
Acta Cryst. (2008). E64, m1177 [ doi:10.1107/S1600536808025890 ]
-Piperazine-1,4-dicarbodithioato-
4S,S':S'',S''')bis[triphenyltin(IV)] dichloromethane solvateThe dinuclear centrosymmetric title compound, [Sn2(C6H5)6(C6H8N2S4)]·CH2Cl2, features a distorted cis-trigonal-bipyramidal coordination geometry for Sn based on a C3S2 donor set. The dinuclear molecule lies across a centre of inversion. The solvent dichloromethane molecule is disordered about a centre of inversion.
The title compound was prepared by following a literature procedure (Yin et al., 2002). Colourless crystals were isolated by the slow evaporation of a dichloromethane solution of (I); m.p. 487–489 K (crystal turned opaque at 363–368 K). TGA: two steps, First mass loss 7.2% (onset 388.3 K, midpoint 392.6 K, endset 396.9 K) corresponds to loss CH2Cl2 (8.2% theoretical). Second mass loss 69.3% (onset 558.5 K, midpoint 620 K, endset 680 K), corresponds to decomposition to SnS (total experimental mass loss 76.5% cf. theoretical value 70.5%). IR (cm-1): 1427, 1416 (strong, C═N), 1214 (strong, C—S).
The H atoms were geometrically placed (C—H = 0.95–0.99 Å) and refined as riding with Uiso(H) = 1.2Ueq(C). The solvent dichloromethane molecule was disordered about a centre of inversion and was modelled with anisotropic displacement parameters.
Data collection: CrystalClear (Rigaku/MSC, 2005); cell refinement: CrystalClear (Rigaku/MSC, 2005); data reduction: CrystalClear (Rigaku/MSC, 2005); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: ORTEPII (Johnson, 1976); software used to prepare material for publication: SHELXL97 (Sheldrick, 2008.
| [Sn2(C6H5)6(C6H8N2S4)]·CH2Cl2 | F000 = 1020 |
| Mr = 1021.37 | Dx = 1.594 Mg m−3 |
| Monoclinic, P21/c | Mo Kα radiation λ = 0.71069 Å |
| Hall symbol: -P 2ybc | Cell parameters from 13756 reflections |
| a = 14.681 (5) Å | θ = 2.4–40.7º |
| b = 10.758 (3) Å | µ = 1.53 mm−1 |
| c = 13.470 (4) Å | T = 98 (2) K |
| β = 90.379 (6)º | Plate, colourless |
| V = 2127.3 (11) Å3 | 0.35 × 0.15 × 0.02 mm |
| Z = 2 |
| Rigaku AFC12κ/SATURN724 diffractometer | 4389 independent reflections |
| Radiation source: fine-focus sealed tube | 4021 reflections with I > 2σ(I) |
| Monochromator: graphite | Rint = 0.048 |
| T = 98(2) K | θmax = 26.5º |
| ω scans | θmin = 2.4º |
| Absorption correction: multi-scan (ABSCOR; Higashi, 1995) | h = −17→18 |
| Tmin = 0.354, Tmax = 1 | k = −13→13 |
| 14400 measured reflections | l = −16→16 |
| Refinement on F2 | Secondary atom site location: difference Fourier map |
| Least-squares matrix: full | Hydrogen site location: inferred from neighbouring sites |
| R[F2 > 2σ(F2)] = 0.048 | H-atom parameters constrained |
| wR(F2) = 0.113 | w = 1/[σ2(Fo2) + (0.04P)2 + 8.4194P] where P = (Fo2 + 2Fc2)/3 |
| S = 1.10 | (Δ/σ)max = 0.001 |
| 4389 reflections | Δρmax = 0.77 e Å−3 |
| 244 parameters | Δρmin = −1.12 e Å−3 |
| Primary atom site location: structure-invariant direct methods | Extinction correction: none |
| [Sn2(C6H5)6(C6H8N2S4)]·CH2Cl2 | V = 2127.3 (11) Å3 |
| Mr = 1021.37 | Z = 2 |
| Monoclinic, P21/c | Mo Kα |
| a = 14.681 (5) Å | µ = 1.53 mm−1 |
| b = 10.758 (3) Å | T = 98 (2) K |
| c = 13.470 (4) Å | 0.35 × 0.15 × 0.02 mm |
| β = 90.379 (6)º |
| Rigaku AFC12κ/SATURN724 diffractometer | 4389 independent reflections |
| Absorption correction: multi-scan (ABSCOR; Higashi, 1995) | 4021 reflections with I > 2σ(I) |
| Tmin = 0.354, Tmax = 1 | Rint = 0.048 |
| 14400 measured reflections |
| R[F2 > 2σ(F2)] = 0.048 | 244 parameters |
| wR(F2) = 0.113 | H-atom parameters constrained |
| S = 1.10 | Δρmax = 0.77 e Å−3 |
| 4389 reflections | Δρmin = −1.12 e Å−3 |
Geometry. All esds (except the esd in the dihedral angle between two l.s. planes) are estimated using the full covariance matrix. The cell esds are taken into account individually in the estimation of esds in distances, angles and torsion angles; correlations between esds in cell parameters are only used when they are defined by crystal symmetry. An approximate (isotropic) treatment of cell esds is used for estimating esds involving l.s. planes. |
Refinement. Refinement of F2 against ALL reflections. The weighted R-factor wR and goodness of fit S are based on F2, conventional R-factors R are based on F, with F set to zero for negative F2. The threshold expression of F2 > 2sigma(F2) is used only for calculating R-factors(gt) etc. and is not relevant to the choice of reflections for refinement. R-factors based on F2 are statistically about twice as large as those based on F, and R- factors based on ALL data will be even larger. |
| x | y | z | Uiso*/Ueq | Occ. (<1) | |
| Sn | 0.23132 (2) | 0.37950 (3) | 0.17164 (2) | 0.02056 (11) | |
| S1 | 0.10733 (8) | 0.32408 (10) | 0.28651 (9) | 0.0237 (3) | |
| S2 | 0.12861 (8) | 0.59723 (11) | 0.26696 (9) | 0.0244 (3) | |
| N1 | 0.0190 (3) | 0.4872 (4) | 0.3970 (3) | 0.0250 (9) | |
| C1 | 0.0795 (3) | 0.4757 (4) | 0.3239 (3) | 0.0228 (9) | |
| C2 | −0.0077 (3) | 0.6087 (4) | 0.4381 (4) | 0.0264 (11) | |
| H2A | −0.0745 | 0.6193 | 0.4320 | 0.032* | |
| H2B | 0.0220 | 0.6761 | 0.4002 | 0.032* | |
| C3 | 0.0208 (3) | 0.6161 (4) | 0.5471 (4) | 0.0260 (10) | |
| H3A | 0.0880 | 0.6128 | 0.5525 | 0.031* | |
| H3B | 0.0001 | 0.6961 | 0.5756 | 0.031* | |
| C4 | 0.2559 (3) | 0.1881 (4) | 0.1326 (3) | 0.0212 (9) | |
| C5 | 0.2678 (3) | 0.1546 (5) | 0.0335 (4) | 0.0238 (10) | |
| H5 | 0.2690 | 0.2174 | −0.0160 | 0.029* | |
| C6 | 0.2780 (3) | 0.0316 (5) | 0.0060 (4) | 0.0284 (11) | |
| H6 | 0.2846 | 0.0103 | −0.0620 | 0.034* | |
| C7 | 0.2785 (3) | −0.0610 (4) | 0.0782 (4) | 0.0284 (11) | |
| H7 | 0.2869 | −0.1453 | 0.0596 | 0.034* | |
| C8 | 0.2666 (4) | −0.0303 (5) | 0.1768 (4) | 0.0320 (12) | |
| H8 | 0.2664 | −0.0936 | 0.2259 | 0.038* | |
| C9 | 0.2549 (3) | 0.0934 (4) | 0.2042 (4) | 0.0270 (10) | |
| H9 | 0.2462 | 0.1139 | 0.2721 | 0.032* | |
| C10 | 0.1869 (3) | 0.4710 (4) | 0.0402 (3) | 0.0231 (10) | |
| C11 | 0.2262 (4) | 0.5821 (5) | 0.0088 (4) | 0.0413 (14) | |
| H11 | 0.2767 | 0.6157 | 0.0442 | 0.050* | |
| C12 | 0.1920 (4) | 0.6440 (5) | −0.0742 (5) | 0.0424 (15) | |
| H12 | 0.2184 | 0.7205 | −0.0944 | 0.051* | |
| C13 | 0.1199 (4) | 0.5948 (4) | −0.1273 (4) | 0.0272 (10) | |
| H13 | 0.0966 | 0.6377 | −0.1836 | 0.033* | |
| C14 | 0.0818 (4) | 0.4841 (5) | −0.0989 (4) | 0.0344 (12) | |
| H14 | 0.0324 | 0.4497 | −0.1356 | 0.041* | |
| C15 | 0.1166 (4) | 0.4223 (5) | −0.0151 (4) | 0.0307 (11) | |
| H15 | 0.0908 | 0.3449 | 0.0038 | 0.037* | |
| C16 | 0.3474 (3) | 0.4550 (4) | 0.2475 (4) | 0.0238 (10) | |
| C17 | 0.4094 (3) | 0.3737 (5) | 0.2921 (4) | 0.0297 (11) | |
| H17 | 0.4011 | 0.2865 | 0.2860 | 0.036* | |
| C18 | 0.4830 (4) | 0.4199 (5) | 0.3453 (4) | 0.0369 (12) | |
| H18 | 0.5247 | 0.3640 | 0.3759 | 0.044* | |
| C19 | 0.4966 (4) | 0.5477 (5) | 0.3543 (4) | 0.0378 (13) | |
| H19 | 0.5475 | 0.5791 | 0.3904 | 0.045* | |
| C20 | 0.4352 (3) | 0.6280 (5) | 0.3103 (4) | 0.0308 (11) | |
| H20 | 0.4439 | 0.7151 | 0.3165 | 0.037* | |
| C21 | 0.3608 (3) | 0.5833 (4) | 0.2570 (4) | 0.0247 (10) | |
| H21 | 0.3191 | 0.6397 | 0.2270 | 0.030* | |
| C22 | 0.5409 (12) | 0.0134 (14) | 0.5721 (11) | 0.066 (4) | 0.50 |
| H22A | 0.6046 | 0.0434 | 0.5764 | 0.080* | 0.50 |
| H22B | 0.5172 | 0.0006 | 0.6400 | 0.080* | 0.50 |
| Cl1 | 0.4667 (2) | 0.1259 (2) | 0.4994 (2) | 0.0958 (9) |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Sn | 0.02652 (19) | 0.01628 (17) | 0.01887 (18) | −0.00089 (12) | −0.00114 (13) | 0.00000 (11) |
| S1 | 0.0281 (6) | 0.0167 (5) | 0.0263 (6) | −0.0002 (4) | 0.0029 (5) | −0.0026 (4) |
| S2 | 0.0294 (6) | 0.0191 (5) | 0.0247 (6) | 0.0000 (5) | 0.0020 (5) | −0.0025 (4) |
| N1 | 0.027 (2) | 0.0180 (19) | 0.030 (2) | 0.0038 (16) | 0.0035 (17) | 0.0006 (16) |
| C1 | 0.024 (2) | 0.023 (2) | 0.021 (2) | 0.0046 (18) | −0.0024 (18) | −0.0055 (18) |
| C2 | 0.025 (2) | 0.019 (2) | 0.035 (3) | 0.0045 (18) | 0.010 (2) | −0.0009 (19) |
| C3 | 0.024 (2) | 0.018 (2) | 0.036 (3) | 0.0017 (18) | 0.007 (2) | −0.001 (2) |
| C4 | 0.026 (2) | 0.015 (2) | 0.023 (2) | 0.0014 (17) | 0.0030 (18) | −0.0032 (17) |
| C5 | 0.024 (2) | 0.027 (2) | 0.021 (2) | 0.0037 (19) | 0.0010 (18) | −0.0005 (19) |
| C6 | 0.032 (3) | 0.030 (3) | 0.023 (3) | 0.001 (2) | −0.001 (2) | −0.008 (2) |
| C7 | 0.029 (3) | 0.018 (2) | 0.038 (3) | −0.0012 (19) | −0.002 (2) | −0.007 (2) |
| C8 | 0.043 (3) | 0.021 (2) | 0.032 (3) | 0.001 (2) | 0.007 (2) | 0.006 (2) |
| C9 | 0.035 (3) | 0.024 (2) | 0.022 (2) | 0.001 (2) | 0.003 (2) | 0.0007 (19) |
| C10 | 0.032 (2) | 0.018 (2) | 0.019 (2) | 0.0025 (18) | 0.0003 (19) | −0.0009 (17) |
| C11 | 0.057 (4) | 0.033 (3) | 0.034 (3) | −0.019 (3) | −0.024 (3) | 0.012 (2) |
| C12 | 0.060 (4) | 0.029 (3) | 0.039 (3) | −0.014 (3) | −0.013 (3) | 0.013 (2) |
| C13 | 0.041 (3) | 0.022 (2) | 0.019 (2) | 0.006 (2) | −0.001 (2) | −0.0006 (19) |
| C14 | 0.039 (3) | 0.029 (3) | 0.035 (3) | −0.004 (2) | −0.016 (2) | 0.002 (2) |
| C15 | 0.038 (3) | 0.024 (2) | 0.030 (3) | −0.007 (2) | −0.009 (2) | 0.003 (2) |
| C16 | 0.018 (2) | 0.027 (2) | 0.026 (3) | −0.0031 (18) | −0.0007 (18) | −0.0023 (19) |
| C17 | 0.028 (3) | 0.031 (3) | 0.030 (3) | 0.001 (2) | −0.004 (2) | 0.001 (2) |
| C18 | 0.029 (3) | 0.036 (3) | 0.045 (3) | 0.002 (2) | −0.006 (2) | 0.004 (3) |
| C19 | 0.032 (3) | 0.040 (3) | 0.041 (3) | −0.011 (2) | −0.005 (2) | −0.005 (3) |
| C20 | 0.026 (3) | 0.032 (3) | 0.034 (3) | −0.009 (2) | −0.002 (2) | −0.003 (2) |
| C21 | 0.023 (2) | 0.023 (2) | 0.027 (3) | −0.0027 (19) | 0.0017 (19) | 0.0021 (19) |
| C22 | 0.102 (12) | 0.050 (8) | 0.048 (9) | 0.001 (8) | 0.023 (8) | 0.001 (7) |
| Cl1 | 0.155 (3) | 0.0477 (11) | 0.0854 (17) | 0.0173 (13) | 0.0274 (17) | 0.0024 (11) |
| Sn—C10 | 2.125 (5) | C10—C15 | 1.373 (7) |
| Sn—C16 | 2.141 (5) | C10—C11 | 1.394 (7) |
| Sn—C4 | 2.157 (4) | C11—C12 | 1.392 (8) |
| Sn—S1 | 2.4699 (13) | C11—H11 | 0.9500 |
| Sn—S2 | 3.0715 (13) | C12—C13 | 1.378 (8) |
| S1—C1 | 1.756 (5) | C12—H12 | 0.9500 |
| S2—C1 | 1.680 (5) | C13—C14 | 1.370 (7) |
| N1—C1 | 1.337 (6) | C13—H13 | 0.9500 |
| N1—C3i | 1.466 (6) | C14—C15 | 1.403 (7) |
| N1—C2 | 1.473 (6) | C14—H14 | 0.9500 |
| C2—C3 | 1.527 (7) | C15—H15 | 0.9500 |
| C2—H2A | 0.9900 | C16—C17 | 1.396 (7) |
| C2—H2B | 0.9900 | C16—C21 | 1.400 (7) |
| C3—N1i | 1.466 (6) | C17—C18 | 1.385 (7) |
| C3—H3A | 0.9900 | C17—H17 | 0.9500 |
| C3—H3B | 0.9900 | C18—C19 | 1.395 (8) |
| C4—C5 | 1.394 (6) | C18—H18 | 0.9500 |
| C4—C9 | 1.403 (7) | C19—C20 | 1.380 (8) |
| C5—C6 | 1.382 (7) | C19—H19 | 0.9500 |
| C5—H5 | 0.9500 | C20—C21 | 1.389 (7) |
| C6—C7 | 1.392 (7) | C20—H20 | 0.9500 |
| C6—H6 | 0.9500 | C21—H21 | 0.9500 |
| C7—C8 | 1.380 (7) | C22—Cl1ii | 1.784 (15) |
| C7—H7 | 0.9500 | C22—Cl1 | 1.896 (16) |
| C8—C9 | 1.392 (7) | C22—H22A | 0.9900 |
| C8—H8 | 0.9500 | C22—H22B | 0.9900 |
| C9—H9 | 0.9500 | Cl1—C22ii | 1.784 (15) |
| C10—Sn—C16 | 117.43 (18) | C8—C9—H9 | 119.7 |
| C10—Sn—C4 | 106.86 (18) | C4—C9—H9 | 119.7 |
| C16—Sn—C4 | 110.16 (18) | C15—C10—C11 | 118.3 (5) |
| C10—Sn—S1 | 114.23 (13) | C15—C10—Sn | 120.1 (4) |
| C16—Sn—S1 | 112.36 (13) | C11—C10—Sn | 121.7 (4) |
| C4—Sn—S1 | 92.74 (12) | C12—C11—C10 | 120.4 (5) |
| C10—Sn—S2 | 81.15 (12) | C12—C11—H11 | 119.8 |
| C16—Sn—S2 | 84.41 (13) | C10—C11—H11 | 119.8 |
| C4—Sn—S2 | 156.03 (12) | C13—C12—C11 | 120.3 (5) |
| S1—Sn—S2 | 63.66 (4) | C13—C12—H12 | 119.9 |
| C1—S1—Sn | 97.41 (16) | C11—C12—H12 | 119.9 |
| C1—S2—Sn | 79.09 (16) | C14—C13—C12 | 120.2 (5) |
| C1—N1—C3i | 125.3 (4) | C14—C13—H13 | 119.9 |
| C1—N1—C2 | 122.6 (4) | C12—C13—H13 | 119.9 |
| C3i—N1—C2 | 111.8 (4) | C13—C14—C15 | 119.3 (5) |
| N1—C1—S2 | 123.6 (4) | C13—C14—H14 | 120.4 |
| N1—C1—S1 | 117.0 (4) | C15—C14—H14 | 120.4 |
| S2—C1—S1 | 119.4 (3) | C10—C15—C14 | 121.6 (5) |
| N1—C2—C3 | 109.6 (4) | C10—C15—H15 | 119.2 |
| N1—C2—H2A | 109.7 | C14—C15—H15 | 119.2 |
| C3—C2—H2A | 109.7 | C17—C16—C21 | 119.2 (5) |
| N1—C2—H2B | 109.7 | C17—C16—Sn | 118.9 (4) |
| C3—C2—H2B | 109.7 | C21—C16—Sn | 121.9 (4) |
| H2A—C2—H2B | 108.2 | C18—C17—C16 | 120.2 (5) |
| N1i—C3—C2 | 110.3 (4) | C18—C17—H17 | 119.9 |
| N1i—C3—H3A | 109.6 | C16—C17—H17 | 119.9 |
| C2—C3—H3A | 109.6 | C17—C18—C19 | 120.6 (5) |
| N1i—C3—H3B | 109.6 | C17—C18—H18 | 119.7 |
| C2—C3—H3B | 109.6 | C19—C18—H18 | 119.7 |
| H3A—C3—H3B | 108.1 | C20—C19—C18 | 119.1 (5) |
| C5—C4—C9 | 118.2 (4) | C20—C19—H19 | 120.4 |
| C5—C4—Sn | 120.2 (3) | C18—C19—H19 | 120.4 |
| C9—C4—Sn | 121.5 (3) | C19—C20—C21 | 121.0 (5) |
| C6—C5—C4 | 121.2 (5) | C19—C20—H20 | 119.5 |
| C6—C5—H5 | 119.4 | C21—C20—H20 | 119.5 |
| C4—C5—H5 | 119.4 | C20—C21—C16 | 119.8 (5) |
| C5—C6—C7 | 119.8 (5) | C20—C21—H21 | 120.1 |
| C5—C6—H6 | 120.1 | C16—C21—H21 | 120.1 |
| C7—C6—H6 | 120.1 | Cl1ii—C22—Cl1 | 102.9 (8) |
| C8—C7—C6 | 120.1 (5) | Cl1ii—C22—H22A | 111.2 |
| C8—C7—H7 | 120.0 | Cl1—C22—H22A | 111.2 |
| C6—C7—H7 | 120.0 | Cl1ii—C22—H22B | 111.2 |
| C7—C8—C9 | 120.0 (5) | Cl1—C22—H22B | 111.2 |
| C7—C8—H8 | 120.0 | H22A—C22—H22B | 109.1 |
| C9—C8—H8 | 120.0 | C22ii—Cl1—C22 | 77.1 (8) |
| C8—C9—C4 | 120.6 (5) | ||
| C10—Sn—S1—C1 | −69.6 (2) | Sn—C4—C9—C8 | 176.9 (4) |
| C16—Sn—S1—C1 | 67.4 (2) | C16—Sn—C10—C15 | 175.8 (4) |
| C4—Sn—S1—C1 | −179.5 (2) | C4—Sn—C10—C15 | 51.5 (4) |
| S2—Sn—S1—C1 | −3.88 (16) | S1—Sn—C10—C15 | −49.5 (4) |
| C10—Sn—S2—C1 | 126.8 (2) | S2—Sn—C10—C15 | −105.3 (4) |
| C16—Sn—S2—C1 | −114.3 (2) | C16—Sn—C10—C11 | −5.6 (5) |
| C4—Sn—S2—C1 | 15.0 (4) | C4—Sn—C10—C11 | −129.8 (5) |
| S1—Sn—S2—C1 | 4.10 (17) | S1—Sn—C10—C11 | 129.2 (4) |
| C3i—N1—C1—S2 | −175.8 (4) | S2—Sn—C10—C11 | 73.4 (4) |
| C2—N1—C1—S2 | −2.8 (7) | C15—C10—C11—C12 | 2.7 (9) |
| C3i—N1—C1—S1 | 4.6 (7) | Sn—C10—C11—C12 | −176.0 (5) |
| C2—N1—C1—S1 | 177.6 (4) | C10—C11—C12—C13 | −1.2 (10) |
| Sn—S2—C1—N1 | 174.5 (4) | C11—C12—C13—C14 | −0.4 (9) |
| Sn—S2—C1—S1 | −5.9 (2) | C12—C13—C14—C15 | 0.5 (8) |
| Sn—S1—C1—N1 | −173.0 (3) | C11—C10—C15—C14 | −2.6 (8) |
| Sn—S1—C1—S2 | 7.3 (3) | Sn—C10—C15—C14 | 176.1 (4) |
| C1—N1—C2—C3 | −116.5 (5) | C13—C14—C15—C10 | 1.1 (8) |
| C3i—N1—C2—C3 | 57.4 (5) | C10—Sn—C16—C17 | −143.2 (4) |
| N1—C2—C3—N1i | −56.4 (5) | C4—Sn—C16—C17 | −20.6 (4) |
| C10—Sn—C4—C5 | 18.7 (4) | S1—Sn—C16—C17 | 81.2 (4) |
| C16—Sn—C4—C5 | −110.0 (4) | S2—Sn—C16—C17 | 139.8 (4) |
| S1—Sn—C4—C5 | 135.0 (4) | C10—Sn—C16—C21 | 39.4 (5) |
| S2—Sn—C4—C5 | 125.3 (3) | C4—Sn—C16—C21 | 162.0 (4) |
| C10—Sn—C4—C9 | −157.4 (4) | S1—Sn—C16—C21 | −96.1 (4) |
| C16—Sn—C4—C9 | 74.0 (4) | S2—Sn—C16—C21 | −37.6 (4) |
| S1—Sn—C4—C9 | −41.1 (4) | C21—C16—C17—C18 | 0.2 (8) |
| S2—Sn—C4—C9 | −50.8 (6) | Sn—C16—C17—C18 | −177.2 (4) |
| C9—C4—C5—C6 | 0.3 (7) | C16—C17—C18—C19 | −0.5 (9) |
| Sn—C4—C5—C6 | −175.9 (4) | C17—C18—C19—C20 | 0.6 (9) |
| C4—C5—C6—C7 | −1.4 (7) | C18—C19—C20—C21 | −0.4 (9) |
| C5—C6—C7—C8 | 1.6 (8) | C19—C20—C21—C16 | 0.0 (8) |
| C6—C7—C8—C9 | −0.5 (8) | C17—C16—C21—C20 | 0.0 (7) |
| C7—C8—C9—C4 | −0.6 (8) | Sn—C16—C21—C20 | 177.4 (4) |
| C5—C4—C9—C8 | 0.7 (7) | Cl1ii—C22—Cl1—C22ii | 0.000 (2) |
| Symmetry codes: (i) −x, −y+1, −z+1; (ii) −x+1, −y, −z+1. |
Addison, A. W., Rao, T. N., Reedijk, J., van Rijn, J. & Verschoor, G. C. (1984). J. Chem. Soc. Dalton Trans. pp. 1349–1356.
Higashi, T. (1995). ABSCOR. Rigaku Corporation, Tokyo, Japan.
Johnson, C. K. (1976). ORTEPII. Report ORNL-5138. Oak Ridge National Laboratory, Tennessee, USA.
Rigaku/MSC (2005). CrystalClear. Rigaku/MSC The Woodlands, Texas, USA.
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122.
Tiekink, E. R. T. (2008). Appl. Organomet. Chem. 22, 553–550.
Yin, H.-D., Ma, C.-L., Wang, Y., Fang, H.-X. & Shao, J.-X. (2002). Chin. J. Chem. 60, 897–903.
Tin dithiocarbamates continue to attract interest owing to their variety of applications (Tiekink, 2008). The title compound, Ph3SnS2CN(CH2CH2)2NCS2SnPh3, has been reported previously as a methanol solvate (Yin et al., 2002). The present structure (I) has been isolated as a dichloromethane solvate, Fig. 1. The molecule is centrosymmetric so that the Ph3Sn entities lie to either side of the pyrrolidine ring which adopts a chair conformation. The dithiocarbamate ligand coordinates in an asymmetric mode, forming Sn—S1 and Sn—S2 distances of 2.4699 (13) and 3.0715 (13) Å, respectively. The coordination geometry is based on a distorted trigonal bipyramid as indicated by the value of τ = 0.64 (Addison et al., 1984).