metal-organic compounds
Poly[[aqua(μ5-1H-benzimidazole-5,6-dicarboxylato)(μ4-1H-benzimidazole-5,6-dicarboxylato)dibarium] 4.5-hydrate]
aDepartment of Chemistry, East China Normal University, Shanghai 200062, People's Republic of China, bDepartment of Chemical Engineering, Huarui College, Northeast Petroleum University, Harbin 15002, People's Republic of China, cDepartment of Chemistry, Zhoukou Normal University, Zhoukou 466001, People's Republic of China, and dDepartment of Chemistry, University of Malaya, 50603 Kuala Lumpur, Malaysia
*Correspondence e-mail: [email protected]
The polymeric title compound, {[Ba2(C9H4N2O4)2(H2O)]·4.5H2O}n, adopts a layer structure parallel to (001) in which adjacent BaII atoms are connected by two benzimidazole-5,6-dicarboxylate dianions, one functioning in a μ4-bridging mode and the other in a μ5-bridging mode. The Ba atom having water in its coordination environment as well as the Ba atom without water exist in a nine-coordinate polyhedron of O atoms; the geometry is difficult to derive. Lattice water molecules occupy the space between layers and interact with the layers through O—H⋯O, O—H⋯N and N—H⋯O hydrogen bonds. ne of the five lattice water molecules is equally disordered around an inversion centre and shows half-occupancy.
Related literature
For the strontium 1H-benzimidazole-5,6-dicarboxylate derivative, see: Song et al. (2009
).
Experimental
Crystal data
|
Refinement
|
|
Data collection: RAPID-AUTO (Rigaku Corporation, 1998
); cell refinement: RAPID-AUTO; data reduction: CrystalStructure (Rigaku/MSC, 2002
); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: X-SEED (Barbour, 2001
); software used to prepare material for publication: publCIF (Westrip, 2010
).
Supporting information
contains datablocks global, I. DOI: https://doi.org/10.1107/S160053681101590X/jh2280sup1.cif
Structure factors: contains datablock I. DOI: https://doi.org/10.1107/S160053681101590X/jh2280Isup2.hkl
Barium chloride (0.0416 g, 0.20 mmol) and 1H-benzimidazole-5,6-dicarboxylic acid (0.0412 g, 0.20 mmol) were placed in water (35 ml); the reactants dissolved upon addition of several drops of dilute sodium hydroxide to a pH of 7. The solution was set aside for the growth of crystals over several weeks; yield 60% based on Ba.
Hydrogen atoms were placed in calculated positions (C–H 0.93 Å) and were included in the in the riding model approximation, with U(H) set to 1.2Ueq(C). The amino and water H atoms were placed in chemically sensible positions on the basis of hydrogen bonding interactions (O–H 0.84 Å and N–H 0.88 Å); their temperature factors were tied by a factor of 1.2–1.5 times. Positioning the H atoms lead to H12···H21 and H31···H42 distances of about 2 Å, which are regarded as being acceptable. The O5w molecule then forms only one hydrogen bond. Positioning the second H atom elsewhere led to too short interactions.
On this basis, the N1 and N4 atoms are atoms having a hydrogen connected to them whereas the N2 and N3 atoms do not.
One of the water molecules (O5w) is disordered about a center-of-inversion.
The anisotropic temperature factors of the free water molecules were restrained to be nearly isotropic.
The final difference Fourier map had peaks in the vicinity of both Ba atoms.
The 1H-benzimidazole-5,6-dicarboxylate dianion affords a large number of metal salts; most of the studies involve rare earth metals. The crystal structures of only few main group derivatives have been reported. The SrII derivative exists as a monohydrate; the metal atom is also coordinated by two water ligands in an eight-coordinate square-antiprismatic geometry. The dianion functions in a \m4 bridging mode (Song et al., 2009). The BaII analog has 4.5 lattice water molecules (Scheme I). Polymeric Ba2(H2O)(C9H4NO4)2.4.5H2O adopts a layer structure in which adjacent BaII atoms are connected by two benzimidazole-5,6-dicarboxylate dianions, one functioning in a µ4 bridging mode and the other in a µ5 bridging mode. The Ba atom having water in its coordination environment as well as the Ba atom without water exist in a nine-coordinate polyhedron of O atom; the geometry is undefined. Lattice water molecules occupy the space between layers, and interact with the layers through O–H···O and N–H···O hydrogen bonds to generate a three-dimensional network (Table 1).
For the strontium 1H-benzimidazole-5,6-dicarboxylate derivative, see: Song et al. (2009).
Data collection: RAPID-AUTO (Rigaku Corporation, 1998); cell RAPID-AUTO (Rigaku Corporation, 1998); data reduction: CrystalStructure (Rigaku/MSC, 2002); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: X-SEED (Barbour, 2001); software used to prepare material for publication: publCIF (Westrip, 2010).
| [Ba2(C9H4N2O4)2(H2O)]·4.5H2O | Z = 2 |
| Mr = 782.05 | F(000) = 750 |
| Triclinic, P1 | Dx = 2.231 Mg m−3 |
| Hall symbol: -P 1 | Mo Kα radiation, λ = 0.71073 Å |
| a = 6.9331 (4) Å | Cell parameters from 10107 reflections |
| b = 9.5950 (4) Å | θ = 3.1–27.5° |
| c = 18.0179 (7) Å | µ = 3.44 mm−1 |
| α = 103.186 (1)° | T = 293 K |
| β = 92.068 (2)° | Prism, colorless |
| γ = 93.032 (2)° | 0.33 × 0.24 × 0.21 mm |
| V = 1163.94 (9) Å3 |
| Rigaku R-AXIS RAPID diffractometer | 5246 independent reflections |
| Radiation source: fine-focus sealed tube | 4749 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.025 |
| Detector resolution: 10.000 pixels mm-1 | θmax = 27.5°, θmin = 3.1° |
| ω scans | h = −8→8 |
| Absorption correction: multi-scan (ABSCOR; Higashi, 1995) | k = −11→12 |
| Tmin = 0.396, Tmax = 0.532 | l = −23→23 |
| 11398 measured reflections |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.028 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.074 | H-atom parameters constrained |
| S = 1.07 | w = 1/[σ2(Fo2) + (0.0388P)2 + 1.7294P] where P = (Fo2 + 2Fc2)/3 |
| 5246 reflections | (Δ/σ)max = 0.001 |
| 343 parameters | Δρmax = 1.54 e Å−3 |
| 30 restraints | Δρmin = −0.68 e Å−3 |
| [Ba2(C9H4N2O4)2(H2O)]·4.5H2O | γ = 93.032 (2)° |
| Mr = 782.05 | V = 1163.94 (9) Å3 |
| Triclinic, P1 | Z = 2 |
| a = 6.9331 (4) Å | Mo Kα radiation |
| b = 9.5950 (4) Å | µ = 3.44 mm−1 |
| c = 18.0179 (7) Å | T = 293 K |
| α = 103.186 (1)° | 0.33 × 0.24 × 0.21 mm |
| β = 92.068 (2)° |
| Rigaku R-AXIS RAPID diffractometer | 5246 independent reflections |
| Absorption correction: multi-scan (ABSCOR; Higashi, 1995) | 4749 reflections with I > 2σ(I) |
| Tmin = 0.396, Tmax = 0.532 | Rint = 0.025 |
| 11398 measured reflections |
| R[F2 > 2σ(F2)] = 0.028 | 30 restraints |
| wR(F2) = 0.074 | H-atom parameters constrained |
| S = 1.07 | Δρmax = 1.54 e Å−3 |
| 5246 reflections | Δρmin = −0.68 e Å−3 |
| 343 parameters |
| x | y | z | Uiso*/Ueq | Occ. (<1) | |
| Ba1 | 0.26276 (3) | 0.610140 (19) | 0.450910 (11) | 0.02043 (7) | |
| Ba2 | 0.26062 (3) | 0.078630 (18) | 0.581428 (11) | 0.01842 (7) | |
| O1 | 0.1686 (4) | 0.8140 (3) | 0.60189 (15) | 0.0296 (5) | |
| O2 | 0.0501 (4) | 0.5894 (3) | 0.57721 (14) | 0.0267 (5) | |
| O3 | 0.3591 (4) | 0.3818 (3) | 0.61724 (16) | 0.0335 (6) | |
| O4 | 0.0593 (4) | 0.3350 (3) | 0.64668 (16) | 0.0325 (6) | |
| O5 | 0.4310 (4) | 0.3577 (2) | 0.43836 (15) | 0.0282 (5) | |
| O6 | 0.4612 (3) | 0.1417 (2) | 0.46119 (14) | 0.0228 (5) | |
| O7 | 0.1291 (3) | −0.0557 (3) | 0.43544 (14) | 0.0259 (5) | |
| O8 | 0.3566 (3) | −0.1786 (3) | 0.37175 (15) | 0.0262 (5) | |
| O1w | 0.3097 (12) | 1.1921 (6) | 0.8946 (3) | 0.128 (2) | |
| H11 | 0.2025 | 1.2235 | 0.9081 | 0.192* | |
| H12 | 0.3998 | 1.2440 | 0.9213 | 0.192* | |
| O2w | 0.5133 (16) | 0.5633 (9) | 1.0382 (5) | 0.083 (3) | 0.50 |
| H21 | 0.4591 | 0.5883 | 1.0013 | 0.124* | 0.50 |
| H22 | 0.5884 | 0.4986 | 1.0218 | 0.124* | 0.50 |
| O3w | 0.2112 (15) | 0.4994 (10) | 0.1075 (5) | 0.177 (4) | |
| H31 | 0.1689 | 0.4135 | 0.0922 | 0.266* | |
| H32 | 0.2282 | 0.5210 | 0.1552 | 0.266* | |
| O4w | −0.0138 (16) | −0.3037 (13) | 0.0517 (7) | 0.225 (5) | |
| H41 | 0.0288 | −0.3661 | 0.0729 | 0.337* | |
| H42 | −0.0152 | −0.3286 | 0.0039 | 0.337* | |
| O5w | 0.3529 (5) | 0.1624 (4) | 0.74063 (18) | 0.0466 (8) | |
| H51 | 0.2820 | 0.1137 | 0.7634 | 0.070* | |
| H52 | 0.4694 | 0.1486 | 0.7492 | 0.070* | |
| O6w | 0.2361 (6) | −0.4351 (4) | 0.2606 (3) | 0.0666 (11) | |
| H61 | 0.1264 | −0.4298 | 0.2790 | 0.100* | |
| H62 | 0.3069 | −0.3650 | 0.2855 | 0.100* | |
| N1 | 0.3285 (6) | 0.9029 (4) | 0.8973 (2) | 0.0397 (8) | |
| H1 | 0.3280 | 0.9966 | 0.9036 | 0.048* | |
| N2 | 0.3607 (6) | 0.6883 (4) | 0.9229 (2) | 0.0424 (9) | |
| N3 | 0.2152 (6) | 0.2189 (5) | 0.1479 (2) | 0.0434 (9) | |
| N4 | 0.1238 (6) | −0.0140 (5) | 0.1170 (2) | 0.0473 (10) | |
| H4 | 0.0825 | −0.0992 | 0.0897 | 0.057* | |
| C1 | 0.1336 (4) | 0.6990 (3) | 0.62169 (19) | 0.0198 (6) | |
| C2 | 0.1978 (5) | 0.6878 (3) | 0.70029 (19) | 0.0199 (6) | |
| C3 | 0.2313 (5) | 0.8127 (4) | 0.7571 (2) | 0.0250 (7) | |
| H3A | 0.2173 | 0.9023 | 0.7467 | 0.030* | |
| C4 | 0.2863 (6) | 0.7997 (4) | 0.8300 (2) | 0.0290 (7) | |
| C5 | 0.3694 (7) | 0.8313 (5) | 0.9496 (2) | 0.0459 (11) | |
| H5 | 0.4014 | 0.8757 | 1.0004 | 0.055* | |
| C6 | 0.3078 (6) | 0.6659 (4) | 0.8458 (2) | 0.0305 (8) | |
| C7 | 0.2809 (6) | 0.5397 (4) | 0.7887 (2) | 0.0294 (8) | |
| H7 | 0.2983 | 0.4506 | 0.7992 | 0.035* | |
| C8 | 0.2277 (5) | 0.5522 (3) | 0.71628 (19) | 0.0208 (6) | |
| C9 | 0.2134 (5) | 0.4149 (3) | 0.6539 (2) | 0.0241 (7) | |
| C10 | 0.4047 (4) | 0.2236 (3) | 0.41961 (19) | 0.0198 (6) | |
| C11 | 0.3099 (5) | 0.1562 (3) | 0.34209 (19) | 0.0201 (6) | |
| C12 | 0.3057 (5) | 0.2372 (4) | 0.2876 (2) | 0.0271 (7) | |
| H12A | 0.3482 | 0.3337 | 0.2999 | 0.033* | |
| C13 | 0.2370 (5) | 0.1713 (4) | 0.2147 (2) | 0.0306 (8) | |
| C14 | 0.1482 (8) | 0.1045 (6) | 0.0937 (3) | 0.0517 (12) | |
| H14 | 0.1213 | 0.1093 | 0.0434 | 0.062* | |
| C15 | 0.1772 (6) | 0.0235 (4) | 0.1942 (2) | 0.0312 (8) | |
| C16 | 0.1771 (5) | −0.0567 (4) | 0.2494 (2) | 0.0285 (7) | |
| H16 | 0.1342 | −0.1530 | 0.2371 | 0.034* | |
| C17 | 0.2418 (5) | 0.0098 (3) | 0.32264 (19) | 0.0206 (6) | |
| C18 | 0.2422 (5) | −0.0791 (3) | 0.38180 (19) | 0.0201 (6) |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Ba1 | 0.01885 (11) | 0.01795 (11) | 0.02441 (11) | −0.00112 (7) | −0.00104 (7) | 0.00554 (8) |
| Ba2 | 0.01508 (11) | 0.01541 (10) | 0.02374 (11) | −0.00021 (7) | 0.00126 (7) | 0.00261 (8) |
| O1 | 0.0343 (14) | 0.0228 (12) | 0.0336 (14) | −0.0030 (10) | 0.0009 (11) | 0.0118 (11) |
| O2 | 0.0294 (13) | 0.0237 (12) | 0.0247 (12) | −0.0051 (10) | −0.0022 (10) | 0.0027 (10) |
| O3 | 0.0334 (15) | 0.0224 (12) | 0.0429 (16) | 0.0048 (10) | 0.0116 (12) | 0.0014 (11) |
| O4 | 0.0310 (14) | 0.0199 (12) | 0.0433 (15) | −0.0043 (10) | −0.0035 (11) | 0.0024 (11) |
| O5 | 0.0296 (14) | 0.0170 (11) | 0.0360 (14) | 0.0010 (10) | −0.0055 (11) | 0.0032 (10) |
| O6 | 0.0206 (12) | 0.0219 (11) | 0.0260 (12) | −0.0023 (9) | −0.0012 (9) | 0.0066 (10) |
| O7 | 0.0189 (12) | 0.0325 (13) | 0.0245 (12) | −0.0055 (10) | 0.0009 (9) | 0.0042 (10) |
| O8 | 0.0210 (12) | 0.0212 (11) | 0.0377 (14) | 0.0022 (9) | 0.0004 (10) | 0.0096 (11) |
| O1w | 0.250 (7) | 0.084 (3) | 0.052 (3) | 0.056 (4) | −0.013 (4) | 0.010 (3) |
| O2w | 0.115 (7) | 0.066 (5) | 0.070 (5) | 0.018 (5) | −0.021 (5) | 0.024 (4) |
| O3w | 0.222 (8) | 0.179 (7) | 0.139 (6) | 0.058 (6) | 0.037 (6) | 0.036 (5) |
| O4w | 0.220 (9) | 0.245 (8) | 0.216 (9) | 0.008 (7) | 0.022 (7) | 0.067 (7) |
| O5w | 0.049 (2) | 0.0500 (18) | 0.0395 (17) | 0.0039 (15) | 0.0036 (14) | 0.0080 (15) |
| O6w | 0.058 (2) | 0.046 (2) | 0.089 (3) | 0.0012 (17) | 0.014 (2) | 0.002 (2) |
| N1 | 0.051 (2) | 0.0288 (16) | 0.0326 (17) | 0.0046 (15) | −0.0052 (15) | −0.0057 (14) |
| N2 | 0.059 (2) | 0.042 (2) | 0.0234 (16) | −0.0016 (17) | −0.0061 (15) | 0.0048 (15) |
| N3 | 0.039 (2) | 0.062 (2) | 0.0366 (19) | 0.0035 (18) | −0.0018 (15) | 0.0271 (19) |
| N4 | 0.052 (2) | 0.061 (2) | 0.0265 (17) | 0.0011 (19) | −0.0085 (16) | 0.0065 (18) |
| C1 | 0.0138 (14) | 0.0201 (15) | 0.0252 (16) | 0.0012 (11) | 0.0034 (12) | 0.0045 (13) |
| C2 | 0.0161 (15) | 0.0184 (14) | 0.0244 (16) | 0.0021 (11) | 0.0013 (12) | 0.0031 (13) |
| C3 | 0.0246 (17) | 0.0189 (15) | 0.0304 (18) | 0.0025 (13) | 0.0012 (14) | 0.0028 (14) |
| C4 | 0.0298 (19) | 0.0263 (17) | 0.0259 (17) | 0.0017 (14) | −0.0002 (14) | −0.0044 (14) |
| C5 | 0.059 (3) | 0.049 (3) | 0.0234 (19) | 0.002 (2) | −0.0075 (18) | −0.0030 (18) |
| C6 | 0.035 (2) | 0.0309 (18) | 0.0237 (17) | −0.0003 (15) | −0.0015 (14) | 0.0036 (15) |
| C7 | 0.037 (2) | 0.0222 (16) | 0.0284 (18) | 0.0018 (14) | −0.0023 (15) | 0.0061 (14) |
| C8 | 0.0197 (16) | 0.0163 (14) | 0.0248 (16) | −0.0008 (12) | 0.0001 (12) | 0.0021 (13) |
| C9 | 0.0289 (18) | 0.0157 (14) | 0.0276 (17) | 0.0026 (13) | −0.0018 (13) | 0.0052 (13) |
| C10 | 0.0135 (14) | 0.0200 (14) | 0.0258 (16) | 0.0013 (11) | 0.0014 (12) | 0.0048 (13) |
| C11 | 0.0155 (15) | 0.0179 (14) | 0.0272 (16) | 0.0033 (11) | 0.0017 (12) | 0.0051 (13) |
| C12 | 0.0228 (17) | 0.0273 (17) | 0.0342 (19) | 0.0011 (13) | 0.0021 (14) | 0.0128 (15) |
| C13 | 0.0247 (18) | 0.041 (2) | 0.0309 (19) | 0.0055 (15) | 0.0008 (14) | 0.0178 (17) |
| C14 | 0.049 (3) | 0.079 (4) | 0.030 (2) | 0.004 (3) | −0.0050 (19) | 0.022 (2) |
| C15 | 0.0285 (19) | 0.038 (2) | 0.0248 (17) | 0.0024 (15) | −0.0037 (14) | 0.0022 (16) |
| C16 | 0.0274 (18) | 0.0265 (17) | 0.0292 (18) | 0.0013 (14) | −0.0015 (14) | 0.0019 (15) |
| C17 | 0.0166 (15) | 0.0202 (15) | 0.0248 (16) | 0.0026 (12) | 0.0006 (12) | 0.0044 (13) |
| C18 | 0.0157 (15) | 0.0176 (14) | 0.0258 (16) | −0.0047 (11) | −0.0032 (12) | 0.0044 (13) |
| Ba1—O1 | 3.080 (3) | O3w—H31 | 0.8400 |
| Ba1—O2 | 2.795 (2) | O3w—H32 | 0.8400 |
| Ba1—O2i | 2.769 (2) | O4w—H41 | 0.8401 |
| Ba1—O3ii | 2.940 (3) | O4w—H42 | 0.8400 |
| Ba1—O4i | 2.936 (3) | O5w—H51 | 0.8401 |
| Ba1—O5 | 2.711 (2) | O5w—H52 | 0.8400 |
| Ba1—O5ii | 2.816 (3) | O6w—H61 | 0.8401 |
| Ba1—O6ii | 3.069 (2) | O6w—H62 | 0.8400 |
| Ba1—O8iii | 2.795 (2) | N1—C5 | 1.318 (6) |
| Ba2—O1iv | 2.695 (2) | N1—C4 | 1.389 (5) |
| Ba2—O3 | 2.871 (3) | N1—H1 | 0.8800 |
| Ba2—O4 | 2.923 (3) | N2—C5 | 1.343 (6) |
| Ba2—O6 | 2.778 (2) | N2—C6 | 1.389 (5) |
| Ba2—O6v | 2.928 (2) | N3—C14 | 1.342 (7) |
| Ba2—O7vi | 2.700 (2) | N3—C13 | 1.387 (5) |
| Ba2—O7 | 2.751 (2) | N4—C14 | 1.304 (7) |
| Ba2—O8v | 2.806 (2) | N4—C15 | 1.386 (5) |
| Ba2—O5w | 2.836 (3) | N4—H4 | 0.8800 |
| O1—C1 | 1.249 (4) | C1—C2 | 1.498 (5) |
| O1—Ba2iii | 2.695 (2) | C2—C3 | 1.390 (5) |
| O2—C1 | 1.266 (4) | C2—C8 | 1.419 (4) |
| O2—Ba1i | 2.769 (2) | C3—C4 | 1.389 (5) |
| O3—C9 | 1.242 (4) | C3—H3A | 0.9300 |
| O3—Ba1ii | 2.940 (3) | C4—C6 | 1.392 (5) |
| O4—C9 | 1.266 (4) | C5—H5 | 0.9300 |
| O4—Ba1i | 2.936 (3) | C6—C7 | 1.398 (5) |
| O5—C10 | 1.255 (4) | C7—C8 | 1.376 (5) |
| O5—Ba1ii | 2.816 (3) | C7—H7 | 0.9300 |
| O6—C10 | 1.270 (4) | C8—C9 | 1.521 (5) |
| O6—Ba2v | 2.928 (2) | C10—C11 | 1.509 (5) |
| O6—Ba1ii | 3.069 (2) | C10—Ba1ii | 3.290 (3) |
| O7—C18 | 1.254 (4) | C11—C12 | 1.384 (5) |
| O7—Ba2vi | 2.700 (2) | C11—C17 | 1.419 (4) |
| O8—C18 | 1.259 (4) | C12—C13 | 1.377 (5) |
| O8—Ba1iv | 2.795 (2) | C12—H12A | 0.9300 |
| O8—Ba2v | 2.806 (2) | C13—C15 | 1.417 (6) |
| O1w—H11 | 0.8400 | C14—H14 | 0.9300 |
| O1w—H12 | 0.8400 | C15—C16 | 1.388 (6) |
| O2w—O2wvii | 1.613 (18) | C16—C17 | 1.377 (5) |
| O2w—H21 | 0.8400 | C16—H16 | 0.9300 |
| O2w—H22 | 0.8400 | C17—C18 | 1.510 (4) |
| O5—Ba1—O2i | 77.01 (8) | C10—O6—Ba2 | 124.7 (2) |
| O5—Ba1—O2 | 95.97 (8) | C10—O6—Ba2v | 125.3 (2) |
| O2i—Ba1—O2 | 64.13 (8) | Ba2—O6—Ba2v | 107.25 (7) |
| O5—Ba1—O8iii | 126.34 (8) | C10—O6—Ba1ii | 88.47 (18) |
| O2i—Ba1—O8iii | 127.94 (7) | Ba2—O6—Ba1ii | 99.88 (7) |
| O2—Ba1—O8iii | 136.76 (7) | Ba2v—O6—Ba1ii | 99.38 (7) |
| O5—Ba1—O5ii | 70.23 (8) | C18—O7—Ba2vi | 125.1 (2) |
| O2i—Ba1—O5ii | 128.53 (7) | C18—O7—Ba2 | 121.1 (2) |
| O2—Ba1—O5ii | 80.81 (8) | Ba2vi—O7—Ba2 | 112.68 (8) |
| O8iii—Ba1—O5ii | 103.49 (7) | C18—O8—Ba1iv | 113.3 (2) |
| O5—Ba1—O4i | 126.10 (7) | C18—O8—Ba2v | 112.42 (19) |
| O2i—Ba1—O4i | 63.11 (7) | Ba1iv—O8—Ba2v | 106.20 (8) |
| O2—Ba1—O4i | 97.43 (8) | H11—O1w—H12 | 110.0 |
| O8iii—Ba1—O4i | 66.63 (7) | O2wvii—O2w—H21 | 66.4 |
| O5ii—Ba1—O4i | 163.60 (7) | O2wvii—O2w—H22 | 51.6 |
| O5—Ba1—O3ii | 68.84 (7) | H21—O2w—H22 | 109.5 |
| O2i—Ba1—O3ii | 132.66 (7) | H31—O3w—H32 | 110.7 |
| O2—Ba1—O3ii | 148.68 (8) | H41—O4w—H42 | 112.7 |
| O8iii—Ba1—O3ii | 60.17 (7) | Ba2—O5w—H51 | 109.4 |
| O5ii—Ba1—O3ii | 68.41 (8) | Ba2—O5w—H52 | 109.5 |
| O4i—Ba1—O3ii | 113.72 (8) | H51—O5w—H52 | 109.5 |
| O5—Ba1—O6ii | 110.03 (7) | H61—O6w—H62 | 107.7 |
| O2i—Ba1—O6ii | 158.74 (6) | C5—N1—C4 | 105.7 (4) |
| O2—Ba1—O6ii | 94.83 (7) | C5—N1—H1 | 127.1 |
| O8iii—Ba1—O6ii | 64.97 (7) | C4—N1—H1 | 127.1 |
| O5ii—Ba1—O6ii | 44.11 (6) | C5—N2—C6 | 105.2 (4) |
| O4i—Ba1—O6ii | 120.42 (7) | C14—N3—C13 | 106.3 (4) |
| O3ii—Ba1—O6ii | 67.22 (7) | C14—N4—C15 | 105.0 (4) |
| O5—Ba1—O1 | 125.39 (7) | C14—N4—H4 | 127.5 |
| O2i—Ba1—O1 | 103.10 (7) | C15—N4—H4 | 127.5 |
| O2—Ba1—O1 | 43.78 (6) | O1—C1—O2 | 122.6 (3) |
| O8iii—Ba1—O1 | 97.04 (7) | O1—C1—C2 | 119.2 (3) |
| O5ii—Ba1—O1 | 68.40 (7) | O2—C1—C2 | 118.2 (3) |
| O4i—Ba1—O1 | 98.98 (7) | C3—C2—C8 | 120.4 (3) |
| O3ii—Ba1—O1 | 123.17 (7) | C3—C2—C1 | 118.9 (3) |
| O6ii—Ba1—O1 | 56.15 (6) | C8—C2—C1 | 120.7 (3) |
| O1iv—Ba2—O7vi | 76.72 (8) | C4—C3—C2 | 118.0 (3) |
| O1iv—Ba2—O7 | 80.25 (8) | C4—C3—H3A | 121.0 |
| O7vi—Ba2—O7 | 67.32 (8) | C2—C3—H3A | 121.0 |
| O1iv—Ba2—O6 | 125.88 (8) | C3—C4—N1 | 131.1 (4) |
| O7vi—Ba2—O6 | 116.89 (7) | C3—C4—C6 | 121.1 (3) |
| O7—Ba2—O6 | 62.22 (7) | N1—C4—C6 | 107.7 (3) |
| O1iv—Ba2—O8v | 113.68 (8) | N1—C5—N2 | 113.9 (4) |
| O7vi—Ba2—O8v | 163.12 (8) | N1—C5—H5 | 123.1 |
| O7—Ba2—O8v | 126.06 (7) | N2—C5—H5 | 123.1 |
| O6—Ba2—O8v | 68.87 (7) | N2—C6—C4 | 107.4 (3) |
| O1iv—Ba2—O5w | 87.21 (9) | N2—C6—C7 | 131.1 (4) |
| O7vi—Ba2—O5w | 106.45 (9) | C4—C6—C7 | 121.4 (3) |
| O7—Ba2—O5w | 166.97 (8) | C8—C7—C6 | 117.6 (3) |
| O6—Ba2—O5w | 129.48 (9) | C8—C7—H7 | 121.2 |
| O8v—Ba2—O5w | 62.57 (9) | C6—C7—H7 | 121.2 |
| O1iv—Ba2—O3 | 159.72 (8) | C7—C8—C2 | 121.4 (3) |
| O7vi—Ba2—O3 | 104.58 (8) | C7—C8—C9 | 116.6 (3) |
| O7—Ba2—O3 | 119.27 (8) | C2—C8—C9 | 121.9 (3) |
| O6—Ba2—O3 | 72.16 (7) | O3—C9—O4 | 123.7 (3) |
| O8v—Ba2—O3 | 60.90 (8) | O3—C9—C8 | 118.1 (3) |
| O5w—Ba2—O3 | 72.92 (9) | O4—C9—C8 | 118.0 (3) |
| O1iv—Ba2—O4 | 124.90 (8) | O5—C10—O6 | 123.3 (3) |
| O7vi—Ba2—O4 | 63.37 (7) | O5—C10—C11 | 118.2 (3) |
| O7—Ba2—O4 | 113.76 (8) | O6—C10—C11 | 118.4 (3) |
| O6—Ba2—O4 | 106.09 (7) | O5—C10—Ba1ii | 57.20 (18) |
| O8v—Ba2—O4 | 100.03 (7) | O6—C10—Ba1ii | 68.83 (18) |
| O5w—Ba2—O4 | 70.81 (9) | C11—C10—Ba1ii | 159.4 (2) |
| O3—Ba2—O4 | 44.87 (7) | C12—C11—C17 | 120.1 (3) |
| O1iv—Ba2—O6v | 61.79 (7) | C12—C11—C10 | 118.3 (3) |
| O7vi—Ba2—O6v | 129.53 (7) | C17—C11—C10 | 121.3 (3) |
| O7—Ba2—O6v | 77.96 (7) | C13—C12—C11 | 118.3 (3) |
| O6—Ba2—O6v | 72.75 (7) | C13—C12—H12A | 120.9 |
| O8v—Ba2—O6v | 66.84 (7) | C11—C12—H12A | 120.9 |
| O5w—Ba2—O6v | 99.26 (8) | C12—C13—N3 | 133.1 (4) |
| O3—Ba2—O6v | 124.42 (7) | C12—C13—C15 | 121.7 (3) |
| O4—Ba2—O6v | 166.54 (7) | N3—C13—C15 | 105.1 (4) |
| C1—O1—Ba2iii | 171.4 (2) | N4—C14—N3 | 114.6 (4) |
| C1—O1—Ba1 | 82.76 (19) | N4—C14—H14 | 122.7 |
| Ba2iii—O1—Ba1 | 104.56 (8) | N3—C14—H14 | 122.7 |
| C1—O2—Ba1i | 147.4 (2) | N4—C15—C16 | 131.3 (4) |
| C1—O2—Ba1 | 95.42 (19) | N4—C15—C13 | 108.9 (4) |
| Ba1i—O2—Ba1 | 115.87 (8) | C16—C15—C13 | 119.9 (3) |
| C9—O3—Ba2 | 95.3 (2) | C17—C16—C15 | 118.4 (3) |
| C9—O3—Ba1ii | 163.6 (2) | C17—C16—H16 | 120.8 |
| Ba2—O3—Ba1ii | 100.86 (8) | C15—C16—H16 | 120.8 |
| C9—O4—Ba2 | 92.3 (2) | C16—C17—C11 | 121.5 (3) |
| C9—O4—Ba1i | 118.6 (2) | C16—C17—C18 | 117.8 (3) |
| Ba2—O4—Ba1i | 114.25 (9) | C11—C17—C18 | 120.7 (3) |
| C10—O5—Ba1 | 145.3 (2) | O7—C18—O8 | 123.6 (3) |
| C10—O5—Ba1ii | 100.8 (2) | O7—C18—C17 | 120.6 (3) |
| Ba1—O5—Ba1ii | 109.77 (8) | O8—C18—C17 | 115.8 (3) |
| O5—Ba1—O1—C1 | −35.8 (2) | O3—Ba2—O7—C18 | 74.1 (3) |
| O2i—Ba1—O1—C1 | 47.5 (2) | O4—Ba2—O7—C18 | 124.3 (2) |
| O2—Ba1—O1—C1 | 20.40 (18) | O6v—Ba2—O7—C18 | −48.8 (2) |
| O8iii—Ba1—O1—C1 | 179.1 (2) | O1iv—Ba2—O7—Ba2vi | 79.59 (10) |
| O5ii—Ba1—O1—C1 | −79.1 (2) | O7vi—Ba2—O7—Ba2vi | 0.0 |
| O4i—Ba1—O1—C1 | 111.8 (2) | O6—Ba2—O7—Ba2vi | −140.71 (12) |
| O3ii—Ba1—O1—C1 | −122.06 (19) | O8v—Ba2—O7—Ba2vi | −168.15 (7) |
| O6ii—Ba1—O1—C1 | −127.5 (2) | O5w—Ba2—O7—Ba2vi | 63.6 (4) |
| O5—Ba1—O1—Ba2iii | 139.56 (8) | O3—Ba2—O7—Ba2vi | −94.51 (10) |
| O2i—Ba1—O1—Ba2iii | −137.20 (9) | O4—Ba2—O7—Ba2vi | −44.37 (11) |
| O2—Ba1—O1—Ba2iii | −164.28 (15) | O6v—Ba2—O7—Ba2vi | 142.60 (10) |
| O8iii—Ba1—O1—Ba2iii | −5.53 (9) | Ba1—O1—C1—O2 | −39.2 (3) |
| O5ii—Ba1—O1—Ba2iii | 96.23 (9) | Ba1—O1—C1—C2 | 138.9 (3) |
| O4i—Ba1—O1—Ba2iii | −72.88 (9) | Ba1i—O2—C1—O1 | −120.1 (4) |
| O3ii—Ba1—O1—Ba2iii | 53.27 (12) | Ba1—O2—C1—O1 | 44.0 (3) |
| O6ii—Ba1—O1—Ba2iii | 47.87 (8) | Ba1i—O2—C1—C2 | 61.8 (5) |
| O5—Ba1—O2—C1 | 117.0 (2) | Ba1—O2—C1—C2 | −134.1 (2) |
| O2i—Ba1—O2—C1 | −170.5 (3) | O1—C1—C2—C3 | 22.3 (5) |
| O8iii—Ba1—O2—C1 | −51.7 (2) | O2—C1—C2—C3 | −159.5 (3) |
| O5ii—Ba1—O2—C1 | 48.2 (2) | O1—C1—C2—C8 | −156.5 (3) |
| O4i—Ba1—O2—C1 | −115.3 (2) | O2—C1—C2—C8 | 21.7 (5) |
| O3ii—Ba1—O2—C1 | 58.8 (3) | C8—C2—C3—C4 | −2.7 (5) |
| O6ii—Ba1—O2—C1 | 6.3 (2) | C1—C2—C3—C4 | 178.5 (3) |
| O1—Ba1—O2—C1 | −20.05 (18) | C2—C3—C4—N1 | −179.8 (4) |
| O5—Ba1—O2—Ba1i | −72.43 (10) | C2—C3—C4—C6 | 0.2 (6) |
| O2i—Ba1—O2—Ba1i | 0.0 | C5—N1—C4—C3 | 179.1 (4) |
| O8iii—Ba1—O2—Ba1i | 118.81 (11) | C5—N1—C4—C6 | −0.9 (5) |
| O5ii—Ba1—O2—Ba1i | −141.24 (11) | C4—N1—C5—N2 | 0.8 (6) |
| O4i—Ba1—O2—Ba1i | 55.24 (10) | C6—N2—C5—N1 | −0.4 (6) |
| O3ii—Ba1—O2—Ba1i | −130.67 (12) | C5—N2—C6—C4 | −0.3 (5) |
| O6ii—Ba1—O2—Ba1i | 176.81 (9) | C5—N2—C6—C7 | 178.3 (5) |
| O1—Ba1—O2—Ba1i | 150.49 (16) | C3—C4—C6—N2 | −179.3 (4) |
| O1iv—Ba2—O3—C9 | −57.0 (4) | N1—C4—C6—N2 | 0.7 (5) |
| O7vi—Ba2—O3—C9 | 34.1 (2) | C3—C4—C6—C7 | 2.0 (6) |
| O7—Ba2—O3—C9 | 106.0 (2) | N1—C4—C6—C7 | −178.0 (4) |
| O6—Ba2—O3—C9 | 148.1 (2) | N2—C6—C7—C8 | −179.9 (4) |
| O8v—Ba2—O3—C9 | −136.6 (2) | C4—C6—C7—C8 | −1.5 (6) |
| O5w—Ba2—O3—C9 | −69.0 (2) | C6—C7—C8—C2 | −1.1 (5) |
| O4—Ba2—O3—C9 | 10.7 (2) | C6—C7—C8—C9 | 175.7 (3) |
| O6v—Ba2—O3—C9 | −158.6 (2) | C3—C2—C8—C7 | 3.2 (5) |
| O1iv—Ba2—O3—Ba1ii | 120.0 (2) | C1—C2—C8—C7 | −178.0 (3) |
| O7vi—Ba2—O3—Ba1ii | −148.87 (8) | C3—C2—C8—C9 | −173.4 (3) |
| O7—Ba2—O3—Ba1ii | −76.98 (10) | C1—C2—C8—C9 | 5.4 (5) |
| O6—Ba2—O3—Ba1ii | −34.84 (8) | Ba2—O3—C9—O4 | −21.3 (4) |
| O8v—Ba2—O3—Ba1ii | 40.43 (8) | Ba1ii—O3—C9—O4 | 169.0 (7) |
| O5w—Ba2—O3—Ba1ii | 108.05 (11) | Ba2—O3—C9—C8 | 152.6 (3) |
| O4—Ba2—O3—Ba1ii | −172.25 (15) | Ba1ii—O3—C9—C8 | −17.2 (11) |
| O6v—Ba2—O3—Ba1ii | 18.42 (12) | Ba2—O4—C9—O3 | 20.8 (4) |
| O1iv—Ba2—O4—C9 | 146.5 (2) | Ba1i—O4—C9—O3 | −98.5 (4) |
| O7vi—Ba2—O4—C9 | −165.0 (2) | Ba2—O4—C9—C8 | −153.0 (3) |
| O7—Ba2—O4—C9 | −118.8 (2) | Ba1i—O4—C9—C8 | 87.6 (3) |
| O6—Ba2—O4—C9 | −52.6 (2) | C7—C8—C9—O3 | −91.7 (4) |
| O8v—Ba2—O4—C9 | 18.2 (2) | C2—C8—C9—O3 | 85.1 (4) |
| O5w—Ba2—O4—C9 | 74.3 (2) | C7—C8—C9—O4 | 82.5 (4) |
| O3—Ba2—O4—C9 | −10.4 (2) | C2—C8—C9—O4 | −100.7 (4) |
| O6v—Ba2—O4—C9 | 30.6 (4) | Ba1—O5—C10—O6 | −131.3 (3) |
| O1iv—Ba2—O4—Ba1i | −90.55 (11) | Ba1ii—O5—C10—O6 | 20.4 (4) |
| O7vi—Ba2—O4—Ba1i | −42.08 (8) | Ba1—O5—C10—C11 | 51.7 (5) |
| O7—Ba2—O4—Ba1i | 4.13 (11) | Ba1ii—O5—C10—C11 | −156.6 (2) |
| O6—Ba2—O4—Ba1i | 70.37 (10) | Ba1—O5—C10—Ba1ii | −151.7 (4) |
| O8v—Ba2—O4—Ba1i | 141.10 (9) | Ba2—O6—C10—O5 | 82.7 (4) |
| O5w—Ba2—O4—Ba1i | −162.74 (12) | Ba2v—O6—C10—O5 | −118.7 (3) |
| O3—Ba2—O4—Ba1i | 112.48 (14) | Ba1ii—O6—C10—O5 | −18.3 (3) |
| O6v—Ba2—O4—Ba1i | 153.5 (2) | Ba2—O6—C10—C11 | −100.4 (3) |
| O2i—Ba1—O5—C10 | 10.7 (4) | Ba2v—O6—C10—C11 | 58.2 (3) |
| O2—Ba1—O5—C10 | 72.3 (4) | Ba1ii—O6—C10—C11 | 158.7 (3) |
| O8iii—Ba1—O5—C10 | −117.2 (4) | Ba2—O6—C10—Ba1ii | 100.96 (18) |
| O5ii—Ba1—O5—C10 | 150.3 (5) | Ba2v—O6—C10—Ba1ii | −100.42 (18) |
| O4i—Ba1—O5—C10 | −31.4 (4) | O5—C10—C11—C12 | 17.9 (5) |
| O3ii—Ba1—O5—C10 | −136.0 (4) | O6—C10—C11—C12 | −159.2 (3) |
| O6ii—Ba1—O5—C10 | 169.7 (4) | Ba1ii—C10—C11—C12 | −53.5 (7) |
| O1—Ba1—O5—C10 | 107.6 (4) | O5—C10—C11—C17 | −167.7 (3) |
| O2i—Ba1—O5—Ba1ii | −139.66 (10) | O6—C10—C11—C17 | 15.2 (5) |
| O2—Ba1—O5—Ba1ii | −77.98 (9) | Ba1ii—C10—C11—C17 | 121.0 (5) |
| O8iii—Ba1—O5—Ba1ii | 92.48 (11) | C17—C11—C12—C13 | −1.0 (5) |
| O5ii—Ba1—O5—Ba1ii | 0.0 | C10—C11—C12—C13 | 173.5 (3) |
| O4i—Ba1—O5—Ba1ii | 178.30 (8) | C11—C12—C13—N3 | −179.2 (4) |
| O3ii—Ba1—O5—Ba1ii | 73.73 (10) | C11—C12—C13—C15 | −2.0 (6) |
| O6ii—Ba1—O5—Ba1ii | 19.40 (11) | C14—N3—C13—C12 | 177.3 (5) |
| O1—Ba1—O5—Ba1ii | −42.68 (12) | C14—N3—C13—C15 | −0.2 (5) |
| O1iv—Ba2—O6—C10 | 128.5 (2) | C15—N4—C14—N3 | 0.6 (6) |
| O7vi—Ba2—O6—C10 | 35.7 (3) | C13—N3—C14—N4 | −0.2 (6) |
| O7—Ba2—O6—C10 | 76.6 (2) | C14—N4—C15—C16 | 178.2 (5) |
| O8v—Ba2—O6—C10 | −126.9 (3) | C14—N4—C15—C13 | −0.7 (5) |
| O5w—Ba2—O6—C10 | −110.3 (3) | C12—C13—C15—N4 | −177.3 (4) |
| O3—Ba2—O6—C10 | −62.0 (2) | N3—C13—C15—N4 | 0.6 (5) |
| O4—Ba2—O6—C10 | −32.2 (3) | C12—C13—C15—C16 | 3.6 (6) |
| O6v—Ba2—O6—C10 | 161.8 (3) | N3—C13—C15—C16 | −178.5 (4) |
| O1iv—Ba2—O6—Ba2v | −33.33 (12) | N4—C15—C16—C17 | 179.1 (4) |
| O7vi—Ba2—O6—Ba2v | −126.14 (8) | C13—C15—C16—C17 | −2.1 (6) |
| O7—Ba2—O6—Ba2v | −85.22 (9) | C15—C16—C17—C11 | −0.8 (5) |
| O8v—Ba2—O6—Ba2v | 71.25 (8) | C15—C16—C17—C18 | −179.5 (3) |
| O5w—Ba2—O6—Ba2v | 87.86 (12) | C12—C11—C17—C16 | 2.4 (5) |
| O3—Ba2—O6—Ba2v | 136.20 (10) | C10—C11—C17—C16 | −171.9 (3) |
| O4—Ba2—O6—Ba2v | 165.99 (7) | C12—C11—C17—C18 | −178.9 (3) |
| O6v—Ba2—O6—Ba2v | 0.0 | C10—C11—C17—C18 | 6.8 (5) |
| O1iv—Ba2—O6—Ba1ii | −136.47 (8) | Ba2vi—O7—C18—O8 | −115.8 (3) |
| O7vi—Ba2—O6—Ba1ii | 130.72 (7) | Ba2—O7—C18—O8 | 77.0 (4) |
| O7—Ba2—O6—Ba1ii | 171.65 (10) | Ba2vi—O7—C18—C17 | 61.7 (4) |
| O8v—Ba2—O6—Ba1ii | −31.89 (7) | Ba2—O7—C18—C17 | −105.5 (3) |
| O5w—Ba2—O6—Ba1ii | −15.28 (13) | Ba1iv—O8—C18—O7 | 17.2 (4) |
| O3—Ba2—O6—Ba1ii | 33.06 (8) | Ba2v—O8—C18—O7 | −103.3 (3) |
| O4—Ba2—O6—Ba1ii | 62.86 (8) | Ba1iv—O8—C18—C17 | −160.4 (2) |
| O6v—Ba2—O6—Ba1ii | −103.13 (9) | Ba2v—O8—C18—C17 | 79.1 (3) |
| O1iv—Ba2—O7—C18 | −111.8 (3) | C16—C17—C18—O7 | −112.0 (4) |
| O7vi—Ba2—O7—C18 | 168.6 (3) | C11—C17—C18—O7 | 69.3 (4) |
| O6—Ba2—O7—C18 | 27.9 (2) | C16—C17—C18—O8 | 65.7 (4) |
| O8v—Ba2—O7—C18 | 0.5 (3) | C11—C17—C18—O8 | −113.0 (3) |
| O5w—Ba2—O7—C18 | −127.7 (4) |
| Symmetry codes: (i) −x, −y+1, −z+1; (ii) −x+1, −y+1, −z+1; (iii) x, y+1, z; (iv) x, y−1, z; (v) −x+1, −y, −z+1; (vi) −x, −y, −z+1; (vii) −x+1, −y+1, −z+2. |
| D—H···A | D—H | H···A | D···A | D—H···A |
| O1w—H11···O4wi | 0.84 | 1.66 | 2.49 (1) | 170 |
| O1w—H12···O2wviii | 0.84 | 1.88 | 2.60 (1) | 143 |
| O2w—H21···N2 | 0.84 | 2.00 | 2.83 (1) | 168 |
| O2w—H22···N2vii | 0.84 | 2.28 | 2.83 (1) | 124 |
| O3w—H31···N3 | 0.84 | 2.34 | 2.95 (1) | 129 |
| O3w—H32···O6wiii | 0.84 | 1.85 | 2.68 (1) | 174 |
| O4w—H41···O3wiv | 0.84 | 2.03 | 2.84 (2) | 161 |
| O5w—H51···O1wiv | 0.84 | 2.31 | 2.75 (1) | 113 |
| O6w—H61···O4vi | 0.84 | 1.99 | 2.76 (1) | 152 |
| O6w—H62···O8 | 0.84 | 2.09 | 2.86 (1) | 152 |
| N1—H1···O1w | 0.88 | 1.93 | 2.80 (1) | 168 |
| N4—H4···O4w | 0.88 | 1.99 | 2.86 (1) | 167 |
| Symmetry codes: (i) −x, −y+1, −z+1; (iii) x, y+1, z; (iv) x, y−1, z; (vi) −x, −y, −z+1; (vii) −x+1, −y+1, −z+2; (viii) −x+1, −y+2, −z+2. |
Experimental details
| Crystal data | |
| Chemical formula | [Ba2(C9H4N2O4)2(H2O)]·4.5H2O |
| Mr | 782.05 |
| Crystal system, space group | Triclinic, P1 |
| Temperature (K) | 293 |
| a, b, c (Å) | 6.9331 (4), 9.5950 (4), 18.0179 (7) |
| α, β, γ (°) | 103.186 (1), 92.068 (2), 93.032 (2) |
| V (Å3) | 1163.94 (9) |
| Z | 2 |
| Radiation type | Mo Kα |
| µ (mm−1) | 3.44 |
| Crystal size (mm) | 0.33 × 0.24 × 0.21 |
| Data collection | |
| Diffractometer | Rigaku R-AXIS RAPID |
| Absorption correction | Multi-scan (ABSCOR; Higashi, 1995) |
| Tmin, Tmax | 0.396, 0.532 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 11398, 5246, 4749 |
| Rint | 0.025 |
| (sin θ/λ)max (Å−1) | 0.649 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.028, 0.074, 1.07 |
| No. of reflections | 5246 |
| No. of parameters | 343 |
| No. of restraints | 30 |
| H-atom treatment | H-atom parameters constrained |
| Δρmax, Δρmin (e Å−3) | 1.54, −0.68 |
Computer programs: RAPID-AUTO (Rigaku Corporation, 1998), CrystalStructure (Rigaku/MSC, 2002), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), X-SEED (Barbour, 2001), publCIF (Westrip, 2010).
| D—H···A | D—H | H···A | D···A | D—H···A |
| O1w—H11···O4wi | 0.84 | 1.66 | 2.49 (1) | 170 |
| O1w—H12···O2wii | 0.84 | 1.88 | 2.60 (1) | 143 |
| O2w—H21···N2 | 0.84 | 2.00 | 2.83 (1) | 168 |
| O2w—H22···N2iii | 0.84 | 2.28 | 2.83 (1) | 124 |
| O3w—H31···N3 | 0.84 | 2.34 | 2.95 (1) | 129 |
| O3w—H32···O6wiv | 0.84 | 1.85 | 2.68 (1) | 174 |
| O4w—H41···O3wv | 0.84 | 2.03 | 2.84 (2) | 161 |
| O5w—H51···O1wv | 0.84 | 2.31 | 2.75 (1) | 113 |
| O6w—H61···O4vi | 0.84 | 1.99 | 2.76 (1) | 152 |
| O6w—H62···O8 | 0.84 | 2.09 | 2.86 (1) | 152 |
| N1—H1···O1w | 0.88 | 1.93 | 2.80 (1) | 168 |
| N4—H4···O4w | 0.88 | 1.99 | 2.86 (1) | 167 |
| Symmetry codes: (i) −x, −y+1, −z+1; (ii) −x+1, −y+2, −z+2; (iii) −x+1, −y+1, −z+2; (iv) x, y+1, z; (v) x, y−1, z; (vi) −x, −y, −z+1. |
Acknowledgements
We thank the Scientific Research Foundation of the Education Department of Heilongjiang Province (No. 11544005), the Scientific Research Innovation Foundation for young teachers of Zhoukou Normal University (No. zknuqn201044B) and the University of Malaya for supporting this study.
References
Barbour, L. J. (2001). J. Supramol. Chem. 1, 189–191. CrossRef CAS Google Scholar
Higashi, T. (1995). ABSCOR. Rigaku Corporation, Tokyo, Japan. Google Scholar
Rigaku Corporation (1998). RAPID-AUTO. Rigaku Corporation, Tokyo, Japan. Google Scholar
Rigaku/MSC (2002). CrystalStructure. Rigaku/MSC, The Woodlands, Texas, USA. Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Song, W.-D., Wang, H., Liu, J.-H., Ma, X.-T. & Ng, S. W. (2009). Acta Cryst. E65, m1643–m1644. Web of Science CSD CrossRef IUCr Journals Google Scholar
Westrip, S. P. (2010). J. Appl. Cryst. 43, 920–925. Web of Science CrossRef CAS IUCr Journals Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.

journal menu
access
![[Figure 1]](./jh2280fig1thm.gif)




The 1H-benzimidazole-5,6-dicarboxylate dianion affords a large number of metal salts; most of the crystal structure studies involve rare earth metals. The crystal structures of only few main group derivatives have been reported. The SrII derivative exists as a monohydrate; the metal atom is also coordinated by two water ligands in an eight-coordinate square-antiprismatic geometry. The dianion functions in a \m4 bridging mode (Song et al., 2009). The BaII analog has 4.5 lattice water molecules (Scheme I). Polymeric Ba2(H2O)(C9H4NO4)2.4.5H2O adopts a layer structure in which adjacent BaII atoms are connected by two benzimidazole-5,6-dicarboxylate dianions, one functioning in a µ4 bridging mode and the other in a µ5 bridging mode. The Ba atom having water in its coordination environment as well as the Ba atom without water exist in a nine-coordinate polyhedron of O atom; the geometry is undefined. Lattice water molecules occupy the space between layers, and interact with the layers through O–H···O and N–H···O hydrogen bonds to generate a three-dimensional network (Table 1).