14B | 0.9800 |
| C7—N1 | 1.284 (5) | C14—H14C | 0.9800 |
| C7—H7 | 0.9500 | C15—H15A | 0.9800 |
| C8—N2 | 1.462 (5) | C15—H15B | 0.9800 |
| C8—H8A | 0.9800 | C15—H15C | 0.9800 |
| C8—H8B | 0.9800 | C16—H16A | 0.9800 |
| C8—H8C | 0.9800 | C16—H16B | 0.9800 |
| C9—O1 | 1.236 (4) | C16—H16C | 0.9800 |
| C9—N2 | 1.358 (5) | N1—N2 | 1.381 (4) |
| C9—C10 | 1.531 (5) | N3—H1N | 0.88 (4) |
| C10—N3 | 1.465 (5) | O2A—H11A | 0.4685 |
| C10—C11 | 1.523 (5) | O2A—H2A | 0.8421 |
| C10—H10 | 1.0000 | O2B—H11B | 0.6548 |
| C11—O2B | 1.356 (13) | O2B—H2B | 0.8400 |
| C11—O2A | 1.363 (5) | ||
| C2—C1—C6 | 120.7 (4) | O2B—C11—H11C | 108.6 |
| C2—C1—H1 | 119.6 | O2A—C11—H11C | 112.7 |
| C6—C1—H1 | 119.6 | C10—C11—H11C | 107.8 |
| C3—C2—C1 | 119.5 (4) | H11A—C11—H11C | 107.0 |
| C3—C2—H2 | 120.2 | H11B—C11—H11C | 103.4 |
| C1—C2—H2 | 120.2 | O4—C12—N3 | 124.7 (3) |
| C2—C3—C4 | 120.4 (4) | O4—C12—O3 | 125.4 (3) |
| C2—C3—H3 | 119.8 | N3—C12—O3 | 109.8 (3) |
| C4—C3—H3 | 119.8 | O3—C13—C16 | 112.1 (3) |
| C5—C4—C3 | 120.2 (4) | O3—C13—C15 | 107.2 (3) |
| C5—C4—H4 | 119.9 | C16—C13—C15 | 113.1 (4) |
| C3—C4—H4 | 119.9 | O3—C13—C14 | 102.6 (3) |
| C4—C5—C6 | 120.0 (4) | C16—C13—C14 | 110.6 (4) |
| C4—C5—H5 | 120.0 | C15—C13—C14 | 110.7 (4) |
| C6—C5—H5 | 120.0 | C13—C14—H14A | 109.5 |
| C1—C6—C5 | 119.1 (4) | C13—C14—H14B | 109.5 |
| C1—C6—C7 | 118.4 (4) | H14A—C14—H14B | 109.5 |
| C5—C6—C7 | 122.4 (3) | C13—C14—H14C | 109.5 |
| N1—C7—C6 | 120.1 (3) | H14A—C14—H14C | 109.5 |
| N1—C7—H7 | 120.0 | H14B—C14—H14C | 109.5 |
| C6—C7—H7 | 120.0 | C13—C15—H15A | 109.5 |
| N2—C8—H8A | 109.5 | C13—C15—H15B | 109.5 |
| N2—C8—H8B | 109.5 | H15A—C15—H15B | 109.5 |
| H8A—C8—H8B | 109.5 | C13—C15—H15C | 109.5 |
| N2—C8—H8C | 109.5 | H15A—C15—H15C | 109.5 |
| H8A—C8—H8C | 109.5 | H15B—C15—H15C | 109.5 |
| H8B—C8—H8C | 109.5 | C13—C16—H16A | 109.5 |
| O1—C9—N2 | 121.9 (3) | C13—C16—H16B | 109.5 |
| O1—C9—C10 | 121.0 (3) | H16A—C16—H16B | 109.5 |
| N2—C9—C10 | 117.1 (3) | C13—C16—H16C | 109.5 |
| N3—C10—C11 | 112.0 (3) | H16A—C16—H16C | 109.5 |
| N3—C10—C9 | 105.5 (3) | H16B—C16—H16C | 109.5 |
| C11—C10—C9 | 112.0 (3) | C7—N1—N2 | 118.3 (3) |
| N3—C10—H10 | 109.1 | C9—N2—N1 | 116.8 (3) |
| C11—C10—H10 | 109.1 | C9—N2—C8 | 120.5 (3) |
| C9—C10—H10 | 109.1 | N1—N2—C8 | 122.5 (3) |
| O2B—C11—O2A | 84.4 (6) | C12—N3—C10 | 121.8 (3) |
| O2B—C11—C10 | 128.1 (6) | C12—N3—H1N | 121 (3) |
| O2A—C11—C10 | 113.4 (3) | C10—N3—H1N | 112 (3) |
| O2B—C11—H11A | 98.4 | C11—O2A—H11A | 30.8 |
| O2A—C11—H11A | 14.0 | C11—O2A—H2A | 111.3 |
| C10—C11—H11A | 104.9 | H11A—O2A—H2A | 81.1 |
| O2B—C11—H11B | 27.8 | C11—O2B—H11B | 47.0 |
| O2A—C11—H11B | 111.2 | C11—O2B—H2B | 109.4 |
| C10—C11—H11B | 107.7 | H11B—O2B—H2B | 63.3 |
| H11A—C11—H11B | 125.2 | C12—O3—C13 | 121.8 (3) |
| C6—C1—C2—C3 | −0.2 (6) | C9—C10—C11—O2A | −54.9 (4) |
| C1—C2—C3—C4 | 0.1 (6) | C6—C7—N1—N2 | 179.1 (3) |
| C2—C3—C4—C5 | −0.2 (7) | O1—C9—N2—N1 | −178.6 (3) |
| C3—C4—C5—C6 | 0.2 (6) | C10—C9—N2—N1 | −0.5 (5) |
| C2—C1—C6—C5 | 0.3 (6) | O1—C9—N2—C8 | −1.7 (5) |
| C2—C1—C6—C7 | 178.8 (4) | C10—C9—N2—C8 | 176.5 (3) |
| C4—C5—C6—C1 | −0.3 (6) | C7—N1—N2—C9 | 177.7 (3) |
| C4—C5—C6—C7 | −178.7 (4) | C7—N1—N2—C8 | 0.8 (5) |
| C1—C6—C7—N1 | −179.7 (4) | O4—C12—N3—C10 | −17.6 (6) |
| C5—C6—C7—N1 | −1.3 (6) | O3—C12—N3—C10 | 163.4 (3) |
| O1—C9—C10—N3 | −21.4 (5) | C11—C10—N3—C12 | 95.9 (4) |
| N2—C9—C10—N3 | 160.5 (3) | C9—C10—N3—C12 | −141.9 (4) |
| O1—C9—C10—C11 | 100.8 (4) | O4—C12—O3—C13 | −7.2 (6) |
| N2—C9—C10—C11 | −77.4 (4) | N3—C12—O3—C13 | 171.8 (3) |
| N3—C10—C11—O2B | −38.4 (9) | C16—C13—O3—C12 | 57.0 (5) |
| C9—C10—C11—O2B | −156.7 (8) | C15—C13—O3—C12 | −67.7 (5) |
| N3—C10—C11—O2A | 63.5 (4) | C14—C13—O3—C12 | 175.7 (3) |
| D—H···A | D—H | H···A | D···A | D—H···A |
| N3—H1N···O1 | 0.88 (4) | 2.11 (4) | 2.623 (4) | 116 (3) |
| O2A—H2A···O4i | 0.84 | 2.09 | 2.852 (4) | 150 |
| O2B—H2B···O1ii | 0.84 | 2.18 | 2.966 (13) | 156 |
| C7—H7···O2Aiii | 0.95 | 2.45 | 3.229 (5) | 140 |
| Symmetry codes: (i) −x+1, y−1/2, −z+1/2; (ii) −x+1, y+1/2, −z+1/2; (iii) x, −y+1/2, z−1/2. |
| Cg2 is the centroid of the C14-C19 ring. |
| D—H···A | D—H | H···A | D···A | D—H···A |
| N3—H3A···O4i | 0.88 | 2.40 | 3.091 (6) | 135 |
| O2—H2A···O4i | 0.84 | 2.08 | 2.873 (5) | 158 |
| C16—H16···Cg2ii | 0.95 | 2.78 | 3.558 (18) | 140 |
| C19—H19···Cg2iii | 0.95 | 2.86 | 3.598 (13) | 135 |
| Symmetry codes: (i) x+1, y, z; (ii) −x+2, y+1/2, −z+1; (iii) −x+1, y−1/2, −z+1. |
| D—H···A | D—H | H···A | D···A | D—H···A |
| N3—H3···O1 | 0.88 | 2.27 | 2.620 (6) | 104 |
| O2—H2A···O4i | 0.84 | 2.09 | 2.877 (5) | 156 |
| C4—H4···N4ii | 0.95 | 2.61 | 3.549 (8) | 168 |
| Symmetry codes: (i) x+1, y, z; (ii) −x−1, y−1/2, −z+1. |
| D—H···A | D—H | H···A | D···A | D—H···A |
| N3—H1N···O1 | 0.88 (4) | 2.11 (4) | 2.623 (4) | 116 (3) |
| O2A—H2A···O4i | 0.84 | 2.09 | 2.852 (4) | 150 |
| O2B—H2B···O1ii | 0.84 | 2.18 | 2.966 (13) | 156 |
| C7—H7···O2Aiii | 0.95 | 2.45 | 3.229 (5) | 140 |
| Symmetry codes: (i) −x+1, y−1/2, −z+1/2; (ii) −x+1, y+1/2, −z+1/2; (iii) x, −y+1/2, z−1/2. |
Experimental details
| (I) | (II) | (III) | |
| Crystal data | |||
| Chemical formula | C20H20N4O4 | C17H22N4O4 | C16H23N3O4 |
| Mr | 380.40 | 346.39 | 321.37 |
| Crystal system, space group | Monoclinic, P21 | Monoclinic, P21 | Monoclinic, P21/c |
| Temperature (K) | 100 | 100 | 100 |
| a, b, c (Å) | 4.995 (6), 8.172 (8), 22.94 (3) | 5.348 (3), 7.883 (5), 20.903 (14) | 10.454 (7), 10.571 (7), 15.664 (11) |
| β (°) | 93.48 (3) | 92.763 (1) | 101.172 (12) |
| V (Å3) | 934.7 (19) | 880.2 (10) | 1698 (2) |
| Z | 2 | 2 | 4 |
| Radiation type | Mo Kα | Mo Kα | Mo Kα |
| µ (mm−1) | 0.10 | 0.10 | 0.09 |
| Crystal size (mm) | 0.14 × 0.03 × 0.01 | 0.08 × 0.08 × 0.02 | 0.16 × 0.05 × 0.01 |
| Data collection | |||
| Diffractometer | Rigaku Mercury CCD diffractometer | Rigaku Mercury CCD diffractometer | Rigaku Mercury CCD diffractometer |
| Absorption correction | – | – | – |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 13928, 4691, 3270 | 3672, 2483, 2143 | 8546, 3319, 2716 |
| Rint | 0.070 | 0.023 | 0.048 |
| (sin θ/λ)max (Å−1) | 0.734 | 0.617 | 0.617 |
| Refinement | |||
| R[F2 > 2σ(F2)], wR(F2), S | 0.095, 0.278, 1.10 | 0.057, 0.194, 1.13 | 0.104, 0.197, 1.23 |
| No. of reflections | 4691 | 2483 | 3319 |
| No. of parameters | 255 | 231 | 220 |
| No. of restraints | 1 | 1 | 0 |
| H-atom treatment | H-atom parameters constrained | H-atom parameters constrained | H atoms treated by a mixture of independent and constrained refinement |
| Δρmax, Δρmin (e Å−3) | 0.39, −0.35 | 0.31, −0.35 | 0.44, −0.26 |
Computer programs: CrystalClear (Rigaku, 2012), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), ORTEP-3 for Windows (Farrugia, 2012), publCIF (Westrip, 2010).
Acknowledgements
We thank the EPSRC National Crystallography Service (University of Southampton) for the X-ray data collections.
References
Blaskovich, M. A. & Lajoie, G. A. (1993). J. Am. Chem. Soc. 115, 5021–5030. CSD CrossRef CAS Web of Science Google Scholar
Farrugia, L. J. (2012). J. Appl. Cryst. 45, 849–854. Web of Science CrossRef CAS IUCr Journals Google Scholar
Groom, C. R. & Allen, F. H. (2014). Angew. Chem. Int. Ed. 53, 662–671. Web of Science CrossRef CAS Google Scholar
Howie, R. A., de Souza, M. V. N., Pinheiro, A., Kaiser, C. R., Wardell, J. L. & Wardell, S. M. S. V. (2011). Z. Kristallogr. 226, 483–491. CAS Google Scholar
Kovacs, J., Jham, G. N., Hui, K. Y., Holleran, E. M., Kim, S. E. & Canavan, T. (1984). Int. J. Peptide Protein Res. 24, 161–167. CrossRef CAS Google Scholar
Noguiera, T. C. M., Pinheiro, A. C., Kaiser, C., Wardell, J. L., Wardell, S. M. S. V. & de Souza, M. V. N. (2013). Lett. Org. Chem. 10, 626–631. Google Scholar
Noguiera, T. C. M., Pinheiro, A. C., Wardell, J. L., de Souza, M. V. N., Abberley, J. P. & Harrison, W. T. A. (2015). Acta Cryst. C71. Submitted. Google Scholar
Pinheiro, A. C., Kaiser, C. R., Noguiera, T. C. M., Carvalho, S. A., Silva, E. F., Feitosa, L. O., Henriques, M. O., Candéa, L. P., Lourenço, M. C. S. & Souza, M. V. N. (2011). Med. Chem. 7, 611–623. Web of Science CAS PubMed Google Scholar
Rigaku (2012). CrystalClear. Rigaku Corporation, Tokyo, Japan. Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Spek, A. L. (2009). Acta Cryst. D65, 148–155. Web of Science CrossRef CAS IUCr Journals Google Scholar
Westrip, S. P. (2010). J. Appl. Cryst. 43, 920–925. Web of Science CrossRef CAS IUCr Journals Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
; (iii)
.
.
; (ii)
; (iii)
.
![[Figure 1]](./hg5443fig1thm.gif)
![[Figure 2]](./hg5443fig2thm.gif)
![[Figure 3]](./hg5443fig3thm.gif)
![[Figure 4]](./hg5443fig4thm.gif)
![[Figure 5]](./hg5443fig5thm.gif)
![[Figure 6]](./hg5443fig6thm.gif)



