metal-organic compounds
n-Butyldichlorido{4-cyclohexyl-1-[phenyl(2-pyridyl-κN)methylene]thiosemicarbazidato-κ2N1,S}tin(IV) chloroform monosolvate
aFaculty of Resource Science and Technology, Universiti Malaysia Sarawak, 94300 Kota Samarahan, Sarawak, Malaysia, bSchool of Chemical Sciences and Food Technology, Universiti Kebangsaan Malaysia, 43600 Bangi, Malaysia, and cDepartment of Chemistry, University of Malaya, 50603 Kuala Lumpur, Malaysia
*Correspondence e-mail: [email protected]
The monodeprotonated Schiff base ligand in the title compound, [Sn(C4H9)(C19H21N4S)Cl2]·CHCl3, N,N′,S-chelates to the Sn atom, which is six-coordinated in an octahedral environment. The three coordinating atoms along with the butyl C atom comprise a square plane, above and below which are positioned the Cl atoms. The amino group is a hydrogen-bond donor to a Cl atom of an adjacent molecule, the hydrogen bond giving rise to a helical chain propagating in [010]. The Cl and H atoms of the chloroform molecule are disordered over two positions in an 0.67:0.33 ratio.
Related literature
For the crystal structures of other metal derivatives of the Schiff base, see: Joseph et al. (2004
).
Experimental
Crystal data
|
Refinement
|
| ||||||||||||||||
| |||||||||||||||||
Data collection: APEX2 (Bruker, 2009
); cell refinement: SAINT (Bruker, 2009
); data reduction: SAINT; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: X-SEED (Barbour, 2001
); software used to prepare material for publication: publCIF (Westrip, 2010
).
Supporting information
contains datablocks global, I. DOI: https://doi.org/10.1107/S1600536810014455/bt5251sup1.cif
Structure factors: contains datablock I. DOI: https://doi.org/10.1107/S1600536810014455/bt5251Isup2.hkl
2-Benzoylpyridine 4-cyclohexyl thiosemicarbazone was synthesized by using a literature method (Joseph et al., 2004). The compound (0.34 g, 1 mmol) was dissolved in dry methanol (10 ml) in a Schlenk apparatus under a nitrogen atmosphere. n-Butyltin trichoride (0.28 g, 1 mmol) dissolved in methanol (10 ml) was added. The mixture was heated for an hour. The solvent was removed and the yellow compound recrystallized from chloroform/methanol (1:1) in 70% yield, m.p. 478-480 K.
Hydrogen atoms were placed in calculated positions (C—H 0.93 to 0.97, N–H 0.86 Å) and were included in the in the riding model approximation, with U(H) set to 1.2 to 1.5Ueq(C).
For the butyl chain and cyclohexyl ring, the 1,2 carbon-carbon distances were restrained to 1.54±0.01 Å and the 1,3 ones to 2.51±0.01 Å. The anisotropic displacement ellipsoids of the Cβ, Cγ and Cδ atoms of the chain were restrained to be nearly isotropic.
The solvent molecule is disodered over two positions. The occupancy could not be refined, and was estimated by an examination of their temperature factors to be a 2:1 disorder. The six carbon-chlorine distances were restrained to within 0.01 Å of each other, as were the pairs of chlorine-chlorine distances. The anisotropic temperature factors were similar restrained to be nearly isotropic.
The final difference Fourier map had a peak/hole in the vicinity of the solvent molecule.
The mono-deprotonated anion of 2-benzoylpyridine 4-cyclohexyl thiosemicarbazone is a ligand that N,N',S-binds to metal atoms (Joseph et al., 2004). Whereas similar ligands have been complexed with diorganotin and triorganotin systems, the monoorganotin analogs have not been so extensively studied. The mono-deprotonated Schiff-base ligand in SnCl2(C4H9)(C19H12N4S).CHCl3 N,N',S-chelates to the tin atom, which is six-coordinate in an octahedral environment (Scheme I, Fig. 1). The three coordinating atoms along with the ipso-butyl carbon comprise a square plane, above and below which are positioned the chlorine atoms.
For the crystal structures of other metal derivatives of the Schiff base, see: Joseph et al. (2004).
Data collection: APEX2 (Bruker, 2009); cell SAINT (Bruker, 2009); data reduction: SAINT (Bruker, 2009); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: X-SEED (Barbour, 2001); software used to prepare material for publication: publCIF (Westrip, 2010).
| [Sn(C4H9)(C19H21N4S)Cl2]·CHCl3 | F(000) = 1416 |
| Mr = 703.53 | Dx = 1.495 Mg m−3 |
| Monoclinic, P21/n | Mo Kα radiation, λ = 0.71073 Å |
| Hall symbol: -P 2yn | Cell parameters from 8312 reflections |
| a = 14.5095 (9) Å | θ = 2.3–24.6° |
| b = 13.7308 (8) Å | µ = 1.33 mm−1 |
| c = 15.7412 (10) Å | T = 293 K |
| β = 94.418 (1)° | Prism, orange |
| V = 3126.8 (3) Å3 | 0.40 × 0.30 × 0.20 mm |
| Z = 4 |
| Bruker SMART APEX diffractometer | 7179 independent reflections |
| Radiation source: fine-focus sealed tube | 5127 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.032 |
| ω scans | θmax = 27.5°, θmin = 1.8° |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | h = −18→18 |
| Tmin = 0.618, Tmax = 0.777 | k = −17→17 |
| 29403 measured reflections | l = −20→19 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.058 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.202 | H-atom parameters constrained |
| S = 1.10 | w = 1/[σ2(Fo2) + (0.1058P)2 + 5.4806P] where P = (Fo2 + 2Fc2)/3 |
| 7179 reflections | (Δ/σ)max = 0.001 |
| 332 parameters | Δρmax = 1.48 e Å−3 |
| 105 restraints | Δρmin = −1.14 e Å−3 |
| [Sn(C4H9)(C19H21N4S)Cl2]·CHCl3 | V = 3126.8 (3) Å3 |
| Mr = 703.53 | Z = 4 |
| Monoclinic, P21/n | Mo Kα radiation |
| a = 14.5095 (9) Å | µ = 1.33 mm−1 |
| b = 13.7308 (8) Å | T = 293 K |
| c = 15.7412 (10) Å | 0.40 × 0.30 × 0.20 mm |
| β = 94.418 (1)° |
| Bruker SMART APEX diffractometer | 7179 independent reflections |
| Absorption correction: multi-scan (SADABS; Sheldrick, 1996) | 5127 reflections with I > 2σ(I) |
| Tmin = 0.618, Tmax = 0.777 | Rint = 0.032 |
| 29403 measured reflections |
| R[F2 > 2σ(F2)] = 0.058 | 105 restraints |
| wR(F2) = 0.202 | H-atom parameters constrained |
| S = 1.10 | Δρmax = 1.48 e Å−3 |
| 7179 reflections | Δρmin = −1.14 e Å−3 |
| 332 parameters |
| x | y | z | Uiso*/Ueq | Occ. (<1) | |
| Sn1 | 0.64810 (3) | 0.58870 (3) | 0.13740 (3) | 0.04946 (18) | |
| Cl1 | 0.66887 (14) | 0.53556 (13) | 0.29057 (11) | 0.0682 (5) | |
| Cl2 | 0.65057 (13) | 0.61135 (14) | −0.01975 (11) | 0.0670 (4) | |
| Cl3 | 0.8024 (6) | 0.4670 (4) | 0.4790 (4) | 0.168 (3) | 0.67 |
| Cl4 | 0.9050 (5) | 0.3830 (5) | 0.6208 (4) | 0.154 (2) | 0.67 |
| Cl5 | 0.7217 (6) | 0.3399 (7) | 0.5849 (7) | 0.251 (4) | 0.67 |
| Cl3' | 0.7344 (11) | 0.4338 (15) | 0.5063 (12) | 0.225 (9) | 0.33 |
| Cl4' | 0.9232 (11) | 0.4198 (17) | 0.4959 (12) | 0.282 (11) | 0.33 |
| Cl5' | 0.8460 (14) | 0.3630 (19) | 0.6443 (6) | 0.271 (13) | 0.33 |
| S1 | 0.70794 (10) | 0.75442 (11) | 0.16994 (11) | 0.0531 (4) | |
| N1 | 0.6704 (4) | 0.4298 (3) | 0.1105 (3) | 0.0500 (11) | |
| N2 | 0.7996 (3) | 0.5648 (4) | 0.1381 (3) | 0.0458 (10) | |
| N3 | 0.8608 (3) | 0.6390 (3) | 0.1461 (3) | 0.0518 (12) | |
| N4 | 0.8811 (4) | 0.8021 (4) | 0.1619 (4) | 0.0697 (16) | |
| H4 | 0.8588 | 0.8578 | 0.1745 | 0.084* | |
| C1 | 0.5004 (5) | 0.5961 (6) | 0.1334 (6) | 0.077 (2) | |
| H1A | 0.4766 | 0.6069 | 0.0749 | 0.092* | |
| H1B | 0.4773 | 0.5335 | 0.1509 | 0.092* | |
| C2 | 0.4634 (6) | 0.6725 (9) | 0.1871 (9) | 0.133 (4) | |
| H2A | 0.4890 | 0.7341 | 0.1702 | 0.159* | |
| H2B | 0.4876 | 0.6604 | 0.2453 | 0.159* | |
| C3 | 0.3626 (7) | 0.6855 (10) | 0.1881 (10) | 0.152 (5) | |
| H3A | 0.3493 | 0.6944 | 0.2471 | 0.182* | |
| H3B | 0.3470 | 0.7462 | 0.1589 | 0.182* | |
| C4 | 0.2979 (9) | 0.6108 (13) | 0.1514 (13) | 0.209 (8) | |
| H4A | 0.2355 | 0.6335 | 0.1535 | 0.314* | |
| H4B | 0.3059 | 0.5516 | 0.1836 | 0.314* | |
| H4C | 0.3101 | 0.5987 | 0.0933 | 0.314* | |
| C5 | 0.6025 (5) | 0.3647 (5) | 0.0968 (5) | 0.0636 (17) | |
| H5 | 0.5415 | 0.3860 | 0.0928 | 0.076* | |
| C6 | 0.6202 (5) | 0.2677 (5) | 0.0883 (5) | 0.0712 (19) | |
| H6 | 0.5718 | 0.2239 | 0.0774 | 0.085* | |
| C7 | 0.7096 (6) | 0.2356 (5) | 0.0961 (5) | 0.0706 (19) | |
| H7 | 0.7228 | 0.1696 | 0.0914 | 0.085* | |
| C8 | 0.7794 (5) | 0.3018 (4) | 0.1109 (4) | 0.0576 (15) | |
| H8 | 0.8406 | 0.2810 | 0.1172 | 0.069* | |
| C9 | 0.7591 (4) | 0.3990 (4) | 0.1165 (4) | 0.0486 (13) | |
| C10 | 0.8304 (4) | 0.4756 (4) | 0.1303 (4) | 0.0484 (13) | |
| C11 | 0.9298 (2) | 0.4507 (3) | 0.1343 (3) | 0.0560 (15) | |
| C12 | 0.9676 (3) | 0.4104 (4) | 0.0638 (3) | 0.0686 (18) | |
| H12 | 0.9305 | 0.3991 | 0.0140 | 0.082* | |
| C13 | 1.0611 (4) | 0.3869 (4) | 0.0678 (4) | 0.088 (3) | |
| H13 | 1.0864 | 0.3599 | 0.0207 | 0.106* | |
| C14 | 1.1167 (3) | 0.4038 (5) | 0.1423 (5) | 0.106 (4) | |
| H14 | 1.1792 | 0.3880 | 0.1450 | 0.127* | |
| C15 | 1.0788 (3) | 0.4441 (6) | 0.2127 (4) | 0.123 (4) | |
| H15 | 1.1160 | 0.4554 | 0.2625 | 0.148* | |
| C16 | 0.9854 (4) | 0.4676 (5) | 0.2087 (3) | 0.087 (3) | |
| H16 | 0.9601 | 0.4946 | 0.2559 | 0.105* | |
| C17 | 0.8230 (4) | 0.7263 (4) | 0.1580 (4) | 0.0515 (13) | |
| C18 | 0.9787 (4) | 0.7986 (5) | 0.1466 (5) | 0.072 (2) | |
| H18 | 0.9957 | 0.7311 | 0.1350 | 0.087* | |
| C19 | 1.0359 (5) | 0.8338 (9) | 0.2262 (5) | 0.107 (3) | |
| H19A | 1.0171 | 0.8994 | 0.2399 | 0.128* | |
| H19B | 1.0243 | 0.7920 | 0.2739 | 0.128* | |
| C20 | 1.1388 (5) | 0.8330 (11) | 0.2126 (6) | 0.136 (5) | |
| H20A | 1.1731 | 0.8598 | 0.2626 | 0.163* | |
| H20B | 1.1590 | 0.7663 | 0.2058 | 0.163* | |
| C21 | 1.1596 (6) | 0.8913 (9) | 0.1353 (7) | 0.121 (5) | |
| H21A | 1.1484 | 0.9597 | 0.1460 | 0.145* | |
| H21B | 1.2245 | 0.8839 | 0.1257 | 0.145* | |
| C22 | 1.1017 (6) | 0.8603 (10) | 0.0562 (6) | 0.129 (4) | |
| H22A | 1.1201 | 0.7955 | 0.0395 | 0.155* | |
| H22B | 1.1120 | 0.9046 | 0.0099 | 0.155* | |
| C23 | 0.9983 (5) | 0.8599 (10) | 0.0720 (7) | 0.110 (3) | |
| H23A | 0.9783 | 0.9261 | 0.0817 | 0.132* | |
| H23B | 0.9629 | 0.8355 | 0.0216 | 0.132* | |
| C24 | 0.8274 (6) | 0.3624 (8) | 0.5359 (6) | 0.134 (4) | |
| H24 | 0.8452 | 0.3083 | 0.5000 | 0.161* | 0.67 |
| H24' | 0.8185 | 0.2966 | 0.5127 | 0.161* | 0.33 |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Sn1 | 0.0436 (3) | 0.0431 (3) | 0.0616 (3) | −0.00057 (16) | 0.00317 (18) | 0.00019 (17) |
| Cl1 | 0.0875 (12) | 0.0550 (9) | 0.0624 (10) | −0.0180 (8) | 0.0071 (8) | 0.0049 (7) |
| Cl2 | 0.0722 (11) | 0.0693 (10) | 0.0584 (9) | −0.0024 (8) | −0.0024 (8) | 0.0029 (8) |
| Cl3 | 0.247 (7) | 0.095 (3) | 0.162 (5) | 0.047 (4) | 0.004 (5) | 0.012 (3) |
| Cl4 | 0.142 (4) | 0.179 (5) | 0.132 (4) | 0.034 (4) | −0.037 (4) | −0.043 (4) |
| Cl5 | 0.218 (7) | 0.239 (8) | 0.300 (9) | 0.027 (7) | 0.053 (7) | −0.020 (7) |
| Cl3' | 0.212 (12) | 0.233 (12) | 0.229 (12) | 0.036 (9) | −0.001 (9) | −0.021 (9) |
| Cl4' | 0.286 (14) | 0.267 (14) | 0.286 (14) | −0.009 (10) | −0.019 (10) | 0.005 (10) |
| Cl5' | 0.283 (16) | 0.277 (15) | 0.253 (15) | −0.022 (10) | 0.017 (10) | −0.010 (10) |
| S1 | 0.0492 (8) | 0.0414 (7) | 0.0698 (10) | 0.0030 (6) | 0.0113 (7) | −0.0050 (7) |
| N1 | 0.048 (3) | 0.042 (2) | 0.059 (3) | −0.004 (2) | −0.003 (2) | 0.000 (2) |
| N2 | 0.045 (2) | 0.042 (2) | 0.050 (3) | −0.0014 (19) | 0.000 (2) | 0.000 (2) |
| N3 | 0.046 (3) | 0.037 (2) | 0.073 (3) | −0.001 (2) | 0.008 (2) | −0.008 (2) |
| N4 | 0.055 (3) | 0.040 (3) | 0.116 (5) | −0.004 (2) | 0.024 (3) | −0.019 (3) |
| C1 | 0.048 (4) | 0.092 (6) | 0.091 (6) | 0.002 (4) | 0.008 (4) | −0.011 (4) |
| C2 | 0.087 (6) | 0.132 (8) | 0.179 (9) | 0.019 (6) | 0.010 (6) | −0.048 (7) |
| C3 | 0.112 (7) | 0.152 (9) | 0.193 (9) | 0.022 (7) | 0.020 (7) | −0.049 (8) |
| C4 | 0.189 (11) | 0.206 (12) | 0.236 (12) | 0.013 (9) | 0.029 (9) | −0.030 (9) |
| C5 | 0.062 (4) | 0.052 (4) | 0.075 (4) | −0.006 (3) | −0.002 (3) | −0.002 (3) |
| C6 | 0.070 (4) | 0.055 (4) | 0.087 (5) | −0.018 (3) | −0.001 (4) | −0.004 (4) |
| C7 | 0.089 (5) | 0.041 (3) | 0.081 (5) | −0.008 (3) | −0.001 (4) | −0.002 (3) |
| C8 | 0.066 (4) | 0.039 (3) | 0.067 (4) | 0.002 (3) | 0.000 (3) | 0.001 (3) |
| C9 | 0.056 (3) | 0.042 (3) | 0.048 (3) | 0.005 (2) | −0.001 (3) | −0.002 (2) |
| C10 | 0.049 (3) | 0.040 (3) | 0.055 (3) | 0.005 (2) | 0.001 (2) | −0.004 (2) |
| C11 | 0.053 (3) | 0.039 (3) | 0.075 (4) | 0.004 (3) | −0.003 (3) | −0.003 (3) |
| C12 | 0.067 (4) | 0.062 (4) | 0.077 (5) | 0.009 (3) | 0.012 (4) | −0.004 (3) |
| C13 | 0.080 (6) | 0.083 (5) | 0.105 (7) | 0.018 (4) | 0.027 (5) | −0.005 (5) |
| C14 | 0.058 (5) | 0.098 (7) | 0.159 (11) | 0.023 (5) | −0.003 (5) | −0.016 (6) |
| C15 | 0.080 (6) | 0.145 (9) | 0.136 (9) | 0.039 (6) | −0.049 (6) | −0.053 (8) |
| C16 | 0.069 (5) | 0.101 (7) | 0.089 (6) | 0.023 (5) | −0.017 (4) | −0.027 (5) |
| C17 | 0.052 (3) | 0.041 (3) | 0.062 (4) | −0.001 (2) | 0.008 (3) | −0.005 (3) |
| C18 | 0.056 (4) | 0.045 (3) | 0.118 (6) | −0.008 (3) | 0.026 (4) | −0.017 (4) |
| C19 | 0.063 (5) | 0.157 (10) | 0.101 (7) | 0.010 (6) | 0.004 (5) | 0.006 (7) |
| C20 | 0.061 (6) | 0.185 (14) | 0.162 (11) | 0.005 (7) | 0.005 (6) | 0.013 (11) |
| C21 | 0.075 (6) | 0.105 (8) | 0.186 (14) | −0.025 (5) | 0.031 (8) | −0.023 (8) |
| C22 | 0.097 (8) | 0.146 (11) | 0.153 (11) | −0.006 (8) | 0.066 (8) | 0.014 (9) |
| C23 | 0.083 (6) | 0.148 (10) | 0.101 (7) | −0.014 (7) | 0.024 (5) | 0.011 (7) |
| C24 | 0.151 (8) | 0.116 (7) | 0.133 (8) | 0.019 (7) | −0.008 (7) | −0.009 (7) |
| Sn1—C1 | 2.142 (7) | C7—C8 | 1.368 (9) |
| Sn1—N1 | 2.250 (5) | C7—H7 | 0.9300 |
| Sn1—N2 | 2.221 (5) | C8—C9 | 1.371 (8) |
| Sn1—S1 | 2.475 (2) | C8—H8 | 0.9300 |
| Sn1—Cl1 | 2.515 (2) | C9—C10 | 1.479 (8) |
| Sn1—Cl2 | 2.496 (2) | C10—C11 | 1.480 (7) |
| Cl3—C24 | 1.715 (8) | C11—C12 | 1.3900 |
| Cl4—C24 | 1.704 (8) | C11—C16 | 1.3900 |
| Cl5—C24 | 1.795 (8) | C12—C13 | 1.3900 |
| Cl3'—C24 | 1.703 (10) | C12—H12 | 0.9300 |
| Cl4'—C24 | 1.755 (9) | C13—C14 | 1.3900 |
| Cl5'—C24 | 1.707 (10) | C13—H13 | 0.9300 |
| S1—C17 | 1.738 (6) | C14—C15 | 1.3900 |
| N1—C5 | 1.336 (8) | C14—H14 | 0.9300 |
| N1—C9 | 1.350 (8) | C15—C16 | 1.3900 |
| N2—C10 | 1.313 (7) | C15—H15 | 0.9300 |
| N2—N3 | 1.351 (7) | C16—H16 | 0.9300 |
| N3—C17 | 1.338 (7) | C18—C23 | 1.489 (12) |
| N4—C17 | 1.337 (8) | C18—C19 | 1.527 (8) |
| N4—C18 | 1.456 (8) | C18—H18 | 0.9800 |
| N4—H4 | 0.8600 | C19—C20 | 1.525 (8) |
| C1—C2 | 1.474 (8) | C19—H19A | 0.9700 |
| C1—H1A | 0.9700 | C19—H19B | 0.9700 |
| C1—H1B | 0.9700 | C20—C21 | 1.507 (9) |
| C2—C3 | 1.475 (8) | C20—H20A | 0.9700 |
| C2—H2A | 0.9700 | C20—H20B | 0.9700 |
| C2—H2B | 0.9700 | C21—C22 | 1.510 (9) |
| C3—C4 | 1.478 (9) | C21—H21A | 0.9700 |
| C3—H3A | 0.9700 | C21—H21B | 0.9700 |
| C3—H3B | 0.9700 | C22—C23 | 1.540 (8) |
| C4—H4A | 0.9600 | C22—H22A | 0.9700 |
| C4—H4B | 0.9600 | C22—H22B | 0.9700 |
| C4—H4C | 0.9600 | C23—H23A | 0.9700 |
| C5—C6 | 1.364 (10) | C23—H23B | 0.9700 |
| C5—H5 | 0.9300 | C24—H24 | 0.9800 |
| C6—C7 | 1.367 (11) | C24—H24' | 0.9801 |
| C6—H6 | 0.9300 | ||
| C1—Sn1—N2 | 174.1 (2) | C15—C14—C13 | 120.0 |
| C1—Sn1—N1 | 101.4 (2) | C15—C14—H14 | 120.0 |
| N2—Sn1—N1 | 72.61 (18) | C13—C14—H14 | 120.0 |
| C1—Sn1—S1 | 107.3 (2) | C14—C15—C16 | 120.0 |
| N2—Sn1—S1 | 78.67 (13) | C14—C15—H15 | 120.0 |
| N1—Sn1—S1 | 151.28 (13) | C16—C15—H15 | 120.0 |
| C1—Sn1—Cl2 | 93.2 (2) | C15—C16—C11 | 120.0 |
| N2—Sn1—Cl2 | 86.17 (13) | C15—C16—H16 | 120.0 |
| N1—Sn1—Cl2 | 85.49 (14) | C11—C16—H16 | 120.0 |
| S1—Sn1—Cl2 | 93.38 (6) | N4—C17—N3 | 116.1 (5) |
| C1—Sn1—Cl1 | 95.0 (3) | N4—C17—S1 | 115.5 (4) |
| N2—Sn1—Cl1 | 84.68 (13) | N3—C17—S1 | 128.4 (5) |
| N1—Sn1—Cl1 | 83.71 (14) | N4—C18—C23 | 111.0 (6) |
| S1—Sn1—Cl1 | 93.11 (6) | N4—C18—C19 | 109.1 (6) |
| Cl2—Sn1—Cl1 | 167.54 (7) | C23—C18—C19 | 110.1 (7) |
| C17—S1—Sn1 | 95.6 (2) | N4—C18—H18 | 108.9 |
| C5—N1—C9 | 119.3 (5) | C23—C18—H18 | 108.9 |
| C5—N1—Sn1 | 124.4 (5) | C19—C18—H18 | 108.9 |
| C9—N1—Sn1 | 116.1 (4) | C20—C19—C18 | 111.0 (6) |
| C10—N2—N3 | 119.1 (5) | C20—C19—H19A | 109.4 |
| C10—N2—Sn1 | 118.7 (4) | C18—C19—H19A | 109.4 |
| N3—N2—Sn1 | 122.2 (4) | C20—C19—H19B | 109.4 |
| C17—N3—N2 | 114.5 (5) | C18—C19—H19B | 109.4 |
| C17—N4—C18 | 125.8 (5) | H19A—C19—H19B | 108.0 |
| C17—N4—H4 | 117.1 | C21—C20—C19 | 111.6 (7) |
| C18—N4—H4 | 117.1 | C21—C20—H20A | 109.3 |
| C2—C1—Sn1 | 115.1 (6) | C19—C20—H20A | 109.3 |
| C2—C1—H1A | 108.5 | C21—C20—H20B | 109.3 |
| Sn1—C1—H1A | 108.5 | C19—C20—H20B | 109.3 |
| C2—C1—H1B | 108.5 | H20A—C20—H20B | 108.0 |
| Sn1—C1—H1B | 108.5 | C22—C21—C20 | 112.5 (7) |
| H1A—C1—H1B | 107.5 | C22—C21—H21A | 109.1 |
| C1—C2—C3 | 119.8 (7) | C20—C21—H21A | 109.1 |
| C1—C2—H2A | 107.4 | C22—C21—H21B | 109.1 |
| C3—C2—H2A | 107.4 | C20—C21—H21B | 109.1 |
| C1—C2—H2B | 107.4 | H21A—C21—H21B | 107.8 |
| C3—C2—H2B | 107.4 | C21—C22—C23 | 110.8 (7) |
| H2A—C2—H2B | 106.9 | C21—C22—H22A | 109.5 |
| C4—C3—C2 | 120.8 (9) | C23—C22—H22A | 109.5 |
| C4—C3—H3A | 107.1 | C21—C22—H22B | 109.5 |
| C2—C3—H3A | 107.1 | C23—C22—H22B | 109.5 |
| C4—C3—H3B | 107.1 | H22A—C22—H22B | 108.1 |
| C2—C3—H3B | 107.1 | C18—C23—C22 | 112.1 (8) |
| H3A—C3—H3B | 106.8 | C18—C23—H23A | 109.2 |
| C3—C4—H4A | 109.5 | C22—C23—H23A | 109.2 |
| C3—C4—H4B | 109.5 | C18—C23—H23B | 109.2 |
| H4A—C4—H4B | 109.5 | C22—C23—H23B | 109.2 |
| C3—C4—H4C | 109.5 | H23A—C23—H23B | 107.9 |
| H4A—C4—H4C | 109.5 | Cl5'—C24—Cl4 | 34.0 (7) |
| H4B—C4—H4C | 109.5 | Cl5'—C24—Cl3' | 109.4 (8) |
| N1—C5—C6 | 121.8 (7) | Cl4—C24—Cl3' | 125.5 (11) |
| N1—C5—H5 | 119.1 | Cl5'—C24—Cl3 | 121.9 (12) |
| C6—C5—H5 | 119.1 | Cl4—C24—Cl3 | 111.8 (7) |
| C7—C6—C5 | 119.3 (7) | Cl3'—C24—Cl3 | 41.0 (7) |
| C7—C6—H6 | 120.3 | Cl5'—C24—Cl4' | 106.7 (7) |
| C5—C6—H6 | 120.3 | Cl4—C24—Cl4' | 73.3 (7) |
| C6—C7—C8 | 119.1 (6) | Cl3'—C24—Cl4' | 106.0 (7) |
| C6—C7—H7 | 120.4 | Cl3—C24—Cl4' | 65.1 (7) |
| C8—C7—H7 | 120.4 | Cl5'—C24—Cl5 | 69.3 (7) |
| C9—C8—C7 | 119.8 (7) | Cl4—C24—Cl5 | 103.1 (6) |
| C9—C8—H8 | 120.1 | Cl3'—C24—Cl5 | 62.1 (7) |
| C7—C8—H8 | 120.1 | Cl3—C24—Cl5 | 102.5 (6) |
| N1—C9—C8 | 120.6 (6) | Cl4'—C24—Cl5 | 163.2 (12) |
| N1—C9—C10 | 116.1 (5) | Cl5'—C24—H24 | 123.4 |
| C8—C9—C10 | 123.3 (6) | Cl4—C24—H24 | 112.9 |
| N2—C10—C11 | 123.3 (5) | Cl3'—C24—H24 | 121.2 |
| N2—C10—C9 | 116.0 (5) | Cl3—C24—H24 | 112.9 |
| C11—C10—C9 | 120.7 (5) | Cl4'—C24—H24 | 83.2 |
| C12—C11—C16 | 120.0 | Cl5—C24—H24 | 112.9 |
| C12—C11—C10 | 120.1 (4) | Cl5'—C24—H24' | 112.5 |
| C16—C11—C10 | 119.9 (4) | Cl4—C24—H24' | 120.3 |
| C13—C12—C11 | 120.0 | Cl3'—C24—H24' | 110.5 |
| C13—C12—H12 | 120.0 | Cl3—C24—H24' | 124.2 |
| C11—C12—H12 | 120.0 | Cl4'—C24—H24' | 111.5 |
| C12—C13—C14 | 120.0 | Cl5—C24—H24' | 84.7 |
| C12—C13—H13 | 120.0 | H24—C24—H24' | 28.2 |
| C14—C13—H13 | 120.0 | ||
| C1—Sn1—S1—C17 | −174.4 (3) | C5—N1—C9—C10 | 179.0 (6) |
| N2—Sn1—S1—C17 | 5.4 (2) | Sn1—N1—C9—C10 | −6.7 (7) |
| N1—Sn1—S1—C17 | 6.8 (4) | C7—C8—C9—N1 | 2.3 (10) |
| Cl2—Sn1—S1—C17 | −80.0 (2) | C7—C8—C9—C10 | −178.5 (6) |
| Cl1—Sn1—S1—C17 | 89.4 (2) | N3—N2—C10—C11 | 3.3 (9) |
| C1—Sn1—N1—C5 | 0.0 (6) | Sn1—N2—C10—C11 | −176.8 (4) |
| N2—Sn1—N1—C5 | −179.7 (6) | N3—N2—C10—C9 | −176.4 (5) |
| S1—Sn1—N1—C5 | 178.9 (4) | Sn1—N2—C10—C9 | 3.5 (7) |
| Cl2—Sn1—N1—C5 | −92.3 (5) | N1—C9—C10—N2 | 2.2 (8) |
| Cl1—Sn1—N1—C5 | 93.9 (5) | C8—C9—C10—N2 | −177.0 (6) |
| C1—Sn1—N1—C9 | −174.0 (5) | N1—C9—C10—C11 | −177.5 (5) |
| N2—Sn1—N1—C9 | 6.2 (4) | C8—C9—C10—C11 | 3.3 (9) |
| S1—Sn1—N1—C9 | 4.8 (6) | N2—C10—C11—C12 | −117.1 (6) |
| Cl2—Sn1—N1—C9 | 93.6 (4) | C9—C10—C11—C12 | 62.6 (7) |
| Cl1—Sn1—N1—C9 | −80.1 (4) | N2—C10—C11—C16 | 63.1 (7) |
| C1—Sn1—N2—C10 | −8 (3) | C9—C10—C11—C16 | −117.3 (5) |
| N1—Sn1—N2—C10 | −5.2 (4) | C16—C11—C12—C13 | 0.0 |
| S1—Sn1—N2—C10 | 174.1 (5) | C10—C11—C12—C13 | −179.8 (5) |
| Cl2—Sn1—N2—C10 | −91.7 (4) | C11—C12—C13—C14 | 0.0 |
| Cl1—Sn1—N2—C10 | 79.9 (4) | C12—C13—C14—C15 | 0.0 |
| C1—Sn1—N2—N3 | 172 (2) | C13—C14—C15—C16 | 0.0 |
| N1—Sn1—N2—N3 | 174.7 (5) | C14—C15—C16—C11 | 0.0 |
| S1—Sn1—N2—N3 | −6.0 (4) | C12—C11—C16—C15 | 0.0 |
| Cl2—Sn1—N2—N3 | 88.3 (4) | C10—C11—C16—C15 | 179.8 (5) |
| Cl1—Sn1—N2—N3 | −100.2 (4) | C18—N4—C17—N3 | 6.0 (11) |
| C10—N2—N3—C17 | −176.7 (6) | C18—N4—C17—S1 | −174.4 (6) |
| Sn1—N2—N3—C17 | 3.4 (7) | N2—N3—C17—N4 | −176.7 (6) |
| N2—Sn1—C1—C2 | 154 (2) | N2—N3—C17—S1 | 3.7 (9) |
| N1—Sn1—C1—C2 | 151.1 (9) | Sn1—S1—C17—N4 | 173.2 (5) |
| S1—Sn1—C1—C2 | −28.3 (9) | Sn1—S1—C17—N3 | −7.3 (6) |
| Cl2—Sn1—C1—C2 | −122.8 (9) | C17—N4—C18—C23 | 117.7 (9) |
| Cl1—Sn1—C1—C2 | 66.6 (9) | C17—N4—C18—C19 | −120.8 (9) |
| Sn1—C1—C2—C3 | 178.8 (11) | N4—C18—C19—C20 | −179.1 (8) |
| C1—C2—C3—C4 | 13 (3) | C23—C18—C19—C20 | −57.1 (11) |
| C9—N1—C5—C6 | −0.2 (11) | C18—C19—C20—C21 | 55.1 (13) |
| Sn1—N1—C5—C6 | −174.0 (6) | C19—C20—C21—C22 | −53.4 (14) |
| N1—C5—C6—C7 | 1.6 (12) | C20—C21—C22—C23 | 52.4 (14) |
| C5—C6—C7—C8 | −1.0 (12) | N4—C18—C23—C22 | 178.1 (8) |
| C6—C7—C8—C9 | −0.9 (11) | C19—C18—C23—C22 | 57.2 (11) |
| C5—N1—C9—C8 | −1.8 (9) | C21—C22—C23—C18 | −55.0 (13) |
| Sn1—N1—C9—C8 | 172.6 (5) |
| D—H···A | D—H | H···A | D···A | D—H···A |
| N4—H4···Cl1i | 0.86 | 2.54 | 3.383 (6) | 167 |
| Symmetry code: (i) −x+3/2, y+1/2, −z+1/2. |
Experimental details
| Crystal data | |
| Chemical formula | [Sn(C4H9)(C19H21N4S)Cl2]·CHCl3 |
| Mr | 703.53 |
| Crystal system, space group | Monoclinic, P21/n |
| Temperature (K) | 293 |
| a, b, c (Å) | 14.5095 (9), 13.7308 (8), 15.7412 (10) |
| β (°) | 94.418 (1) |
| V (Å3) | 3126.8 (3) |
| Z | 4 |
| Radiation type | Mo Kα |
| µ (mm−1) | 1.33 |
| Crystal size (mm) | 0.40 × 0.30 × 0.20 |
| Data collection | |
| Diffractometer | Bruker SMART APEX diffractometer |
| Absorption correction | Multi-scan (SADABS; Sheldrick, 1996) |
| Tmin, Tmax | 0.618, 0.777 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 29403, 7179, 5127 |
| Rint | 0.032 |
| (sin θ/λ)max (Å−1) | 0.650 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.058, 0.202, 1.10 |
| No. of reflections | 7179 |
| No. of parameters | 332 |
| No. of restraints | 105 |
| H-atom treatment | H-atom parameters constrained |
| Δρmax, Δρmin (e Å−3) | 1.48, −1.14 |
Computer programs: APEX2 (Bruker, 2009), SAINT (Bruker, 2009), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), X-SEED (Barbour, 2001), publCIF (Westrip, 2010).
| Sn1—C1 | 2.142 (7) | Sn1—S1 | 2.475 (2) |
| Sn1—N1 | 2.250 (5) | Sn1—Cl1 | 2.515 (2) |
| Sn1—N2 | 2.221 (5) | Sn1—Cl2 | 2.496 (2) |
| D—H···A | D—H | H···A | D···A | D—H···A |
| N4—H4···Cl1i | 0.86 | 2.54 | 3.383 (6) | 167 |
| Symmetry code: (i) −x+3/2, y+1/2, −z+1/2. |
Acknowledgements
We thank MOSTI (grant No. 06-01-09-SF0046), Universiti Malaysia Sarawak and the University of Malaya for supporting this study.
References
Barbour, L. J. (2001). J. Supramol. Chem. 1, 189–191. CrossRef CAS Google Scholar
Bruker (2009). APEX2 and SAINT. Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
Joseph, M., Suni, V., Kurup, M. R. P., Nethaji, M., Kishore, A. & Bhat, S. G. (2004). Polyhedron, 23, 3069–3080. Web of Science CSD CrossRef CAS Google Scholar
Sheldrick, G. M. (1996). SADABS. University of Göttingen, Germany. Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Westrip, S. P. (2010). J. Appl. Cryst. 43. Submitted. Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
. ![[Figure 1]](./bt5251fig1thm.gif)




The mono-deprotonated anion of 2-benzoylpyridine 4-cyclohexyl thiosemicarbazone is a ligand that N,N',S-binds to metal atoms (Joseph et al., 2004). Whereas similar ligands have been complexed with diorganotin and triorganotin systems, the monoorganotin analogs have not been so extensively studied. The mono-deprotonated Schiff-base ligand in SnCl2(C4H9)(C19H12N4S).CHCl3 N,N',S-chelates to the tin atom, which is six-coordinate in an octahedral environment (Scheme I, Fig. 1). The three coordinating atoms along with the ipso-butyl carbon comprise a square plane, above and below which are positioned the chlorine atoms.