metal-organic compounds
Bis(μ-2,2′-disulfanediyldibenzoato)bis[aqua(2,2′-bipyridine)nickel(II)]
aTesting Center, Yangzhou Universitry, Yangzhou, 225002, People's Republic of China, and bCollege of Chemistry and Chemical Engineering, Yangzhou Universitry, Yangzhou, 225002, People's Republic of China
*Correspondence e-mail: [email protected]
In the centrosymmetric title complex, [Ni2(C14H8O4S2)2(C10H8N2)2(H2O)2], the NiII atom is coordinated by two N atoms from one 2,2′-bipyridine ligand, three carboxylate O atoms (one bidentate and one monodentate) from two different disulfanediyldibenzoate ligands and one O atom from a coordinated water molecule in an octahedral coordination geometry. The disulfanediyldibenzoate dianion bridges two NiII atoms. Adjacent molecules are linked through the coordinated water molecules, forming a O—H⋯O hydrogen-bonded chain running along the a axis.
Related literature
For complexes of 2,2′-disulfanediyldibenzoic acid, see: Feng et al. (2009
); Humphrey et al. (2004
); Li et al. (2007
); Murugavel et al. (2001
); Zhou et al. (2009
).
Experimental
Crystal data
|
Refinement
|
| ||||||||||||||||||||||
Data collection: SMART (Bruker, 2002)
; cell refinement: SAINT-Plus (Bruker, 2003
); data reduction: SAINT-Plus; program(s) used to solve structure: SHELXTL (Sheldrick, 2008
); program(s) used to refine structure: SHELXTL; molecular graphics: SHELXTL and DIAMOND (Brandenburg, 2006
); software used to prepare material for publication: publCIF (Westrip, 2010
).
Supporting information
contains datablocks I, global. DOI: https://doi.org/10.1107/S1600536810045824/ng5064sup1.cif
Structure factors: contains datablock I. DOI: https://doi.org/10.1107/S1600536810045824/ng5064Isup2.hkl
A mixture of Ni(NO3)2.6H2O (21.0 mg, 0.1 mmol) with 2,2'-disulfanediyldibenzoic acid (30.6 mg, 0.1 mmol), 2,2'-bipyridine (15.6 mg, 0.1 mmol) and water (10 ml) was sealed in a 25 ml Teflon-lined stainless steel vessel, and heated at 383 K for 3 d. A number of green block crystals of (I) were obtained after cooling the solution to room temperature. The yield of (I) was ca 65%, based on 2, 2'-disulfanediyldibenzoic acid.
The water H atoms were located in a difference Fourier map with a distance restraint of O—H = 0.85 Å and Uiso(H) =1.5Ueq(O). The of water H atoms were performed using 3 least-squares restraints by applying DFIX instructions of SHELXTL. All other H atoms were positioned geometrically and constrained as riding atoms, with C—H distances of 0.93 Å and Uiso(H) set to 1.2eq(C) of the parent atom.
The flexible 2,2'-disulfanediyldibenzoic acid, a multifunctional ligand containing both carboxylic and thio groups, can potentially afford various coordination modes and diverse coordination architectures. Many complexes with this ligand show unique structural topologies and interesting properties (Murugavel et al., 2001; Humphrey et al., 2004; Li et al., 2007; Zhou et al., 2009; Feng et al., 2009). In this work, we have used this ligand to react with a NiII salt in the presence of 2,2'-bipyridine as a chelating co-ligand, to obtain the title binuclear compound, Ni2(H2O)2(C10H8N2)2(C14H8O4S2)2.
The of the title compound is composed of one NiII ion, one 2,2'-disulfanediyldibenzoate ligand, one 2,2'-bipyridine ligand and one coordinated water molecule (Fig. 1). The NiII center is six-coordinated, in a distorted octahedral geometry, by two N atoms from one 2,2'-bipyridine ligand, three carboxylate O atoms from two different disulfanediyldibenzoate ligands and one O atom from a coordinated water molecule Two disulfanediyldibenzoate dianions bridge two NiII ions about a center of inversion with its two carboxylate groups in bidentate chelating and monodentate modes, respectively, generating the title binuclear compound. The Ni···Ni distance bridged by two 2, 2'-disulfanediyldibenzoate is 10.061 (3) Å. Adjacent molecules are linked through both O5—H5A···O2 and O5—H5B···O4(x + 1, y, z) hydrogen bonds and lead to the formation of a one-dimensional hydrogen-bonded chain running along the a axis (Fig. 2).
For complexes of 2,2'-disulfanediyldibenzoic acid, see: Feng et al. (2009); Humphrey et al. (2004); Li et al. (2007); Murugavel et al. (2001); Zhou et al. (2009).
Data collection: SMART (Bruker, 2002); cell SAINT-Plus (Bruker, 2003); data reduction: SAINT-Plus (Bruker, 2003); program(s) used to solve structure: SHELXTL (Sheldrick, 2008); program(s) used to refine structure: SHELXTL (Sheldrick, 2008); molecular graphics: SHELXTL (Sheldrick, 2008) and DIAMOND (Brandenburg, 2006); software used to prepare material for publication: publCIF (Westrip, 2010).
| [Ni2(C14H8O4S2)2(C10H8N2)2(H2O)2] | F(000) = 1104 |
| Mr = 1074.47 | Dx = 1.542 Mg m−3 |
| Monoclinic, P21/c | Mo Kα radiation, λ = 0.71073 Å |
| Hall symbol: -P 2ybc | Cell parameters from 7893 reflections |
| a = 13.498 (4) Å | θ = 2.3–27.5° |
| b = 16.769 (5) Å | µ = 1.06 mm−1 |
| c = 10.238 (3) Å | T = 296 K |
| β = 93.196 (4)° | Block, green |
| V = 2313.7 (12) Å3 | 0.35 × 0.33 × 0.28 mm |
| Z = 2 |
| Bruker SMART APEX CCD diffractometer | 5302 independent reflections |
| Radiation source: fine-focus sealed tube | 4428 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.034 |
| φ and ω scans | θmax = 27.5°, θmin = 1.5° |
| Absorption correction: multi-scan (SADABS; Sheldrick, 2004) | h = −17→17 |
| Tmin = 0.708, Tmax = 0.756 | k = −21→20 |
| 19861 measured reflections | l = −13→13 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.029 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.080 | H atoms treated by a mixture of independent and constrained refinement |
| S = 1.06 | w = 1/[σ2(Fo2) + (0.0369P)2 + 0.5543P] where P = (Fo2 + 2Fc2)/3 |
| 5302 reflections | (Δ/σ)max = 0.001 |
| 307 parameters | Δρmax = 0.34 e Å−3 |
| 3 restraints | Δρmin = −0.26 e Å−3 |
| [Ni2(C14H8O4S2)2(C10H8N2)2(H2O)2] | V = 2313.7 (12) Å3 |
| Mr = 1074.47 | Z = 2 |
| Monoclinic, P21/c | Mo Kα radiation |
| a = 13.498 (4) Å | µ = 1.06 mm−1 |
| b = 16.769 (5) Å | T = 296 K |
| c = 10.238 (3) Å | 0.35 × 0.33 × 0.28 mm |
| β = 93.196 (4)° |
| Bruker SMART APEX CCD diffractometer | 5302 independent reflections |
| Absorption correction: multi-scan (SADABS; Sheldrick, 2004) | 4428 reflections with I > 2σ(I) |
| Tmin = 0.708, Tmax = 0.756 | Rint = 0.034 |
| 19861 measured reflections |
| R[F2 > 2σ(F2)] = 0.029 | 3 restraints |
| wR(F2) = 0.080 | H atoms treated by a mixture of independent and constrained refinement |
| S = 1.06 | Δρmax = 0.34 e Å−3 |
| 5302 reflections | Δρmin = −0.26 e Å−3 |
| 307 parameters |
Geometry. All e.s.d.'s (except the e.s.d. in the dihedral angle between two l.s. planes) are estimated using the full covariance matrix. The cell e.s.d.'s are taken into account individually in the estimation of e.s.d.'s in distances, angles and torsion angles; correlations between e.s.d.'s in cell parameters are only used when they are defined by crystal symmetry. An approximate (isotropic) treatment of cell e.s.d.'s is used for estimating e.s.d.'s involving l.s. planes. |
Refinement. Refinement of F2 against ALL reflections. The weighted R-factor wR and goodness of fit S are based on F2, conventional R-factors R are based on F, with F set to zero for negative F2. The threshold expression of F2 > σ(F2) is used only for calculating R-factors(gt) etc. and is not relevant to the choice of reflections for refinement. R-factors based on F2 are statistically about twice as large as those based on F, and R- factors based on ALL data will be even larger. |
| x | y | z | Uiso*/Ueq | ||
| Ni1 | 0.847531 (15) | 0.055670 (13) | 0.87112 (2) | 0.035 | |
| C1 | 0.71145 (13) | −0.16433 (10) | 0.72485 (16) | 0.0372 (4) | |
| C2 | 0.61332 (13) | −0.15067 (10) | 0.75883 (16) | 0.0361 (4) | |
| C3 | 0.54059 (16) | −0.20699 (12) | 0.7226 (2) | 0.0516 (5) | |
| H3 | 0.4753 | −0.1986 | 0.7440 | 0.062* | |
| C4 | 0.56481 (19) | −0.27532 (13) | 0.6549 (2) | 0.0630 (6) | |
| H4 | 0.5157 | −0.3124 | 0.6317 | 0.076* | |
| C5 | 0.66066 (19) | −0.28886 (13) | 0.6217 (2) | 0.0635 (6) | |
| H5 | 0.6763 | −0.3347 | 0.5760 | 0.076* | |
| C6 | 0.73315 (17) | −0.23407 (12) | 0.65659 (19) | 0.0514 (5) | |
| H6 | 0.7980 | −0.2435 | 0.6344 | 0.062* | |
| C7 | 0.79432 (13) | −0.10570 (11) | 0.75377 (16) | 0.0375 (4) | |
| C8 | 0.26979 (12) | 0.00106 (10) | 0.79602 (16) | 0.0364 (4) | |
| C9 | 0.37029 (12) | −0.01665 (10) | 0.77860 (15) | 0.0352 (3) | |
| C10 | 0.41443 (15) | 0.01522 (13) | 0.67009 (18) | 0.0493 (5) | |
| H10 | 0.4808 | 0.0044 | 0.6576 | 0.059* | |
| C11 | 0.36100 (17) | 0.06275 (15) | 0.5808 (2) | 0.0609 (6) | |
| H11 | 0.3919 | 0.0836 | 0.5094 | 0.073* | |
| C12 | 0.26263 (17) | 0.07935 (15) | 0.5966 (2) | 0.0631 (6) | |
| H12 | 0.2268 | 0.1108 | 0.5359 | 0.076* | |
| C13 | 0.21750 (15) | 0.04884 (13) | 0.70385 (19) | 0.0509 (5) | |
| H13 | 0.1511 | 0.0603 | 0.7149 | 0.061* | |
| C14 | 0.21825 (12) | −0.02608 (10) | 0.91345 (16) | 0.0345 (3) | |
| O1 | 0.76966 (9) | −0.04232 (7) | 0.81054 (13) | 0.0430 (3) | |
| O2 | 0.87892 (10) | −0.12087 (10) | 0.71985 (16) | 0.0652 (4) | |
| O3 | 0.26151 (9) | −0.07316 (7) | 0.99322 (11) | 0.0361 (3) | |
| O4 | 0.13146 (8) | −0.00058 (8) | 0.93571 (12) | 0.0437 (3) | |
| S1 | 0.58588 (3) | −0.06272 (3) | 0.85144 (4) | 0.03707 (9) | |
| S2 | 0.44006 (3) | −0.07593 (3) | 0.89692 (4) | 0.03871 (10) | |
| C15 | 0.71731 (16) | 0.10390 (13) | 0.6351 (2) | 0.0548 (5) | |
| H15 | 0.7039 | 0.0497 | 0.6255 | 0.066* | |
| C16 | 0.66890 (17) | 0.15698 (15) | 0.5504 (2) | 0.0650 (6) | |
| H16 | 0.6246 | 0.1389 | 0.4841 | 0.078* | |
| C17 | 0.68751 (18) | 0.23695 (15) | 0.5661 (2) | 0.0652 (6) | |
| H17 | 0.6560 | 0.2739 | 0.5103 | 0.078* | |
| C18 | 0.75337 (18) | 0.26211 (13) | 0.6655 (2) | 0.0577 (5) | |
| H18 | 0.7656 | 0.3162 | 0.6782 | 0.069* | |
| C19 | 0.80122 (14) | 0.20630 (11) | 0.74626 (18) | 0.0430 (4) | |
| C20 | 0.87518 (14) | 0.22631 (11) | 0.85377 (18) | 0.0441 (4) | |
| C21 | 0.90507 (19) | 0.30399 (14) | 0.8850 (2) | 0.0629 (6) | |
| H21 | 0.8783 | 0.3471 | 0.8380 | 0.075* | |
| C22 | 0.9751 (2) | 0.31585 (16) | 0.9869 (3) | 0.0739 (7) | |
| H22 | 0.9951 | 0.3673 | 1.0099 | 0.089* | |
| C23 | 1.01454 (18) | 0.25211 (16) | 1.0536 (2) | 0.0671 (6) | |
| H23 | 1.0621 | 0.2593 | 1.1219 | 0.081* | |
| C24 | 0.98269 (15) | 0.17672 (14) | 1.0180 (2) | 0.0564 (5) | |
| H24 | 1.0101 | 0.1332 | 1.0631 | 0.068* | |
| N1 | 0.78256 (11) | 0.12735 (9) | 0.73016 (14) | 0.0413 (3) | |
| N2 | 0.91367 (11) | 0.16354 (9) | 0.92081 (15) | 0.0432 (3) | |
| O5 | 0.96680 (9) | 0.01730 (9) | 0.77302 (14) | 0.0491 (3) | |
| H5A | 1.0177 (12) | 0.0183 (13) | 0.824 (2) | 0.074* | |
| H5B | 0.9511 (17) | −0.0306 (7) | 0.754 (2) | 0.074* |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Ni1 | 0.026 | 0.039 | 0.040 | −0.001 | 0.003 | 0.007 |
| C1 | 0.0405 (9) | 0.0373 (9) | 0.0332 (8) | 0.0051 (7) | −0.0024 (7) | 0.0006 (7) |
| C2 | 0.0394 (9) | 0.0346 (9) | 0.0338 (8) | 0.0004 (7) | −0.0025 (7) | 0.0028 (6) |
| C3 | 0.0476 (11) | 0.0493 (11) | 0.0572 (11) | −0.0082 (9) | −0.0033 (9) | −0.0062 (9) |
| C4 | 0.0699 (15) | 0.0470 (12) | 0.0703 (14) | −0.0087 (11) | −0.0129 (12) | −0.0120 (10) |
| C5 | 0.0832 (17) | 0.0434 (12) | 0.0624 (13) | 0.0081 (11) | −0.0098 (12) | −0.0160 (10) |
| C6 | 0.0570 (12) | 0.0489 (11) | 0.0476 (10) | 0.0123 (10) | −0.0028 (9) | −0.0067 (9) |
| C7 | 0.0341 (9) | 0.0441 (10) | 0.0340 (8) | 0.0070 (7) | 0.0008 (7) | 0.0009 (7) |
| C8 | 0.0318 (8) | 0.0419 (9) | 0.0356 (8) | −0.0026 (7) | 0.0020 (7) | −0.0001 (7) |
| C9 | 0.0343 (8) | 0.0380 (9) | 0.0333 (8) | −0.0011 (7) | 0.0009 (6) | −0.0010 (7) |
| C10 | 0.0398 (10) | 0.0672 (13) | 0.0416 (9) | 0.0035 (9) | 0.0100 (8) | 0.0056 (9) |
| C11 | 0.0549 (13) | 0.0874 (17) | 0.0411 (10) | 0.0048 (11) | 0.0106 (9) | 0.0210 (10) |
| C12 | 0.0552 (13) | 0.0885 (17) | 0.0455 (11) | 0.0112 (12) | 0.0017 (10) | 0.0251 (11) |
| C13 | 0.0362 (10) | 0.0692 (14) | 0.0474 (10) | 0.0067 (9) | 0.0025 (8) | 0.0131 (9) |
| C14 | 0.0282 (8) | 0.0361 (8) | 0.0392 (8) | −0.0051 (7) | 0.0015 (7) | −0.0012 (7) |
| O1 | 0.0318 (6) | 0.0405 (7) | 0.0576 (7) | −0.0019 (5) | 0.0097 (6) | −0.0059 (6) |
| O2 | 0.0349 (7) | 0.0753 (11) | 0.0862 (11) | 0.0066 (7) | 0.0110 (7) | −0.0292 (9) |
| O3 | 0.0303 (6) | 0.0369 (6) | 0.0414 (6) | −0.0006 (5) | 0.0051 (5) | 0.0039 (5) |
| O4 | 0.0268 (6) | 0.0562 (8) | 0.0483 (7) | 0.0033 (5) | 0.0052 (5) | 0.0090 (6) |
| S1 | 0.0287 (2) | 0.0389 (2) | 0.0437 (2) | −0.00063 (17) | 0.00326 (17) | −0.00318 (18) |
| S2 | 0.0290 (2) | 0.0452 (2) | 0.0422 (2) | −0.00065 (18) | 0.00338 (17) | 0.00589 (18) |
| C15 | 0.0550 (12) | 0.0520 (12) | 0.0560 (12) | 0.0005 (10) | −0.0092 (9) | 0.0086 (9) |
| C16 | 0.0598 (14) | 0.0721 (16) | 0.0610 (13) | 0.0092 (12) | −0.0150 (11) | 0.0087 (11) |
| C17 | 0.0726 (16) | 0.0638 (15) | 0.0585 (13) | 0.0257 (12) | −0.0014 (11) | 0.0158 (11) |
| C18 | 0.0692 (14) | 0.0450 (11) | 0.0594 (12) | 0.0142 (10) | 0.0079 (10) | 0.0108 (9) |
| C19 | 0.0429 (10) | 0.0420 (10) | 0.0453 (9) | 0.0038 (8) | 0.0128 (8) | 0.0075 (8) |
| C20 | 0.0432 (10) | 0.0435 (10) | 0.0470 (10) | −0.0060 (8) | 0.0150 (8) | 0.0060 (8) |
| C21 | 0.0758 (16) | 0.0470 (12) | 0.0670 (14) | −0.0151 (11) | 0.0128 (12) | 0.0067 (10) |
| C22 | 0.0807 (18) | 0.0650 (16) | 0.0771 (16) | −0.0348 (14) | 0.0130 (14) | −0.0062 (13) |
| C23 | 0.0585 (14) | 0.0775 (17) | 0.0652 (14) | −0.0287 (13) | 0.0014 (11) | −0.0046 (12) |
| C24 | 0.0410 (11) | 0.0672 (14) | 0.0604 (12) | −0.0145 (10) | −0.0024 (9) | 0.0069 (10) |
| N1 | 0.0360 (8) | 0.0433 (8) | 0.0444 (8) | 0.0004 (7) | 0.0023 (6) | 0.0083 (7) |
| N2 | 0.0338 (8) | 0.0477 (9) | 0.0487 (8) | −0.0080 (7) | 0.0068 (6) | 0.0061 (7) |
| O5 | 0.0286 (7) | 0.0674 (9) | 0.0516 (8) | 0.0012 (6) | 0.0054 (5) | 0.0055 (7) |
| Ni1—O1 | 2.0290 (13) | C12—H12 | 0.9300 |
| Ni1—N1 | 2.0385 (15) | C13—H13 | 0.9300 |
| Ni1—O5 | 2.0481 (14) | C14—O3 | 1.256 (2) |
| Ni1—N2 | 2.0682 (16) | C14—O4 | 1.279 (2) |
| Ni1—O3i | 2.0999 (13) | C14—Ni1i | 2.4734 (18) |
| Ni1—O4i | 2.1869 (13) | O3—Ni1i | 2.0999 (13) |
| Ni1—C14i | 2.4733 (18) | O4—Ni1i | 2.1870 (13) |
| C1—C6 | 1.402 (3) | S1—S2 | 2.0596 (8) |
| C1—C2 | 1.407 (2) | C15—N1 | 1.335 (2) |
| C1—C7 | 1.506 (2) | C15—C16 | 1.381 (3) |
| C2—C3 | 1.398 (2) | C15—H15 | 0.9300 |
| C2—S1 | 1.8029 (18) | C16—C17 | 1.372 (3) |
| C3—C4 | 1.387 (3) | C16—H16 | 0.9300 |
| C3—H3 | 0.9300 | C17—C18 | 1.379 (3) |
| C4—C5 | 1.375 (3) | C17—H17 | 0.9300 |
| C4—H4 | 0.9300 | C18—C19 | 1.385 (3) |
| C5—C6 | 1.375 (3) | C18—H18 | 0.9300 |
| C5—H5 | 0.9300 | C19—N1 | 1.356 (2) |
| C6—H6 | 0.9300 | C19—C20 | 1.483 (3) |
| C7—O2 | 1.238 (2) | C20—N2 | 1.345 (2) |
| C7—O1 | 1.265 (2) | C20—C21 | 1.395 (3) |
| C8—C13 | 1.399 (2) | C21—C22 | 1.383 (3) |
| C8—C9 | 1.410 (2) | C21—H21 | 0.9300 |
| C8—C14 | 1.493 (2) | C22—C23 | 1.361 (4) |
| C9—C10 | 1.396 (2) | C22—H22 | 0.9300 |
| C9—S2 | 1.7932 (17) | C23—C24 | 1.378 (3) |
| C10—C11 | 1.385 (3) | C23—H23 | 0.9300 |
| C10—H10 | 0.9300 | C24—N2 | 1.343 (2) |
| C11—C12 | 1.375 (3) | C24—H24 | 0.9300 |
| C11—H11 | 0.9300 | O5—H5A | 0.841 (9) |
| C12—C13 | 1.383 (3) | O5—H5B | 0.850 (9) |
| O1—Ni1—N1 | 93.79 (6) | C11—C12—H12 | 120.3 |
| O1—Ni1—O5 | 90.21 (6) | C13—C12—H12 | 120.3 |
| N1—Ni1—O5 | 99.03 (6) | C12—C13—C8 | 121.29 (19) |
| O1—Ni1—N2 | 173.06 (6) | C12—C13—H13 | 119.4 |
| N1—Ni1—N2 | 79.70 (6) | C8—C13—H13 | 119.4 |
| O5—Ni1—N2 | 93.16 (6) | O3—C14—O4 | 119.43 (15) |
| O1—Ni1—O3i | 86.85 (5) | O3—C14—C8 | 119.62 (15) |
| N1—Ni1—O3i | 95.52 (6) | O4—C14—C8 | 120.92 (15) |
| O5—Ni1—O3i | 165.32 (5) | O3—C14—Ni1i | 58.08 (9) |
| N2—Ni1—O3i | 91.37 (5) | O4—C14—Ni1i | 62.00 (9) |
| O1—Ni1—O4i | 88.47 (5) | C8—C14—Ni1i | 170.27 (12) |
| N1—Ni1—O4i | 156.68 (6) | C7—O1—Ni1 | 132.52 (12) |
| O5—Ni1—O4i | 104.18 (5) | C14—O3—Ni1i | 91.41 (10) |
| N2—Ni1—O4i | 96.58 (6) | C14—O4—Ni1i | 86.90 (10) |
| O3i—Ni1—O4i | 61.39 (5) | C2—S1—S2 | 104.94 (6) |
| O1—Ni1—C14i | 84.52 (5) | C9—S2—S1 | 105.08 (6) |
| N1—Ni1—C14i | 126.01 (6) | N1—C15—C16 | 122.5 (2) |
| O5—Ni1—C14i | 134.86 (6) | N1—C15—H15 | 118.7 |
| N2—Ni1—C14i | 97.33 (6) | C16—C15—H15 | 118.7 |
| O3i—Ni1—C14i | 30.51 (5) | C17—C16—C15 | 118.6 (2) |
| O4i—Ni1—C14i | 31.10 (5) | C17—C16—H16 | 120.7 |
| C6—C1—C2 | 119.01 (17) | C15—C16—H16 | 120.7 |
| C6—C1—C7 | 117.97 (17) | C16—C17—C18 | 119.46 (19) |
| C2—C1—C7 | 122.97 (15) | C16—C17—H17 | 120.3 |
| C3—C2—C1 | 118.77 (17) | C18—C17—H17 | 120.3 |
| C3—C2—S1 | 122.05 (15) | C17—C18—C19 | 119.6 (2) |
| C1—C2—S1 | 119.15 (13) | C17—C18—H18 | 120.2 |
| C4—C3—C2 | 120.6 (2) | C19—C18—H18 | 120.2 |
| C4—C3—H3 | 119.7 | N1—C19—C18 | 120.67 (19) |
| C2—C3—H3 | 119.7 | N1—C19—C20 | 115.09 (16) |
| C5—C4—C3 | 120.7 (2) | C18—C19—C20 | 124.23 (19) |
| C5—C4—H4 | 119.6 | N2—C20—C21 | 121.00 (19) |
| C3—C4—H4 | 119.6 | N2—C20—C19 | 115.26 (16) |
| C4—C5—C6 | 119.4 (2) | C21—C20—C19 | 123.75 (19) |
| C4—C5—H5 | 120.3 | C22—C21—C20 | 118.9 (2) |
| C6—C5—H5 | 120.3 | C22—C21—H21 | 120.5 |
| C5—C6—C1 | 121.4 (2) | C20—C21—H21 | 120.5 |
| C5—C6—H6 | 119.3 | C23—C22—C21 | 119.8 (2) |
| C1—C6—H6 | 119.3 | C23—C22—H22 | 120.1 |
| O2—C7—O1 | 124.88 (17) | C21—C22—H22 | 120.1 |
| O2—C7—C1 | 119.81 (17) | C22—C23—C24 | 118.7 (2) |
| O1—C7—C1 | 115.29 (15) | C22—C23—H23 | 120.7 |
| C13—C8—C9 | 119.23 (16) | C24—C23—H23 | 120.7 |
| C13—C8—C14 | 118.52 (16) | N2—C24—C23 | 122.7 (2) |
| C9—C8—C14 | 122.18 (15) | N2—C24—H24 | 118.6 |
| C10—C9—C8 | 118.46 (16) | C23—C24—H24 | 118.6 |
| C10—C9—S2 | 121.23 (14) | C15—N1—C19 | 119.12 (16) |
| C8—C9—S2 | 120.27 (13) | C15—N1—Ni1 | 125.65 (14) |
| C11—C10—C9 | 121.06 (18) | C19—N1—Ni1 | 114.83 (12) |
| C11—C10—H10 | 119.5 | C24—N2—C20 | 118.79 (18) |
| C9—C10—H10 | 119.5 | C24—N2—Ni1 | 126.75 (14) |
| C12—C11—C10 | 120.63 (19) | C20—N2—Ni1 | 114.19 (12) |
| C12—C11—H11 | 119.7 | Ni1—O5—H5A | 108.9 (17) |
| C10—C11—H11 | 119.7 | Ni1—O5—H5B | 102.6 (18) |
| C11—C12—C13 | 119.32 (19) | H5A—O5—H5B | 110.3 (14) |
| Symmetry code: (i) −x+1, −y, −z+2. |
| D—H···A | D—H | H···A | D···A | D—H···A |
| O5—H5B···O2 | 0.85 (1) | 1.82 (1) | 2.646 (2) | 162 (2) |
| O5—H5A···O4ii | 0.84 (1) | 1.89 (1) | 2.7187 (18) | 169 (2) |
| Symmetry code: (ii) x+1, y, z. |
Experimental details
| Crystal data | |
| Chemical formula | [Ni2(C14H8O4S2)2(C10H8N2)2(H2O)2] |
| Mr | 1074.47 |
| Crystal system, space group | Monoclinic, P21/c |
| Temperature (K) | 296 |
| a, b, c (Å) | 13.498 (4), 16.769 (5), 10.238 (3) |
| β (°) | 93.196 (4) |
| V (Å3) | 2313.7 (12) |
| Z | 2 |
| Radiation type | Mo Kα |
| µ (mm−1) | 1.06 |
| Crystal size (mm) | 0.35 × 0.33 × 0.28 |
| Data collection | |
| Diffractometer | Bruker SMART APEX CCD |
| Absorption correction | Multi-scan (SADABS; Sheldrick, 2004) |
| Tmin, Tmax | 0.708, 0.756 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 19861, 5302, 4428 |
| Rint | 0.034 |
| (sin θ/λ)max (Å−1) | 0.649 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.029, 0.080, 1.06 |
| No. of reflections | 5302 |
| No. of parameters | 307 |
| No. of restraints | 3 |
| H-atom treatment | H atoms treated by a mixture of independent and constrained refinement |
| Δρmax, Δρmin (e Å−3) | 0.34, −0.26 |
Computer programs: SMART (Bruker, 2002), SAINT-Plus (Bruker, 2003), SHELXTL (Sheldrick, 2008) and DIAMOND (Brandenburg, 2006), publCIF (Westrip, 2010).
| D—H···A | D—H | H···A | D···A | D—H···A |
| O5—H5B···O2 | 0.850 (9) | 1.824 (11) | 2.646 (2) | 162 (2) |
| O5—H5A···O4i | 0.841 (9) | 1.888 (11) | 2.7187 (18) | 169 (2) |
| Symmetry code: (i) x+1, y, z. |
Acknowledgements
This work was supported by the Foundation of the Key Laboratory of Environmental Material and Environmental Engineering of Jiangsu Province.
References
Brandenburg, K. (2006). DIAMOND. Crystal Impact GbR, Bonn, Germany. Google Scholar
Bruker (2002). SMART. Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
Bruker (2003). SAINT-Plus. Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
Feng, R., Jiang, F. L., Chen, L., Yan, C. F., Wu, M. Y. & Hong, M. C. (2009). Chem. Commun. pp. 5296–5298. Web of Science CSD CrossRef Google Scholar
Humphrey, S. M., Mole, R. A., Rawson, J. M. & Wood, P. T. (2004). Dalton Trans. pp. 1670–1678. Web of Science CSD CrossRef PubMed Google Scholar
Li, X.-H., Jia, S.-C. & Jalbout, A. F. (2007). Z. Kristallogr. New Cryst. Struct. 222, 117–118. CAS Google Scholar
Murugavel, R., Baheti, K. & Anantharaman, G. (2001). Inorg. Chem. 40, 6870–6878. Web of Science CSD CrossRef PubMed CAS Google Scholar
Sheldrick, G. M. (2004). SADABS. University of Göttingen, Germany. Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Westrip, S. P. (2010). J. Appl. Cryst. 43, 920–925. Web of Science CrossRef CAS IUCr Journals Google Scholar
Zhou, L.-M., Zhang, Q. & Hu, M. (2009). Acta Cryst. E65, m1221–m1222. Web of Science CSD CrossRef IUCr Journals Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
![[Figure 1]](./ng5064fig1thm.gif)
![[Figure 2]](./ng5064fig2thm.gif)




The flexible 2,2'-disulfanediyldibenzoic acid, a multifunctional ligand containing both carboxylic and thio groups, can potentially afford various coordination modes and diverse coordination architectures. Many complexes with this ligand show unique structural topologies and interesting properties (Murugavel et al., 2001; Humphrey et al., 2004; Li et al., 2007; Zhou et al., 2009; Feng et al., 2009). In this work, we have used this ligand to react with a NiII salt in the presence of 2,2'-bipyridine as a chelating co-ligand, to obtain the title binuclear compound, Ni2(H2O)2(C10H8N2)2(C14H8O4S2)2.
The asymmetric unit of the title compound is composed of one NiII ion, one 2,2'-disulfanediyldibenzoate ligand, one 2,2'-bipyridine ligand and one coordinated water molecule (Fig. 1). The NiII center is six-coordinated, in a distorted octahedral geometry, by two N atoms from one 2,2'-bipyridine ligand, three carboxylate O atoms from two different disulfanediyldibenzoate ligands and one O atom from a coordinated water molecule Two disulfanediyldibenzoate dianions bridge two NiII ions about a center of inversion with its two carboxylate groups in bidentate chelating and monodentate modes, respectively, generating the title binuclear compound. The Ni···Ni distance bridged by two 2, 2'-disulfanediyldibenzoate is 10.061 (3) Å. Adjacent molecules are linked through both O5—H5A···O2 and O5—H5B···O4(x + 1, y, z) hydrogen bonds and lead to the formation of a one-dimensional hydrogen-bonded chain running along the a axis (Fig. 2).