organic compounds
2-Chloroethyl 2-(2-chlorophenyl)-2-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-yl)acetate
aMaterials Science and Engineering, Tianjin Polytechnic University, Tianjin, 300160, People's Republic of China, and bTianjin Institute of Pharmaceutical Research, Tianjin, 300193, People's Republic of China
*Correspondence e-mail: [email protected]
The molecular packing of the title compound, C17H17Cl2NO2S, is stabilized by weak C—H⋯O and C—H⋯Cl interactions. The ester chain is almost planar with a mean deviation of 0.0605 Å and makes dihedral angles of 71.60 (4) and 74.70 (8)° with the benzene ring and the thiophene ring, respectively. The benzene and thiophene rings make a dihedral angle of 84.22 (7)°.
Related literature
The title compound is a derivative of clopidogrel. For background to the bioactivity and applications of the antiplatelet agent clopidogrel, see, for example, Gurbel & Tantry (2007
); Muller et al. (2003
); Savi et al. (1994
); Sharis et al. (1998
). For the synthesis of other derivatives with thienopyridine, see: Aubert et al. (1985
); Bipin et al. (2002
); Bouisset & Radisson (1991
).
Experimental
Crystal data
|
Refinement
|
| ||||||||||||||||||||||
Data collection: CrystalClear (Rigaku/MSC, 2005
); cell refinement: CrystalClear; data reduction: CrystalClear; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: SHELXTL (Sheldrick, 2008
); software used to prepare material for publication: CrystalStructure (Rigaku/MSC, 2005
).
Supporting information
contains datablocks global, I. DOI: https://doi.org/10.1107/S1600536810046908/fk2029sup1.cif
Structure factors: contains datablock I. DOI: https://doi.org/10.1107/S1600536810046908/fk2029Isup2.hkl
(I) was prepared from α-bromo(2-chloro)phenyl acetic acid and 4,5,6,7-tetrahydro thieno[3,2-c] pyridin by esterification and substitution reaction. Colourless crystals (m.p. 91.8–92.8°C) were obtained in a yield of 93.7%. Single crystals were grown from hexane-ethyl acetate (1:1) solution.
All the H atoms were positioned geometrically and refined as riding atoms, with C8—H8=1.00 Å, C—H=0.95Å (for the other CH groups), and 0.99Å (CH2), Uiso = 1.2Ueq(C).
Clopidogrel, a thienopyridine class inhibitor of P2Y12 ADP platelet receptor, has been found to be particularly useful in the treatment of coronary artery disease, peripheral vascular disease, and cerebrovascular disease (Aubert et al., 1985; Bipin et al., 2002; Bouisset & Radisson, 1991; Muller et al., 2003; Savi, et al.,1994; Gurbel & Tantry, 2007; Sharis et al., 1998). The of the title compound, 2-Chloroethyl 2-(2-chlorophenyl)-2-(6,7-dihydro thieno[3,2-c]pyridin-5(4H)-yl)acetate (I), a derivative of clopidogrel, is reported here.
As shown in Fig. 1, the benzene ring, the ester chain and the thienopyridine group are all linked to C8 and a molecular chiral center is formed. The ester chain(C15/C16/C17/O1/O2/Cl2) is almost planar, the mean deviation from the plane is 0.0605 Å. The dihedral angles formed between the benzene ring plane (A), the ester chain plane (B) and the thiophene ring plane (C) are 71.60 (4) ° (A/B), 74.70 (8) ° (B/C) and 84.22 (7) ° (A/C), respectively. The packing is consolidated by C—H···O and C—H···Cl interactions, see Table 1.
The title compound is a derivative of clopidogrel. For background to the bioactivity and applications of the antiplatelet agent clopidogrel, see, for example, Gurbel & Tantry (2007); Muller et al. (2003); Savi et al. (1994); Sharis et al. (1998). For the synthesis of other derivatives with thienopyridine, see: Aubert et al. (1985); Bipin et al. (2002); Bouisset & Radisson (1991).
Data collection: CrystalClear (Rigaku/MSC, 2005); cell CrystalClear (Rigaku/MSC, 2005); data reduction: CrystalClear (Rigaku/MSC, 2005); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: SHELXTL (Sheldrick, 2008); software used to prepare material for publication: CrystalStructure (Rigaku/MSC, 2005).
| Fig. 1. The molecular structure of (I), displacement ellipsoids are drawn at the 50% probability level. |
| C17H17Cl2NO2S | F(000) = 768 |
| Mr = 370.28 | Dx = 1.472 Mg m−3 |
| Monoclinic, P21/n | Cu Kα radiation, λ = 1.54187 Å |
| Hall symbol: -P 2yn | Cell parameters from 2162 reflections |
| a = 9.689 (1) Å | θ = 27.6–72.0° |
| b = 11.2670 (12) Å | µ = 4.73 mm−1 |
| c = 15.5670 (16) Å | T = 113 K |
| β = 100.509 (8)° | Prism, colorless |
| V = 1670.9 (3) Å3 | 0.26 × 0.24 × 0.20 mm |
| Z = 4 |
| Rigaku Saturn diffractometer | 3203 independent reflections |
| Radiation source: fine-focus sealed tube | 2974 reflections with I > 2σ(I) |
| Multilayer monochromator | Rint = 0.065 |
| Detector resolution: 14.63 pixels mm-1 | θmax = 72.6°, θmin = 4.9° |
| ω scans | h = −11→11 |
| Absorption correction: multi-scan (CrystalClear; Rigaku/MSC, 2005) | k = −13→13 |
| Tmin = 0.373, Tmax = 0.451 | l = −19→15 |
| 18109 measured reflections |
| Refinement on F2 | Secondary atom site location: difference Fourier map |
| Least-squares matrix: full | Hydrogen site location: inferred from neighbouring sites |
| R[F2 > 2σ(F2)] = 0.037 | H-atom parameters constrained |
| wR(F2) = 0.107 | w = 1/[σ2(Fo2) + (0.0633P)2 + 0.6161P] where P = (Fo2 + 2Fc2)/3 |
| S = 1.09 | (Δ/σ)max = 0.001 |
| 3203 reflections | Δρmax = 0.55 e Å−3 |
| 210 parameters | Δρmin = −0.50 e Å−3 |
| 0 restraints | Extinction correction: SHELXL, Fc*=kFc[1+0.001xFc2λ3/sin(2θ)]-1/4 |
| Primary atom site location: structure-invariant direct methods | Extinction coefficient: 0.0023 (4) |
| C17H17Cl2NO2S | V = 1670.9 (3) Å3 |
| Mr = 370.28 | Z = 4 |
| Monoclinic, P21/n | Cu Kα radiation |
| a = 9.689 (1) Å | µ = 4.73 mm−1 |
| b = 11.2670 (12) Å | T = 113 K |
| c = 15.5670 (16) Å | 0.26 × 0.24 × 0.20 mm |
| β = 100.509 (8)° |
| Rigaku Saturn diffractometer | 3203 independent reflections |
| Absorption correction: multi-scan (CrystalClear; Rigaku/MSC, 2005) | 2974 reflections with I > 2σ(I) |
| Tmin = 0.373, Tmax = 0.451 | Rint = 0.065 |
| 18109 measured reflections |
| R[F2 > 2σ(F2)] = 0.037 | 0 restraints |
| wR(F2) = 0.107 | H-atom parameters constrained |
| S = 1.09 | Δρmax = 0.55 e Å−3 |
| 3203 reflections | Δρmin = −0.50 e Å−3 |
| 210 parameters |
Geometry. All e.s.d.'s (except the e.s.d. in the dihedral angle between two l.s. planes) are estimated using the full covariance matrix. The cell e.s.d.'s are taken into account individually in the estimation of e.s.d.'s in distances, angles and torsion angles; correlations between e.s.d.'s in cell parameters are only used when they are defined by crystal symmetry. An approximate (isotropic) treatment of cell e.s.d.'s is used for estimating e.s.d.'s involving l.s. planes. |
Refinement. Refinement of F2 against ALL reflections. The weighted R-factor wR and goodness of fit S are based on F2, conventional R-factors R are based on F, with F set to zero for negative F2. The threshold expression of F2 > σ(F2) is used only for calculating R-factors(gt) etc. and is not relevant to the choice of reflections for refinement. R-factors based on F2 are statistically about twice as large as those based on F, and R- factors based on ALL data will be even larger. |
| x | y | z | Uiso*/Ueq | ||
| Cl1 | 0.04822 (5) | 0.57741 (4) | 0.11386 (3) | 0.02277 (16) | |
| Cl2 | 0.76621 (5) | 0.81053 (4) | 0.43330 (3) | 0.02378 (16) | |
| S1 | −0.27359 (5) | 0.25362 (4) | 0.37037 (3) | 0.02083 (16) | |
| O1 | 0.32239 (15) | 0.54792 (13) | 0.45403 (9) | 0.0225 (3) | |
| O2 | 0.39640 (14) | 0.66198 (12) | 0.35279 (9) | 0.0174 (3) | |
| N1 | 0.08010 (16) | 0.47629 (13) | 0.32205 (10) | 0.0130 (3) | |
| C1 | −0.1656 (2) | 0.13256 (17) | 0.36824 (13) | 0.0210 (4) | |
| H1 | −0.1959 | 0.0524 | 0.3685 | 0.025* | |
| C2 | −0.0317 (2) | 0.16624 (17) | 0.36612 (13) | 0.0179 (4) | |
| H2 | 0.0432 | 0.1120 | 0.3656 | 0.022* | |
| C3 | −0.01587 (19) | 0.29199 (16) | 0.36478 (12) | 0.0144 (4) | |
| C4 | −0.13725 (19) | 0.35097 (16) | 0.36683 (12) | 0.0153 (4) | |
| C5 | −0.1531 (2) | 0.48332 (16) | 0.36218 (13) | 0.0176 (4) | |
| H5A | −0.2034 | 0.5113 | 0.4083 | 0.021* | |
| H5B | −0.2085 | 0.5066 | 0.3048 | 0.021* | |
| C6 | −0.0070 (2) | 0.53980 (16) | 0.37471 (13) | 0.0169 (4) | |
| H6A | −0.0154 | 0.6242 | 0.3568 | 0.020* | |
| H6B | 0.0376 | 0.5364 | 0.4372 | 0.020* | |
| C7 | 0.11670 (19) | 0.35649 (16) | 0.35549 (14) | 0.0175 (4) | |
| H7A | 0.1803 | 0.3613 | 0.4129 | 0.021* | |
| H7B | 0.1657 | 0.3130 | 0.3146 | 0.021* | |
| C8 | 0.19666 (18) | 0.54645 (15) | 0.30224 (12) | 0.0139 (4) | |
| H8 | 0.1549 | 0.6221 | 0.2756 | 0.017* | |
| C9 | 0.26203 (18) | 0.48536 (15) | 0.23238 (12) | 0.0132 (4) | |
| C10 | 0.19866 (18) | 0.49132 (16) | 0.14532 (12) | 0.0143 (4) | |
| C11 | 0.2530 (2) | 0.43267 (17) | 0.08043 (13) | 0.0175 (4) | |
| H11 | 0.2070 | 0.4375 | 0.0212 | 0.021* | |
| C12 | 0.3751 (2) | 0.36703 (16) | 0.10307 (13) | 0.0179 (4) | |
| H12 | 0.4127 | 0.3261 | 0.0592 | 0.021* | |
| C13 | 0.44201 (19) | 0.36086 (16) | 0.18876 (13) | 0.0164 (4) | |
| H13 | 0.5268 | 0.3171 | 0.2039 | 0.020* | |
| C14 | 0.38540 (19) | 0.41882 (15) | 0.25317 (13) | 0.0155 (4) | |
| H14 | 0.4314 | 0.4131 | 0.3124 | 0.019* | |
| C15 | 0.31009 (19) | 0.58238 (15) | 0.37984 (13) | 0.0160 (4) | |
| C16 | 0.5174 (2) | 0.69884 (17) | 0.41623 (13) | 0.0188 (4) | |
| H16A | 0.5675 | 0.6293 | 0.4458 | 0.023* | |
| H16B | 0.4892 | 0.7517 | 0.4608 | 0.023* | |
| C17 | 0.6085 (2) | 0.76441 (17) | 0.36247 (14) | 0.0202 (4) | |
| H17A | 0.5577 | 0.8345 | 0.3342 | 0.024* | |
| H17B | 0.6316 | 0.7118 | 0.3162 | 0.024* |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Cl1 | 0.0140 (2) | 0.0368 (3) | 0.0168 (3) | 0.00997 (17) | 0.00123 (19) | 0.00264 (18) |
| Cl2 | 0.0144 (3) | 0.0303 (3) | 0.0259 (3) | −0.00757 (16) | 0.0018 (2) | 0.00000 (18) |
| S1 | 0.0121 (3) | 0.0269 (3) | 0.0237 (3) | −0.00480 (16) | 0.0040 (2) | 0.00486 (18) |
| O1 | 0.0192 (7) | 0.0317 (7) | 0.0173 (8) | −0.0060 (6) | 0.0050 (6) | 0.0020 (6) |
| O2 | 0.0138 (6) | 0.0248 (7) | 0.0131 (7) | −0.0073 (5) | 0.0014 (5) | 0.0002 (5) |
| N1 | 0.0113 (7) | 0.0173 (7) | 0.0119 (8) | −0.0005 (6) | 0.0062 (6) | 0.0000 (6) |
| C1 | 0.0235 (10) | 0.0211 (9) | 0.0194 (11) | −0.0054 (7) | 0.0063 (8) | 0.0003 (7) |
| C2 | 0.0217 (10) | 0.0208 (9) | 0.0126 (10) | −0.0013 (7) | 0.0065 (8) | 0.0001 (7) |
| C3 | 0.0136 (9) | 0.0210 (9) | 0.0090 (9) | −0.0004 (7) | 0.0033 (7) | 0.0018 (7) |
| C4 | 0.0141 (9) | 0.0241 (9) | 0.0079 (9) | −0.0021 (7) | 0.0027 (7) | 0.0012 (7) |
| C5 | 0.0148 (9) | 0.0225 (9) | 0.0174 (10) | 0.0024 (7) | 0.0077 (8) | 0.0037 (7) |
| C6 | 0.0154 (9) | 0.0186 (8) | 0.0191 (10) | 0.0005 (7) | 0.0100 (8) | −0.0004 (7) |
| C7 | 0.0101 (8) | 0.0171 (8) | 0.0262 (11) | 0.0005 (6) | 0.0058 (8) | 0.0031 (7) |
| C8 | 0.0111 (8) | 0.0172 (8) | 0.0143 (9) | −0.0011 (6) | 0.0049 (7) | −0.0002 (7) |
| C9 | 0.0093 (8) | 0.0167 (8) | 0.0143 (9) | −0.0025 (6) | 0.0044 (7) | 0.0013 (6) |
| C10 | 0.0103 (8) | 0.0205 (8) | 0.0123 (10) | −0.0005 (6) | 0.0026 (7) | 0.0007 (7) |
| C11 | 0.0135 (9) | 0.0243 (9) | 0.0145 (10) | −0.0015 (7) | 0.0020 (7) | −0.0003 (7) |
| C12 | 0.0169 (9) | 0.0207 (9) | 0.0174 (10) | 0.0008 (7) | 0.0068 (8) | −0.0030 (7) |
| C13 | 0.0131 (9) | 0.0204 (9) | 0.0161 (10) | 0.0024 (7) | 0.0036 (7) | 0.0001 (7) |
| C14 | 0.0114 (9) | 0.0190 (9) | 0.0159 (10) | −0.0006 (6) | 0.0023 (7) | 0.0013 (7) |
| C15 | 0.0124 (9) | 0.0183 (9) | 0.0188 (11) | −0.0002 (6) | 0.0068 (8) | −0.0017 (7) |
| C16 | 0.0137 (9) | 0.0262 (10) | 0.0162 (10) | −0.0057 (7) | 0.0024 (8) | −0.0035 (7) |
| C17 | 0.0140 (9) | 0.0240 (9) | 0.0222 (11) | −0.0049 (7) | 0.0022 (8) | −0.0004 (8) |
| Cl1—C10 | 1.7450 (18) | C6—H6B | 0.9900 |
| Cl2—C17 | 1.791 (2) | C7—H7A | 0.9900 |
| S1—C1 | 1.723 (2) | C7—H7B | 0.9900 |
| S1—C4 | 1.7256 (18) | C8—C9 | 1.520 (2) |
| O1—C15 | 1.204 (2) | C8—C15 | 1.532 (3) |
| O2—C15 | 1.345 (2) | C8—H8 | 1.0000 |
| O2—C16 | 1.449 (2) | C9—C10 | 1.384 (3) |
| N1—C8 | 1.457 (2) | C9—C14 | 1.398 (3) |
| N1—C6 | 1.466 (2) | C10—C11 | 1.389 (3) |
| N1—C7 | 1.467 (2) | C11—C12 | 1.385 (3) |
| C1—C2 | 1.358 (3) | C11—H11 | 0.9500 |
| C1—H1 | 0.9500 | C12—C13 | 1.374 (3) |
| C2—C3 | 1.426 (3) | C12—H12 | 0.9500 |
| C2—H2 | 0.9500 | C13—C14 | 1.390 (3) |
| C3—C4 | 1.356 (3) | C13—H13 | 0.9500 |
| C3—C7 | 1.506 (2) | C14—H14 | 0.9500 |
| C4—C5 | 1.499 (3) | C16—C17 | 1.515 (3) |
| C5—C6 | 1.532 (3) | C16—H16A | 0.9900 |
| C5—H5A | 0.9900 | C16—H16B | 0.9900 |
| C5—H5B | 0.9900 | C17—H17A | 0.9900 |
| C6—H6A | 0.9900 | C17—H17B | 0.9900 |
| C1—S1—C4 | 91.80 (9) | C9—C8—C15 | 110.57 (14) |
| C15—O2—C16 | 116.73 (15) | N1—C8—H8 | 106.2 |
| C8—N1—C6 | 113.66 (14) | C9—C8—H8 | 106.2 |
| C8—N1—C7 | 115.33 (14) | C15—C8—H8 | 106.2 |
| C6—N1—C7 | 112.16 (14) | C10—C9—C14 | 117.43 (17) |
| C2—C1—S1 | 111.44 (15) | C10—C9—C8 | 120.70 (16) |
| C2—C1—H1 | 124.3 | C14—C9—C8 | 121.85 (17) |
| S1—C1—H1 | 124.3 | C9—C10—C11 | 122.00 (17) |
| C1—C2—C3 | 112.55 (17) | C9—C10—Cl1 | 120.04 (14) |
| C1—C2—H2 | 123.7 | C11—C10—Cl1 | 117.94 (15) |
| C3—C2—H2 | 123.7 | C12—C11—C10 | 119.25 (19) |
| C4—C3—C2 | 113.01 (17) | C12—C11—H11 | 120.4 |
| C4—C3—C7 | 121.62 (16) | C10—C11—H11 | 120.4 |
| C2—C3—C7 | 125.23 (16) | C13—C12—C11 | 120.25 (18) |
| C3—C4—C5 | 124.61 (16) | C13—C12—H12 | 119.9 |
| C3—C4—S1 | 111.19 (14) | C11—C12—H12 | 119.9 |
| C5—C4—S1 | 124.14 (14) | C12—C13—C14 | 119.86 (17) |
| C4—C5—C6 | 108.82 (15) | C12—C13—H13 | 120.1 |
| C4—C5—H5A | 109.9 | C14—C13—H13 | 120.1 |
| C6—C5—H5A | 109.9 | C13—C14—C9 | 121.20 (18) |
| C4—C5—H5B | 109.9 | C13—C14—H14 | 119.4 |
| C6—C5—H5B | 109.9 | C9—C14—H14 | 119.4 |
| H5A—C5—H5B | 108.3 | O1—C15—O2 | 123.85 (18) |
| N1—C6—C5 | 109.83 (15) | O1—C15—C8 | 127.06 (17) |
| N1—C6—H6A | 109.7 | O2—C15—C8 | 109.08 (15) |
| C5—C6—H6A | 109.7 | O2—C16—C17 | 104.11 (16) |
| N1—C6—H6B | 109.7 | O2—C16—H16A | 110.9 |
| C5—C6—H6B | 109.7 | C17—C16—H16A | 110.9 |
| H6A—C6—H6B | 108.2 | O2—C16—H16B | 110.9 |
| N1—C7—C3 | 108.85 (15) | C17—C16—H16B | 110.9 |
| N1—C7—H7A | 109.9 | H16A—C16—H16B | 109.0 |
| C3—C7—H7A | 109.9 | C16—C17—Cl2 | 108.60 (15) |
| N1—C7—H7B | 109.9 | C16—C17—H17A | 110.0 |
| C3—C7—H7B | 109.9 | Cl2—C17—H17A | 110.0 |
| H7A—C7—H7B | 108.3 | C16—C17—H17B | 110.0 |
| N1—C8—C9 | 110.25 (14) | Cl2—C17—H17B | 110.0 |
| N1—C8—C15 | 116.67 (15) | H17A—C17—H17B | 108.4 |
| C4—S1—C1—C2 | 0.79 (17) | N1—C8—C9—C10 | 78.1 (2) |
| S1—C1—C2—C3 | −0.9 (2) | C15—C8—C9—C10 | −151.36 (16) |
| C1—C2—C3—C4 | 0.6 (2) | N1—C8—C9—C14 | −100.15 (19) |
| C1—C2—C3—C7 | −175.08 (19) | C15—C8—C9—C14 | 30.3 (2) |
| C2—C3—C4—C5 | −177.23 (17) | C14—C9—C10—C11 | 0.9 (3) |
| C7—C3—C4—C5 | −1.3 (3) | C8—C9—C10—C11 | −177.49 (16) |
| C2—C3—C4—S1 | 0.0 (2) | C14—C9—C10—Cl1 | −177.49 (13) |
| C7—C3—C4—S1 | 175.86 (15) | C8—C9—C10—Cl1 | 4.1 (2) |
| C1—S1—C4—C3 | −0.42 (16) | C9—C10—C11—C12 | −0.6 (3) |
| C1—S1—C4—C5 | 176.78 (17) | Cl1—C10—C11—C12 | 177.76 (14) |
| C3—C4—C5—C6 | −12.0 (3) | C10—C11—C12—C13 | −0.5 (3) |
| S1—C4—C5—C6 | 171.12 (14) | C11—C12—C13—C14 | 1.3 (3) |
| C8—N1—C6—C5 | 157.57 (15) | C12—C13—C14—C9 | −1.0 (3) |
| C7—N1—C6—C5 | −69.4 (2) | C10—C9—C14—C13 | 0.0 (3) |
| C4—C5—C6—N1 | 44.8 (2) | C8—C9—C14—C13 | 178.30 (16) |
| C8—N1—C7—C3 | −174.85 (15) | C16—O2—C15—O1 | 5.7 (3) |
| C6—N1—C7—C3 | 52.9 (2) | C16—O2—C15—C8 | −175.09 (14) |
| C4—C3—C7—N1 | −18.0 (3) | N1—C8—C15—O1 | 9.3 (3) |
| C2—C3—C7—N1 | 157.41 (17) | C9—C8—C15—O1 | −117.7 (2) |
| C6—N1—C8—C9 | −167.86 (15) | N1—C8—C15—O2 | −169.92 (14) |
| C7—N1—C8—C9 | 60.6 (2) | C9—C8—C15—O2 | 63.05 (18) |
| C6—N1—C8—C15 | 65.0 (2) | C15—O2—C16—C17 | 167.79 (15) |
| C7—N1—C8—C15 | −66.6 (2) | O2—C16—C17—Cl2 | −177.94 (12) |
| D—H···A | D—H | H···A | D···A | D—H···A |
| C7—H7a···O1 | 0.99 | 2.53 | 3.140 (2) | 120 |
| C8—H8···Cl1 | 1.00 | 2.59 | 3.042 (2) | 107 |
Experimental details
| Crystal data | |
| Chemical formula | C17H17Cl2NO2S |
| Mr | 370.28 |
| Crystal system, space group | Monoclinic, P21/n |
| Temperature (K) | 113 |
| a, b, c (Å) | 9.689 (1), 11.2670 (12), 15.5670 (16) |
| β (°) | 100.509 (8) |
| V (Å3) | 1670.9 (3) |
| Z | 4 |
| Radiation type | Cu Kα |
| µ (mm−1) | 4.73 |
| Crystal size (mm) | 0.26 × 0.24 × 0.20 |
| Data collection | |
| Diffractometer | Rigaku Saturn |
| Absorption correction | Multi-scan (CrystalClear; Rigaku/MSC, 2005) |
| Tmin, Tmax | 0.373, 0.451 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 18109, 3203, 2974 |
| Rint | 0.065 |
| (sin θ/λ)max (Å−1) | 0.619 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.037, 0.107, 1.09 |
| No. of reflections | 3203 |
| No. of parameters | 210 |
| H-atom treatment | H-atom parameters constrained |
| Δρmax, Δρmin (e Å−3) | 0.55, −0.50 |
Computer programs: CrystalClear (Rigaku/MSC, 2005), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), SHELXTL (Sheldrick, 2008), CrystalStructure (Rigaku/MSC, 2005).
| D—H···A | D—H | H···A | D···A | D—H···A |
| C7—H7a···O1 | 0.99 | 2.53 | 3.140 (2) | 120.0 |
| C8—H8···Cl1 | 1.00 | 2.59 | 3.042 (2) | 107.0 |
Acknowledgements
The authors thank Mr Hai-Bin Song, Nankai University, for the X-ray crystallographic determination and helpful suggestions.
References
Aubert, D., Ferrand, C. & Maffrand, J. P. (1985). US. Patent 4 529 596. Google Scholar
Bipin, P., Bhushan, L. B. & Bhushan, L. V. (2002). WO Patent 02/059128 A2. Google Scholar
Bouisset, M. & Radisson, J. (1991). US Patent 5 036 156. Google Scholar
Gurbel, P. A. & Tantry, U. S. (2007). Thromb. Res. 120 , 311–321. Web of Science CrossRef PubMed CAS Google Scholar
Muller, I., Besta, F., Schulz, C., Li, Z., Massberg, S. & Gawaz, M. (2003). Circulation. 108, 2195–2197. Web of Science CrossRef PubMed Google Scholar
Rigaku/MSC (2005). CrystalClear and CrystalStructure. Rigaku/MSC Inc., The Woodlands, Texas, USA. Google Scholar
Savi, P., Combalbert, J., Gaich, C., Rouchon, M. C., Maffrand, J. P., Berger, Y. & Herbert, J. M. (1994). Thromb. Haemost. 72, 313–317. CAS PubMed Web of Science Google Scholar
Sharis, P. J., Cannon, C. P. & Loscalzo, J. (1998). Ann. Intern. Med. 129, 394–405. Web of Science CrossRef CAS PubMed Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
![[Figure 1]](./fk2029fig1thm.gif)




Clopidogrel, a thienopyridine class inhibitor of P2Y12 ADP platelet receptor, has been found to be particularly useful in the treatment of coronary artery disease, peripheral vascular disease, and cerebrovascular disease (Aubert et al., 1985; Bipin et al., 2002; Bouisset & Radisson, 1991; Muller et al., 2003; Savi, et al.,1994; Gurbel & Tantry, 2007; Sharis et al., 1998). The crystal structure of the title compound, 2-Chloroethyl 2-(2-chlorophenyl)-2-(6,7-dihydro thieno[3,2-c]pyridin-5(4H)-yl)acetate (I), a derivative of clopidogrel, is reported here.
As shown in Fig. 1, the benzene ring, the ester chain and the thienopyridine group are all linked to C8 and a molecular chiral center is formed. The ester chain(C15/C16/C17/O1/O2/Cl2) is almost planar, the mean deviation from the plane is 0.0605 Å. The dihedral angles formed between the benzene ring plane (A), the ester chain plane (B) and the thiophene ring plane (C) are 71.60 (4) ° (A/B), 74.70 (8) ° (B/C) and 84.22 (7) ° (A/C), respectively. The packing is consolidated by C—H···O and C—H···Cl interactions, see Table 1.