metal-organic compounds
Diaquahexa-μ2-dichloroacetato-μ3-oxido-tetrahydrofurandiiron(III)manganese(II)
aDepartment of Chemistry, General Campus, Shahid Beheshti University, Tehran 1983963113, Iran, and bDepartment of Chemistry, University of Malaya, 50603 Kuala Lumpur, Malaysia
*Correspondence e-mail: [email protected]
In the oxido-centered title compound, [Fe2Mn(C2HCl2O2)6O(C4H8O)(H2O)2], the central O atom is linked to three metal atoms, which are themselves each linked to four dichloroacetate anions, and is in a triangular configuration. Two of the metal atoms are each coordinated by a water molecule, whereas the third is coordinated by a tetrahydrofuran molecule. In the crystal, adjacent molecules are linked by O—H⋯O and O—H⋯Cl hydrogen bonds across centers of inversion, generating a hydrogen-bonded chain along the c axis. The MnII atoms are disordered with respect to the FeIII atoms, and the same metal site is occupied by 1/3Mn + 2/3Fe.
Related literature
For aquabis(tetrahydrofuran)hexakis(trifluoroacetato)(μ3-oxido)M(II)diiron(III) (M = copper, zinc), see: Amini et al. (2004a
,b
).
Experimental
Crystal data
|
Refinement
|
|
Data collection: APEX2 (Bruker, 2008
); cell refinement: SAINT (Bruker, 2008
); data reduction: SAINT; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: X-SEED (Barbour, 2001
); software used to prepare material for publication: publCIF (Westrip, 2010
).
Supporting information
contains datablocks global, I. DOI: 10.1107/S1600536809054518/ci2991sup1.cif
Structure factors: contains datablock I. DOI: 10.1107/S1600536809054518/ci2991Isup2.hkl
Sodium bicarbonate (4.12 g, 49 mmol) was dissolved in water (50 ml) and this was mixed with dichloroacetic acid (6.19 g, 48 mmol), ferric nitrate nonahydrate (6.46 g, 16 mmol) dissolved in water (30 ml) along with manganese nitrate hexahydrate (2.36 g, 8 mmol) dissolved in water (5 ml). The mixture was stirred for 24 h. The water was removed under reduced pressure and the residue dissolved in a tetrahydrofuran and hexane mixture. The solvent was removed to give an oily residue. This was treated with hexane to remove the oil; the pure compound was obtained by recrystallization from hexane to which several drops of tetrahydrofuran were added. The brown compound melts at 435–436 K.
Carbon-bound H-atoms were placed in calculated positions (C–H = 0.97–0.98 Å) and were included in the in the riding model approximation, with Uiso(H) set to 1.2Ueq(C). The water H-atoms were located in a difference Fourier map, and were refined with distance restraints of O–H = 0.84 (1) Å and H···H 1.37 (1) Å; their Uiso parameters were refined.
The manganese(II) atoms are disordered with respect to the iron(III) atoms, with the pair of Mn/Fe atoms occupying the same site. As the occupancy refined to nearly 1:2, the ratio was fixed as exactly 1:2.
For the THF molecule, the O—C distances were restrained to 1.45 (1) Å and the C—C distances to 1.54 (1) Å; the anisotropic displacement parameters of atoms C13, C14, C15 and C16 were restrained to be nearly isotropic.
The final difference map had a peak in the vicinity of O14.
Data collection: APEX2 (Bruker, 2008); cell SAINT (Bruker, 2008); data reduction: SAINT (Bruker, 2008); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: X-SEED (Barbour, 2001); software used to prepare material for publication: publCIF (Westrip, 2010).
| Fig. 1. Displacement ellipsoid plot (Barbour, 2001) of Fe2MnO(H2O)2(C4H8O)(C2HO2Cl2)6; ellipsoids are drawn at the 50% probability level and H atoms of arbitrary radius. |
| [Fe2Mn(C2HCl2O2)6O(C4H8O)(H2O)2] | Z = 2 |
| Mr = 1058.34 | F(000) = 1046 |
| Triclinic, P1 | Dx = 1.869 Mg m−3 |
| Hall symbol: -P 1 | Mo Kα radiation, λ = 0.71073 Å |
| a = 9.380 (1) Å | Cell parameters from 4712 reflections |
| b = 13.316 (1) Å | θ = 2.4–27.4° |
| c = 15.432 (1) Å | µ = 2.01 mm−1 |
| α = 90.131 (1)° | T = 295 K |
| β = 100.067 (1)° | Block, brown |
| γ = 97.677 (1)° | 0.35 × 0.15 × 0.15 mm |
| V = 1880.1 (2) Å3 |
| Bruker SMART APEX diffractometer | 8543 independent reflections |
| Radiation source: fine-focus sealed tube | 5788 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.025 |
| ω scans | θmax = 27.5°, θmin = 1.3° |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | h = −12→12 |
| Tmin = 0.540, Tmax = 0.753 | k = −17→17 |
| 15425 measured reflections | l = −20→17 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.063 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.207 | H atoms treated by a mixture of independent and constrained refinement |
| S = 1.03 | w = 1/[σ2(Fo2) + (0.1141P)2 + 3.6071P] where P = (Fo2 + 2Fc2)/3 |
| 8543 reflections | (Δ/σ)max = 0.001 |
| 440 parameters | Δρmax = 1.64 e Å−3 |
| 35 restraints | Δρmin = −0.90 e Å−3 |
| [Fe2Mn(C2HCl2O2)6O(C4H8O)(H2O)2] | γ = 97.677 (1)° |
| Mr = 1058.34 | V = 1880.1 (2) Å3 |
| Triclinic, P1 | Z = 2 |
| a = 9.380 (1) Å | Mo Kα radiation |
| b = 13.316 (1) Å | µ = 2.01 mm−1 |
| c = 15.432 (1) Å | T = 295 K |
| α = 90.131 (1)° | 0.35 × 0.15 × 0.15 mm |
| β = 100.067 (1)° |
| Bruker SMART APEX diffractometer | 8543 independent reflections |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | 5788 reflections with I > 2σ(I) |
| Tmin = 0.540, Tmax = 0.753 | Rint = 0.025 |
| 15425 measured reflections |
| R[F2 > 2σ(F2)] = 0.063 | 35 restraints |
| wR(F2) = 0.207 | H atoms treated by a mixture of independent and constrained refinement |
| S = 1.03 | Δρmax = 1.64 e Å−3 |
| 8543 reflections | Δρmin = −0.90 e Å−3 |
| 440 parameters |
| x | y | z | Uiso*/Ueq | Occ. (<1) | |
| Fe1 | 0.48559 (8) | 0.58734 (5) | 0.15449 (5) | 0.02900 (19) | 0.67 |
| Fe2 | 0.70394 (8) | 0.77291 (5) | 0.26487 (5) | 0.03113 (19) | 0.67 |
| Fe3 | 0.62644 (8) | 0.55454 (6) | 0.36749 (5) | 0.0331 (2) | 0.67 |
| Mn1 | 0.48559 (8) | 0.58734 (5) | 0.15449 (5) | 0.02900 (19) | 0.33 |
| Mn2 | 0.70394 (8) | 0.77291 (5) | 0.26487 (5) | 0.03113 (19) | 0.33 |
| Mn3 | 0.62644 (8) | 0.55454 (6) | 0.36749 (5) | 0.0331 (2) | 0.33 |
| Cl1 | 0.7881 (3) | 0.31545 (18) | 0.11574 (16) | 0.0856 (7) | |
| Cl2 | 0.5060 (4) | 0.21726 (17) | 0.1440 (3) | 0.1210 (11) | |
| Cl3 | 0.9003 (3) | 0.83097 (19) | −0.00937 (16) | 0.0953 (8) | |
| Cl4 | 0.9893 (3) | 0.6422 (2) | 0.0556 (2) | 0.1111 (10) | |
| Cl5 | 0.3394 (5) | 0.9362 (2) | 0.0396 (2) | 0.1385 (14) | |
| Cl6 | 0.3033 (4) | 0.9569 (2) | 0.2189 (3) | 0.1291 (12) | |
| Cl7 | 0.1673 (3) | 0.30107 (17) | 0.22744 (18) | 0.0944 (8) | |
| Cl8 | 0.0953 (3) | 0.4052 (2) | 0.37391 (18) | 0.1134 (11) | |
| Cl9 | 0.5161 (3) | 0.77820 (18) | 0.60071 (13) | 0.0888 (7) | |
| Cl10 | 0.6888 (3) | 0.94612 (19) | 0.53350 (18) | 0.1011 (9) | |
| Cl11 | 1.2099 (2) | 0.7122 (2) | 0.3483 (2) | 0.1044 (9) | |
| Cl12 | 1.1217 (3) | 0.7937 (2) | 0.5016 (2) | 0.1191 (11) | |
| O1 | 0.5657 (5) | 0.4523 (3) | 0.1497 (3) | 0.0473 (10) | |
| O2 | 0.6456 (5) | 0.4239 (3) | 0.2908 (3) | 0.0490 (10) | |
| O3 | 0.6341 (4) | 0.6367 (3) | 0.0718 (3) | 0.0449 (9) | |
| O4 | 0.7827 (5) | 0.7618 (3) | 0.1493 (3) | 0.0522 (11) | |
| O5 | 0.3761 (4) | 0.7103 (3) | 0.1277 (3) | 0.0485 (10) | |
| O6 | 0.5320 (4) | 0.8361 (3) | 0.2003 (3) | 0.0532 (11) | |
| O7 | 0.3171 (4) | 0.5173 (3) | 0.2051 (3) | 0.0503 (10) | |
| O8 | 0.3900 (4) | 0.4967 (3) | 0.3482 (2) | 0.0421 (9) | |
| O9 | 0.6494 (6) | 0.8139 (3) | 0.3790 (3) | 0.0556 (11) | |
| O10 | 0.5825 (4) | 0.6753 (3) | 0.4504 (3) | 0.0426 (9) | |
| O11 | 0.8568 (4) | 0.6037 (3) | 0.4047 (3) | 0.0487 (10) | |
| O12 | 0.8968 (4) | 0.7428 (3) | 0.3279 (3) | 0.0523 (11) | |
| O13 | 0.6045 (4) | 0.6424 (2) | 0.2557 (2) | 0.0310 (7) | |
| O14 | 0.8102 (5) | 0.9224 (3) | 0.2647 (3) | 0.0485 (10) | |
| O1w | 0.3539 (5) | 0.5332 (3) | 0.0336 (2) | 0.0428 (9) | |
| H11 | 0.354 (9) | 0.4734 (18) | 0.015 (3) | 0.07 (2)* | |
| H12 | 0.336 (7) | 0.570 (3) | −0.011 (2) | 0.046 (18)* | |
| O2w | 0.6460 (4) | 0.4572 (3) | 0.4791 (3) | 0.0407 (8) | |
| H21 | 0.580 (7) | 0.408 (4) | 0.481 (5) | 0.08 (3)* | |
| H22 | 0.662 (11) | 0.489 (6) | 0.528 (3) | 0.13 (4)* | |
| C1 | 0.6208 (6) | 0.4026 (4) | 0.2124 (4) | 0.0396 (12) | |
| C2 | 0.6613 (9) | 0.2998 (5) | 0.1891 (5) | 0.0596 (18) | |
| H2 | 0.7080 | 0.2706 | 0.2433 | 0.072* | |
| C3 | 0.7428 (6) | 0.7024 (4) | 0.0862 (3) | 0.0364 (11) | |
| C4 | 0.8391 (7) | 0.7079 (6) | 0.0146 (5) | 0.0615 (19) | |
| H4 | 0.7829 | 0.6730 | −0.0391 | 0.074* | |
| C5 | 0.4141 (6) | 0.7987 (4) | 0.1553 (4) | 0.0425 (13) | |
| C6 | 0.3003 (8) | 0.8696 (5) | 0.1314 (7) | 0.079 (3) | |
| H6 | 0.2031 | 0.8299 | 0.1170 | 0.095* | |
| C7 | 0.3020 (6) | 0.4845 (4) | 0.2785 (4) | 0.0393 (12) | |
| C8 | 0.1511 (7) | 0.4205 (6) | 0.2740 (5) | 0.0608 (18) | |
| H8 | 0.0783 | 0.4525 | 0.2340 | 0.073* | |
| C9 | 0.6017 (6) | 0.7685 (4) | 0.4403 (4) | 0.0374 (11) | |
| C10 | 0.5580 (7) | 0.8389 (5) | 0.5070 (4) | 0.0504 (15) | |
| H10 | 0.4682 | 0.8634 | 0.4777 | 0.061* | |
| C11 | 0.9324 (6) | 0.6772 (4) | 0.3815 (4) | 0.0407 (12) | |
| C12 | 1.0941 (7) | 0.6917 (6) | 0.4260 (5) | 0.0584 (17) | |
| H12a | 1.1148 | 0.6303 | 0.4580 | 0.070* | |
| C13 | 0.7881 (14) | 0.9875 (9) | 0.1903 (8) | 0.140 (5) | |
| H13A | 0.7012 | 1.0197 | 0.1900 | 0.168* | |
| H13B | 0.7769 | 0.9488 | 0.1356 | 0.168* | |
| C14 | 0.9230 (15) | 1.0664 (10) | 0.2007 (8) | 0.143 (5) | |
| H14A | 1.0047 | 1.0406 | 0.1816 | 0.171* | |
| H14B | 0.9039 | 1.1280 | 0.1700 | 0.171* | |
| C15 | 0.9457 (18) | 1.0811 (8) | 0.2983 (8) | 0.144 (5) | |
| H15A | 0.8773 | 1.1229 | 0.3150 | 0.173* | |
| H15B | 1.0445 | 1.1126 | 0.3213 | 0.173* | |
| C16 | 0.9183 (18) | 0.9741 (9) | 0.3316 (9) | 0.165 (6) | |
| H16A | 1.0069 | 0.9424 | 0.3396 | 0.198* | |
| H16B | 0.8833 | 0.9744 | 0.3871 | 0.198* |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Fe1 | 0.0335 (4) | 0.0263 (4) | 0.0262 (4) | 0.0008 (3) | 0.0051 (3) | 0.0000 (3) |
| Fe2 | 0.0348 (4) | 0.0247 (4) | 0.0311 (4) | −0.0016 (3) | 0.0025 (3) | 0.0006 (3) |
| Fe3 | 0.0358 (4) | 0.0320 (4) | 0.0305 (4) | 0.0010 (3) | 0.0059 (3) | 0.0003 (3) |
| Mn1 | 0.0335 (4) | 0.0263 (4) | 0.0262 (4) | 0.0008 (3) | 0.0051 (3) | 0.0000 (3) |
| Mn2 | 0.0348 (4) | 0.0247 (4) | 0.0311 (4) | −0.0016 (3) | 0.0025 (3) | 0.0006 (3) |
| Mn3 | 0.0358 (4) | 0.0320 (4) | 0.0305 (4) | 0.0010 (3) | 0.0059 (3) | 0.0003 (3) |
| Cl1 | 0.0947 (15) | 0.0943 (15) | 0.0880 (15) | 0.0563 (13) | 0.0386 (12) | 0.0159 (12) |
| Cl2 | 0.131 (2) | 0.0474 (11) | 0.186 (3) | −0.0117 (13) | 0.050 (2) | −0.0354 (15) |
| Cl3 | 0.1197 (19) | 0.0878 (15) | 0.0785 (14) | −0.0301 (14) | 0.0511 (14) | 0.0132 (12) |
| Cl4 | 0.0769 (14) | 0.120 (2) | 0.155 (3) | 0.0284 (14) | 0.0592 (17) | −0.0058 (19) |
| Cl5 | 0.214 (4) | 0.104 (2) | 0.098 (2) | 0.074 (2) | −0.009 (2) | 0.0416 (17) |
| Cl6 | 0.134 (2) | 0.0947 (19) | 0.185 (3) | 0.0527 (18) | 0.072 (2) | −0.010 (2) |
| Cl7 | 0.1038 (17) | 0.0655 (13) | 0.1057 (18) | −0.0294 (12) | 0.0273 (14) | −0.0193 (12) |
| Cl8 | 0.0954 (17) | 0.150 (3) | 0.0903 (17) | −0.0524 (17) | 0.0554 (14) | −0.0208 (16) |
| Cl9 | 0.145 (2) | 0.0797 (14) | 0.0520 (11) | 0.0171 (14) | 0.0442 (12) | −0.0051 (10) |
| Cl10 | 0.1105 (18) | 0.0784 (14) | 0.1083 (18) | −0.0314 (13) | 0.0369 (15) | −0.0541 (14) |
| Cl11 | 0.0527 (11) | 0.142 (2) | 0.132 (2) | 0.0308 (13) | 0.0393 (13) | 0.0530 (18) |
| Cl12 | 0.0953 (18) | 0.121 (2) | 0.116 (2) | −0.0117 (16) | −0.0304 (16) | −0.0442 (18) |
| O1 | 0.072 (3) | 0.033 (2) | 0.037 (2) | 0.0182 (19) | 0.0018 (19) | −0.0010 (16) |
| O2 | 0.074 (3) | 0.042 (2) | 0.034 (2) | 0.018 (2) | 0.0087 (19) | −0.0006 (17) |
| O3 | 0.044 (2) | 0.053 (2) | 0.035 (2) | −0.0111 (18) | 0.0133 (16) | −0.0022 (17) |
| O4 | 0.063 (3) | 0.046 (2) | 0.045 (2) | −0.013 (2) | 0.020 (2) | −0.0057 (19) |
| O5 | 0.048 (2) | 0.038 (2) | 0.055 (3) | 0.0091 (18) | −0.0061 (19) | 0.0007 (18) |
| O6 | 0.043 (2) | 0.033 (2) | 0.075 (3) | 0.0012 (17) | −0.010 (2) | 0.004 (2) |
| O7 | 0.043 (2) | 0.065 (3) | 0.035 (2) | −0.0156 (19) | 0.0043 (17) | 0.0022 (19) |
| O8 | 0.039 (2) | 0.052 (2) | 0.033 (2) | −0.0039 (17) | 0.0066 (16) | 0.0045 (17) |
| O9 | 0.088 (3) | 0.033 (2) | 0.048 (2) | −0.005 (2) | 0.028 (2) | −0.0066 (18) |
| O10 | 0.055 (2) | 0.036 (2) | 0.039 (2) | 0.0071 (17) | 0.0136 (18) | −0.0020 (16) |
| O11 | 0.036 (2) | 0.049 (2) | 0.059 (3) | 0.0001 (18) | 0.0065 (18) | 0.012 (2) |
| O12 | 0.039 (2) | 0.046 (2) | 0.063 (3) | −0.0021 (18) | −0.0071 (19) | 0.013 (2) |
| O13 | 0.0362 (18) | 0.0248 (16) | 0.0294 (17) | −0.0007 (13) | 0.0021 (14) | 0.0022 (13) |
| O14 | 0.055 (2) | 0.031 (2) | 0.054 (3) | −0.0073 (17) | 0.003 (2) | 0.0038 (17) |
| O1w | 0.051 (2) | 0.045 (2) | 0.0296 (19) | 0.0013 (19) | 0.0038 (17) | −0.0049 (17) |
| O2w | 0.046 (2) | 0.043 (2) | 0.032 (2) | 0.0025 (18) | 0.0067 (16) | 0.0062 (17) |
| C1 | 0.049 (3) | 0.035 (3) | 0.037 (3) | 0.007 (2) | 0.013 (2) | 0.000 (2) |
| C2 | 0.101 (5) | 0.039 (3) | 0.048 (4) | 0.032 (3) | 0.020 (4) | 0.004 (3) |
| C3 | 0.040 (3) | 0.038 (3) | 0.032 (3) | 0.001 (2) | 0.011 (2) | 0.002 (2) |
| C4 | 0.052 (4) | 0.080 (5) | 0.052 (4) | −0.019 (3) | 0.027 (3) | −0.009 (3) |
| C5 | 0.036 (3) | 0.039 (3) | 0.051 (3) | 0.004 (2) | 0.005 (2) | 0.009 (3) |
| C6 | 0.046 (4) | 0.038 (3) | 0.145 (8) | 0.011 (3) | −0.010 (4) | 0.016 (4) |
| C7 | 0.030 (2) | 0.044 (3) | 0.042 (3) | −0.005 (2) | 0.008 (2) | −0.005 (2) |
| C8 | 0.047 (3) | 0.067 (4) | 0.065 (4) | −0.015 (3) | 0.016 (3) | 0.000 (3) |
| C9 | 0.040 (3) | 0.034 (3) | 0.036 (3) | 0.002 (2) | 0.001 (2) | −0.005 (2) |
| C10 | 0.060 (4) | 0.045 (3) | 0.047 (3) | 0.006 (3) | 0.013 (3) | −0.012 (3) |
| C11 | 0.033 (3) | 0.043 (3) | 0.045 (3) | 0.006 (2) | 0.004 (2) | −0.004 (2) |
| C12 | 0.038 (3) | 0.063 (4) | 0.069 (4) | 0.002 (3) | −0.002 (3) | 0.012 (3) |
| C13 | 0.154 (9) | 0.108 (7) | 0.138 (8) | −0.014 (7) | −0.003 (7) | 0.030 (7) |
| C14 | 0.152 (8) | 0.112 (7) | 0.154 (9) | −0.030 (6) | 0.039 (7) | 0.032 (7) |
| C15 | 0.188 (9) | 0.082 (6) | 0.136 (8) | −0.059 (6) | 0.013 (7) | 0.009 (6) |
| C16 | 0.179 (9) | 0.122 (8) | 0.167 (9) | −0.020 (7) | −0.010 (8) | 0.010 (7) |
| Fe1—O13 | 1.841 (3) | O7—C7 | 1.239 (7) |
| Fe1—O7 | 2.004 (4) | O8—C7 | 1.232 (7) |
| Fe1—O1 | 2.045 (4) | O9—C9 | 1.241 (7) |
| Fe1—O5 | 2.052 (4) | O10—C9 | 1.244 (6) |
| Fe1—O3 | 2.092 (4) | O11—C11 | 1.222 (7) |
| Fe1—O1w | 2.116 (4) | O12—C11 | 1.241 (7) |
| Fe2—O13 | 1.852 (3) | O14—C16 | 1.419 (9) |
| Fe2—O12 | 1.991 (4) | O14—C13 | 1.442 (8) |
| Fe2—O9 | 2.012 (4) | O1w—H11 | 0.85 (1) |
| Fe2—O6 | 2.026 (4) | O1w—H12 | 0.85 (1) |
| Fe2—O4 | 2.058 (4) | O2w—H21 | 0.85 (1) |
| Fe2—O14 | 2.104 (4) | O2w—H22 | 0.85 (1) |
| Fe3—O13 | 2.082 (3) | C1—C2 | 1.528 (8) |
| Fe3—O2 | 2.146 (4) | C2—H2 | 0.98 |
| Fe3—O11 | 2.148 (4) | C3—C4 | 1.541 (8) |
| Fe3—O2w | 2.155 (4) | C4—H4 | 0.98 |
| Fe3—O10 | 2.178 (4) | C5—C6 | 1.516 (8) |
| Fe3—O8 | 2.216 (4) | C6—H6 | 0.98 |
| Cl1—C2 | 1.773 (8) | C7—C8 | 1.542 (8) |
| Cl2—C2 | 1.740 (9) | C8—H8 | 0.98 |
| Cl3—C4 | 1.725 (8) | C9—C10 | 1.534 (8) |
| Cl4—C4 | 1.781 (9) | C10—H10 | 0.98 |
| Cl5—C6 | 1.740 (10) | C11—C12 | 1.538 (8) |
| Cl6—C6 | 1.774 (10) | C12—H12a | 0.98 |
| Cl7—C8 | 1.779 (8) | C13—C14 | 1.519 (9) |
| Cl8—C8 | 1.717 (7) | C13—H13A | 0.97 |
| Cl9—C10 | 1.736 (7) | C13—H13B | 0.97 |
| Cl10—C10 | 1.751 (7) | C14—C15 | 1.493 (9) |
| Cl11—C12 | 1.751 (8) | C14—H14A | 0.97 |
| Cl12—C12 | 1.752 (8) | C14—H14B | 0.97 |
| O1—C1 | 1.250 (7) | C15—C16 | 1.521 (9) |
| O2—C1 | 1.217 (7) | C15—H15A | 0.97 |
| O3—C3 | 1.240 (6) | C15—H15B | 0.97 |
| O4—C3 | 1.226 (7) | C16—H16A | 0.97 |
| O5—C5 | 1.236 (7) | C16—H16B | 0.97 |
| O6—C5 | 1.240 (7) | ||
| O13—Fe1—O7 | 100.17 (16) | Cl2—C2—Cl1 | 111.0 (4) |
| O13—Fe1—O1 | 98.93 (16) | C1—C2—H2 | 108.3 |
| O7—Fe1—O1 | 89.64 (19) | Cl2—C2—H2 | 108.3 |
| O13—Fe1—O5 | 95.75 (16) | Cl1—C2—H2 | 108.3 |
| O7—Fe1—O5 | 89.80 (19) | O4—C3—O3 | 128.6 (5) |
| O1—Fe1—O5 | 165.17 (16) | O4—C3—C4 | 117.0 (5) |
| O13—Fe1—O3 | 94.81 (15) | O3—C3—C4 | 114.4 (5) |
| O7—Fe1—O3 | 164.61 (16) | C3—C4—Cl3 | 112.5 (5) |
| O1—Fe1—O3 | 84.53 (18) | C3—C4—Cl4 | 106.3 (5) |
| O5—Fe1—O3 | 92.22 (18) | Cl3—C4—Cl4 | 110.5 (4) |
| O13—Fe1—O1w | 176.02 (16) | C3—C4—H4 | 109.1 |
| O7—Fe1—O1w | 83.07 (16) | Cl3—C4—H4 | 109.1 |
| O1—Fe1—O1w | 83.33 (17) | Cl4—C4—H4 | 109.1 |
| O5—Fe1—O1w | 81.89 (17) | O5—C5—O6 | 128.3 (5) |
| O3—Fe1—O1w | 82.11 (16) | O5—C5—C6 | 115.3 (5) |
| O13—Fe2—O12 | 98.58 (16) | O6—C5—C6 | 116.4 (6) |
| O13—Fe2—O9 | 97.57 (16) | C5—C6—Cl5 | 107.9 (6) |
| O12—Fe2—O9 | 90.9 (2) | C5—C6—Cl6 | 111.4 (6) |
| O13—Fe2—O6 | 94.49 (16) | Cl5—C6—Cl6 | 109.1 (4) |
| O12—Fe2—O6 | 166.89 (17) | C5—C6—H6 | 109.5 |
| O9—Fe2—O6 | 88.4 (2) | Cl5—C6—H6 | 109.5 |
| O13—Fe2—O4 | 94.61 (16) | Cl6—C6—H6 | 109.5 |
| O12—Fe2—O4 | 87.6 (2) | O8—C7—O7 | 128.3 (5) |
| O9—Fe2—O4 | 167.81 (17) | O8—C7—C8 | 121.0 (5) |
| O6—Fe2—O4 | 90.4 (2) | O7—C7—C8 | 110.7 (5) |
| O13—Fe2—O14 | 175.47 (16) | C7—C8—Cl8 | 114.3 (5) |
| O12—Fe2—O14 | 84.51 (17) | C7—C8—Cl7 | 105.4 (5) |
| O9—Fe2—O14 | 85.66 (17) | Cl8—C8—Cl7 | 110.5 (4) |
| O6—Fe2—O14 | 82.38 (16) | C7—C8—H8 | 108.8 |
| O4—Fe2—O14 | 82.17 (17) | Cl8—C8—H8 | 108.8 |
| O13—Fe3—O2 | 91.27 (14) | Cl7—C8—H8 | 108.8 |
| O13—Fe3—O11 | 94.02 (15) | O9—C9—O10 | 127.3 (5) |
| O2—Fe3—O11 | 96.35 (18) | O9—C9—C10 | 113.6 (5) |
| O13—Fe3—O2w | 177.25 (15) | O10—C9—C10 | 119.1 (5) |
| O2—Fe3—O2w | 86.15 (16) | C9—C10—Cl9 | 113.7 (4) |
| O11—Fe3—O2w | 87.23 (16) | C9—C10—Cl10 | 111.5 (4) |
| O13—Fe3—O10 | 92.63 (14) | Cl9—C10—Cl10 | 111.7 (4) |
| O2—Fe3—O10 | 172.53 (16) | C9—C10—H10 | 106.5 |
| O11—Fe3—O10 | 89.72 (17) | Cl9—C10—H10 | 106.5 |
| O2w—Fe3—O10 | 89.82 (15) | Cl10—C10—H10 | 106.5 |
| O13—Fe3—O8 | 93.57 (14) | O11—C11—O12 | 129.2 (5) |
| O2—Fe3—O8 | 85.85 (17) | O11—C11—C12 | 115.5 (5) |
| O11—Fe3—O8 | 172.04 (15) | O12—C11—C12 | 115.3 (5) |
| O2w—Fe3—O8 | 85.28 (15) | C11—C12—Cl11 | 111.3 (5) |
| O10—Fe3—O8 | 87.56 (15) | C11—C12—Cl12 | 107.9 (5) |
| C1—O1—Fe1 | 128.2 (4) | Cl11—C12—Cl12 | 111.4 (4) |
| C1—O2—Fe3 | 134.2 (4) | C11—C12—H12a | 108.7 |
| C3—O3—Fe1 | 129.1 (3) | Cl11—C12—H12a | 108.7 |
| C3—O4—Fe2 | 130.9 (4) | Cl12—C12—H12a | 108.7 |
| C5—O5—Fe1 | 128.3 (4) | O14—C13—C14 | 106.2 (8) |
| C5—O6—Fe2 | 132.2 (4) | O14—C13—H13A | 110.5 |
| C7—O7—Fe1 | 134.5 (4) | C14—C13—H13A | 110.5 |
| C7—O8—Fe3 | 128.0 (3) | O14—C13—H13B | 110.5 |
| C9—O9—Fe2 | 135.5 (4) | C14—C13—H13B | 110.5 |
| C9—O10—Fe3 | 128.8 (4) | H13A—C13—H13B | 108.7 |
| C11—O11—Fe3 | 130.0 (4) | C15—C14—C13 | 97.9 (9) |
| C11—O12—Fe2 | 132.6 (4) | C15—C14—H14A | 112.2 |
| Fe1—O13—Fe2 | 123.79 (18) | C13—C14—H14A | 112.2 |
| Fe1—O13—Fe3 | 118.50 (16) | C15—C14—H14B | 112.2 |
| Fe2—O13—Fe3 | 117.70 (17) | C13—C14—H14B | 112.2 |
| C16—O14—C13 | 108.7 (7) | H14A—C14—H14B | 109.8 |
| C16—O14—Fe2 | 127.9 (5) | C14—C15—C16 | 103.8 (10) |
| C13—O14—Fe2 | 123.3 (5) | C14—C15—H15A | 111.0 |
| Fe1—O1w—H11 | 121 (4) | C16—C15—H15A | 111.0 |
| Fe1—O1w—H12 | 124 (4) | C14—C15—H15B | 111.0 |
| H11—O1w—H12 | 107.6 (17) | C16—C15—H15B | 111.0 |
| Fe3—O2w—H21 | 119 (6) | H15A—C15—H15B | 109.0 |
| Fe3—O2w—H22 | 114 (7) | O14—C16—C15 | 104.4 (8) |
| H21—O2w—H22 | 107.5 (18) | O14—C16—H16A | 110.9 |
| O2—C1—O1 | 129.0 (5) | C15—C16—H16A | 110.9 |
| O2—C1—C2 | 114.4 (5) | O14—C16—H16B | 110.9 |
| O1—C1—C2 | 116.5 (5) | C15—C16—H16B | 110.9 |
| C1—C2—Cl2 | 110.8 (5) | H16A—C16—H16B | 108.9 |
| C1—C2—Cl1 | 110.0 (5) | ||
| O13—Fe1—O1—C1 | 30.2 (5) | O3—Fe1—O13—Fe3 | −134.8 (2) |
| O7—Fe1—O1—C1 | −70.1 (5) | O12—Fe2—O13—Fe1 | −135.3 (2) |
| O5—Fe1—O1—C1 | −157.9 (6) | O9—Fe2—O13—Fe1 | 132.7 (2) |
| O3—Fe1—O1—C1 | 124.2 (5) | O6—Fe2—O13—Fe1 | 43.7 (3) |
| O1w—Fe1—O1—C1 | −153.2 (5) | O4—Fe2—O13—Fe1 | −47.0 (3) |
| O13—Fe3—O2—C1 | −14.5 (6) | O12—Fe2—O13—Fe3 | 45.9 (2) |
| O11—Fe3—O2—C1 | −108.7 (6) | O9—Fe2—O13—Fe3 | −46.1 (2) |
| O2w—Fe3—O2—C1 | 164.6 (6) | O6—Fe2—O13—Fe3 | −135.1 (2) |
| O8—Fe3—O2—C1 | 79.0 (6) | O4—Fe2—O13—Fe3 | 134.2 (2) |
| O13—Fe1—O3—C3 | −16.7 (5) | O2—Fe3—O13—Fe1 | 43.2 (2) |
| O7—Fe1—O3—C3 | 176.6 (6) | O11—Fe3—O13—Fe1 | 139.6 (2) |
| O1—Fe1—O3—C3 | −115.2 (5) | O10—Fe3—O13—Fe1 | −130.5 (2) |
| O5—Fe1—O3—C3 | 79.3 (5) | O8—Fe3—O13—Fe1 | −42.8 (2) |
| O1w—Fe1—O3—C3 | 160.8 (5) | O2—Fe3—O13—Fe2 | −138.0 (2) |
| O13—Fe2—O4—C3 | 18.4 (6) | O11—Fe3—O13—Fe2 | −41.5 (2) |
| O12—Fe2—O4—C3 | 116.8 (6) | O10—Fe3—O13—Fe2 | 48.4 (2) |
| O9—Fe2—O4—C3 | −160.3 (8) | O8—Fe3—O13—Fe2 | 136.1 (2) |
| O6—Fe2—O4—C3 | −76.2 (6) | O12—Fe2—O14—C13 | 139.5 (9) |
| O14—Fe2—O4—C3 | −158.4 (6) | O9—Fe2—O14—C13 | −129.2 (9) |
| O13—Fe1—O5—C5 | 19.9 (5) | O6—Fe2—O14—C13 | −40.2 (9) |
| O7—Fe1—O5—C5 | 120.1 (5) | O4—Fe2—O14—C13 | 51.2 (9) |
| O1—Fe1—O5—C5 | −152.1 (7) | Fe3—O2—C1—O1 | −4.6 (10) |
| O3—Fe1—O5—C5 | −75.2 (5) | Fe3—O2—C1—C2 | 176.5 (5) |
| O1w—Fe1—O5—C5 | −156.9 (5) | Fe1—O1—C1—C2 | 175.7 (4) |
| O13—Fe2—O6—C5 | −13.1 (6) | O2—C1—C2—Cl2 | 114.7 (6) |
| O12—Fe2—O6—C5 | 162.4 (8) | O1—C1—C2—Cl2 | −64.4 (7) |
| O9—Fe2—O6—C5 | −110.6 (6) | O2—C1—C2—Cl1 | −122.3 (5) |
| O4—Fe2—O6—C5 | 81.6 (6) | O1—C1—C2—Cl1 | 58.7 (7) |
| O14—Fe2—O6—C5 | 163.6 (6) | Fe2—O4—C3—C4 | −172.8 (5) |
| O13—Fe1—O7—C7 | −23.4 (6) | Fe1—O3—C3—O4 | −7.7 (9) |
| O1—Fe1—O7—C7 | 75.7 (6) | Fe1—O3—C3—C4 | 171.8 (4) |
| O5—Fe1—O7—C7 | −119.2 (6) | O4—C3—C4—Cl3 | −41.7 (8) |
| O3—Fe1—O7—C7 | 143.2 (6) | O3—C3—C4—Cl3 | 138.7 (5) |
| O1w—Fe1—O7—C7 | 159.0 (6) | O4—C3—C4—Cl4 | 79.4 (6) |
| O13—Fe3—O8—C7 | 28.5 (5) | O3—C3—C4—Cl4 | −100.2 (5) |
| O2—Fe3—O8—C7 | −62.6 (5) | Fe1—O5—C5—C6 | −173.3 (5) |
| O2w—Fe3—O8—C7 | −149.0 (5) | Fe2—O6—C5—C6 | 169.0 (5) |
| O10—Fe3—O8—C7 | 120.9 (5) | O5—C5—C6—Cl5 | −97.9 (6) |
| O13—Fe2—O9—C9 | 18.2 (6) | O6—C5—C6—Cl5 | 82.8 (7) |
| O12—Fe2—O9—C9 | −80.6 (6) | O5—C5—C6—Cl6 | 142.3 (5) |
| O6—Fe2—O9—C9 | 112.5 (6) | O6—C5—C6—Cl6 | −37.0 (8) |
| O4—Fe2—O9—C9 | −163.2 (8) | Fe3—O8—C7—O7 | −13.7 (9) |
| O14—Fe2—O9—C9 | −165.0 (6) | Fe3—O8—C7—C8 | 165.3 (4) |
| O13—Fe3—O10—C9 | −25.7 (5) | Fe1—O7—C7—C8 | −169.9 (5) |
| O11—Fe3—O10—C9 | 68.3 (5) | O8—C7—C8—Cl8 | 20.3 (8) |
| O2w—Fe3—O10—C9 | 155.5 (5) | O7—C7—C8—Cl8 | −160.5 (5) |
| O8—Fe3—O10—C9 | −119.2 (5) | O8—C7—C8—Cl7 | −101.2 (6) |
| O13—Fe3—O11—C11 | 17.7 (5) | O7—C7—C8—Cl7 | 78.0 (6) |
| O2—Fe3—O11—C11 | 109.4 (5) | Fe2—O9—C9—C10 | −171.7 (5) |
| O2w—Fe3—O11—C11 | −164.8 (5) | Fe3—O10—C9—O9 | 1.0 (9) |
| O10—Fe3—O11—C11 | −74.9 (5) | Fe3—O10—C9—C10 | 178.3 (4) |
| O13—Fe2—O12—C11 | −30.9 (6) | O9—C9—C10—Cl9 | −171.3 (5) |
| O9—Fe2—O12—C11 | 66.9 (6) | O10—C9—C10—Cl9 | 11.0 (7) |
| O6—Fe2—O12—C11 | 153.6 (8) | O9—C9—C10—Cl10 | −44.0 (7) |
| O4—Fe2—O12—C11 | −125.2 (6) | O10—C9—C10—Cl10 | 138.4 (5) |
| O14—Fe2—O12—C11 | 152.4 (6) | Fe3—O11—C11—C12 | 176.9 (4) |
| O7—Fe1—O13—Fe2 | −137.2 (2) | Fe2—O12—C11—C12 | −170.4 (4) |
| O1—Fe1—O13—Fe2 | 131.6 (2) | O11—C11—C12—Cl11 | 131.1 (5) |
| O5—Fe1—O13—Fe2 | −46.3 (2) | O12—C11—C12—Cl11 | −49.9 (7) |
| O3—Fe1—O13—Fe2 | 46.4 (2) | O11—C11—C12—Cl12 | −106.4 (6) |
| O7—Fe1—O13—Fe3 | 41.6 (2) | O12—C11—C12—Cl12 | 72.7 (6) |
| O1—Fe1—O13—Fe3 | −49.6 (2) | Fe2—O14—C13—C14 | −157.0 (8) |
| O5—Fe1—O13—Fe3 | 132.5 (2) | Fe2—O14—C16—C15 | −175.9 (8) |
| D—H···A | D—H | H···A | D···A | D—H···A |
| O1w—H11···O3i | 0.85 (1) | 2.01 (3) | 2.809 (6) | 158 (5) |
| O2w—H22···O8ii | 0.85 (1) | 2.06 (4) | 2.821 (5) | 149 (7) |
| O2W—H21···O10ii | 0.84 (6) | 2.19 (7) | 2.950 (6) | 150 (6) |
| O1W—H12···Cl1i | 0.85 (3) | 2.47 (4) | 3.288 (4) | 160 (6) |
| Symmetry codes: (i) −x+1, −y+1, −z; (ii) −x+1, −y+1, −z+1. |
Experimental details
| Crystal data | |
| Chemical formula | [Fe2Mn(C2HCl2O2)6O(C4H8O)(H2O)2] |
| Mr | 1058.34 |
| Crystal system, space group | Triclinic, P1 |
| Temperature (K) | 295 |
| a, b, c (Å) | 9.380 (1), 13.316 (1), 15.432 (1) |
| α, β, γ (°) | 90.131 (1), 100.067 (1), 97.677 (1) |
| V (Å3) | 1880.1 (2) |
| Z | 2 |
| Radiation type | Mo Kα |
| µ (mm−1) | 2.01 |
| Crystal size (mm) | 0.35 × 0.15 × 0.15 |
| Data collection | |
| Diffractometer | Bruker SMART APEX diffractometer |
| Absorption correction | Multi-scan (SADABS; Sheldrick, 1996) |
| Tmin, Tmax | 0.540, 0.753 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 15425, 8543, 5788 |
| Rint | 0.025 |
| (sin θ/λ)max (Å−1) | 0.650 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.063, 0.207, 1.03 |
| No. of reflections | 8543 |
| No. of parameters | 440 |
| No. of restraints | 35 |
| H-atom treatment | H atoms treated by a mixture of independent and constrained refinement |
| Δρmax, Δρmin (e Å−3) | 1.64, −0.90 |
Computer programs: APEX2 (Bruker, 2008), SAINT (Bruker, 2008), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), X-SEED (Barbour, 2001), publCIF (Westrip, 2010).
| D—H···A | D—H | H···A | D···A | D—H···A |
| O1w—H11···O3i | 0.85 (1) | 2.01 (3) | 2.809 (6) | 158 (5) |
| O2w—H22···O8ii | 0.85 (1) | 2.06 (4) | 2.821 (5) | 149 (7) |
| O2W—H21···O10ii | 0.84 (6) | 2.19 (7) | 2.950 (6) | 150 (6) |
| O1W—H12···Cl1i | 0.85 (3) | 2.47 (4) | 3.288 (4) | 160 (6) |
| Symmetry codes: (i) −x+1, −y+1, −z; (ii) −x+1, −y+1, −z+1. |
Acknowledgements
The authors thank Shahid Beheshti University and the University of Malaya for supporting this study.
References
Amini, M. M., Yadavi, M. & Ng, S. W. (2004a). Acta Cryst. E60, m492–m494. Web of Science CSD CrossRef IUCr Journals Google Scholar
Amini, M. M., Yadavi, M. & Ng, S. W. (2004b). Acta Cryst. E60, m495–m497. Web of Science CSD CrossRef IUCr Journals Google Scholar
Barbour, L. J. (2001). J. Supramol. Chem. 1, 189–191. CrossRef CAS Google Scholar
Bruker (2008). APEX2 and SAINT. Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
Sheldrick, G. M. (1996). SADABS. University of Göttingen, Germany. Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Westrip, S. P. (2010). publCIF. In preparation. Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
![[P \overline 1] Mathematical equation](teximages/ci2991fi1.gif)
![[Figure 1]](./ci2991fig1thm.gif)



