 | Acta Crystallographica Section E Acta Crystallographica Section E CRYSTALLOGRAPHIC COMMUNICATIONS |
journal menu
![[Figure 1]](jh2280fig1mag.jpg)
|
| Figure 1 Thermal ellipsoid plot (Barbour, 2001) of a portion of the layer structure of Ba2(H2O)(C9H4NO4)2.4.5H2O at the 50% probability level; hydrogen atoms are drawn as spheres of arbitrary radius. Symmetry code: (i) −x, −y + 1, −z + 1; (ii) −x + 1, −y + 1, −z + 1; (iii) x, y + 1, z; (iv) x, y − 1, z; (v) −x + 1, −y, −z + 1; (vi) −x, −y, −z + 1. |
![[Figure 1]](jh2280fig1.jpg)
| CRYSTALLOGRAPHIC COMMUNICATIONS |
ISSN: 2056-9890
