2. Structural commentary
The title compound containing the 2,6-diaryl-piperidin-4-one moiety, C18H18NOCl, (I)
, crystallizes in the triclinic space group P
(Fig. 1
) whereas compounds C20H22NOCl, (II)
(Fig. 2
) and C18H16NOCl3, (III)
(Fig. 3
) both crystallize in the orthorhombic space group Pna21. The piperidin-4-one ring in all three compounds exhibits a distorted chair conformation [puckering parameters Q = 0.559 (3) Å (I)
, 0.568 (2) Å (II)
, 0.557 (3) Å (III)
; θ = 173.3 (3)° (I)
, 168.5 (2)° (II)
, 167.8 (3)° (III)
and φ = 180 (2)° (I)
, 156.9 (12)° (II)
, 206.8 (13)° (III)]. The methyl substituent on position 3 of the piperidine ring takes up a syn-periplanar orientation [C18—C2—C1—O1 = −3.4 (3)° (I)
, −7.4 (3)° (II)
, 8.6 (4)° (III)] while the chloro substituent takes up an anti-clinical orientation [Cl1—C2—C1—O1 = 113.3 (2)° (I)
, 109.0 (2)° (II)
, −106.9 (3)° (III)] owing to the repulsion from a nearby oxygen atom. The phenyl rings bonded to the piperidine moiety occupy equatorial positions in all three compounds: the dihedral angles between the mean planes of the phenyl rings are 58.4 (2), 73.5 (5) and 78.6 (2)° in (I)
, (II)
and (III)
, respectively. The increase in the dihedral angles between the phenyl rings from (I)
to (III)
might be attributed to the steric repulsion resulting from the substituents on the phenyl rings. The sum of bond angles around N1 in each structure [333.1° (I)
, 332.0° (II)
, 337.3° (III)] is consistent with sp3 hybridization (Beddoes et al., 1986
).
| Figure 1 A view of the molecular structure of (I) , showing displacement ellipsoids drawn at the 30% probability level. |
| Figure 2 A view of the molecular structure of (II) , showing displacement ellipsoids drawn at the 30% probability level. |
| Figure 3 A view of the molecular structure of (III) , showing displacement ellipsoids drawn at the 30% probability level. |
3. Supramolecular features
For each structure, the crystal packing is influenced by weak N1—H1⋯O1 hydrogen bonds, forming infinite chains along the a axis direction (Figs. 4
, 5
and 6
). In (III)
, additional weak C10—H10⋯O1 interactions are observed. Weak C—H⋯π interactions are observed in all three compounds (Tables 1
, 2
and 3
). In all three compounds, π–π interactions must be extremely weak, with centroid–centroid separations greater than 4 Å.
| D—H⋯A | D—H | H⋯A | D⋯A | D—H⋯A | | N1—H1⋯O1i | 0.83 (3) | 2.49 (3) | 3.257 (3) | 154 (3) | | C9—H9⋯Cg3ii | 0.95 | 2.97 | 3.662 (3) | 131 | | C15—H15⋯Cg2iii | 0.96 | 2.98 | 3.861 (3) | 155 | | C18—H18A⋯Cg2iv | 0.98 | 2.73 | 3.497 (3) | 136 | Symmetry codes: (i) x-1, y, z; (ii) x, y-1, z; (iii) x-1, y+1, z; (iv) x+1, y, z. | |
| D—H⋯A | D—H | H⋯A | D⋯A | D—H⋯A | | N1—H1⋯O1i | 0.85 (3) | 2.27 (3) | 3.057 (2) | 154 (3) | | C18—H18A⋯Cg3ii | 0.98 | 2.92 | 3.686 (3) | 135 | | C20—H20A⋯Cg2iii | 0.97 | 2.81 | 3.724 (3) | 156 | Symmetry codes: (i) ; (ii) ; (iii) . | |
| D—H⋯A | D—H | H⋯A | D⋯A | D—H⋯A | | N1—H1⋯O1i | 0.74 (3) | 2.40 (3) | 3.071 (3) | 151 (3) | | C10—H10⋯O1ii | 0.95 | 2.56 | 3.374 (3) | 144 | | C18—H18C⋯Cg3iii | 0.98 | 2.98 | 3.725 (3) | 134 | Symmetry codes: (i) ; (ii) ; (iii) . | |
| Figure 4 A partial view along the c axis of the crystal packing for (I) , showing the chains formed along [100] by a weak N—H⋯O hydrogen bond. H atoms not involved in this weak hydrogen-bonding activity have been omitted for clarity. |
| Figure 5 A partial view along the c axis of the crystal packing for (II) showing the chains formed along [100] by a weak N—H⋯O hydrogen bond. H atoms not involved in this weak hydrogen-bonding activity have been omitted for clarity. |
| Figure 6 A partial view along the c axis of the crystal packing for (III) showing the chains formed along [100] by a single weak N—H⋯O interaction, which is consolidated by a C—H⋯O bond. H atoms not involved in this weak hydrogen-bonding activity have been omitted for clarity. |
4. Database survey
A search in the Cambridge Structural Database (CSD, Version 5.37, update February 2016; Groom et al., 2016
) for the 2,6-diphenylpiperidin-4-one skeleton gave 221 hits. Three closely related structures, viz. c-3,t-3-dimethyl-r-2,c-6-diphenyl-piperidin-4-one (CSD refcode: PUGNEL; Thenmozhi et al., 2009
); r-2,c-6-bis-(4-chlorophenyl)-3,3-dimethylpiperidin-4-one (CSD refcode: OGEJEQ; Ilango et al., 2008
) and 3,3-dimethyl-cis-2,6-di-p-tolylpiperidin-4-one (CSD refcode: PUFHAA; Gayathri et al., 2009
) may be briefly compared to the three structures reported here: the distorted chair conformations of the piperidine rings are also observed in PUGNEL, OGEJEQ and PUFHAA. The packing in (I)
,(II) and (III)
and and PUGNEL, PUFHAA and OGEJEQ all feature N—H⋯O hydrogen bonds and C—H⋯π interactions. Both (III)
and OGEJEQ also exhibit additional weak C—H⋯O interactions.
5. Synthesis and crystallization
A mixture of ammonium acetate (0.1 mol, 7.71 g), the respective aldehyde (0.2 mol) (benzaldehyde/p-methylbenzaldehyde/p-chlorobenzaldehyde, 20.4 ml, 24.0 g and 28.1 ml) and 3-chloro-2-butanone (0.1 mol, 10.1 ml) in distilled ethanol was heated first to boiling. After cooling, the viscous liquid obtained was dissolved in diethyl ether (200 ml) and shaken with 100 ml concentrated hydrochloric acid. The precipitated hydrochloride of the 3-chloro, 3-methyl-r(6),c(6)-diarylpiperidin-4-one was removed by filtration and washed first with a 40 ml mixture of ethanol and diethyl ether (1:1) and then with diethyl ether to remove most of the coloured impurities. The base was liberated from an alcoholic solution by adding aqueous ammonia and then diluted with water. Each compound was recrystallized twice from distilled ethanol solution: single crystals of (I)
, (II)
and (III)
were obtained after two days.
3-Chloro-3-methyl-r(2),c(6)-diphenylpiperidin-4-one, (C18H18ClNO) (I) IR (KBr): 3333.64 (υN—H), 3063.43, 3007.40 (υC—H), 1713.51 (υC=O), 1602.76, 1495.15 (υC=C), 749.57 (υC—Cl) cm−1. 1H NMR (500 MHz, CDCl3): δ 7.41–7.16 (m, aromatic protons), 4.00–3.97 [dd, H(6) proton], 3.87 [s, H(2) proton] , 3.44–3.39 [t, H(5e) proton], 2.50–2.45 [dd, H(5a) proton], 1.66 (s, NH proton), 1.38 (s, CH3 proton). 13C NMR (CDCl3, 500 MHz): δ 202.69 (C=O), 142.27, 137.32 (aromatic ipso carbon atoms), 129.52–126.89 (aromatic carbon atoms), 72.02 (C-3 carbon), 69.88 (C-2 carbon), 61.49 (C-6 carbon), 45.60 (C-5 carbon), 22.25 (methyl carbon).
3-Chloro-3-methyl-r(2),c(6)-di-p-tolyl-piperidin-4-one, (C20H22ClNO) (II) IR (KBr): 3332.57 (υN—H), 3095.35, 3007.79 (υC—H), 1715.40 (υC=O), 1615.57, 1513.79 (υC=C), 738.68 (υC—Cl) cm−1. 1H NMR (500 MHz, CDCl3): δ 7.50–7.33 (m, aromatic protons), 4.06–4.03 [dd, H(6) proton], 3.93 [s, H(2) proton], 3.45–3.40 [dd, H(5e) proton], 2.54–2.51 [dd, H(5a) proton], 1.70 (s, NH proton), 1.43 (s, CH3 proton at C-3), 2.45 (s, CH3 protons attached to the phenyl ring). 13C NMR (CDCl3, 500 MHz): δ 203.07 (C=O), 139.32, 138.56, 138.01, 134.32 (aromatic ipso carbon atoms), 129.69–126.76 (aromatic carbon atoms), 72.16 (C-3 carbon), 69.62 (C-2 carbon), 61.18 (C-6 carbon), 45.58 (C-5 carbon), 21.37 (methyl carbon at C-3), 22.22 (methyl carbon atoms attached to the phenyl ring).
3-Chloro-3-methyl-r(2),c(6)-bis(p-chlorophenyl)piperidin-4-one, (C18H16Cl3NO) (III) IR (KBr): 3325.87 (υN—H), 3047.68, 3009.09 (υC—H), 1715.63 (υC=O), 1596.88, 1491.72 (υC=C), 799.88 (υC—Cl) cm−1. 1H NMR (500 MHz, CDCl3): δ 7.50–7.33 (m, aromatic protons), 4.06–4.03 [dd, H(6) proton], 3.93 [s, H(2) proton], 3.45–.40 [dd, H(5e) proton], 2.54–2.51 [dd, H(5a) proton], 1.70 (s, NH proton), 1.43 (s, CH3 proton). 13C NMR (CDCl3, 500 MHz): δ 201.73 (C=O), 140.41, 135.41, 134.67, 133.93 (aromatic ipso carbon atoms), 130.55–128.04 (aromatic carbon atoms), 71.31 (C-3 carbon), 68.92 (C-2 carbon), 60.54 (C-6 carbon), 45.24 (C-5 carbon), 21.92 (methyl carbon).
6. Refinement
Crystal data, data collection and structure refinement details are summarized in Table 4
. In (I)
, all H atoms were placed in their calculated positions and then refined using a riding model with bond lengths of 0.95 or 1.0 Å (CH), 0.99 Å (CH2), 0.98 Å (CH3) or 0.83 Å (NH). In (II)
and (III)
, atom H1 was located in a difference map and refined isotropically. Isotropic displacement parameters for all these atoms in (I)
, (II)
and (III)
were set to 1.2 (CH, CH2) or 1.5 (CH3) times Ueq of the parent atom. Idealized methyl groups were refined as rotating groups. The refinement for (III)
showed some parameter oscillation, and convergence was achieved with the use of a DAMP card.
| | (I) | (II) | (III) | | Crystal data | | Chemical formula | C18H18ClNO | C20H22ClNO | C18H16Cl3NO | | Mr | 299.78 | 327.83 | 368.67 | | Crystal system, space group | Triclinic, P![[\overline{1}] Mathematical equation](teximages/hb7647fi1.gif) | Orthorhombic, Pna21 | Orthorhombic, Pna21 | | Temperature (K) | 173 | 173 | 173 | | a, b, c (Å) | 6.7150 (6), 10.9591 (13), 11.1704 (10) | 13.0578 (2), 22.6513 (4), 5.93756 (8) | 13.2430 (4), 22.3945 (6), 5.81947 (14) | | α, β, γ (°) | 72.162 (9), 79.721 (7), 76.873 (8) | 90, 90, 90 | 90, 90, 90 | | V (Å3) | 756.80 (14) | 1756.19 (5) | 1725.88 (8) | | Z | 2 | 4 | 4 | | Radiation type | Cu Kα | Cu Kα | Cu Kα | | μ (mm−1) | 2.21 | 1.94 | 4.83 | | Crystal size (mm) | 0.26 × 0.22 × 0.06 | 0.32 × 0.18 × 0.08 | 0.34 × 0.14 × 0.14 | | | | Data collection | | Diffractometer | Rigaku Oxford Diffraction | Agilent Xcalibur, Eos, Gemini | Agilent Xcalibur, Eos, Gemini | | Absorption correction | Multi-scan CrysAlis PRO (Agilent, 2014 ) | Multi-scan CrysAlis PRO (Agilent, 2014 ) | Multi-scan CrysAlis PRO (Agilent, 2014 ) | | Tmin, Tmax | 0.609, 1.000 | 0.724, 1.000 | 0.646, 1.000 | | No. of measured, independent and observed [I > 2σ(I)] reflections | 4920, 2847, 2456 | 11595, 2966, 2873 | 12474, 2602, 2494 | | Rint | 0.030 | 0.050 | 0.033 | | (sin θ/λ)max (Å−1) | 0.615 | 0.615 | 0.615 | | | | Refinement | | R[F2 > 2σ(F2)], wR(F2), S | 0.057, 0.168, 1.05 | 0.034, 0.087, 1.07 | 0.032, 0.084, 1.02 | | No. of reflections | 2847 | 2966 | 2602 | | No. of parameters | 195 | 214 | 212 | | No. of restraints | 0 | 1 | 1 | | H-atom treatment | H atoms treated by a mixture of independent and constrained refinement | H atoms treated by a mixture of independent and constrained refinement | H atoms treated by a mixture of independent and constrained refinement | | Δρmax, Δρmin (e Å−3) | 0.68, −0.29 | 0.24, −0.21 | 0.45, −0.23 | | Absolute structure | – | Flack x determined using 1017 quotients [(I+)−(I−)]/[(I+)+(I−)] (Parsons et al., 2013 ) | Flack x determined using 695 quotients [(I+)−(I−)]/[(I+)+(I−)] (Parsons et al., 2013 ) | | Absolute structure parameter | – | −0.010 (13) | 0.135 (13) | Computer programs: CrysAlis PRO (Agilent, 2014 ), SHELXT (Sheldrick, 2015a ), SHELXL (Sheldrick, 2015b ) and OLEX2 (Dolomanov et al., 2009 ). | |
Supporting information
For all compounds, data collection: CrysAlis PRO (Agilent, 2014); cell refinement: CrysAlis PRO (Agilent, 2014); data reduction: CrysAlis PRO (Agilent, 2014); program(s) used to solve structure: SHELXT (Sheldrick, 2015a); program(s) used to refine structure: SHELXL (Sheldrick, 2015b); molecular graphics: OLEX2 (Dolomanov et al., 2009); software used to prepare material for publication: OLEX2 (Dolomanov et al., 2009).
(I) 3-Chloro-3-methyl-
r-2,
c-6-diphenylpiperidin-4-one
top Crystal data top | C18H18ClNO | Z = 2 |
| Mr = 299.78 | F(000) = 316 |
| Triclinic, P1 | Dx = 1.316 Mg m−3 |
| a = 6.7150 (6) Å | Cu Kα radiation, λ = 1.54184 Å |
| b = 10.9591 (13) Å | Cell parameters from 1924 reflections |
| c = 11.1704 (10) Å | θ = 4.2–71.4° |
| α = 72.162 (9)° | µ = 2.21 mm−1 |
| β = 79.721 (7)° | T = 173 K |
| γ = 76.873 (8)° | Plate, colourless |
| V = 756.80 (14) Å3 | 0.26 × 0.22 × 0.06 mm |
Data collection top Rigaku Oxford Diffraction diffractometer | 2847 independent reflections |
| Radiation source: Enhance (Cu) X-ray Source | 2456 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.030 |
| Detector resolution: 16.0416 pixels mm-1 | θmax = 71.6°, θmin = 4.2° |
| ω scans | h = −5→8 |
Absorption correction: multi-scan CrysAlisPro (Agilent, 2014) | k = −13→12 |
| Tmin = 0.609, Tmax = 1.000 | l = −13→13 |
| 4920 measured reflections | |
Refinement top | Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Hydrogen site location: mixed |
| R[F2 > 2σ(F2)] = 0.057 | H atoms treated by a mixture of independent and constrained refinement |
| wR(F2) = 0.168 | w = 1/[σ2(Fo2) + (0.1016P)2 + 0.3319P] where P = (Fo2 + 2Fc2)/3 |
| S = 1.05 | (Δ/σ)max < 0.001 |
| 2847 reflections | Δρmax = 0.68 e Å−3 |
| 195 parameters | Δρmin = −0.29 e Å−3 |
| 0 restraints | |
Special details top Geometry. All esds (except the esd in the dihedral angle between two l.s. planes) are estimated using the full covariance matrix. The cell esds are taken into account individually in the estimation of esds in distances, angles and torsion angles; correlations between esds in cell parameters are only used when they are defined by crystal symmetry. An approximate (isotropic) treatment of cell esds is used for estimating esds involving l.s. planes. |
Fractional atomic coordinates and isotropic or equivalent isotropic displacement parameters (Å2) top| | x | y | z | Uiso*/Ueq | |
| Cl1 | 0.84481 (9) | 0.47065 (6) | 0.39680 (5) | 0.0398 (2) | |
| O1 | 1.0539 (3) | 0.6618 (2) | 0.10828 (18) | 0.0419 (5) | |
| N1 | 0.4811 (3) | 0.6045 (2) | 0.2321 (2) | 0.0317 (4) | |
| H1 | 0.366 (5) | 0.597 (3) | 0.221 (3) | 0.030 (7)* | |
| C1 | 0.8931 (4) | 0.6412 (3) | 0.1735 (2) | 0.0329 (5) | |
| C2 | 0.8483 (3) | 0.5027 (2) | 0.2271 (2) | 0.0305 (5) | |
| C3 | 0.6344 (3) | 0.5032 (2) | 0.1920 (2) | 0.0301 (5) | |
| H3 | 0.6451 | 0.5259 | 0.0976 | 0.036* | |
| C4 | 0.5174 (4) | 0.7368 (2) | 0.1683 (2) | 0.0330 (5) | |
| H4 | 0.5264 | 0.7524 | 0.0747 | 0.040* | |
| C5 | 0.7243 (4) | 0.7487 (2) | 0.2022 (2) | 0.0357 (5) | |
| H5A | 0.7597 | 0.8344 | 0.1527 | 0.043* | |
| H5B | 0.7110 | 0.7434 | 0.2932 | 0.043* | |
| C6 | 0.5636 (3) | 0.3733 (2) | 0.2443 (2) | 0.0307 (5) | |
| C7 | 0.5880 (4) | 0.2906 (3) | 0.1680 (2) | 0.0355 (5) | |
| H7 | 0.6524 | 0.3150 | 0.0834 | 0.043* | |
| C8 | 0.5196 (4) | 0.1733 (3) | 0.2141 (3) | 0.0432 (6) | |
| H8 | 0.5352 | 0.1183 | 0.1605 | 0.052* | |
| C9 | 0.4285 (4) | 0.1354 (3) | 0.3377 (3) | 0.0448 (6) | |
| H9 | 0.3834 | 0.0541 | 0.3696 | 0.054* | |
| C10 | 0.4040 (4) | 0.2172 (3) | 0.4142 (3) | 0.0441 (6) | |
| H10 | 0.3422 | 0.1915 | 0.4993 | 0.053* | |
| C11 | 0.4687 (4) | 0.3364 (3) | 0.3680 (2) | 0.0371 (5) | |
| H11 | 0.4483 | 0.3928 | 0.4207 | 0.044* | |
| C12 | 0.3394 (4) | 0.8335 (2) | 0.2104 (2) | 0.0335 (5) | |
| C13 | 0.2480 (4) | 0.9433 (3) | 0.1241 (3) | 0.0422 (6) | |
| H13 | 0.2997 | 0.9597 | 0.0368 | 0.051* | |
| C14 | 0.0817 (5) | 1.0298 (3) | 0.1631 (3) | 0.0479 (7) | |
| H14 | 0.0217 | 1.1054 | 0.1031 | 0.057* | |
| C15 | 0.0041 (4) | 1.0049 (3) | 0.2902 (3) | 0.0463 (7) | |
| H15 | −0.1102 | 1.0630 | 0.3176 | 0.056* | |
| C16 | 0.0935 (4) | 0.8953 (3) | 0.3769 (3) | 0.0446 (6) | |
| H16 | 0.0405 | 0.8783 | 0.4640 | 0.053* | |
| C17 | 0.2606 (4) | 0.8099 (3) | 0.3375 (2) | 0.0379 (6) | |
| H17 | 0.3214 | 0.7349 | 0.3977 | 0.045* | |
| C18 | 1.0159 (4) | 0.4010 (3) | 0.1837 (3) | 0.0369 (5) | |
| H18A | 1.1507 | 0.4128 | 0.1957 | 0.055* | |
| H18B | 1.0120 | 0.4111 | 0.0938 | 0.055* | |
| H18C | 0.9931 | 0.3136 | 0.2335 | 0.055* | |
Atomic displacement parameters (Å2) top| | U11 | U22 | U33 | U12 | U13 | U23 |
| Cl1 | 0.0387 (4) | 0.0523 (4) | 0.0297 (3) | −0.0089 (3) | −0.0114 (2) | −0.0087 (3) |
| O1 | 0.0284 (9) | 0.0543 (11) | 0.0436 (10) | −0.0149 (8) | 0.0023 (7) | −0.0132 (8) |
| N1 | 0.0201 (9) | 0.0363 (11) | 0.0398 (11) | −0.0026 (8) | −0.0084 (8) | −0.0110 (8) |
| C1 | 0.0272 (11) | 0.0446 (13) | 0.0297 (11) | −0.0073 (10) | −0.0107 (9) | −0.0098 (10) |
| C2 | 0.0235 (11) | 0.0418 (13) | 0.0261 (10) | −0.0037 (9) | −0.0071 (8) | −0.0087 (9) |
| C3 | 0.0233 (10) | 0.0382 (12) | 0.0292 (11) | −0.0037 (9) | −0.0087 (8) | −0.0083 (9) |
| C4 | 0.0286 (11) | 0.0374 (12) | 0.0330 (12) | −0.0035 (9) | −0.0077 (9) | −0.0094 (9) |
| C5 | 0.0309 (12) | 0.0384 (13) | 0.0397 (13) | −0.0097 (10) | −0.0037 (10) | −0.0114 (10) |
| C6 | 0.0206 (10) | 0.0384 (12) | 0.0347 (12) | −0.0022 (9) | −0.0090 (9) | −0.0115 (10) |
| C7 | 0.0250 (11) | 0.0434 (13) | 0.0395 (13) | −0.0024 (9) | −0.0065 (9) | −0.0146 (11) |
| C8 | 0.0356 (13) | 0.0429 (14) | 0.0568 (16) | −0.0010 (11) | −0.0131 (12) | −0.0223 (12) |
| C9 | 0.0362 (13) | 0.0405 (14) | 0.0582 (17) | −0.0109 (11) | −0.0142 (12) | −0.0069 (12) |
| C10 | 0.0397 (14) | 0.0519 (16) | 0.0413 (14) | −0.0172 (12) | −0.0058 (11) | −0.0069 (12) |
| C11 | 0.0324 (12) | 0.0452 (14) | 0.0358 (12) | −0.0106 (10) | −0.0039 (10) | −0.0120 (10) |
| C12 | 0.0273 (11) | 0.0379 (12) | 0.0377 (12) | −0.0069 (10) | −0.0071 (9) | −0.0113 (10) |
| C13 | 0.0419 (14) | 0.0427 (14) | 0.0406 (14) | −0.0041 (11) | −0.0101 (11) | −0.0093 (11) |
| C14 | 0.0411 (14) | 0.0416 (14) | 0.0591 (17) | 0.0059 (11) | −0.0187 (13) | −0.0139 (13) |
| C15 | 0.0321 (13) | 0.0481 (15) | 0.0619 (18) | 0.0014 (11) | −0.0083 (12) | −0.0246 (13) |
| C16 | 0.0360 (13) | 0.0525 (16) | 0.0468 (15) | −0.0072 (12) | −0.0004 (11) | −0.0192 (13) |
| C17 | 0.0328 (12) | 0.0407 (13) | 0.0381 (13) | −0.0037 (10) | −0.0055 (10) | −0.0095 (10) |
| C18 | 0.0265 (11) | 0.0431 (13) | 0.0427 (13) | −0.0021 (10) | −0.0075 (10) | −0.0151 (11) |
Geometric parameters (Å, º) top | Cl1—C2 | 1.816 (2) | C8—C9 | 1.384 (4) |
| O1—C1 | 1.215 (3) | C9—H9 | 0.9500 |
| N1—H1 | 0.83 (3) | C9—C10 | 1.383 (4) |
| N1—C3 | 1.454 (3) | C10—H10 | 0.9500 |
| N1—C4 | 1.461 (3) | C10—C11 | 1.388 (4) |
| C1—C2 | 1.529 (4) | C11—H11 | 0.9500 |
| C1—C5 | 1.507 (3) | C12—C13 | 1.385 (4) |
| C2—C3 | 1.553 (3) | C12—C17 | 1.389 (4) |
| C2—C18 | 1.520 (3) | C13—H13 | 0.9500 |
| C3—H3 | 1.0000 | C13—C14 | 1.391 (4) |
| C3—C6 | 1.515 (3) | C14—H14 | 0.9500 |
| C4—H4 | 1.0000 | C14—C15 | 1.388 (4) |
| C4—C5 | 1.546 (3) | C15—H15 | 0.9500 |
| C4—C12 | 1.517 (3) | C15—C16 | 1.381 (4) |
| C5—H5A | 0.9900 | C16—H16 | 0.9500 |
| C5—H5B | 0.9900 | C16—C17 | 1.389 (4) |
| C6—C7 | 1.389 (3) | C17—H17 | 0.9500 |
| C6—C11 | 1.393 (3) | C18—H18A | 0.9800 |
| C7—H7 | 0.9500 | C18—H18B | 0.9800 |
| C7—C8 | 1.381 (4) | C18—H18C | 0.9800 |
| C8—H8 | 0.9500 | | |
| | | |
| C3—N1—H1 | 109 (2) | C7—C8—H8 | 119.8 |
| C3—N1—C4 | 114.13 (19) | C7—C8—C9 | 120.5 (3) |
| C4—N1—H1 | 110 (2) | C9—C8—H8 | 119.8 |
| O1—C1—C2 | 121.0 (2) | C8—C9—H9 | 120.4 |
| O1—C1—C5 | 122.8 (2) | C10—C9—C8 | 119.3 (3) |
| C5—C1—C2 | 116.2 (2) | C10—C9—H9 | 120.4 |
| C1—C2—Cl1 | 103.69 (15) | C9—C10—H10 | 119.7 |
| C1—C2—C3 | 108.02 (19) | C9—C10—C11 | 120.7 (3) |
| C3—C2—Cl1 | 111.52 (16) | C11—C10—H10 | 119.7 |
| C18—C2—Cl1 | 107.95 (16) | C6—C11—H11 | 120.0 |
| C18—C2—C1 | 113.27 (19) | C10—C11—C6 | 119.9 (2) |
| C18—C2—C3 | 112.11 (19) | C10—C11—H11 | 120.0 |
| N1—C3—C2 | 109.95 (19) | C13—C12—C4 | 121.4 (2) |
| N1—C3—H3 | 107.4 | C13—C12—C17 | 118.8 (2) |
| N1—C3—C6 | 110.15 (18) | C17—C12—C4 | 119.7 (2) |
| C2—C3—H3 | 107.4 | C12—C13—H13 | 119.5 |
| C6—C3—C2 | 114.24 (19) | C12—C13—C14 | 121.0 (3) |
| C6—C3—H3 | 107.4 | C14—C13—H13 | 119.5 |
| N1—C4—H4 | 109.3 | C13—C14—H14 | 120.2 |
| N1—C4—C5 | 108.10 (19) | C15—C14—C13 | 119.5 (3) |
| N1—C4—C12 | 109.07 (19) | C15—C14—H14 | 120.2 |
| C5—C4—H4 | 109.3 | C14—C15—H15 | 120.1 |
| C12—C4—H4 | 109.3 | C16—C15—C14 | 119.9 (3) |
| C12—C4—C5 | 111.7 (2) | C16—C15—H15 | 120.1 |
| C1—C5—C4 | 110.3 (2) | C15—C16—H16 | 119.8 |
| C1—C5—H5A | 109.6 | C15—C16—C17 | 120.3 (3) |
| C1—C5—H5B | 109.6 | C17—C16—H16 | 119.8 |
| C4—C5—H5A | 109.6 | C12—C17—H17 | 119.8 |
| C4—C5—H5B | 109.6 | C16—C17—C12 | 120.4 (3) |
| H5A—C5—H5B | 108.1 | C16—C17—H17 | 119.8 |
| C7—C6—C3 | 120.2 (2) | C2—C18—H18A | 109.5 |
| C7—C6—C11 | 119.1 (2) | C2—C18—H18B | 109.5 |
| C11—C6—C3 | 120.7 (2) | C2—C18—H18C | 109.5 |
| C6—C7—H7 | 119.7 | H18A—C18—H18B | 109.5 |
| C8—C7—C6 | 120.5 (2) | H18A—C18—H18C | 109.5 |
| C8—C7—H7 | 119.7 | H18B—C18—H18C | 109.5 |
| | | |
| Cl1—C2—C3—N1 | 60.5 (2) | C4—C12—C13—C14 | 178.5 (2) |
| Cl1—C2—C3—C6 | −63.9 (2) | C4—C12—C17—C16 | −177.9 (2) |
| O1—C1—C2—Cl1 | 113.3 (2) | C5—C1—C2—Cl1 | −69.0 (2) |
| O1—C1—C2—C3 | −128.2 (2) | C5—C1—C2—C3 | 49.4 (3) |
| O1—C1—C2—C18 | −3.4 (3) | C5—C1—C2—C18 | 174.2 (2) |
| O1—C1—C5—C4 | 127.1 (2) | C5—C4—C12—C13 | 105.9 (3) |
| N1—C3—C6—C7 | 137.0 (2) | C5—C4—C12—C17 | −76.4 (3) |
| N1—C3—C6—C11 | −41.4 (3) | C6—C7—C8—C9 | −1.0 (4) |
| N1—C4—C5—C1 | 53.2 (3) | C7—C6—C11—C10 | 1.3 (4) |
| N1—C4—C12—C13 | −134.6 (2) | C7—C8—C9—C10 | 0.9 (4) |
| N1—C4—C12—C17 | 43.1 (3) | C8—C9—C10—C11 | 0.3 (4) |
| C1—C2—C3—N1 | −52.8 (2) | C9—C10—C11—C6 | −1.4 (4) |
| C1—C2—C3—C6 | −177.23 (19) | C11—C6—C7—C8 | −0.1 (3) |
| C2—C1—C5—C4 | −50.6 (3) | C12—C4—C5—C1 | 173.2 (2) |
| C2—C3—C6—C7 | −98.7 (2) | C12—C13—C14—C15 | −0.9 (4) |
| C2—C3—C6—C11 | 82.9 (3) | C13—C12—C17—C16 | −0.2 (4) |
| C3—N1—C4—C5 | −62.7 (2) | C13—C14—C15—C16 | 0.6 (4) |
| C3—N1—C4—C12 | 175.60 (18) | C14—C15—C16—C17 | −0.1 (4) |
| C3—C6—C7—C8 | −178.5 (2) | C15—C16—C17—C12 | −0.1 (4) |
| C3—C6—C11—C10 | 179.7 (2) | C17—C12—C13—C14 | 0.7 (4) |
| C4—N1—C3—C2 | 63.7 (2) | C18—C2—C3—N1 | −178.29 (19) |
| C4—N1—C3—C6 | −169.51 (18) | C18—C2—C3—C6 | 57.3 (3) |
Hydrogen-bond geometry (Å, º) top| Cg2 and Cg3 are the centroids of the C6–C11 and C12–C17 rings, respectively. |
| D—H···A | D—H | H···A | D···A | D—H···A |
| N1—H1···O1i | 0.83 (3) | 2.49 (3) | 3.257 (3) | 154 (3) |
| C9—H9···Cg3ii | 0.95 | 2.97 | 3.662 (3) | 131 |
| C15—H15···Cg2iii | 0.96 | 2.98 | 3.861 (3) | 155 |
| C18—H18A···Cg2iv | 0.98 | 2.73 | 3.497 (3) | 136 |
| Symmetry codes: (i) x−1, y, z; (ii) x, y−1, z; (iii) x−1, y+1, z; (iv) x+1, y, z. |
(II) 3-Chloro-3-methyl-
r-2,
c-6-di-
p-tolylpiperidin-4-one
top Crystal data top | C20H22ClNO | Dx = 1.240 Mg m−3 |
| Mr = 327.83 | Cu Kα radiation, λ = 1.54184 Å |
| Orthorhombic, Pna21 | Cell parameters from 5659 reflections |
| a = 13.0578 (2) Å | θ = 3.9–71.5° |
| b = 22.6513 (4) Å | µ = 1.94 mm−1 |
| c = 5.93756 (8) Å | T = 173 K |
| V = 1756.19 (5) Å3 | , colourless |
| Z = 4 | 0.32 × 0.18 × 0.08 mm |
| F(000) = 696 | |
Data collection top Agilent Xcalibur, Eos, Gemini diffractometer | 2966 independent reflections |
| Radiation source: Enhance (Cu) X-ray Source | 2873 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.050 |
| Detector resolution: 16.0416 pixels mm-1 | θmax = 71.4°, θmin = 3.9° |
| ω scans | h = −15→15 |
Absorption correction: multi-scan CrysAlisPro (Agilent, 2014) | k = −24→27 |
| Tmin = 0.724, Tmax = 1.000 | l = −6→7 |
| 11595 measured reflections | |
Refinement top | Refinement on F2 | Hydrogen site location: mixed |
| Least-squares matrix: full | H atoms treated by a mixture of independent and constrained refinement |
| R[F2 > 2σ(F2)] = 0.034 | w = 1/[σ2(Fo2) + (0.0522P)2 + 0.1354P] where P = (Fo2 + 2Fc2)/3 |
| wR(F2) = 0.087 | (Δ/σ)max = 0.001 |
| S = 1.07 | Δρmax = 0.24 e Å−3 |
| 2966 reflections | Δρmin = −0.21 e Å−3 |
| 214 parameters | Absolute structure: Flack x determined using 1017 quotients [(I+)-(I-)]/[(I+)+(I-)] (Parsons et al., 2013) |
| 1 restraint | Absolute structure parameter: −0.010 (13) |
Special details top Geometry. All esds (except the esd in the dihedral angle between two l.s. planes) are estimated using the full covariance matrix. The cell esds are taken into account individually in the estimation of esds in distances, angles and torsion angles; correlations between esds in cell parameters are only used when they are defined by crystal symmetry. An approximate (isotropic) treatment of cell esds is used for estimating esds involving l.s. planes. |
Fractional atomic coordinates and isotropic or equivalent isotropic displacement parameters (Å2) top| | x | y | z | Uiso*/Ueq | |
| Cl1 | 0.54670 (4) | 0.77906 (3) | 0.75415 (12) | 0.04218 (17) | |
| O1 | 0.43096 (11) | 0.75024 (7) | 0.2382 (4) | 0.0378 (4) | |
| N1 | 0.71897 (14) | 0.72611 (7) | 0.4371 (4) | 0.0287 (4) | |
| H1 | 0.784 (3) | 0.7255 (12) | 0.419 (6) | 0.034* | |
| C1 | 0.50913 (16) | 0.74057 (10) | 0.3414 (4) | 0.0310 (4) | |
| C2 | 0.56797 (16) | 0.79142 (10) | 0.4558 (4) | 0.0300 (4) | |
| C3 | 0.68295 (15) | 0.78608 (8) | 0.3965 (4) | 0.0269 (4) | |
| H3 | 0.6902 | 0.7941 | 0.2317 | 0.032* | |
| C4 | 0.66920 (16) | 0.68266 (9) | 0.2913 (4) | 0.0303 (5) | |
| H4 | 0.6745 | 0.6960 | 0.1312 | 0.036* | |
| C5 | 0.55566 (16) | 0.68040 (10) | 0.3595 (5) | 0.0384 (6) | |
| H5A | 0.5185 | 0.6526 | 0.2600 | 0.046* | |
| H5B | 0.5496 | 0.6659 | 0.5163 | 0.046* | |
| C6 | 0.75100 (15) | 0.82967 (9) | 0.5206 (4) | 0.0276 (4) | |
| C7 | 0.77498 (16) | 0.88426 (9) | 0.4254 (4) | 0.0313 (4) | |
| H7 | 0.7474 | 0.8945 | 0.2826 | 0.038* | |
| C8 | 0.83845 (17) | 0.92371 (9) | 0.5363 (4) | 0.0337 (5) | |
| H8 | 0.8530 | 0.9609 | 0.4694 | 0.040* | |
| C9 | 0.88100 (14) | 0.90983 (9) | 0.7432 (5) | 0.0338 (5) | |
| C10 | 0.85823 (18) | 0.85499 (10) | 0.8368 (4) | 0.0336 (5) | |
| H10 | 0.8873 | 0.8444 | 0.9778 | 0.040* | |
| C11 | 0.79398 (15) | 0.81549 (9) | 0.7278 (4) | 0.0306 (4) | |
| H11 | 0.7792 | 0.7784 | 0.7953 | 0.037* | |
| C12 | 0.72266 (16) | 0.62377 (9) | 0.3163 (4) | 0.0309 (5) | |
| C13 | 0.77964 (18) | 0.60043 (11) | 0.1403 (5) | 0.0370 (5) | |
| H13 | 0.7821 | 0.6205 | −0.0001 | 0.044* | |
| C14 | 0.83321 (19) | 0.54782 (11) | 0.1675 (5) | 0.0403 (6) | |
| H14 | 0.8717 | 0.5325 | 0.0449 | 0.048* | |
| C15 | 0.83168 (18) | 0.51738 (10) | 0.3687 (5) | 0.0374 (5) | |
| C16 | 0.7745 (2) | 0.54068 (11) | 0.5437 (5) | 0.0424 (6) | |
| H16 | 0.7719 | 0.5203 | 0.6835 | 0.051* | |
| C17 | 0.7208 (2) | 0.59322 (10) | 0.5193 (5) | 0.0388 (5) | |
| H17 | 0.6825 | 0.6084 | 0.6424 | 0.047* | |
| C18 | 0.52313 (18) | 0.85084 (10) | 0.3942 (5) | 0.0409 (6) | |
| H18A | 0.4509 | 0.8521 | 0.4390 | 0.061* | |
| H18B | 0.5285 | 0.8568 | 0.2311 | 0.061* | |
| H18C | 0.5609 | 0.8821 | 0.4725 | 0.061* | |
| C19 | 0.9515 (2) | 0.95208 (12) | 0.8652 (6) | 0.0476 (7) | |
| H19A | 1.0201 | 0.9500 | 0.7986 | 0.071* | |
| H19B | 0.9552 | 0.9412 | 1.0248 | 0.071* | |
| H19C | 0.9250 | 0.9924 | 0.8513 | 0.071* | |
| C20 | 0.8889 (2) | 0.46004 (11) | 0.3978 (6) | 0.0486 (7) | |
| H20A | 0.8438 | 0.4270 | 0.3588 | 0.073* | |
| H20B | 0.9111 | 0.4561 | 0.5547 | 0.073* | |
| H20C | 0.9489 | 0.4597 | 0.2987 | 0.073* | |
Atomic displacement parameters (Å2) top| | U11 | U22 | U33 | U12 | U13 | U23 |
| Cl1 | 0.0344 (3) | 0.0598 (3) | 0.0323 (3) | −0.0046 (2) | 0.0068 (3) | −0.0043 (3) |
| O1 | 0.0232 (7) | 0.0479 (8) | 0.0423 (10) | 0.0006 (6) | −0.0037 (8) | −0.0050 (9) |
| N1 | 0.0199 (8) | 0.0283 (9) | 0.0380 (11) | −0.0017 (6) | 0.0002 (8) | −0.0030 (7) |
| C1 | 0.0205 (9) | 0.0392 (11) | 0.0334 (11) | −0.0025 (8) | 0.0030 (8) | −0.0007 (9) |
| C2 | 0.0254 (9) | 0.0353 (10) | 0.0294 (11) | 0.0014 (8) | 0.0011 (9) | −0.0015 (9) |
| C3 | 0.0233 (9) | 0.0293 (9) | 0.0281 (12) | −0.0024 (7) | 0.0014 (8) | −0.0005 (8) |
| C4 | 0.0291 (9) | 0.0285 (9) | 0.0333 (13) | −0.0022 (8) | −0.0022 (8) | −0.0017 (8) |
| C5 | 0.0271 (11) | 0.0334 (11) | 0.0548 (16) | −0.0071 (8) | −0.0067 (10) | −0.0025 (11) |
| C6 | 0.0222 (9) | 0.0275 (9) | 0.0332 (11) | −0.0001 (7) | 0.0012 (8) | −0.0019 (9) |
| C7 | 0.0294 (10) | 0.0313 (10) | 0.0333 (12) | 0.0007 (8) | 0.0011 (9) | 0.0033 (9) |
| C8 | 0.0308 (10) | 0.0264 (9) | 0.0439 (14) | −0.0020 (8) | 0.0056 (9) | 0.0001 (9) |
| C9 | 0.0252 (9) | 0.0317 (9) | 0.0445 (13) | −0.0017 (7) | 0.0030 (11) | −0.0086 (10) |
| C10 | 0.0308 (10) | 0.0352 (10) | 0.0347 (11) | 0.0008 (8) | −0.0046 (9) | −0.0016 (9) |
| C11 | 0.0294 (9) | 0.0275 (9) | 0.0350 (12) | −0.0011 (7) | −0.0007 (9) | 0.0012 (9) |
| C12 | 0.0291 (10) | 0.0288 (9) | 0.0347 (13) | −0.0037 (8) | −0.0046 (8) | −0.0040 (8) |
| C13 | 0.0375 (12) | 0.0398 (12) | 0.0336 (13) | 0.0007 (9) | −0.0012 (10) | −0.0021 (10) |
| C14 | 0.0371 (12) | 0.0412 (12) | 0.0427 (15) | 0.0034 (10) | 0.0001 (10) | −0.0104 (10) |
| C15 | 0.0328 (10) | 0.0311 (10) | 0.0483 (15) | −0.0024 (9) | −0.0098 (10) | −0.0062 (10) |
| C16 | 0.0504 (14) | 0.0366 (12) | 0.0401 (14) | 0.0000 (10) | −0.0024 (11) | 0.0040 (10) |
| C17 | 0.0433 (12) | 0.0368 (11) | 0.0363 (13) | 0.0025 (9) | 0.0039 (10) | −0.0025 (10) |
| C18 | 0.0307 (10) | 0.0357 (11) | 0.0561 (17) | 0.0036 (9) | −0.0063 (11) | −0.0037 (11) |
| C19 | 0.0439 (13) | 0.0416 (13) | 0.0573 (18) | −0.0119 (10) | −0.0041 (12) | −0.0113 (13) |
| C20 | 0.0452 (13) | 0.0371 (12) | 0.0634 (19) | 0.0069 (10) | −0.0101 (13) | −0.0063 (12) |
Geometric parameters (Å, º) top | Cl1—C2 | 1.815 (3) | C10—H10 | 0.9500 |
| O1—C1 | 1.211 (3) | C10—C11 | 1.387 (3) |
| N1—H1 | 0.85 (3) | C11—H11 | 0.9500 |
| N1—C3 | 1.458 (3) | C12—C13 | 1.388 (3) |
| N1—C4 | 1.463 (3) | C12—C17 | 1.390 (4) |
| C1—C2 | 1.542 (3) | C13—H13 | 0.9500 |
| C1—C5 | 1.496 (3) | C13—C14 | 1.391 (3) |
| C2—C3 | 1.547 (3) | C14—H14 | 0.9500 |
| C2—C18 | 1.513 (3) | C14—C15 | 1.379 (4) |
| C3—H3 | 1.0000 | C15—C16 | 1.385 (4) |
| C3—C6 | 1.519 (3) | C15—C20 | 1.508 (3) |
| C4—H4 | 1.0000 | C16—H16 | 0.9500 |
| C4—C5 | 1.538 (3) | C16—C17 | 1.389 (4) |
| C4—C12 | 1.513 (3) | C17—H17 | 0.9500 |
| C5—H5A | 0.9900 | C18—H18A | 0.9800 |
| C5—H5B | 0.9900 | C18—H18B | 0.9800 |
| C6—C7 | 1.395 (3) | C18—H18C | 0.9800 |
| C6—C11 | 1.390 (3) | C19—H19A | 0.9800 |
| C7—H7 | 0.9500 | C19—H19B | 0.9800 |
| C7—C8 | 1.385 (3) | C19—H19C | 0.9800 |
| C8—H8 | 0.9500 | C20—H20A | 0.9800 |
| C8—C9 | 1.384 (4) | C20—H20B | 0.9800 |
| C9—C10 | 1.393 (3) | C20—H20C | 0.9800 |
| C9—C19 | 1.513 (3) | | |
| | | |
| C3—N1—H1 | 108.3 (18) | C9—C10—H10 | 119.4 |
| C3—N1—C4 | 112.70 (18) | C11—C10—C9 | 121.2 (2) |
| C4—N1—H1 | 111 (2) | C11—C10—H10 | 119.4 |
| O1—C1—C2 | 120.5 (2) | C6—C11—H11 | 119.7 |
| O1—C1—C5 | 122.9 (2) | C10—C11—C6 | 120.5 (2) |
| C5—C1—C2 | 116.51 (19) | C10—C11—H11 | 119.7 |
| C1—C2—Cl1 | 103.80 (15) | C13—C12—C4 | 120.6 (2) |
| C1—C2—C3 | 108.96 (17) | C13—C12—C17 | 118.2 (2) |
| C3—C2—Cl1 | 111.02 (16) | C17—C12—C4 | 121.1 (2) |
| C18—C2—Cl1 | 108.31 (18) | C12—C13—H13 | 119.7 |
| C18—C2—C1 | 111.42 (19) | C12—C13—C14 | 120.6 (2) |
| C18—C2—C3 | 112.96 (19) | C14—C13—H13 | 119.7 |
| N1—C3—C2 | 110.39 (17) | C13—C14—H14 | 119.3 |
| N1—C3—H3 | 107.5 | C15—C14—C13 | 121.4 (2) |
| N1—C3—C6 | 109.69 (17) | C15—C14—H14 | 119.3 |
| C2—C3—H3 | 107.5 | C14—C15—C16 | 117.9 (2) |
| C6—C3—C2 | 114.00 (17) | C14—C15—C20 | 121.5 (3) |
| C6—C3—H3 | 107.5 | C16—C15—C20 | 120.6 (3) |
| N1—C4—H4 | 109.1 | C15—C16—H16 | 119.3 |
| N1—C4—C5 | 107.14 (18) | C15—C16—C17 | 121.4 (3) |
| N1—C4—C12 | 109.27 (18) | C17—C16—H16 | 119.3 |
| C5—C4—H4 | 109.1 | C12—C17—H17 | 119.7 |
| C12—C4—H4 | 109.1 | C16—C17—C12 | 120.6 (3) |
| C12—C4—C5 | 112.94 (18) | C16—C17—H17 | 119.7 |
| C1—C5—C4 | 110.02 (18) | C2—C18—H18A | 109.5 |
| C1—C5—H5A | 109.7 | C2—C18—H18B | 109.5 |
| C1—C5—H5B | 109.7 | C2—C18—H18C | 109.5 |
| C4—C5—H5A | 109.7 | H18A—C18—H18B | 109.5 |
| C4—C5—H5B | 109.7 | H18A—C18—H18C | 109.5 |
| H5A—C5—H5B | 108.2 | H18B—C18—H18C | 109.5 |
| C7—C6—C3 | 120.7 (2) | C9—C19—H19A | 109.5 |
| C11—C6—C3 | 121.01 (19) | C9—C19—H19B | 109.5 |
| C11—C6—C7 | 118.2 (2) | C9—C19—H19C | 109.5 |
| C6—C7—H7 | 119.6 | H19A—C19—H19B | 109.5 |
| C8—C7—C6 | 120.9 (2) | H19A—C19—H19C | 109.5 |
| C8—C7—H7 | 119.6 | H19B—C19—H19C | 109.5 |
| C7—C8—H8 | 119.5 | C15—C20—H20A | 109.5 |
| C9—C8—C7 | 121.0 (2) | C15—C20—H20B | 109.5 |
| C9—C8—H8 | 119.5 | C15—C20—H20C | 109.5 |
| C8—C9—C10 | 118.1 (2) | H20A—C20—H20B | 109.5 |
| C8—C9—C19 | 121.7 (2) | H20A—C20—H20C | 109.5 |
| C10—C9—C19 | 120.2 (3) | H20B—C20—H20C | 109.5 |
| | | |
| Cl1—C2—C3—N1 | 64.2 (2) | C5—C1—C2—Cl1 | −72.9 (2) |
| Cl1—C2—C3—C6 | −59.8 (2) | C5—C1—C2—C3 | 45.4 (3) |
| O1—C1—C2—Cl1 | 109.0 (2) | C5—C1—C2—C18 | 170.7 (2) |
| O1—C1—C2—C3 | −132.7 (2) | C5—C4—C12—C13 | 129.5 (2) |
| O1—C1—C2—C18 | −7.4 (3) | C5—C4—C12—C17 | −54.1 (3) |
| O1—C1—C5—C4 | 128.2 (2) | C6—C7—C8—C9 | 0.9 (3) |
| N1—C3—C6—C7 | 143.2 (2) | C7—C6—C11—C10 | 0.5 (3) |
| N1—C3—C6—C11 | −34.4 (3) | C7—C8—C9—C10 | 0.1 (3) |
| N1—C4—C5—C1 | 56.9 (3) | C7—C8—C9—C19 | 179.2 (2) |
| N1—C4—C12—C13 | −111.4 (2) | C8—C9—C10—C11 | −0.7 (3) |
| N1—C4—C12—C17 | 65.1 (3) | C9—C10—C11—C6 | 0.4 (3) |
| C1—C2—C3—N1 | −49.5 (3) | C11—C6—C7—C8 | −1.1 (3) |
| C1—C2—C3—C6 | −173.48 (19) | C12—C4—C5—C1 | 177.2 (2) |
| C2—C1—C5—C4 | −49.9 (3) | C12—C13—C14—C15 | −0.1 (4) |
| C2—C3—C6—C7 | −92.4 (2) | C13—C12—C17—C16 | −0.2 (4) |
| C2—C3—C6—C11 | 89.9 (2) | C13—C14—C15—C16 | 0.3 (4) |
| C3—N1—C4—C5 | −66.6 (2) | C13—C14—C15—C20 | 179.4 (2) |
| C3—N1—C4—C12 | 170.74 (18) | C14—C15—C16—C17 | −0.5 (4) |
| C3—C6—C7—C8 | −178.9 (2) | C15—C16—C17—C12 | 0.4 (4) |
| C3—C6—C11—C10 | 178.2 (2) | C17—C12—C13—C14 | 0.0 (3) |
| C4—N1—C3—C2 | 64.0 (2) | C18—C2—C3—N1 | −173.9 (2) |
| C4—N1—C3—C6 | −169.52 (18) | C18—C2—C3—C6 | 62.1 (3) |
| C4—C12—C13—C14 | 176.6 (2) | C19—C9—C10—C11 | −179.9 (2) |
| C4—C12—C17—C16 | −176.7 (2) | C20—C15—C16—C17 | −179.6 (2) |
Hydrogen-bond geometry (Å, º) top| Cg2 and Cg3 are the centroids of the C6–C11 and C12–C17 rings, respectively. |
| D—H···A | D—H | H···A | D···A | D—H···A |
| N1—H1···O1i | 0.85 (3) | 2.27 (3) | 3.057 (2) | 154 (3) |
| C18—H18A···Cg3ii | 0.98 | 2.92 | 3.686 (3) | 135 |
| C20—H20A···Cg2iii | 0.97 | 2.81 | 3.724 (3) | 156 |
| Symmetry codes: (i) x+1/2, −y+3/2, z; (ii) −x−1/2, y+3/2, z+1/2; (iii) x+3/2, −y−1/2, z−1. |
(III) 3-Chloro-3-methyl-
r-2,
c-6-bis(4-chlorophenyl)piperidin-4-one
top Crystal data top | C18H16Cl3NO | Dx = 1.419 Mg m−3 |
| Mr = 368.67 | Cu Kα radiation, λ = 1.54184 Å |
| Orthorhombic, Pna21 | Cell parameters from 5579 reflections |
| a = 13.2430 (4) Å | θ = 3.9–71.2° |
| b = 22.3945 (6) Å | µ = 4.83 mm−1 |
| c = 5.81947 (14) Å | T = 173 K |
| V = 1725.88 (8) Å3 | Prism, colourless |
| Z = 4 | 0.34 × 0.14 × 0.14 mm |
| F(000) = 760 | |
Data collection top Agilent Xcalibur, Eos, Gemini diffractometer | 2602 independent reflections |
| Radiation source: Enhance (Cu) X-ray Source | 2494 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.033 |
| Detector resolution: 16.0416 pixels mm-1 | θmax = 71.4°, θmin = 3.9° |
| ω scans | h = −16→15 |
Absorption correction: multi-scan CrysAlisPro (Agilent, 2014) | k = −27→27 |
| Tmin = 0.646, Tmax = 1.000 | l = −7→4 |
| 12474 measured reflections | |
Refinement top | Refinement on F2 | Hydrogen site location: mixed |
| Least-squares matrix: full | H atoms treated by a mixture of independent and constrained refinement |
| R[F2 > 2σ(F2)] = 0.032 | w = 1/[σ2(Fo2) + (0.0469P)2 + 0.6568P] where P = (Fo2 + 2Fc2)/3 |
| wR(F2) = 0.084 | (Δ/σ)max = 0.001 |
| S = 1.02 | Δρmax = 0.45 e Å−3 |
| 2602 reflections | Δρmin = −0.23 e Å−3 |
| 212 parameters | Absolute structure: Flack x determined using 695 quotients [(I+)-(I-)]/[(I+)+(I-)] (Parsons et al., 2013) |
| 1 restraint | Absolute structure parameter: 0.135 (13) |
Special details top Geometry. All esds (except the esd in the dihedral angle between two l.s. planes) are estimated using the full covariance matrix. The cell esds are taken into account individually in the estimation of esds in distances, angles and torsion angles; correlations between esds in cell parameters are only used when they are defined by crystal symmetry. An approximate (isotropic) treatment of cell esds is used for estimating esds involving l.s. planes. |
Fractional atomic coordinates and isotropic or equivalent isotropic displacement parameters (Å2) top| | x | y | z | Uiso*/Ueq | |
| Cl1 | 0.45288 (4) | 0.77767 (3) | 0.75233 (13) | 0.04111 (16) | |
| Cl2 | 0.03876 (5) | 0.95332 (3) | 0.88033 (17) | 0.05145 (19) | |
| Cl3 | 0.10150 (6) | 0.45148 (3) | 0.38178 (19) | 0.0578 (2) | |
| O1 | 0.57167 (12) | 0.74818 (9) | 0.2363 (4) | 0.0363 (4) | |
| N1 | 0.28424 (14) | 0.72489 (9) | 0.4198 (4) | 0.0288 (5) | |
| H1 | 0.228 (2) | 0.7238 (12) | 0.413 (6) | 0.035* | |
| C1 | 0.49247 (17) | 0.73891 (11) | 0.3332 (5) | 0.0294 (6) | |
| C2 | 0.43340 (17) | 0.79041 (11) | 0.4461 (5) | 0.0277 (5) | |
| C3 | 0.32060 (17) | 0.78557 (9) | 0.3839 (5) | 0.0261 (5) | |
| H3 | 0.3143 | 0.7944 | 0.2161 | 0.031* | |
| C4 | 0.33396 (17) | 0.68095 (10) | 0.2728 (5) | 0.0291 (5) | |
| H4 | 0.3302 | 0.6946 | 0.1095 | 0.035* | |
| C5 | 0.44518 (17) | 0.67810 (12) | 0.3470 (6) | 0.0364 (6) | |
| H5A | 0.4497 | 0.6630 | 0.5066 | 0.044* | |
| H5B | 0.4823 | 0.6501 | 0.2460 | 0.044* | |
| C6 | 0.25273 (17) | 0.82914 (10) | 0.5104 (5) | 0.0260 (5) | |
| C7 | 0.22816 (18) | 0.88418 (11) | 0.4167 (5) | 0.0303 (6) | |
| H7 | 0.2565 | 0.8955 | 0.2733 | 0.036* | |
| C8 | 0.1631 (2) | 0.92294 (11) | 0.5281 (5) | 0.0335 (6) | |
| H8 | 0.1467 | 0.9606 | 0.4625 | 0.040* | |
| C9 | 0.12236 (17) | 0.90591 (11) | 0.7364 (6) | 0.0336 (6) | |
| C10 | 0.14495 (18) | 0.85140 (11) | 0.8344 (5) | 0.0321 (6) | |
| H10 | 0.1161 | 0.8402 | 0.9776 | 0.039* | |
| C11 | 0.21035 (17) | 0.81329 (11) | 0.7205 (5) | 0.0303 (6) | |
| H11 | 0.2265 | 0.7757 | 0.7869 | 0.036* | |
| C12 | 0.27945 (18) | 0.62177 (11) | 0.2956 (5) | 0.0312 (6) | |
| C13 | 0.2849 (2) | 0.58865 (14) | 0.4970 (6) | 0.0445 (7) | |
| H13 | 0.3268 | 0.6021 | 0.6190 | 0.053* | |
| C14 | 0.2303 (3) | 0.53636 (14) | 0.5229 (7) | 0.0471 (8) | |
| H14 | 0.2346 | 0.5140 | 0.6613 | 0.057* | |
| C15 | 0.1701 (2) | 0.51733 (11) | 0.3470 (6) | 0.0402 (7) | |
| C16 | 0.1625 (2) | 0.54859 (14) | 0.1446 (6) | 0.0420 (7) | |
| H16 | 0.1206 | 0.5347 | 0.0235 | 0.050* | |
| C17 | 0.2180 (2) | 0.60143 (13) | 0.1208 (6) | 0.0384 (7) | |
| H17 | 0.2133 | 0.6236 | −0.0179 | 0.046* | |
| C18 | 0.47925 (19) | 0.85094 (11) | 0.3858 (6) | 0.0356 (6) | |
| H18A | 0.4427 | 0.8825 | 0.4675 | 0.053* | |
| H18B | 0.4740 | 0.8576 | 0.2198 | 0.053* | |
| H18C | 0.5505 | 0.8516 | 0.4313 | 0.053* | |
Atomic displacement parameters (Å2) top| | U11 | U22 | U33 | U12 | U13 | U23 |
| Cl1 | 0.0355 (3) | 0.0587 (4) | 0.0292 (3) | 0.0045 (3) | −0.0049 (3) | −0.0023 (3) |
| Cl2 | 0.0479 (3) | 0.0469 (3) | 0.0596 (5) | 0.0179 (3) | 0.0108 (4) | −0.0101 (4) |
| Cl3 | 0.0598 (4) | 0.0405 (3) | 0.0732 (5) | −0.0189 (3) | 0.0166 (4) | −0.0065 (4) |
| O1 | 0.0232 (7) | 0.0470 (9) | 0.0388 (10) | −0.0017 (7) | 0.0030 (9) | −0.0059 (11) |
| N1 | 0.0196 (8) | 0.0281 (9) | 0.0386 (13) | 0.0013 (7) | 0.0008 (9) | −0.0027 (10) |
| C1 | 0.0220 (10) | 0.0378 (12) | 0.0286 (13) | 0.0045 (9) | −0.0038 (10) | −0.0023 (11) |
| C2 | 0.0252 (10) | 0.0342 (11) | 0.0235 (12) | 0.0000 (9) | 0.0010 (10) | −0.0018 (10) |
| C3 | 0.0267 (10) | 0.0265 (10) | 0.0252 (13) | 0.0012 (8) | −0.0026 (10) | 0.0008 (11) |
| C4 | 0.0305 (10) | 0.0251 (10) | 0.0318 (14) | 0.0010 (9) | 0.0013 (11) | −0.0013 (11) |
| C5 | 0.0260 (11) | 0.0354 (12) | 0.0478 (16) | 0.0062 (9) | 0.0070 (12) | −0.0021 (13) |
| C6 | 0.0219 (9) | 0.0280 (11) | 0.0282 (12) | −0.0016 (9) | −0.0020 (9) | −0.0018 (11) |
| C7 | 0.0311 (11) | 0.0279 (11) | 0.0318 (14) | 0.0007 (9) | 0.0013 (10) | 0.0001 (11) |
| C8 | 0.0337 (12) | 0.0262 (11) | 0.0406 (16) | 0.0047 (10) | −0.0027 (12) | 0.0011 (12) |
| C9 | 0.0270 (10) | 0.0320 (12) | 0.0418 (15) | 0.0038 (9) | −0.0016 (12) | −0.0085 (13) |
| C10 | 0.0287 (11) | 0.0375 (13) | 0.0302 (14) | 0.0001 (9) | 0.0051 (10) | −0.0018 (12) |
| C11 | 0.0286 (10) | 0.0282 (11) | 0.0340 (15) | 0.0019 (9) | 0.0021 (11) | 0.0020 (11) |
| C12 | 0.0309 (11) | 0.0270 (11) | 0.0357 (16) | 0.0027 (9) | 0.0047 (10) | −0.0018 (11) |
| C13 | 0.0550 (16) | 0.0411 (15) | 0.0375 (17) | −0.0085 (13) | −0.0069 (14) | 0.0021 (14) |
| C14 | 0.0615 (18) | 0.0365 (14) | 0.0434 (18) | −0.0062 (13) | −0.0018 (16) | 0.0052 (15) |
| C15 | 0.0383 (12) | 0.0304 (12) | 0.0519 (17) | −0.0028 (10) | 0.0133 (13) | −0.0090 (13) |
| C16 | 0.0382 (13) | 0.0431 (15) | 0.0446 (17) | −0.0045 (12) | 0.0007 (13) | −0.0089 (13) |
| C17 | 0.0387 (13) | 0.0385 (14) | 0.0379 (16) | −0.0017 (11) | −0.0008 (13) | 0.0004 (13) |
| C18 | 0.0297 (11) | 0.0321 (11) | 0.0449 (16) | −0.0036 (9) | 0.0045 (12) | −0.0012 (14) |
Geometric parameters (Å, º) top | Cl1—C2 | 1.823 (3) | C7—C8 | 1.385 (4) |
| Cl2—C9 | 1.748 (3) | C8—H8 | 0.9500 |
| Cl3—C15 | 1.744 (3) | C8—C9 | 1.380 (4) |
| O1—C1 | 1.209 (3) | C9—C10 | 1.380 (4) |
| N1—H1 | 0.74 (3) | C10—H10 | 0.9500 |
| N1—C3 | 1.457 (3) | C10—C11 | 1.385 (4) |
| N1—C4 | 1.460 (3) | C11—H11 | 0.9500 |
| C1—C2 | 1.541 (3) | C12—C13 | 1.389 (4) |
| C1—C5 | 1.501 (4) | C12—C17 | 1.380 (4) |
| C2—C3 | 1.541 (3) | C13—H13 | 0.9500 |
| C2—C18 | 1.526 (3) | C13—C14 | 1.384 (4) |
| C3—H3 | 1.0000 | C14—H14 | 0.9500 |
| C3—C6 | 1.517 (3) | C14—C15 | 1.365 (5) |
| C4—H4 | 1.0000 | C15—C16 | 1.374 (5) |
| C4—C5 | 1.536 (3) | C16—H16 | 0.9500 |
| C4—C12 | 1.515 (3) | C16—C17 | 1.400 (4) |
| C5—H5A | 0.9900 | C17—H17 | 0.9500 |
| C5—H5B | 0.9900 | C18—H18A | 0.9800 |
| C6—C7 | 1.386 (3) | C18—H18B | 0.9800 |
| C6—C11 | 1.391 (4) | C18—H18C | 0.9800 |
| C7—H7 | 0.9500 | | |
| | | |
| C3—N1—H1 | 111 (2) | C7—C8—H8 | 120.6 |
| C3—N1—C4 | 113.3 (2) | C9—C8—C7 | 118.7 (2) |
| C4—N1—H1 | 113 (2) | C9—C8—H8 | 120.6 |
| O1—C1—C2 | 120.7 (2) | C8—C9—Cl2 | 120.0 (2) |
| O1—C1—C5 | 122.9 (2) | C10—C9—Cl2 | 118.5 (2) |
| C5—C1—C2 | 116.4 (2) | C10—C9—C8 | 121.5 (2) |
| C1—C2—Cl1 | 103.17 (17) | C9—C10—H10 | 120.6 |
| C1—C2—C3 | 109.8 (2) | C9—C10—C11 | 118.9 (3) |
| C3—C2—Cl1 | 110.85 (17) | C11—C10—H10 | 120.6 |
| C18—C2—Cl1 | 107.91 (19) | C6—C11—H11 | 119.5 |
| C18—C2—C1 | 111.4 (2) | C10—C11—C6 | 121.0 (2) |
| C18—C2—C3 | 113.2 (2) | C10—C11—H11 | 119.5 |
| N1—C3—C2 | 110.62 (19) | C13—C12—C4 | 121.1 (2) |
| N1—C3—H3 | 107.3 | C17—C12—C4 | 120.3 (2) |
| N1—C3—C6 | 109.5 (2) | C17—C12—C13 | 118.5 (2) |
| C2—C3—H3 | 107.3 | C12—C13—H13 | 119.4 |
| C6—C3—C2 | 114.5 (2) | C14—C13—C12 | 121.1 (3) |
| C6—C3—H3 | 107.3 | C14—C13—H13 | 119.4 |
| N1—C4—H4 | 109.1 | C13—C14—H14 | 120.4 |
| N1—C4—C5 | 107.2 (2) | C15—C14—C13 | 119.1 (3) |
| N1—C4—C12 | 108.9 (2) | C15—C14—H14 | 120.4 |
| C5—C4—H4 | 109.1 | C14—C15—Cl3 | 118.7 (3) |
| C12—C4—H4 | 109.1 | C14—C15—C16 | 121.8 (3) |
| C12—C4—C5 | 113.3 (2) | C16—C15—Cl3 | 119.5 (2) |
| C1—C5—C4 | 110.3 (2) | C15—C16—H16 | 120.8 |
| C1—C5—H5A | 109.6 | C15—C16—C17 | 118.5 (3) |
| C1—C5—H5B | 109.6 | C17—C16—H16 | 120.8 |
| C4—C5—H5A | 109.6 | C12—C17—C16 | 121.0 (3) |
| C4—C5—H5B | 109.6 | C12—C17—H17 | 119.5 |
| H5A—C5—H5B | 108.1 | C16—C17—H17 | 119.5 |
| C7—C6—C3 | 121.3 (2) | C2—C18—H18A | 109.5 |
| C7—C6—C11 | 118.5 (2) | C2—C18—H18B | 109.5 |
| C11—C6—C3 | 120.1 (2) | C2—C18—H18C | 109.5 |
| C6—C7—H7 | 119.4 | H18A—C18—H18B | 109.5 |
| C8—C7—C6 | 121.3 (3) | H18A—C18—H18C | 109.5 |
| C8—C7—H7 | 119.4 | H18B—C18—H18C | 109.5 |
| | | |
| Cl1—C2—C3—N1 | −65.4 (2) | C4—C12—C13—C14 | 176.1 (3) |
| Cl1—C2—C3—C6 | 59.0 (2) | C4—C12—C17—C16 | −176.2 (2) |
| Cl2—C9—C10—C11 | 179.4 (2) | C5—C1—C2—Cl1 | 74.3 (2) |
| Cl3—C15—C16—C17 | 179.8 (2) | C5—C1—C2—C3 | −44.0 (3) |
| O1—C1—C2—Cl1 | −106.9 (3) | C5—C1—C2—C18 | −170.2 (2) |
| O1—C1—C2—C3 | 134.8 (3) | C5—C4—C12—C13 | 49.2 (4) |
| O1—C1—C2—C18 | 8.6 (4) | C5—C4—C12—C17 | −134.8 (3) |
| O1—C1—C5—C4 | −129.9 (3) | C6—C7—C8—C9 | 0.0 (4) |
| N1—C3—C6—C7 | −142.0 (2) | C7—C6—C11—C10 | 0.1 (4) |
| N1—C3—C6—C11 | 35.4 (3) | C7—C8—C9—Cl2 | −179.3 (2) |
| N1—C4—C5—C1 | −56.5 (3) | C7—C8—C9—C10 | −0.2 (4) |
| N1—C4—C12—C13 | −69.9 (3) | C8—C9—C10—C11 | 0.3 (4) |
| N1—C4—C12—C17 | 106.0 (3) | C9—C10—C11—C6 | −0.2 (4) |
| C1—C2—C3—N1 | 48.0 (3) | C11—C6—C7—C8 | 0.1 (4) |
| C1—C2—C3—C6 | 172.4 (2) | C12—C4—C5—C1 | −176.6 (2) |
| C2—C1—C5—C4 | 48.9 (3) | C12—C13—C14—C15 | −0.1 (5) |
| C2—C3—C6—C7 | 93.1 (3) | C13—C12—C17—C16 | −0.2 (4) |
| C2—C3—C6—C11 | −89.6 (3) | C13—C14—C15—Cl3 | −179.9 (2) |
| C3—N1—C4—C5 | 66.1 (3) | C13—C14—C15—C16 | 0.2 (5) |
| C3—N1—C4—C12 | −170.9 (2) | C14—C15—C16—C17 | −0.3 (4) |
| C3—C6—C7—C8 | 177.4 (2) | C15—C16—C17—C12 | 0.3 (4) |
| C3—C6—C11—C10 | −177.4 (2) | C17—C12—C13—C14 | 0.1 (4) |
| C4—N1—C3—C2 | −62.9 (3) | C18—C2—C3—N1 | 173.2 (2) |
| C4—N1—C3—C6 | 169.9 (2) | C18—C2—C3—C6 | −62.4 (3) |
Hydrogen-bond geometry (Å, º) top| Cg3 is the centroid of the C12–C17 ring. |
| D—H···A | D—H | H···A | D···A | D—H···A |
| N1—H1···O1i | 0.74 (3) | 2.40 (3) | 3.071 (3) | 151 (3) |
| C10—H10···O1ii | 0.95 | 2.56 | 3.374 (3) | 144 |
| C18—H18C···Cg3iii | 0.98 | 2.98 | 3.725 (3) | 134 |
| Symmetry codes: (i) x−1/2, −y+3/2, z; (ii) x−1/2, −y+3/2, z+1; (iii) −x+1/2, y+3/2, z+1/2. |
Acknowledgements
The authors thank the Sophisticated Analytical Instrument Facility (SAIF), IITM, Chennai, India, for recording the NMR data and extend their thanks to the Principal, Dr P. Kathirvel, Chairman, Mr R. Sattanathan, and Treasurer, Mr T. Ramalingam, of Thiruvalluvar Arts and Science College, Kurinjipadi 607 302, Tamilnadu, India, for giving permission to carry out research work in the Chemistry Laboratory. JPJ acknowledges the NSF–MRI program (grant No. CHE-1039027) for funds to purchase the X-ray diffractometer.
References
Agilent (2014). CrysAlis PRO. Agilent Technologies. Agilent Technologies Ltd, Yarnton, England. Google Scholar
Arulraj, R., Sivakumar, S., Thiruvalluvar, A., Kaur, M. & Jasinski, J. P. (2016). IUCrData, 1, x161580. Google Scholar
Beddoes, R. L., Dalton, L., Joule, T. A., Mills, O. S., Street, J. D. & Watt, C. I. F. (1986). J. Chem. Soc. Perkin Trans. 2, pp. 787–797. CSD CrossRef Web of Science Google Scholar
Dimmock, J. R., Padmanilayam, M. P., Puthucode, R. N., Nazarali, A. J., Motaganahalli, N. L., Zello, G. A., Quail, J. W., Oloo, E. O., Kraatz, H. B., Prisciak, J. S., Allen, T. M., Santos, C. L., Balzarini, J., De Clercq, E. & Manavathu, E. K. (2001). J. Med. Chem. 44, 586–593. Web of Science CSD CrossRef PubMed CAS Google Scholar
Dolomanov, O. V., Bourhis, L. J., Gildea, R. J., Howard, J. A. K. & Puschmann, H. (2009). J. Appl. Cryst. 42, 339–341. Web of Science CrossRef CAS IUCr Journals Google Scholar
Gayathri, P., Ilango, S. S., Ponnuswamy, S., Thiruvalluvar, A. & Butcher, R. J. (2009). Acta Cryst. E65, o2445. Web of Science CSD CrossRef IUCr Journals Google Scholar
Groom, C. R., Bruno, I. J., Lightfoot, M. P. & Ward, S. C. (2016). Acta Cryst. B72, 171–179. Web of Science CSD CrossRef IUCr Journals Google Scholar
Ilango, S. S., Ponnuswamy, S., Gayathri, P., Thiruvalluvar, A. & Butcher, R. J. (2008). Acta Cryst. E64, o2312. Web of Science CSD CrossRef IUCr Journals Google Scholar
Parsons, S., Flack, H. D. & Wagner, T. (2013). Acta Cryst. B69, 249–259. Web of Science CrossRef CAS IUCr Journals Google Scholar
Perumal, R. V., Adiraj, M. & Shanmugapandiyan, P. (2001). Indian Drugs, 38, 156–159. Google Scholar
Sheldrick, G. M. (2015a). Acta Cryst. A71, 3–8. Web of Science CrossRef IUCr Journals Google Scholar
Sheldrick, G. M. (2015b). Acta Cryst. C71, 3–8. Web of Science CrossRef IUCr Journals Google Scholar
Thenmozhi, M., Ponnuswamy, S., Umamaheshwari, J., Jamesh, M. & Ponnuswamy, M. N. (2009). Acta Cryst. E65, o2794. Web of Science CSD CrossRef IUCr Journals Google Scholar
Watson, P. S., Jiang, B. & Scott, B. (2000). Org. Lett. 2, 3679–3681. Web of Science CrossRef PubMed CAS Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.
 | CRYSTALLOGRAPHIC COMMUNICATIONS |
ISSN: 2056-9890
Open

access