metal-organic compounds
catena-Poly[[[bis(3-aminopyrazine-2-carboxylato)triaquapraseodymium(III)]-μ-3-aminopyrazine-2-carboxylato-[(3-aminopyrazine-2-carboxylato)diaquaformatopraseodymium(III)]-μ-3-aminopyrazine-2-carboxylato] hexahydrate]
aKey Laboratory of Functional Inorganic Material Chemistry, Ministry of Education, Heilongjiang University, Harbin 150080, People's Republic of China, bDepartment of Chemistry, University of Malaya, 50603 Kuala Lumpur, Malaysia, and cChemistry Department, Faculty of Science, King Abdulaziz University, PO Box 80203 Jeddah, Saudi Arabia
*Correspondence e-mail: [email protected]
The of the polymeric title compound, {[Pr2(C5H4N3O2)5(CHO2)(H2O)5]·6H2O}n, has two independent PrIII atoms; one is coordinated by two water molecules and the other by three water molecules. The first is N,O-chelated by three 3-aminopyrazine-2-carboxylate ions, whereas the second is chelated by two carboxylate ions; both exist in a monocapped square-antiprismatic geometry. The polymeric chains that run along the a axis interact with the lattice water molecules, generating a three-dimensional hydrogen-bonded network. The formate ion is disordered over two positions with respect to the non-coordinated atoms in a 1:1 ratio.
Related literature
3-Aminopyrazinecarboxylic acid decomposition with subsequent oxalate formation has been documented in a related lanthanum system; see: Gao & Ng (2011
).
Experimental
Crystal data
|
Refinement
|
|
Data collection: RAPID-AUTO (Rigaku, 1998
); cell refinement: RAPID-AUTO; data reduction: CrystalClear (Rigaku/MSC, 2002
); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: X-SEED (Barbour, 2001
); software used to prepare material for publication: publCIF (Westrip, 2010
).
Supporting information
contains datablocks global, I. DOI: 10.1107/S1600536811031308/xu5282sup1.cif
Structure factors: contains datablock I. DOI: 10.1107/S1600536811031308/xu5282Isup2.hkl
Praeseodymium(III) nitrate hexahydrate (0.5 mmol), 3-aminopyrazine-2-carboxylic acid (2 mmol) and sodium hydroxide (2 mmol) were dissolved in water (12 ml). The solution was placed in a 23-ml, Teflon-lined Parr bomb. The bomb was heated at 433 K for 3 days. It was cooled to room temperature; colorless prismatic crystals were isolated by hand.
Carbon- and nitrogen-bound H-atoms were placed in calculated positions (C–H 0.93 Å, N–H 0.88 Å were included in the in the riding model approximation, with U(H) set to 1.2Ueq(C,N). The water H-atoms were located in a difference Fourier map, and were refined with distance restraints of O—H 0.84–0.01 Å and H···H 1.37±0.01 Å; their temperature factors were tied by a factor of 1.5 times.
The formate ion is disordered with respect to the C and uncoordinated O atoms in a 1:1 ratio; the occupancy was assumed as it could not be refined.
The final difference Fourier map had a peak/hole in the vicinity of Pr1.
Omitted from the were (-1 1 12), (-1 0 3), (3 4 10), (-7 13 2), (-2 4 11), (3 3 9), (1 3 10), (-4 - 3 6), (2 4 11), (12 6 9), (-1 3 9), (1 10 13), (6 8 4), (5 7 5) and (-4 5 00.
Data collection: RAPID-AUTO (Rigaku, 1998); cell RAPID-AUTO (Rigaku, 1998); data reduction: CrystalClear (Rigaku/MSC, 2002); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: X-SEED (Barbour, 2001); software used to prepare material for publication: publCIF (Westrip, 2010).
| [Pr2(C5H4N3O2)5(CHO2)(H2O)5]·6H2O | Z = 2 |
| Mr = 1215.58 | F(000) = 1212 |
| Triclinic, P1 | Dx = 1.842 Mg m−3 |
| Hall symbol: -P 1 | Mo Kα radiation, λ = 0.71073 Å |
| a = 9.7213 (3) Å | Cell parameters from 16800 reflections |
| b = 14.2113 (6) Å | θ = 3.0–27.5° |
| c = 17.6228 (6) Å | µ = 2.30 mm−1 |
| α = 68.801 (1)° | T = 293 K |
| β = 76.291 (1)° | Prism, colorless |
| γ = 79.349 (1)° | 0.14 × 0.12 × 0.07 mm |
| V = 2191.97 (14) Å3 |
| Rigaku R-AXIS RAPID IP diffractometer | 9906 independent reflections |
| Radiation source: fine-focus sealed tube | 8214 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.041 |
| ω scans | θmax = 27.5°, θmin = 3.0° |
| Absorption correction: multi-scan (ABSCOR; Higashi, 1995) | h = −11→12 |
| Tmin = 0.739, Tmax = 0.856 | k = −18→18 |
| 21572 measured reflections | l = −22→22 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.035 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.088 | H atoms treated by a mixture of independent and constrained refinement |
| S = 1.06 | w = 1/[σ2(Fo2) + (0.0227P)2 + 4.2692P] where P = (Fo2 + 2Fc2)/3 |
| 9906 reflections | (Δ/σ)max = 0.001 |
| 679 parameters | Δρmax = 1.34 e Å−3 |
| 69 restraints | Δρmin = −1.03 e Å−3 |
| [Pr2(C5H4N3O2)5(CHO2)(H2O)5]·6H2O | γ = 79.349 (1)° |
| Mr = 1215.58 | V = 2191.97 (14) Å3 |
| Triclinic, P1 | Z = 2 |
| a = 9.7213 (3) Å | Mo Kα radiation |
| b = 14.2113 (6) Å | µ = 2.30 mm−1 |
| c = 17.6228 (6) Å | T = 293 K |
| α = 68.801 (1)° | 0.14 × 0.12 × 0.07 mm |
| β = 76.291 (1)° |
| Rigaku R-AXIS RAPID IP diffractometer | 9906 independent reflections |
| Absorption correction: multi-scan (ABSCOR; Higashi, 1995) | 8214 reflections with I > 2σ(I) |
| Tmin = 0.739, Tmax = 0.856 | Rint = 0.041 |
| 21572 measured reflections |
| R[F2 > 2σ(F2)] = 0.035 | 69 restraints |
| wR(F2) = 0.088 | H atoms treated by a mixture of independent and constrained refinement |
| S = 1.06 | Δρmax = 1.34 e Å−3 |
| 9906 reflections | Δρmin = −1.03 e Å−3 |
| 679 parameters |
| x | y | z | Uiso*/Ueq | Occ. (<1) | |
| Pr1 | 0.41603 (2) | 0.502827 (16) | 0.710959 (12) | 0.02425 (6) | |
| Pr2 | 0.83609 (2) | 0.788695 (16) | 0.719791 (12) | 0.02408 (6) | |
| O1 | 0.5494 (3) | 0.4496 (2) | 0.59541 (18) | 0.0380 (7) | |
| O2 | 0.6256 (4) | 0.3460 (3) | 0.5212 (2) | 0.0495 (9) | |
| O3 | 0.3840 (3) | 0.3776 (2) | 0.84899 (17) | 0.0343 (7) | |
| O4 | 0.4534 (4) | 0.2648 (3) | 0.9623 (2) | 0.0555 (10) | |
| O5 | 0.6159 (3) | 0.6033 (2) | 0.63160 (17) | 0.0330 (7) | |
| O6 | 0.6980 (3) | 0.6774 (2) | 0.70017 (17) | 0.0345 (7) | |
| O7 | 1.0367 (3) | 0.6542 (2) | 0.72776 (17) | 0.0362 (7) | |
| O8 | 1.1707 (3) | 0.5181 (2) | 0.79033 (18) | 0.0379 (7) | |
| O9 | 0.5965 (3) | 0.8007 (2) | 0.79749 (19) | 0.0378 (7) | |
| O10 | 0.4025 (4) | 0.8696 (3) | 0.8612 (2) | 0.0519 (9) | |
| O11 | 0.7239 (4) | 0.9123 (3) | 0.6086 (2) | 0.0474 (8) | |
| O12 | 0.8772 (8) | 1.0092 (6) | 0.5192 (4) | 0.056 (2) | 0.50 |
| O12' | 0.5902 (9) | 0.9751 (6) | 0.5161 (5) | 0.059 (2) | 0.50 |
| O1W | 0.2309 (3) | 0.5361 (2) | 0.61620 (19) | 0.0372 (7) | |
| H11 | 0.162 (4) | 0.571 (3) | 0.635 (3) | 0.056* | |
| H12 | 0.277 (4) | 0.573 (3) | 0.5723 (18) | 0.056* | |
| O2W | 0.4608 (3) | 0.5895 (2) | 0.8054 (2) | 0.0387 (7) | |
| H21 | 0.392 (3) | 0.634 (3) | 0.812 (3) | 0.058* | |
| H22 | 0.537 (3) | 0.617 (3) | 0.788 (3) | 0.058* | |
| O3W | 0.3224 (3) | 0.6911 (2) | 0.6547 (2) | 0.0406 (7) | |
| H31 | 0.2358 (17) | 0.699 (4) | 0.675 (3) | 0.061* | |
| H32 | 0.362 (4) | 0.740 (3) | 0.652 (3) | 0.061* | |
| O4W | 1.0343 (4) | 0.8931 (3) | 0.6399 (2) | 0.0480 (9) | |
| H41 | 1.087 (5) | 0.917 (4) | 0.659 (3) | 0.072* | |
| H42 | 1.005 (6) | 0.939 (3) | 0.600 (3) | 0.072* | |
| O5W | 0.9665 (4) | 0.8011 (3) | 0.82261 (19) | 0.0446 (8) | |
| H51 | 1.050 (2) | 0.780 (4) | 0.830 (3) | 0.067* | |
| H52 | 0.914 (4) | 0.801 (5) | 0.8676 (17) | 0.067* | |
| O6W | 0.2393 (4) | 0.7251 (3) | 0.85899 (19) | 0.0440 (8) | |
| H61 | 0.211 (6) | 0.683 (3) | 0.9056 (15) | 0.066* | |
| H62 | 0.272 (6) | 0.772 (3) | 0.865 (3) | 0.066* | |
| O7W | 0.4322 (4) | 0.8556 (4) | 0.6513 (4) | 0.0823 (14) | |
| H71 | 0.504 (5) | 0.836 (6) | 0.673 (4) | 0.124* | |
| H72 | 0.457 (7) | 0.881 (7) | 0.5998 (9) | 0.124* | |
| O8W | 0.1955 (4) | 0.9725 (3) | 0.7077 (3) | 0.0617 (10) | |
| H81 | 0.266 (4) | 0.928 (3) | 0.707 (4) | 0.093* | |
| H82 | 0.224 (6) | 1.0301 (19) | 0.691 (4) | 0.093* | |
| O9W | 0.0929 (6) | 0.9679 (5) | 0.8854 (4) | 0.0950 (16) | |
| H91 | 0.018 (6) | 0.944 (7) | 0.916 (4) | 0.142* | |
| H92 | 0.107 (9) | 0.956 (7) | 0.841 (3) | 0.142* | |
| O10W | 0.0689 (6) | 1.1357 (4) | 0.9393 (3) | 0.0792 (13) | |
| H101 | 0.082 (9) | 1.0757 (19) | 0.939 (5) | 0.119* | |
| H102 | 0.031 (8) | 1.174 (4) | 0.899 (3) | 0.119* | |
| O11W | 0.2027 (5) | 1.1827 (4) | 1.0380 (2) | 0.0652 (11) | |
| H111 | 0.176 (6) | 1.161 (5) | 1.006 (3) | 0.098* | |
| H112 | 0.279 (4) | 1.208 (5) | 1.015 (3) | 0.098* | |
| N1 | 0.3688 (4) | 0.3253 (3) | 0.7031 (2) | 0.0330 (8) | |
| N2 | 0.3064 (5) | 0.1593 (4) | 0.6744 (3) | 0.0570 (12) | |
| N3 | 0.4764 (6) | 0.1887 (4) | 0.5559 (3) | 0.0726 (16) | |
| H3A | 0.4545 | 0.1353 | 0.5490 | 0.087* | |
| H3B | 0.5434 | 0.2240 | 0.5197 | 0.087* | |
| N4 | 0.6502 (4) | 0.3927 (3) | 0.7672 (2) | 0.0341 (8) | |
| N5 | 0.8834 (4) | 0.2900 (3) | 0.8402 (3) | 0.0437 (10) | |
| N6 | 0.7344 (5) | 0.2209 (4) | 0.9634 (3) | 0.0573 (12) | |
| H6A | 0.8095 | 0.1892 | 0.9855 | 0.069* | |
| H6B | 0.6484 | 0.2134 | 0.9935 | 0.069* | |
| N7 | 0.9158 (4) | 0.7375 (3) | 0.5762 (2) | 0.0309 (7) | |
| N8 | 0.9749 (4) | 0.6727 (3) | 0.4391 (2) | 0.0447 (10) | |
| N9 | 0.7825 (4) | 0.5828 (3) | 0.4898 (2) | 0.0444 (10) | |
| H9A | 0.8063 | 0.5635 | 0.4459 | 0.053* | |
| H9B | 0.7070 | 0.5618 | 0.5274 | 0.053* | |
| N10 | 0.8203 (3) | 0.6149 (3) | 0.85557 (19) | 0.0276 (7) | |
| N11 | 0.8290 (4) | 0.4378 (3) | 0.9913 (2) | 0.0364 (8) | |
| N12 | 1.0622 (4) | 0.3924 (3) | 0.9406 (2) | 0.0389 (9) | |
| H12A | 1.0612 | 0.3381 | 0.9852 | 0.047* | |
| H12B | 1.1400 | 0.4031 | 0.9025 | 0.047* | |
| N13 | 0.7367 (4) | 0.9580 (3) | 0.7629 (2) | 0.0417 (9) | |
| N14 | 0.6270 (7) | 1.1151 (4) | 0.8261 (4) | 0.0830 (18) | |
| N15 | 0.4277 (6) | 1.0373 (4) | 0.8961 (4) | 0.0872 (19) | |
| H15A | 0.3987 | 1.0871 | 0.9167 | 0.105* | |
| H15B | 0.3746 | 0.9877 | 0.9099 | 0.105* | |
| C1 | 0.2705 (5) | 0.2673 (4) | 0.7555 (3) | 0.0450 (11) | |
| H1 | 0.2220 | 0.2818 | 0.8029 | 0.054* | |
| C2 | 0.2400 (6) | 0.1856 (4) | 0.7402 (3) | 0.0564 (14) | |
| H2 | 0.1696 | 0.1472 | 0.7775 | 0.068* | |
| C3 | 0.4077 (6) | 0.2163 (4) | 0.6214 (3) | 0.0457 (12) | |
| C4 | 0.4399 (4) | 0.3005 (3) | 0.6368 (3) | 0.0335 (9) | |
| C5 | 0.5461 (4) | 0.3707 (3) | 0.5795 (3) | 0.0330 (9) | |
| C6 | 0.7837 (5) | 0.3997 (4) | 0.7244 (3) | 0.0414 (11) | |
| H6 | 0.7993 | 0.4398 | 0.6688 | 0.050* | |
| C7 | 0.8968 (5) | 0.3491 (4) | 0.7610 (3) | 0.0472 (12) | |
| H7 | 0.9879 | 0.3561 | 0.7292 | 0.057* | |
| C8 | 0.7509 (5) | 0.2801 (4) | 0.8845 (3) | 0.0374 (10) | |
| C9 | 0.6311 (4) | 0.3337 (3) | 0.8464 (2) | 0.0313 (9) | |
| C10 | 0.4781 (5) | 0.3237 (3) | 0.8901 (3) | 0.0337 (9) | |
| C11 | 1.0286 (5) | 0.7640 (4) | 0.5170 (3) | 0.0418 (11) | |
| H11A | 1.0895 | 0.8048 | 0.5207 | 0.050* | |
| C12 | 1.0555 (5) | 0.7305 (4) | 0.4495 (3) | 0.0475 (12) | |
| H12C | 1.1354 | 0.7502 | 0.4090 | 0.057* | |
| C13 | 0.8612 (4) | 0.6441 (4) | 0.4995 (3) | 0.0341 (9) | |
| C14 | 0.8306 (4) | 0.6788 (3) | 0.5689 (2) | 0.0278 (8) | |
| C15 | 0.7060 (4) | 0.6513 (3) | 0.6374 (2) | 0.0270 (8) | |
| C16 | 0.7085 (4) | 0.5945 (4) | 0.9177 (3) | 0.0363 (10) | |
| H16 | 0.6265 | 0.6404 | 0.9162 | 0.044* | |
| C17 | 0.7145 (5) | 0.5055 (4) | 0.9841 (3) | 0.0394 (10) | |
| H17 | 0.6344 | 0.4923 | 1.0259 | 0.047* | |
| C18 | 0.9451 (4) | 0.4587 (3) | 0.9306 (2) | 0.0290 (8) | |
| C19 | 0.9370 (4) | 0.5484 (3) | 0.8608 (2) | 0.0257 (8) | |
| C20 | 1.0576 (4) | 0.5752 (3) | 0.7884 (2) | 0.0283 (8) | |
| C21 | 0.8085 (7) | 1.0364 (5) | 0.7454 (4) | 0.0672 (17) | |
| H21A | 0.8979 | 1.0391 | 0.7113 | 0.081* | |
| C22 | 0.7522 (9) | 1.1138 (5) | 0.7769 (5) | 0.087 (2) | |
| H22A | 0.8052 | 1.1678 | 0.7629 | 0.105* | |
| C23 | 0.5516 (7) | 1.0371 (4) | 0.8444 (4) | 0.0566 (14) | |
| C24 | 0.6070 (5) | 0.9575 (3) | 0.8110 (3) | 0.0353 (9) | |
| C25 | 0.5288 (4) | 0.8702 (3) | 0.8248 (2) | 0.0331 (9) | |
| C26 | 0.757 (2) | 0.9797 (17) | 0.5430 (14) | 0.052 (4) | 0.50 |
| H26 | 0.6889 | 1.0100 | 0.5095 | 0.063* | 0.50 |
| C26' | 0.705 (2) | 0.9658 (19) | 0.5407 (16) | 0.056 (5) | 0.50 |
| H26' | 0.7791 | 1.0019 | 0.5045 | 0.067* | 0.50 |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| Pr1 | 0.02117 (11) | 0.02774 (12) | 0.02498 (11) | −0.00649 (8) | 0.00251 (8) | −0.01252 (9) |
| Pr2 | 0.02275 (11) | 0.02509 (12) | 0.02534 (11) | −0.00591 (8) | −0.00256 (9) | −0.00912 (9) |
| O1 | 0.0382 (16) | 0.0429 (19) | 0.0378 (16) | −0.0160 (14) | 0.0080 (14) | −0.0232 (14) |
| O2 | 0.054 (2) | 0.050 (2) | 0.0449 (18) | −0.0100 (17) | 0.0141 (16) | −0.0288 (16) |
| O3 | 0.0248 (14) | 0.0406 (18) | 0.0325 (15) | −0.0043 (13) | −0.0009 (13) | −0.0087 (13) |
| O4 | 0.0380 (18) | 0.073 (3) | 0.0322 (17) | 0.0019 (17) | 0.0029 (15) | 0.0001 (17) |
| O5 | 0.0327 (15) | 0.0402 (18) | 0.0332 (15) | −0.0181 (13) | 0.0041 (13) | −0.0201 (13) |
| O6 | 0.0353 (16) | 0.0464 (19) | 0.0287 (14) | −0.0200 (14) | 0.0080 (13) | −0.0220 (13) |
| O7 | 0.0266 (14) | 0.0380 (18) | 0.0297 (14) | 0.0021 (13) | 0.0053 (12) | −0.0038 (13) |
| O8 | 0.0238 (14) | 0.0392 (18) | 0.0336 (15) | 0.0044 (13) | 0.0094 (13) | −0.0052 (13) |
| O9 | 0.0328 (16) | 0.0338 (17) | 0.0467 (17) | −0.0052 (13) | 0.0029 (14) | −0.0191 (14) |
| O10 | 0.0379 (18) | 0.054 (2) | 0.058 (2) | −0.0023 (16) | 0.0099 (17) | −0.0246 (18) |
| O11 | 0.055 (2) | 0.044 (2) | 0.0390 (18) | −0.0019 (16) | −0.0176 (17) | −0.0048 (15) |
| O12 | 0.065 (5) | 0.062 (5) | 0.037 (4) | −0.035 (4) | −0.009 (4) | 0.002 (3) |
| O12' | 0.063 (5) | 0.056 (5) | 0.061 (5) | −0.006 (4) | −0.030 (4) | −0.012 (4) |
| O1W | 0.0369 (17) | 0.0442 (19) | 0.0350 (16) | −0.0078 (14) | −0.0023 (14) | −0.0196 (14) |
| O2W | 0.0364 (16) | 0.044 (2) | 0.0383 (16) | −0.0151 (14) | 0.0091 (15) | −0.0215 (15) |
| O3W | 0.0319 (16) | 0.0350 (18) | 0.0537 (19) | −0.0069 (14) | 0.0018 (15) | −0.0179 (15) |
| O4W | 0.060 (2) | 0.053 (2) | 0.0325 (16) | −0.0346 (19) | −0.0015 (16) | −0.0069 (15) |
| O5W | 0.0425 (18) | 0.063 (2) | 0.0362 (16) | −0.0103 (17) | −0.0137 (15) | −0.0200 (17) |
| O6W | 0.0495 (19) | 0.045 (2) | 0.0339 (16) | −0.0131 (16) | −0.0001 (15) | −0.0102 (14) |
| O7W | 0.046 (2) | 0.075 (3) | 0.148 (4) | −0.012 (2) | −0.013 (3) | −0.063 (3) |
| O8W | 0.052 (2) | 0.050 (2) | 0.091 (3) | −0.0163 (18) | −0.009 (2) | −0.030 (2) |
| O9W | 0.100 (4) | 0.092 (4) | 0.097 (4) | −0.031 (3) | 0.006 (3) | −0.042 (3) |
| O10W | 0.079 (3) | 0.092 (4) | 0.077 (3) | 0.000 (3) | −0.028 (3) | −0.036 (3) |
| O11W | 0.067 (3) | 0.085 (3) | 0.0409 (19) | −0.018 (2) | −0.0025 (19) | −0.018 (2) |
| N1 | 0.0340 (18) | 0.0287 (19) | 0.0367 (18) | −0.0070 (15) | −0.0010 (16) | −0.0131 (15) |
| N2 | 0.068 (3) | 0.044 (3) | 0.064 (3) | −0.020 (2) | 0.005 (2) | −0.028 (2) |
| N3 | 0.092 (4) | 0.061 (3) | 0.078 (3) | −0.029 (3) | 0.019 (3) | −0.051 (3) |
| N4 | 0.0280 (17) | 0.035 (2) | 0.0351 (18) | −0.0045 (15) | 0.0030 (15) | −0.0122 (16) |
| N5 | 0.0284 (19) | 0.058 (3) | 0.048 (2) | 0.0006 (18) | −0.0078 (18) | −0.023 (2) |
| N6 | 0.044 (2) | 0.078 (4) | 0.039 (2) | 0.006 (2) | −0.011 (2) | −0.011 (2) |
| N7 | 0.0278 (17) | 0.035 (2) | 0.0302 (17) | −0.0095 (15) | −0.0007 (15) | −0.0108 (15) |
| N8 | 0.039 (2) | 0.065 (3) | 0.0334 (19) | −0.017 (2) | 0.0096 (17) | −0.0248 (19) |
| N9 | 0.046 (2) | 0.064 (3) | 0.0352 (19) | −0.023 (2) | 0.0076 (18) | −0.032 (2) |
| N10 | 0.0255 (16) | 0.0295 (19) | 0.0240 (15) | −0.0035 (14) | 0.0032 (14) | −0.0090 (14) |
| N11 | 0.0316 (19) | 0.039 (2) | 0.0300 (18) | −0.0096 (16) | 0.0036 (15) | −0.0047 (16) |
| N12 | 0.035 (2) | 0.036 (2) | 0.0333 (18) | −0.0001 (16) | −0.0006 (17) | −0.0027 (16) |
| N13 | 0.048 (2) | 0.034 (2) | 0.048 (2) | −0.0094 (18) | −0.0072 (19) | −0.0193 (18) |
| N14 | 0.110 (5) | 0.053 (3) | 0.096 (4) | −0.016 (3) | 0.009 (4) | −0.050 (3) |
| N15 | 0.092 (4) | 0.066 (4) | 0.100 (4) | −0.002 (3) | 0.029 (4) | −0.056 (3) |
| C1 | 0.045 (3) | 0.044 (3) | 0.045 (3) | −0.017 (2) | 0.008 (2) | −0.017 (2) |
| C2 | 0.063 (3) | 0.049 (3) | 0.057 (3) | −0.031 (3) | 0.005 (3) | −0.016 (3) |
| C3 | 0.053 (3) | 0.033 (3) | 0.057 (3) | −0.005 (2) | −0.005 (2) | −0.025 (2) |
| C4 | 0.033 (2) | 0.032 (2) | 0.037 (2) | −0.0006 (18) | −0.0041 (19) | −0.0166 (18) |
| C5 | 0.031 (2) | 0.037 (2) | 0.034 (2) | −0.0028 (18) | −0.0015 (18) | −0.0181 (18) |
| C6 | 0.029 (2) | 0.044 (3) | 0.040 (2) | −0.002 (2) | 0.008 (2) | −0.011 (2) |
| C7 | 0.027 (2) | 0.056 (3) | 0.054 (3) | −0.008 (2) | 0.006 (2) | −0.019 (2) |
| C8 | 0.035 (2) | 0.044 (3) | 0.037 (2) | 0.001 (2) | −0.008 (2) | −0.020 (2) |
| C9 | 0.027 (2) | 0.040 (2) | 0.030 (2) | −0.0026 (18) | −0.0006 (17) | −0.0192 (18) |
| C10 | 0.032 (2) | 0.038 (3) | 0.031 (2) | −0.0029 (19) | 0.0026 (18) | −0.0164 (18) |
| C11 | 0.032 (2) | 0.053 (3) | 0.040 (2) | −0.018 (2) | 0.003 (2) | −0.015 (2) |
| C12 | 0.039 (3) | 0.064 (4) | 0.033 (2) | −0.020 (2) | 0.014 (2) | −0.014 (2) |
| C13 | 0.031 (2) | 0.045 (3) | 0.029 (2) | −0.0048 (19) | −0.0029 (18) | −0.0161 (19) |
| C14 | 0.0260 (19) | 0.033 (2) | 0.0241 (18) | −0.0094 (16) | 0.0033 (16) | −0.0110 (16) |
| C15 | 0.0259 (19) | 0.028 (2) | 0.0272 (18) | −0.0037 (16) | −0.0007 (16) | −0.0117 (16) |
| C16 | 0.0233 (19) | 0.044 (3) | 0.033 (2) | −0.0043 (18) | 0.0073 (18) | −0.0101 (19) |
| C17 | 0.032 (2) | 0.047 (3) | 0.029 (2) | −0.007 (2) | 0.0076 (19) | −0.0084 (19) |
| C18 | 0.032 (2) | 0.029 (2) | 0.0247 (18) | −0.0069 (17) | 0.0006 (17) | −0.0093 (16) |
| C19 | 0.0243 (18) | 0.027 (2) | 0.0237 (18) | −0.0042 (15) | 0.0003 (16) | −0.0087 (15) |
| C20 | 0.0265 (19) | 0.032 (2) | 0.0232 (18) | −0.0046 (17) | 0.0041 (16) | −0.0102 (16) |
| C21 | 0.067 (4) | 0.054 (4) | 0.088 (4) | −0.025 (3) | 0.013 (3) | −0.041 (3) |
| C22 | 0.112 (6) | 0.054 (4) | 0.110 (6) | −0.040 (4) | 0.016 (5) | −0.052 (4) |
| C23 | 0.072 (4) | 0.042 (3) | 0.058 (3) | 0.002 (3) | −0.005 (3) | −0.028 (3) |
| C24 | 0.041 (2) | 0.033 (2) | 0.032 (2) | 0.0028 (19) | −0.005 (2) | −0.0150 (18) |
| C25 | 0.033 (2) | 0.036 (2) | 0.029 (2) | 0.0024 (18) | −0.0067 (18) | −0.0108 (18) |
| C26 | 0.066 (13) | 0.042 (8) | 0.035 (6) | −0.014 (8) | −0.010 (10) | 0.006 (6) |
| C26' | 0.054 (11) | 0.055 (10) | 0.042 (8) | −0.015 (8) | 0.012 (9) | −0.006 (6) |
| Pr1—O3 | 2.428 (3) | N3—C3 | 1.342 (6) |
| Pr1—O1 | 2.429 (3) | N3—H3A | 0.8800 |
| Pr1—O5 | 2.462 (3) | N3—H3B | 0.8800 |
| Pr1—O8i | 2.478 (3) | N4—C9 | 1.331 (5) |
| Pr1—O2W | 2.549 (3) | N4—C6 | 1.338 (5) |
| Pr1—O3W | 2.564 (3) | N5—C7 | 1.333 (6) |
| Pr1—O1W | 2.605 (3) | N5—C8 | 1.341 (6) |
| Pr1—N4 | 2.692 (4) | N6—C8 | 1.328 (6) |
| Pr1—N1 | 2.703 (4) | N6—H6A | 0.8800 |
| Pr2—O6 | 2.413 (3) | N6—H6B | 0.8800 |
| Pr2—O9 | 2.417 (3) | N7—C11 | 1.326 (5) |
| Pr2—O11 | 2.435 (3) | N7—C14 | 1.335 (5) |
| Pr2—O7 | 2.456 (3) | N8—C12 | 1.318 (6) |
| Pr2—O4W | 2.482 (3) | N8—C13 | 1.348 (5) |
| Pr2—O5W | 2.515 (3) | N9—C13 | 1.337 (5) |
| Pr2—N13 | 2.723 (4) | N9—H9A | 0.8800 |
| Pr2—N10 | 2.746 (3) | N9—H9B | 0.8800 |
| Pr2—N7 | 2.780 (3) | N10—C19 | 1.334 (5) |
| O1—C5 | 1.256 (5) | N10—C16 | 1.337 (5) |
| O2—C5 | 1.250 (5) | N11—C17 | 1.328 (6) |
| O3—C10 | 1.266 (5) | N11—C18 | 1.352 (5) |
| O4—C10 | 1.240 (5) | N12—C18 | 1.339 (5) |
| O5—C15 | 1.248 (5) | N12—H12A | 0.8800 |
| O6—C15 | 1.270 (5) | N12—H12B | 0.8800 |
| O7—C20 | 1.263 (5) | N13—C21 | 1.327 (6) |
| O8—C20 | 1.239 (5) | N13—C24 | 1.342 (6) |
| O8—Pr1ii | 2.478 (3) | N14—C22 | 1.318 (9) |
| O9—C25 | 1.263 (5) | N14—C23 | 1.342 (8) |
| O10—C25 | 1.244 (5) | N15—C23 | 1.327 (7) |
| O11—C26' | 1.20 (3) | N15—H15A | 0.8800 |
| O11—C26 | 1.22 (2) | N15—H15B | 0.8800 |
| O12—C26 | 1.243 (17) | C1—C2 | 1.378 (7) |
| O12'—C26' | 1.262 (19) | C1—H1 | 0.9300 |
| O1W—H11 | 0.84 (1) | C2—H2 | 0.9300 |
| O1W—H12 | 0.84 (1) | C3—C4 | 1.420 (6) |
| O2W—H21 | 0.84 (1) | C4—C5 | 1.497 (6) |
| O2W—H22 | 0.84 (1) | C6—C7 | 1.361 (7) |
| O3W—H31 | 0.84 (1) | C6—H6 | 0.9300 |
| O3W—H32 | 0.84 (1) | C7—H7 | 0.9300 |
| O4W—H41 | 0.84 (1) | C8—C9 | 1.436 (6) |
| O4W—H42 | 0.84 (1) | C9—C10 | 1.510 (6) |
| O5W—H51 | 0.84 (1) | C11—C12 | 1.387 (7) |
| O5W—H52 | 0.84 (1) | C11—H11A | 0.9300 |
| O6W—H61 | 0.84 (1) | C12—H12C | 0.9300 |
| O6W—H62 | 0.84 (1) | C13—C14 | 1.427 (5) |
| O7W—H71 | 0.84 (1) | C14—C15 | 1.489 (5) |
| O7W—H72 | 0.84 (1) | C16—C17 | 1.382 (6) |
| O8W—H81 | 0.84 (1) | C16—H16 | 0.9300 |
| O8W—H82 | 0.84 (1) | C17—H17 | 0.9300 |
| O9W—H91 | 0.84 (1) | C18—C19 | 1.421 (5) |
| O9W—H92 | 0.84 (1) | C19—C20 | 1.500 (5) |
| O10W—H101 | 0.84 (1) | C21—C22 | 1.376 (8) |
| O10W—H102 | 0.84 (1) | C21—H21A | 0.9300 |
| O11W—H111 | 0.84 (1) | C22—H22A | 0.9300 |
| O11W—H112 | 0.84 (1) | C23—C24 | 1.422 (7) |
| N1—C1 | 1.330 (6) | C24—C25 | 1.489 (6) |
| N1—C4 | 1.339 (5) | C26—H26 | 0.9300 |
| N2—C2 | 1.330 (7) | C26'—H26' | 0.9300 |
| N2—C3 | 1.345 (7) | ||
| O3—Pr1—O1 | 118.90 (11) | C9—N4—C6 | 118.2 (4) |
| O3—Pr1—O5 | 130.60 (9) | C9—N4—Pr1 | 116.4 (3) |
| O1—Pr1—O5 | 67.17 (9) | C6—N4—Pr1 | 125.2 (3) |
| O3—Pr1—O8i | 67.07 (9) | C7—N5—C8 | 117.3 (4) |
| O1—Pr1—O8i | 141.05 (10) | C8—N6—H6A | 120.0 |
| O5—Pr1—O8i | 141.66 (10) | C8—N6—H6B | 120.0 |
| O3—Pr1—O2W | 74.58 (10) | H6A—N6—H6B | 120.0 |
| O1—Pr1—O2W | 137.75 (10) | C11—N7—C14 | 118.6 (4) |
| O5—Pr1—O2W | 74.37 (9) | C11—N7—Pr2 | 126.7 (3) |
| O8i—Pr1—O2W | 81.00 (10) | C14—N7—Pr2 | 114.7 (2) |
| O3—Pr1—O3W | 132.45 (10) | C12—N8—C13 | 116.5 (4) |
| O1—Pr1—O3W | 108.56 (11) | C13—N9—H9A | 120.0 |
| O5—Pr1—O3W | 70.21 (10) | C13—N9—H9B | 120.0 |
| O8i—Pr1—O3W | 74.64 (10) | H9A—N9—H9B | 120.0 |
| O2W—Pr1—O3W | 72.50 (11) | C19—N10—C16 | 118.2 (4) |
| O3—Pr1—O1W | 120.40 (10) | C19—N10—Pr2 | 116.4 (2) |
| O1—Pr1—O1W | 75.93 (10) | C16—N10—Pr2 | 125.3 (3) |
| O5—Pr1—O1W | 108.77 (10) | C17—N11—C18 | 117.6 (4) |
| O8i—Pr1—O1W | 69.75 (10) | C18—N12—H12A | 120.0 |
| O2W—Pr1—O1W | 134.93 (10) | C18—N12—H12B | 120.0 |
| O3W—Pr1—O1W | 67.22 (10) | H12A—N12—H12B | 120.0 |
| O3—Pr1—N4 | 62.15 (10) | C21—N13—C24 | 118.0 (5) |
| O1—Pr1—N4 | 76.64 (11) | C21—N13—Pr2 | 125.9 (4) |
| O5—Pr1—N4 | 73.83 (10) | C24—N13—Pr2 | 116.0 (3) |
| O8i—Pr1—N4 | 128.16 (10) | C22—N14—C23 | 117.2 (5) |
| O2W—Pr1—N4 | 76.48 (11) | C23—N15—H15A | 120.0 |
| O3W—Pr1—N4 | 137.40 (11) | C23—N15—H15B | 120.0 |
| O1W—Pr1—N4 | 148.53 (10) | H15A—N15—H15B | 120.0 |
| O3—Pr1—N1 | 70.33 (11) | N1—C1—C2 | 120.5 (5) |
| O1—Pr1—N1 | 61.54 (10) | N1—C1—H1 | 119.7 |
| O5—Pr1—N1 | 127.33 (10) | C2—C1—H1 | 119.7 |
| O8i—Pr1—N1 | 89.24 (11) | N2—C2—C1 | 123.1 (5) |
| O2W—Pr1—N1 | 144.65 (11) | N2—C2—H2 | 118.5 |
| O3W—Pr1—N1 | 137.23 (11) | C1—C2—H2 | 118.5 |
| O1W—Pr1—N1 | 70.05 (10) | N3—C3—N2 | 117.2 (5) |
| N4—Pr1—N1 | 83.46 (11) | N3—C3—C4 | 122.7 (5) |
| O6—Pr2—O9 | 70.23 (10) | N2—C3—C4 | 120.0 (4) |
| O6—Pr2—O11 | 81.60 (11) | N1—C4—C3 | 120.8 (4) |
| O9—Pr2—O11 | 81.77 (11) | N1—C4—C5 | 115.3 (4) |
| O6—Pr2—O7 | 87.91 (11) | C3—C4—C5 | 123.8 (4) |
| O9—Pr2—O7 | 134.68 (10) | O2—C5—O1 | 125.3 (4) |
| O11—Pr2—O7 | 135.14 (11) | O2—C5—C4 | 118.1 (4) |
| O6—Pr2—O4W | 138.28 (10) | O1—C5—C4 | 116.6 (4) |
| O9—Pr2—O4W | 141.47 (12) | N4—C6—C7 | 121.0 (4) |
| O11—Pr2—O4W | 79.38 (12) | N4—C6—H6 | 119.5 |
| O7—Pr2—O4W | 80.18 (12) | C7—C6—H6 | 119.5 |
| O6—Pr2—O5W | 141.67 (11) | N5—C7—C6 | 123.2 (4) |
| O9—Pr2—O5W | 98.21 (11) | N5—C7—H7 | 118.4 |
| O11—Pr2—O5W | 134.30 (12) | C6—C7—H7 | 118.4 |
| O7—Pr2—O5W | 74.59 (12) | N6—C8—N5 | 118.6 (4) |
| O4W—Pr2—O5W | 72.72 (11) | N6—C8—C9 | 121.6 (4) |
| O6—Pr2—N13 | 127.32 (11) | N5—C8—C9 | 119.8 (4) |
| O9—Pr2—N13 | 61.50 (11) | N4—C9—C8 | 120.6 (4) |
| O11—Pr2—N13 | 72.21 (12) | N4—C9—C10 | 115.8 (4) |
| O7—Pr2—N13 | 141.75 (11) | C8—C9—C10 | 123.5 (4) |
| O4W—Pr2—N13 | 80.77 (13) | O4—C10—O3 | 124.9 (4) |
| O5W—Pr2—N13 | 68.18 (12) | O4—C10—C9 | 118.8 (4) |
| O6—Pr2—N10 | 71.21 (10) | O3—C10—C9 | 116.2 (4) |
| O9—Pr2—N10 | 74.03 (10) | N7—C11—C12 | 119.8 (4) |
| O11—Pr2—N10 | 148.30 (11) | N7—C11—H11A | 120.1 |
| O7—Pr2—N10 | 61.27 (9) | C12—C11—H11A | 120.1 |
| O4W—Pr2—N10 | 132.06 (11) | N8—C12—C11 | 124.2 (4) |
| O5W—Pr2—N10 | 70.47 (11) | N8—C12—H12C | 117.9 |
| N13—Pr2—N10 | 111.80 (11) | C11—C12—H12C | 117.9 |
| O6—Pr2—N7 | 61.32 (9) | N9—C13—N8 | 116.2 (4) |
| O9—Pr2—N7 | 125.75 (10) | N9—C13—C14 | 123.7 (4) |
| O11—Pr2—N7 | 68.92 (11) | N8—C13—C14 | 120.2 (4) |
| O7—Pr2—N7 | 67.81 (10) | N7—C14—C13 | 120.8 (4) |
| O4W—Pr2—N7 | 77.21 (10) | N7—C14—C15 | 116.1 (3) |
| O5W—Pr2—N7 | 134.98 (11) | C13—C14—C15 | 123.1 (4) |
| N13—Pr2—N7 | 138.04 (11) | O5—C15—O6 | 123.0 (4) |
| N10—Pr2—N7 | 109.50 (10) | O5—C15—C14 | 119.5 (3) |
| C5—O1—Pr1 | 129.5 (3) | O6—C15—C14 | 117.5 (3) |
| C10—O3—Pr1 | 128.6 (3) | N10—C16—C17 | 120.1 (4) |
| C15—O5—Pr1 | 143.6 (3) | N10—C16—H16 | 120.0 |
| C15—O6—Pr2 | 129.7 (2) | C17—C16—H16 | 120.0 |
| C20—O7—Pr2 | 128.3 (2) | N11—C17—C16 | 123.2 (4) |
| C20—O8—Pr1ii | 141.7 (3) | N11—C17—H17 | 118.4 |
| C25—O9—Pr2 | 129.8 (3) | C16—C17—H17 | 118.4 |
| C26'—O11—Pr2 | 161.0 (11) | N12—C18—N11 | 117.1 (4) |
| C26—O11—Pr2 | 139.1 (9) | N12—C18—C19 | 123.9 (4) |
| Pr1—O1W—H11 | 104 (4) | N11—C18—C19 | 119.1 (4) |
| Pr1—O1W—H12 | 98 (4) | N10—C19—C18 | 121.7 (3) |
| H11—O1W—H12 | 110 (4) | N10—C19—C20 | 115.4 (3) |
| Pr1—O2W—H21 | 110 (4) | C18—C19—C20 | 122.9 (4) |
| Pr1—O2W—H22 | 114 (4) | O8—C20—O7 | 123.6 (4) |
| H21—O2W—H22 | 109 (4) | O8—C20—C19 | 118.7 (4) |
| Pr1—O3W—H31 | 109 (3) | O7—C20—C19 | 117.7 (3) |
| Pr1—O3W—H32 | 126 (4) | N13—C21—C22 | 120.8 (6) |
| H31—O3W—H32 | 109 (4) | N13—C21—H21A | 119.6 |
| Pr2—O4W—H41 | 127 (4) | C22—C21—H21A | 119.6 |
| Pr2—O4W—H42 | 108 (4) | N14—C22—C21 | 123.3 (6) |
| H41—O4W—H42 | 109 (4) | N14—C22—H22A | 118.4 |
| Pr2—O5W—H51 | 131 (4) | C21—C22—H22A | 118.4 |
| Pr2—O5W—H52 | 113 (3) | N15—C23—N14 | 116.8 (5) |
| H51—O5W—H52 | 110 (4) | N15—C23—C24 | 122.9 (5) |
| H61—O6W—H62 | 110 (4) | N14—C23—C24 | 120.2 (5) |
| H71—O7W—H72 | 110 (4) | N13—C24—C23 | 120.5 (5) |
| H81—O8W—H82 | 110 (4) | N13—C24—C25 | 115.4 (4) |
| H91—O9W—H92 | 109 (4) | C23—C24—C25 | 124.1 (4) |
| H101—O10W—H102 | 110 (4) | O10—C25—O9 | 123.7 (4) |
| H111—O11W—H112 | 110 (4) | O10—C25—C24 | 119.4 (4) |
| C1—N1—C4 | 118.3 (4) | O9—C25—C24 | 116.9 (4) |
| C1—N1—Pr1 | 124.5 (3) | O11—C26—O12 | 122.6 (18) |
| C4—N1—Pr1 | 116.8 (3) | O11—C26—H26 | 118.7 |
| C2—N2—C3 | 117.2 (4) | O12—C26—H26 | 118.7 |
| C3—N3—H3A | 120.0 | O11—C26'—O12' | 122.8 (16) |
| C3—N3—H3B | 120.0 | O11—C26'—H26' | 118.6 |
| H3A—N3—H3B | 120.0 | O12'—C26'—H26' | 118.6 |
| Symmetry codes: (i) x−1, y, z; (ii) x+1, y, z. |
| D—H···A | D—H | H···A | D···A | D—H···A |
| O1w—H11···O7i | 0.84 (1) | 2.34 (2) | 3.115 (4) | 155 (5) |
| O1w—H12···O2iii | 0.84 (1) | 1.80 (1) | 2.635 (5) | 179 (5) |
| O2w—H21···O6w | 0.84 (1) | 2.02 (2) | 2.839 (5) | 164 (5) |
| O2w—H22···O6 | 0.84 (1) | 1.99 (3) | 2.771 (4) | 153 (5) |
| O3w—H31···O7i | 0.84 (1) | 2.05 (2) | 2.829 (4) | 155 (4) |
| O3w—H32···O7w | 0.84 (1) | 1.89 (1) | 2.721 (5) | 174 (4) |
| O4w—H41···O8wii | 0.84 (1) | 1.93 (1) | 2.769 (5) | 176 (6) |
| O4w—H42···O12iv | 0.84 (1) | 2.07 (5) | 2.649 (7) | 126 (5) |
| O5w—H51···O6wii | 0.84 (1) | 1.97 (1) | 2.803 (5) | 174 (5) |
| O5w—H52···O11wv | 0.84 (1) | 1.84 (1) | 2.673 (5) | 173 (6) |
| O6w—H61···N11vi | 0.84 (1) | 2.02 (2) | 2.842 (5) | 169 (6) |
| O6w—H62···O10 | 0.84 (1) | 2.02 (2) | 2.833 (5) | 164 (6) |
| O7w—H71···O9 | 0.84 (1) | 2.41 (4) | 3.135 (6) | 146 (7) |
| O7w—H72···O12′ | 0.84 (1) | 1.99 (5) | 2.688 (10) | 141 (8) |
| O8w—H81···O7w | 0.84 (1) | 2.01 (3) | 2.782 (6) | 154 (7) |
| O8w—H82···N2vii | 0.84 (1) | 2.03 (2) | 2.861 (6) | 168 (7) |
| O9w—H91···O10wviii | 0.84 (1) | 2.40 (6) | 3.074 (8) | 138 (7) |
| O10w—H102···N5ix | 0.84 (1) | 2.11 (3) | 2.893 (6) | 155 (7) |
| O11w—H112···O4vii | 0.84 (1) | 1.90 (1) | 2.732 (5) | 180 (7) |
| N6—H6b···O4 | 0.88 | 2.03 | 2.690 (5) | 131 |
| N9—H9a···O1wiii | 0.88 | 2.20 | 2.974 (5) | 147 |
| N9—H9b···O1 | 0.88 | 2.23 | 3.037 (5) | 152 |
| N9—H9b···O5 | 0.88 | 2.08 | 2.718 (5) | 129 |
| N12—H12a···O11wx | 0.88 | 2.37 | 3.099 (6) | 140 |
| N12—H12b···O8 | 0.88 | 2.06 | 2.695 (5) | 129 |
| N15—H15b···O10 | 0.88 | 2.10 | 2.733 (7) | 129 |
| Symmetry codes: (i) x−1, y, z; (ii) x+1, y, z; (iii) −x+1, −y+1, −z+1; (iv) −x+2, −y+2, −z+1; (v) −x+1, −y+2, −z+2; (vi) −x+1, −y+1, −z+2; (vii) x, y+1, z; (viii) −x, −y+2, −z+2; (ix) x−1, y+1, z; (x) x+1, y−1, z. |
Experimental details
| Crystal data | |
| Chemical formula | [Pr2(C5H4N3O2)5(CHO2)(H2O)5]·6H2O |
| Mr | 1215.58 |
| Crystal system, space group | Triclinic, P1 |
| Temperature (K) | 293 |
| a, b, c (Å) | 9.7213 (3), 14.2113 (6), 17.6228 (6) |
| α, β, γ (°) | 68.801 (1), 76.291 (1), 79.349 (1) |
| V (Å3) | 2191.97 (14) |
| Z | 2 |
| Radiation type | Mo Kα |
| µ (mm−1) | 2.30 |
| Crystal size (mm) | 0.14 × 0.12 × 0.07 |
| Data collection | |
| Diffractometer | Rigaku R-AXIS RAPID IP diffractometer |
| Absorption correction | Multi-scan (ABSCOR; Higashi, 1995) |
| Tmin, Tmax | 0.739, 0.856 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 21572, 9906, 8214 |
| Rint | 0.041 |
| (sin θ/λ)max (Å−1) | 0.649 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.035, 0.088, 1.06 |
| No. of reflections | 9906 |
| No. of parameters | 679 |
| No. of restraints | 69 |
| H-atom treatment | H atoms treated by a mixture of independent and constrained refinement |
| Δρmax, Δρmin (e Å−3) | 1.34, −1.03 |
Computer programs: RAPID-AUTO (Rigaku, 1998), CrystalClear (Rigaku/MSC, 2002), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), X-SEED (Barbour, 2001), publCIF (Westrip, 2010).
| D—H···A | D—H | H···A | D···A | D—H···A |
| O1w—H11···O7i | 0.84 (1) | 2.34 (2) | 3.115 (4) | 155 (5) |
| O1w—H12···O2ii | 0.84 (1) | 1.80 (1) | 2.635 (5) | 179 (5) |
| O2w—H21···O6w | 0.84 (1) | 2.02 (2) | 2.839 (5) | 164 (5) |
| O2w—H22···O6 | 0.84 (1) | 1.99 (3) | 2.771 (4) | 153 (5) |
| O3w—H31···O7i | 0.84 (1) | 2.05 (2) | 2.829 (4) | 155 (4) |
| O3w—H32···O7w | 0.84 (1) | 1.89 (1) | 2.721 (5) | 174 (4) |
| O4w—H41···O8wiii | 0.84 (1) | 1.93 (1) | 2.769 (5) | 176 (6) |
| O4w—H42···O12iv | 0.84 (1) | 2.07 (5) | 2.649 (7) | 126 (5) |
| O5w—H51···O6wiii | 0.84 (1) | 1.97 (1) | 2.803 (5) | 174 (5) |
| O5w—H52···O11wv | 0.84 (1) | 1.84 (1) | 2.673 (5) | 173 (6) |
| O6w—H61···N11vi | 0.84 (1) | 2.02 (2) | 2.842 (5) | 169 (6) |
| O6w—H62···O10 | 0.84 (1) | 2.02 (2) | 2.833 (5) | 164 (6) |
| O7w—H71···O9 | 0.84 (1) | 2.41 (4) | 3.135 (6) | 146 (7) |
| O7w—H72···O12' | 0.84 (1) | 1.99 (5) | 2.688 (10) | 141 (8) |
| O8w—H81···O7w | 0.84 (1) | 2.01 (3) | 2.782 (6) | 154 (7) |
| O8w—H82···N2vii | 0.84 (1) | 2.03 (2) | 2.861 (6) | 168 (7) |
| O9w—H91···O10wviii | 0.84 (1) | 2.40 (6) | 3.074 (8) | 138 (7) |
| O10w—H102···N5ix | 0.84 (1) | 2.11 (3) | 2.893 (6) | 155 (7) |
| Symmetry codes: (i) x−1, y, z; (ii) −x+1, −y+1, −z+1; (iii) x+1, y, z; (iv) −x+2, −y+2, −z+1; (v) −x+1, −y+2, −z+2; (vi) −x+1, −y+1, −z+2; (vii) x, y+1, z; (viii) −x, −y+2, −z+2; (ix) x−1, y+1, z. |
Acknowledgements
This work was supported by the Key Project of the Natural Science Foundation of Heilongjiang Province (No. ZD200903), the Innovation Team of the Education Bureau of Heilongjiang Province (No. 2010 t d03), the Key Project of the Education Bureau of Heilongjiang Province (No. 12511z023) and the University of Malaya.
References
Barbour, L. J. (2001). J. Supramol. Chem. 1, 189–191. CrossRef CAS Google Scholar
Gao, S. & Ng, S. W. (2011). Acta Cryst. E67, m1301. Google Scholar
Higashi, T. (1995). ABSCOR. Rigaku Corporation, Tokyo, Japan. Google Scholar
Rigaku (1998). RAPID-AUTO. Rigaku Corporation, Tokyo, Japan. Google Scholar
Rigaku/MSC (2002). CrystalClear. Rigaku/MSC Inc., The Woodlands, Texas, USA. Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Westrip, S. P. (2010). J. Appl. Cryst. 43, 920–925. Web of Science CrossRef CAS IUCr Journals Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
![[P \overline 1] Mathematical equation](teximages/xu5282fi1.gif)
![[Figure 1]](./xu5282fig1thm.gif)
![[Figure 2]](./xu5282fig2thm.gif)




The chelating ability of the 3-aminopyrazine-2-carboxylate anion is probably similar to that of the pyrazine-2-carboxylate anion, and the crystal structures of a number of lanthanum carboxylates have been reported. The additional amino substitution in the 3-aminopyrazine-2-carboxylate should be expected to consolidate the crystal structure of the praeseodymium derivative through extensive hydrogen bonding. The synthesis of the praseodymium analog under hydrothermal conditions yielded instead the polymeric chain compound, Pr2(H2O)5(CHO2)(C5H4N3O2)5.6H2O; a formate group is (Scheme I, Fig. 1). In a previous synthesis, the carboxylic acid was found to decompose to an oxalate (Gao & Ng, 2011).
Adjacent chains interact with the lattice water molecules to generate a three-dimensional hydrogen-bonded network (Table 1).