metal-organic compounds
Aqua(iminodiacetato-κ3O,N,O′)(1,10-phenanthroline-κ2N,N′)cobalt(II) monohydrate
aFaculty of Engineering & Science, Universiti Tunku Abdul Rahman, Jalan Genting Kelang, 53100 Kuala Lumpur, Malaysia, and bDepartment of Chemistry, University of Malaya, 50603 Kuala Lumpur, Malaysia
*Correspondence e-mail: [email protected]
The iminodiacetate dianion in the title compound, [Co(C4H5NO4)(C12H8N2)(H2O)]·H2O, chelates to the cobalt(II) atom, its N and two O atoms occupying the fac sites of the distorted octahedron around the metal atom. The metal atom is also chelated by the N-heterocycle. The dianion, and coordinated and uncoordinated water molecules interact through hydrogen bonds, generating a layer motif. The crystal studied was a racemic twin with a 0.62 (2):0.38 (2) domain ratio.
Related literature
For structural examples of the N-heterocycle adducts of cobalt iminodiacetate, see: Su & Xu (2004
); Xu et al. (1989
).
Experimental
Crystal data
|
|
Data collection: APEX2 (Bruker, 2007
); cell refinement: SAINT (Bruker, 2007
); data reduction: SAINT; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: X-SEED (Barbour, 2001
); software used to prepare material for publication: publCIF (Westrip, 2009
).
Supporting information
contains datablocks global, I. DOI: 10.1107/S1600536808041226/sj2563sup1.cif
Structure factors: contains datablock I. DOI: 10.1107/S1600536808041226/sj2563Isup2.hkl
An aqueous solution of cobalt(II) chloride (0.24 g, 1 mmol) was mixed with an aqueous solutin of disodium iminodiacetate monohydrate (0.20 g, 1 mmol); this was added to a water-methanol solution of 1,10-phenanthroline (0.20 g, 1 mmol). The solution was set aside for the growth of orange crystals.
Carbon-bound hydrogen atoms were placed at calculated positions (C–H 0.95–0.99 Å) and were treated as riding on their parent atoms, with U(H) set to 1.2 times Ueq(C). The water H-atoms were located in a difference Fourier map, and were refined with a distance restraint of O–H 0.84±0.01 Å; their temperature factors were freely refined. The amino H-atom could not be located, and was treated as riding.
The structure is a racemic twin. The explicit of the gave the twin component as 0.38 (2).
Data collection: APEX2 (Bruker, 2007); cell APEX2 (Bruker, 2007); data reduction: SAINT (Bruker, 2007); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: X-SEED (Barbour, 2001); software used to prepare material for publication: pubCIF (Westrip, 2009).
| Fig. 1. Thermal ellipsoid plot (Barbour, 2001) of Co(C12H8N2)(C4H5NO4)(H2O).H2O at the 70% probability level. Hydrogen atoms are drawn as spheres of arbitrary radius. |
| [Co(C4H5NO4)(C12H8N2)(H2O)]·H2O | F(000) = 418 |
| Mr = 406.26 | Dx = 1.650 Mg m−3 |
| Monoclinic, Pn | Mo Kα radiation, λ = 0.71073 Å |
| Hall symbol: P 2yac | Cell parameters from 1265 reflections |
| a = 6.7884 (3) Å | θ = 2.6–24.5° |
| b = 12.0903 (5) Å | µ = 1.09 mm−1 |
| c = 10.4945 (4) Å | T = 100 K |
| β = 108.357 (3)° | Prism, orange |
| V = 817.49 (6) Å3 | 0.35 × 0.02 × 0.02 mm |
| Z = 2 |
| Bruker SMART APEX diffractometer | 3639 independent reflections |
| Radiation source: fine-focus sealed tube | 2997 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.048 |
| ω scans | θmax = 27.5°, θmin = 1.7° |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | h = −8→8 |
| Tmin = 0.701, Tmax = 0.979 | k = −15→15 |
| 6417 measured reflections | l = −13→13 |
| Refinement on F2 | Secondary atom site location: difference Fourier map |
| Least-squares matrix: full | Hydrogen site location: inferred from neighbouring sites |
| R[F2 > 2σ(F2)] = 0.048 | H atoms treated by a mixture of independent and constrained refinement |
| wR(F2) = 0.126 | w = 1/[σ2(Fo2) + (0.0697P)2] where P = (Fo2 + 2Fc2)/3 |
| S = 1.00 | (Δ/σ)max = 0.001 |
| 3639 reflections | Δρmax = 0.86 e Å−3 |
| 248 parameters | Δρmin = −0.49 e Å−3 |
| 8 restraints | Absolute structure: Flack (1983), 1746 Friedel pairs |
| Primary atom site location: structure-invariant direct methods | Absolute structure parameter: 0.38 (2) |
| [Co(C4H5NO4)(C12H8N2)(H2O)]·H2O | V = 817.49 (6) Å3 |
| Mr = 406.26 | Z = 2 |
| Monoclinic, Pn | Mo Kα radiation |
| a = 6.7884 (3) Å | µ = 1.09 mm−1 |
| b = 12.0903 (5) Å | T = 100 K |
| c = 10.4945 (4) Å | 0.35 × 0.02 × 0.02 mm |
| β = 108.357 (3)° |
| Bruker SMART APEX diffractometer | 3639 independent reflections |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | 2997 reflections with I > 2σ(I) |
| Tmin = 0.701, Tmax = 0.979 | Rint = 0.048 |
| 6417 measured reflections |
| R[F2 > 2σ(F2)] = 0.048 | H atoms treated by a mixture of independent and constrained refinement |
| wR(F2) = 0.126 | Δρmax = 0.86 e Å−3 |
| S = 1.00 | Δρmin = −0.49 e Å−3 |
| 3639 reflections | Absolute structure: Flack (1983), 1746 Friedel pairs |
| 248 parameters | Absolute structure parameter: 0.38 (2) |
| 8 restraints |
| x | y | z | Uiso*/Ueq | ||
| Co1 | 0.49999 (10) | 0.85733 (5) | 0.50000 (8) | 0.01527 (16) | |
| O1 | 0.4183 (7) | 0.8730 (3) | 0.6730 (4) | 0.0222 (9) | |
| O2 | 0.3360 (6) | 1.0019 (3) | 0.7965 (4) | 0.0254 (8) | |
| O3 | 0.7258 (6) | 0.9787 (3) | 0.5790 (3) | 0.0196 (9) | |
| O4 | 0.7806 (5) | 1.1607 (3) | 0.5786 (3) | 0.0190 (7) | |
| O1W | 0.5702 (6) | 0.8446 (3) | 0.3211 (4) | 0.0194 (9) | |
| H11 | 0.652 (7) | 0.896 (3) | 0.317 (5) | 0.029* | |
| H12 | 0.493 (7) | 0.830 (4) | 0.243 (2) | 0.029* | |
| O2W | 0.9365 (7) | 1.2706 (3) | 0.3875 (4) | 0.0307 (9) | |
| H21 | 0.939 (10) | 1.225 (4) | 0.327 (4) | 0.046* | |
| H22 | 0.870 (9) | 1.243 (4) | 0.435 (5) | 0.046* | |
| N1 | 0.3129 (7) | 1.0058 (4) | 0.4480 (4) | 0.0162 (10) | |
| H1 | 0.2104 | 0.9968 | 0.3727 | 0.019* | |
| N2 | 0.6902 (8) | 0.7165 (4) | 0.5733 (5) | 0.0171 (10) | |
| N3 | 0.2824 (7) | 0.7278 (4) | 0.4343 (4) | 0.0168 (11) | |
| C1 | 0.3389 (7) | 0.9654 (4) | 0.6867 (5) | 0.0193 (10) | |
| C2 | 0.2335 (7) | 1.0313 (4) | 0.5604 (5) | 0.0202 (10) | |
| H2A | 0.0826 | 1.0160 | 0.5320 | 0.024* | |
| H2B | 0.2533 | 1.1112 | 0.5814 | 0.024* | |
| C3 | 0.4607 (8) | 1.0907 (4) | 0.4324 (5) | 0.0183 (10) | |
| H3A | 0.4062 | 1.1653 | 0.4414 | 0.022* | |
| H3B | 0.4760 | 1.0849 | 0.3419 | 0.022* | |
| C4 | 0.6704 (8) | 1.0754 (4) | 0.5382 (5) | 0.0177 (10) | |
| C5 | 0.8890 (9) | 0.7128 (5) | 0.6410 (5) | 0.0217 (13) | |
| H5 | 0.9625 | 0.7806 | 0.6638 | 0.026* | |
| C6 | 0.9974 (10) | 0.6143 (5) | 0.6811 (6) | 0.0256 (13) | |
| H6 | 1.1410 | 0.6154 | 0.7310 | 0.031* | |
| C7 | 0.8948 (9) | 0.5164 (5) | 0.6478 (5) | 0.0246 (13) | |
| H7 | 0.9666 | 0.4485 | 0.6736 | 0.030* | |
| C8 | 0.6812 (10) | 0.5167 (5) | 0.5748 (5) | 0.0221 (13) | |
| C9 | 0.5835 (10) | 0.6199 (5) | 0.5401 (7) | 0.0210 (14) | |
| C10 | 0.5597 (10) | 0.4182 (5) | 0.5380 (6) | 0.0269 (14) | |
| H10 | 0.6247 | 0.3481 | 0.5601 | 0.032* | |
| C11 | 0.3534 (10) | 0.4234 (4) | 0.4720 (6) | 0.0230 (12) | |
| H11A | 0.2754 | 0.3570 | 0.4500 | 0.028* | |
| C12 | 0.2518 (10) | 0.5267 (5) | 0.4351 (5) | 0.0205 (13) | |
| C13 | 0.3668 (10) | 0.6250 (4) | 0.4676 (6) | 0.0128 (12) | |
| C14 | 0.0390 (9) | 0.5374 (4) | 0.3682 (5) | 0.0220 (12) | |
| H14 | −0.0462 | 0.4734 | 0.3459 | 0.026* | |
| C15 | −0.0462 (10) | 0.6399 (4) | 0.3350 (6) | 0.0238 (14) | |
| H15 | −0.1902 | 0.6475 | 0.2884 | 0.029* | |
| C16 | 0.0795 (8) | 0.7328 (5) | 0.3699 (6) | 0.0182 (11) | |
| H16 | 0.0175 | 0.8035 | 0.3467 | 0.022* |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Co1 | 0.0158 (3) | 0.0120 (3) | 0.0173 (3) | 0.0003 (3) | 0.0041 (2) | −0.0001 (3) |
| O1 | 0.033 (3) | 0.0132 (18) | 0.024 (2) | 0.0052 (16) | 0.0135 (19) | 0.0029 (14) |
| O2 | 0.0220 (19) | 0.032 (2) | 0.0207 (17) | 0.0070 (16) | 0.0052 (14) | −0.0024 (16) |
| O3 | 0.017 (2) | 0.0178 (19) | 0.021 (2) | 0.0012 (15) | 0.0013 (16) | 0.0033 (15) |
| O4 | 0.0219 (18) | 0.0127 (17) | 0.0210 (17) | −0.0021 (14) | 0.0048 (14) | 0.0012 (13) |
| O1W | 0.014 (2) | 0.023 (2) | 0.0183 (19) | −0.0049 (15) | 0.0022 (16) | 0.0039 (15) |
| O2W | 0.049 (3) | 0.0175 (19) | 0.029 (2) | −0.0081 (18) | 0.0165 (19) | −0.0030 (15) |
| N1 | 0.010 (2) | 0.022 (3) | 0.012 (2) | −0.0009 (18) | −0.0025 (17) | 0.0020 (19) |
| N2 | 0.019 (2) | 0.011 (2) | 0.022 (2) | 0.0010 (19) | 0.0077 (19) | −0.0011 (19) |
| N3 | 0.021 (2) | 0.015 (2) | 0.014 (2) | 0.0008 (19) | 0.0053 (19) | −0.0012 (18) |
| C1 | 0.012 (2) | 0.027 (3) | 0.017 (2) | 0.001 (2) | 0.0017 (19) | −0.001 (2) |
| C2 | 0.015 (2) | 0.021 (2) | 0.025 (3) | 0.0072 (19) | 0.008 (2) | 0.003 (2) |
| C3 | 0.017 (3) | 0.013 (2) | 0.022 (2) | −0.002 (2) | 0.002 (2) | 0.0032 (19) |
| C4 | 0.020 (3) | 0.016 (3) | 0.017 (2) | 0.001 (2) | 0.007 (2) | 0.001 (2) |
| C5 | 0.019 (3) | 0.026 (3) | 0.018 (3) | 0.002 (2) | 0.003 (2) | −0.004 (2) |
| C6 | 0.017 (3) | 0.034 (3) | 0.022 (3) | 0.008 (3) | 0.002 (2) | 0.004 (2) |
| C7 | 0.027 (3) | 0.021 (3) | 0.026 (3) | 0.012 (2) | 0.008 (2) | 0.008 (2) |
| C8 | 0.027 (3) | 0.020 (3) | 0.023 (3) | 0.004 (2) | 0.013 (2) | 0.007 (2) |
| C9 | 0.023 (3) | 0.018 (3) | 0.024 (3) | 0.001 (2) | 0.009 (2) | 0.000 (2) |
| C10 | 0.041 (4) | 0.011 (2) | 0.033 (3) | 0.004 (2) | 0.017 (3) | 0.002 (2) |
| C11 | 0.029 (3) | 0.013 (2) | 0.030 (3) | −0.001 (2) | 0.014 (2) | 0.001 (2) |
| C12 | 0.029 (3) | 0.015 (3) | 0.022 (3) | −0.004 (2) | 0.013 (3) | 0.000 (2) |
| C13 | 0.016 (3) | 0.010 (3) | 0.013 (2) | 0.003 (2) | 0.006 (2) | 0.0001 (19) |
| C14 | 0.019 (3) | 0.019 (3) | 0.027 (3) | −0.007 (2) | 0.006 (2) | −0.002 (2) |
| C15 | 0.019 (3) | 0.025 (3) | 0.027 (3) | −0.005 (2) | 0.006 (2) | −0.003 (2) |
| C16 | 0.012 (2) | 0.016 (3) | 0.023 (3) | 0.003 (2) | 0.001 (2) | −0.003 (2) |
| Co1—O1 | 2.067 (4) | C3—C4 | 1.516 (7) |
| Co1—O1W | 2.083 (4) | C3—H3A | 0.9900 |
| Co1—O3 | 2.095 (4) | C3—H3B | 0.9900 |
| Co1—N3 | 2.113 (5) | C5—C6 | 1.394 (8) |
| Co1—N2 | 2.129 (5) | C5—H5 | 0.9500 |
| Co1—N1 | 2.167 (5) | C6—C7 | 1.362 (8) |
| O1—C1 | 1.269 (6) | C6—H6 | 0.9500 |
| O2—C1 | 1.240 (6) | C7—C8 | 1.411 (8) |
| O3—C4 | 1.260 (6) | C7—H7 | 0.9500 |
| O4—C4 | 1.267 (6) | C8—C9 | 1.406 (9) |
| O1W—H11 | 0.84 (5) | C8—C10 | 1.430 (8) |
| O1W—H12 | 0.84 (6) | C9—C13 | 1.429 (8) |
| O2W—H21 | 0.84 (5) | C10—C11 | 1.355 (9) |
| O2W—H22 | 0.84 (6) | C10—H10 | 0.9500 |
| N1—C2 | 1.476 (6) | C11—C12 | 1.420 (8) |
| N1—C3 | 1.480 (6) | C11—H11A | 0.9500 |
| N1—H1 | 0.8800 | C12—C14 | 1.399 (9) |
| N2—C5 | 1.313 (8) | C12—C13 | 1.403 (8) |
| N2—C9 | 1.360 (8) | C14—C15 | 1.365 (8) |
| N3—C16 | 1.331 (7) | C14—H14 | 0.9500 |
| N3—C13 | 1.368 (7) | C15—C16 | 1.389 (8) |
| C1—C2 | 1.518 (6) | C15—H15 | 0.9500 |
| C2—H2A | 0.9900 | C16—H16 | 0.9500 |
| C2—H2B | 0.9900 | ||
| O1—Co1—O1W | 177.6 (2) | C4—C3—H3A | 109.6 |
| O1—Co1—O3 | 87.34 (16) | N1—C3—H3B | 109.6 |
| O1W—Co1—O3 | 93.54 (15) | C4—C3—H3B | 109.6 |
| O1—Co1—N3 | 90.07 (17) | H3A—C3—H3B | 108.1 |
| O1W—Co1—N3 | 89.20 (16) | O3—C4—O4 | 124.0 (5) |
| O3—Co1—N3 | 175.53 (17) | O3—C4—C3 | 118.3 (5) |
| O1—Co1—N2 | 93.20 (16) | O4—C4—C3 | 117.7 (4) |
| O1W—Co1—N2 | 88.95 (17) | N2—C5—C6 | 123.2 (6) |
| O3—Co1—N2 | 97.62 (17) | N2—C5—H5 | 118.4 |
| N3—Co1—N2 | 78.88 (15) | C6—C5—H5 | 118.4 |
| O1—Co1—N1 | 81.23 (15) | C7—C6—C5 | 119.1 (6) |
| O1W—Co1—N1 | 96.68 (15) | C7—C6—H6 | 120.4 |
| O3—Co1—N1 | 79.47 (17) | C5—C6—H6 | 120.4 |
| N3—Co1—N1 | 103.74 (19) | C6—C7—C8 | 119.5 (5) |
| N2—Co1—N1 | 173.79 (18) | C6—C7—H7 | 120.2 |
| C1—O1—Co1 | 114.9 (3) | C8—C7—H7 | 120.2 |
| C4—O3—Co1 | 114.3 (3) | C9—C8—C7 | 117.5 (5) |
| Co1—O1W—H11 | 109 (3) | C9—C8—C10 | 119.0 (5) |
| Co1—O1W—H12 | 130 (3) | C7—C8—C10 | 123.5 (5) |
| H11—O1W—H12 | 109 (5) | N2—C9—C8 | 121.7 (6) |
| H21—O2W—H22 | 109 (5) | N2—C9—C13 | 118.4 (6) |
| C2—N1—C3 | 111.9 (4) | C8—C9—C13 | 119.9 (6) |
| C2—N1—Co1 | 107.7 (3) | C11—C10—C8 | 121.0 (5) |
| C3—N1—Co1 | 103.8 (3) | C11—C10—H10 | 119.5 |
| C2—N1—H1 | 111.0 | C8—C10—H10 | 119.5 |
| C3—N1—H1 | 111.0 | C10—C11—C12 | 121.0 (6) |
| Co1—N1—H1 | 111.0 | C10—C11—H11A | 119.5 |
| C5—N2—C9 | 118.9 (5) | C12—C11—H11A | 119.5 |
| C5—N2—Co1 | 128.7 (4) | C14—C12—C13 | 116.9 (5) |
| C9—N2—Co1 | 112.4 (4) | C14—C12—C11 | 123.6 (5) |
| C16—N3—C13 | 117.0 (5) | C13—C12—C11 | 119.5 (6) |
| C16—N3—Co1 | 129.6 (4) | N3—C13—C12 | 123.5 (6) |
| C13—N3—Co1 | 113.4 (4) | N3—C13—C9 | 116.9 (6) |
| O2—C1—O1 | 123.4 (5) | C12—C13—C9 | 119.6 (6) |
| O2—C1—C2 | 118.9 (4) | C15—C14—C12 | 119.9 (5) |
| O1—C1—C2 | 117.6 (4) | C15—C14—H14 | 120.0 |
| N1—C2—C1 | 113.4 (4) | C12—C14—H14 | 120.0 |
| N1—C2—H2A | 108.9 | C14—C15—C16 | 119.5 (6) |
| C1—C2—H2A | 108.9 | C14—C15—H15 | 120.3 |
| N1—C2—H2B | 108.9 | C16—C15—H15 | 120.3 |
| C1—C2—H2B | 108.9 | N3—C16—C15 | 123.3 (5) |
| H2A—C2—H2B | 107.7 | N3—C16—H16 | 118.4 |
| N1—C3—C4 | 110.3 (4) | C15—C16—H16 | 118.4 |
| N1—C3—H3A | 109.6 | ||
| O3—Co1—O1—C1 | 66.7 (4) | Co1—O3—C4—C3 | −4.4 (6) |
| N3—Co1—O1—C1 | −116.9 (4) | N1—C3—C4—O3 | 31.4 (6) |
| N2—Co1—O1—C1 | 164.2 (4) | N1—C3—C4—O4 | −149.6 (4) |
| N1—Co1—O1—C1 | −13.1 (4) | C9—N2—C5—C6 | −0.1 (8) |
| O1—Co1—O3—C4 | −96.3 (4) | Co1—N2—C5—C6 | −178.6 (4) |
| O1W—Co1—O3—C4 | 81.5 (4) | N2—C5—C6—C7 | 0.8 (9) |
| N2—Co1—O3—C4 | 170.9 (3) | C5—C6—C7—C8 | −0.6 (8) |
| N1—Co1—O3—C4 | −14.7 (4) | C6—C7—C8—C9 | −0.3 (8) |
| O1—Co1—N1—C2 | −1.0 (3) | C6—C7—C8—C10 | −178.6 (5) |
| O1W—Co1—N1—C2 | 177.7 (3) | C5—N2—C9—C8 | −0.9 (8) |
| O3—Co1—N1—C2 | −89.9 (3) | Co1—N2—C9—C8 | 177.9 (4) |
| N3—Co1—N1—C2 | 86.9 (3) | C5—N2—C9—C13 | 179.4 (5) |
| O1—Co1—N1—C3 | 117.8 (3) | Co1—N2—C9—C13 | −1.9 (6) |
| O1W—Co1—N1—C3 | −63.4 (3) | C7—C8—C9—N2 | 1.0 (8) |
| O3—Co1—N1—C3 | 28.9 (3) | C10—C8—C9—N2 | 179.4 (5) |
| N3—Co1—N1—C3 | −154.3 (3) | C7—C8—C9—C13 | −179.2 (5) |
| O1—Co1—N2—C5 | −90.5 (5) | C10—C8—C9—C13 | −0.8 (7) |
| O1W—Co1—N2—C5 | 90.7 (5) | C9—C8—C10—C11 | −0.7 (8) |
| O3—Co1—N2—C5 | −2.8 (5) | C7—C8—C10—C11 | 177.6 (5) |
| N3—Co1—N2—C5 | −180.0 (5) | C8—C10—C11—C12 | 1.1 (8) |
| O1—Co1—N2—C9 | 90.9 (4) | C10—C11—C12—C14 | −179.3 (5) |
| O1W—Co1—N2—C9 | −88.0 (4) | C10—C11—C12—C13 | 0.0 (8) |
| O3—Co1—N2—C9 | 178.6 (4) | C16—N3—C13—C12 | 1.3 (8) |
| N3—Co1—N2—C9 | 1.4 (4) | Co1—N3—C13—C12 | 179.6 (4) |
| O1—Co1—N3—C16 | 84.0 (5) | C16—N3—C13—C9 | −178.2 (5) |
| O1W—Co1—N3—C16 | −93.7 (5) | Co1—N3—C13—C9 | 0.1 (6) |
| N2—Co1—N3—C16 | 177.2 (5) | C14—C12—C13—N3 | −1.7 (8) |
| N1—Co1—N3—C16 | 3.0 (5) | C11—C12—C13—N3 | 179.0 (5) |
| O1—Co1—N3—C13 | −94.1 (4) | C14—C12—C13—C9 | 177.8 (5) |
| O1W—Co1—N3—C13 | 88.3 (4) | C11—C12—C13—C9 | −1.5 (7) |
| N2—Co1—N3—C13 | −0.8 (4) | N2—C9—C13—N3 | 1.2 (7) |
| N1—Co1—N3—C13 | −175.0 (3) | C8—C9—C13—N3 | −178.5 (5) |
| Co1—O1—C1—O2 | −158.4 (4) | N2—C9—C13—C12 | −178.3 (5) |
| Co1—O1—C1—C2 | 24.6 (6) | C8—C9—C13—C12 | 1.9 (7) |
| C3—N1—C2—C1 | −101.0 (5) | C13—C12—C14—C15 | 1.4 (8) |
| Co1—N1—C2—C1 | 12.5 (5) | C11—C12—C14—C15 | −179.2 (5) |
| O2—C1—C2—N1 | 157.4 (4) | C12—C14—C15—C16 | −0.9 (9) |
| O1—C1—C2—N1 | −25.4 (6) | C13—N3—C16—C15 | −0.7 (8) |
| C2—N1—C3—C4 | 77.1 (5) | Co1—N3—C16—C15 | −178.7 (4) |
| Co1—N1—C3—C4 | −38.8 (4) | C14—C15—C16—N3 | 0.5 (9) |
| Co1—O3—C4—O4 | 176.7 (4) |
| D—H···A | D—H | H···A | D···A | D—H···A |
| O1w—H11···O2i | 0.84 (5) | 1.82 (4) | 2.656 (5) | 174 (6) |
| O1w—H12···O4ii | 0.84 (6) | 1.87 (4) | 2.682 (5) | 162 (6) |
| O2w—H21···O1i | 0.84 (5) | 1.98 (4) | 2.815 (5) | 174 (7) |
| O2w—H22···O4 | 0.84 (6) | 2.05 (5) | 2.871 (5) | 165 (6) |
| N1—H1···O2ii | 0.88 | 2.41 | 3.126 (6) | 139 |
| Symmetry codes: (i) x+1/2, −y+2, z−1/2; (ii) x−1/2, −y+2, z−1/2. |
Experimental details
| Crystal data | |
| Chemical formula | [Co(C4H5NO4)(C12H8N2)(H2O)]·H2O |
| Mr | 406.26 |
| Crystal system, space group | Monoclinic, Pn |
| Temperature (K) | 100 |
| a, b, c (Å) | 6.7884 (3), 12.0903 (5), 10.4945 (4) |
| β (°) | 108.357 (3) |
| V (Å3) | 817.49 (6) |
| Z | 2 |
| Radiation type | Mo Kα |
| µ (mm−1) | 1.09 |
| Crystal size (mm) | 0.35 × 0.02 × 0.02 |
| Data collection | |
| Diffractometer | Bruker SMART APEX diffractometer |
| Absorption correction | Multi-scan (SADABS; Sheldrick, 1996) |
| Tmin, Tmax | 0.701, 0.979 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 6417, 3639, 2997 |
| Rint | 0.048 |
| (sin θ/λ)max (Å−1) | 0.650 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.048, 0.126, 1.00 |
| No. of reflections | 3639 |
| No. of parameters | 248 |
| No. of restraints | 8 |
| H-atom treatment | H atoms treated by a mixture of independent and constrained refinement |
| Δρmax, Δρmin (e Å−3) | 0.86, −0.49 |
| Absolute structure | Flack (1983), 1746 Friedel pairs |
| Absolute structure parameter | 0.38 (2) |
Computer programs: APEX2 (Bruker, 2007), SAINT (Bruker, 2007), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), X-SEED (Barbour, 2001), pubCIF (Westrip, 2009).
| D—H···A | D—H | H···A | D···A | D—H···A |
| O1w—H11···O2i | 0.84 (5) | 1.82 (4) | 2.656 (5) | 174 (6) |
| O1w—H12···O4ii | 0.84 (6) | 1.87 (4) | 2.682 (5) | 162 (6) |
| O2w—H21···O1i | 0.84 (5) | 1.98 (4) | 2.815 (5) | 174 (7) |
| O2w—H22···O4 | 0.84 (6) | 2.05 (5) | 2.871 (5) | 165 (6) |
| Symmetry codes: (i) x+1/2, −y+2, z−1/2; (ii) x−1/2, −y+2, z−1/2. |
Acknowledgements
We thank Universiti Tunku Abdul Rahman and the University of Malaya for supporting this study.
References
Barbour, L. J. (2001). J. Supramol. Chem. 1, 189–191. CrossRef CAS Google Scholar
Bruker (2007). APEX2 and SAINT. Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
Flack, H. D. (1983). Acta Cryst. A39, 876–881. CrossRef CAS Web of Science IUCr Journals Google Scholar
Sheldrick, G. M. (1996). SADABS. University of Göttingen, Germany. Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Su, J.-R. & Xu, D.-J. (2004). J. Coord. Chem. 57, 223–229. Web of Science CSD CrossRef CAS Google Scholar
Westrip, S. P. (2009). publCIF. In preparation. Google Scholar
Xu, D.-J., Cheng, C. R., Xu, Y.-Z. & Hu, S.-Z. (1989). Jiegou Huaxue, 8, 81–85. CAS Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
; (ii)
. ![[Figure 1]](./sj2563fig1thm.gif)



