|
Figure 1 Anisotropic displacement ellipsoid plot (Barbour, 2001) of SnCl2(C4H9)(C19H21N4S).CHCl3 at the 50% probability level; hydrogen atoms are drawn as spheres of arbitrary radius. The disorder in the chloroform molecule is not shown. |
|
Figure 1 Anisotropic displacement ellipsoid plot (Barbour, 2001) of SnCl2(C4H9)(C19H21N4S).CHCl3 at the 50% probability level; hydrogen atoms are drawn as spheres of arbitrary radius. The disorder in the chloroform molecule is not shown. |