metal-organic compounds
(Acetonitrile-κN){1,2-bis[bis(pentafluorophenyl)phosphino]ethane-κ2P,P}(η5-pentamethylcyclopentadienyl)ruthenium(II) hexafluorophosphate
aSchool of Chemistry, Queen's University Belfast, David Keir Building, Belfast BT9 5AG, Northern Ireland
*Correspondence e-mail: [email protected]
The cation of the title salt, [Ru(η5-C5Me5)(NCMe){(C6F5)2PCH2CH2P(C6F5)2}]PF6 or [Ru(C10H15)(C26H4F20P2)(C2H3N)]PF6, has contacts with three anions. One lies close to the pentamethylcyclopentadienyl ring, such that three F atoms of the anion are ca 3.5 Å from two of the ring methyl C atoms of the cation and there is one H⋯F distance shorter than the sum of the van der Waals radii.
Comment
Salts of the cation [(η5-C5Me5)RhCl{(C6F5)2PCH2CH2P(C6F5)2}]+ have been found to undergo intramolecular dehydrofluorinative C–C reactions on thermolysis or in the presence of a proton sponge or fluoride, to yield [{η5,κP,κP-C5Me4CH2C6F4-2-P(C6F5)CH2CH2P(C6F5)2}RhCl]+ and then [{η5,κP,κP-C5Me3[CH2C6F4-2-P(C6F5)CH2]-1,3}RhCl]+ (Atherton et al., 1996
; Bellabarba et al., 2001
). The thermolysis is dependent on the solvent and the anion. The reaction for the tetrafluoroborate salt occurs only in polar protic solvents, such as ethanol, whereas for chloride, hexafluorophosphate and tetraphenylborate salts, the reaction also occurs readily in non-polar aprotic solvents, such as benzene (Atherton et al., 1999
).
The structure of [(η5-C5Me5)RhCl{(C6F5)2PCH2CH2P(C6F5)2}]BF4 revealed that a tetrafluoroborate anion is positioned close to the pentamethylcyclopentadienyl ligand, such that three F atoms of the anion form a plane almost parallel (5.1° deviation) to the C5 plane, with a separation between the two planes of ca 3.19 Å. The anion is displaced slightly from the (η5-C5Me5)–Rh axis, giving rise to short F⋯H and F⋯C distances between the anion and the pentamethylcyclopentadienyl ligand of 2.4–2.7 and 3.1–3.3 Å, respectively (Atherton et al., 1996
). A similar positioning of the anion and cation is found in the related salts [(η5-C5Me5)IrCl{(C6F5)2PCH2CH2P(C6F5)2}]BF4 (Atherton et al., 1996
) and [(η5-C5Me5)RhCl{(C6H3F2-2,6)2PCH2CH2P(C6H3F2-2,6)2}]BF4 (Fawcett et al., 1998
). If BF4−⋯C5Me5 interactions are present in aprotic solvents, then the absence of similar anion⋯C5Me5 interactions in the salts of the other anions may provide the basis for an explanation for the difference in reactivity. Of particular relevance is the salt of the hexafluorophosphate anion, which is the most similar to the tetrafluoroborate anion. These two anions comprise a periphery of F atoms, with equilateral triangular faces with edges of ca 2.1–2.3 Å (Allen et al., 1987
; Atherton et al., 1996
; Fawcett et al., 1998
). Unfortunately, crystals suitable for single-crystal X-ray diffraction studies of the non-tetrafluoroborate salts of [(η5-C5Me5)RhCl{(C6F5)2PCH2CH2P(C6F5)2}]+ have been elusive. However, the structure of the title isoelectronic ruthenium salt, [(η5-C5Me5)Ru(NCMe){(C6F5)2PCH2CH2P(C6F5)2}]PF6, (I)
, has now been determined and is presented here.
The structure of (I)
(Fig. 1
) reveals that the hexafluorophosphate anion does not adopt a similar position to that of the tetrafluoroborate anion in [(η5-C5Me5)RhCl{(C6F5)2PCH2CH2P(C6F5)2}]BF4 and [(η5-C5Me5)RhCl{(C6H3F2-2,6)2PCH2CH2P(C6H3F2-2,6)2}]BF4. The cation shows contacts to three anions which are shorter than the sum of the van der Waals radii of the respective atoms. One anion position is close to the pentamethylcyclopentadienyl ligand, such that there is one F⋯H distance shorter than the sum of the van der Waals radii (F36⋯H10C = 2.626 Å). The shortest inter-ion F⋯C(C5Me5) distances are between atoms F34 and C9 [3.493 (6) Å], F36 and C10 [3.564 (7) Å], and F32 and C10 [3.597 (7) Å]. However, for this anion, the shortest inter-ion F⋯C distance of 3.028 (6) Å is between atoms F36 and C2S of the acetonitrile. The distance between atoms C3S and F36 is 3.123 (5) Å, with F36⋯H3S2 = 2.609 Å, and that between atoms C3S and F34 is 3.396 (7) Å, with F34⋯H3S2 = 2.481 Å.
Another anion position gives three short contacts with a C6F5 ring (F32⋯F26B = 2.888 (6) Å, F32⋯C26B = 2.964 (6) Å and F32⋯C25B = 3.110 (6) Å) and a contact with a CH2 H atom (F35⋯H2A2 = 2.633 Å). The third anion position gives a contact with a C6F5 ring (F31⋯C14B = 3.113 (7) Å), a CH2 H atom (F33⋯H1A1 = 2.599 Å) and an acetonitrile H atom (F35⋯H3S1 = 2.428 Å).
| Figure 1 A view of (I) . Displacement ellipsoids are drawn at the 30% probability level. H atoms have been omitted for clarity. |
Experimental
The title complex was obtained from the reaction of [(η5-C5Me5)Ru(NCMe)3]PF6 with (C6F5)2PCH2CH2P(C6F5)2 in dichloromethane (10 ml) gave a yellow–green solution from which a small number of yellow crystals of (I)
were obtained by cooling the reaction mixture to 273 K.
Crystal data
|
Data collection
H atoms were added in idealized positions and a riding model with fixed displacement parameters [Uiso(H) = 1.2Ueq of the parent atom (1.5Ueq for methyl H atoms].
Data collection: SMART (Bruker, 2001
); cell refinement: SAINT (Bruker, 2002
); data reduction: SHELXTL (Bruker, 2001
) and SAINT; program(s) used to solve structure: SHELXS97 (Sheldrick, 1997
); program(s) used to refine structure: SHELXL97 (Sheldrick, 1997
); molecular graphics: SHELXTL; software used to prepare material for publication: SHELXTL.
Supporting information
contains datablocks I, global. DOI: https://doi.org/10.1107/S1600536805020052/wk6052sup1.cif
Structure factors: contains datablock I. DOI: https://doi.org/10.1107/S1600536805020052/wk6052Isup2.hkl
Data collection: SMART (Bruker, 2001); cell SAINT (Bruker, 2002); data reduction: SHELXTL (Bruker, 2001) and SAINT; program(s) used to solve structure: SHELXS97 (Sheldrick, 1997); program(s) used to refine structure: SHELXL97 (Sheldrick, 1997); molecular graphics: SHELXTL; software used to prepare material for publication: SHELXTL.
| [Ru(C10H15)(C26H4F20P2)(C2H3N)]PF6 | F(000) = 2320 |
| Mr = 1180.55 | Dx = 1.874 Mg m−3 |
| Monoclinic, P21/n | Mo Kα radiation, λ = 0.71073 Å |
| a = 12.5380 (9) Å | Cell parameters from 5351 reflections |
| b = 10.6157 (8) Å | θ = 4–50° |
| c = 31.760 (2) Å | µ = 0.64 mm−1 |
| β = 98.062 (2)° | T = 153 K |
| V = 4185.4 (5) Å3 | Needle, red |
| Z = 4 | 0.42 × 0.10 × 0.08 mm |
| Bruker SMART 1000 CCD area-detector diffractometer | 9479 independent reflections |
| Radiation source: fine-focus sealed tube | 5575 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.098 |
| φ and ω scans | θmax = 27.5°, θmin = 1.3° |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | h = −16→16 |
| Tmin = 0.775, Tmax = 0.951 | k = −13→13 |
| 37499 measured reflections | l = −41→40 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.047 | Hydrogen site location: geom and difmap for Me H |
| wR(F2) = 0.109 | H-atom parameters constrained |
| S = 0.94 | w = 1/[σ2(Fo2) + (0.0422P)2] where P = (Fo2 + 2Fc2)/3 |
| 9479 reflections | (Δ/σ)max < 0.001 |
| 627 parameters | Δρmax = 0.67 e Å−3 |
| 0 restraints | Δρmin = −0.83 e Å−3 |
Geometry. All esds (except the esd in the dihedral angle between two l.s. planes) are estimated using the full covariance matrix. The cell esds are taken into account individually in the estimation of esds in distances, angles and torsion angles; correlations between esds in cell parameters are only used when they are defined by crystal symmetry. An approximate (isotropic) treatment of cell esds is used for estimating esds involving l.s. planes. |
Refinement. Refinement of F2 against ALL reflections. The weighted R-factor wR and goodness of fit S are based on F2, conventional R-factors R are based on F, with F set to zero for negative F2. The threshold expression of F2 > 2sigma(F2) is used only for calculating R-factors(gt) etc. and is not relevant to the choice of reflections for R-factors based on F2 are statistically about twice as large as those based on F, and R- factors based on ALL data will be even larger. |
| x | y | z | Uiso*/Ueq | ||
| Ru1 | 0.11895 (3) | 0.13441 (3) | 0.386595 (10) | 0.02476 (9) | |
| C1 | 0.1383 (4) | 0.0814 (4) | 0.45544 (13) | 0.0344 (10) | |
| C2 | 0.0259 (3) | 0.0940 (4) | 0.44016 (13) | 0.0338 (10) | |
| C3 | −0.0011 (3) | 0.0004 (4) | 0.40794 (13) | 0.0334 (10) | |
| C4 | 0.0929 (3) | −0.0680 (4) | 0.40313 (13) | 0.0326 (10) | |
| C5 | 0.1810 (3) | −0.0172 (4) | 0.43183 (13) | 0.0310 (10) | |
| C6 | 0.1987 (4) | 0.1406 (4) | 0.49471 (13) | 0.0426 (11) | |
| H6A | 0.1538 | 0.2057 | 0.5053 | 0.064* | |
| H6B | 0.2653 | 0.1788 | 0.4878 | 0.064* | |
| H6C | 0.2163 | 0.0760 | 0.5166 | 0.064* | |
| C7 | −0.0529 (4) | 0.1709 (4) | 0.46049 (15) | 0.0489 (13) | |
| H7A | −0.0822 | 0.1200 | 0.4819 | 0.073* | |
| H7B | −0.1117 | 0.1981 | 0.4388 | 0.073* | |
| H7C | −0.0164 | 0.2451 | 0.4741 | 0.073* | |
| C8 | −0.1145 (4) | −0.0332 (5) | 0.38813 (15) | 0.0479 (13) | |
| H8A | −0.1122 | −0.0757 | 0.3609 | 0.072* | |
| H8B | −0.1577 | 0.0437 | 0.3834 | 0.072* | |
| H8C | −0.1470 | −0.0895 | 0.4073 | 0.072* | |
| C9 | 0.1016 (4) | −0.1771 (4) | 0.37448 (15) | 0.0471 (13) | |
| H9A | 0.1719 | −0.1755 | 0.3644 | 0.071* | |
| H9B | 0.0444 | −0.1721 | 0.3501 | 0.071* | |
| H9C | 0.0941 | −0.2556 | 0.3901 | 0.071* | |
| C10 | 0.2918 (4) | −0.0755 (4) | 0.43991 (16) | 0.0464 (12) | |
| H10A | 0.2859 | −0.1630 | 0.4491 | 0.070* | |
| H10B | 0.3367 | −0.0279 | 0.4622 | 0.070* | |
| H10C | 0.3247 | −0.0734 | 0.4137 | 0.070* | |
| P1 | 0.01571 (8) | 0.27318 (10) | 0.34249 (3) | 0.0243 (2) | |
| C11A | −0.0839 (3) | 0.3702 (4) | 0.36536 (11) | 0.0253 (8) | |
| C12A | −0.1899 (3) | 0.3329 (4) | 0.36497 (13) | 0.0322 (10) | |
| F12A | −0.22560 (18) | 0.2244 (2) | 0.34630 (8) | 0.0442 (7) | |
| C13A | −0.2644 (3) | 0.4012 (4) | 0.38383 (14) | 0.0368 (11) | |
| F13A | −0.3655 (2) | 0.3605 (3) | 0.38198 (9) | 0.0552 (8) | |
| C14A | −0.2331 (4) | 0.5123 (4) | 0.40430 (14) | 0.0396 (11) | |
| F14A | −0.3026 (2) | 0.5787 (3) | 0.42356 (9) | 0.0577 (8) | |
| C15A | −0.1292 (4) | 0.5530 (4) | 0.40570 (13) | 0.0361 (11) | |
| F15A | −0.0969 (2) | 0.6597 (2) | 0.42586 (9) | 0.0553 (8) | |
| C16A | −0.0572 (3) | 0.4830 (4) | 0.38573 (13) | 0.0305 (10) | |
| F16A | 0.04305 (19) | 0.5298 (2) | 0.38709 (8) | 0.0406 (6) | |
| C11B | −0.0692 (3) | 0.2292 (4) | 0.29221 (12) | 0.0284 (9) | |
| C12B | −0.0825 (3) | 0.1088 (4) | 0.27615 (13) | 0.0314 (10) | |
| F12B | −0.03597 (19) | 0.0094 (2) | 0.29806 (8) | 0.0391 (6) | |
| C13B | −0.1424 (4) | 0.0806 (5) | 0.23738 (14) | 0.0396 (11) | |
| F13B | −0.1493 (2) | −0.0382 (3) | 0.22318 (8) | 0.0530 (7) | |
| C14B | −0.1957 (4) | 0.1761 (5) | 0.21398 (14) | 0.0428 (12) | |
| F14B | −0.2558 (2) | 0.1507 (3) | 0.17677 (8) | 0.0633 (9) | |
| C15B | −0.1852 (3) | 0.2980 (5) | 0.22826 (14) | 0.0396 (11) | |
| F15B | −0.2360 (2) | 0.3917 (3) | 0.20523 (8) | 0.0529 (7) | |
| C16B | −0.1228 (3) | 0.3231 (4) | 0.26627 (13) | 0.0304 (10) | |
| F16B | −0.11495 (18) | 0.4451 (2) | 0.27840 (7) | 0.0378 (6) | |
| C1A | 0.1091 (3) | 0.3770 (4) | 0.31799 (12) | 0.0283 (9) | |
| H1A1 | 0.1290 | 0.3347 | 0.2924 | 0.034* | |
| H1A2 | 0.0708 | 0.4558 | 0.3086 | 0.034* | |
| C2A | 0.2128 (3) | 0.4109 (4) | 0.34770 (12) | 0.0291 (9) | |
| H2A1 | 0.2033 | 0.4932 | 0.3613 | 0.035* | |
| H2A2 | 0.2731 | 0.4190 | 0.3308 | 0.035* | |
| P2 | 0.24670 (8) | 0.28992 (10) | 0.38917 (3) | 0.0261 (2) | |
| C21A | 0.3767 (3) | 0.2212 (4) | 0.38038 (14) | 0.0314 (10) | |
| C22A | 0.4452 (3) | 0.1681 (4) | 0.41375 (15) | 0.0371 (11) | |
| F22A | 0.4254 (2) | 0.1869 (2) | 0.45387 (8) | 0.0457 (7) | |
| C23A | 0.5333 (4) | 0.0951 (4) | 0.40833 (19) | 0.0478 (13) | |
| F23A | 0.5957 (2) | 0.0465 (3) | 0.44162 (11) | 0.0735 (10) | |
| C24A | 0.5545 (4) | 0.0730 (5) | 0.3679 (2) | 0.0575 (16) | |
| F24A | 0.6387 (2) | −0.0004 (3) | 0.36203 (13) | 0.0825 (11) | |
| C25A | 0.4908 (4) | 0.1249 (5) | 0.33344 (18) | 0.0527 (14) | |
| F25A | 0.5121 (2) | 0.1039 (3) | 0.29398 (11) | 0.0774 (10) | |
| C26A | 0.4045 (4) | 0.1966 (4) | 0.34006 (15) | 0.0394 (11) | |
| F26A | 0.3439 (2) | 0.2439 (3) | 0.30516 (8) | 0.0481 (7) | |
| C21B | 0.2839 (3) | 0.4011 (4) | 0.43330 (13) | 0.0311 (10) | |
| C22B | 0.2068 (4) | 0.4407 (4) | 0.45785 (13) | 0.0349 (10) | |
| F22B | 0.1089 (2) | 0.3850 (2) | 0.45389 (8) | 0.0421 (6) | |
| C23B | 0.2221 (4) | 0.5382 (4) | 0.48622 (14) | 0.0423 (12) | |
| F23B | 0.1433 (3) | 0.5716 (3) | 0.50852 (9) | 0.0625 (8) | |
| C24B | 0.3180 (5) | 0.6007 (5) | 0.49196 (15) | 0.0523 (14) | |
| F24B | 0.3349 (3) | 0.6951 (3) | 0.52025 (9) | 0.0691 (9) | |
| C25B | 0.3983 (4) | 0.5671 (4) | 0.46856 (15) | 0.0453 (13) | |
| F25B | 0.4913 (2) | 0.6298 (3) | 0.47281 (9) | 0.0606 (8) | |
| C26B | 0.3801 (4) | 0.4689 (4) | 0.43942 (14) | 0.0356 (11) | |
| F26B | 0.45955 (19) | 0.4423 (2) | 0.41727 (9) | 0.0454 (7) | |
| N1S | 0.1761 (3) | 0.0731 (3) | 0.33285 (10) | 0.0268 (8) | |
| C2S | 0.2011 (3) | 0.0292 (4) | 0.30337 (14) | 0.0310 (10) | |
| C3S | 0.2301 (4) | −0.0259 (5) | 0.26464 (14) | 0.0494 (13) | |
| H3S1 | 0.1680 | −0.0223 | 0.2422 | 0.074* | |
| H3S2 | 0.2515 | −0.1139 | 0.2699 | 0.074* | |
| H3S3 | 0.2902 | 0.0213 | 0.2557 | 0.074* | |
| P3 | 0.40845 (10) | 0.71325 (12) | 0.33113 (4) | 0.0385 (3) | |
| F31 | 0.5311 (2) | 0.7346 (3) | 0.34824 (10) | 0.0687 (9) | |
| F32 | 0.3840 (2) | 0.6759 (3) | 0.37704 (9) | 0.0632 (9) | |
| F33 | 0.4288 (2) | 0.7504 (3) | 0.28423 (9) | 0.0632 (8) | |
| F34 | 0.2840 (2) | 0.6917 (3) | 0.31325 (9) | 0.0564 (8) | |
| F35 | 0.4325 (2) | 0.5692 (3) | 0.32137 (9) | 0.0564 (8) | |
| F36 | 0.3821 (2) | 0.8565 (2) | 0.34084 (9) | 0.0568 (8) |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Ru1 | 0.02723 (18) | 0.02367 (17) | 0.02360 (17) | 0.00175 (15) | 0.00433 (12) | 0.00038 (15) |
| C1 | 0.044 (3) | 0.029 (2) | 0.031 (2) | 0.003 (2) | 0.010 (2) | 0.0092 (19) |
| C2 | 0.039 (3) | 0.035 (3) | 0.031 (2) | 0.004 (2) | 0.015 (2) | 0.0086 (19) |
| C3 | 0.040 (3) | 0.027 (2) | 0.035 (2) | −0.004 (2) | 0.009 (2) | 0.0088 (19) |
| C4 | 0.041 (3) | 0.025 (2) | 0.033 (2) | −0.003 (2) | 0.010 (2) | 0.0072 (19) |
| C5 | 0.040 (3) | 0.023 (2) | 0.031 (2) | 0.0073 (19) | 0.0073 (19) | 0.0087 (18) |
| C6 | 0.057 (3) | 0.040 (3) | 0.030 (2) | 0.006 (2) | 0.006 (2) | 0.005 (2) |
| C7 | 0.057 (3) | 0.047 (3) | 0.049 (3) | 0.010 (2) | 0.027 (3) | 0.015 (2) |
| C8 | 0.041 (3) | 0.052 (3) | 0.052 (3) | −0.011 (2) | 0.010 (2) | 0.010 (3) |
| C9 | 0.066 (3) | 0.025 (2) | 0.052 (3) | −0.007 (2) | 0.013 (3) | −0.003 (2) |
| C10 | 0.048 (3) | 0.041 (3) | 0.048 (3) | 0.010 (2) | 0.002 (2) | 0.012 (2) |
| P1 | 0.0239 (5) | 0.0253 (6) | 0.0234 (5) | 0.0000 (4) | 0.0026 (4) | −0.0004 (4) |
| C11A | 0.031 (2) | 0.025 (2) | 0.0198 (19) | −0.0004 (19) | 0.0047 (16) | 0.0007 (17) |
| C12A | 0.035 (2) | 0.032 (3) | 0.029 (2) | −0.0006 (19) | 0.0029 (19) | 0.0005 (19) |
| F12A | 0.0308 (14) | 0.0447 (16) | 0.0590 (18) | −0.0066 (12) | 0.0125 (12) | −0.0120 (13) |
| C13A | 0.032 (3) | 0.047 (3) | 0.034 (3) | 0.004 (2) | 0.011 (2) | 0.005 (2) |
| F13A | 0.0368 (16) | 0.0644 (19) | 0.069 (2) | 0.0035 (14) | 0.0224 (14) | −0.0053 (16) |
| C14A | 0.051 (3) | 0.040 (3) | 0.031 (2) | 0.021 (2) | 0.017 (2) | 0.005 (2) |
| F14A | 0.0669 (19) | 0.0585 (19) | 0.0531 (18) | 0.0256 (16) | 0.0272 (15) | −0.0024 (15) |
| C15A | 0.054 (3) | 0.027 (2) | 0.028 (2) | 0.007 (2) | 0.006 (2) | −0.0041 (19) |
| F15A | 0.076 (2) | 0.0374 (17) | 0.0552 (18) | 0.0038 (14) | 0.0175 (15) | −0.0154 (13) |
| C16A | 0.034 (2) | 0.027 (2) | 0.030 (2) | 0.0031 (19) | 0.0033 (19) | 0.0042 (18) |
| F16A | 0.0422 (15) | 0.0306 (14) | 0.0495 (16) | −0.0077 (12) | 0.0074 (12) | −0.0119 (12) |
| C11B | 0.025 (2) | 0.035 (2) | 0.025 (2) | −0.0009 (19) | 0.0061 (17) | 0.0017 (19) |
| C12B | 0.027 (2) | 0.035 (3) | 0.033 (2) | −0.0014 (19) | 0.0066 (18) | −0.0035 (19) |
| F12B | 0.0419 (15) | 0.0299 (14) | 0.0446 (15) | −0.0034 (11) | 0.0023 (12) | −0.0075 (12) |
| C13B | 0.037 (3) | 0.045 (3) | 0.037 (3) | −0.009 (2) | 0.007 (2) | −0.018 (2) |
| F13B | 0.0536 (17) | 0.0562 (18) | 0.0483 (17) | −0.0147 (14) | 0.0044 (14) | −0.0241 (14) |
| C14B | 0.036 (3) | 0.063 (3) | 0.027 (2) | −0.006 (2) | −0.005 (2) | −0.011 (2) |
| F14B | 0.0589 (18) | 0.091 (2) | 0.0336 (15) | −0.0083 (17) | −0.0157 (13) | −0.0137 (16) |
| C15B | 0.030 (2) | 0.056 (3) | 0.031 (2) | 0.000 (2) | 0.002 (2) | 0.008 (2) |
| F15B | 0.0505 (17) | 0.071 (2) | 0.0330 (15) | 0.0090 (15) | −0.0099 (12) | 0.0093 (14) |
| C16B | 0.027 (2) | 0.036 (3) | 0.027 (2) | −0.0011 (18) | 0.0010 (18) | −0.0025 (19) |
| F16B | 0.0409 (15) | 0.0375 (15) | 0.0333 (14) | 0.0045 (12) | −0.0008 (11) | 0.0050 (11) |
| C1A | 0.026 (2) | 0.033 (2) | 0.027 (2) | −0.0014 (19) | 0.0031 (17) | −0.0009 (19) |
| C2A | 0.025 (2) | 0.032 (2) | 0.030 (2) | −0.0053 (18) | 0.0023 (17) | 0.0031 (18) |
| P2 | 0.0255 (6) | 0.0279 (6) | 0.0242 (5) | 0.0011 (5) | 0.0006 (4) | −0.0017 (5) |
| C21A | 0.028 (2) | 0.028 (2) | 0.037 (2) | −0.0032 (18) | 0.0010 (19) | −0.0030 (19) |
| C22A | 0.033 (2) | 0.032 (3) | 0.043 (3) | −0.0020 (19) | −0.006 (2) | −0.012 (2) |
| F22A | 0.0494 (16) | 0.0422 (15) | 0.0407 (16) | 0.0090 (13) | −0.0100 (13) | −0.0002 (13) |
| C23A | 0.029 (3) | 0.032 (3) | 0.077 (4) | 0.003 (2) | −0.009 (3) | −0.009 (3) |
| F23A | 0.0492 (18) | 0.0526 (19) | 0.108 (3) | 0.0183 (15) | −0.0249 (18) | −0.0076 (18) |
| C24A | 0.025 (3) | 0.050 (3) | 0.098 (5) | −0.004 (2) | 0.013 (3) | −0.028 (3) |
| F24A | 0.0333 (17) | 0.066 (2) | 0.151 (3) | 0.0068 (15) | 0.0211 (19) | −0.034 (2) |
| C25A | 0.034 (3) | 0.061 (4) | 0.068 (4) | −0.008 (3) | 0.024 (3) | −0.027 (3) |
| F25A | 0.063 (2) | 0.092 (3) | 0.087 (2) | −0.0090 (18) | 0.0463 (18) | −0.037 (2) |
| C26A | 0.033 (3) | 0.046 (3) | 0.040 (3) | −0.006 (2) | 0.008 (2) | −0.010 (2) |
| F26A | 0.0518 (17) | 0.0596 (18) | 0.0351 (15) | −0.0093 (14) | 0.0142 (13) | −0.0070 (13) |
| C21B | 0.038 (3) | 0.024 (2) | 0.030 (2) | 0.0091 (18) | −0.0005 (19) | 0.0008 (18) |
| C22B | 0.048 (3) | 0.031 (3) | 0.025 (2) | 0.003 (2) | 0.001 (2) | 0.0052 (19) |
| F22B | 0.0463 (16) | 0.0408 (16) | 0.0423 (15) | 0.0066 (13) | 0.0167 (12) | −0.0004 (12) |
| C23B | 0.067 (3) | 0.035 (3) | 0.025 (2) | 0.008 (3) | 0.007 (2) | −0.002 (2) |
| F23B | 0.098 (2) | 0.0507 (18) | 0.0421 (17) | 0.0231 (17) | 0.0206 (16) | −0.0075 (14) |
| C24B | 0.085 (4) | 0.035 (3) | 0.031 (3) | 0.009 (3) | −0.013 (3) | −0.007 (2) |
| F24B | 0.120 (3) | 0.0408 (17) | 0.0405 (17) | 0.0050 (18) | −0.0106 (17) | −0.0196 (14) |
| C25B | 0.052 (3) | 0.036 (3) | 0.040 (3) | −0.001 (2) | −0.020 (2) | −0.003 (2) |
| F25B | 0.0635 (19) | 0.0414 (16) | 0.066 (2) | −0.0095 (15) | −0.0272 (15) | −0.0095 (15) |
| C26B | 0.038 (3) | 0.033 (3) | 0.032 (2) | 0.003 (2) | −0.009 (2) | −0.002 (2) |
| F26B | 0.0336 (15) | 0.0391 (16) | 0.0623 (18) | −0.0032 (12) | 0.0020 (13) | −0.0102 (13) |
| N1S | 0.0259 (18) | 0.0254 (19) | 0.0288 (19) | 0.0000 (15) | 0.0032 (15) | −0.0003 (15) |
| C2S | 0.032 (2) | 0.030 (2) | 0.030 (2) | 0.0037 (19) | 0.0029 (19) | 0.0013 (19) |
| C3S | 0.067 (3) | 0.055 (3) | 0.029 (3) | 0.018 (3) | 0.012 (2) | −0.004 (2) |
| P3 | 0.0419 (7) | 0.0380 (7) | 0.0364 (7) | −0.0014 (6) | 0.0082 (5) | −0.0006 (6) |
| F31 | 0.0456 (18) | 0.079 (2) | 0.076 (2) | −0.0089 (16) | −0.0086 (16) | −0.0006 (18) |
| F32 | 0.090 (2) | 0.0595 (19) | 0.0432 (17) | 0.0183 (17) | 0.0217 (16) | 0.0120 (14) |
| F33 | 0.064 (2) | 0.084 (2) | 0.0467 (18) | 0.0111 (17) | 0.0239 (15) | 0.0129 (16) |
| F34 | 0.0431 (17) | 0.0541 (18) | 0.072 (2) | 0.0021 (14) | 0.0070 (14) | −0.0095 (15) |
| F35 | 0.0586 (19) | 0.0450 (17) | 0.065 (2) | 0.0121 (14) | 0.0082 (15) | −0.0106 (15) |
| F36 | 0.078 (2) | 0.0362 (16) | 0.0549 (18) | −0.0010 (15) | 0.0062 (15) | −0.0038 (14) |
| Ru1—N1S | 2.048 (3) | C12B—C13B | 1.382 (6) |
| Ru1—C5 | 2.224 (4) | C13B—F13B | 1.339 (5) |
| Ru1—C2 | 2.235 (4) | C13B—C14B | 1.374 (6) |
| Ru1—C1 | 2.238 (4) | C14B—F14B | 1.337 (5) |
| Ru1—C3 | 2.244 (4) | C14B—C15B | 1.371 (6) |
| Ru1—C4 | 2.247 (4) | C15B—F15B | 1.342 (5) |
| Ru1—P2 | 2.2936 (11) | C15B—C16B | 1.370 (6) |
| Ru1—P1 | 2.3019 (11) | C16B—F16B | 1.351 (5) |
| C1—C2 | 1.432 (6) | C1A—C2A | 1.538 (5) |
| C1—C5 | 1.434 (6) | C1A—H1A1 | 0.9900 |
| C1—C6 | 1.503 (6) | C1A—H1A2 | 0.9900 |
| C2—C3 | 1.433 (6) | C2A—P2 | 1.846 (4) |
| C2—C7 | 1.496 (6) | C2A—H2A1 | 0.9900 |
| C3—C4 | 1.410 (6) | C2A—H2A2 | 0.9900 |
| C3—C8 | 1.515 (6) | P2—C21B | 1.841 (4) |
| C4—C5 | 1.435 (6) | P2—C21A | 1.842 (4) |
| C4—C9 | 1.486 (6) | C21A—C22A | 1.387 (6) |
| C5—C10 | 1.510 (6) | C21A—C26A | 1.398 (6) |
| C6—H6A | 0.9800 | C22A—F22A | 1.347 (5) |
| C6—H6B | 0.9800 | C22A—C23A | 1.380 (6) |
| C6—H6C | 0.9800 | C23A—F23A | 1.328 (5) |
| C7—H7A | 0.9800 | C23A—C24A | 1.367 (7) |
| C7—H7B | 0.9800 | C24A—F24A | 1.347 (5) |
| C7—H7C | 0.9800 | C24A—C25A | 1.377 (8) |
| C8—H8A | 0.9800 | C25A—F25A | 1.336 (6) |
| C8—H8B | 0.9800 | C25A—C26A | 1.363 (6) |
| C8—H8C | 0.9800 | C26A—F26A | 1.349 (5) |
| C9—H9A | 0.9800 | C21B—C22B | 1.389 (6) |
| C9—H9B | 0.9800 | C21B—C26B | 1.395 (6) |
| C9—H9C | 0.9800 | C22B—F22B | 1.352 (5) |
| C10—H10A | 0.9800 | C22B—C23B | 1.368 (6) |
| C10—H10B | 0.9800 | C23B—F23B | 1.341 (5) |
| C10—H10C | 0.9800 | C23B—C24B | 1.363 (7) |
| P1—C11A | 1.844 (4) | C24B—F24B | 1.342 (5) |
| P1—C11B | 1.851 (4) | C24B—C25B | 1.379 (7) |
| P1—C1A | 1.857 (4) | C25B—F25B | 1.333 (5) |
| C11A—C16A | 1.380 (5) | C25B—C26B | 1.391 (6) |
| C11A—C12A | 1.385 (5) | C26B—F26B | 1.328 (5) |
| C12A—F12A | 1.343 (4) | N1S—C2S | 1.129 (5) |
| C12A—C13A | 1.384 (6) | C2S—C3S | 1.453 (6) |
| C13A—F13A | 1.333 (5) | C3S—H3S1 | 0.9800 |
| C13A—C14A | 1.377 (6) | C3S—H3S2 | 0.9800 |
| C14A—F14A | 1.334 (5) | C3S—H3S3 | 0.9800 |
| C14A—C15A | 1.367 (6) | P3—F31 | 1.574 (3) |
| C15A—F15A | 1.335 (5) | P3—F32 | 1.582 (3) |
| C15A—C16A | 1.389 (6) | P3—F36 | 1.595 (3) |
| C16A—F16A | 1.347 (5) | P3—F33 | 1.596 (3) |
| C11B—C12B | 1.378 (6) | P3—F35 | 1.598 (3) |
| C11B—C16B | 1.403 (5) | P3—F34 | 1.600 (3) |
| C12B—F12B | 1.351 (5) | ||
| N1S—Ru1—C5 | 100.19 (14) | F14A—C14A—C13A | 120.5 (4) |
| N1S—Ru1—C2 | 148.71 (15) | C15A—C14A—C13A | 119.6 (4) |
| C5—Ru1—C2 | 62.76 (15) | F15A—C15A—C14A | 120.5 (4) |
| N1S—Ru1—C1 | 137.05 (14) | F15A—C15A—C16A | 120.0 (4) |
| C5—Ru1—C1 | 37.50 (14) | C14A—C15A—C16A | 119.5 (4) |
| C2—Ru1—C1 | 37.33 (15) | F16A—C16A—C11A | 119.9 (4) |
| N1S—Ru1—C3 | 112.23 (14) | F16A—C16A—C15A | 116.8 (4) |
| C5—Ru1—C3 | 62.26 (15) | C11A—C16A—C15A | 123.3 (4) |
| C2—Ru1—C3 | 37.31 (15) | C12B—C11B—C16B | 114.7 (4) |
| C1—Ru1—C3 | 62.03 (16) | C12B—C11B—P1 | 125.4 (3) |
| N1S—Ru1—C4 | 88.30 (14) | C16B—C11B—P1 | 119.8 (3) |
| C5—Ru1—C4 | 37.45 (15) | F12B—C12B—C11B | 120.9 (4) |
| C2—Ru1—C4 | 61.98 (16) | F12B—C12B—C13B | 115.5 (4) |
| C1—Ru1—C4 | 62.01 (16) | C11B—C12B—C13B | 123.6 (4) |
| C3—Ru1—C4 | 36.61 (15) | F13B—C13B—C14B | 120.6 (4) |
| N1S—Ru1—P2 | 86.22 (9) | F13B—C13B—C12B | 120.4 (4) |
| C5—Ru1—P2 | 108.57 (11) | C14B—C13B—C12B | 119.0 (4) |
| C2—Ru1—P2 | 123.19 (12) | F14B—C14B—C15B | 119.9 (4) |
| C1—Ru1—P2 | 99.58 (12) | F14B—C14B—C13B | 120.0 (4) |
| C3—Ru1—P2 | 160.09 (11) | C15B—C14B—C13B | 120.0 (4) |
| C4—Ru1—P2 | 143.49 (11) | F15B—C15B—C16B | 120.3 (4) |
| N1S—Ru1—P1 | 85.92 (9) | F15B—C15B—C14B | 120.2 (4) |
| C5—Ru1—P1 | 166.43 (11) | C16B—C15B—C14B | 119.5 (4) |
| C2—Ru1—P1 | 106.06 (11) | F16B—C16B—C15B | 116.6 (4) |
| C1—Ru1—P1 | 136.89 (11) | F16B—C16B—C11B | 120.3 (3) |
| C3—Ru1—P1 | 104.24 (11) | C15B—C16B—C11B | 123.1 (4) |
| C4—Ru1—P1 | 131.80 (11) | C2A—C1A—P1 | 114.2 (3) |
| P2—Ru1—P1 | 83.77 (4) | C2A—C1A—H1A1 | 108.7 |
| C2—C1—C5 | 108.2 (4) | P1—C1A—H1A1 | 108.7 |
| C2—C1—C6 | 126.8 (4) | C2A—C1A—H1A2 | 108.7 |
| C5—C1—C6 | 123.9 (4) | P1—C1A—H1A2 | 108.7 |
| C2—C1—Ru1 | 71.3 (2) | H1A1—C1A—H1A2 | 107.6 |
| C5—C1—Ru1 | 70.7 (2) | C1A—C2A—P2 | 111.4 (3) |
| C6—C1—Ru1 | 132.8 (3) | C1A—C2A—H2A1 | 109.3 |
| C1—C2—C3 | 107.4 (4) | P2—C2A—H2A1 | 109.3 |
| C1—C2—C7 | 125.7 (4) | C1A—C2A—H2A2 | 109.3 |
| C3—C2—C7 | 125.7 (4) | P2—C2A—H2A2 | 109.3 |
| C1—C2—Ru1 | 71.4 (2) | H2A1—C2A—H2A2 | 108.0 |
| C3—C2—Ru1 | 71.7 (2) | C21B—P2—C21A | 103.55 (19) |
| C7—C2—Ru1 | 132.1 (3) | C21B—P2—C2A | 96.07 (18) |
| C4—C3—C2 | 108.5 (4) | C21A—P2—C2A | 106.68 (19) |
| C4—C3—C8 | 125.7 (4) | C21B—P2—Ru1 | 126.11 (15) |
| C2—C3—C8 | 125.0 (4) | C21A—P2—Ru1 | 109.75 (13) |
| C4—C3—Ru1 | 71.8 (2) | C2A—P2—Ru1 | 112.68 (13) |
| C2—C3—Ru1 | 71.0 (2) | C22A—C21A—C26A | 114.6 (4) |
| C8—C3—Ru1 | 130.9 (3) | C22A—C21A—P2 | 120.8 (3) |
| C3—C4—C5 | 108.5 (4) | C26A—C21A—P2 | 123.5 (3) |
| C3—C4—C9 | 127.0 (4) | F22A—C22A—C23A | 117.3 (4) |
| C5—C4—C9 | 124.5 (4) | F22A—C22A—C21A | 119.1 (4) |
| C3—C4—Ru1 | 71.6 (2) | C23A—C22A—C21A | 123.6 (5) |
| C5—C4—Ru1 | 70.4 (2) | F23A—C23A—C24A | 120.7 (5) |
| C9—C4—Ru1 | 125.2 (3) | F23A—C23A—C22A | 120.7 (5) |
| C1—C5—C4 | 107.2 (4) | C24A—C23A—C22A | 118.5 (5) |
| C1—C5—C10 | 127.8 (4) | F24A—C24A—C23A | 119.3 (5) |
| C4—C5—C10 | 124.2 (4) | F24A—C24A—C25A | 120.0 (5) |
| C1—C5—Ru1 | 71.8 (2) | C23A—C24A—C25A | 120.7 (5) |
| C4—C5—Ru1 | 72.1 (2) | F25A—C25A—C26A | 120.4 (5) |
| C10—C5—Ru1 | 129.5 (3) | F25A—C25A—C24A | 120.6 (5) |
| C1—C6—H6A | 109.5 | C26A—C25A—C24A | 119.0 (5) |
| C1—C6—H6B | 109.5 | F26A—C26A—C25A | 116.6 (4) |
| H6A—C6—H6B | 109.5 | F26A—C26A—C21A | 120.0 (4) |
| C1—C6—H6C | 109.5 | C25A—C26A—C21A | 123.4 (5) |
| H6A—C6—H6C | 109.5 | C22B—C21B—C26B | 114.9 (4) |
| H6B—C6—H6C | 109.5 | C22B—C21B—P2 | 120.0 (3) |
| C2—C7—H7A | 109.5 | C26B—C21B—P2 | 124.0 (3) |
| C2—C7—H7B | 109.5 | F22B—C22B—C23B | 115.7 (4) |
| H7A—C7—H7B | 109.5 | F22B—C22B—C21B | 120.6 (4) |
| C2—C7—H7C | 109.5 | C23B—C22B—C21B | 123.7 (5) |
| H7A—C7—H7C | 109.5 | F23B—C23B—C24B | 120.1 (4) |
| H7B—C7—H7C | 109.5 | F23B—C23B—C22B | 120.1 (5) |
| C3—C8—H8A | 109.5 | C24B—C23B—C22B | 119.8 (5) |
| C3—C8—H8B | 109.5 | F24B—C24B—C23B | 120.4 (5) |
| H8A—C8—H8B | 109.5 | F24B—C24B—C25B | 119.7 (5) |
| C3—C8—H8C | 109.5 | C23B—C24B—C25B | 119.9 (4) |
| H8A—C8—H8C | 109.5 | F25B—C25B—C24B | 120.7 (4) |
| H8B—C8—H8C | 109.5 | F25B—C25B—C26B | 120.0 (5) |
| C4—C9—H9A | 109.5 | C24B—C25B—C26B | 119.2 (5) |
| C4—C9—H9B | 109.5 | F26B—C26B—C25B | 116.5 (4) |
| H9A—C9—H9B | 109.5 | F26B—C26B—C21B | 121.0 (4) |
| C4—C9—H9C | 109.5 | C25B—C26B—C21B | 122.5 (5) |
| H9A—C9—H9C | 109.5 | C2S—N1S—Ru1 | 173.1 (3) |
| H9B—C9—H9C | 109.5 | N1S—C2S—C3S | 178.2 (5) |
| C5—C10—H10A | 109.5 | C2S—C3S—H3S1 | 109.5 |
| C5—C10—H10B | 109.5 | C2S—C3S—H3S2 | 109.5 |
| H10A—C10—H10B | 109.5 | H3S1—C3S—H3S2 | 109.5 |
| C5—C10—H10C | 109.5 | C2S—C3S—H3S3 | 109.5 |
| H10A—C10—H10C | 109.5 | H3S1—C3S—H3S3 | 109.5 |
| H10B—C10—H10C | 109.5 | H3S2—C3S—H3S3 | 109.5 |
| C11A—P1—C11B | 98.14 (17) | F31—P3—F32 | 91.37 (18) |
| C11A—P1—C1A | 109.58 (18) | F31—P3—F36 | 90.86 (17) |
| C11B—P1—C1A | 96.20 (17) | F32—P3—F36 | 89.35 (16) |
| C11A—P1—Ru1 | 118.14 (12) | F31—P3—F33 | 90.61 (17) |
| C11B—P1—Ru1 | 124.75 (14) | F32—P3—F33 | 178.02 (18) |
| C1A—P1—Ru1 | 107.53 (13) | F36—P3—F33 | 90.52 (16) |
| C16A—C11A—C12A | 114.9 (4) | F31—P3—F35 | 90.16 (17) |
| C16A—C11A—P1 | 122.4 (3) | F32—P3—F35 | 90.29 (16) |
| C12A—C11A—P1 | 122.6 (3) | F36—P3—F35 | 178.93 (17) |
| F12A—C12A—C13A | 115.9 (4) | F33—P3—F35 | 89.80 (17) |
| F12A—C12A—C11A | 120.6 (4) | F31—P3—F34 | 179.43 (18) |
| C13A—C12A—C11A | 123.5 (4) | F32—P3—F34 | 89.20 (17) |
| F13A—C13A—C14A | 120.3 (4) | F36—P3—F34 | 89.24 (16) |
| F13A—C13A—C12A | 120.5 (4) | F33—P3—F34 | 88.83 (16) |
| C14A—C13A—C12A | 119.2 (4) | F35—P3—F34 | 89.75 (15) |
| F14A—C14A—C15A | 119.9 (4) |
Acknowledgements
We thank the EPSRC for support.
References
Allen, F. H., Kennard, O., Watson, D. G., Brammer, L., Orpen, A. G. & Taylor, R. (1987). J. Chem. Soc. Perkin Trans. 2, pp. S1–19. CSD CrossRef Web of Science Google Scholar
Atherton, M. J., Fawcett, J., Holloway, J. H., Hope, E. G., Karaçar, A., Russell, D. R. & Saunders, G. C. (1996). J. Chem. Soc. Dalton Trans. pp. 3215–3220. CrossRef Google Scholar
Atherton, M. J. Fawcett, J., Holloway, J. H., Hope, E. G., Russell, D. R. & Saunders G. C. (1999). J. Organomet. Chem. 582, 163–172. CrossRef CAS Google Scholar
Bellabarba, R. M., Nieuwenhuyzen, M. & Saunders, G. C. (2001). J. Chem. Soc. Dalton Trans. pp. 512–514. CrossRef Google Scholar
Bruker (2001). SMART (Version 5.622) and SHELXTL (Version 6.12). Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
Bruker (2002). SAINT. Version 6.36a. Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
Fawcett, J., Friedrichs, S., Holloway, J. H., Hope, E. G., McKee, V., Nieuwenhuyzen, M., Russell, D. R. & Saunders, G. C. (1998). J. Chem. Soc. Dalton Trans. pp. 1477–1484. CrossRef Google Scholar
Sheldrick, G. M. (1996). SADABS. University of Göttingen, Germany. Google Scholar
Sheldrick, G. M. (1997). SHELXS97 and SHELXL97. University of Göttingen, Germany. Google Scholar
© International Union of Crystallography. Prior permission is not required to reproduce short quotations, tables and figures from this article, provided the original authors and source are cited. For more information, click here.


journal menu



