organic compounds
N-(2,6-Difluorobenzoyl)-P,P-bis(pyrrolidin-1-yl)phosphinic amide
aDepartment of Chemistry, Ferdowsi University of Mashhad, Mashhad, 91779, Iran, and bDepartment of Chemistry, University of California, San Diego, 9500 Gilman, Drive, La Jolla, CA 92093, USA
*Correspondence e-mail: [email protected]
The phosphoryl and carbonyl groups in the title compound, C15H20F2N3O2P, are anti with respect to each other (but the P- and C-groups are separated by another atom) and the P atom is in a tetrahedral coordination environment. Two C atoms in one of the pyrrolidinyl fragments are disordered over two sets of sites with occupancies of 0.746 (8) and 0.254 (8). The environments of the pyrrolidinyl N atoms show a slight deviation from planarity and none of the three N atoms is involved in any hydrogen bond as an acceptor. In the crystal, pairs of intermolecular N—H⋯O hydrogen bonds form inversion dimers.
Related literature
For hydrogen-bond patterns in compounds containing a C(O)NHP(O) skeleton, see: Toghraee et al. (2011
); Pourayoubi et al. (2011
). For hydrogen-bond strength, see: Pourayoubi et al. (2011
). For a related structure, see: Pourayoubi et al. (2010
). For bond lengths, angles and torsion angles, see: Tarahhomi et al. (2011
). For graph-set motifs, see Bernstein et al. (1995
). For a related phosphoric triamide, see: Sabbaghi et al. (2010
).
Experimental
Crystal data
|
Refinement
|
| |||||||||||||||||
Data collection: APEX2 (Bruker, 2005
); cell refinement: SAINT (Bruker, 2005
); data reduction: SAINT; program(s) used to solve structure: SHELXS97 (Sheldrick, 2008
); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008
); molecular graphics: SHELXTL (Sheldrick, 2008
); software used to prepare material for publication: SHELXTL and enCIFer (Allen et al., 2004
).
Supporting information
contains datablocks I, global. DOI: 10.1107/S1600536811033216/jj2098sup1.cif
Structure factors: contains datablock I. DOI: 10.1107/S1600536811033216/jj2098Isup2.hkl
2,6—F2C6H3C(O)NHP(O)Cl2 was prepared according to the literature method reported by Pourayoubi et al. (2010).
To a solution of 2,6—F2C6H3C(O)NHP(O)Cl2 (0.4 g, 1.46 mmol) in dry chloroform (30 ml), a solution of pyrrolidine (0.415 g, 5.84 mmol) in dry chloroform (10 ml) was added at 0 °C. After 4 h stirring, the solvent was removed and the product was washed with distilled water and recrystallized from a mixture of CH3OH/DMF (4:1) at room temperature. Single crystals of the title compound were obtained from this solution at room temperature.
All non-hydrogen atoms were refined anisotropically by Fourier full matrix least squares on F2. Hydrogen atom H1A was located from a Fourier difference map and allowed to refine with a N—H distance of 0.87 (1) Å and Uiso(H) = 1.2Ueq(N). All other hydrogen atoms were placed in geometrically idealized positions with C—H distances of 0.95 Å (aromatic) or 0.99 Å (CH2) and with Uiso(H) = 1.2Ueq(C). Carbon atoms C13 and C14 were disordered over two positions with approximate partial occupancies of 0.746 (8) and 0.254 (8). Hydrogen atoms on C12 and C15 were also treated using the above two parts model.
Data collection: APEX2 (Bruker, 2005); cell SAINT (Bruker, 2005); data reduction: SAINT (Bruker, 2005); program(s) used to solve structure: SHELXS97 (Sheldrick, 2008); program(s) used to refine structure: SHELXL97 (Sheldrick, 2008); molecular graphics: SHELXTL (Sheldrick, 2008) and Mercury (Macrae et al., 2008); software used to prepare material for publication: SHELXTL (Sheldrick, 2008) and enCIFer (Allen et al., 2004).
| Fig. 1. An ORTEP-style plot of title compound with labeling. Displacement ellipsoids are given at 50% probability level and H atoms are drawn as small spheres of arbitrary radii. |
| C15H20F2N3O2P | F(000) = 720 |
| Mr = 343.31 | Dx = 1.383 Mg m−3 |
| Monoclinic, P21/n | Mo Kα radiation, λ = 0.71073 Å |
| Hall symbol: -P 2yn | Cell parameters from 7152 reflections |
| a = 10.286 (3) Å | θ = 2.5–27.9° |
| b = 14.873 (4) Å | µ = 0.20 mm−1 |
| c = 10.917 (3) Å | T = 100 K |
| β = 99.296 (3)° | Block, colourless |
| V = 1648.3 (7) Å3 | 0.40 × 0.30 × 0.25 mm |
| Z = 4 |
| Bruker APEXII CCD diffractometer | 3776 independent reflections |
| Radiation source: fine-focus sealed tube | 2953 reflections with I > 2σ(I) |
| Graphite monochromator | Rint = 0.043 |
| ϕ and ω scans | θmax = 27.9°, θmin = 2.3° |
| Absorption correction: multi-scan (SADABS; Sheldrick, 2004) | h = −13→13 |
| Tmin = 0.925, Tmax = 0.952 | k = −19→14 |
| 13279 measured reflections | l = −14→14 |
| Refinement on F2 | Primary atom site location: structure-invariant direct methods |
| Least-squares matrix: full | Secondary atom site location: difference Fourier map |
| R[F2 > 2σ(F2)] = 0.047 | Hydrogen site location: inferred from neighbouring sites |
| wR(F2) = 0.119 | H atoms treated by a mixture of independent and constrained refinement |
| S = 1.05 | w = 1/[σ2(Fo2) + (0.0419P)2 + 1.0825P] where P = (Fo2 + 2Fc2)/3 |
| 3776 reflections | (Δ/σ)max < 0.001 |
| 230 parameters | Δρmax = 0.39 e Å−3 |
| 7 restraints | Δρmin = −0.41 e Å−3 |
| C15H20F2N3O2P | V = 1648.3 (7) Å3 |
| Mr = 343.31 | Z = 4 |
| Monoclinic, P21/n | Mo Kα radiation |
| a = 10.286 (3) Å | µ = 0.20 mm−1 |
| b = 14.873 (4) Å | T = 100 K |
| c = 10.917 (3) Å | 0.40 × 0.30 × 0.25 mm |
| β = 99.296 (3)° |
| Bruker APEXII CCD diffractometer | 3776 independent reflections |
| Absorption correction: multi-scan (SADABS; Sheldrick, 2004) | 2953 reflections with I > 2σ(I) |
| Tmin = 0.925, Tmax = 0.952 | Rint = 0.043 |
| 13279 measured reflections |
| R[F2 > 2σ(F2)] = 0.047 | 7 restraints |
| wR(F2) = 0.119 | H atoms treated by a mixture of independent and constrained refinement |
| S = 1.05 | Δρmax = 0.39 e Å−3 |
| 3776 reflections | Δρmin = −0.41 e Å−3 |
| 230 parameters |
Experimental. IR (KBr, ν, cm-1): 3062 (NH), 2846, 1684, 1622, 1465, 1442, 1284, 1218, 1181, 1092, 1008, 876, 800, 768, 708, 586. |
Geometry. All e.s.d.'s (except the e.s.d. in the dihedral angle between two l.s. planes) are estimated using the full covariance matrix. The cell e.s.d.'s are taken into account individually in the estimation of e.s.d.'s in distances, angles and torsion angles; correlations between e.s.d.'s in cell parameters are only used when they are defined by crystal symmetry. An approximate (isotropic) treatment of cell e.s.d.'s is used for estimating e.s.d.'s involving l.s. planes. |
Refinement. Refinement of F2 against ALL reflections. The weighted R-factor wR and goodness of fit S are based on F2, conventional R-factors R are based on F, with F set to zero for negative F2. The threshold expression of F2 > σ(F2) is used only for calculating R-factors(gt) etc. and is not relevant to the choice of reflections for refinement. R-factors based on F2 are statistically about twice as large as those based on F, and R- factors based on ALL data will be even larger. |
| x | y | z | Uiso*/Ueq | Occ. (<1) | |
| P1 | 0.58132 (4) | 0.60634 (4) | 0.14444 (5) | 0.02623 (15) | |
| F1 | 0.06841 (11) | 0.66217 (8) | 0.14052 (12) | 0.0357 (3) | |
| F2 | 0.33806 (10) | 0.40553 (8) | 0.20332 (11) | 0.0333 (3) | |
| O1 | 0.34013 (13) | 0.65942 (10) | 0.26101 (14) | 0.0340 (4) | |
| O2 | 0.65277 (12) | 0.54022 (11) | 0.07877 (12) | 0.0322 (4) | |
| N1 | 0.42250 (14) | 0.57290 (13) | 0.12010 (15) | 0.0283 (4) | |
| H1A | 0.402 (2) | 0.5349 (12) | 0.0604 (16) | 0.034* | |
| N2 | 0.64224 (15) | 0.60885 (11) | 0.29142 (15) | 0.0260 (4) | |
| N3 | 0.57871 (16) | 0.71092 (14) | 0.10109 (18) | 0.0396 (5) | |
| C1 | 0.08224 (17) | 0.57212 (14) | 0.15613 (17) | 0.0249 (4) | |
| C2 | −0.02954 (17) | 0.52080 (14) | 0.15101 (18) | 0.0282 (4) | |
| H2A | −0.1144 | 0.5478 | 0.1386 | 0.034* | |
| C3 | −0.01492 (18) | 0.42859 (15) | 0.16440 (19) | 0.0304 (5) | |
| H3A | −0.0908 | 0.3919 | 0.1621 | 0.036* | |
| C4 | 0.10900 (19) | 0.38887 (14) | 0.18117 (18) | 0.0284 (4) | |
| H4A | 0.1190 | 0.3256 | 0.1904 | 0.034* | |
| C5 | 0.21675 (17) | 0.44419 (14) | 0.18402 (17) | 0.0260 (4) | |
| C6 | 0.20909 (16) | 0.53694 (13) | 0.17294 (16) | 0.0225 (4) | |
| C7 | 0.32904 (17) | 0.59659 (14) | 0.18895 (17) | 0.0249 (4) | |
| C8 | 0.6309 (2) | 0.68401 (14) | 0.3773 (2) | 0.0328 (5) | |
| H8A | 0.5548 | 0.7229 | 0.3452 | 0.039* | |
| H8B | 0.7120 | 0.7209 | 0.3900 | 0.039* | |
| C9 | 0.6109 (3) | 0.63821 (17) | 0.4964 (2) | 0.0440 (6) | |
| H9A | 0.5167 | 0.6244 | 0.4962 | 0.053* | |
| H9B | 0.6438 | 0.6761 | 0.5695 | 0.053* | |
| C10 | 0.6916 (3) | 0.55236 (17) | 0.4966 (2) | 0.0450 (6) | |
| H10A | 0.6603 | 0.5057 | 0.5497 | 0.054* | |
| H10B | 0.7862 | 0.5641 | 0.5265 | 0.054* | |
| C11 | 0.6688 (2) | 0.52362 (14) | 0.36086 (18) | 0.0334 (5) | |
| H11A | 0.7477 | 0.4934 | 0.3391 | 0.040* | |
| H11B | 0.5926 | 0.4823 | 0.3431 | 0.040* | |
| C12 | 0.7037 (2) | 0.75855 (18) | 0.0940 (3) | 0.0512 (7) | |
| H12A | 0.7311 | 0.7953 | 0.1693 | 0.061* | 0.746 (8) |
| H12B | 0.7748 | 0.7152 | 0.0857 | 0.061* | 0.746 (8) |
| H12C | 0.7680 | 0.7205 | 0.0597 | 0.061* | 0.254 (8) |
| H12D | 0.7447 | 0.7840 | 0.1748 | 0.061* | 0.254 (8) |
| C13 | 0.6757 (6) | 0.8164 (5) | −0.0173 (6) | 0.0601 (19) | 0.746 (8) |
| H13A | 0.6871 | 0.7829 | −0.0933 | 0.072* | 0.746 (8) |
| H13B | 0.7335 | 0.8700 | −0.0094 | 0.072* | 0.746 (8) |
| C14 | 0.5338 (4) | 0.8424 (3) | −0.0195 (4) | 0.0520 (13) | 0.746 (8) |
| H14A | 0.4933 | 0.8646 | −0.1024 | 0.062* | 0.746 (8) |
| H14B | 0.5252 | 0.8890 | 0.0434 | 0.062* | 0.746 (8) |
| C13A | 0.6387 (15) | 0.8325 (12) | 0.0017 (13) | 0.043 (4) | 0.254 (8) |
| H13C | 0.6062 | 0.8819 | 0.0495 | 0.051* | 0.254 (8) |
| H13D | 0.7061 | 0.8577 | −0.0438 | 0.051* | 0.254 (8) |
| C14A | 0.5278 (10) | 0.7968 (8) | −0.0887 (9) | 0.048 (3) | 0.254 (8) |
| H14C | 0.5559 | 0.7543 | −0.1492 | 0.057* | 0.254 (8) |
| H14D | 0.4704 | 0.8443 | −0.1318 | 0.057* | 0.254 (8) |
| C15 | 0.4701 (2) | 0.7512 (2) | 0.0127 (3) | 0.0557 (8) | |
| H15A | 0.3910 | 0.7613 | 0.0518 | 0.067* | 0.746 (8) |
| H15B | 0.4462 | 0.7131 | −0.0620 | 0.067* | 0.746 (8) |
| H15C | 0.4195 | 0.7936 | 0.0565 | 0.067* | 0.254 (8) |
| H15D | 0.4095 | 0.7034 | −0.0250 | 0.067* | 0.254 (8) |
| U11 | U22 | U33 | U12 | U13 | U23 | |
| P1 | 0.0153 (2) | 0.0358 (3) | 0.0272 (3) | −0.00273 (19) | 0.00216 (18) | 0.0048 (2) |
| F1 | 0.0267 (6) | 0.0268 (7) | 0.0548 (8) | 0.0024 (5) | 0.0109 (5) | −0.0006 (6) |
| F2 | 0.0230 (5) | 0.0356 (7) | 0.0407 (7) | 0.0057 (5) | 0.0034 (5) | 0.0040 (5) |
| O1 | 0.0278 (7) | 0.0339 (9) | 0.0410 (8) | −0.0075 (6) | 0.0079 (6) | −0.0103 (7) |
| O2 | 0.0182 (6) | 0.0502 (10) | 0.0279 (7) | −0.0018 (6) | 0.0030 (5) | −0.0034 (7) |
| N1 | 0.0187 (7) | 0.0436 (11) | 0.0230 (8) | −0.0054 (7) | 0.0046 (6) | −0.0037 (8) |
| N2 | 0.0261 (8) | 0.0215 (9) | 0.0284 (8) | −0.0003 (6) | −0.0019 (6) | 0.0007 (7) |
| N3 | 0.0218 (8) | 0.0465 (12) | 0.0508 (12) | 0.0006 (8) | 0.0067 (7) | 0.0229 (10) |
| C1 | 0.0244 (8) | 0.0237 (10) | 0.0277 (9) | 0.0011 (7) | 0.0079 (7) | −0.0022 (8) |
| C2 | 0.0179 (8) | 0.0351 (12) | 0.0325 (10) | −0.0003 (8) | 0.0067 (7) | −0.0042 (9) |
| C3 | 0.0251 (9) | 0.0355 (12) | 0.0318 (10) | −0.0099 (8) | 0.0083 (8) | −0.0042 (9) |
| C4 | 0.0305 (9) | 0.0264 (11) | 0.0291 (10) | −0.0035 (8) | 0.0074 (8) | 0.0001 (8) |
| C5 | 0.0215 (8) | 0.0323 (11) | 0.0242 (9) | 0.0032 (8) | 0.0035 (7) | 0.0001 (8) |
| C6 | 0.0180 (8) | 0.0289 (11) | 0.0213 (9) | −0.0024 (7) | 0.0055 (7) | −0.0018 (8) |
| C7 | 0.0189 (8) | 0.0306 (11) | 0.0250 (9) | −0.0026 (7) | 0.0027 (7) | 0.0014 (8) |
| C8 | 0.0306 (10) | 0.0233 (11) | 0.0408 (12) | 0.0019 (8) | −0.0047 (8) | −0.0049 (9) |
| C9 | 0.0621 (15) | 0.0340 (13) | 0.0371 (12) | 0.0038 (11) | 0.0115 (11) | −0.0074 (10) |
| C10 | 0.0674 (16) | 0.0360 (14) | 0.0287 (11) | 0.0082 (12) | −0.0009 (11) | −0.0024 (10) |
| C11 | 0.0458 (12) | 0.0254 (11) | 0.0272 (10) | 0.0066 (9) | 0.0004 (9) | −0.0005 (9) |
| C12 | 0.0343 (11) | 0.0389 (15) | 0.085 (2) | −0.0063 (10) | 0.0237 (12) | 0.0122 (14) |
| C13 | 0.091 (4) | 0.038 (3) | 0.064 (3) | −0.025 (3) | 0.052 (3) | −0.008 (2) |
| C14 | 0.081 (3) | 0.040 (2) | 0.036 (2) | −0.0016 (19) | 0.0119 (19) | 0.0143 (18) |
| C13A | 0.048 (8) | 0.046 (9) | 0.035 (7) | −0.004 (6) | 0.010 (6) | 0.013 (6) |
| C14A | 0.072 (7) | 0.037 (6) | 0.032 (6) | 0.001 (5) | 0.004 (5) | 0.007 (5) |
| C15 | 0.0462 (13) | 0.068 (2) | 0.0523 (16) | 0.0092 (13) | 0.0052 (12) | 0.0353 (14) |
| P1—O2 | 1.4803 (16) | C9—H9B | 0.9900 |
| P1—N3 | 1.625 (2) | C10—C11 | 1.524 (3) |
| P1—N2 | 1.6261 (17) | C10—H10A | 0.9900 |
| P1—N1 | 1.6872 (16) | C10—H10B | 0.9900 |
| F1—C1 | 1.355 (2) | C11—H11A | 0.9900 |
| F2—C5 | 1.359 (2) | C11—H11B | 0.9900 |
| O1—C7 | 1.215 (2) | C12—C13 | 1.479 (7) |
| N1—C7 | 1.359 (2) | C12—C13A | 1.566 (14) |
| N1—H1A | 0.863 (9) | C12—H12A | 0.9900 |
| N2—C8 | 1.476 (3) | C12—H12B | 0.9900 |
| N2—C11 | 1.480 (3) | C12—H12C | 0.9891 |
| N3—C15 | 1.480 (3) | C12—H12D | 0.9903 |
| N3—C12 | 1.481 (3) | C13—C14 | 1.507 (7) |
| C1—C2 | 1.374 (3) | C13—H13A | 0.9900 |
| C1—C6 | 1.390 (2) | C13—H13B | 0.9900 |
| C2—C3 | 1.385 (3) | C14—C15 | 1.571 (4) |
| C2—H2A | 0.9500 | C14—H14A | 0.9900 |
| C3—C4 | 1.390 (3) | C14—H14B | 0.9900 |
| C3—H3A | 0.9500 | C13A—C14A | 1.481 (15) |
| C4—C5 | 1.377 (3) | C13A—H13C | 0.9900 |
| C4—H4A | 0.9500 | C13A—H13D | 0.9900 |
| C5—C6 | 1.386 (3) | C14A—C15 | 1.500 (9) |
| C6—C7 | 1.507 (2) | C14A—H14C | 0.9900 |
| C8—C9 | 1.512 (3) | C14A—H14D | 0.9900 |
| C8—H8A | 0.9900 | C15—H15A | 0.9900 |
| C8—H8B | 0.9900 | C15—H15B | 0.9900 |
| C9—C10 | 1.523 (3) | C15—H15C | 0.9892 |
| C9—H9A | 0.9900 | C15—H15D | 0.9898 |
| O2—P1—N3 | 118.75 (10) | C13—C12—N3 | 105.4 (3) |
| O2—P1—N2 | 110.54 (8) | N3—C12—C13A | 94.9 (6) |
| N3—P1—N2 | 104.53 (10) | C13—C12—H12A | 110.7 |
| O2—P1—N1 | 105.77 (9) | N3—C12—H12A | 110.7 |
| N3—P1—N1 | 105.44 (9) | C13A—C12—H12A | 100.4 |
| N2—P1—N1 | 111.79 (8) | C13—C12—H12B | 110.7 |
| C7—N1—P1 | 126.16 (14) | N3—C12—H12B | 110.7 |
| C7—N1—H1A | 118.4 (15) | C13A—C12—H12B | 130.1 |
| P1—N1—H1A | 115.3 (15) | H12A—C12—H12B | 108.8 |
| C8—N2—C11 | 110.53 (16) | C13—C12—H12C | 94.3 |
| C8—N2—P1 | 125.92 (13) | N3—C12—H12C | 112.7 |
| C11—N2—P1 | 119.72 (13) | C13A—C12—H12C | 113.6 |
| C15—N3—C12 | 110.05 (19) | H12A—C12—H12C | 120.9 |
| C15—N3—P1 | 123.53 (17) | C13—C12—H12D | 120.5 |
| C12—N3—P1 | 119.96 (15) | N3—C12—H12D | 112.6 |
| F1—C1—C2 | 118.29 (16) | C13A—C12—H12D | 112.4 |
| F1—C1—C6 | 117.78 (16) | H12B—C12—H12D | 96.8 |
| C2—C1—C6 | 123.90 (19) | H12C—C12—H12D | 110.0 |
| C1—C2—C3 | 118.04 (17) | C12—C13—C14 | 102.8 (4) |
| C1—C2—H2A | 121.0 | C12—C13—H13A | 111.2 |
| C3—C2—H2A | 121.0 | C14—C13—H13A | 111.2 |
| C2—C3—C4 | 121.09 (18) | C12—C13—H13B | 111.2 |
| C2—C3—H3A | 119.5 | C14—C13—H13B | 111.2 |
| C4—C3—H3A | 119.5 | H13A—C13—H13B | 109.1 |
| C5—C4—C3 | 117.83 (19) | C13—C14—C15 | 102.3 (4) |
| C5—C4—H4A | 121.1 | C13—C14—H14A | 111.3 |
| C3—C4—H4A | 121.1 | C15—C14—H14A | 111.3 |
| F2—C5—C4 | 117.79 (18) | C13—C14—H14B | 111.3 |
| F2—C5—C6 | 118.20 (16) | C15—C14—H14B | 111.3 |
| C4—C5—C6 | 123.97 (17) | H14A—C14—H14B | 109.2 |
| C5—C6—C1 | 115.16 (16) | C14A—C13A—C12 | 112.3 (12) |
| C5—C6—C7 | 122.82 (16) | C14A—C13A—H13C | 109.1 |
| C1—C6—C7 | 121.82 (18) | C12—C13A—H13C | 109.1 |
| O1—C7—N1 | 123.83 (17) | C14A—C13A—H13D | 109.1 |
| O1—C7—C6 | 121.16 (17) | C12—C13A—H13D | 109.1 |
| N1—C7—C6 | 114.99 (17) | H13C—C13A—H13D | 107.9 |
| N2—C8—C9 | 103.94 (17) | C13A—C14A—C15 | 91.4 (9) |
| N2—C8—H8A | 111.0 | C13A—C14A—H14C | 113.4 |
| C9—C8—H8A | 111.0 | C15—C14A—H14C | 113.4 |
| N2—C8—H8B | 111.0 | C13A—C14A—H14D | 113.4 |
| C9—C8—H8B | 111.0 | C15—C14A—H14D | 113.4 |
| H8A—C8—H8B | 109.0 | H14C—C14A—H14D | 110.7 |
| C8—C9—C10 | 103.24 (19) | N3—C15—C14A | 108.5 (4) |
| C8—C9—H9A | 111.1 | N3—C15—C14 | 101.4 (2) |
| C10—C9—H9A | 111.1 | N3—C15—H15A | 111.5 |
| C8—C9—H9B | 111.1 | C14A—C15—H15A | 134.5 |
| C10—C9—H9B | 111.1 | C14—C15—H15A | 111.5 |
| H9A—C9—H9B | 109.1 | N3—C15—H15B | 111.5 |
| C9—C10—C11 | 103.61 (18) | C14A—C15—H15B | 74.1 |
| C9—C10—H10A | 111.0 | C14—C15—H15B | 111.5 |
| C11—C10—H10A | 111.0 | H15A—C15—H15B | 109.3 |
| C9—C10—H10B | 111.0 | N3—C15—H15C | 110.1 |
| C11—C10—H10B | 111.0 | C14A—C15—H15C | 111.7 |
| H10A—C10—H10B | 109.0 | C14—C15—H15C | 80.1 |
| N2—C11—C10 | 104.16 (17) | H15B—C15—H15C | 133.1 |
| N2—C11—H11A | 110.9 | N3—C15—H15D | 109.8 |
| C10—C11—H11A | 110.9 | C14A—C15—H15D | 108.4 |
| N2—C11—H11B | 110.9 | C14—C15—H15D | 141.7 |
| C10—C11—H11B | 110.9 | H15A—C15—H15D | 77.4 |
| H11A—C11—H11B | 108.9 | H15C—C15—H15D | 108.3 |
| O2—P1—N1—C7 | 160.11 (17) | P1—N1—C7—C6 | −162.13 (14) |
| N3—P1—N1—C7 | −73.26 (19) | C5—C6—C7—O1 | −126.8 (2) |
| N2—P1—N1—C7 | 39.7 (2) | C1—C6—C7—O1 | 47.8 (3) |
| O2—P1—N2—C8 | 157.70 (16) | C5—C6—C7—N1 | 51.5 (2) |
| N3—P1—N2—C8 | 28.81 (18) | C1—C6—C7—N1 | −133.96 (19) |
| N1—P1—N2—C8 | −84.76 (18) | C11—N2—C8—C9 | −16.4 (2) |
| O2—P1—N2—C11 | −46.49 (17) | P1—N2—C8—C9 | 141.28 (16) |
| N3—P1—N2—C11 | −175.38 (15) | N2—C8—C9—C10 | 33.4 (2) |
| N1—P1—N2—C11 | 71.05 (17) | C8—C9—C10—C11 | −38.2 (2) |
| O2—P1—N3—C15 | 95.4 (2) | C8—N2—C11—C10 | −7.4 (2) |
| N2—P1—N3—C15 | −140.9 (2) | P1—N2—C11—C10 | −166.62 (15) |
| N1—P1—N3—C15 | −22.9 (2) | C9—C10—C11—N2 | 28.0 (2) |
| O2—P1—N3—C12 | −53.6 (2) | C15—N3—C12—C13 | −11.0 (4) |
| N2—P1—N3—C12 | 70.2 (2) | P1—N3—C12—C13 | 141.7 (3) |
| N1—P1—N3—C12 | −171.80 (19) | C15—N3—C12—C13A | 5.5 (7) |
| F1—C1—C2—C3 | 178.66 (18) | P1—N3—C12—C13A | 158.3 (6) |
| C6—C1—C2—C3 | 0.5 (3) | N3—C12—C13—C14 | 33.6 (5) |
| C1—C2—C3—C4 | −0.7 (3) | C13A—C12—C13—C14 | −25 (2) |
| C2—C3—C4—C5 | 0.0 (3) | C12—C13—C14—C15 | −42.7 (5) |
| C3—C4—C5—F2 | 178.50 (17) | C13—C12—C13A—C14A | 89 (3) |
| C3—C4—C5—C6 | 0.9 (3) | N3—C12—C13A—C14A | −35.5 (12) |
| F2—C5—C6—C1 | −178.62 (16) | C12—C13A—C14A—C15 | 47.7 (13) |
| C4—C5—C6—C1 | −1.1 (3) | C12—N3—C15—C14A | 23.9 (6) |
| F2—C5—C6—C7 | −3.8 (3) | P1—N3—C15—C14A | −127.7 (5) |
| C4—C5—C6—C7 | 173.80 (18) | C12—N3—C15—C14 | −15.1 (3) |
| F1—C1—C6—C5 | −177.82 (17) | P1—N3—C15—C14 | −166.7 (2) |
| C2—C1—C6—C5 | 0.3 (3) | C13A—C14A—C15—N3 | −40.9 (10) |
| F1—C1—C6—C7 | 7.3 (3) | C13A—C14A—C15—C14 | 44.1 (8) |
| C2—C1—C6—C7 | −174.62 (18) | C13—C14—C15—N3 | 35.1 (4) |
| P1—N1—C7—O1 | 16.1 (3) | C13—C14—C15—C14A | −70.4 (8) |
| D—H···A | D—H | H···A | D···A | D—H···A |
| N1—H1A···O2i | 0.86 (1) | 1.90 (1) | 2.757 (2) | 175 (2) |
| Symmetry code: (i) −x+1, −y+1, −z. |
Experimental details
| Crystal data | |
| Chemical formula | C15H20F2N3O2P |
| Mr | 343.31 |
| Crystal system, space group | Monoclinic, P21/n |
| Temperature (K) | 100 |
| a, b, c (Å) | 10.286 (3), 14.873 (4), 10.917 (3) |
| β (°) | 99.296 (3) |
| V (Å3) | 1648.3 (7) |
| Z | 4 |
| Radiation type | Mo Kα |
| µ (mm−1) | 0.20 |
| Crystal size (mm) | 0.40 × 0.30 × 0.25 |
| Data collection | |
| Diffractometer | Bruker APEXII CCD diffractometer |
| Absorption correction | Multi-scan (SADABS; Sheldrick, 2004) |
| Tmin, Tmax | 0.925, 0.952 |
| No. of measured, independent and observed [I > 2σ(I)] reflections | 13279, 3776, 2953 |
| Rint | 0.043 |
| (sin θ/λ)max (Å−1) | 0.658 |
| Refinement | |
| R[F2 > 2σ(F2)], wR(F2), S | 0.047, 0.119, 1.05 |
| No. of reflections | 3776 |
| No. of parameters | 230 |
| No. of restraints | 7 |
| H-atom treatment | H atoms treated by a mixture of independent and constrained refinement |
| Δρmax, Δρmin (e Å−3) | 0.39, −0.41 |
Computer programs: APEX2 (Bruker, 2005), SAINT (Bruker, 2005), SHELXS97 (Sheldrick, 2008), SHELXL97 (Sheldrick, 2008), SHELXTL (Sheldrick, 2008) and Mercury (Macrae et al., 2008), SHELXTL (Sheldrick, 2008) and enCIFer (Allen et al., 2004).
| D—H···A | D—H | H···A | D···A | D—H···A |
| N1—H1A···O2i | 0.863 (9) | 1.896 (10) | 2.757 (2) | 175 (2) |
| Symmetry code: (i) −x+1, −y+1, −z. |
Acknowledgements
Support of this investigation by Ferdowsi University of Mashhad is gratefully acknowledged.
References
Allen, F. H., Johnson, O., Shields, G. P., Smith, B. R. & Towler, M. (2004). J. Appl. Cryst. 37, 335–338. Web of Science CrossRef CAS IUCr Journals Google Scholar
Bernstein, J., Davis, R. E., Shimoni, L. & Chang, N.-L. (1995). Angew. Chem. Int. Ed. Engl. 34, 1555–1573. CrossRef CAS Web of Science Google Scholar
Bruker (2005). SAINT and APEX2. Bruker AXS Inc., Madison, Wisconsin, USA. Google Scholar
Pourayoubi, M., Tarahhomi, A., Rheingold, A. L. & Golen, J. A. (2010). Acta Cryst. E66, o3159. Web of Science CSD CrossRef IUCr Journals Google Scholar
Pourayoubi, M., Tarahhomi, A., Saneei, A., Rheingold, A. L. & Golen, J. A. (2011). Acta Cryst. C67, o265–o272. Web of Science CSD CrossRef CAS IUCr Journals Google Scholar
Sabbaghi, F., Pourayoubi, M., Toghraee, M. & Divjakovic, V. (2010). Acta Cryst. E66, o344. Web of Science CSD CrossRef IUCr Journals Google Scholar
Sheldrick, G. M. (2004). SADABS. University of Göttingen, Germany. Google Scholar
Sheldrick, G. M. (2008). Acta Cryst. A64, 112–122. Web of Science CrossRef CAS IUCr Journals Google Scholar
Tarahhomi, A., Pourayoubi, M., Rheingold, A. L. & Golen, J. A. (2011). Struct. Chem. 22, 201–210. Web of Science CSD CrossRef CAS Google Scholar
Toghraee, M., Pourayoubi, M. & Divjakovic, V. (2011). Polyhedron, 30, 1680–1690. Web of Science CSD CrossRef CAS Google Scholar
This is an open-access article distributed under the terms of the Creative Commons Attribution (CC-BY) Licence, which permits unrestricted use, distribution, and reproduction in any medium, provided the original authors and source are cited.


journal menu
access
![[Figure 1]](./jj2098fig1thm.gif)




The patterns of hydrogen bonds and their strengths on phosphoric triamides containing a C(O)NHP(O) skeleton have been discussed (Toghraee et al., 2011; Pourayoubi et al., 2011). The structure determination of the title compound, C15H20F2N3O2P (Fig. 1), was performed as a continuation of work on this family of compounds in our laboratory.
The carbon atoms C13 and C14 in one of the pyrrolidinyl fragments are disordered over two sets of sites with occupancies of 0.746 (8) and 0.254 (8). The P═O and C═O groups are in anti positions with respect to each other. The P atom is in a distorted tetrahedral environment as has been noted for other phosphoric triamides (Sabbaghi et al., 2010). The nitrogen atoms show sp2 character, the average bond angles at the two tertiary N atoms being 117.8 and 118.7°, respectively. The P═O, C═O and P—N bond lengths, P—N—C bond angles and O—P—N—C torsion angles are within the expected values (Tarahhomi et al., 2011).
The P═O group and the N—H unit are syn with respect to one another. In the crystal, pairs of intermolecular N—H···O(P) hydrogen bonds (Table 1) form hydrogen-bonded dimers as R22(8) graph-set rings (Bernstein et al., 1995).