metal-organic compounds
Aqua(2,2′-bipyridine-κ2N,N′)bis(4-iodobenzoato-κO)copper(II)
aDepartment of Chemistry, University of Malaya, 50603 Kuala Lumpur, Malaysia
*Correspondence e-mail: [email protected]
The CuII atom in the title compound, [Cu(C7H4IO2)2(C10H8N2)(H2O)], is N,N′-chelated by a 2,2′-bipyridine ligand and is coordinated by two monodentate carboxylate ions and a water molecule in a distorted square-pyramidal geometry. The apical site is occupied by one of the carboxylate O atoms. The water molecule forms intramolecular hydrogen bonds to the uncoordinated carboxyl O atoms. The crystal studied was a nonmerohedral twin with minor components in 0.381 (3) and 0.108 (2) proportions.
Related literature
For related copper carboxylate–2,2′-bipyridine adducts, see: He et al. (2007
); Li et al. (2006
); Liu et al. (2006
); Yang et al. (1994
).
Experimental
Crystal data
|
Refinement
|
| ||||||||||||||
| ||||||||||||||||||||||
Data collection: APEX2 (Bruker, 2009
); cell refinement: SAINT (Bruker, 2009
); data reduction: SAINT; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: X-SEED (Barbour, 2001
); software used to prepare material for publication: publCIF (Westrip, 2010
).
Supporting information
contains datablocks global, I. DOI: https://doi.org/10.1107/S1600536810044995/xu5068sup1.cif
Structure factors: contains datablock I. DOI: https://doi.org/10.1107/S1600536810044995/xu5068Isup2.hkl
Copper acetate monohydrate (2.00 g, 10 mmol) and 4-iodobenzoic acid (4.96 g, 20 mmol) were heated in aqueous ethanol (1:1, 60 ml) for 1 h. The solvent was removed to give blue copper bis(4-iodobenzoate), which was isolated in 50% yield. The powder and 2,2'-bipyridine (0.77 g, 5 mmol) were dissolved in tetrahydrofuran. Crystals were isolated after several days.
H atoms were placed in calculated positions (C–H 0.95, O–H 0.84 Å) and were included in the in the riding model approximation, with U(H) set to 1.2 to 1.5U(C,O).
The final difference Fourier map had a peak and a hole in the vicinity of I2.
The crystal studied is a non-merohedral twin with minor components in a 38.1 (3) and 10.8 (2)% proportion. The twinned nature of the adversely affected the quality of the diffraction measured, and this is reflected in the somewhat larger numbers in the weighting scheme.
Copper(II) benzoate and its analogs form adducts with 2,2'-bipyridine. The copper benzoate homolog furnishes a water-coordinated adduct (Yang et al., 1994), as does copper p-toluate (Li et al., 2006; Liu et al., 2006) and copper o-toluate (He et al., 2007). The copper atom in Cu(H2O)(C10H8N2)(C7H4IO2)2 (Scheme I) is chelated by the N-heterocycle and is coordinated by two monodentate carboxylate ions and a water molecule in a square-pyramidal geometry (Fig. 1). The apical site is occupied by the O atom of the carboxylate unit. The crystal studied is a non-merohedral twin with minor components in a 0.381 (3) and 0.108 (2) proportion.
For related copper carboxylate–2,2'-bipyridine adducts, see: He et al. (2007); Li et al. (2006); Liu et al. (2006); Yang et al. (1994).
Data collection: APEX2 (Bruker, 2009); cell SAINT (Bruker, 2009); data reduction: SAINT (Bruker, 2009); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: X-SEED (Barbour, 2001); software used to prepare material for publication: publCIF (Westrip, 2010).
| Fig. 1. Thermal ellipsoid plot (Barbour, 2001) of Cu(H2O)(C10H8N2)(C7H4IO2)2 at the 70% probability level; hydrogen atoms are drawn as spheres of arbitrary radius. |
| [Cu(C7H4IO2)2(C10H8N2)(H2O)] | F(000) = 1404 |
| Mr = 731.74 | Dx = 1.990 Mg m−3 |
| Monoclinic, P21/c | Mo Kα radiation, λ = 0.71073 Å |
| Hall symbol: -P 2ybc | Cell parameters from 1215 reflections |
| a = 13.0571 (2) Å | θ = 2.5–24.2° |
| b = 16.0724 (2) Å | µ = 3.46 mm−1 |
| c = 11.9605 (2) Å | T = 100 K |
| β = 103.298 (1)° | Cube, blue |
| V = 2442.72 (6) Å3 | 0.30 × 0.30 × 0.30 mm |
| Z = 4 |
| Bruker SMART APEX diffractometer | 5698 independent reflections |
| Radiation source: fine-focus sealed tube | 4505 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.092 |
| ω scans | θmax = 25.1°, θmin = 2.0° |
| Absorption correction: multi-scan (TWINABS; Bruker, 2009) | h = −15→15 |
| Tmin = 0.423, Tmax = 0.423 | k = 0→19 |
| 33957 measured reflections | l = 0→14 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.058 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.175 | H-atom parameters constrained |
| S = 1.08 | w = 1/[σ2(Fo2) + (0.087P)2 + 12.0788P] where P = (Fo2 + 2Fc2)/3 |
| 5698 reflections | (Δ/σ)max = 0.001 |
| 310 parameters | Δρmax = 1.71 e Å−3 |
| 0 restraints | Δρmin = −1.69 e Å−3 |
| [Cu(C7H4IO2)2(C10H8N2)(H2O)] | V = 2442.72 (6) Å3 |
| Mr = 731.74 | Z = 4 |
| Monoclinic, P21/c | Mo Kα radiation |
| a = 13.0571 (2) Å | µ = 3.46 mm−1 |
| b = 16.0724 (2) Å | T = 100 K |
| c = 11.9605 (2) Å | 0.30 × 0.30 × 0.30 mm |
| β = 103.298 (1)° |
| Bruker SMART APEX diffractometer | 5698 independent reflections |
| Absorption correction: multi-scan (TWINABS; Bruker, 2009) | 4505 reflections with I > 2σ(I) |
| Tmin = 0.423, Tmax = 0.423 | Rint = 0.092 |
| 33957 measured reflections |
| R[F2 > 2σ(F2)] = 0.058 | 0 restraints |
| wR(F2) = 0.175 | H-atom parameters constrained |
| S = 1.08 | w = 1/[σ2(Fo2) + (0.087P)2 + 12.0788P] where P = (Fo2 + 2Fc2)/3 |
| 5698 reflections | Δρmax = 1.71 e Å−3 |
| 310 parameters | Δρmin = −1.69 e Å−3 |
| x | y | z | Uiso*/Ueq | ||
| I1 | 1.52100 (5) | 0.77933 (4) | 0.96178 (5) | 0.0307 (2) | |
| I2 | 0.54254 (5) | 1.06313 (4) | 0.81444 (6) | 0.0370 (2) | |
| Cu1 | 0.88404 (8) | 0.70624 (6) | 0.44393 (8) | 0.0165 (3) | |
| O1 | 0.7975 (5) | 0.7791 (3) | 0.5186 (5) | 0.0189 (13) | |
| O2 | 0.7765 (5) | 0.8878 (4) | 0.3970 (6) | 0.0319 (16) | |
| O3 | 1.0368 (4) | 0.7208 (3) | 0.5695 (5) | 0.0182 (12) | |
| O4 | 1.0982 (5) | 0.8248 (4) | 0.4776 (5) | 0.0220 (13) | |
| O1W | 0.9172 (5) | 0.7943 (3) | 0.3446 (5) | 0.0203 (13) | |
| H11 | 0.8773 | 0.8352 | 0.3455 | 0.030* | |
| H12 | 0.9801 | 0.8092 | 0.3687 | 0.030* | |
| N1 | 0.8380 (5) | 0.6058 (4) | 0.5151 (6) | 0.0162 (15) | |
| N2 | 0.9245 (5) | 0.6191 (4) | 0.3416 (5) | 0.0144 (14) | |
| C1 | 0.7637 (7) | 0.8513 (5) | 0.4846 (8) | 0.0215 (19) | |
| C2 | 0.7064 (7) | 0.8978 (5) | 0.5618 (7) | 0.0209 (18) | |
| C3 | 0.6627 (7) | 0.9757 (5) | 0.5274 (8) | 0.024 (2) | |
| H3 | 0.6656 | 0.9967 | 0.4540 | 0.029* | |
| C4 | 0.6158 (7) | 1.0224 (6) | 0.5975 (8) | 0.028 (2) | |
| H4 | 0.5884 | 1.0759 | 0.5737 | 0.034* | |
| C5 | 0.6090 (7) | 0.9913 (5) | 0.7019 (8) | 0.0236 (19) | |
| C6 | 0.6510 (7) | 0.9127 (5) | 0.7390 (8) | 0.026 (2) | |
| H6 | 0.6470 | 0.8919 | 0.8122 | 0.031* | |
| C7 | 0.6977 (7) | 0.8665 (5) | 0.6682 (7) | 0.0219 (19) | |
| H7 | 0.7245 | 0.8128 | 0.6916 | 0.026* | |
| C8 | 1.1036 (7) | 0.7747 (5) | 0.5605 (7) | 0.0195 (18) | |
| C9 | 1.2009 (7) | 0.7822 (5) | 0.6583 (7) | 0.0171 (17) | |
| C10 | 1.2850 (7) | 0.8289 (5) | 0.6483 (7) | 0.0217 (19) | |
| H10 | 1.2808 | 0.8612 | 0.5809 | 0.026* | |
| C11 | 1.3773 (7) | 0.8306 (5) | 0.7346 (7) | 0.0222 (19) | |
| H11A | 1.4365 | 0.8623 | 0.7263 | 0.027* | |
| C12 | 1.3794 (7) | 0.7842 (5) | 0.8332 (7) | 0.0216 (19) | |
| C13 | 1.2941 (7) | 0.7393 (5) | 0.8471 (8) | 0.0235 (19) | |
| H13 | 1.2969 | 0.7096 | 0.9164 | 0.028* | |
| C14 | 1.2052 (7) | 0.7373 (5) | 0.7612 (7) | 0.0204 (18) | |
| H14 | 1.1460 | 0.7059 | 0.7703 | 0.024* | |
| C15 | 0.7940 (7) | 0.6048 (5) | 0.6056 (7) | 0.0218 (19) | |
| H15 | 0.7804 | 0.6566 | 0.6378 | 0.026* | |
| C16 | 0.7670 (8) | 0.5324 (5) | 0.6550 (8) | 0.025 (2) | |
| H16 | 0.7364 | 0.5339 | 0.7198 | 0.030* | |
| C17 | 0.7866 (7) | 0.4578 (6) | 0.6057 (8) | 0.026 (2) | |
| H17 | 0.7687 | 0.4068 | 0.6365 | 0.031* | |
| C18 | 0.8320 (7) | 0.4570 (5) | 0.5122 (8) | 0.0230 (19) | |
| H18 | 0.8456 | 0.4059 | 0.4782 | 0.028* | |
| C19 | 0.8573 (6) | 0.5329 (5) | 0.4690 (7) | 0.0152 (17) | |
| C20 | 0.9038 (6) | 0.5399 (5) | 0.3673 (7) | 0.0166 (17) | |
| C21 | 0.9213 (7) | 0.4734 (5) | 0.3003 (8) | 0.026 (2) | |
| H21 | 0.9065 | 0.4181 | 0.3200 | 0.031* | |
| C22 | 0.9603 (8) | 0.4886 (6) | 0.2050 (7) | 0.026 (2) | |
| H22 | 0.9734 | 0.4439 | 0.1582 | 0.031* | |
| C23 | 0.9802 (7) | 0.5701 (5) | 0.1779 (8) | 0.024 (2) | |
| H23 | 1.0054 | 0.5821 | 0.1112 | 0.029* | |
| C24 | 0.9627 (6) | 0.6336 (5) | 0.2493 (7) | 0.0195 (18) | |
| H24 | 0.9784 | 0.6892 | 0.2320 | 0.023* |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| I1 | 0.0258 (3) | 0.0370 (4) | 0.0256 (4) | 0.0053 (3) | −0.0018 (2) | −0.0007 (2) |
| I2 | 0.0303 (4) | 0.0424 (4) | 0.0393 (4) | 0.0066 (3) | 0.0099 (3) | −0.0150 (3) |
| Cu1 | 0.0216 (6) | 0.0126 (5) | 0.0153 (5) | −0.0010 (4) | 0.0045 (4) | 0.0007 (4) |
| O1 | 0.026 (3) | 0.016 (3) | 0.015 (3) | 0.000 (2) | 0.007 (3) | −0.004 (2) |
| O2 | 0.039 (4) | 0.029 (4) | 0.032 (4) | 0.010 (3) | 0.017 (3) | 0.017 (3) |
| O3 | 0.017 (3) | 0.020 (3) | 0.015 (3) | −0.002 (2) | 0.000 (2) | 0.000 (2) |
| O4 | 0.025 (3) | 0.021 (3) | 0.019 (3) | −0.007 (3) | 0.003 (3) | 0.008 (2) |
| O1W | 0.025 (3) | 0.017 (3) | 0.018 (3) | 0.000 (2) | 0.002 (3) | 0.001 (2) |
| N1 | 0.020 (4) | 0.010 (3) | 0.017 (4) | −0.003 (3) | 0.000 (3) | −0.001 (3) |
| N2 | 0.016 (3) | 0.017 (4) | 0.008 (3) | 0.003 (3) | 0.000 (3) | 0.001 (3) |
| C1 | 0.016 (4) | 0.020 (5) | 0.028 (5) | 0.004 (3) | 0.005 (4) | 0.007 (4) |
| C2 | 0.017 (4) | 0.020 (4) | 0.025 (5) | −0.001 (3) | 0.002 (4) | 0.000 (3) |
| C3 | 0.025 (5) | 0.023 (5) | 0.026 (5) | 0.000 (4) | 0.008 (4) | 0.004 (3) |
| C4 | 0.022 (5) | 0.026 (5) | 0.036 (6) | 0.001 (4) | 0.006 (4) | −0.003 (4) |
| C5 | 0.015 (4) | 0.026 (5) | 0.027 (5) | 0.003 (4) | −0.001 (4) | −0.011 (4) |
| C6 | 0.021 (5) | 0.022 (5) | 0.036 (6) | −0.001 (4) | 0.009 (4) | 0.001 (4) |
| C7 | 0.017 (4) | 0.017 (4) | 0.027 (5) | 0.001 (3) | −0.007 (4) | −0.002 (3) |
| C8 | 0.023 (5) | 0.015 (4) | 0.022 (5) | 0.003 (4) | 0.008 (4) | −0.004 (3) |
| C9 | 0.020 (4) | 0.019 (4) | 0.014 (4) | 0.004 (3) | 0.005 (3) | 0.002 (3) |
| C10 | 0.030 (5) | 0.024 (5) | 0.013 (4) | 0.002 (4) | 0.009 (4) | 0.000 (3) |
| C11 | 0.019 (4) | 0.032 (5) | 0.017 (4) | −0.005 (4) | 0.007 (4) | −0.006 (3) |
| C12 | 0.029 (5) | 0.022 (4) | 0.015 (4) | 0.009 (4) | 0.007 (4) | −0.008 (3) |
| C13 | 0.026 (5) | 0.019 (4) | 0.025 (5) | 0.005 (4) | 0.004 (4) | −0.001 (3) |
| C14 | 0.025 (5) | 0.012 (4) | 0.024 (5) | 0.004 (3) | 0.006 (4) | −0.002 (3) |
| C15 | 0.024 (5) | 0.017 (4) | 0.024 (5) | 0.000 (4) | 0.004 (4) | −0.001 (3) |
| C16 | 0.034 (5) | 0.023 (5) | 0.019 (5) | −0.004 (4) | 0.008 (4) | 0.002 (3) |
| C17 | 0.028 (5) | 0.027 (5) | 0.023 (5) | −0.006 (4) | 0.008 (4) | 0.006 (4) |
| C18 | 0.019 (5) | 0.013 (4) | 0.037 (5) | 0.003 (3) | 0.006 (4) | 0.003 (4) |
| C19 | 0.010 (4) | 0.019 (4) | 0.015 (4) | 0.004 (3) | −0.002 (3) | 0.004 (3) |
| C20 | 0.016 (4) | 0.014 (4) | 0.019 (5) | 0.001 (3) | 0.000 (3) | 0.000 (3) |
| C21 | 0.031 (5) | 0.017 (5) | 0.029 (5) | −0.005 (4) | 0.006 (4) | 0.002 (3) |
| C22 | 0.035 (5) | 0.023 (5) | 0.020 (5) | 0.002 (4) | 0.007 (4) | −0.006 (4) |
| C23 | 0.023 (5) | 0.028 (5) | 0.020 (5) | 0.002 (4) | 0.002 (4) | 0.004 (4) |
| C24 | 0.019 (4) | 0.025 (5) | 0.017 (5) | 0.002 (4) | 0.009 (4) | −0.001 (3) |
| I1—C12 | 2.117 (9) | C8—C9 | 1.521 (12) |
| I2—C5 | 2.106 (8) | C9—C10 | 1.358 (12) |
| Cu1—N1 | 1.982 (7) | C9—C14 | 1.416 (11) |
| Cu1—N2 | 2.009 (6) | C10—C11 | 1.395 (12) |
| Cu1—O1 | 1.977 (5) | C10—H10 | 0.9500 |
| Cu1—O3 | 2.216 (6) | C11—C12 | 1.390 (12) |
| Cu1—O1W | 1.959 (5) | C11—H11A | 0.9500 |
| O1—C1 | 1.275 (10) | C12—C13 | 1.369 (13) |
| O2—C1 | 1.246 (10) | C13—C14 | 1.363 (12) |
| O3—C8 | 1.251 (10) | C13—H13 | 0.9500 |
| O4—C8 | 1.268 (10) | C14—H14 | 0.9500 |
| O1W—H11 | 0.8400 | C15—C16 | 1.387 (12) |
| O1W—H12 | 0.8400 | C15—H15 | 0.9500 |
| N1—C15 | 1.338 (11) | C16—C17 | 1.386 (12) |
| N1—C19 | 1.344 (10) | C16—H16 | 0.9500 |
| N2—C24 | 1.332 (10) | C17—C18 | 1.380 (12) |
| N2—C20 | 1.351 (10) | C17—H17 | 0.9500 |
| C1—C2 | 1.513 (12) | C18—C19 | 1.394 (11) |
| C2—C7 | 1.396 (12) | C18—H18 | 0.9500 |
| C2—C3 | 1.397 (12) | C19—C20 | 1.484 (12) |
| C3—C4 | 1.369 (12) | C20—C21 | 1.386 (12) |
| C3—H3 | 0.9500 | C21—C22 | 1.373 (12) |
| C4—C5 | 1.367 (13) | C21—H21 | 0.9500 |
| C4—H4 | 0.9500 | C22—C23 | 1.389 (13) |
| C5—C6 | 1.409 (12) | C22—H22 | 0.9500 |
| C6—C7 | 1.370 (12) | C23—C24 | 1.383 (12) |
| C6—H6 | 0.9500 | C23—H23 | 0.9500 |
| C7—H7 | 0.9500 | C24—H24 | 0.9500 |
| O1W—Cu1—O1 | 94.3 (2) | C14—C9—C8 | 119.1 (7) |
| O1W—Cu1—N1 | 168.6 (3) | C9—C10—C11 | 121.6 (8) |
| O1—Cu1—N1 | 91.6 (3) | C9—C10—H10 | 119.2 |
| O1W—Cu1—N2 | 90.5 (3) | C11—C10—H10 | 119.2 |
| O1—Cu1—N2 | 161.0 (3) | C12—C11—C10 | 117.5 (8) |
| N1—Cu1—N2 | 80.9 (3) | C12—C11—H11A | 121.3 |
| O1W—Cu1—O3 | 92.6 (2) | C10—C11—H11A | 121.3 |
| O1—Cu1—O3 | 98.7 (2) | C13—C12—C11 | 121.9 (8) |
| N1—Cu1—O3 | 96.3 (2) | C13—C12—I1 | 119.4 (6) |
| N2—Cu1—O3 | 99.5 (2) | C11—C12—I1 | 118.6 (7) |
| C1—O1—Cu1 | 126.0 (5) | C14—C13—C12 | 119.8 (8) |
| C8—O3—Cu1 | 123.5 (5) | C14—C13—H13 | 120.1 |
| Cu1—O1W—H11 | 109.5 | C12—C13—H13 | 120.1 |
| Cu1—O1W—H12 | 109.5 | C13—C14—C9 | 120.0 (8) |
| H11—O1W—H12 | 109.5 | C13—C14—H14 | 120.0 |
| C15—N1—C19 | 118.6 (7) | C9—C14—H14 | 120.0 |
| C15—N1—Cu1 | 125.9 (5) | N1—C15—C16 | 123.6 (8) |
| C19—N1—Cu1 | 115.5 (5) | N1—C15—H15 | 118.2 |
| C24—N2—C20 | 119.1 (7) | C16—C15—H15 | 118.2 |
| C24—N2—Cu1 | 125.7 (6) | C17—C16—C15 | 117.1 (8) |
| C20—N2—Cu1 | 115.1 (5) | C17—C16—H16 | 121.5 |
| O2—C1—O1 | 126.4 (8) | C15—C16—H16 | 121.5 |
| O2—C1—C2 | 117.5 (7) | C18—C17—C16 | 120.6 (8) |
| O1—C1—C2 | 116.1 (7) | C18—C17—H17 | 119.7 |
| C7—C2—C3 | 118.5 (8) | C16—C17—H17 | 119.7 |
| C7—C2—C1 | 122.2 (8) | C17—C18—C19 | 118.3 (8) |
| C3—C2—C1 | 119.3 (7) | C17—C18—H18 | 120.9 |
| C4—C3—C2 | 121.4 (8) | C19—C18—H18 | 120.9 |
| C4—C3—H3 | 119.3 | N1—C19—C18 | 121.9 (7) |
| C2—C3—H3 | 119.3 | N1—C19—C20 | 114.9 (7) |
| C5—C4—C3 | 119.4 (9) | C18—C19—C20 | 123.2 (7) |
| C5—C4—H4 | 120.3 | N2—C20—C21 | 121.8 (7) |
| C3—C4—H4 | 120.3 | N2—C20—C19 | 113.5 (7) |
| C4—C5—C6 | 120.9 (8) | C21—C20—C19 | 124.6 (7) |
| C4—C5—I2 | 120.5 (7) | C22—C21—C20 | 119.0 (8) |
| C6—C5—I2 | 118.6 (6) | C22—C21—H21 | 120.5 |
| C7—C6—C5 | 119.2 (8) | C20—C21—H21 | 120.5 |
| C7—C6—H6 | 120.4 | C21—C22—C23 | 119.1 (8) |
| C5—C6—H6 | 120.4 | C21—C22—H22 | 120.4 |
| C6—C7—C2 | 120.6 (8) | C23—C22—H22 | 120.4 |
| C6—C7—H7 | 119.7 | C24—C23—C22 | 119.1 (8) |
| C2—C7—H7 | 119.7 | C24—C23—H23 | 120.5 |
| O3—C8—O4 | 126.4 (8) | C22—C23—H23 | 120.5 |
| O3—C8—C9 | 117.7 (7) | N2—C24—C23 | 121.9 (8) |
| O4—C8—C9 | 115.9 (7) | N2—C24—H24 | 119.0 |
| C10—C9—C14 | 119.1 (8) | C23—C24—H24 | 119.0 |
| C10—C9—C8 | 121.7 (7) | ||
| O1W—Cu1—O1—C1 | 13.0 (7) | Cu1—O3—C8—C9 | 174.9 (5) |
| N1—Cu1—O1—C1 | −157.2 (7) | O3—C8—C9—C10 | 169.1 (8) |
| N2—Cu1—O1—C1 | −91.2 (10) | O4—C8—C9—C10 | −11.3 (11) |
| O3—Cu1—O1—C1 | 106.2 (7) | O3—C8—C9—C14 | −9.0 (11) |
| O1W—Cu1—O3—C8 | 2.8 (6) | O4—C8—C9—C14 | 170.5 (7) |
| O1—Cu1—O3—C8 | −91.9 (6) | C14—C9—C10—C11 | 3.1 (12) |
| N1—Cu1—O3—C8 | 175.6 (6) | C8—C9—C10—C11 | −175.0 (7) |
| N2—Cu1—O3—C8 | 93.8 (6) | C9—C10—C11—C12 | −1.6 (12) |
| O1W—Cu1—N1—C15 | −138.5 (12) | C10—C11—C12—C13 | −1.0 (12) |
| O1—Cu1—N1—C15 | −17.7 (7) | C10—C11—C12—I1 | 176.3 (6) |
| N2—Cu1—N1—C15 | 179.8 (7) | C11—C12—C13—C14 | 2.0 (12) |
| O3—Cu1—N1—C15 | 81.2 (7) | I1—C12—C13—C14 | −175.3 (6) |
| O1W—Cu1—N1—C19 | 44.0 (17) | C12—C13—C14—C9 | −0.5 (12) |
| O1—Cu1—N1—C19 | 164.8 (6) | C10—C9—C14—C13 | −2.1 (12) |
| N2—Cu1—N1—C19 | 2.3 (6) | C8—C9—C14—C13 | 176.1 (7) |
| O3—Cu1—N1—C19 | −96.3 (6) | C19—N1—C15—C16 | 0.1 (13) |
| O1W—Cu1—N2—C24 | 2.9 (7) | Cu1—N1—C15—C16 | −177.3 (7) |
| O1—Cu1—N2—C24 | 107.7 (9) | N1—C15—C16—C17 | −0.6 (14) |
| N1—Cu1—N2—C24 | 175.3 (7) | C15—C16—C17—C18 | 0.6 (14) |
| O3—Cu1—N2—C24 | −89.8 (7) | C16—C17—C18—C19 | 0.0 (14) |
| O1W—Cu1—N2—C20 | −172.7 (6) | C15—N1—C19—C18 | 0.5 (12) |
| O1—Cu1—N2—C20 | −68.0 (10) | Cu1—N1—C19—C18 | 178.2 (6) |
| N1—Cu1—N2—C20 | −0.3 (6) | C15—N1—C19—C20 | 178.5 (7) |
| O3—Cu1—N2—C20 | 94.6 (6) | Cu1—N1—C19—C20 | −3.8 (9) |
| Cu1—O1—C1—O2 | 2.1 (13) | C17—C18—C19—N1 | −0.6 (13) |
| Cu1—O1—C1—C2 | −175.2 (5) | C17—C18—C19—C20 | −178.4 (8) |
| O2—C1—C2—C7 | −172.9 (8) | C24—N2—C20—C21 | 0.1 (12) |
| O1—C1—C2—C7 | 4.7 (12) | Cu1—N2—C20—C21 | 176.0 (7) |
| O2—C1—C2—C3 | 5.4 (13) | C24—N2—C20—C19 | −177.5 (7) |
| O1—C1—C2—C3 | −177.0 (8) | Cu1—N2—C20—C19 | −1.5 (9) |
| C7—C2—C3—C4 | 2.5 (13) | N1—C19—C20—N2 | 3.5 (11) |
| C1—C2—C3—C4 | −175.9 (9) | C18—C19—C20—N2 | −178.6 (8) |
| C2—C3—C4—C5 | −1.8 (14) | N1—C19—C20—C21 | −174.0 (8) |
| C3—C4—C5—C6 | 1.1 (14) | C18—C19—C20—C21 | 4.0 (14) |
| C3—C4—C5—I2 | 177.7 (7) | N2—C20—C21—C22 | −0.3 (14) |
| C4—C5—C6—C7 | −1.1 (13) | C19—C20—C21—C22 | 176.9 (8) |
| I2—C5—C6—C7 | −177.8 (7) | C20—C21—C22—C23 | −0.6 (14) |
| C5—C6—C7—C2 | 1.7 (13) | C21—C22—C23—C24 | 1.6 (14) |
| C3—C2—C7—C6 | −2.4 (13) | C20—N2—C24—C23 | 1.1 (13) |
| C1—C2—C7—C6 | 175.9 (8) | Cu1—N2—C24—C23 | −174.4 (6) |
| Cu1—O3—C8—O4 | −4.6 (12) | C22—C23—C24—N2 | −1.9 (14) |
| D—H···A | D—H | H···A | D···A | D—H···A |
| O1w—H11···O2 | 0.84 | 1.79 | 2.560 (9) | 152 |
| O1w—H12···O4 | 0.84 | 1.79 | 2.575 (8) | 154 |
Experimental details
| Crystal data | |
| Chemical formula | [Cu(C7H4IO2)2(C10H8N2)(H2O)] |
| Mr | 731.74 |
| Crystal system, space group | Monoclinic, P21/c |
| Temperature (K) | 100 |
| a, b, c (Å) | 13.0571 (2), 16.0724 (2), 11.9605 (2) |
| β (°) | 103.298 (1) |
| V (Å3) | 2442.72 (6) |
| Z | 4 |
| Radiation type | Mo Kα |
| µ (mm−1) | 3.46 |
| Crystal size (mm) | 0.30 × 0.30 × 0.30 |
| Data collection | |
| Diffractometer | Bruker SMART APEX |
| Absorption correction | Multi-scan (TWINABS; Bruker, 2009) |
| Tmin, Tmax | 0.423, 0.423 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 33957, 5698, 4505 |
| Rint | 0.092 |
| (sin θ/λ)max (Å−1) | 0.598 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.058, 0.175, 1.08 |
| No. of reflections | 5698 |
| No. of parameters | 310 |
| H-atom treatment | H-atom parameters constrained |
| w = 1/[σ2(Fo2) + (0.087P)2 + 12.0788P] where P = (Fo2 + 2Fc2)/3 | |
| Δρmax, Δρmin (e Å−3) | 1.71, −1.69 |
Computer programs: APEX2 (Bruker, 2009), SAINT (Bruker, 2009), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), X-SEED (Barbour, 2001), publCIF (Westrip, 2010).
| Cu1—N1 | 1.982 (7) | Cu1—O3 | 2.216 (6) |
| Cu1—N2 | 2.009 (6) | Cu1—O1W | 1.959 (5) |
| Cu1—O1 | 1.977 (5) |
| D—H···A | D—H | H···A | D···A | D—H···A |
| O1w—H11···O2 | 0.84 | 1.79 | 2.560 (9) | 151.9 |
| O1w—H12···O4 | 0.84 | 1.79 | 2.575 (8) | 153.9 |
Acknowledgements
We thank the University of Malaya for supporting this study.
References
Barbour, L. J. (2001). J. Supramol. Chem. 1, 189–191. CrossRef CAS Google Scholar
Bruker (2009). APEX2, SAINT and TWINABS. Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
He, X.-M., Li, C.-H., Yang, Y.-Q. & Li, W. (2007). Chin. J. Struct. Chem. 26, 206–210. CAS Google Scholar
Li, W., Li, C.-H., Yang, Y.-Q., Kuang, D.-Z. & Xu, W.-J. (2006). Chin. J. Struct. Chem. 25, 616–620. CAS Google Scholar
Liu, F.-Q., Wang, Q.-X., Jiao, K., Jian, F.-F., Liu, G.-Y. & Li, R.-X. (2006). Inorg. Chim. Acta, 359, 1524–1530. Web of Science CSD CrossRef CAS Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Westrip, S. P. (2010). J. Appl. Cryst. 43, 920–925. Web of Science CrossRef CAS IUCr Journals Google Scholar
Yang, R.-N., Wang, D.-M., Jin, D.-M., Wang, H.-Q. & Yang, Y. (1994). Chin. J. Struct. Chem. 13, 45–47. CAS Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
![[Figure 1]](./xu5068fig1thm.gif)




Copper(II) benzoate and its analogs form adducts with 2,2'-bipyridine. The copper benzoate homolog furnishes a water-coordinated adduct (Yang et al., 1994), as does copper p-toluate (Li et al., 2006; Liu et al., 2006) and copper o-toluate (He et al., 2007). The copper atom in Cu(H2O)(C10H8N2)(C7H4IO2)2 (Scheme I) is chelated by the N-heterocycle and is coordinated by two monodentate carboxylate ions and a water molecule in a square-pyramidal geometry (Fig. 1). The apical site is occupied by the O atom of the carboxylate unit. The crystal studied is a non-merohedral twin with minor components in a 0.381 (3) and 0.108 (2) proportion.