|
Figure 1 Thermal ellipsoid plot of a portion of the chain structure of Pb(C19H12N4O)2(C14H8O5).2H2O; displacement ellipsoids are drawn at the 50% probability level, and H atoms as spheres of arbitrary radius. Symmetry codes are given in Table 1. |
|
Figure 1 Thermal ellipsoid plot of a portion of the chain structure of Pb(C19H12N4O)2(C14H8O5).2H2O; displacement ellipsoids are drawn at the 50% probability level, and H atoms as spheres of arbitrary radius. Symmetry codes are given in Table 1. |